summary refs log tree commit diff
path: root/maintainers
diff options
context:
space:
mode:
Diffstat (limited to 'maintainers')
-rw-r--r--maintainers/maintainer-list.nix938
-rw-r--r--maintainers/scripts/all-tarballs.nix2
-rwxr-xr-xmaintainers/scripts/fix-maintainers.pl14
-rwxr-xr-xmaintainers/scripts/haskell/hydra-report.hs19
-rwxr-xr-xmaintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh2
-rw-r--r--maintainers/scripts/luarocks-packages.csv27
-rw-r--r--maintainers/scripts/pluginupdate.py58
-rwxr-xr-xmaintainers/scripts/update-luarocks-packages216
-rw-r--r--maintainers/scripts/update-luarocks-shell.nix13
-rw-r--r--maintainers/team-list.nix27
10 files changed, 955 insertions, 361 deletions
diff --git a/maintainers/maintainer-list.nix b/maintainers/maintainer-list.nix
index e54123ac9e4..5df00f2371f 100644
--- a/maintainers/maintainer-list.nix
+++ b/maintainers/maintainer-list.nix
@@ -19,7 +19,7 @@
     where
 
     - `handle` is the handle you are going to use in nixpkgs expressions,
-    - `name` is your, preferably real, name,
+    - `name` is a name that people would know and recognize you by,
     - `email` is your maintainer email address,
     - `matrix` is your Matrix user ID,
     - `github` is your GitHub handle (as it appears in the URL of your profile page, `https://github.com/<userhandle>`),
@@ -371,6 +371,15 @@
     githubId = 124545;
     name = "Anthony Cowley";
   };
+  acuteenvy = {
+    matrix = "@acuteenvy:matrix.org";
+    github = "acuteenvy";
+    githubId = 126529524;
+    name = "Lena";
+    keys = [{
+      fingerprint = "CE85 54F7 B9BC AC0D D648  5661 AB5F C04C 3C94 443F";
+    }];
+  };
   adamcstephens = {
     email = "happy.plan4249@valkor.net";
     matrix = "@adam:valkor.net";
@@ -446,6 +455,13 @@
     githubId = 25236206;
     name = "Adrian Dole";
   };
+  adriangl = {
+    email = "adrian@lauterer.it";
+    matrix = "@adriangl:pvv.ntnu.no";
+    github = "adrlau";
+    githubId = 25004152;
+    name = "Adrian Gunnar Lauterer";
+  };
   AdsonCicilioti = {
     name = "Adson Cicilioti";
     email = "adson.cicilioti@live.com";
@@ -533,6 +549,12 @@
     githubId = 732652;
     name = "Andreas Herrmann";
   };
+  ahoneybun = {
+    email = "aaron@system76.com";
+    github = "ahoneybun";
+    githubId = 4884946;
+    name = "Aaron Honeycutt";
+  };
   ahrzb = {
     email = "ahrzb5@gmail.com";
     github = "ahrzb";
@@ -759,6 +781,12 @@
     github = "Alexnortung";
     githubId = 1552267;
   };
+  alexoundos = {
+    email = "alexoundos@gmail.com";
+    github = "AleXoundOS";
+    githubId = 464913;
+    name = "Alexander Tomokhov";
+  };
   alexshpilkin = {
     email = "ashpilkin@gmail.com";
     github = "alexshpilkin";
@@ -787,6 +815,12 @@
     githubId = 5053729;
     name = "Alias Gram";
   };
+  alias-dev = {
+    email = "alias-dev@protonmail.com";
+    github = "alias-dev";
+    githubId = 30437811;
+    name = "Alex Andrews";
+  };
   alibabzo = {
     email = "alistair.bill@gmail.com";
     github = "alistairbill";
@@ -823,6 +857,12 @@
     githubId = 5892756;
     name = "Alec Snyder";
   };
+  allusive = {
+    email = "jasper@allusive.dev";
+    name = "Allusive";
+    github = "allusive-dev";
+    githubId = 99632976;
+  };
   almac = {
     email = "alma.cemerlic@gmail.com";
     github = "a1mac";
@@ -889,6 +929,12 @@
     githubId = 160476;
     name = "Amanjeev Sethi";
   };
+  amanse = {
+    email = "amansetiarjp@gmail.com";
+    github = "amanse";
+    githubId = 13214574;
+    name = "Aman Setia";
+  };
   amar1729 = {
     email = "amar.paul16@gmail.com";
     github = "Amar1729";
@@ -1179,6 +1225,11 @@
     githubId = 81317317;
     name = "Anna Aurora";
   };
+  a-n-n-a-l-e-e = {
+    github = "a-n-n-a-l-e-e";
+    githubId = 150648636;
+    name = "annalee";
+  };
   anoa = {
     matrix = "@andrewm:amorgan.xyz";
     email = "andrew@amorgan.xyz";
@@ -1250,6 +1301,9 @@
     github = "antonmosich";
     githubId = 27223336;
     name = "Anton Mosich";
+    keys = [ {
+      fingerprint = "F401 287C 324F 0A1C B321  657B 9B96 97B8 FB18 7D14";
+    } ];
   };
   antono = {
     email = "self@antono.info";
@@ -1359,6 +1413,12 @@
     githubId = 59743220;
     name = "Vinícius Müller";
   };
+  arcuru = {
+    email = "patrick@jackson.dev";
+    github = "arcuru";
+    githubId = 160646;
+    name = "Patrick Jackson";
+  };
   ardumont = {
     email = "eniotna.t@gmail.com";
     github = "ardumont";
@@ -1371,6 +1431,12 @@
     githubId = 58516559;
     name = "Alexander Rezvov";
   };
+  argrat = {
+    email = "n.bertazzo@protonmail.com";
+    github = "argrat";
+    githubId = 98821629;
+    name = "Nicolò Bertazzo";
+  };
   arian-d = {
     email = "arianxdehghani@gmail.com";
     github = "arian-d";
@@ -1738,12 +1804,6 @@
     githubId = 1217745;
     name = "Aldwin Vlasblom";
   };
-  aveltras = {
-    email = "romain.viallard@outlook.fr";
-    github = "aveltras";
-    githubId = 790607;
-    name = "Romain Viallard";
-  };
   averelld = {
     email = "averell+nixos@rxd4.com";
     github = "averelld";
@@ -1762,6 +1822,15 @@
     githubId = 1222;
     name = "Aaron VonderHaar";
   };
+  aviallon = {
+    email = "antoine-nixos@lesviallon.fr";
+    github = "aviallon";
+    githubId = 7479436;
+    name = "Antoine Viallon";
+    keys = [{
+      fingerprint = "4AC4 A28D 7208 FC6F 2B51  5EA9 D126 B13A B555 E16F";
+    }];
+  };
   avitex = {
     email = "theavitex@gmail.com";
     github = "avitex";
@@ -2336,6 +2405,15 @@
     github = "blaggacao";
     githubId = 7548295;
   };
+  blankparticle = {
+    name = "BlankParticle";
+    email = "blankparticle@gmail.com";
+    github = "BlankParticle";
+    githubId = 130567419;
+    keys = [{
+      fingerprint = "1757 64C3 7065 AA8D 614D  41C9 0ACE 126D 7B35 9261";
+    }];
+  };
   blanky0230 = {
     email = "blanky0230@gmail.com";
     github = "blanky0230";
@@ -2404,6 +2482,12 @@
     githubId = 50839;
     name = "Brian Jones";
   };
+  boltzmannrain = {
+    email = "boltzmannrain@gmail.com";
+    github = "boltzmannrain";
+    githubId = 150560585;
+    name = "Dmitry Ivankov";
+  };
   booklearner = {
     name = "booklearner";
     email = "booklearner@proton.me";
@@ -2472,6 +2556,12 @@
     githubId = 4621;
     name = "Brad Ediger";
   };
+  brahyerr = {
+    name = "Bryant Pham";
+    email = "bp@1829847@gmail.com";
+    github = "brahyerr";
+    githubId = 120991075;
+  };
   brainrape = {
     email = "martonboros@gmail.com";
     github = "brainrake";
@@ -2566,12 +2656,6 @@
     githubId = 200617;
     name = "Ben Sima";
   };
-  bstrik = {
-    email = "dutchman55@gmx.com";
-    github = "bstrik";
-    githubId = 7716744;
-    name = "Berno Strik";
-  };
   btlvr = {
     email = "btlvr@protonmail.com";
     github = "btlvr";
@@ -2609,6 +2693,12 @@
     githubId = 61636;
     name = "Brad Langhorst";
   };
+  bycEEE = {
+    email = "bycEEE@gmail.com";
+    github = "bycEEE";
+    githubId = 8891115;
+    name = "Brian Choy";
+  };
   bzizou = {
     email = "Bruno@bzizou.net";
     github = "bzizou";
@@ -2724,6 +2814,12 @@
     githubId = 7435854;
     name = "Victor Calvert";
   };
+  camelpunch = {
+    email = "me@andrewbruce.net";
+    github = "camelpunch";
+    githubId = 141733;
+    name = "Andrew Bruce";
+  };
   cameronfyfe = {
     email = "cameron.j.fyfe@gmail.com";
     github = "cameronfyfe";
@@ -3003,6 +3099,9 @@
     email = "chayleaf-nix@pavluk.org";
     github = "chayleaf";
     githubId = 9590981;
+    keys = [{
+      fingerprint = "4314 3701 154D 9E5F 7051  7ECF 7817 1AD4 6227 E68E";
+    }];
     matrix = "@chayleaf:matrix.pavluk.org";
     name = "Anna Pavlyuk";
   };
@@ -3012,6 +3111,12 @@
     githubId = 1689801;
     name = "Mikhail Chekan";
   };
+  chen = {
+    email = "i@cuichen.cc";
+    github = "cu1ch3n";
+    githubId = 80438676;
+    name = "Chen Cui";
+  };
   ChengCat = {
     email = "yu@cheng.cat";
     github = "ChengCat";
@@ -3625,6 +3730,12 @@
     githubId = 1222362;
     name = "Matías Lang";
   };
+  criyle = {
+    email = "i+nixos@goj.ac";
+    name = "Yang Gao";
+    githubId = 6821729;
+    github = "criyle";
+  };
   CRTified = {
     email = "carl.schneider+nixos@rub.de";
     matrix = "@schnecfk:ruhr-uni-bochum.de";
@@ -3635,6 +3746,15 @@
       fingerprint = "2017 E152 BB81 5C16 955C  E612 45BC C1E2 709B 1788";
     }];
   };
+  Cryolitia = {
+    name = "Beiyan Cryolitia";
+    email = "Cryolitia@gmail.com";
+    github = "Cryolitia";
+    githubId = 23723294;
+    keys = [{
+      fingerprint = "1C3C 6547 538D 7152 310C 0EEA 84DD 0C01 30A5 4DF7";
+    }];
+  };
   cryptix = {
     email = "cryptix@riseup.net";
     github = "cryptix";
@@ -3653,18 +3773,18 @@
     githubId = 398996;
     name = "Christopher Singley";
   };
-  cstrahan = {
-    email = "charles@cstrahan.com";
-    github = "cstrahan";
-    githubId = 143982;
-    name = "Charles Strahan";
-  };
   cswank = {
     email = "craigswank@gmail.com";
     github = "cswank";
     githubId = 490965;
     name = "Craig Swank";
   };
+  ctron = {
+    email = "ctron@dentrassi.de";
+    github = "ctron";
+    githubId = 202474;
+    name = "Jens Reimann";
+  };
   cust0dian = {
     email = "serg@effectful.software";
     github = "cust0dian";
@@ -3838,12 +3958,25 @@
     githubId = 50051176;
     name = "Daniel Rolls";
   };
+  danielsidhion = {
+    email = "nixpkgs@sidhion.com";
+    github = "DanielSidhion";
+    githubId = 160084;
+    name = "Daniel Sidhion";
+  };
   daniyalsuri6 = {
     email = "daniyal.suri@gmail.com";
     github = "daniyalsuri6";
     githubId = 107034852;
     name = "Daniyal Suri";
   };
+  dannixon = {
+    email = "dan@dan-nixon.com";
+    github = "DanNixon";
+    githubId = 4037377;
+    name = "Dan Nixon";
+    matrix = "@dannixon:matrix.org";
+  };
   dansbandit = {
     github = "dansbandit";
     githubId = 4530687;
@@ -3932,7 +4065,7 @@
   };
   davidarmstronglewis = {
     email = "davidlewis@mac.com";
-    github = "davidarmstronglewis";
+    github = "oceanlewis";
     githubId = 6754950;
     name = "David Armstrong Lewis";
   };
@@ -4132,6 +4265,12 @@
     githubId = 12224254;
     name = "Delta";
   };
+  delta231 = {
+    email = "swstkbaranwal@gmail.com";
+    github = "Delta456";
+    githubId = 28479139;
+    name = "Swastik Baranwal";
+  };
   deltadelta = {
     email = "contact@libellules.eu";
     name = "Dara Ly";
@@ -4150,6 +4289,12 @@
     githubId = 5503422;
     name = "Dmitriy Demin";
   };
+  demine = {
+    email = "riches_tweaks0o@icloud.com";
+    github = "demine0";
+    githubId = 51992962;
+    name = "Nikita Demin";
+  };
   demize = {
     email = "johannes@kyriasis.com";
     github = "kyrias";
@@ -4382,6 +4527,15 @@
     githubId = 14034137;
     name = "Mostly Void";
   };
+  ditsuke = {
+    name = "Tushar";
+    email = "hello@ditsuke.com";
+    github = "ditsuke";
+    githubId = 72784348;
+    keys = [{
+      fingerprint = "8FD2 153F 4889 541A 54F1  E09E 71B6 C31C 8A5A 9D21";
+    }];
+  };
   djacu = {
     email = "daniel.n.baker@gmail.com";
     github = "djacu";
@@ -4459,6 +4613,12 @@
     githubId = 1708810;
     name = "Daniel Vianna";
   };
+  dmytrokyrychuk = {
+    email = "dmytro@kyrych.uk";
+    github = "dmytrokyrychuk";
+    githubId = 699961;
+    name = "Dmytro Kyrychuk";
+  };
   dnr = {
     email = "dnr@dnr.im";
     github = "dnr";
@@ -4549,6 +4709,16 @@
       fingerprint = "4749 0887 CF3B 85A1 6355  C671 78C7 DD40 DF23 FB16";
     }];
   };
+  dpc = {
+    email = "dpc@dpc.pw";
+    github = "dpc";
+    githubId = 9209;
+    matrix = "@dpc:matrix.org";
+    name = "Dawid Ciężarkiewicz";
+    keys = [{
+      fingerprint = "0402 11D2 0830 2D71 5792 8197 86BB 1D5B 5575 7D38";
+    }];
+  };
   DPDmancul = {
     name = "Davide Peressoni";
     email = "davide.peressoni@tuta.io";
@@ -4826,6 +4996,12 @@
     githubId = 50854;
     name = "edef";
   };
+  edeneast = {
+    email = "edenofest@gmail.com";
+    github = "edeneast";
+    githubId = 2746374;
+    name = "edeneast";
+  };
   ederoyd46 = {
     email = "matt@ederoyd.co.uk";
     github = "ederoyd46";
@@ -5211,6 +5387,13 @@
       fingerprint = "F178 B4B4 6165 6D1B 7C15  B55D 4029 3358 C7B9 326B";
     }];
   };
+  ericthemagician = {
+    email = "eric@ericyen.com";
+    matrix = "@eric:jupiterbroadcasting.com";
+    github = "EricTheMagician";
+    githubId = 323436;
+    name = "Eric Yen";
+  };
   erikarvstedt = {
     email = "erik.arvstedt@gmail.com";
     matrix = "@erikarvstedt:matrix.org";
@@ -5259,6 +5442,11 @@
     githubId = 1855930;
     name = "Ertugrul Söylemez";
   };
+  esau79p = {
+    github = "EsAu79p";
+    githubId = 21313906;
+    name = "EsAu";
+  };
   esclear = {
     github = "esclear";
     githubId = 7432848;
@@ -5796,10 +5984,14 @@
     githubId = 1618343;
   };
   foo-dogsquared = {
-    email = "foo.dogsquared@gmail.com";
+    email = "foodogsquared@foodogsquared.one";
     github = "foo-dogsquared";
     githubId = 34962634;
+    matrix = "@foodogsquared:matrix.org";
     name = "Gabriel Arazas";
+    keys = [{
+      fingerprint = "DDD7 D0BD 602E 564B AA04  FC35 1431 0D91 4115 2B92";
+    }];
   };
   fooker = {
     email = "fooker@lab.sh";
@@ -5828,13 +6020,6 @@
     githubId = 92793;
     name = "Friedrich von Never";
   };
-  fortuneteller2k = {
-    email = "lythe1107@gmail.com";
-    matrix = "@fortuneteller2k:matrix.org";
-    github = "fortuneteller2k";
-    githubId = 20619776;
-    name = "fortuneteller2k";
-  };
   fpletz = {
     email = "fpletz@fnordicwalking.de";
     github = "fpletz";
@@ -5862,6 +6047,11 @@
     githubId = 119691;
     name = "Michael Gough";
   };
+  franciscod = {
+    github = "franciscod";
+    githubId = 726447;
+    name = "Francisco Demartino";
+  };
   franzmondlichtmann = {
     name = "Franz Schroepf";
     email = "franz-schroepf@t-online.de";
@@ -5938,6 +6128,10 @@
     github = "frogamic";
     githubId = 10263813;
     name = "Dominic Shelton";
+    matrix = "@frogamic:beeper.com";
+    keys = [{
+      fingerprint = "779A 7CA8 D51C C53A 9C51  43F7 AAE0 70F0 67EC 00A5";
+    }];
   };
   frontsideair = {
     email = "photonia@gmail.com";
@@ -5957,6 +6151,15 @@
     githubId = 134872;
     name = "Sergei Lukianov";
   };
+  fryuni = {
+    name = "Luiz Ferraz";
+    email = "luiz@lferraz.com";
+    github = "Fryuni";
+    githubId = 11063910;
+    keys = [{
+      fingerprint = "2109 4B0E 560B 031E F539  62C8 2B56 8731 DB24 47EC";
+    }];
+  };
   fsagbuya = {
     email = "fa@m-labs.ph";
     github = "fsagbuya";
@@ -5995,7 +6198,7 @@
   };
   fugi = {
     email = "me@fugi.dev";
-    github = "FugiMuffi";
+    github = "fugidev";
     githubId = 21362942;
     name = "Fugi";
   };
@@ -6022,6 +6225,15 @@
     githubId = 12715461;
     name = "Anders Bo Rasmussen";
   };
+  fwam = {
+    name = "Legion Orsetti";
+    email = "fwam@queereen.dev";
+    github = "fwam";
+    githubId = 113541944;
+    keys = [{
+      fingerprint = "3822 20B8 57ED 0602 3786  8A7A 18E1 AE22 D704 B4FC";
+    }];
+  };
   fwc = {
     github = "fwc";
     githubId = 29337229;
@@ -6095,6 +6307,16 @@
     githubId = 45048741;
     name = "Alwanga Oyango";
   };
+  galaxy = {
+    email = "galaxy@dmc.chat";
+    matrix = "@galaxy:mozilla.org";
+    name = "The Galaxy";
+    github = "ga1aksy";
+    githubId = 148551648;
+    keys = [{
+      fingerprint = "48CA 3873 9E9F CA8E 76A0  835A E3DE CF85 4212 E1EA";
+    }];
+  };
   gal_bolle = {
     email = "florent.becker@ens-lyon.org";
     github = "FlorentBecker";
@@ -6238,6 +6460,16 @@
       fingerprint = "D0CF 440A A703 E0F9 73CB  A078 82BB 70D5 41AE 2DB4";
     }];
   };
+  gepbird = {
+    email = "gutyina.gergo.2@gmail.com";
+    github = "gepbird";
+    githubId = 29818440;
+    name = "Gutyina Gergő";
+    keys = [
+      { fingerprint = "RoAfvqa6w1l8Vdm3W60TDXurYwJ6h03VEGD+wDNGEwc"; }
+      { fingerprint = "MP2UpIRtJpbFFqyucP431H/FPCfn58UhEUTro4lXtRs"; }
+    ];
+  };
   gerg-l = {
     email = "gregleyda@proton.me";
     github = "Gerg-L";
@@ -6333,6 +6565,12 @@
     githubId = 1713676;
     name = "Luis G. Torres";
   };
+  giomf = {
+    email = "giomf@mailbox.org";
+    github = "giomf";
+    githubId = 35076723;
+    name = "Guillaume Fournier";
+  };
   giorgiga = {
     email = "giorgio.gallo@bitnic.it";
     github = "giorgiga";
@@ -6390,6 +6628,10 @@
     githubId = 1447245;
     name = "Robin Gloster";
   };
+  gm6k = {
+    email = "nix@quidecco.pl";
+    name = "Isidor Zeuner";
+  };
   gmemstr = {
     email = "git@gmem.ca";
     github = "gmemstr";
@@ -6513,6 +6755,12 @@
     githubId = 4656860;
     name = "Gaute Ravndal";
   };
+  gray-heron = {
+    email = "ave+nix@cezar.info";
+    github = "gray-heron";
+    githubId = 7032646;
+    name = "Cezary Siwek";
+  };
   graysonhead = {
     email = "grayson@graysonhead.net";
     github = "graysonhead";
@@ -6737,6 +6985,12 @@
     githubId = 33523827;
     name = "Harrison Thorne";
   };
+  haruki7049 = {
+    email = "tontonkirikiri@gmail.com";
+    github = "haruki7049";
+    githubId = 64677724;
+    name = "haruki7049";
+  };
   harvidsen = {
     email = "harvidsen@gmail.com";
     github = "harvidsen";
@@ -7102,6 +7356,13 @@
       fingerprint = "731A 7A05 AD8B 3AE5 956A  C227 4A03 18E0 4E55 5DE5";
     }];
   };
+  hubble = {
+    name = "Hubble the Wolverine";
+    email = "hubblethewolverine@gmail.com";
+    matrix = "@hubofeverything:bark.lgbt";
+    github = "the-furry-hubofeverything";
+    githubId = 53921912;
+  };
   hufman = {
     email = "hufman@gmail.com";
     github = "hufman";
@@ -7272,6 +7533,13 @@
     githubId = 1550265;
     name = "Dominic Steinitz";
   };
+  iFreilicht = {
+    github = "iFreilicht";
+    githubId = 9742635;
+    matrix = "@ifreilicht:matrix.org";
+    email = "nixpkgs@mail.felix-uhl.de";
+    name = "Felix Uhl";
+  };
   ifurther = {
     github = "ifurther";
     githubId = 55025025;
@@ -7301,6 +7569,12 @@
     githubId = 25505957;
     name = "Ilian";
   };
+  iliayar = {
+    email = "iliayar3@gmail.com";
+    github = "iliayar";
+    githubId = 17529355;
+    name = "Ilya Yaroshevskiy";
+  };
   ilikeavocadoes = {
     email = "ilikeavocadoes@hush.com";
     github = "ilikeavocadoes";
@@ -7469,6 +7743,12 @@
     githubId = 88038050;
     name = "Souvik Sen";
   };
+  iogamaster = {
+    email = "iogamastercode+nixpkgs@gmail.com";
+    name = "IogaMaster";
+    github = "iogamaster";
+    githubId = 67164465;
+  };
   ionutnechita = {
     email = "ionut_n2001@yahoo.com";
     github = "ionutnechita";
@@ -7530,6 +7810,12 @@
     githubId = 4458;
     name = "Ivan Kozik";
   };
+  ivan770 = {
+    email = "ivan@ivan770.me";
+    github = "ivan770";
+    githubId = 14003886;
+    name = "Ivan Leshchenko";
+  };
   ivan-babrou = {
     email = "nixpkgs@ivan.computer";
     name = "Ivan Babrou";
@@ -7713,6 +7999,12 @@
     githubId = 2212681;
     name = "Jakub Grzgorz Sokołowski";
   };
+  jakuzure = {
+    email = "shin@posteo.jp";
+    github = "jakuzure";
+    githubId = 11823547;
+    name = "jakuzure";
+  };
   jali-clarke = {
     email = "jinnah.ali-clarke@outlook.com";
     name = "Jinnah Ali-Clarke";
@@ -7773,6 +8065,12 @@
     githubId = 488556;
     name = "Javier Aguirre";
   };
+  javimerino = {
+    email = "merino.jav@gmail.com";
+    name = "Javi Merino";
+    github = "JaviMerino";
+    githubId = 44926;
+  };
   jayesh-bhoot = {
     name = "Jayesh Bhoot";
     email = "jb@jayeshbhoot.com";
@@ -7981,6 +8279,12 @@
     githubId = 854319;
     name = "Matt McHenry";
   };
+  jerrysm64 = {
+    email = "jerry.starke@icloud.com";
+    github = "jerrysm64";
+    githubId = 42114389;
+    name = "Jerry Starke";
+  };
   jeschli = {
     email = "jeschli@gmail.com";
     github = "0mbi";
@@ -8026,6 +8330,15 @@
     githubId = 18501;
     name = "Julien Langlois";
   };
+  jfly = {
+    name = "Jeremy Fleischman";
+    email = "jeremyfleischman@gmail.com";
+    github = "jfly";
+    githubId = 277474;
+    keys = [{
+      fingerprint = "F1F1 3395 8E8E 9CC4 D9FC  9647 1931 9CD8 416A 642B";
+    }];
+  };
   jfrankenau = {
     email = "johannes@frankenau.net";
     github = "jfrankenau";
@@ -8084,6 +8397,12 @@
     githubId = 6445082;
     name = "Joseph Lukasik";
   };
+  jgoux = {
+    email = "hi@jgoux.dev";
+    github = "jgoux";
+    githubId = 1443499;
+    name = "Julien Goux";
+  };
   jhh = {
     email = "jeff@j3ff.io";
     github = "jhh";
@@ -8157,6 +8476,12 @@
     githubId = 3081095;
     name = "Jürgen Keck";
   };
+  jl178 = {
+    email = "jeredlittle1996@gmail.com";
+    github = "jl178";
+    githubId = 72664723;
+    name = "Jered Little";
+  };
   jlamur = {
     email = "contact@juleslamur.fr";
     github = "jlamur";
@@ -8484,6 +8809,12 @@
     github = "jorsn";
     githubId = 4646725;
   };
+  joscha = {
+    name = "Joscha Loos";
+    email = "j.loos@posteo.net";
+    github = "jooooscha";
+    githubId = 57965027;
+  };
   josephst = {
     name = "Joseph Stahl";
     email = "hello@josephstahl.com";
@@ -8526,6 +8857,12 @@
     githubId = 1918771;
     name = "Joe Doyle";
   };
+  jpentland = {
+    email = "joe.pentland@gmail.com";
+    github = "jpentland";
+    githubId = 1135582;
+    name = "Joe Pentland";
+  };
   jperras = {
     email = "joel@nerderati.com";
     github = "jperras";
@@ -8658,6 +8995,12 @@
     githubId = 1189739;
     name = "Julio Borja Barra";
   };
+  jue89 = {
+    email = "me@jue.yt";
+    github = "jue89";
+    githubId = 6105784;
+    name = "Juergen Fitschen";
+  };
   jugendhacker = {
     name = "j.r";
     email = "j.r@jugendhacker.de";
@@ -8802,6 +9145,15 @@
     githubId = 386765;
     matrix = "@k900:0upti.me";
   };
+  kachick = {
+    email = "kachick1@gmail.com";
+    github = "kachick";
+    githubId = 1180335;
+    name = "Kenichi Kamiya";
+    keys = [{
+      fingerprint = "9121 5D87 20CA B405 C63F  24D2 EF6E 574D 040A E2A5";
+    }];
+  };
   kaction = {
     name = "Dmitry Bogatov";
     email = "KAction@disroot.org";
@@ -9578,6 +9930,11 @@
     }];
     name = "Joseph LaFreniere";
   };
+  lagoja = {
+    github = "Lagoja";
+    githubId =750845;
+    name = "John Lago";
+  };
   laikq = {
     email = "gwen@quasebarth.de";
     github = "laikq";
@@ -9889,6 +10246,17 @@
     githubId = 3696783;
     name = "Leroy Hopson";
   };
+  liketechnik = {
+    name = "Florian Warzecha";
+
+    email = "liketechnik@disroot.org";
+    github = "liketechnik";
+    githubId = 24209689;
+
+    keys = [{
+      fingerprint = "92D8 A09D 03DD B774 AABD 53B9 E136 2F07 D750 DB5C";
+    }];
+  };
   lillycham = {
     email = "lillycat332@gmail.com";
     github = "lillycat332";
@@ -10218,6 +10586,12 @@
     githubId = 2487922;
     name = "Lars Jellema";
   };
+  ludat = {
+    email = "lucas6246@gmail.com";
+    github = "ludat";
+    githubId = 4952044;
+    name = "Lucas David Traverso";
+  };
   ludo = {
     email = "ludo@gnu.org";
     github = "civodul";
@@ -10304,12 +10678,6 @@
     githubId = 84395723;
     name = "Lukas Wurzinger";
   };
-  lukeadams = {
-    email = "luke.adams@belljar.io";
-    github = "lukeadams";
-    githubId = 3508077;
-    name = "Luke Adams";
-  };
   lukebfox = {
     email = "lbentley-fox1@sheffield.ac.uk";
     github = "lukebfox";
@@ -10623,6 +10991,12 @@
     githubId = 1651325;
     name = "maralorn";
   };
+  marcovergueira = {
+    email = "vergueira.marco@gmail.com";
+    github = "marcovergueira";
+    githubId = 929114;
+    name = "Marco Vergueira";
+  };
   marcus7070 = {
     email = "marcus@geosol.com.au";
     github = "marcus7070";
@@ -10758,6 +11132,12 @@
     githubId = 29855073;
     name = "Michael Colicchia";
   };
+  massimogengarelli = {
+    email = "massimo.gengarelli@gmail.com";
+    github = "massix";
+    githubId = 585424;
+    name = "Massimo Gengarelli";
+  };
   matejc = {
     email = "cotman.matej@gmail.com";
     github = "matejc";
@@ -10879,6 +11259,12 @@
     githubId = 11810057;
     name = "Matt Snider";
   };
+  matusf = {
+    email = "matus.ferech@gmail.com";
+    github = "matusf";
+    githubId = 18228995;
+    name = "Matúš Ferech";
+  };
   maurer = {
     email = "matthew.r.maurer+nix@gmail.com";
     github = "maurer";
@@ -10933,12 +11319,6 @@
     githubId = 4708337;
     name = "Marcelo A. de L. Santos";
   };
-  maxhille = {
-    email = "mh@lambdasoup.com";
-    github = "maxhille";
-    githubId = 693447;
-    name = "Max Hille";
-  };
   maximsmol = {
     email = "maximsmol@gmail.com";
     github = "maximsmol";
@@ -11390,6 +11770,18 @@
     githubId = 43088426;
     name = "Mihnea Stoian";
   };
+  mikaelfangel = {
+    email = "nixpkgs.bottle597@passfwd.com";
+    github = "MikaelFangel";
+    githubId = 34864484;
+    name = "Mikael Fangel";
+  };
+  mikecm = {
+    email = "mikecmcleod@gmail.com";
+    github = "MaxwellDupre";
+    githubId = 14096356;
+    name = "Michael McLeod";
+  };
   mikefaille = {
     email = "michael@faille.io";
     github = "mikefaille";
@@ -11502,12 +11894,28 @@
     githubId = 149558;
     name = "Merlin Gaillard";
   };
+  mirkolenz = {
+    name = "Mirko Lenz";
+    email = "mirko@mirkolenz.com";
+    matrix = "@mlenz:matrix.org";
+    github = "mirkolenz";
+    githubId = 5160954;
+  };
   mirrexagon = {
     email = "mirrexagon@mirrexagon.com";
     github = "mirrexagon";
     githubId = 1776903;
     name = "Andrew Abbott";
   };
+  mirrorwitch = {
+    email = "mirrorwitch@transmom.love";
+    github = "mirrorwitch";
+    githubId = 146672255;
+    name = "mirrorwitch";
+    keys = [{
+        fingerprint = "C3E7 F8C4 9CBC 9320 D360  B117 8516 D0FA 7D8F 58FC";
+    }];
+  };
   Misaka13514 = {
     name = "Misaka13514";
     email = "Misaka13514@gmail.com";
@@ -11551,6 +11959,13 @@
     githubId = 1001112;
     name = "Marcin Janczyk";
   };
+  mjm = {
+    email = "matt@mattmoriarity.com";
+    github = "mjm";
+    githubId = 1181;
+    matrix = "@mjm:beeper.com";
+    name = "Matt Moriarity";
+  };
   mjp = {
     email = "mike@mythik.co.uk";
     github = "MikePlayle";
@@ -11702,6 +12117,13 @@
     github = "ribosomerocker";
     githubId = 46468162;
   };
+  moni = {
+    email = "lythe1107@gmail.com";
+    matrix = "@fortuneteller2k:matrix.org";
+    github = "moni";
+    githubId = 20619776;
+    name = "moni";
+  };
   monsieurp = {
     email = "monsieurp@gentoo.org";
     github = "monsieurp";
@@ -11804,6 +12226,13 @@
     githubId = 2072185;
     name = "Marc Scholten";
   };
+  mrcjkb = {
+    email = "marc@jakobi.dev";
+    matrix = "@mrcjk:matrix.org";
+    name = "Marc Jakobi";
+    github = "mrcjkb";
+    githubId = 12857160;
+  };
   mredaelli = {
     email = "massimo@typish.io";
     github = "mredaelli";
@@ -11846,12 +12275,30 @@
     github = "MrTarantoga";
     githubId = 53876219;
   };
+  mrtnvgr = {
+    name = "Egor Martynov";
+    github = "mrtnvgr";
+    githubId = 48406064;
+    keys = [{
+      fingerprint = "6FAD DB43 D5A5 FE52 6835  0943 5B33 79E9 81EF 48B1";
+    }];
+  };
   mrVanDalo = {
     email = "contact@ingolf-wagner.de";
     github = "mrVanDalo";
     githubId = 839693;
     name = "Ingolf Wanger";
   };
+  msanft = {
+    email = "moritz.sanft@outlook.de";
+    matrix = "@msanft:matrix.org";
+    name = "Moritz Sanft";
+    github = "msanft";
+    githubId = 58110325;
+    keys = [{
+      fingerprint = "3CAC 1D21 3D97 88FF 149A  E116 BB8B 30F5 A024 C31C";
+    }];
+  };
   mschristiansen = {
     email = "mikkel@rheosystems.com";
     github = "mschristiansen";
@@ -12044,6 +12491,11 @@
     githubId = 59313755;
     name = "Maxim Karasev";
   };
+  mxmlnkn = {
+    github = "mxmlnkn";
+    githubId = 6842824;
+    name = "Maximilian Knespel";
+  };
   myaats = {
     email = "mats@mats.sh";
     github = "Myaats";
@@ -12077,6 +12529,11 @@
       fingerprint = "9E6A 25F2 C1F2 9D76 ED00  1932 1261 173A 01E1 0298";
     }];
   };
+  nadir-ishiguro = {
+    github = "nadir-ishiguro";
+    githubId = 23151917;
+    name = "nadir-ishiguro";
+  };
   nadrieril = {
     email = "nadrieril@gmail.com";
     github = "Nadrieril";
@@ -12120,6 +12577,11 @@
     githubId = 6709831;
     name = "Jake Hill";
   };
+  nasageek = {
+    github = "NasaGeek";
+    githubId = 474937;
+    name = "Chris Roberts";
+  };
   nasirhm = {
     email = "nasirhussainm14@gmail.com";
     github = "nasirhm";
@@ -12325,6 +12787,12 @@
     githubId = 13920346;
     name = "Sébastien Iooss";
   };
+  netthier = {
+    email = "netthier@proton.me";
+    name = "nett_hier";
+    github = "netthier";
+    githubId = 66856670;
+  };
   networkexception = {
     name = "networkException";
     email = "nix@nwex.de";
@@ -12510,13 +12978,6 @@
       fingerprint = "9B1A 7906 5D2F 2B80 6C8A  5A1C 7D2A CDAF 4653 CF28";
     }];
   };
-  ninjatrappeur = {
-    email = "felix@alternativebit.fr";
-    matrix = "@ninjatrappeur:matrix.org";
-    github = "NinjaTrappeur";
-    githubId = 1219785;
-    name = "Félix Baylac-Jacqué";
-  };
   nintron = {
     email = "nintron@sent.com";
     github = "Nintron27";
@@ -12556,6 +13017,11 @@
     githubId = 66913205;
     name = "Rick Sanchez";
   };
+  nix-julia = {
+    name = "nix-julia";
+    github = "nix-julia";
+    githubId = 149073815;
+  };
   nixy = {
     email = "nixy@nixy.moe";
     github = "nixy";
@@ -12715,6 +13181,12 @@
     githubId = 9939720;
     name = "Philippe Nguyen";
   };
+  npulidomateo = {
+    matrix = "@npulidomateo:matrix.org";
+    github = "npulidomateo";
+    githubId = 13149442;
+    name = "Nico Pulido-Mateo";
+  };
   nrdxp = {
     email = "tim.deh@pm.me";
     matrix = "@timdeh:matrix.org";
@@ -12872,6 +13344,13 @@
       fingerprint = "939E F8A5 CED8 7F50 5BB5  B2D0 24BC 2738 5F70 234F";
     }];
   };
+  octodi = {
+    name = "octodi";
+    email = "octodi@proton.me";
+    matrix = "@octodi:matrix.org";
+    github = "octodi";
+    githubId = 127038896;
+  };
   oddlama = {
     email = "oddlama@oddlama.org";
     github = "oddlama";
@@ -12899,6 +13378,11 @@
     githubId = 585547;
     name = "Jaka Hudoklin";
   };
+  offsetcyan = {
+    github = "offsetcyan";
+    githubId = 49906709;
+    name = "Dakota";
+  };
   oida = {
     email = "oida@posteo.de";
     github = "oida";
@@ -13041,6 +13525,15 @@
     githubId = 75299;
     name = "Malcolm Matalka";
   };
+  orhun = {
+    email = "orhunparmaksiz@gmail.com";
+    github = "orhun";
+    githubId = 24392180;
+    name = "Orhun Parmaksız";
+    keys = [{
+      fingerprint = "165E 0FF7 C48C 226E 1EC3 63A7 F834 2482 4B3E 4B90";
+    }];
+  };
   orichter = {
     email = "richter-oliver@gmx.net";
     github = "ORichterSec";
@@ -13285,12 +13778,6 @@
     githubId = 6931743;
     name = "pasqui23";
   };
-  patricksjackson = {
-    email = "patrick@jackson.dev";
-    github = "patricksjackson";
-    githubId = 160646;
-    name = "Patrick Jackson";
-  };
   patryk27 = {
     email = "pwychowaniec@pm.me";
     github = "Patryk27";
@@ -13312,6 +13799,11 @@
     githubId = 15645854;
     name = "Brad Christensen";
   };
+  paumr = {
+    github = "paumr";
+    name = "Michael Bergmeister";
+    githubId = 53442728;
+  };
   paveloom = {
     email = "paveloom@riseup.net";
     github = "paveloom";
@@ -13373,6 +13865,7 @@
   pbsds = {
     name = "Peder Bergebakken Sundt";
     email = "pbsds@hotmail.com";
+    matrix = "@pederbs:pvv.ntnu.no";
     github = "pbsds";
     githubId = 140964;
   };
@@ -13424,6 +13917,12 @@
     githubId = 152312;
     name = "Periklis Tsirakidis";
   };
+  perstark = {
+    email = "perstark.se@gmail.com";
+    github = "perstarkse";
+    githubId = 63069986;
+    name = "Per Stark";
+  };
   petercommand = {
     email = "petercommand@gmail.com";
     github = "petercommand";
@@ -13541,6 +14040,12 @@
     githubId = 9267430;
     name = "Philipp Mildenberger";
   };
+  philiptaron = {
+    email = "philip.taron@gmail.com";
+    github = "philiptaron";
+    githubId = 43863;
+    name = "Philip Taron";
+  };
   phip1611 = {
     email = "phip1611@gmail.com";
     github = "phip1611";
@@ -13565,6 +14070,12 @@
     githubId = 301903;
     name = "Chip Collier";
   };
+  phrogg = {
+    name = "Phil Roggenbuck";
+    email = "nixpkgs@phrogg.de";
+    github = "phrogg";
+    githubId = 1367949;
+  };
   phryneas = {
     email = "mail@lenzw.de";
     github = "phryneas";
@@ -13577,6 +14088,13 @@
     githubId = 627831;
     name = "Hoang Xuan Phu";
   };
+  picnoir = {
+    email = "felix@alternativebit.fr";
+    matrix = "@picnoir:alternativebit.fr";
+    github = "picnoir";
+    githubId = 1219785;
+    name = "Félix Baylac-Jacqué";
+  };
   piegames = {
     name = "piegames";
     email = "nix@piegames.de";
@@ -13692,6 +14210,12 @@
     githubId = 610615;
     name = "Chih-Mao Chen";
   };
+  pks = {
+    email = "ps@pks.im";
+    github = "pks-t";
+    githubId = 4056630;
+    name = "Patrick Steinhardt";
+  };
   plabadens = {
     name = "Pierre Labadens";
     email = "labadens.pierre+nixpkgs@gmail.com";
@@ -13728,12 +14252,25 @@
     githubId = 7839004;
     name = "Dmitriy Pleshevskiy";
   };
+  pluiedev = {
+    email = "hi@pluie.me";
+    github = "pluiedev";
+    githubId = 22406910;
+    name = "Leah Amelia Chen";
+  };
   plumps = {
     email = "maks.bronsky@web.de";
     github = "plumps";
     githubId = 13000278;
     name = "Maksim Bronsky";
   };
+  plusgut = {
+    name = "Carlo Jeske";
+    email = "carlo.jeske+nixpkgs@webentwickler2-0.de";
+    github = "plusgut";
+    githubId = 277935;
+    matrix = "@plusgut5:matrix.org";
+  };
   PlushBeaver = {
     name = "Dmitry Kozlyuk";
     email = "dmitry.kozliuk+nixpkgs@gmail.com";
@@ -13876,7 +14413,7 @@
     name = "Pedro Pombeiro";
   };
   pongo1231 = {
-    email = "pongo1999712@gmail.com";
+    email = "pongo12310@gmail.com";
     github = "pongo1231";
     githubId = 4201956;
     name = "pongo1231";
@@ -14011,6 +14548,12 @@
     githubId = 406946;
     name = "Valentin Lorentz";
   };
+  prominentretail = {
+    email = "me@jakepark.me";
+    github = "ProminentRetail";
+    githubId = 94048404;
+    name = "Jake Park";
+  };
   proofconstruction = {
     email = "source@proof.construction";
     github = "proofconstruction";
@@ -14188,6 +14731,12 @@
       fingerprint = "3586 3350 BFEA C101 DB1A 4AF0 1F81 112D 62A9 ADCE";
     }];
   };
+  qdlmcfresh = {
+    name = "Philipp Urlbauer";
+    email = "qdlmcfresh@gmail.com";
+    github = "qdlmcfresh";
+    githubId = 10837173;
+  };
   qjoly = {
     email = "github@thoughtless.eu";
     github = "qjoly";
@@ -14220,7 +14769,7 @@
   };
   quantenzitrone = {
     email = "quantenzitrone@protonmail.com";
-    github = "Quantenzitrone";
+    github = "quantenzitrone";
     githubId = 74491719;
     matrix = "@quantenzitrone:matrix.org";
     name = "quantenzitrone";
@@ -14252,6 +14801,12 @@
     githubId = 1332289;
     name = "Quentin Machu";
   };
+  quinn-dougherty = {
+    email = "quinnd@riseup.net";
+    github = "quinn-dougherty";
+    githubId = 39039420;
+    name = "Quinn Dougherty";
+  };
   qyliss = {
     email = "hi@alyssa.is";
     github = "alyssais";
@@ -14296,6 +14851,12 @@
     githubId = 1016742;
     name = "Rafael García";
   };
+  rafaelrc = {
+    email = "contact@rafaelrc.com";
+    name = "Rafael Carvalho";
+    github = "rafaelrc7";
+    githubId = 5376043;
+  };
   ragge = {
     email = "r.dahlen@gmail.com";
     github = "ragnard";
@@ -14408,6 +14969,12 @@
     githubId = 145816;
     name = "David McKay";
   };
+  rayslash = {
+    email = "stevemathewjoy@tutanota.com";
+    github = "rayslash";
+    githubId = 45141270;
+    name = "Steve Mathew Joy";
+  };
   razvan = {
     email = "razvan.panda@gmail.com";
     github = "freeman42x";
@@ -14582,6 +15149,12 @@
     githubId = 165283;
     name = "Alexey Kutepov";
   };
+  rexxDigital = {
+    email = "joellarssonpriv@gmail.com";
+    github = "rexxDigital";
+    githubId = 44014925;
+    name = "Rexx Larsson";
+  };
   rgnns = {
     email = "jglievano@gmail.com";
     github = "rgnns";
@@ -14654,6 +15227,12 @@
     githubId = 42619;
     name = "Wei-Ming Yang";
   };
+  rickvanprim = {
+    email = "me@rickvanprim.com";
+    github = "rickvanprim";
+    githubId = 13792812;
+    name = "James Leitch";
+  };
   rickynils = {
     email = "rickynils@gmail.com";
     github = "rickynils";
@@ -14974,15 +15553,6 @@
     }];
     name = "Rahul Butani";
   };
-  rs0vere = {
-    email = "rs0vere@proton.me";
-    github = "rs0vere";
-    githubId = 140035635;
-    keys = [{
-      fingerprint = "C6D8 B5C2 FA79 901B DCCF  95E1 FEC4 5C5A ED00 C58D";
-    }];
-    name = "Red Star Over Earth";
-  };
   rski = {
     name = "rski";
     email = "rom.skiad+nix@gmail.com";
@@ -15007,6 +15577,12 @@
     githubId = 47790121;
     name = "Ryan Burns";
   };
+  rtimush = {
+    email = "rtimush@gmail.com";
+    github = "rtimush";
+    githubId = 831307;
+    name = "Roman Timushev";
+  };
   rtreffer = {
     email = "treffer+nixos@measite.de";
     github = "rtreffer";
@@ -15123,6 +15699,12 @@
       fingerprint = "E4F4 1EAB BF0F C785 06D8  62EF EF68 CF41 D42A 593D";
     }];
   };
+  ryangibb = {
+    email = "ryan@freumh.org";
+    github = "ryangibb";
+    githubId = 22669046;
+    name = "Ryan Gibb";
+  };
   ryanorendorff = {
     github = "ryanorendorff";
     githubId = 12442942;
@@ -15236,6 +15818,12 @@
     githubId = 171470;
     name = "Sam Hug";
   };
+  SamirTalwar = {
+    email = "lazy.git@functional.computer";
+    github = "abstracte";
+    githubId = 47852;
+    name = "Samir Talwar";
+  };
   samlich = {
     email = "nixos@samli.ch";
     github = "samlich";
@@ -15276,6 +15864,12 @@
     githubId = 107703;
     name = "Samuel Rivas";
   };
+  samueltardieu = {
+    email = "nixpkgs@sam.rfc1149.net";
+    github = "samueltardieu";
+    githubId = 44656;
+    name = "Samuel Tardieu";
+  };
   samw = {
     email = "sam@wlcx.cc";
     github = "wlcx";
@@ -15380,6 +15974,12 @@
     githubId = 3958212;
     name = "Tom Sorlie";
   };
+  schinmai-akamai = {
+    email = "schinmai@akamai.com";
+    github = "schinmai-akamai";
+    githubId = 70169773;
+    name = "Tarun Chinmai Sekar";
+  };
   schmitthenner = {
     email = "development@schmitthenner.eu";
     github = "fkz";
@@ -15793,6 +16393,12 @@
       fingerprint = "AB63 4CD9 3322 BD42 6231  F764 C404 1EA6 B326 33DE";
     }];
   };
+  shivaraj-bh = {
+    email = "sbh69840@gmail.com";
+    name = "Shivaraj B H";
+    github = "shivaraj-bh";
+    githubId = 23645788;
+  };
   shlevy = {
     email = "shea@shealevy.com";
     github = "shlevy";
@@ -15963,6 +16569,12 @@
       fingerprint = "B234 EFD4 2B42 FE81 EE4D  7627 F72C 4A88 7F9A 24CA";
     }];
   };
+  sironheart = {
+    email = "git@beisenherz.dev";
+    github = "Sironheart";
+    githubId = 13799656;
+    name = "Steffen Beisenherz";
+  };
   sirseruju = {
     email = "sir.seruju@yandex.ru";
     github = "SirSeruju";
@@ -16005,11 +16617,10 @@
     githubId = 158321;
     name = "Stewart Mackenzie";
   };
-  skeidel = {
-    email = "svenkeidel@gmail.com";
-    github = "svenkeidel";
-    githubId = 266500;
-    name = "Sven Keidel";
+  skovati = {
+    github = "skovati";
+    githubId = 49844593;
+    name = "skovati";
   };
   skykanin = {
     github = "skykanin";
@@ -16131,6 +16742,16 @@
     github = "SnO2WMaN";
     githubId = 15155608;
   };
+  snowflake = {
+    email = "snowflake@pissmail.com";
+    name = "Snowflake";
+    github = "snf1k";
+    githubId = 149651684;
+    matrix = "@snowflake:mozilla.org";
+    keys = [{
+      fingerprint = "8223 7B6F 2FF4 8F16 B652  6CA3 934F 9E5F 9701 2C0B";
+    }];
+  };
   snpschaaf = {
     email = "philipe.schaaf@secunet.com";
     name = "Philippe Schaaf";
@@ -16170,6 +16791,16 @@
       fingerprint = "E067 520F 5EF2 C175 3F60  50C0 BA46 725F 6A26 7442";
     }];
   };
+  soispha = {
+    name = "Soispha";
+    email = "soispha@vhack.eu";
+    matrix = "@soispha:vhack.eu";
+    github = "soispha";
+    githubId = 132207423;
+    keys = [{
+      fingerprint = "9606 FC74 9FCE 1636 0723  D4AD A5E9 4010 C3A6 42AD";
+    }];
+  };
   solson = {
     email = "scott@solson.me";
     matrix = "@solson:matrix.org";
@@ -16196,6 +16827,16 @@
     githubId = 53029739;
     name = "Joshua Ortiz";
   };
+  Sorixelle = {
+    email = "ruby+nixpkgs@srxl.me";
+    matrix = "@ruby:isincredibly.gay";
+    name = "Ruby Iris Juric";
+    github = "Sorixelle";
+    githubId = 38685302;
+    keys = [{
+      fingerprint = "2D76 76C7 A28E 16FC 75C7  268D 1B55 6ED8 4B0E 303A";
+    }];
+  };
   sorki = {
     email = "srk@48.io";
     github = "sorki";
@@ -16224,6 +16865,11 @@
       fingerprint = "75F0 AB7C FE01 D077 AEE6  CAFD 353E 4A18 EE0F AB72";
     }];
   };
+  spacefault = {
+    github = "spacefault";
+    githubId = 74156492;
+    name = "spacefault";
+  };
   spacefrogg = {
     email = "spacefrogg-nixos@meterriblecrew.net";
     github = "spacefrogg";
@@ -16737,6 +17383,12 @@
     githubId = 7075751;
     name = "Patrick Hilhorst";
   };
+  sysedwinistrator = {
+    email = "edwin.mowen@gmail.com";
+    github = "sysedwinistrator";
+    githubId = 71331875;
+    name = "Edwin Mackenzie-Owen";
+  };
   szczyp = {
     email = "qb@szczyp.com";
     github = "Szczyp";
@@ -16862,6 +17514,12 @@
     githubId = 1901799;
     name = "Nathan van Doorn";
   };
+  taranarmo = {
+    email = "taranarmo@gmail.com";
+    github = "taranarmo";
+    githubId = 11619234;
+    name = "Sergey Volkov";
+  };
   tari = {
     email = "peter@taricorp.net";
     github = "tari";
@@ -17504,6 +18162,12 @@
     githubId = 858790;
     name = "Tobias Mayer";
   };
+  tochiaha = {
+    email = "tochiahan@proton.me";
+    github = "Tochiaha";
+    githubId = 74688871;
+    name = "Tochukwu Ahanonu";
+  };
   tokudan = {
     email = "git@danielfrank.net";
     github = "tokudan";
@@ -17549,6 +18213,10 @@
     githubId = 13155277;
     name = "Tom Houle";
   };
+  tomkoid = {
+    email = "tomaszierl@outlook.com";
+    name = "Tomkoid";
+  };
   tomodachi94 = {
     email = "tomodachi94+nixpkgs@protonmail.com";
     matrix = "@tomodachi94:matrix.org";
@@ -17619,12 +18287,6 @@
     githubId = 10110;
     name = "Travis B. Hartwell";
   };
-  travisdavis-ops = {
-    email = "travisdavismedia@gmail.com";
-    github = "TravisDavis-ops";
-    githubId = 52011418;
-    name = "Travis Davis";
-  };
   traxys = {
     email = "quentin+dev@familleboyer.net";
     github = "traxys";
@@ -17649,6 +18311,13 @@
     githubId = 25440339;
     name = "Tom Repetti";
   };
+  trevdev = {
+    email = "trev@trevdev.ca";
+    matrix = "@trevdev:matrix.org";
+    github = "trev-dev";
+    githubId = 28788713;
+    name = "Trevor Richards";
+  };
   trevorj = {
     email = "nix@trevor.joynson.io";
     github = "akatrevorjay";
@@ -17703,6 +18372,12 @@
     githubId = 15064765;
     name = "tshaynik";
   };
+  tsowell = {
+    email = "tom@ldtlb.com";
+    github = "tsowell";
+    githubId = 4044033;
+    name = "Thomas Sowell";
+  };
   ttuegel = {
     email = "ttuegel@mailbox.org";
     github = "ttuegel";
@@ -17827,6 +18502,12 @@
     githubId = 1983821;
     name = "Eric Wolf";
   };
+  u2x1 = {
+    email = "u2x1@outlook.com";
+    github = "u2x1";
+    githubId = 30677291;
+    name = "u2x1";
+  };
   uakci = {
     name = "uakci";
     email = "uakci@uakci.pl";
@@ -17845,6 +18526,16 @@
     githubId = 1607770;
     name = "Ulrik Strid";
   };
+  unclamped = {
+    name = "Maru";
+    email = "clear6860@tutanota.com";
+    matrix = "@unhidden0174:matrix.org";
+    github = "unclamped";
+    githubId = 104658278;
+    keys = [{
+      fingerprint = "57A2 CC43 3068 CB62 89C1  F1DA 9137 BB2E 77AD DE7E";
+    }];
+  };
   unclechu = {
     name = "Viacheslav Lotsmanov";
     email = "lotsmanov89@gmail.com";
@@ -18136,6 +18827,15 @@
     githubId = 245573;
     name = "Dmitry Kalinkin";
   };
+  vgskye = {
+    name = "Skye Green";
+    email = "me@skye.vg";
+    github = "vgskye";
+    githubId = 116078858;
+    keys = [{
+      fingerprint = "CDEA 7E04 69E3 0885 A754  4B05 0104 BC05 F41B 77B8";
+    }];
+  };
   victormeriqui = {
     name = "Victor Meriqui";
     email = "victor.meriqui@ororatech.com";
@@ -18302,6 +19002,12 @@
     githubId = 7038383;
     name = "Vojta Káně";
   };
+  volfyd = {
+    email = "lb.nix@lisbethmail.com";
+    github = "volfyd";
+    githubId = 3578382;
+    name = "Leif Huhn";
+  };
   volhovm = {
     email = "volhovm.cs@gmail.com";
     github = "volhovm";
@@ -18407,6 +19113,13 @@
       fingerprint = "47F7 009E 3AE3 1DA7 988E  12E1 8C9B 0A8F C0C0 D862";
     }];
   };
+  wamirez = {
+    email = "wamirez@protonmail.com";
+    matrix = "@wamirez:matrix.org";
+    github = "wamirez";
+    githubId = 24505474;
+    name = "Daniel Ramirez";
+  };
   wamserma = {
     name = "Markus S. Wamser";
     email = "github-dev@mail2013.wamser.eu";
@@ -18414,7 +19127,7 @@
     githubId = 60148;
   };
   water-sucks = {
-    email = "varun@cvte.org";
+    email = "varun@snare.dev";
     name = "Varun Narravula";
     github = "water-sucks";
     githubId = 68445574;
@@ -18501,6 +19214,12 @@
       fingerprint = "F844 80B2 0CA9 D6CC C7F5  2479 A776 D2AD 099E 8BC0";
     }];
   };
+  wexder = {
+    email = "wexder19@gmail.com";
+    github = "wexder";
+    githubId = 24979302;
+    name = "Vladimír Zahradník";
+  };
   wheelsandmetal = {
     email = "jakob@schmutz.co.uk";
     github = "wheelsandmetal";
@@ -18516,6 +19235,12 @@
       fingerprint = "640B EDDE 9734 310A BFA3  B257 52ED AE6A 3995 AFAB";
     }];
   };
+  whiteley = {
+    email = "mattwhiteley@gmail.com";
+    github = "whiteley";
+    githubId = 2215;
+    name = "Matt Whiteley";
+  };
   WhittlesJr = {
     email = "alex.joseph.whitt@gmail.com";
     github = "WhittlesJr";
@@ -18528,6 +19253,12 @@
     githubId = 7121530;
     name = "Wolf Honoré";
   };
+  wietsedv = {
+    email = "wietsedv@proton.me";
+    github = "wietsedv";
+    githubId = 13139101;
+    name = "Wietse de Vries";
+  };
   wigust = {
     name = "Oleg Pykhalov";
     email = "go.wigust@gmail.com";
@@ -18623,11 +19354,11 @@
     githubId = 168610;
     name = "Ricardo M. Correia";
   };
-  wjlroe = {
-    email = "willroe@gmail.com";
-    github = "wjlroe";
-    githubId = 43315;
-    name = "William Roe";
+  wladmis = {
+    email = "dev@wladmis.org";
+    github = "wladmis";
+    githubId = 5000261;
+    name = "Wladmis";
   };
   wldhx = {
     email = "wldhx+nixpkgs@wldhx.me";
@@ -18807,11 +19538,11 @@
     name = "Uli Baum";
   };
   xfix = {
-    email = "konrad@borowski.pw";
+    email = "kamila@borowska.pw";
     matrix = "@xfix:matrix.org";
     github = "xfix";
     githubId = 1297598;
-    name = "Konrad Borowski";
+    name = "Kamila Borowska";
   };
   xfnw = {
     email = "xfnw+nixos@riseup.net";
@@ -18913,6 +19644,12 @@
     github = "yanganto";
     githubId = 10803111;
   };
+  yannip = {
+    email = "yPapandreou7@gmail.com";
+    github = "YanniPapandreou";
+    githubId = 15948162;
+    name = "Yanni Papandreou";
+  };
   yarny = {
     github = "Yarny0";
     githubId = 41838844;
@@ -18936,7 +19673,7 @@
     ];
   };
   yayayayaka = {
-    email = "nixpkgs@uwu.is";
+    email = "github@uwu.is";
     matrix = "@yaya:uwu.is";
     github = "yayayayaka";
     githubId = 73759599;
@@ -18957,6 +19694,13 @@
       fingerprint = "FD0A C425 9EF5 4084 F99F 9B47 2ACC 9749 7C68 FAD4";
     }];
   };
+  YellowOnion = {
+    name = "Daniel Hill";
+    email = "daniel@gluo.nz";
+    github   = "YellowOnion";
+    githubId = 364160;
+    matrix = "@woobilicious:matrix.org";
+  };
   yesbox = {
     email = "jesper.geertsen.jonsson@gmail.com";
     github = "yesbox";
@@ -19018,6 +19762,11 @@
     github = "ymeister";
     githubId = 47071325;
   };
+  ymstnt = {
+    name = "YMSTNT";
+    github = "ymstnt";
+    githubId = 21342713;
+  };
   yoavlavi = {
     email = "yoav@yoavlavi.com";
     github = "yoav-lavi";
@@ -19050,6 +19799,13 @@
     github = "YorikSar";
     githubId = 428074;
   };
+  YoshiRulz = {
+    name = "YoshiRulz";
+    email = "OSSYoshiRulz+Nixpkgs@gmail.com";
+    matrix = "@YoshiRulz:matrix.org";
+    github = "YoshiRulz";
+    githubId = 13409956;
+  };
   yrashk = {
     email = "yrashk@gmail.com";
     github = "yrashk";
@@ -19090,6 +19846,12 @@
       fingerprint = "85F8 E850 F8F2 F823 F934  535B EC50 6589 9AEA AF4C";
     }];
   };
+  yunfachi = {
+    email = "yunfachi@gmail.com";
+    github = "yunfachi";
+    githubId = 73419713;
+    name = "Yunfachi";
+  };
   yureien = {
     email = "contact@sohamsen.me";
     github = "Yureien";
@@ -19330,6 +20092,12 @@
     github = "zmitchell";
     githubId = 10246891;
   };
+  znaniye = {
+    email = "zn4niye@proton.me";
+    github = "znaniye";
+    githubId = 134703788;
+    name = "Samuel Silva";
+  };
   znewman01 = {
     email = "znewman01@gmail.com";
     github = "znewman01";
diff --git a/maintainers/scripts/all-tarballs.nix b/maintainers/scripts/all-tarballs.nix
index 6a4de8a4b95..83236e6fa91 100644
--- a/maintainers/scripts/all-tarballs.nix
+++ b/maintainers/scripts/all-tarballs.nix
@@ -12,5 +12,5 @@ import ../../pkgs/top-level/release.nix
     scrubJobs = false;
     # No need to evaluate on i686.
     supportedSystems = [ "x86_64-linux" ];
-    limitedSupportedSystems = [];
+    bootstrapConfigs = [];
   }
diff --git a/maintainers/scripts/fix-maintainers.pl b/maintainers/scripts/fix-maintainers.pl
index a83df9ec0cf..c953cff5cc4 100755
--- a/maintainers/scripts/fix-maintainers.pl
+++ b/maintainers/scripts/fix-maintainers.pl
@@ -13,12 +13,15 @@ STDOUT->autoflush(1);
 
 my $ua = LWP::UserAgent->new();
 
+if (!defined $ENV{GH_TOKEN}) {
+    die "Set GH_TOKEN before running this script";
+}
+
 keys %$maintainers_json; # reset the internal iterator so a prior each() doesn't affect the loop
 while(my($k, $v) = each %$maintainers_json) {
     my $current_user = %$v{'github'};
     if (!defined $current_user) {
         print "$k has no github handle\n";
-        next;
     }
     my $github_id = %$v{'githubId'};
     if (!defined $github_id) {
@@ -37,13 +40,16 @@ while(my($k, $v) = each %$maintainers_json) {
         sleep($ratelimit_reset - time() + 5);
     }
     if ($resp->code != 200) {
-        print $current_user . " likely deleted their github account\n";
+        print "$k likely deleted their github account\n";
         next;
     }
     my $resp_json = from_json($resp->content);
     my $api_user = %$resp_json{"login"};
-    if (lc($current_user) ne lc($api_user)) {
-        print $current_user . " is now known on github as " . $api_user . ". Editing maintainer-list.nix…\n";
+    if (!defined $current_user) {
+        print "$k is known on github as $api_user.\n";
+    }
+    elsif (lc($current_user) ne lc($api_user)) {
+        print "$k is now known on github as $api_user. Editing maintainer-list.nix…\n";
         my $file = path($maintainers_list_nix);
         my $data = $file->slurp_utf8;
         $data =~ s/github = "$current_user";$/github = "$api_user";/m;
diff --git a/maintainers/scripts/haskell/hydra-report.hs b/maintainers/scripts/haskell/hydra-report.hs
index 5573e5e5afc..2ce3ecb2ae7 100755
--- a/maintainers/scripts/haskell/hydra-report.hs
+++ b/maintainers/scripts/haskell/hydra-report.hs
@@ -187,7 +187,7 @@ getBuildReports opt = runReq defaultHttpConfig do
 
 getEvalBuilds :: HydraSlownessWorkaroundFlag -> Int -> Req (Seq Build)
 getEvalBuilds NoHydraSlownessWorkaround id =
-  hydraJSONQuery (responseTimeout 900000000) ["eval", showT id, "builds"]
+  hydraJSONQuery mempty ["eval", showT id, "builds"]
 getEvalBuilds HydraSlownessWorkaround id = do
   Eval{builds} <- hydraJSONQuery mempty [ "eval", showT id ]
   forM builds $ \buildId -> do
@@ -195,14 +195,15 @@ getEvalBuilds HydraSlownessWorkaround id = do
     hydraJSONQuery mempty [ "build", showT buildId ]
 
 hydraQuery :: HttpResponse a => Proxy a -> Option 'Https -> [Text] -> Req (HttpResponseBody a)
-hydraQuery responseType option query =
-   responseBody
-      <$> req
-         GET
-         (foldl' (/:) (https "hydra.nixos.org") query)
-         NoReqBody
-         responseType
-         (header "User-Agent" "hydra-report.hs/v1 (nixpkgs;maintainers/scripts/haskell) pls fix https://github.com/NixOS/nixos-org-configurations/issues/270" <> option)
+hydraQuery responseType option query = do
+  let customHeaderOpt =
+        header
+          "User-Agent"
+          "hydra-report.hs/v1 (nixpkgs;maintainers/scripts/haskell) pls fix https://github.com/NixOS/nixos-org-configurations/issues/270"
+      customTimeoutOpt = responseTimeout 900_000_000 -- 15 minutes
+      opts = customHeaderOpt <> customTimeoutOpt <> option
+      url = foldl' (/:) (https "hydra.nixos.org") query
+  responseBody <$> req GET url NoReqBody responseType opts
 
 hydraJSONQuery :: FromJSON a => Option 'Https -> [Text] -> Req a
 hydraJSONQuery = hydraQuery jsonResponse
diff --git a/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh b/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh
index 86fecbc3d87..9130941a536 100755
--- a/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh
+++ b/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh
@@ -39,5 +39,5 @@ fi
 package_list="$(nix-build -A haskell.package-list)/nixos-hackage-packages.csv"
 username=$(grep "^username:" "$CABAL_DIR/config" | sed "s/^username: //")
 password_command=$(grep "^password-command:" "$CABAL_DIR/config" | sed "s/^password-command: //")
-curl -u "$username:$($password_command | head -n1)" --digest -H "Content-type: text/csv" -T "$package_list" http://hackage.haskell.org/distro/NixOS/packages.csv
+curl -u "$username:$($password_command | head -n1)" --digest -H "Content-type: text/csv" -T "$package_list" https://hackage.haskell.org/distro/NixOS/packages.csv
 echo
diff --git a/maintainers/scripts/luarocks-packages.csv b/maintainers/scripts/luarocks-packages.csv
index 52ac8a93431..78cfca24d96 100644
--- a/maintainers/scripts/luarocks-packages.csv
+++ b/maintainers/scripts/luarocks-packages.csv
@@ -1,9 +1,9 @@
 name,src,ref,server,version,luaversion,maintainers
 alt-getopt,,,,,,arobyn
 bit32,,,,5.3.0-1,5.1,lblasc
-argparse,https://github.com/luarocks/argparse.git,,,,,
-basexx,https://github.com/teto/basexx.git,,,,,
-binaryheap,https://github.com/Tieske/binaryheap.lua,,,,,vcunat
+argparse,,,,,,
+basexx,,,,,,
+binaryheap,,,,,,vcunat
 busted,,,,,,
 cassowary,,,,,,marsam alerque
 cldr,,,,,,alerque
@@ -12,8 +12,7 @@ cosmo,,,,,,marsam
 coxpcall,,,,1.17.0-1,,
 cqueues,,,,,,vcunat
 cyan,,,,,,
-cyrussasl,https://github.com/JorjBauer/lua-cyrussasl.git,,,,,
-digestif,https://github.com/astoff/digestif.git,,,0.2-1,5.3,
+digestif,https://github.com/astoff/digestif.git,,,,5.3,
 dkjson,,,,,,
 fennel,,,,,,misterio77
 fifo,,,,,,
@@ -24,7 +23,7 @@ http,,,,0.3-0,,vcunat
 inspect,,,,,,
 jsregexp,,,,,,
 ldbus,,,http://luarocks.org/dev,,,
-ldoc,https://github.com/stevedonovan/LDoc.git,,,,,
+ldoc,,,,,,
 lgi,,,,,,
 linenoise,https://github.com/hoelzro/lua-linenoise.git,,,,,
 ljsyscall,,,,,5.1,lblasc
@@ -34,14 +33,13 @@ loadkit,,,,,,alerque
 lpeg,,,,,,vyp
 lpeg_patterns,,,,,,
 lpeglabel,,,,1.6.0,,
-lpty,,,,,,
 lrexlib-gnu,,,,,,
 lrexlib-pcre,,,,,,vyp
 lrexlib-posix,,,,,,
 lua-cjson,,,,,,
 lua-cmsgpack,,,,,,
 lua-curl,,,,,,
-lua-iconv,,,,,,
+lua-ffi-zlib,,,,,,
 lua-lsp,,,,,,
 lua-messagepack,,,,,,
 lua-protobuf,,,,,,lockejan
@@ -50,6 +48,7 @@ lua-resty-jwt,,,,,,
 lua-resty-openidc,,,,,,
 lua-resty-openssl,,,,,,
 lua-resty-session,,,,,,
+lua-rtoml,https://github.com/lblasc/lua-rtoml,,,,,lblasc
 lua-subprocess,https://github.com/0x0ade/lua-subprocess,,,,5.1,scoder12
 lua-term,,,,,,
 lua-toml,,,,,,
@@ -72,6 +71,7 @@ lualogging,,,,,,
 luaossl,,,,,5.1,
 luaposix,,,,34.1.1-1,,vyp lblasc
 luarepl,,,,,,
+luarocks-build-rust-mlua,,,,,,mrcjkb
 luasec,,,,,,flosse
 luasocket,,,,,,
 luasql-sqlite3,,,,,,vyp
@@ -82,31 +82,36 @@ luaunit,,,,,,lockejan
 luautf8,,,,,,pstn
 luazip,,,,,,
 lua-yajl,,,,,,pstn
+lua-iconv,,,,7.0.0,,
 luuid,,,,,,
 luv,,,,1.44.2-1,,
 lush.nvim,https://github.com/rktjmp/lush.nvim,,,,,teto
 lyaml,,,,,,lblasc
-magick,,,,,,donovanglover
+magick,,,,,5.1,donovanglover
 markdown,,,,,,
 mediator_lua,,,,,,
+middleclass,,,,,,
 mpack,,,,,,
 moonscript,https://github.com/leafo/moonscript.git,dev-1,,,,arobyn
+nui.nvim,,,,,,mrcjkb
 nvim-client,https://github.com/neovim/lua-client.git,,,,,
 nvim-cmp,https://github.com/hrsh7th/nvim-cmp,,,,,
 penlight,https://github.com/lunarmodules/Penlight.git,,,,,alerque
 plenary.nvim,https://github.com/nvim-lua/plenary.nvim.git,,,,5.1,
 rapidjson,https://github.com/xpol/lua-rapidjson.git,,,,,
 rest.nvim,,,,,5.1,teto
-readline,,,,,,
+rustaceanvim,,,,,,mrcjkb
 say,https://github.com/Olivine-Labs/say.git,,,,,
 serpent,,,,,,lockejan
 sqlite,,,,,,
 std._debug,https://github.com/lua-stdlib/_debug.git,,,,,
-std.normalize,https://github.com/lua-stdlib/normalize.git,,,,,
+std.normalize,,,,,,
 stdlib,,,,41.2.2,,vyp
 teal-language-server,,,http://luarocks.org/dev,,,
 telescope.nvim,,,,,5.1,
 telescope-manix,,,,,,
 tl,,,,,,mephistophiles
+toml,,,,,,mrcjkb
+toml-edit,,,,,5.1,mrcjkb
 vstruct,https://github.com/ToxicFrog/vstruct.git,,,,,
 vusted,,,,,,figsoda
diff --git a/maintainers/scripts/pluginupdate.py b/maintainers/scripts/pluginupdate.py
index 6a607eb6248..cc0f4ef742d 100644
--- a/maintainers/scripts/pluginupdate.py
+++ b/maintainers/scripts/pluginupdate.py
@@ -26,7 +26,7 @@ import urllib.parse
 import urllib.request
 import xml.etree.ElementTree as ET
 from dataclasses import asdict, dataclass
-from datetime import datetime
+from datetime import UTC, datetime
 from functools import wraps
 from multiprocessing.dummy import Pool
 from pathlib import Path
@@ -321,8 +321,13 @@ def load_plugins_from_csv(
     return plugins
 
 
-def run_nix_expr(expr):
-    with CleanEnvironment() as nix_path:
+
+def run_nix_expr(expr, nixpkgs: str):
+    '''
+    :param expr nix expression to fetch current plugins
+    :param nixpkgs Path towards a nixpkgs checkout
+    '''
+    with CleanEnvironment(nixpkgs) as nix_path:
         cmd = [
             "nix",
             "eval",
@@ -335,8 +340,8 @@ def run_nix_expr(expr):
             "--nix-path",
             nix_path,
         ]
-        log.debug("Running command %s", " ".join(cmd))
-        out = subprocess.check_output(cmd)
+        log.debug("Running command: %s", " ".join(cmd))
+        out = subprocess.check_output(cmd, timeout=90)
         data = json.loads(out)
         return data
 
@@ -396,9 +401,9 @@ class Editor:
         """CSV spec"""
         print("the update member function should be overriden in subclasses")
 
-    def get_current_plugins(self) -> List[Plugin]:
+    def get_current_plugins(self, nixpkgs) -> List[Plugin]:
         """To fill the cache"""
-        data = run_nix_expr(self.get_plugins)
+        data = run_nix_expr(self.get_plugins, nixpkgs)
         plugins = []
         for name, attr in data.items():
             p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"])
@@ -414,7 +419,7 @@ class Editor:
         raise NotImplementedError()
 
     def get_update(self, input_file: str, outfile: str, config: FetchConfig):
-        cache: Cache = Cache(self.get_current_plugins(), self.cache_file)
+        cache: Cache = Cache(self.get_current_plugins(self.nixpkgs), self.cache_file)
         _prefetch = functools.partial(prefetch, cache=cache)
 
         def update() -> dict:
@@ -454,9 +459,16 @@ class Editor:
             ),
         )
         common.add_argument(
+            "--nixpkgs",
+            type=str,
+            default=os.getcwd(),
+            help="Adjust log level",
+        )
+        common.add_argument(
             "--input-names",
             "-i",
             dest="input_file",
+            type=Path,
             default=self.default_in,
             help="A list of plugins in the form owner/repo",
         )
@@ -465,6 +477,7 @@ class Editor:
             "-o",
             dest="outfile",
             default=self.default_out,
+            type=Path,
             help="Filename to save generated nix code",
         )
         common.add_argument(
@@ -541,22 +554,26 @@ class Editor:
         command = args.command or "update"
         log.setLevel(LOG_LEVELS[args.debug])
         log.info("Chose to run command: %s", command)
+        self.nixpkgs = args.nixpkgs
 
-        if not args.no_commit:
-            self.nixpkgs_repo = git.Repo(self.root, search_parent_directories=True)
+        self.nixpkgs_repo = git.Repo(args.nixpkgs, search_parent_directories=True)
 
         getattr(self, command)(args)
 
 
 class CleanEnvironment(object):
+    def __init__(self, nixpkgs):
+        self.local_pkgs = nixpkgs
+
     def __enter__(self) -> str:
-        self.old_environ = os.environ.copy()
+        """
         local_pkgs = str(Path(__file__).parent.parent.parent)
+        """
+        self.old_environ = os.environ.copy()
         self.empty_config = NamedTemporaryFile()
         self.empty_config.write(b"{}")
         self.empty_config.flush()
-        os.environ["NIXPKGS_CONFIG"] = self.empty_config.name
-        return f"localpkgs={local_pkgs}"
+        return f"localpkgs={self.local_pkgs}"
 
     def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None:
         os.environ.update(self.old_environ)
@@ -758,7 +775,8 @@ def commit(repo: git.Repo, message: str, files: List[Path]) -> None:
 
 
 def update_plugins(editor: Editor, args):
-    """The main entry function of this module. All input arguments are grouped in the `Editor`."""
+    """The main entry function of this module.
+    All input arguments are grouped in the `Editor`."""
 
     log.info("Start updating plugins")
     fetch_config = FetchConfig(args.proc, args.github_token)
@@ -770,8 +788,16 @@ def update_plugins(editor: Editor, args):
     autocommit = not args.no_commit
 
     if autocommit:
-        editor.nixpkgs_repo = git.Repo(editor.root, search_parent_directories=True)
-        commit(editor.nixpkgs_repo, f"{editor.attr_path}: update", [args.outfile])
+        try:
+            repo = git.Repo(os.getcwd())
+            updated = datetime.now(tz=UTC).strftime('%Y-%m-%d')
+            print(args.outfile)
+            commit(repo,
+                   f"{editor.attr_path}: update on {updated}", [args.outfile]
+                   )
+        except git.InvalidGitRepositoryError as e:
+            print(f"Not in a git repository: {e}", file=sys.stderr)
+            sys.exit(1)
 
     if redirects:
         update()
diff --git a/maintainers/scripts/update-luarocks-packages b/maintainers/scripts/update-luarocks-packages
deleted file mode 100755
index 791cd8a1d89..00000000000
--- a/maintainers/scripts/update-luarocks-packages
+++ /dev/null
@@ -1,216 +0,0 @@
-#!/usr/bin/env nix-shell
-#!nix-shell update-luarocks-shell.nix -i python3
-
-# format:
-# $ nix run nixpkgs.python3Packages.black -c black update.py
-# type-check:
-# $ nix run nixpkgs.python3Packages.mypy -c mypy update.py
-# linted:
-# $ nix run nixpkgs.python3Packages.flake8 -c flake8 --ignore E501,E265,E402 update.py
-
-import inspect
-import os
-import tempfile
-import shutil
-from dataclasses import dataclass
-import subprocess
-import csv
-import logging
-import textwrap
-from multiprocessing.dummy import Pool
-
-from typing import List, Tuple, Optional
-from pathlib import Path
-
-log = logging.getLogger()
-log.addHandler(logging.StreamHandler())
-
-ROOT = Path(os.path.dirname(os.path.abspath(inspect.getfile(inspect.currentframe())))).parent.parent # type: ignore
-import pluginupdate
-from pluginupdate import update_plugins, FetchConfig, CleanEnvironment
-
-PKG_LIST="maintainers/scripts/luarocks-packages.csv"
-TMP_FILE="$(mktemp)"
-GENERATED_NIXFILE="pkgs/development/lua-modules/generated-packages.nix"
-LUAROCKS_CONFIG="maintainers/scripts/luarocks-config.lua"
-
-HEADER = """/* {GENERATED_NIXFILE} is an auto-generated file -- DO NOT EDIT!
-Regenerate it with:
-nixpkgs$ ./maintainers/scripts/update-luarocks-packages
-
-You can customize the generated packages in pkgs/development/lua-modules/overrides.nix
-*/
-""".format(GENERATED_NIXFILE=GENERATED_NIXFILE)
-
-FOOTER="""
-}
-/* GENERATED - do not edit this file */
-"""
-
-@dataclass
-class LuaPlugin:
-    name: str
-    '''Name of the plugin, as seen on luarocks.org'''
-    src: str
-    '''address to the git repository'''
-    ref: Optional[str]
-    '''git reference (branch name/tag)'''
-    version: Optional[str]
-    '''Set it to pin a package '''
-    server: Optional[str]
-    '''luarocks.org registers packages under different manifests.
-    Its value can be 'http://luarocks.org/dev'
-    '''
-    luaversion: Optional[str]
-    '''Attribue of the lua interpreter if a package is available only for a specific lua version'''
-    maintainers: Optional[str]
-    ''' Optional string listing maintainers separated by spaces'''
-
-    @property
-    def normalized_name(self) -> str:
-        return self.name.replace(".", "-")
-
-# rename Editor to LangUpdate/ EcosystemUpdater
-class LuaEditor(pluginupdate.Editor):
-    def get_current_plugins(self):
-        return []
-
-    def load_plugin_spec(self, input_file) -> List[LuaPlugin]:
-        luaPackages = []
-        csvfilename=input_file
-        log.info("Loading package descriptions from %s", csvfilename)
-
-        with open(csvfilename, newline='') as csvfile:
-            reader = csv.DictReader(csvfile,)
-            for row in reader:
-                # name,server,version,luaversion,maintainers
-                plugin = LuaPlugin(**row)
-                luaPackages.append(plugin)
-        return luaPackages
-
-    def update(self, args):
-        update_plugins(self, args)
-
-    def generate_nix(
-        self,
-        results: List[Tuple[LuaPlugin, str]],
-        outfilename: str
-        ):
-
-        with tempfile.NamedTemporaryFile("w+") as f:
-            f.write(HEADER)
-            header2 = textwrap.dedent(
-            # header2 = inspect.cleandoc(
-            """
-                { self, stdenv, lib, fetchurl, fetchgit, callPackage, ... } @ args:
-                final: prev:
-                {
-            """)
-            f.write(header2)
-            for (plugin, nix_expr) in results:
-                f.write(f"{plugin.normalized_name} = {nix_expr}")
-            f.write(FOOTER)
-            f.flush()
-
-            # if everything went fine, move the generated file to its destination
-            # using copy since move doesn't work across disks
-            shutil.copy(f.name, outfilename)
-
-        print(f"updated {outfilename}")
-
-    @property
-    def attr_path(self):
-        return "luaPackages"
-
-    def get_update(self, input_file: str, outfile: str, config: FetchConfig):
-        _prefetch = generate_pkg_nix
-
-        def update() -> dict:
-            plugin_specs = self.load_plugin_spec(input_file)
-            sorted_plugin_specs = sorted(plugin_specs, key=lambda v: v.name.lower())
-
-            try:
-                pool = Pool(processes=config.proc)
-                results = pool.map(_prefetch, sorted_plugin_specs)
-            finally:
-                pass
-
-            self.generate_nix(results, outfile)
-
-            redirects = {}
-            return redirects
-
-        return update
-
-    def rewrite_input(self, input_file: str, *args, **kwargs):
-        # vim plugin reads the file before update but that shouldn't be our case
-        # not implemented yet
-        # fieldnames = ['name', 'server', 'version', 'luaversion', 'maintainers']
-        # input_file = "toto.csv"
-        # with open(input_file, newline='') as csvfile:
-        #     writer = csv.DictWriter(csvfile, fieldnames=fieldnames)
-        #     writer.writeheader()
-        #     for row in reader:
-        #         # name,server,version,luaversion,maintainers
-        #         plugin = LuaPlugin(**row)
-        #         luaPackages.append(plugin)
-        pass
-
-def generate_pkg_nix(plug: LuaPlugin):
-    '''
-    Generate nix expression for a luarocks package
-    Our cache key associates "p.name-p.version" to its rockspec
-    '''
-    log.debug("Generating nix expression for %s", plug.name)
-    custom_env = os.environ.copy()
-    custom_env['LUAROCKS_CONFIG'] = LUAROCKS_CONFIG
-
-    # we add --dev else luarocks wont find all the "scm" (=dev) versions of the
-    # packages
-	# , "--dev"
-    cmd = [ "luarocks", "nix" ]
-
-    if plug.maintainers:
-        cmd.append(f"--maintainers={plug.maintainers}")
-
-    # if plug.server == "src":
-    if plug.src != "":
-        if plug.src is None:
-            msg = "src must be set when 'version' is set to \"src\" for package %s" % plug.name
-            log.error(msg)
-            raise RuntimeError(msg)
-        log.debug("Updating from source %s", plug.src)
-        cmd.append(plug.src)
-    # update the plugin from luarocks
-    else:
-        cmd.append(plug.name)
-        if plug.version and plug.version != "src":
-
-            cmd.append(plug.version)
-
-    if plug.server != "src" and plug.server:
-        cmd.append(f"--only-server={plug.server}")
-
-    if plug.luaversion:
-        cmd.append(f"--lua-version={plug.luaversion}")
-
-    log.debug("running %s", ' '.join(cmd))
-
-    output = subprocess.check_output(cmd, env=custom_env, text=True)
-    output = "callPackage(" + output.strip() + ") {};\n\n"
-    return (plug, output)
-
-def main():
-
-    editor = LuaEditor("lua", ROOT, '',
-        default_in = ROOT.joinpath(PKG_LIST),
-        default_out = ROOT.joinpath(GENERATED_NIXFILE)
-        )
-
-    editor.run()
-
-if __name__ == "__main__":
-
-    main()
-
-#  vim: set ft=python noet fdm=manual fenc=utf-8 ff=unix sts=0 sw=4 ts=4 :
diff --git a/maintainers/scripts/update-luarocks-shell.nix b/maintainers/scripts/update-luarocks-shell.nix
deleted file mode 100644
index 346b0319b08..00000000000
--- a/maintainers/scripts/update-luarocks-shell.nix
+++ /dev/null
@@ -1,13 +0,0 @@
-{ nixpkgs ? import ../.. { }
-}:
-with nixpkgs;
-let
-  pyEnv = python3.withPackages(ps: [ ps.gitpython ]);
-in
-mkShell {
-  packages = [
-    pyEnv
-    luarocks-nix
-    nix-prefetch-scripts
-  ];
-}
diff --git a/maintainers/team-list.nix b/maintainers/team-list.nix
index 6b90ce30588..db66b8fe868 100644
--- a/maintainers/team-list.nix
+++ b/maintainers/team-list.nix
@@ -324,12 +324,16 @@ with lib.maintainers; {
   geospatial = {
     members = [
       imincik
-      sikmir
       nh2
+      sikmir
       willcohen
     ];
+    githubTeams = [
+      "geospatial"
+    ];
     scope = "Maintain geospatial packages.";
     shortName = "Geospatial";
+    enableFeatureFreezePing = true;
   };
 
   gitlab = {
@@ -350,6 +354,7 @@ with lib.maintainers; {
       mic92
       zowoq
       qbit
+      mfrw
     ];
     githubTeams = [
       "golang"
@@ -393,6 +398,7 @@ with lib.maintainers; {
       cdepillabout
       expipiplus1
       maralorn
+      ncfavier
       sternenseemann
     ];
     githubTeams = [
@@ -406,7 +412,6 @@ with lib.maintainers; {
   home-assistant = {
     members = [
       fab
-      globin
       hexa
       mic92
     ];
@@ -430,6 +435,7 @@ with lib.maintainers; {
     members = [
       cleeyv
       ryantm
+      lassulus
     ];
     scope = "Maintain Jitsi.";
     shortName = "Jitsi";
@@ -439,6 +445,7 @@ with lib.maintainers; {
     members = [
       GaetanLepage
       natsukium
+      thomasjm
     ];
     scope = "Maintain Jupyter and related packages.";
     shortName = "Jupyter";
@@ -611,6 +618,7 @@ with lib.maintainers; {
 
   minimal-bootstrap = {
     members = [
+      alejandrosame
       artturin
       emilytrau
       ericson2314
@@ -682,6 +690,18 @@ with lib.maintainers; {
     shortName = "Numtide team";
   };
 
+  ocaml = {
+    members = [
+      alizter
+    ];
+    githubTeams = [
+      "ocaml"
+    ];
+    scope = "Maintain the OCaml compiler and package set.";
+    shortName = "OCaml";
+    enableFeatureFreezePing = true;
+  };
+
   openstack = {
     members = [
       SuperSandro2000
@@ -728,7 +748,6 @@ with lib.maintainers; {
       aanderse
       drupol
       etu
-      globin
       ma27
       talyz
     ];
@@ -898,7 +917,6 @@ with lib.maintainers; {
 
   tts = {
     members = [
-      hexa
       mic92
     ];
     scope = "coqui-ai TTS (formerly Mozilla TTS) and leaf packages";
@@ -919,7 +937,6 @@ with lib.maintainers; {
   wdz = {
     members = [
       n0emis
-      netali
       vidister
       johannwagner
       yuka