summary refs log tree commit diff
diff options
context:
space:
mode:
-rw-r--r--.github/CODEOWNERS5
-rw-r--r--maintainers/scripts/pluginupdate.py187
-rw-r--r--nixos/doc/manual/from_md/release-notes/rl-1803.section.xml8
-rw-r--r--nixos/doc/manual/release-notes/rl-1803.section.md2
-rw-r--r--nixos/lib/make-disk-image.nix1
-rw-r--r--nixos/modules/system/boot/systemd/initrd.nix28
-rw-r--r--nixos/tests/docker-tools-cross.nix4
-rw-r--r--nixos/tests/docker-tools.nix2
-rw-r--r--nixos/tests/vaultwarden.nix1
-rw-r--r--pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names39
-rw-r--r--pkgs/applications/editors/vim/plugins/generated.nix1779
-rw-r--r--pkgs/applications/editors/vim/plugins/vim-plugin-names2022
-rw-r--r--pkgs/applications/graphics/imgbrd-grabber/default.nix2
-rw-r--r--pkgs/applications/graphics/jpegrescan/default.nix6
-rw-r--r--pkgs/applications/graphics/synfigstudio/default.nix4
-rw-r--r--pkgs/applications/misc/gnome-solanum/default.nix10
-rw-r--r--pkgs/applications/networking/sniffers/wireshark/default.nix11
-rw-r--r--pkgs/applications/science/chemistry/jmol/default.nix4
-rw-r--r--pkgs/build-support/docker/default.nix18
-rw-r--r--pkgs/build-support/docker/examples.nix2
-rw-r--r--pkgs/desktops/pantheon/apps/elementary-code/default.nix14
-rw-r--r--pkgs/development/compilers/julia/1.6-bin.nix4
-rw-r--r--pkgs/development/libraries/hivex/default.nix4
-rw-r--r--pkgs/development/ocaml-modules/eliom/default.nix12
-rw-r--r--pkgs/development/ocaml-modules/ocsigen-server/default.nix8
-rw-r--r--pkgs/development/ocaml-modules/ocsigen-start/default.nix4
-rw-r--r--pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix4
-rw-r--r--pkgs/development/ocaml-modules/ocsipersist/default.nix20
-rw-r--r--pkgs/development/ocaml-modules/ocsipersist/lib.nix27
-rw-r--r--pkgs/development/ocaml-modules/ocsipersist/pgsql.nix24
-rw-r--r--pkgs/development/ocaml-modules/ocsipersist/sqlite.nix23
-rw-r--r--pkgs/development/python-modules/faraday-plugins/default.nix4
-rw-r--r--pkgs/development/python-modules/hachoir/default.nix12
-rw-r--r--pkgs/development/python-modules/hahomematic/default.nix4
-rw-r--r--pkgs/development/python-modules/md-toc/default.nix4
-rw-r--r--pkgs/development/python-modules/pex/default.nix4
-rw-r--r--pkgs/development/python-modules/pyvesync/default.nix4
-rw-r--r--pkgs/development/python-modules/sqlmap/default.nix4
-rw-r--r--pkgs/development/python-modules/typed-settings/default.nix4
-rw-r--r--pkgs/development/python-modules/weasyprint/default.nix4
-rw-r--r--pkgs/development/tools/analysis/checkov/default.nix9
-rw-r--r--pkgs/development/tools/continuous-integration/buildkite-agent/default.nix8
-rw-r--r--pkgs/development/tools/misc/gef/default.nix8
-rw-r--r--pkgs/development/tools/neil/default.nix4
-rw-r--r--pkgs/development/tools/phantomjs2/default.nix3
-rw-r--r--pkgs/development/tools/skaffold/default.nix4
-rw-r--r--pkgs/development/tools/skopeo/default.nix5
-rw-r--r--pkgs/os-specific/linux/pam_usb/default.nix6
-rw-r--r--pkgs/servers/monitoring/munin/default.nix5
-rw-r--r--pkgs/servers/owncast/default.nix2
-rw-r--r--pkgs/servers/rt/default.nix2
-rw-r--r--pkgs/tools/X11/obconf/default.nix2
-rw-r--r--pkgs/tools/misc/kisslicer/default.nix5
-rw-r--r--pkgs/tools/misc/logstash/6.x.nix6
-rw-r--r--pkgs/tools/misc/logstash/7.x.nix5
-rw-r--r--pkgs/tools/package-management/nix/default.nix11
-rw-r--r--pkgs/tools/security/aeskeyfind/default.nix30
-rw-r--r--pkgs/top-level/all-packages.nix2
-rw-r--r--pkgs/top-level/ocaml-packages.nix8
59 files changed, 2358 insertions, 2090 deletions
diff --git a/.github/CODEOWNERS b/.github/CODEOWNERS
index 008d51b29aa..07dfe176f49 100644
--- a/.github/CODEOWNERS
+++ b/.github/CODEOWNERS
@@ -242,9 +242,8 @@
 
 # Docker tools
 /pkgs/build-support/docker                   @roberth
-/nixos/tests/docker-tools-overlay.nix        @roberth
-/nixos/tests/docker-tools.nix                @roberth
-/doc/builders/images/dockertools.xml         @roberth
+/nixos/tests/docker-tools*                   @roberth
+/doc/builders/images/dockertools.section.md  @roberth
 
 # Blockchains
 /pkgs/applications/blockchains  @mmahut @RaghavSood
diff --git a/maintainers/scripts/pluginupdate.py b/maintainers/scripts/pluginupdate.py
index 017e3ac758a..3cfdb138705 100644
--- a/maintainers/scripts/pluginupdate.py
+++ b/maintainers/scripts/pluginupdate.py
@@ -8,6 +8,7 @@
 # $ nix run nixpkgs.python3Packages.flake8 -c flake8 --ignore E501,E265 update.py
 
 import argparse
+import csv
 import functools
 import http
 import json
@@ -28,7 +29,7 @@ from pathlib import Path
 from typing import Dict, List, Optional, Tuple, Union, Any, Callable
 from urllib.parse import urljoin, urlparse
 from tempfile import NamedTemporaryFile
-from dataclasses import dataclass
+from dataclasses import dataclass, asdict
 
 import git
 
@@ -85,21 +86,30 @@ def make_request(url: str, token=None) -> urllib.request.Request:
         headers["Authorization"] = f"token {token}"
     return urllib.request.Request(url, headers=headers)
 
+
+Redirects = Dict['Repo', 'Repo']
+
 class Repo:
     def __init__(
-        self, uri: str, branch: str, alias: Optional[str]
+        self, uri: str, branch: str
     ) -> None:
         self.uri = uri
         '''Url to the repo'''
-        self.branch = branch
-        self.alias = alias
-        self.redirect: Dict[str, str] = {}
+        self._branch = branch
+        # {old_uri: new_uri}
+        self.redirect: Redirects = {}
         self.token = "dummy_token"
 
     @property
     def name(self):
         return self.uri.split('/')[-1]
 
+    @property
+    def branch(self):
+        return self._branch or "HEAD"
+
+    def __str__(self) -> str:
+        return f"{self.uri}"
     def __repr__(self) -> str:
         return f"Repo({self.name}, {self.uri})"
 
@@ -109,6 +119,7 @@ class Repo:
 
     @retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
     def latest_commit(self) -> Tuple[str, datetime]:
+        log.debug("Latest commit")
         loaded = self._prefetch(None)
         updated = datetime.strptime(loaded['date'], "%Y-%m-%dT%H:%M:%S%z")
 
@@ -124,6 +135,7 @@ class Repo:
         return loaded
 
     def prefetch(self, ref: Optional[str]) -> str:
+        print("Prefetching")
         loaded = self._prefetch(ref)
         return loaded["sha256"]
 
@@ -137,21 +149,22 @@ class Repo:
 
 class RepoGitHub(Repo):
     def __init__(
-        self, owner: str, repo: str, branch: str, alias: Optional[str]
+        self, owner: str, repo: str, branch: str
     ) -> None:
         self.owner = owner
         self.repo = repo
         self.token = None
         '''Url to the repo'''
-        super().__init__(self.url(""), branch, alias)
-        log.debug("Instantiating github repo %s/%s", self.owner, self.repo)
+        super().__init__(self.url(""), branch)
+        log.debug("Instantiating github repo owner=%s and repo=%s", self.owner, self.repo)
 
     @property
     def name(self):
         return self.repo
 
     def url(self, path: str) -> str:
-        return urljoin(f"https://github.com/{self.owner}/{self.name}/", path)
+        res = urljoin(f"https://github.com/{self.owner}/{self.repo}/", path)
+        return res
 
     @retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
     def has_submodules(self) -> bool:
@@ -168,6 +181,7 @@ class RepoGitHub(Repo):
     @retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
     def latest_commit(self) -> Tuple[str, datetime]:
         commit_url = self.url(f"commits/{self.branch}.atom")
+        log.debug("Sending request to %s", commit_url)
         commit_req = make_request(commit_url, self.token)
         with urllib.request.urlopen(commit_req, timeout=10) as req:
             self._check_for_redirect(commit_url, req)
@@ -191,12 +205,9 @@ class RepoGitHub(Repo):
             new_owner, new_name = (
                 urllib.parse.urlsplit(response_url).path.strip("/").split("/")[:2]
             )
-            end_line = "\n" if self.alias is None else f" as {self.alias}\n"
-            plugin_line = "{owner}/{name}" + end_line
 
-            old_plugin = plugin_line.format(owner=self.owner, name=self.name)
-            new_plugin = plugin_line.format(owner=new_owner, name=new_name)
-            self.redirect[old_plugin] = new_plugin
+            new_repo = RepoGitHub(owner=new_owner, repo=new_name, branch=self.branch)
+            self.redirect[self] = new_repo
 
 
     def prefetch(self, commit: str) -> str:
@@ -207,9 +218,9 @@ class RepoGitHub(Repo):
         return sha256
 
     def prefetch_github(self, ref: str) -> str:
-        data = subprocess.check_output(
-            ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")]
-        )
+        cmd = ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")]
+        log.debug("Running %s", cmd)
+        data = subprocess.check_output(cmd)
         return data.strip().decode("utf-8")
 
     def as_nix(self, plugin: "Plugin") -> str:
@@ -239,21 +250,38 @@ class PluginDesc:
         else:
             return self.alias
 
+    def __lt__(self, other):
+        return self.repo.name < other.repo.name
+
+    @staticmethod
+    def load_from_csv(config: FetchConfig, row: Dict[str, str]) -> 'PluginDesc':
+        branch = row["branch"]
+        repo = make_repo(row['repo'], branch.strip())
+        repo.token = config.github_token
+        return PluginDesc(repo, branch.strip(), row["alias"])
+
+
+    @staticmethod
+    def load_from_string(config: FetchConfig, line: str) -> 'PluginDesc':
+        branch = "HEAD"
+        alias = None
+        uri = line
+        if " as " in uri:
+            uri, alias = uri.split(" as ")
+            alias = alias.strip()
+        if "@" in uri:
+            uri, branch = uri.split("@")
+        repo = make_repo(uri.strip(), branch.strip())
+        repo.token = config.github_token
+        return PluginDesc(repo, branch.strip(), alias)
 
+@dataclass
 class Plugin:
-    def __init__(
-        self,
-        name: str,
-        commit: str,
-        has_submodules: bool,
-        sha256: str,
-        date: Optional[datetime] = None,
-    ) -> None:
-        self.name = name
-        self.commit = commit
-        self.has_submodules = has_submodules
-        self.sha256 = sha256
-        self.date = date
+    name: str
+    commit: str
+    has_submodules: bool
+    sha256: str
+    date: Optional[datetime] = None
 
     @property
     def normalized_name(self) -> str:
@@ -270,6 +298,17 @@ class Plugin:
         return copy
 
 
+def load_plugins_from_csv(config: FetchConfig, input_file: Path,) -> List[PluginDesc]:
+    log.debug("Load plugins from csv %s", input_file)
+    plugins = []
+    with open(input_file, newline='') as csvfile:
+        log.debug("Writing into %s", input_file)
+        reader = csv.DictReader(csvfile,)
+        for line in reader:
+            plugin = PluginDesc.load_from_csv(config, line)
+            plugins.append(plugin)
+
+    return plugins
 
 class Editor:
     """The configuration of the update script."""
@@ -298,14 +337,8 @@ class Editor:
         return get_current_plugins(self)
 
     def load_plugin_spec(self, config: FetchConfig, plugin_file) -> List[PluginDesc]:
-        plugins = []
-        with open(plugin_file) as f:
-            for line in f:
-                if line.startswith("#"):
-                    continue
-                plugin = parse_plugin_line(config, line)
-                plugins.append(plugin)
-        return plugins
+        '''CSV spec'''
+        return load_plugins_from_csv(config, plugin_file)
 
     def generate_nix(self, plugins, outfile: str):
         '''Returns nothing for now, writes directly to outfile'''
@@ -316,11 +349,11 @@ class Editor:
         _prefetch = functools.partial(prefetch, cache=cache)
 
         def update() -> dict:
-            plugin_names = self.load_plugin_spec(config, input_file)
+            plugins = self.load_plugin_spec(config, input_file)
 
             try:
                 pool = Pool(processes=config.proc)
-                results = pool.map(_prefetch, plugin_names)
+                results = pool.map(_prefetch, plugins)
             finally:
                 cache.store()
 
@@ -423,6 +456,7 @@ def get_current_plugins(editor: Editor) -> List[Plugin]:
     data = json.loads(out)
     plugins = []
     for name, attr in data.items():
+        print("get_current_plugins: name %s" % name)
         p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"])
         plugins.append(p)
     return plugins
@@ -431,7 +465,7 @@ def get_current_plugins(editor: Editor) -> List[Plugin]:
 def prefetch_plugin(
     p: PluginDesc,
     cache: "Optional[Cache]" = None,
-) -> Tuple[Plugin, Dict[str, str]]:
+) -> Tuple[Plugin, Redirects]:
     repo, branch, alias = p.repo, p.branch, p.alias
     name = alias or p.repo.name
     commit = None
@@ -454,11 +488,6 @@ def prefetch_plugin(
     )
 
 
-def fetch_plugin_from_pluginline(config: FetchConfig, plugin_line: str) -> Plugin:
-    plugin, _ = prefetch_plugin(parse_plugin_line(config, plugin_line))
-    return plugin
-
-
 def print_download_error(plugin: str, ex: Exception):
     print(f"{plugin}: {ex}", file=sys.stderr)
     ex_traceback = ex.__traceback__
@@ -468,14 +497,14 @@ def print_download_error(plugin: str, ex: Exception):
     ]
     print("\n".join(tb_lines))
 
-
 def check_results(
-    results: List[Tuple[PluginDesc, Union[Exception, Plugin], Dict[str, str]]]
-) -> Tuple[List[Tuple[PluginDesc, Plugin]], Dict[str, str]]:
+    results: List[Tuple[PluginDesc, Union[Exception, Plugin], Redirects]]
+) -> Tuple[List[Tuple[PluginDesc, Plugin]], Redirects]:
     ''' '''
     failures: List[Tuple[str, Exception]] = []
     plugins = []
-    redirects: Dict[str, str] = {}
+    # {old: new} plugindesc
+    redirects: Dict[Repo, Repo] = {}
     for (pdesc, result, redirect) in results:
         if isinstance(result, Exception):
             failures.append((pdesc.name, result))
@@ -495,31 +524,17 @@ def check_results(
 
         sys.exit(1)
 
-def make_repo(uri, branch, alias) -> Repo:
+def make_repo(uri: str, branch) -> Repo:
     '''Instantiate a Repo with the correct specialization depending on server (gitub spec)'''
     # dumb check to see if it's of the form owner/repo (=> github) or https://...
-    res = uri.split('/')
-    if len(res) <= 2:
-        repo = RepoGitHub(res[0], res[1], branch, alias)
+    res = urlparse(uri)
+    if res.netloc in [ "github.com", ""]:
+        res = res.path.strip('/').split('/')
+        repo = RepoGitHub(res[0], res[1], branch)
     else:
-        repo = Repo(uri.strip(), branch, alias)
+        repo = Repo(uri.strip(), branch)
     return repo
 
-def parse_plugin_line(config: FetchConfig, line: str) -> PluginDesc:
-    branch = "HEAD"
-    alias = None
-    uri = line
-    if " as " in uri:
-        uri, alias = uri.split(" as ")
-        alias = alias.strip()
-    if "@" in uri:
-        uri, branch = uri.split("@")
-
-    repo = make_repo(uri.strip(), branch.strip(), alias)
-    repo.token = config.github_token
-
-    return PluginDesc(repo, branch.strip(), alias)
-
 
 def get_cache_path(cache_file_name: str) -> Optional[Path]:
     xdg_cache = os.environ.get("XDG_CACHE_HOME", None)
@@ -585,27 +600,27 @@ def prefetch(
         return (pluginDesc, e, {})
 
 
+
 def rewrite_input(
     config: FetchConfig,
     input_file: Path,
     deprecated: Path,
-    redirects: Dict[str, str] = None,
-    append: Tuple = (),
+    # old pluginDesc and the new
+    redirects: Dict[PluginDesc, PluginDesc] = {},
+    append: List[PluginDesc] = [],
 ):
-    with open(input_file, "r") as f:
-        lines = f.readlines()
+    plugins = load_plugins_from_csv(config, input_file,)
 
-    lines.extend(append)
+    plugins.extend(append)
 
     if redirects:
-        lines = [redirects.get(line, line) for line in lines]
 
         cur_date_iso = datetime.now().strftime("%Y-%m-%d")
         with open(deprecated, "r") as f:
             deprecations = json.load(f)
         for old, new in redirects.items():
-            old_plugin = fetch_plugin_from_pluginline(config, old)
-            new_plugin = fetch_plugin_from_pluginline(config, new)
+            old_plugin, _ = prefetch_plugin(old)
+            new_plugin, _ = prefetch_plugin(new)
             if old_plugin.normalized_name != new_plugin.normalized_name:
                 deprecations[old_plugin.normalized_name] = {
                     "new": new_plugin.normalized_name,
@@ -615,10 +630,14 @@ def rewrite_input(
             json.dump(deprecations, f, indent=4, sort_keys=True)
             f.write("\n")
 
-    lines = sorted(lines, key=str.casefold)
-
     with open(input_file, "w") as f:
-        f.writelines(lines)
+        log.debug("Writing into %s", input_file)
+        # fields = dataclasses.fields(PluginDesc)
+        fieldnames = ['repo', 'branch', 'alias']
+        writer = csv.DictWriter(f, fieldnames, dialect='unix', quoting=csv.QUOTE_NONE)
+        writer.writeheader()
+        for plugin in sorted(plugins):
+            writer.writerow(asdict(plugin))
 
 
 def commit(repo: git.Repo, message: str, files: List[Path]) -> None:
@@ -660,9 +679,11 @@ def update_plugins(editor: Editor, args):
             )
 
     for plugin_line in args.add_plugins:
-        editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=(plugin_line + "\n",))
+        pdesc = PluginDesc.load_from_string(fetch_config, plugin_line)
+        append = [ pdesc ]
+        editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=append)
         update()
-        plugin = fetch_plugin_from_pluginline(fetch_config, plugin_line)
+        plugin, _ = prefetch_plugin(pdesc, )
         if autocommit:
             commit(
                 nixpkgs_repo,
diff --git a/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml b/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml
index f54f6129e0d..910cad467e9 100644
--- a/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml
+++ b/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml
@@ -866,6 +866,14 @@
           package.
         </para>
       </listitem>
+      <listitem>
+        <para>
+          The vim/kakoune plugin updater now reads from a CSV file:
+          check
+          <literal>pkgs/applications/editors/vim/plugins/vim-plugin-names</literal>
+          out to see the new format
+        </para>
+      </listitem>
     </itemizedlist>
   </section>
 </section>
diff --git a/nixos/doc/manual/release-notes/rl-1803.section.md b/nixos/doc/manual/release-notes/rl-1803.section.md
index e4e46798104..c5146015d44 100644
--- a/nixos/doc/manual/release-notes/rl-1803.section.md
+++ b/nixos/doc/manual/release-notes/rl-1803.section.md
@@ -282,3 +282,5 @@ When upgrading from a previous release, please be aware of the following incompa
 - The NixOS test driver supports user services declared by `systemd.user.services`. The methods `waitForUnit`, `getUnitInfo`, `startJob` and `stopJob` provide an optional `$user` argument for that purpose.
 
 - Enabling bash completion on NixOS, `programs.bash.enableCompletion`, will now also enable completion for the Nix command line tools by installing the [nix-bash-completions](https://github.com/hedning/nix-bash-completions) package.
+
+- The vim/kakoune plugin updater now reads from a CSV file: check `pkgs/applications/editors/vim/plugins/vim-plugin-names` out to see the new format
diff --git a/nixos/lib/make-disk-image.nix b/nixos/lib/make-disk-image.nix
index 15302ae8241..e784ec9e677 100644
--- a/nixos/lib/make-disk-image.nix
+++ b/nixos/lib/make-disk-image.nix
@@ -170,6 +170,7 @@ let format' = format; in let
       config.system.build.nixos-install
       config.system.build.nixos-enter
       nix
+      systemdMinimal
     ] ++ stdenv.initialPath);
 
   # I'm preserving the line below because I'm going to search for it across nixpkgs to consolidate
diff --git a/nixos/modules/system/boot/systemd/initrd.nix b/nixos/modules/system/boot/systemd/initrd.nix
index c87cddc6914..c383486bb0b 100644
--- a/nixos/modules/system/boot/systemd/initrd.nix
+++ b/nixos/modules/system/boot/systemd/initrd.nix
@@ -108,7 +108,7 @@ let
 
   fileSystems = filter utils.fsNeededForBoot config.system.build.fileSystems;
 
-  fstab = pkgs.writeText "fstab" (lib.concatMapStringsSep "\n"
+  fstab = pkgs.writeText "initrd-fstab" (lib.concatMapStringsSep "\n"
     ({ fsType, mountPoint, device, options, autoFormat, autoResize, ... }@fs: let
         opts = options ++ optional autoFormat "x-systemd.makefs" ++ optional autoResize "x-systemd.growfs";
       in "${device} /sysroot${mountPoint} ${fsType} ${lib.concatStringsSep "," opts}") fileSystems);
@@ -128,11 +128,7 @@ let
     name = "initrd-emergency-env";
     paths = map getBin cfg.initrdBin;
     pathsToLink = ["/bin" "/sbin"];
-    # Make recovery easier
-    postBuild = ''
-      ln -s ${cfg.package.util-linux}/bin/mount $out/bin/
-      ln -s ${cfg.package.util-linux}/bin/umount $out/bin/
-    '';
+    postBuild = concatStringsSep "\n" (mapAttrsToList (n: v: "ln -s '${v}' $out/bin/'${n}'") cfg.extraBin);
   };
 
   initialRamdisk = pkgs.makeInitrdNG {
@@ -205,6 +201,19 @@ in {
       default = [];
     };
 
+    extraBin = mkOption {
+      description = ''
+        Tools to add to /bin
+      '';
+      example = literalExpression ''
+        {
+          umount = ''${pkgs.util-linux}/bin/umount;
+        }
+      '';
+      type = types.attrsOf types.path;
+      default = {};
+    };
+
     suppressedStorePaths = mkOption {
       description = ''
         Store paths specified in the storePaths option that
@@ -342,8 +351,15 @@ in {
 
   config = mkIf (config.boot.initrd.enable && cfg.enable) {
     system.build = { inherit initialRamdisk; };
+
+    boot.initrd.availableKernelModules = [ "autofs4" ]; # systemd needs this for some features
+
     boot.initrd.systemd = {
       initrdBin = [pkgs.bash pkgs.coreutils pkgs.kmod cfg.package] ++ config.system.fsPackages;
+      extraBin = {
+        mount = "${cfg.package.util-linux}/bin/mount";
+        umount = "${cfg.package.util-linux}/bin/umount";
+      };
 
       contents = {
         "/init".source = "${cfg.package}/lib/systemd/systemd";
diff --git a/nixos/tests/docker-tools-cross.nix b/nixos/tests/docker-tools-cross.nix
index a7a6a31475d..8791ec25812 100644
--- a/nixos/tests/docker-tools-cross.nix
+++ b/nixos/tests/docker-tools-cross.nix
@@ -7,7 +7,7 @@ import ./make-test-python.nix ({ pkgs, ... }:
 let
 
   remoteSystem =
-    if pkgs.system == "aarch64-linux"
+    if pkgs.stdenv.hostPlatform.system == "aarch64-linux"
     then "x86_64-linux"
     else "aarch64-linux";
 
@@ -18,7 +18,7 @@ let
 
     # NOTE: Since this file can't control where the test will be _run_ we don't
     #       cross-compile _to_ a different system but _from_ a different system
-    crossSystem = pkgs.system;
+    crossSystem = pkgs.stdenv.hostPlatform.system;
   };
 
   hello1 = remoteCrossPkgs.dockerTools.buildImage {
diff --git a/nixos/tests/docker-tools.nix b/nixos/tests/docker-tools.nix
index 8a240ddb17f..80859ac7a96 100644
--- a/nixos/tests/docker-tools.nix
+++ b/nixos/tests/docker-tools.nix
@@ -315,7 +315,7 @@ import ./make-test-python.nix ({ pkgs, ... }: {
                 "docker inspect ${pkgs.dockerTools.examples.cross.imageName} "
                 + "| ${pkgs.jq}/bin/jq -r .[].Architecture"
             ).strip()
-            == "${if pkgs.system == "aarch64-linux" then "amd64" else "arm64"}"
+            == "${if pkgs.stdenv.hostPlatform.system == "aarch64-linux" then "amd64" else "arm64"}"
         )
 
     with subtest("buildLayeredImage doesn't dereference /nix/store symlink layers"):
diff --git a/nixos/tests/vaultwarden.nix b/nixos/tests/vaultwarden.nix
index 56f1d245d50..814d8d7c0ab 100644
--- a/nixos/tests/vaultwarden.nix
+++ b/nixos/tests/vaultwarden.nix
@@ -113,7 +113,6 @@ let
                   driver.find_element_by_css_selector('input#masterPasswordRetype').send_keys(
                     '${userPassword}'
                   )
-                  driver.find_element_by_css_selector('input#acceptPolicies').click()
 
                   driver.find_element_by_xpath("//button[contains(., 'Submit')]").click()
 
diff --git a/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names b/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names
index 6cf7d30f274..a6cae7a4505 100644
--- a/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names
+++ b/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names
@@ -1,19 +1,20 @@
-alexherbo2/auto-pairs.kak
-alexherbo2/replace-mode.kak
-alexherbo2/sleuth.kak
-andreyorst/fzf.kak
-andreyorst/powerline.kak
-basbebe/pandoc.kak
-danr/kakoune-easymotion
-Delapouite/kakoune-buffers
-Delapouite/kakoune-registers
-enricozb/tabs.kak@main
-greenfork/active-window.kak
-kakoune-editor/kakoune-extra-filetypes
-kakounedotcom/connect.kak
-kakounedotcom/prelude.kak
-lePerdu/kakboard
-listentolist/kakoune-rainbow
-mayjs/openscad.kak
-occivink/kakoune-buffer-switcher
-occivink/kakoune-vertical-selection
+repo,branch,alias
+alexherbo2/auto-pairs.kak,,
+alexherbo2/replace-mode.kak,,
+alexherbo2/sleuth.kak,,
+andreyorst/fzf.kak,,
+andreyorst/powerline.kak,,
+basbebe/pandoc.kak,,
+danr/kakoune-easymotion,,
+Delapouite/kakoune-buffers,,
+Delapouite/kakoune-registers,,
+enricozb/tabs.kak@main,,
+greenfork/active-window.kak,,
+kakoune-editor/kakoune-extra-filetypes,,
+kakounedotcom/connect.kak,,
+kakounedotcom/prelude.kak,,
+lePerdu/kakboard,,
+listentolist/kakoune-rainbow,,
+mayjs/openscad.kak,,
+occivink/kakoune-buffer-switcher,,
+occivink/kakoune-vertical-selection,,
diff --git a/pkgs/applications/editors/vim/plugins/generated.nix b/pkgs/applications/editors/vim/plugins/generated.nix
index 92578520b98..c62140c66a1 100644
--- a/pkgs/applications/editors/vim/plugins/generated.nix
+++ b/pkgs/applications/editors/vim/plugins/generated.nix
@@ -3,6 +3,451 @@
 
 final: prev:
 {
+  BetterLua-vim = buildVimPluginFrom2Nix {
+    pname = "BetterLua.vim";
+    version = "2020-08-14";
+    src = fetchFromGitHub {
+      owner = "euclidianAce";
+      repo = "BetterLua.vim";
+      rev = "d2d6c115575d09258a794a6f20ac60233eee59d5";
+      sha256 = "1rvlx21kw8865dg6q97hx9i2s1n8mn1nyhn0m7dkx625pghsx3js";
+    };
+    meta.homepage = "https://github.com/euclidianAce/BetterLua.vim/";
+  };
+
+  BufOnly-vim = buildVimPluginFrom2Nix {
+    pname = "BufOnly.vim";
+    version = "2010-10-18";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "BufOnly.vim";
+      rev = "43dd92303979bdb234a3cb2f5662847f7a3affe7";
+      sha256 = "1gvpaqvvxjma0dl1zai68bpv42608api4054appwkw9pgczkkcdl";
+    };
+    meta.homepage = "https://github.com/vim-scripts/BufOnly.vim/";
+  };
+
+  CheckAttach = buildVimPluginFrom2Nix {
+    pname = "CheckAttach";
+    version = "2019-05-08";
+    src = fetchFromGitHub {
+      owner = "chrisbra";
+      repo = "CheckAttach";
+      rev = "8f0b1350431d1d34655a147e6f1cfe6cb5dda5f7";
+      sha256 = "1z9a40nbdjd3pnp28nfsi2bijsbaiphc0ia816f5flkchn07gmmj";
+    };
+    meta.homepage = "https://github.com/chrisbra/CheckAttach/";
+  };
+
+  Colour-Sampler-Pack = buildVimPluginFrom2Nix {
+    pname = "Colour-Sampler-Pack";
+    version = "2012-11-30";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "Colour-Sampler-Pack";
+      rev = "05cded87b2ef29aaa9e930230bb88e23abff4441";
+      sha256 = "03v2r18sfgs0xbgy9p56pxfdg0lsk6m7wyr5hw63wm1nzpwiipg3";
+    };
+    meta.homepage = "https://github.com/vim-scripts/Colour-Sampler-Pack/";
+  };
+
+  Coqtail = buildVimPluginFrom2Nix {
+    pname = "Coqtail";
+    version = "2022-03-28";
+    src = fetchFromGitHub {
+      owner = "whonore";
+      repo = "Coqtail";
+      rev = "cb8f43b2f09f3d41e2821e458901666a82a61298";
+      sha256 = "0h5r0r7hh4g7p874l7fajq30k4z3a88vm3db6583q611h9bwcfrf";
+    };
+    meta.homepage = "https://github.com/whonore/Coqtail/";
+  };
+
+  DoxygenToolkit-vim = buildVimPluginFrom2Nix {
+    pname = "DoxygenToolkit.vim";
+    version = "2010-11-06";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "DoxygenToolkit.vim";
+      rev = "afd8663d36d2ec19d26befdb10e89e912d26bbd3";
+      sha256 = "1za8li02j4nhqjjsyxg4p78638h5af4izim37zc0p1x55zr3i85r";
+    };
+    meta.homepage = "https://github.com/vim-scripts/DoxygenToolkit.vim/";
+  };
+
+  FTerm-nvim = buildVimPluginFrom2Nix {
+    pname = "FTerm.nvim";
+    version = "2022-03-13";
+    src = fetchFromGitHub {
+      owner = "numToStr";
+      repo = "FTerm.nvim";
+      rev = "233633a5f6fe8398187a4eba93eba0828ef3d5f3";
+      sha256 = "0sxnii921xia4mrf67qz7ichi9xqr9zf193hb9dx199l7hl6k1p8";
+    };
+    meta.homepage = "https://github.com/numToStr/FTerm.nvim/";
+  };
+
+  FixCursorHold-nvim = buildVimPluginFrom2Nix {
+    pname = "FixCursorHold.nvim";
+    version = "2022-02-17";
+    src = fetchFromGitHub {
+      owner = "antoinemadec";
+      repo = "FixCursorHold.nvim";
+      rev = "1bfb32e7ba1344925ad815cb0d7f901dbc0ff7c1";
+      sha256 = "0b1iffk6pa2zwd9fvlgqli72r8qj74b7hqkhlw6awhc7r1qj8m1q";
+    };
+    meta.homepage = "https://github.com/antoinemadec/FixCursorHold.nvim/";
+  };
+
+  Improved-AnsiEsc = buildVimPluginFrom2Nix {
+    pname = "Improved-AnsiEsc";
+    version = "2015-08-26";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "Improved-AnsiEsc";
+      rev = "e1c59a8e9203fab6b9150721f30548916da73351";
+      sha256 = "1smjs4kz2kmzprzp9az4957675nakb43146hshbby39j5xz4jsbz";
+    };
+    meta.homepage = "https://github.com/vim-scripts/Improved-AnsiEsc/";
+  };
+
+  Jenkinsfile-vim-syntax = buildVimPluginFrom2Nix {
+    pname = "Jenkinsfile-vim-syntax";
+    version = "2021-01-26";
+    src = fetchFromGitHub {
+      owner = "martinda";
+      repo = "Jenkinsfile-vim-syntax";
+      rev = "0d05729168ea44d60862f17cffa80024ab30bcc9";
+      sha256 = "05z30frs4f5z0l4qgxk08r7mb19bzhqs36hi213yin78cz62b9gy";
+    };
+    meta.homepage = "https://github.com/martinda/Jenkinsfile-vim-syntax/";
+  };
+
+  LanguageClient-neovim = buildVimPluginFrom2Nix {
+    pname = "LanguageClient-neovim";
+    version = "2020-12-10";
+    src = fetchFromGitHub {
+      owner = "autozimu";
+      repo = "LanguageClient-neovim";
+      rev = "a42594c9c320b1283e9b9058b85a8097d8325fed";
+      sha256 = "0lj9na3g2cl0vj56jz8rhz9lm2d3xps5glk8ds491i2ixy4vdm37";
+    };
+    meta.homepage = "https://github.com/autozimu/LanguageClient-neovim/";
+  };
+
+  LanguageTool-nvim = buildVimPluginFrom2Nix {
+    pname = "LanguageTool.nvim";
+    version = "2020-10-19";
+    src = fetchFromGitHub {
+      owner = "vigoux";
+      repo = "LanguageTool.nvim";
+      rev = "809e7d77fec834597f495fec737c59292a10025b";
+      sha256 = "1g12dz85xq8qd92dgna0a3w6zgxa74njlvmvly4k20610r63bzrn";
+    };
+    meta.homepage = "https://github.com/vigoux/LanguageTool.nvim/";
+  };
+
+  LeaderF = buildVimPluginFrom2Nix {
+    pname = "LeaderF";
+    version = "2022-04-03";
+    src = fetchFromGitHub {
+      owner = "Yggdroot";
+      repo = "LeaderF";
+      rev = "cc21177618270255e4181dfa1ade52abebb71c23";
+      sha256 = "0i1dgvn3s0d4k84avb4yz28hm05v3n0krq9clizxg8vi24g58lci";
+    };
+    meta.homepage = "https://github.com/Yggdroot/LeaderF/";
+  };
+
+  MatchTagAlways = buildVimPluginFrom2Nix {
+    pname = "MatchTagAlways";
+    version = "2017-05-20";
+    src = fetchFromGitHub {
+      owner = "Valloric";
+      repo = "MatchTagAlways";
+      rev = "352eb479a4ad1608e0880b79ab2357aac2cf4bed";
+      sha256 = "0y8gq4cs0wm2ijagc2frpmm664z355iridxyl5893576v5aqp8z1";
+    };
+    meta.homepage = "https://github.com/Valloric/MatchTagAlways/";
+  };
+
+  Navigator-nvim = buildVimPluginFrom2Nix {
+    pname = "Navigator.nvim";
+    version = "2022-03-28";
+    src = fetchFromGitHub {
+      owner = "numToStr";
+      repo = "Navigator.nvim";
+      rev = "6c50f278482dc5388743cb5c6eddb146059252f9";
+      sha256 = "1qr2blrr6ihr1adld1cyc98b64s2s4y2876bmlbxg4q17y1zv3l6";
+    };
+    meta.homepage = "https://github.com/numToStr/Navigator.nvim/";
+  };
+
+  NeoSolarized = buildVimPluginFrom2Nix {
+    pname = "NeoSolarized";
+    version = "2020-08-07";
+    src = fetchFromGitHub {
+      owner = "overcache";
+      repo = "NeoSolarized";
+      rev = "b94b1a9ad51e2de015266f10fdc6e142f97bd617";
+      sha256 = "019nz56yirpg1ahg8adfafrxznalw056qwm3xjm9kzg6da8j6v48";
+    };
+    meta.homepage = "https://github.com/overcache/NeoSolarized/";
+  };
+
+  NrrwRgn = buildVimPluginFrom2Nix {
+    pname = "NrrwRgn";
+    version = "2022-02-13";
+    src = fetchFromGitHub {
+      owner = "chrisbra";
+      repo = "NrrwRgn";
+      rev = "e027db9d94f94947153cd7b5ac9abd04371ab2b0";
+      sha256 = "0mcwyqbfc2m865w44s96ra2k0v1mn5kkkxf8i71iqhvc7fvnrfah";
+    };
+    meta.homepage = "https://github.com/chrisbra/NrrwRgn/";
+  };
+
+  PreserveNoEOL = buildVimPluginFrom2Nix {
+    pname = "PreserveNoEOL";
+    version = "2013-06-14";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "PreserveNoEOL";
+      rev = "940e3ce90e54d8680bec1135a21dcfbd6c9bfb62";
+      sha256 = "1726jpr2zf6jrb00pp082ikbx4mll3a877pnzs6i18f9fgpaqqgd";
+    };
+    meta.homepage = "https://github.com/vim-scripts/PreserveNoEOL/";
+  };
+
+  QFEnter = buildVimPluginFrom2Nix {
+    pname = "QFEnter";
+    version = "2020-10-09";
+    src = fetchFromGitHub {
+      owner = "yssl";
+      repo = "QFEnter";
+      rev = "df0a75b287c210f98ae353a12bbfdaf73d858beb";
+      sha256 = "0gdp7nmjlp8ng2rp2v66d8bincnkwrqqpbggb079f0f9szrqlp54";
+    };
+    meta.homepage = "https://github.com/yssl/QFEnter/";
+  };
+
+  Recover-vim = buildVimPluginFrom2Nix {
+    pname = "Recover.vim";
+    version = "2015-08-14";
+    src = fetchFromGitHub {
+      owner = "chrisbra";
+      repo = "Recover.vim";
+      rev = "efa491f6121f65e025f42d79a93081abb8db69d4";
+      sha256 = "17szim82bwnhf9q4n0n4jfmqkmhq6p0lh0j4y77a2x6lkn0pns5s";
+    };
+    meta.homepage = "https://github.com/chrisbra/Recover.vim/";
+  };
+
+  Rename = buildVimPluginFrom2Nix {
+    pname = "Rename";
+    version = "2011-08-31";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "Rename";
+      rev = "b240f28d2ede65fa77cd99fe045efe79202f7a34";
+      sha256 = "1d1myg4zyc281zcc1ba9idbgcgxndb4a0jwqr4yqxhhzdgszw46r";
+    };
+    meta.homepage = "https://github.com/vim-scripts/Rename/";
+  };
+
+  ReplaceWithRegister = buildVimPluginFrom2Nix {
+    pname = "ReplaceWithRegister";
+    version = "2014-10-31";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "ReplaceWithRegister";
+      rev = "832efc23111d19591d495dc72286de2fb0b09345";
+      sha256 = "0mb0sx85j1k59b1zz95r4vkq4kxlb4krhncq70mq7fxrs5bnhq8g";
+    };
+    meta.homepage = "https://github.com/vim-scripts/ReplaceWithRegister/";
+  };
+
+  SchemaStore-nvim = buildVimPluginFrom2Nix {
+    pname = "SchemaStore.nvim";
+    version = "2022-04-01";
+    src = fetchFromGitHub {
+      owner = "b0o";
+      repo = "SchemaStore.nvim";
+      rev = "d423f6c7bbf85c701ce0ce5cfd0f3f340e9419d1";
+      sha256 = "0mcx09j6b6x7f85m5nhv8h9r2p4h92cv4jh94p4j2w0byh6pfz9b";
+    };
+    meta.homepage = "https://github.com/b0o/SchemaStore.nvim/";
+  };
+
+  Shade-nvim = buildVimPluginFrom2Nix {
+    pname = "Shade.nvim";
+    version = "2022-02-01";
+    src = fetchFromGitHub {
+      owner = "sunjon";
+      repo = "Shade.nvim";
+      rev = "4286b5abc47d62d0c9ffb22a4f388b7bf2ac2461";
+      sha256 = "0mb0cnf8065qmjq85hlgb4a1mqk1nwl7966l1imb54hpzw828rzl";
+    };
+    meta.homepage = "https://github.com/sunjon/Shade.nvim/";
+  };
+
+  ShowMultiBase = buildVimPluginFrom2Nix {
+    pname = "ShowMultiBase";
+    version = "2010-10-18";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "ShowMultiBase";
+      rev = "85a39fd12668ce973d3d9282263912b2b8f0d338";
+      sha256 = "0hg5352ahzgh2kwqha5v8ai024fld93xag93hb53wjf5b8nzsz8i";
+    };
+    meta.homepage = "https://github.com/vim-scripts/ShowMultiBase/";
+  };
+
+  SimpylFold = buildVimPluginFrom2Nix {
+    pname = "SimpylFold";
+    version = "2021-11-04";
+    src = fetchFromGitHub {
+      owner = "tmhedberg";
+      repo = "SimpylFold";
+      rev = "b4a87e509c3d873238a39d1c85d0b97d6819f283";
+      sha256 = "0ff5x7ay67wn9c0mi8sb6110i93zrf97c4whg0bd7pr2nmadpvk0";
+    };
+    meta.homepage = "https://github.com/tmhedberg/SimpylFold/";
+  };
+
+  SpaceCamp = buildVimPluginFrom2Nix {
+    pname = "SpaceCamp";
+    version = "2021-04-07";
+    src = fetchFromGitHub {
+      owner = "jaredgorski";
+      repo = "SpaceCamp";
+      rev = "376af5c2204de61726ea86b596acb2dab9795e1f";
+      sha256 = "0h3wxkswd5z9y46d6272sr210i73j5pwf5faw7qhr1plilfgx4gb";
+    };
+    meta.homepage = "https://github.com/jaredgorski/SpaceCamp/";
+  };
+
+  SpaceVim = buildVimPluginFrom2Nix {
+    pname = "SpaceVim";
+    version = "2022-04-03";
+    src = fetchFromGitHub {
+      owner = "SpaceVim";
+      repo = "SpaceVim";
+      rev = "bc5e24c6932f5cdb56520c6fc7e3807cae919fdf";
+      sha256 = "1iz477kmmvw16mxq7mcaqiznqc42p7qiz2dp6bb474c9mp1b3c4a";
+    };
+    meta.homepage = "https://github.com/SpaceVim/SpaceVim/";
+  };
+
+  Spacegray-vim = buildVimPluginFrom2Nix {
+    pname = "Spacegray.vim";
+    version = "2021-07-06";
+    src = fetchFromGitHub {
+      owner = "ackyshake";
+      repo = "Spacegray.vim";
+      rev = "c699ca10ed421c462bd1c87a158faaa570dc8e28";
+      sha256 = "0ma8w6p5jh6llka49x5j5ql8fmhv0bx5hhsn5b2phak79yqg1k61";
+    };
+    meta.homepage = "https://github.com/ackyshake/Spacegray.vim/";
+  };
+
+  SudoEdit-vim = buildVimPluginFrom2Nix {
+    pname = "SudoEdit.vim";
+    version = "2020-02-27";
+    src = fetchFromGitHub {
+      owner = "chrisbra";
+      repo = "SudoEdit.vim";
+      rev = "e203eada5b563e9134ce2aae26b09edae0904fd7";
+      sha256 = "0pf9iix50pw3p430ky51rv11ra1hppdpwa5flzcd5kciybr76n0n";
+    };
+    meta.homepage = "https://github.com/chrisbra/SudoEdit.vim/";
+  };
+
+  TrueZen-nvim = buildVimPluginFrom2Nix {
+    pname = "TrueZen.nvim";
+    version = "2021-10-12";
+    src = fetchFromGitHub {
+      owner = "Pocco81";
+      repo = "TrueZen.nvim";
+      rev = "508b977d71650da5c9243698614a9a1416f116d4";
+      sha256 = "0sr4y1mg83l28l5ias2pv0gxkcgwailfjn2skx35z63f2il3zkbx";
+    };
+    meta.homepage = "https://github.com/Pocco81/TrueZen.nvim/";
+  };
+
+  VimCompletesMe = buildVimPluginFrom2Nix {
+    pname = "VimCompletesMe";
+    version = "2022-02-18";
+    src = fetchFromGitHub {
+      owner = "ackyshake";
+      repo = "VimCompletesMe";
+      rev = "9adf692d7ae6424038458a89d4a411f0a27d1388";
+      sha256 = "1sndgb3291dyifaa8adri2mb8cgbinbar3nw1fnf67k9ahwycaz0";
+    };
+    meta.homepage = "https://github.com/ackyshake/VimCompletesMe/";
+  };
+
+  VimOrganizer = buildVimPluginFrom2Nix {
+    pname = "VimOrganizer";
+    version = "2020-12-15";
+    src = fetchFromGitHub {
+      owner = "hsitz";
+      repo = "VimOrganizer";
+      rev = "09636aed78441a9de2767fcef6d7c567f322cc40";
+      sha256 = "0phpcxmyz562yyp88rbx9pqg46w8r1lyapb700nvxwvqkcd82pfw";
+    };
+    meta.homepage = "https://github.com/hsitz/VimOrganizer/";
+  };
+
+  Vundle-vim = buildVimPluginFrom2Nix {
+    pname = "Vundle.vim";
+    version = "2019-08-17";
+    src = fetchFromGitHub {
+      owner = "VundleVim";
+      repo = "Vundle.vim";
+      rev = "b255382d6242d7ea3877bf059d2934125e0c4d95";
+      sha256 = "0fkmklcq3fgvd6x6irz9bgyvcdaxafykk3k89gsi9p6b0ikw3rw6";
+    };
+    meta.homepage = "https://github.com/VundleVim/Vundle.vim/";
+  };
+
+  YUNOcommit-vim = buildVimPluginFrom2Nix {
+    pname = "YUNOcommit.vim";
+    version = "2014-11-26";
+    src = fetchFromGitHub {
+      owner = "esneider";
+      repo = "YUNOcommit.vim";
+      rev = "981082055a73ef076d7e27477874d2303153a448";
+      sha256 = "0mjc7fn405vcx1n7vadl98p5wgm6jxrlbdbkqgjq8f1m1ir81zab";
+    };
+    meta.homepage = "https://github.com/esneider/YUNOcommit.vim/";
+  };
+
+  YankRing-vim = buildVimPluginFrom2Nix {
+    pname = "YankRing.vim";
+    version = "2015-07-29";
+    src = fetchFromGitHub {
+      owner = "vim-scripts";
+      repo = "YankRing.vim";
+      rev = "28854abef8fa4ebd3cb219aefcf22566997d8f65";
+      sha256 = "0zdp8pdsqgrh6lfw8ipjhrig6psvmdxkim9ik801y3r373sk2hxw";
+    };
+    meta.homepage = "https://github.com/vim-scripts/YankRing.vim/";
+  };
+
+  YouCompleteMe = buildVimPluginFrom2Nix {
+    pname = "YouCompleteMe";
+    version = "2022-04-02";
+    src = fetchFromGitHub {
+      owner = "ycm-core";
+      repo = "YouCompleteMe";
+      rev = "3ededaed2f9923d50bf3860ba8dace0f7d2724cd";
+      sha256 = "1n2h5wsp9vclsvzr40m1ffb6kjmcg0mccfj790giw77qa2i9s1rl";
+      fetchSubmodules = true;
+    };
+    meta.homepage = "https://github.com/ycm-core/YouCompleteMe/";
+  };
+
   a-vim = buildVimPluginFrom2Nix {
     pname = "a.vim";
     version = "2010-11-06";
@@ -41,12 +486,12 @@ final: prev:
 
   aerial-nvim = buildVimPluginFrom2Nix {
     pname = "aerial.nvim";
-    version = "2022-03-24";
+    version = "2022-03-31";
     src = fetchFromGitHub {
       owner = "stevearc";
       repo = "aerial.nvim";
-      rev = "b9f6067529ef123b8ace705ea356869f66aad320";
-      sha256 = "1wcdshvq2nw1dx8xxzplvq519bzzb3qgf7lh0sqafjd19nzgwiji";
+      rev = "0f22463cc1616c0ae7a5a4ad4d81f133035e61c4";
+      sha256 = "0r3my7w1pryqfvzyn32x4063y8cqlx5aps399vv4bq79y60n9rch";
     };
     meta.homepage = "https://github.com/stevearc/aerial.nvim/";
   };
@@ -77,12 +522,12 @@ final: prev:
 
   ale = buildVimPluginFrom2Nix {
     pname = "ale";
-    version = "2022-03-23";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "dense-analysis";
       repo = "ale";
-      rev = "80dcd648d389965603246c2c5a4554e3e4aa184c";
-      sha256 = "1a38q83sgv13aw3iy40mjzkg1wsc5zmf5mmkjqpdcgv5aixyb8m5";
+      rev = "d3df00b89803f1891a772c47fc8eda6a1e9e1baa";
+      sha256 = "0cm374asrkp9nbimp73ljsvaqbc2piqyrmci8n0zshyqq1z6klk2";
     };
     meta.homepage = "https://github.com/dense-analysis/ale/";
   };
@@ -101,12 +546,12 @@ final: prev:
 
   aniseed = buildVimPluginFrom2Nix {
     pname = "aniseed";
-    version = "2022-03-21";
+    version = "2022-03-26";
     src = fetchFromGitHub {
       owner = "Olical";
       repo = "aniseed";
-      rev = "bd79727af8a21037222a08ec9bcaf1c85488aaa4";
-      sha256 = "0l4hvhmf9cgw921956rh97x6aqhjzs2jxsdnk2m38a9fr738hknk";
+      rev = "68ad878e7d7546b291ebff43fd53544b2f6de401";
+      sha256 = "16jsvpfacks2nw4s7qk8qh1xf9jkg6hnvnryp4p2gi0s3x5rfsws";
     };
     meta.homepage = "https://github.com/Olical/aniseed/";
   };
@@ -365,28 +810,16 @@ final: prev:
 
   better-escape-nvim = buildVimPluginFrom2Nix {
     pname = "better-escape.nvim";
-    version = "2022-03-14";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "max397574";
       repo = "better-escape.nvim";
-      rev = "d2efbf0093235525e81f537f8f4e63f23acedf06";
-      sha256 = "1xx23v9jgpzdhyp1diyq0vc36vlxzljx36qnax2cms36kfnc398l";
+      rev = "d5ee0cef56a7e41a86048c14f25e964876ac20c1";
+      sha256 = "04hi2zmaz02fiyvjs94lqn7imp20fn2vpwww37sg7gim18b1mpl4";
     };
     meta.homepage = "https://github.com/max397574/better-escape.nvim/";
   };
 
-  BetterLua-vim = buildVimPluginFrom2Nix {
-    pname = "BetterLua.vim";
-    version = "2020-08-14";
-    src = fetchFromGitHub {
-      owner = "euclidianAce";
-      repo = "BetterLua.vim";
-      rev = "d2d6c115575d09258a794a6f20ac60233eee59d5";
-      sha256 = "1rvlx21kw8865dg6q97hx9i2s1n8mn1nyhn0m7dkx625pghsx3js";
-    };
-    meta.homepage = "https://github.com/euclidianAce/BetterLua.vim/";
-  };
-
   bitbake-vim = buildVimPluginFrom2Nix {
     pname = "bitbake.vim";
     version = "2021-02-06";
@@ -461,28 +894,16 @@ final: prev:
 
   bufferline-nvim = buildVimPluginFrom2Nix {
     pname = "bufferline.nvim";
-    version = "2022-03-21";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "akinsho";
       repo = "bufferline.nvim";
-      rev = "e1202c6569353d03ef0cb3da11b839dba26854dd";
-      sha256 = "1nd5pvbg0yw8jl4rn56dzhabmiwkvlzb8iv595rrkqdb2msdl4qx";
+      rev = "004cd5734fb21e39d48c1fb1469fa63e2797880b";
+      sha256 = "1rr69n4mpkr6ky093fxabf3dcnngam3a01zl71ylvz27lv7gphqh";
     };
     meta.homepage = "https://github.com/akinsho/bufferline.nvim/";
   };
 
-  BufOnly-vim = buildVimPluginFrom2Nix {
-    pname = "BufOnly.vim";
-    version = "2010-10-18";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "BufOnly.vim";
-      rev = "43dd92303979bdb234a3cb2f5662847f7a3affe7";
-      sha256 = "1gvpaqvvxjma0dl1zai68bpv42608api4054appwkw9pgczkkcdl";
-    };
-    meta.homepage = "https://github.com/vim-scripts/BufOnly.vim/";
-  };
-
   calendar-vim = buildVimPluginFrom2Nix {
     pname = "calendar.vim";
     version = "2022-03-21";
@@ -507,18 +928,6 @@ final: prev:
     meta.homepage = "https://github.com/bkad/camelcasemotion/";
   };
 
-  catppuccin-nvim = buildVimPluginFrom2Nix {
-    pname = "catppuccin-nvim";
-    version = "2022-03-20";
-    src = fetchFromGitHub {
-      owner = "catppuccin";
-      repo = "nvim";
-      rev = "f079dda3dc23450d69b4bad11bfbd9af2c77f6f3";
-      sha256 = "1w0n96fbrkm3vdl64v1yzkly8wpcn5g9qflmpb8r1ww9hhig7a38";
-    };
-    meta.homepage = "https://github.com/catppuccin/nvim/";
-  };
-
   caw-vim = buildVimPluginFrom2Nix {
     pname = "caw.vim";
     version = "2021-09-20";
@@ -531,18 +940,6 @@ final: prev:
     meta.homepage = "https://github.com/tyru/caw.vim/";
   };
 
-  chadtree = buildVimPluginFrom2Nix {
-    pname = "chadtree";
-    version = "2022-03-24";
-    src = fetchFromGitHub {
-      owner = "ms-jpq";
-      repo = "chadtree";
-      rev = "e9606bfa350f277d54a61742d560e6122dc4d32c";
-      sha256 = "1vyg48ghr8fd15fh41pk5qlgngdqkw8gwhkkyq9hbvs2mxw8x80c";
-    };
-    meta.homepage = "https://github.com/ms-jpq/chadtree/";
-  };
-
   changeColorScheme-vim = buildVimPluginFrom2Nix {
     pname = "changeColorScheme.vim";
     version = "2010-10-18";
@@ -567,18 +964,6 @@ final: prev:
     meta.homepage = "https://github.com/sudormrfbin/cheatsheet.nvim/";
   };
 
-  CheckAttach = buildVimPluginFrom2Nix {
-    pname = "CheckAttach";
-    version = "2019-05-08";
-    src = fetchFromGitHub {
-      owner = "chrisbra";
-      repo = "CheckAttach";
-      rev = "8f0b1350431d1d34655a147e6f1cfe6cb5dda5f7";
-      sha256 = "1z9a40nbdjd3pnp28nfsi2bijsbaiphc0ia816f5flkchn07gmmj";
-    };
-    meta.homepage = "https://github.com/chrisbra/CheckAttach/";
-  };
-
   ci_dark = buildVimPluginFrom2Nix {
     pname = "ci_dark";
     version = "2022-03-27";
@@ -821,12 +1206,12 @@ final: prev:
 
   cmp-tabnine = buildVimPluginFrom2Nix {
     pname = "cmp-tabnine";
-    version = "2022-01-26";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "tzachar";
       repo = "cmp-tabnine";
-      rev = "2a051347190a22b738e9784426199b9db745e1da";
-      sha256 = "1z3imhw4jgswd957aqhf1yf5dihb1k9dfd22abshziv45fb0fggy";
+      rev = "a436b4af861e33ab9281a32cf0369404a3dcdf9f";
+      sha256 = "0sqd98qz1ydp9wafnhmnndjx75cm06n27aq24cddnifrxp412f57";
     };
     meta.homepage = "https://github.com/tzachar/cmp-tabnine/";
   };
@@ -881,12 +1266,12 @@ final: prev:
 
   cmp_luasnip = buildVimPluginFrom2Nix {
     pname = "cmp_luasnip";
-    version = "2022-03-26";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "saadparwaiz1";
       repo = "cmp_luasnip";
-      rev = "85f2767842a35064f61128b71b8dab1e38c413c4";
-      sha256 = "13s04x9vx3n854q9abb0knls5aycxigbwqgllfmp2xgaycgxqksa";
+      rev = "b10829736542e7cc9291e60bab134df1273165c9";
+      sha256 = "1qygdas99m7py98rqxyza88lmk2as8yi9khjac603x6anxmq766l";
     };
     meta.homepage = "https://github.com/saadparwaiz1/cmp_luasnip/";
   };
@@ -987,18 +1372,6 @@ final: prev:
     meta.homepage = "https://github.com/iamcco/coc-tailwindcss/";
   };
 
-  coc-nvim = buildVimPluginFrom2Nix {
-    pname = "coc.nvim";
-    version = "2022-03-26";
-    src = fetchFromGitHub {
-      owner = "neoclide";
-      repo = "coc.nvim";
-      rev = "16e74f9b31d20b8dfc8933132beed4c175d824ea";
-      sha256 = "0nrfm8517fz31qrg0gfh888q7wcbxxkbpcp39ycvwkdfxpq1bzwr";
-    };
-    meta.homepage = "https://github.com/neoclide/coc.nvim/";
-  };
-
   codi-vim = buildVimPluginFrom2Nix {
     pname = "codi.vim";
     version = "2022-03-20";
@@ -1035,18 +1408,6 @@ final: prev:
     meta.homepage = "https://github.com/lilydjwg/colorizer/";
   };
 
-  Colour-Sampler-Pack = buildVimPluginFrom2Nix {
-    pname = "Colour-Sampler-Pack";
-    version = "2012-11-30";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "Colour-Sampler-Pack";
-      rev = "05cded87b2ef29aaa9e930230bb88e23abff4441";
-      sha256 = "03v2r18sfgs0xbgy9p56pxfdg0lsk6m7wyr5hw63wm1nzpwiipg3";
-    };
-    meta.homepage = "https://github.com/vim-scripts/Colour-Sampler-Pack/";
-  };
-
   command-t = buildVimPluginFrom2Nix {
     pname = "command-t";
     version = "2022-02-25";
@@ -1062,12 +1423,12 @@ final: prev:
 
   comment-nvim = buildVimPluginFrom2Nix {
     pname = "comment.nvim";
-    version = "2022-03-25";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "numtostr";
       repo = "comment.nvim";
-      rev = "03b2a8f81102f2994f4888760e0f08385d841c3f";
-      sha256 = "1ilzpdyis41p1x6wbkavjpva5hvxclagw6hjn76vpmwibnz99pfy";
+      rev = "0aaea32f27315e2a99ba4c12ab9def5cbb4842e4";
+      sha256 = "17vs6k71x6j6gzs1xhsvsmwh2lvpvwgshi2axg9b6ad20wv2v4dr";
     };
     meta.homepage = "https://github.com/numtostr/comment.nvim/";
   };
@@ -1206,12 +1567,12 @@ final: prev:
 
   conjure = buildVimPluginFrom2Nix {
     pname = "conjure";
-    version = "2022-02-15";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "Olical";
       repo = "conjure";
-      rev = "6c53d863c0843be0f68a138def146d6b8f725b22";
-      sha256 = "1f5z99ac72433f2nj714fk6xd76mq7yr5i5z1afwgrhx61zbwn5h";
+      rev = "0c85b2ecce542ce8ee336bf01f433950cf51f31e";
+      sha256 = "15nqxzf2q8iwkc3b09crd66cb38cnh2sv4q49vv9x6nkxar69hgc";
     };
     meta.homepage = "https://github.com/Olical/conjure/";
   };
@@ -1254,28 +1615,16 @@ final: prev:
 
   coq_nvim = buildVimPluginFrom2Nix {
     pname = "coq_nvim";
-    version = "2022-03-26";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "ms-jpq";
       repo = "coq_nvim";
-      rev = "ad255350b66809d4af3aae75f4fb4dd576a06ab4";
-      sha256 = "17l6ajaj03d5v8abi8m754ypqwhz1nw232n15y8av15ll0pb7gk0";
+      rev = "ed7e610e42ab70ccbfb2fe08fbdd963fe160a00c";
+      sha256 = "1ry1mlcayanmhnlki4ifpkia889adp8rv8kx46k80i9lnpm1mhrq";
     };
     meta.homepage = "https://github.com/ms-jpq/coq_nvim/";
   };
 
-  Coqtail = buildVimPluginFrom2Nix {
-    pname = "Coqtail";
-    version = "2022-03-25";
-    src = fetchFromGitHub {
-      owner = "whonore";
-      repo = "Coqtail";
-      rev = "7a1cb8fb1cbdf136bba50a22ddcc056e83dc435c";
-      sha256 = "0jj966bansbfzbhbfgyqciis36s7z46n9n8ihy2m7vxynibbf9yp";
-    };
-    meta.homepage = "https://github.com/whonore/Coqtail/";
-  };
-
   cosco-vim = buildVimPluginFrom2Nix {
     pname = "cosco.vim";
     version = "2018-08-07";
@@ -1772,12 +2121,12 @@ final: prev:
 
   diffview-nvim = buildVimPluginFrom2Nix {
     pname = "diffview.nvim";
-    version = "2022-02-21";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "sindrets";
       repo = "diffview.nvim";
-      rev = "cf32c3fcdbc2f6855f6bb883302c9f290e9c3d88";
-      sha256 = "0vikawxr40pkprsn8yzpacs33hfakpb98j5lmpf7sjmvyzkb1x8b";
+      rev = "6d25771128fd0d2ba272261ac84b3e6798b724b9";
+      sha256 = "0d36hqwk9pficiqp3w488g6iy1w167jciy8m8sfx0x5fvybd8rxv";
     };
     meta.homepage = "https://github.com/sindrets/diffview.nvim/";
   };
@@ -1796,48 +2145,24 @@ final: prev:
 
   doki-theme-vim = buildVimPluginFrom2Nix {
     pname = "doki-theme-vim";
-    version = "2022-02-16";
+    version = "2022-03-31";
     src = fetchFromGitHub {
       owner = "doki-theme";
       repo = "doki-theme-vim";
-      rev = "fe7112ce7db0c8c65420e82aabfe7a98be2b538b";
-      sha256 = "07vy5kf7pqsdqsz5jmqj6lm2aizcncfi4j1vmkpnjw9rpp3c733r";
+      rev = "047caeccfe2052d5be42f0e26986c31bd2e0d5f0";
+      sha256 = "0zbq3c25q03frav7scch5sghwa27swbamlrdnvkmiqw1qfk27r72";
     };
     meta.homepage = "https://github.com/doki-theme/doki-theme-vim/";
   };
 
-  DoxygenToolkit-vim = buildVimPluginFrom2Nix {
-    pname = "DoxygenToolkit.vim";
-    version = "2010-11-06";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "DoxygenToolkit.vim";
-      rev = "afd8663d36d2ec19d26befdb10e89e912d26bbd3";
-      sha256 = "1za8li02j4nhqjjsyxg4p78638h5af4izim37zc0p1x55zr3i85r";
-    };
-    meta.homepage = "https://github.com/vim-scripts/DoxygenToolkit.vim/";
-  };
-
-  dracula-vim = buildVimPluginFrom2Nix {
-    pname = "dracula-vim";
-    version = "2022-03-24";
-    src = fetchFromGitHub {
-      owner = "dracula";
-      repo = "vim";
-      rev = "d7723a842a6cfa2f62cf85530ab66eb418521dc2";
-      sha256 = "1qzil8rwpdzf64gq63ds0cf509ldam77l3fz02g1mia5dry75r02";
-    };
-    meta.homepage = "https://github.com/dracula/vim/";
-  };
-
   dressing-nvim = buildVimPluginFrom2Nix {
     pname = "dressing.nvim";
-    version = "2022-03-24";
+    version = "2022-03-31";
     src = fetchFromGitHub {
       owner = "stevearc";
       repo = "dressing.nvim";
-      rev = "31f12fff6e71a14ddce30bfc7ec9b29a2137ccde";
-      sha256 = "0kjx04q2hnbvw68wh3d9li9p9s5d07j308kfhawpnhnmv6g57nzw";
+      rev = "cad08fac5ed6d5e8384d8c0759268e2f6b89b217";
+      sha256 = "0lc04cvq6iasg724zhpzp1j3bhwj4gphvqbzfh41ikzsy8d2jrpy";
     };
     meta.homepage = "https://github.com/stevearc/dressing.nvim/";
   };
@@ -1915,18 +2240,6 @@ final: prev:
     meta.homepage = "https://github.com/dmix/elvish.vim/";
   };
 
-  embark-vim = buildVimPluginFrom2Nix {
-    pname = "embark-vim";
-    version = "2022-03-26";
-    src = fetchFromGitHub {
-      owner = "embark-theme";
-      repo = "vim";
-      rev = "3f7f03aa2ae0d4185792aaf9b960bca0d22c48fd";
-      sha256 = "0gv2ivrwsrhnsr2kh56yj3m1l4ydwq27vllzxa5vkpbb11jydf3d";
-    };
-    meta.homepage = "https://github.com/embark-theme/vim/";
-  };
-
   emmet-vim = buildVimPluginFrom2Nix {
     pname = "emmet-vim";
     version = "2021-12-04";
@@ -2038,12 +2351,12 @@ final: prev:
 
   fern-vim = buildVimPluginFrom2Nix {
     pname = "fern.vim";
-    version = "2022-03-24";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "lambdalisue";
       repo = "fern.vim";
-      rev = "45950d39965150a6c6bff1979303e735460379d0";
-      sha256 = "067aild4sr5zd08fn2dna9ndycf5i4w524kkz88yzhyr7h5rc0w4";
+      rev = "53d8cf7cd96fcde4138ba1ad67971a594b4abbd4";
+      sha256 = "1dicpzqmpxclrv3v48ipk79yfblhlva42kzrl8hxly95isq2kznp";
     };
     meta.homepage = "https://github.com/lambdalisue/fern.vim/";
   };
@@ -2084,18 +2397,6 @@ final: prev:
     meta.homepage = "https://github.com/bogado/file-line/";
   };
 
-  FixCursorHold-nvim = buildVimPluginFrom2Nix {
-    pname = "FixCursorHold.nvim";
-    version = "2022-02-17";
-    src = fetchFromGitHub {
-      owner = "antoinemadec";
-      repo = "FixCursorHold.nvim";
-      rev = "1bfb32e7ba1344925ad815cb0d7f901dbc0ff7c1";
-      sha256 = "0b1iffk6pa2zwd9fvlgqli72r8qj74b7hqkhlw6awhc7r1qj8m1q";
-    };
-    meta.homepage = "https://github.com/antoinemadec/FixCursorHold.nvim/";
-  };
-
   flake8-vim = buildVimPluginFrom2Nix {
     pname = "flake8-vim";
     version = "2020-10-20";
@@ -2147,12 +2448,12 @@ final: prev:
 
   formatter-nvim = buildVimPluginFrom2Nix {
     pname = "formatter.nvim";
-    version = "2022-03-22";
+    version = "2022-03-29";
     src = fetchFromGitHub {
       owner = "mhartington";
       repo = "formatter.nvim";
-      rev = "cc42c16a793cba102ac75574ab187a77995ba06b";
-      sha256 = "1qz87l2da378wcbbck6n9p82apl594x2kxldl4sxhy88rbbqi2vb";
+      rev = "bec8a57d6e990a503e87eb71ae530cd2c1402e31";
+      sha256 = "14llli9s5x58m7z4ay5b9d2pypq378h3i4062rasdqi5c5and07n";
     };
     meta.homepage = "https://github.com/mhartington/formatter.nvim/";
   };
@@ -2193,18 +2494,6 @@ final: prev:
     meta.homepage = "https://github.com/raghur/fruzzy/";
   };
 
-  FTerm-nvim = buildVimPluginFrom2Nix {
-    pname = "FTerm.nvim";
-    version = "2022-03-13";
-    src = fetchFromGitHub {
-      owner = "numToStr";
-      repo = "FTerm.nvim";
-      rev = "233633a5f6fe8398187a4eba93eba0828ef3d5f3";
-      sha256 = "0sxnii921xia4mrf67qz7ichi9xqr9zf193hb9dx199l7hl6k1p8";
-    };
-    meta.homepage = "https://github.com/numToStr/FTerm.nvim/";
-  };
-
   fugitive-gitlab-vim = buildVimPluginFrom2Nix {
     pname = "fugitive-gitlab.vim";
     version = "2021-09-20";
@@ -2339,12 +2628,12 @@ final: prev:
 
   gina-vim = buildVimPluginFrom2Nix {
     pname = "gina.vim";
-    version = "2021-06-12";
+    version = "2022-03-30";
     src = fetchFromGitHub {
       owner = "lambdalisue";
       repo = "gina.vim";
-      rev = "abdbe0fe33f3b6fc59e94f7cc3072768f8dfd8ac";
-      sha256 = "1f3shh6jxr5i1an2dbb1vmc0l2xg03fm6ava25ahxg4b5ka59bc5";
+      rev = "ff6c2ddeca98f886b57fb42283c12e167d6ab575";
+      sha256 = "09jlnpix2dy6kggiz96mrm5l1f9x1gl5afpdmfrxgkighn2rwpzq";
     };
     meta.homepage = "https://github.com/lambdalisue/gina.vim/";
   };
@@ -2411,12 +2700,12 @@ final: prev:
 
   gitsigns-nvim = buildVimPluginFrom2Nix {
     pname = "gitsigns.nvim";
-    version = "2022-03-25";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "lewis6991";
       repo = "gitsigns.nvim";
-      rev = "2a107231d92fa37224efdbc475abfba71f94b5ee";
-      sha256 = "0i17r2c48csff7pl0k1vvc5j61xh3qv4xq6v75raz937w0kj6hfg";
+      rev = "83ab3ca26ff5038f823060dfddda7a053e579b67";
+      sha256 = "1hrzk6nr1w9747h0fn9h5cm1pgx1sw6njyf3pyr7p220gnh87vzp";
     };
     meta.homepage = "https://github.com/lewis6991/gitsigns.nvim/";
   };
@@ -2529,18 +2818,6 @@ final: prev:
     meta.homepage = "https://github.com/morhetz/gruvbox/";
   };
 
-  gruvbox-community = buildVimPluginFrom2Nix {
-    pname = "gruvbox-community";
-    version = "2022-03-06";
-    src = fetchFromGitHub {
-      owner = "gruvbox-community";
-      repo = "gruvbox";
-      rev = "b6f47ae7031f6746a1f1918c17574aa12c474ef0";
-      sha256 = "0m8rrm5v542a2c30sg7hlgm7r6gs4ah1n6nr5dc101l2064kg97g";
-    };
-    meta.homepage = "https://github.com/gruvbox-community/gruvbox/";
-  };
-
   gruvbox-flat-nvim = buildVimPluginFrom2Nix {
     pname = "gruvbox-flat.nvim";
     version = "2022-01-19";
@@ -2603,12 +2880,12 @@ final: prev:
 
   harpoon = buildVimPluginFrom2Nix {
     pname = "harpoon";
-    version = "2022-02-16";
+    version = "2022-03-31";
     src = fetchFromGitHub {
       owner = "ThePrimeagen";
       repo = "harpoon";
-      rev = "b2bb0d6f2b8a55895afda53f0ad04527998d3411";
-      sha256 = "0izsscglfk6lpisxvarr0qw4m9br8854wi6jhyp2msd8r9gcrzi7";
+      rev = "b6a363c037505c30a41042580729dc09e9bd00ed";
+      sha256 = "0v917h34fha7ww2shrnwaqajp5f0s6qb9rbcmf4f504rpkfbnavl";
     };
     meta.homepage = "https://github.com/ThePrimeagen/harpoon/";
   };
@@ -2759,28 +3036,16 @@ final: prev:
 
   impatient-nvim = buildVimPluginFrom2Nix {
     pname = "impatient.nvim";
-    version = "2022-03-22";
+    version = "2022-03-31";
     src = fetchFromGitHub {
       owner = "lewis6991";
       repo = "impatient.nvim";
-      rev = "989eefca3539b9958df100e8e3130f55eafe1709";
-      sha256 = "0cypb6nm0jlgf4cbsazwplvniiqrnda32nk2nkaqm0dbprs920sv";
+      rev = "2337df7d778e17a58d8709f651653b9039946d8d";
+      sha256 = "06gz1qsdqil1f2wsfyslk8vsdxxjjrsak0gfar2298ardaqb3dhp";
     };
     meta.homepage = "https://github.com/lewis6991/impatient.nvim/";
   };
 
-  Improved-AnsiEsc = buildVimPluginFrom2Nix {
-    pname = "Improved-AnsiEsc";
-    version = "2015-08-26";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "Improved-AnsiEsc";
-      rev = "e1c59a8e9203fab6b9150721f30548916da73351";
-      sha256 = "1smjs4kz2kmzprzp9az4957675nakb43146hshbby39j5xz4jsbz";
-    };
-    meta.homepage = "https://github.com/vim-scripts/Improved-AnsiEsc/";
-  };
-
   increment-activator = buildVimPluginFrom2Nix {
     pname = "increment-activator";
     version = "2021-09-16";
@@ -2819,12 +3084,12 @@ final: prev:
 
   indent-blankline-nvim = buildVimPluginFrom2Nix {
     pname = "indent-blankline.nvim";
-    version = "2022-03-25";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "lukas-reineke";
       repo = "indent-blankline.nvim";
-      rev = "ebedbed53690a53cd15b53c124eb29f9faffc1d2";
-      sha256 = "1wsxvlpq78vyvgz6g0ji07dy1b10bsfr1qk9qdpj2n5592zp8zlk";
+      rev = "9920ceb79bffd0e6b7064be63439e38da0741d03";
+      sha256 = "15wqnd72j98w15i7dhzjdxbyxk766vcb844xdrvany3zwqn5p58x";
     };
     meta.homepage = "https://github.com/lukas-reineke/indent-blankline.nvim/";
   };
@@ -2962,18 +3227,6 @@ final: prev:
     meta.homepage = "https://github.com/nanotech/jellybeans.vim/";
   };
 
-  Jenkinsfile-vim-syntax = buildVimPluginFrom2Nix {
-    pname = "Jenkinsfile-vim-syntax";
-    version = "2021-01-26";
-    src = fetchFromGitHub {
-      owner = "martinda";
-      repo = "Jenkinsfile-vim-syntax";
-      rev = "0d05729168ea44d60862f17cffa80024ab30bcc9";
-      sha256 = "05z30frs4f5z0l4qgxk08r7mb19bzhqs36hi213yin78cz62b9gy";
-    };
-    meta.homepage = "https://github.com/martinda/Jenkinsfile-vim-syntax/";
-  };
-
   jq-vim = buildVimPluginFrom2Nix {
     pname = "jq.vim";
     version = "2019-05-21";
@@ -3058,30 +3311,6 @@ final: prev:
     meta.homepage = "https://github.com/qnighy/lalrpop.vim/";
   };
 
-  LanguageClient-neovim = buildVimPluginFrom2Nix {
-    pname = "LanguageClient-neovim";
-    version = "2020-12-10";
-    src = fetchFromGitHub {
-      owner = "autozimu";
-      repo = "LanguageClient-neovim";
-      rev = "a42594c9c320b1283e9b9058b85a8097d8325fed";
-      sha256 = "0lj9na3g2cl0vj56jz8rhz9lm2d3xps5glk8ds491i2ixy4vdm37";
-    };
-    meta.homepage = "https://github.com/autozimu/LanguageClient-neovim/";
-  };
-
-  LanguageTool-nvim = buildVimPluginFrom2Nix {
-    pname = "LanguageTool.nvim";
-    version = "2020-10-19";
-    src = fetchFromGitHub {
-      owner = "vigoux";
-      repo = "LanguageTool.nvim";
-      rev = "809e7d77fec834597f495fec737c59292a10025b";
-      sha256 = "1g12dz85xq8qd92dgna0a3w6zgxa74njlvmvly4k20610r63bzrn";
-    };
-    meta.homepage = "https://github.com/vigoux/LanguageTool.nvim/";
-  };
-
   last256 = buildVimPluginFrom2Nix {
     pname = "last256";
     version = "2020-12-09";
@@ -3118,26 +3347,14 @@ final: prev:
     meta.homepage = "https://github.com/kdheepak/lazygit.nvim/";
   };
 
-  LeaderF = buildVimPluginFrom2Nix {
-    pname = "LeaderF";
-    version = "2022-03-22";
-    src = fetchFromGitHub {
-      owner = "Yggdroot";
-      repo = "LeaderF";
-      rev = "60e14a5bbd52a22578d6335c606d0539067b9327";
-      sha256 = "05bx5wm8r5rs4y51pkgb2m6bxzddacn7f3bdsgnmbvxz0rxyq8dp";
-    };
-    meta.homepage = "https://github.com/Yggdroot/LeaderF/";
-  };
-
   lean-nvim = buildVimPluginFrom2Nix {
     pname = "lean.nvim";
-    version = "2022-03-23";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "Julian";
       repo = "lean.nvim";
-      rev = "c22a0a6d288488a05a74aaa53dac4d2d71f7a30d";
-      sha256 = "0rb1gw3ndrjw5k1l2ckm936xp83krrwi3ylr27il8mdf4xllw3y8";
+      rev = "d4f1097b8fb659eef47899b5dd04d924e24a893b";
+      sha256 = "11garckhnycds1njifczgspl6jwl4is25d6bnp22kvvjjy5bc5px";
     };
     meta.homepage = "https://github.com/Julian/lean.nvim/";
   };
@@ -3192,12 +3409,12 @@ final: prev:
 
   lf-vim = buildVimPluginFrom2Nix {
     pname = "lf.vim";
-    version = "2021-02-18";
+    version = "2022-03-30";
     src = fetchFromGitHub {
       owner = "ptzz";
       repo = "lf.vim";
-      rev = "73fb502c6d1470243b1f4d8afa81e289d9edd94b";
-      sha256 = "1whrzpavv46r64l3b7vax4sj23kjdfjiwmhfpssb6bprhc9c4j97";
+      rev = "eab8f04b2953f08e3fcd425585598d176369ae4b";
+      sha256 = "125qdj8grw1vilhfqzmjwcwk3r4f1m2kxnxga9klmgypjmcgnkxd";
     };
     meta.homepage = "https://github.com/ptzz/lf.vim/";
   };
@@ -3288,12 +3505,12 @@ final: prev:
 
   lightspeed-nvim = buildVimPluginFrom2Nix {
     pname = "lightspeed.nvim";
-    version = "2022-03-09";
+    version = "2022-03-31";
     src = fetchFromGitHub {
       owner = "ggandor";
       repo = "lightspeed.nvim";
-      rev = "58c9e321b188e040703b01f16922623911f11117";
-      sha256 = "1x9w6nk69a6xzhr9jpcvnw3jby09k49y7gikasxyq5gpq6rp9dfs";
+      rev = "ecb8bbca37ee1c9d153e0835af507905af05f2b5";
+      sha256 = "13b221n9h31i4mqiscdzq6299s6615hvdxc16pwsv18w2mfhpiax";
     };
     meta.homepage = "https://github.com/ggandor/lightspeed.nvim/";
   };
@@ -3360,12 +3577,12 @@ final: prev:
 
   litee-filetree-nvim = buildVimPluginFrom2Nix {
     pname = "litee-filetree.nvim";
-    version = "2022-03-08";
+    version = "2022-03-26";
     src = fetchFromGitHub {
       owner = "ldelossa";
       repo = "litee-filetree.nvim";
-      rev = "4f54ff9708c59385dd2f08aad1ba7df879e638fc";
-      sha256 = "076wyp90mr43xniv0zc7wh6rfk1wr50cpfw5lvaj6ai7dyys466n";
+      rev = "59259b0d0716b628a3e4f44098bd87ff54cf9cba";
+      sha256 = "02awfwdzgcqsvs8p8a4m29c648phy6h5x1l49gklrmp8ymg2xgq3";
     };
     meta.homepage = "https://github.com/ldelossa/litee-filetree.nvim/";
   };
@@ -3515,24 +3732,24 @@ final: prev:
 
   lualine-nvim = buildVimPluginFrom2Nix {
     pname = "lualine.nvim";
-    version = "2022-03-27";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "nvim-lualine";
       repo = "lualine.nvim";
-      rev = "f14175e142825c69c5b39e8f1564b9945a97d4aa";
-      sha256 = "0x6f88ixb6xd5nh3d8y5sql8yfyqs5fnpvdkdv9ywp7swzaydgqc";
+      rev = "c8e5a69085e89c2bac6bd01c74fcb98f9ffa5cdc";
+      sha256 = "0b2fwz1kxg0j8pgb1bzr82k916ii4k2vnbyz69w657v5mqmlpcbm";
     };
     meta.homepage = "https://github.com/nvim-lualine/lualine.nvim/";
   };
 
   luasnip = buildVimPluginFrom2Nix {
     pname = "luasnip";
-    version = "2022-03-27";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "l3mon4d3";
       repo = "luasnip";
-      rev = "d03f0c32b2aa763915401421f6b084315936590f";
-      sha256 = "0qrryj40v70wl1mwn3jc0f50ygslc0848gppki5sxv1aq56a58ps";
+      rev = "eb5b77e7927e4b28800b4f40c5507d6396b7eeaf";
+      sha256 = "03jjrd9k2cksrq5j2js9kdx4np1gy89z2r33baffrfpzy6rnak8b";
     };
     meta.homepage = "https://github.com/l3mon4d3/luasnip/";
   };
@@ -3609,42 +3826,18 @@ final: prev:
     meta.homepage = "https://github.com/vim-scripts/matchit.zip/";
   };
 
-  MatchTagAlways = buildVimPluginFrom2Nix {
-    pname = "MatchTagAlways";
-    version = "2017-05-20";
-    src = fetchFromGitHub {
-      owner = "Valloric";
-      repo = "MatchTagAlways";
-      rev = "352eb479a4ad1608e0880b79ab2357aac2cf4bed";
-      sha256 = "0y8gq4cs0wm2ijagc2frpmm664z355iridxyl5893576v5aqp8z1";
-    };
-    meta.homepage = "https://github.com/Valloric/MatchTagAlways/";
-  };
-
   material-nvim = buildVimPluginFrom2Nix {
     pname = "material.nvim";
-    version = "2022-03-25";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "marko-cerovac";
       repo = "material.nvim";
-      rev = "82f74e8ec5d21a8ec9ebe1175c330a0b6e490212";
-      sha256 = "0hgcgj84d92js6i6skwzznz0ym8cgzwr4pz5aqi038g8ldpcx0ki";
+      rev = "fc3e3d04f9646404dcbf3692e83ad0eecee8bfe8";
+      sha256 = "0zqs3hn946gzcsm4qggakd45qnw5mvas1j6i71l8i55xabkgiffj";
     };
     meta.homepage = "https://github.com/marko-cerovac/material.nvim/";
   };
 
-  mattn-calendar-vim = buildVimPluginFrom2Nix {
-    pname = "mattn-calendar-vim";
-    version = "2022-02-10";
-    src = fetchFromGitHub {
-      owner = "mattn";
-      repo = "calendar-vim";
-      rev = "2083a41e2d310f9bbbbf644517f30e901f1fb04d";
-      sha256 = "13wakcprkh93i7afykkpavxqvxssjh573pjjljsgip3y3778ms5q";
-    };
-    meta.homepage = "https://github.com/mattn/calendar-vim/";
-  };
-
   mayansmoke = buildVimPluginFrom2Nix {
     pname = "mayansmoke";
     version = "2010-10-18";
@@ -3659,12 +3852,12 @@ final: prev:
 
   mini-nvim = buildVimPluginFrom2Nix {
     pname = "mini.nvim";
-    version = "2022-03-26";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "echasnovski";
       repo = "mini.nvim";
-      rev = "b0763e58ccb8b203f87fcd58fe2fecb095119f96";
-      sha256 = "0qbyvz7l9p9iia7mh41119zdgz2v8xrkp8wcxl6hyxqri18j49yn";
+      rev = "aedcaba7892b8a016bf385672ec70ff99cd7876c";
+      sha256 = "0p4q4pxg692b1frs9v8rqbbha7jb4ngjm714ajfiaawn6kgy6r23";
     };
     meta.homepage = "https://github.com/echasnovski/mini.nvim/";
   };
@@ -3729,18 +3922,6 @@ final: prev:
     meta.homepage = "https://github.com/tomasr/molokai/";
   };
 
-  moonlight-nvim = buildVimPluginFrom2Nix {
-    pname = "moonlight.nvim";
-    version = "2021-05-16";
-    src = fetchFromGitHub {
-      owner = "shaunsingh";
-      repo = "moonlight.nvim";
-      rev = "e24e4218ec680b6396532808abf57ca0ada82e66";
-      sha256 = "0m9w3fpypsqxydjd93arbjqb5576nl40iy27i4ijlrqhgdhl49y3";
-    };
-    meta.homepage = "https://github.com/shaunsingh/moonlight.nvim/";
-  };
-
   mru = buildVimPluginFrom2Nix {
     pname = "mru";
     version = "2022-03-12";
@@ -3753,18 +3934,6 @@ final: prev:
     meta.homepage = "https://github.com/yegappan/mru/";
   };
 
-  Navigator-nvim = buildVimPluginFrom2Nix {
-    pname = "Navigator.nvim";
-    version = "2022-03-25";
-    src = fetchFromGitHub {
-      owner = "numToStr";
-      repo = "Navigator.nvim";
-      rev = "58d07e658c15b61ef7b6e375073b1f06934bc28f";
-      sha256 = "0d40rilwcxi7q36fnk4xpyx1cq3nb4yf22j8k8zq6mwg5h4j648r";
-    };
-    meta.homepage = "https://github.com/numToStr/Navigator.nvim/";
-  };
-
   ncm2 = buildVimPluginFrom2Nix {
     pname = "ncm2";
     version = "2022-03-17";
@@ -4103,12 +4272,12 @@ final: prev:
 
   neorg = buildVimPluginFrom2Nix {
     pname = "neorg";
-    version = "2022-03-26";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "nvim-neorg";
       repo = "neorg";
-      rev = "8f8c1ae889ffe666423a89271933272ebffec3ef";
-      sha256 = "10fgkrr9wn6jj35qa42c353k4rnys9a2wrckjk0kwrx6kvx7m6l6";
+      rev = "aec45ca94975c0072516523fec32d69044db36b6";
+      sha256 = "1g1kyhwqdxbshbfqzrwzav9afkl7psys8w5i2h4gkn8dda1h59g6";
     };
     meta.homepage = "https://github.com/nvim-neorg/neorg/";
   };
@@ -4127,12 +4296,12 @@ final: prev:
 
   neosnippet-snippets = buildVimPluginFrom2Nix {
     pname = "neosnippet-snippets";
-    version = "2021-10-02";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "Shougo";
       repo = "neosnippet-snippets";
-      rev = "8a6655a034eb7c12138dad505ef1004bf383a45d";
-      sha256 = "0mwvcjdrk324azqy5m2lpl3z1gi92jspxvmcjcxqnppfjsv1iyhd";
+      rev = "725c989f18e9c134cddd63a7c6b15bed5c244657";
+      sha256 = "0657ial95l0jgyj9ld6qbncnnrl5qkh6pqp40lr703ddqkz10s03";
     };
     meta.homepage = "https://github.com/Shougo/neosnippet-snippets/";
   };
@@ -4149,18 +4318,6 @@ final: prev:
     meta.homepage = "https://github.com/Shougo/neosnippet.vim/";
   };
 
-  NeoSolarized = buildVimPluginFrom2Nix {
-    pname = "NeoSolarized";
-    version = "2020-08-07";
-    src = fetchFromGitHub {
-      owner = "overcache";
-      repo = "NeoSolarized";
-      rev = "b94b1a9ad51e2de015266f10fdc6e142f97bd617";
-      sha256 = "019nz56yirpg1ahg8adfafrxznalw056qwm3xjm9kzg6da8j6v48";
-    };
-    meta.homepage = "https://github.com/overcache/NeoSolarized/";
-  };
-
   neoterm = buildVimPluginFrom2Nix {
     pname = "neoterm";
     version = "2022-01-20";
@@ -4295,12 +4452,12 @@ final: prev:
 
   nightfox-nvim = buildVimPluginFrom2Nix {
     pname = "nightfox.nvim";
-    version = "2022-03-27";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "EdenEast";
       repo = "nightfox.nvim";
-      rev = "2b19e2ad758f078b607408b15bdaf39f3beafac6";
-      sha256 = "0xn78z74wldjq7p5xzlbv4562b6i5nha3lj0bc2hv6w9n3m7q494";
+      rev = "18fea7708f6195ea26ec87701b59bb61a64532d8";
+      sha256 = "1aj6sn20hhdz2kmjgi4gr3m9izhbhjlw7kx2ydkm8bfhjx5wpgjq";
     };
     meta.homepage = "https://github.com/EdenEast/nightfox.nvim/";
   };
@@ -4377,18 +4534,6 @@ final: prev:
     meta.homepage = "https://github.com/andersevenrud/nordic.nvim/";
   };
 
-  NrrwRgn = buildVimPluginFrom2Nix {
-    pname = "NrrwRgn";
-    version = "2022-02-13";
-    src = fetchFromGitHub {
-      owner = "chrisbra";
-      repo = "NrrwRgn";
-      rev = "e027db9d94f94947153cd7b5ac9abd04371ab2b0";
-      sha256 = "0mcwyqbfc2m865w44s96ra2k0v1mn5kkkxf8i71iqhvc7fvnrfah";
-    };
-    meta.homepage = "https://github.com/chrisbra/NrrwRgn/";
-  };
-
   nterm-nvim = buildVimPluginFrom2Nix {
     pname = "nterm.nvim";
     version = "2021-11-10";
@@ -4415,12 +4560,12 @@ final: prev:
 
   null-ls-nvim = buildVimPluginFrom2Nix {
     pname = "null-ls.nvim";
-    version = "2022-03-25";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "jose-elias-alvarez";
       repo = "null-ls.nvim";
-      rev = "7253974f8bd8c805a2a1cf7456b4d47913f4a094";
-      sha256 = "0xy80c1wra3ir8v0ywrrmyswprbzknlwf69q9g33g29zsmgfx9dr";
+      rev = "899785c17c8ec701efc618520edf46bc0f3f367b";
+      sha256 = "0pwvq4aqfjr4vsymc40ppk6jb0qqclj3k47m6vzp2p1d4wa0qbz9";
     };
     meta.homepage = "https://github.com/jose-elias-alvarez/null-ls.nvim/";
   };
@@ -4463,36 +4608,36 @@ final: prev:
 
   nvim-autopairs = buildVimPluginFrom2Nix {
     pname = "nvim-autopairs";
-    version = "2022-03-25";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "windwp";
       repo = "nvim-autopairs";
-      rev = "f3ebca37d6ef1ff22d1f2c764a9e619d1fe5f3c7";
-      sha256 = "0w5xsj55iz30khiw4y47h43i40z2ly607bm8hvddpvrd50i5vcz1";
+      rev = "06535b1f1aefc98df464d180efa693bb696736c4";
+      sha256 = "12ii6vap3s2c58fmr01r900cidifr50pdpbl2ssx78w26qvc7qz4";
     };
     meta.homepage = "https://github.com/windwp/nvim-autopairs/";
   };
 
   nvim-base16 = buildVimPluginFrom2Nix {
     pname = "nvim-base16";
-    version = "2022-03-13";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "RRethy";
       repo = "nvim-base16";
-      rev = "9893a06a11b448e05c0bd1f44970acbb7712e8ba";
-      sha256 = "0hhlyw9nacyc4pyx2537y145lm9p3s4m4ckh8cwbambp5ypnn8kl";
+      rev = "f3c8eaa6c8c0dcd752aa28042f9435c464349776";
+      sha256 = "18xlhyyg9yq54p6jnq4dri47zfw62xfnx4ci9j9iiiii1dyzwr2z";
     };
     meta.homepage = "https://github.com/RRethy/nvim-base16/";
   };
 
   nvim-bqf = buildVimPluginFrom2Nix {
     pname = "nvim-bqf";
-    version = "2022-03-21";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "kevinhwang91";
       repo = "nvim-bqf";
-      rev = "7d3630f1616c2e5cf9f1c8efc1cf186b9249ce7b";
-      sha256 = "0y9kp05qgs7mmivs52ab26jhiqj1izz4jhj1n4x26zmaqbpw4viw";
+      rev = "d67a9b5173806e3f2297ee42b298d1345acb9c24";
+      sha256 = "1g6jvlx78s4a56p0nxg5z3s2g06snnsyq3bllvqf48qy2s43g286";
     };
     meta.homepage = "https://github.com/kevinhwang91/nvim-bqf/";
   };
@@ -4523,12 +4668,12 @@ final: prev:
 
   nvim-cmp = buildVimPluginFrom2Nix {
     pname = "nvim-cmp";
-    version = "2022-03-22";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "hrsh7th";
       repo = "nvim-cmp";
-      rev = "272cbdca3e327bf43e8df85c6f4f00921656c4e4";
-      sha256 = "1z3nsrkla35sl6d66bjnk0qvqn1a5m8vn670qyb8y9nqs344fy8d";
+      rev = "7dbe34e36d9de4912a5f3aa5279540445765814c";
+      sha256 = "0v5z1m7n6q183l9a6pajfqbg6n2cxdkcpx7xmalyh99x9ax0pazf";
     };
     meta.homepage = "https://github.com/hrsh7th/nvim-cmp/";
   };
@@ -4607,24 +4752,24 @@ final: prev:
 
   nvim-dap = buildVimPluginFrom2Nix {
     pname = "nvim-dap";
-    version = "2022-03-25";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "mfussenegger";
       repo = "nvim-dap";
-      rev = "e6d7ba5847fbe5f33ba211cf28d3cea72cfa9865";
-      sha256 = "0w57cxj07law5igbxvblfk59pv5c8z714dm80njb168ldgy26kz6";
+      rev = "c20c78d7c6c82f16a2d1abec31f4273194e3987b";
+      sha256 = "16vlsydx950s6v1nzpw0h38vmykcp9f3wsaxg09sjvc2isgd4f8b";
     };
     meta.homepage = "https://github.com/mfussenegger/nvim-dap/";
   };
 
   nvim-dap-ui = buildVimPluginFrom2Nix {
     pname = "nvim-dap-ui";
-    version = "2022-03-21";
+    version = "2022-03-29";
     src = fetchFromGitHub {
       owner = "rcarriga";
       repo = "nvim-dap-ui";
-      rev = "45805d69273f1ca0753a096abd419e89af8e5f8a";
-      sha256 = "03jjhsdl0w5w0s7d9a64fmvwdpm1pkvjvd5gh1hgsavbpf0w71mb";
+      rev = "33f33dfced1d7d98e2b934bd663175a062d8db39";
+      sha256 = "00achlynnv1qhs0vqp0q40pzx95bxf9cgsgrpwg6p3fwb2f4ssdi";
     };
     meta.homepage = "https://github.com/rcarriga/nvim-dap-ui/";
   };
@@ -4667,12 +4812,12 @@ final: prev:
 
   nvim-fzf-commands = buildVimPluginFrom2Nix {
     pname = "nvim-fzf-commands";
-    version = "2021-05-31";
+    version = "2022-03-31";
     src = fetchFromGitHub {
       owner = "vijaymarupudi";
       repo = "nvim-fzf-commands";
-      rev = "c6188c8618ca6b579af37cbc242414e1016bcd45";
-      sha256 = "0nn04gpz3n0jqb9kyxbmipkixzp1lk2f67knxqzzzlxm27m839fy";
+      rev = "015e77ea3185ca9175544e879e2cbb2cfb08323f";
+      sha256 = "1w6s1kl83fyvwycym3i5azcx4q5ryzsjszh6wvk5pxqm2pmzs8lx";
     };
     meta.homepage = "https://github.com/vijaymarupudi/nvim-fzf-commands/";
   };
@@ -4691,12 +4836,12 @@ final: prev:
 
   nvim-gps = buildVimPluginFrom2Nix {
     pname = "nvim-gps";
-    version = "2022-03-27";
+    version = "2022-03-29";
     src = fetchFromGitHub {
       owner = "smiteshp";
       repo = "nvim-gps";
-      rev = "1ad35eada2972c055b181c73852438a6ea51b484";
-      sha256 = "1kv7p2lcilvkvzl9whdkxgg94vk9fa9d1bikwhahxv2zxzk10qkz";
+      rev = "9f2adbce23a383243458f41654c07e57dc1b7635";
+      sha256 = "1gwq7qrbcmh4nqdgl4pv83b8x5wxaks4vxgq3yryjj6n4x5b56fw";
     };
     meta.homepage = "https://github.com/smiteshp/nvim-gps/";
   };
@@ -4715,12 +4860,12 @@ final: prev:
 
   nvim-hlslens = buildVimPluginFrom2Nix {
     pname = "nvim-hlslens";
-    version = "2022-03-20";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "kevinhwang91";
       repo = "nvim-hlslens";
-      rev = "22f7df73283c6f947a56fef0355f5a3ee2971152";
-      sha256 = "1qjy4n0ly5vmkpfyjanqb76jvh6qa5ldqvhgfgxk91b9l35ca95l";
+      rev = "1944094111217db8d40aac697ffc71f16136d9ec";
+      sha256 = "0f0lqldrgzi72qrafzwqk3i71v74xvsrhgrfnidnbnvd3jc7sa0b";
     };
     meta.homepage = "https://github.com/kevinhwang91/nvim-hlslens/";
   };
@@ -4787,12 +4932,12 @@ final: prev:
 
   nvim-lint = buildVimPluginFrom2Nix {
     pname = "nvim-lint";
-    version = "2022-03-09";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "mfussenegger";
       repo = "nvim-lint";
-      rev = "8cc31931859dc3cc187fd68509f8649599f72cba";
-      sha256 = "006d9l0p86s08vhr5jjm6gi2j27wjbk3c3vfdbq9yi3bz974hgf1";
+      rev = "4040e71c86022cf7937bef5d483156c163df8ca1";
+      sha256 = "0492x97bl0p9kn2fsb6p587m6lsbn4qgdg7k7sr7vrfi73xw4s3k";
     };
     meta.homepage = "https://github.com/mfussenegger/nvim-lint/";
   };
@@ -4811,12 +4956,12 @@ final: prev:
 
   nvim-lspconfig = buildVimPluginFrom2Nix {
     pname = "nvim-lspconfig";
-    version = "2022-03-23";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "neovim";
       repo = "nvim-lspconfig";
-      rev = "7d5a6dc46dd2ebaeb74b573922f289ae33089fe7";
-      sha256 = "1dz2q6n2ibq9l2js088wfp2y5md6z8lqs6hy02xajglvb0d9g3fg";
+      rev = "3d1baa811b351078e5711be1a1158e33b074be9e";
+      sha256 = "0470h3vaw6zmmayfd9rzlh5myzmdc2wa5qlfmax21k0jna62zzr1";
     };
     meta.homepage = "https://github.com/neovim/nvim-lspconfig/";
   };
@@ -4835,12 +4980,12 @@ final: prev:
 
   nvim-metals = buildVimPluginFrom2Nix {
     pname = "nvim-metals";
-    version = "2022-03-20";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "scalameta";
       repo = "nvim-metals";
-      rev = "3312490ef74ea149121a82fde578a13b1921cef9";
-      sha256 = "0xi13qji716kdbbq579pj7rxbjfkwjrsdp3qvfb937spwzbak2jc";
+      rev = "64db05106c952bfc29ad165f21c43e7fdc97eaf1";
+      sha256 = "0m4ab6774j0yj8b1h6p0y0m5zgs4w3x2vn20ahx3z6dr6bzk2pph";
     };
     meta.homepage = "https://github.com/scalameta/nvim-metals/";
   };
@@ -4919,12 +5064,12 @@ final: prev:
 
   nvim-spectre = buildVimPluginFrom2Nix {
     pname = "nvim-spectre";
-    version = "2022-03-22";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "nvim-pack";
       repo = "nvim-spectre";
-      rev = "3bbf9cb2e36200d67c150d71d49011c133d3bbb8";
-      sha256 = "1jif3knz78mqf6sgckfwin1wx6ad4wppdc2y0hcxlj2kwm17xqzk";
+      rev = "fbb03990539d5d484fe10de805772b4b86792c1a";
+      sha256 = "1iw4gnsc72r5rj7z5g3jbxqcnfzzhi9r84zpik8pfjnx8r79ncnj";
     };
     meta.homepage = "https://github.com/nvim-pack/nvim-spectre/";
   };
@@ -4943,24 +5088,24 @@ final: prev:
 
   nvim-tree-lua = buildVimPluginFrom2Nix {
     pname = "nvim-tree.lua";
-    version = "2022-03-27";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "kyazdani42";
       repo = "nvim-tree.lua";
-      rev = "524758a207f9c5bf3888b446d9f93192a837b8a7";
-      sha256 = "0kz7qhirm7gkklmyysanndm4pimvfm0p0qzz3q96hv01hpm3d17y";
+      rev = "63688809682af5fcfa6aedec21b1c9ef3aeb2f4c";
+      sha256 = "0jmllkfj5l5f5a6nlzlglh48n12rmxwb57vz346ji1a1qrrs6bhj";
     };
     meta.homepage = "https://github.com/kyazdani42/nvim-tree.lua/";
   };
 
   nvim-treesitter = buildVimPluginFrom2Nix {
     pname = "nvim-treesitter";
-    version = "2022-03-27";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "nvim-treesitter";
       repo = "nvim-treesitter";
-      rev = "b995eebe84df88092a41cbfd591bfc1565f70d8e";
-      sha256 = "1738mssq22n1njrpi004apgfv00fxn7yx00r3175qn57bjw9bks9";
+      rev = "2472e47e15eb56e8d6d421d7c2c7169140db2813";
+      sha256 = "1cyi7h5xpw2hfyniwqyc5fnmvlyjb6bfbg4l586kn8q34hq5s3kq";
     };
     meta.homepage = "https://github.com/nvim-treesitter/nvim-treesitter/";
   };
@@ -5003,12 +5148,12 @@ final: prev:
 
   nvim-treesitter-textobjects = buildVimPluginFrom2Nix {
     pname = "nvim-treesitter-textobjects";
-    version = "2022-03-25";
+    version = "2022-03-29";
     src = fetchFromGitHub {
       owner = "nvim-treesitter";
       repo = "nvim-treesitter-textobjects";
-      rev = "2885b60e9f9b90b4e2a32b0f8adf8571bf1f390e";
-      sha256 = "0q1dph3pz2ygz1wccjgcdfqyb4faj47rv2v9a4p4ngw2vd00qjgy";
+      rev = "c4b41e42dad700b23c6ea86ecb69c9deb55a8fbb";
+      sha256 = "1l8fbn1rvyifvaplmyp38sf73payy1wlglnrb5xl4dxpcfd6yvzc";
     };
     meta.homepage = "https://github.com/nvim-treesitter/nvim-treesitter-textobjects/";
   };
@@ -5039,12 +5184,12 @@ final: prev:
 
   nvim-ts-rainbow = buildVimPluginFrom2Nix {
     pname = "nvim-ts-rainbow";
-    version = "2022-03-20";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "p00f";
       repo = "nvim-ts-rainbow";
-      rev = "af1a18d2577ba0be5b59bc4b32aebd2569ff085e";
-      sha256 = "1z100akjipzp3zyr7d54vbwwf53dj4f8y8qzf7fv32la142a7idq";
+      rev = "dee11b86ae2419e3f7484197c597a0e634a37a56";
+      sha256 = "1rmv8lmxx4ji4lacgws3vfaaj8df2zbc3vs6sbj9mmzmfg3q38py";
     };
     meta.homepage = "https://github.com/p00f/nvim-ts-rainbow/";
   };
@@ -5099,12 +5244,12 @@ final: prev:
 
   nvimdev-nvim = buildVimPluginFrom2Nix {
     pname = "nvimdev.nvim";
-    version = "2022-03-15";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "neovim";
       repo = "nvimdev.nvim";
-      rev = "cb0fcc1cdbe3864554a7b1ecbe706eb4de4ec680";
-      sha256 = "063fyzawn6i67cv3221s282ln5gpms3qw97blrd80l18syykj2b9";
+      rev = "ebe8f689a9867c6ce57d748a80a2157b49764f13";
+      sha256 = "0r07x8i7w9rk8n1zrdyvqr9pfjv3dihb2hy1100jl4xxc11g43an";
     };
     meta.homepage = "https://github.com/neovim/nvimdev.nvim/";
   };
@@ -5135,12 +5280,12 @@ final: prev:
 
   octo-nvim = buildVimPluginFrom2Nix {
     pname = "octo.nvim";
-    version = "2022-02-28";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "pwntester";
       repo = "octo.nvim";
-      rev = "5e461b944fbf9b6207cf06102ca09fd7778854f7";
-      sha256 = "0s04m3xg98sj74fhhvdmafijmjhpa70hgcylg43yxlgdcscqbd72";
+      rev = "a83219f69320fc65c12427d6bcbcea135861bb3d";
+      sha256 = "11hqfz7rsxnsxqw06zpj3mq1hxz06hsdjbav00jd4zryvcgs6r3v";
     };
     meta.homepage = "https://github.com/pwntester/octo.nvim/";
   };
@@ -5231,12 +5376,12 @@ final: prev:
 
   orgmode = buildVimPluginFrom2Nix {
     pname = "orgmode";
-    version = "2022-03-10";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "nvim-orgmode";
       repo = "orgmode";
-      rev = "e1f3054987ce054525258d9a3cc5837bf6e75212";
-      sha256 = "0hwsajd7lhc04da7yzx770f3bgn2jsibcg1pjhxyib1prr17mpy0";
+      rev = "3a87036a0b6315a41b4292885cbe372b2f763d99";
+      sha256 = "1fak1pfvyy4wwhc4lww5c2ak6b8x0pwgkbljm5azd943lravya1l";
     };
     meta.homepage = "https://github.com/nvim-orgmode/orgmode/";
   };
@@ -5363,24 +5508,24 @@ final: prev:
 
   playground = buildVimPluginFrom2Nix {
     pname = "playground";
-    version = "2022-02-16";
+    version = "2022-03-30";
     src = fetchFromGitHub {
       owner = "nvim-treesitter";
       repo = "playground";
-      rev = "9df82a27a49e1c14e9d7416b537517a79d675086";
-      sha256 = "1hhrcsrgcy3vqxn9gsm68r77n6z5bw4cr0r47darffan5rxykz21";
+      rev = "7dbcd4d647010a80d135804b3fc1da3fb77083d6";
+      sha256 = "0g7rqw2vm00rrbbnhc8b9hyljc7q8qc0lywg63lkj63ks9j4m8y7";
     };
     meta.homepage = "https://github.com/nvim-treesitter/playground/";
   };
 
   plenary-nvim = buildVimPluginFrom2Nix {
     pname = "plenary.nvim";
-    version = "2022-03-20";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "nvim-lua";
       repo = "plenary.nvim";
-      rev = "0d660152000a40d52158c155625865da2aa7aa1b";
-      sha256 = "0r8amnlaqxg9jpqk6v4rzlfrc8q161jy1bpy35jrk7gva76kp9hm";
+      rev = "f9c65cd76ffa76a0818923c6bce5771687dfe64c";
+      sha256 = "1kgi4q7n8m0hv6hn82bs8xhm8n34qmzcq4l8prki1127gfa2gpqj";
     };
     meta.homepage = "https://github.com/nvim-lua/plenary.nvim/";
   };
@@ -5436,28 +5581,16 @@ final: prev:
 
   presenting-vim = buildVimPluginFrom2Nix {
     pname = "presenting.vim";
-    version = "2021-06-02";
+    version = "2022-03-27";
     src = fetchFromGitHub {
       owner = "sotte";
       repo = "presenting.vim";
-      rev = "fd826318582ffccf2f79aff7bef365d68f2ca4fc";
-      sha256 = "1s2c44ngv5vpszwg0nkcghb5flzq9pby1m0l7gr7vwb9p7xl3b83";
+      rev = "e960e204d8e4526d2650c23eaea908317c6becb9";
+      sha256 = "1hpid82gdczis0g0pxvx445n2wg7j4zx66fm43zxq08kcv3k5ara";
     };
     meta.homepage = "https://github.com/sotte/presenting.vim/";
   };
 
-  PreserveNoEOL = buildVimPluginFrom2Nix {
-    pname = "PreserveNoEOL";
-    version = "2013-06-14";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "PreserveNoEOL";
-      rev = "940e3ce90e54d8680bec1135a21dcfbd6c9bfb62";
-      sha256 = "1726jpr2zf6jrb00pp082ikbx4mll3a877pnzs6i18f9fgpaqqgd";
-    };
-    meta.homepage = "https://github.com/vim-scripts/PreserveNoEOL/";
-  };
-
   prev_indent = buildVimPluginFrom2Nix {
     pname = "prev_indent";
     version = "2014-03-08";
@@ -5539,23 +5672,10 @@ final: prev:
       repo = "pywal.nvim";
       rev = "bd58195939d31dd0f15a720fba2956e91598cefe";
       sha256 = "10fs5assp96rvlcxckd8cwnkfwfckjmf0j8cqq91vb2wx8knxc8g";
-      fetchSubmodules = true;
     };
     meta.homepage = "https://github.com/AlphaTechnolog/pywal.nvim/";
   };
 
-  QFEnter = buildVimPluginFrom2Nix {
-    pname = "QFEnter";
-    version = "2020-10-09";
-    src = fetchFromGitHub {
-      owner = "yssl";
-      repo = "QFEnter";
-      rev = "df0a75b287c210f98ae353a12bbfdaf73d858beb";
-      sha256 = "0gdp7nmjlp8ng2rp2v66d8bincnkwrqqpbggb079f0f9szrqlp54";
-    };
-    meta.homepage = "https://github.com/yssl/QFEnter/";
-  };
-
   quick-scope = buildVimPluginFrom2Nix {
     pname = "quick-scope";
     version = "2022-01-29";
@@ -5676,18 +5796,6 @@ final: prev:
     meta.homepage = "https://github.com/ryvnf/readline.vim/";
   };
 
-  Recover-vim = buildVimPluginFrom2Nix {
-    pname = "Recover.vim";
-    version = "2015-08-14";
-    src = fetchFromGitHub {
-      owner = "chrisbra";
-      repo = "Recover.vim";
-      rev = "efa491f6121f65e025f42d79a93081abb8db69d4";
-      sha256 = "17szim82bwnhf9q4n0n4jfmqkmhq6p0lh0j4y77a2x6lkn0pns5s";
-    };
-    meta.homepage = "https://github.com/chrisbra/Recover.vim/";
-  };
-
   refactoring-nvim = buildVimPluginFrom2Nix {
     pname = "refactoring.nvim";
     version = "2022-03-23";
@@ -5712,18 +5820,6 @@ final: prev:
     meta.homepage = "https://github.com/tversteeg/registers.nvim/";
   };
 
-  Rename = buildVimPluginFrom2Nix {
-    pname = "Rename";
-    version = "2011-08-31";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "Rename";
-      rev = "b240f28d2ede65fa77cd99fe045efe79202f7a34";
-      sha256 = "1d1myg4zyc281zcc1ba9idbgcgxndb4a0jwqr4yqxhhzdgszw46r";
-    };
-    meta.homepage = "https://github.com/vim-scripts/Rename/";
-  };
-
   renamer-nvim = buildVimPluginFrom2Nix {
     pname = "renamer.nvim";
     version = "2022-01-15";
@@ -5736,18 +5832,6 @@ final: prev:
     meta.homepage = "https://github.com/filipdutescu/renamer.nvim/";
   };
 
-  ReplaceWithRegister = buildVimPluginFrom2Nix {
-    pname = "ReplaceWithRegister";
-    version = "2014-10-31";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "ReplaceWithRegister";
-      rev = "832efc23111d19591d495dc72286de2fb0b09345";
-      sha256 = "0mb0sx85j1k59b1zz95r4vkq4kxlb4krhncq70mq7fxrs5bnhq8g";
-    };
-    meta.homepage = "https://github.com/vim-scripts/ReplaceWithRegister/";
-  };
-
   rest-nvim = buildVimPluginFrom2Nix {
     pname = "rest.nvim";
     version = "2022-01-26";
@@ -5880,18 +5964,6 @@ final: prev:
     meta.homepage = "https://github.com/vmware-archive/salt-vim/";
   };
 
-  SchemaStore-nvim = buildVimPluginFrom2Nix {
-    pname = "SchemaStore.nvim";
-    version = "2022-03-25";
-    src = fetchFromGitHub {
-      owner = "b0o";
-      repo = "SchemaStore.nvim";
-      rev = "f665a87f88b7b891aa5e1f91236b5bab29c2faaf";
-      sha256 = "1i90yyrm7ji8wf3if431al9ggcnps37k3lsnga3ixqa5pr7xsrg9";
-    };
-    meta.homepage = "https://github.com/b0o/SchemaStore.nvim/";
-  };
-
   scrollbar-nvim = buildVimPluginFrom2Nix {
     pname = "scrollbar.nvim";
     version = "2021-11-16";
@@ -5976,30 +6048,6 @@ final: prev:
     meta.homepage = "https://github.com/osyo-manga/shabadou.vim/";
   };
 
-  Shade-nvim = buildVimPluginFrom2Nix {
-    pname = "Shade.nvim";
-    version = "2022-02-01";
-    src = fetchFromGitHub {
-      owner = "sunjon";
-      repo = "Shade.nvim";
-      rev = "4286b5abc47d62d0c9ffb22a4f388b7bf2ac2461";
-      sha256 = "0mb0cnf8065qmjq85hlgb4a1mqk1nwl7966l1imb54hpzw828rzl";
-    };
-    meta.homepage = "https://github.com/sunjon/Shade.nvim/";
-  };
-
-  ShowMultiBase = buildVimPluginFrom2Nix {
-    pname = "ShowMultiBase";
-    version = "2010-10-18";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "ShowMultiBase";
-      rev = "85a39fd12668ce973d3d9282263912b2b8f0d338";
-      sha256 = "0hg5352ahzgh2kwqha5v8ai024fld93xag93hb53wjf5b8nzsz8i";
-    };
-    meta.homepage = "https://github.com/vim-scripts/ShowMultiBase/";
-  };
-
   sideways-vim = buildVimPluginFrom2Nix {
     pname = "sideways.vim";
     version = "2022-02-12";
@@ -6013,18 +6061,6 @@ final: prev:
     meta.homepage = "https://github.com/AndrewRadev/sideways.vim/";
   };
 
-  SimpylFold = buildVimPluginFrom2Nix {
-    pname = "SimpylFold";
-    version = "2021-11-04";
-    src = fetchFromGitHub {
-      owner = "tmhedberg";
-      repo = "SimpylFold";
-      rev = "b4a87e509c3d873238a39d1c85d0b97d6819f283";
-      sha256 = "0ff5x7ay67wn9c0mi8sb6110i93zrf97c4whg0bd7pr2nmadpvk0";
-    };
-    meta.homepage = "https://github.com/tmhedberg/SimpylFold/";
-  };
-
   skim-vim = buildVimPluginFrom2Nix {
     pname = "skim.vim";
     version = "2020-11-11";
@@ -6051,12 +6087,12 @@ final: prev:
 
   slimv = buildVimPluginFrom2Nix {
     pname = "slimv";
-    version = "2022-02-11";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "kovisoft";
       repo = "slimv";
-      rev = "1b88c3a67948b446720883ed8eadb8c2b83a21ef";
-      sha256 = "0m0kkc75ifg7lvk8p3vgq5iy8hr254ywj7hhjgxwzm2zbrwkr04s";
+      rev = "eb5856c616466b0f463e27a30965ea142003a552";
+      sha256 = "1c4hprzqzxkf0yqkqc8261qr7xk817nm28cp38dw4z1rmjcg1l04";
     };
     meta.homepage = "https://github.com/kovisoft/slimv/";
   };
@@ -6133,30 +6169,6 @@ final: prev:
     meta.homepage = "https://github.com/liuchengxu/space-vim/";
   };
 
-  SpaceCamp = buildVimPluginFrom2Nix {
-    pname = "SpaceCamp";
-    version = "2021-04-07";
-    src = fetchFromGitHub {
-      owner = "jaredgorski";
-      repo = "SpaceCamp";
-      rev = "376af5c2204de61726ea86b596acb2dab9795e1f";
-      sha256 = "0h3wxkswd5z9y46d6272sr210i73j5pwf5faw7qhr1plilfgx4gb";
-    };
-    meta.homepage = "https://github.com/jaredgorski/SpaceCamp/";
-  };
-
-  Spacegray-vim = buildVimPluginFrom2Nix {
-    pname = "Spacegray.vim";
-    version = "2021-07-06";
-    src = fetchFromGitHub {
-      owner = "ackyshake";
-      repo = "Spacegray.vim";
-      rev = "c699ca10ed421c462bd1c87a158faaa570dc8e28";
-      sha256 = "0ma8w6p5jh6llka49x5j5ql8fmhv0bx5hhsn5b2phak79yqg1k61";
-    };
-    meta.homepage = "https://github.com/ackyshake/Spacegray.vim/";
-  };
-
   spacevim = buildVimPluginFrom2Nix {
     pname = "spacevim";
     version = "2018-03-29";
@@ -6169,18 +6181,6 @@ final: prev:
     meta.homepage = "https://github.com/ctjhoa/spacevim/";
   };
 
-  SpaceVim = buildVimPluginFrom2Nix {
-    pname = "SpaceVim";
-    version = "2022-03-27";
-    src = fetchFromGitHub {
-      owner = "SpaceVim";
-      repo = "SpaceVim";
-      rev = "a8d183fdd97de3c1ee54c0e5f0efe9e95a19d866";
-      sha256 = "0rhpasj5jw7jhij6pqjrsb48gwf4hrpadh8ab9d611v6akkkxlvv";
-    };
-    meta.homepage = "https://github.com/SpaceVim/SpaceVim/";
-  };
-
   sparkup = buildVimPluginFrom2Nix {
     pname = "sparkup";
     version = "2012-06-11";
@@ -6231,12 +6231,12 @@ final: prev:
 
   splitjoin-vim = buildVimPluginFrom2Nix {
     pname = "splitjoin.vim";
-    version = "2022-03-21";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "AndrewRadev";
       repo = "splitjoin.vim";
-      rev = "c32b18751a81715e3c13cff22fea9fb5ce31ef35";
-      sha256 = "12kp185ndag507b7l4qvhr369zyikwgh0wyi9lrjyr2ar5impjqc";
+      rev = "dbcd3069fb2b4ecfdd964c1e93aa59fcf7f850b6";
+      sha256 = "1rgc9cbfpjnk8pf7wh9pyyljckbn1i88z5bggyn15q3lfhskvidc";
       fetchSubmodules = true;
     };
     meta.homepage = "https://github.com/AndrewRadev/splitjoin.vim/";
@@ -6326,18 +6326,6 @@ final: prev:
     meta.homepage = "https://github.com/lambdalisue/suda.vim/";
   };
 
-  SudoEdit-vim = buildVimPluginFrom2Nix {
-    pname = "SudoEdit.vim";
-    version = "2020-02-27";
-    src = fetchFromGitHub {
-      owner = "chrisbra";
-      repo = "SudoEdit.vim";
-      rev = "e203eada5b563e9134ce2aae26b09edae0904fd7";
-      sha256 = "0pf9iix50pw3p430ky51rv11ra1hppdpwa5flzcd5kciybr76n0n";
-    };
-    meta.homepage = "https://github.com/chrisbra/SudoEdit.vim/";
-  };
-
   supertab = buildVimPluginFrom2Nix {
     pname = "supertab";
     version = "2021-04-30";
@@ -6510,12 +6498,12 @@ final: prev:
 
   tagbar = buildVimPluginFrom2Nix {
     pname = "tagbar";
-    version = "2022-03-15";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "preservim";
       repo = "tagbar";
-      rev = "69659cfc9d081caf31c8d548dd4c19593839317b";
-      sha256 = "1wdrn0zvqhz7pd0rgl5z3zri3sy4hb947nmw9imvwi62mpdhsh7d";
+      rev = "2137c1437012afc82b5d50404b1404aec8699f7b";
+      sha256 = "099000mv3d2l7aidvrwgfrks48xa5xv38fvqrs6svabqg20k2wwk";
     };
     meta.homepage = "https://github.com/preservim/tagbar/";
   };
@@ -6787,12 +6775,12 @@ final: prev:
 
   telescope-nvim = buildVimPluginFrom2Nix {
     pname = "telescope.nvim";
-    version = "2022-03-26";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "nvim-telescope";
       repo = "telescope.nvim";
-      rev = "cf2d6d34282afd90f0f5d2aba265a23b068494c2";
-      sha256 = "042w0l8hdcxaj3pmbp0w1mqmivfm48pv3vlcz6d423qiljbkrk9k";
+      rev = "6e7ee3829225d5c97c1ebfff686050142ffe5867";
+      sha256 = "0qlv63jll4ja4x2njxvz1h9mlh92akzif06qy8gr7f61gfvfaaca";
     };
     meta.homepage = "https://github.com/nvim-telescope/telescope.nvim/";
   };
@@ -6968,12 +6956,12 @@ final: prev:
 
   toggleterm-nvim = buildVimPluginFrom2Nix {
     pname = "toggleterm.nvim";
-    version = "2022-03-24";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "akinsho";
       repo = "toggleterm.nvim";
-      rev = "9f969e7f72d19966756318d61f2562f67dbb1f9c";
-      sha256 = "118hwkn9cw2wsqigqvbpvbhbag6ywc325lvn088dfpzbn9k7vfmr";
+      rev = "5733b24c684d202f978ccedca4a8c7571889bf28";
+      sha256 = "00z21wvgjks5mqrqja1kc1wnwxpjyy2fl3sn8f16692hz2wcavrd";
     };
     meta.homepage = "https://github.com/akinsho/toggleterm.nvim/";
   };
@@ -7038,18 +7026,6 @@ final: prev:
     meta.homepage = "https://github.com/folke/trouble.nvim/";
   };
 
-  TrueZen-nvim = buildVimPluginFrom2Nix {
-    pname = "TrueZen.nvim";
-    version = "2021-10-12";
-    src = fetchFromGitHub {
-      owner = "Pocco81";
-      repo = "TrueZen.nvim";
-      rev = "508b977d71650da5c9243698614a9a1416f116d4";
-      sha256 = "0sr4y1mg83l28l5ias2pv0gxkcgwailfjn2skx35z63f2il3zkbx";
-    };
-    meta.homepage = "https://github.com/Pocco81/TrueZen.nvim/";
-  };
-
   tslime-vim = buildVimPluginFrom2Nix {
     pname = "tslime.vim";
     version = "2020-09-09";
@@ -7148,12 +7124,12 @@ final: prev:
 
   urlview-nvim = buildVimPluginFrom2Nix {
     pname = "urlview.nvim";
-    version = "2022-03-29";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "axieax";
       repo = "urlview.nvim";
-      rev = "4ca1b22d914ff3187acd5a9486421769928c9d8f";
-      sha256 = "1vy977y7favs76mpk6v3x18ph40y0d20kmm6bssvnlql1nh3ihbd";
+      rev = "ca2b8bca2fa229275d3c33c13bc61a76cda9b714";
+      sha256 = "10q1ifsi4z2g8f2kvij9kmfl41lysr7lnxl73m59zzp27zl2ddd8";
     };
     meta.homepage = "https://github.com/axieax/urlview.nvim/";
   };
@@ -7170,18 +7146,6 @@ final: prev:
     meta.homepage = "https://github.com/vim-scripts/utl.vim/";
   };
 
-  vader-vim = buildVimPluginFrom2Nix {
-    pname = "vader.vim";
-    version = "2020-02-13";
-    src = fetchFromGitHub {
-      owner = "junegunn";
-      repo = "vader.vim";
-      rev = "6fff477431ac3191c69a3a5e5f187925466e275a";
-      sha256 = "153cr1mrf5w5lyr8374brwx1z5yl9h0cnijxnd3xikh3yi3pbmwk";
-    };
-    meta.homepage = "https://github.com/junegunn/vader.vim/";
-  };
-
   vCoolor-vim = buildVimPluginFrom2Nix {
     pname = "vCoolor.vim";
     version = "2020-10-14";
@@ -7194,6 +7158,18 @@ final: prev:
     meta.homepage = "https://github.com/KabbAmine/vCoolor.vim/";
   };
 
+  vader-vim = buildVimPluginFrom2Nix {
+    pname = "vader.vim";
+    version = "2020-02-13";
+    src = fetchFromGitHub {
+      owner = "junegunn";
+      repo = "vader.vim";
+      rev = "6fff477431ac3191c69a3a5e5f187925466e275a";
+      sha256 = "153cr1mrf5w5lyr8374brwx1z5yl9h0cnijxnd3xikh3yi3pbmwk";
+    };
+    meta.homepage = "https://github.com/junegunn/vader.vim/";
+  };
+
   venn-nvim = buildVimPluginFrom2Nix {
     pname = "venn.nvim";
     version = "2021-10-19";
@@ -7220,16 +7196,88 @@ final: prev:
 
   vifm-vim = buildVimPluginFrom2Nix {
     pname = "vifm.vim";
-    version = "2022-03-24";
+    version = "2022-03-28";
     src = fetchFromGitHub {
       owner = "vifm";
       repo = "vifm.vim";
-      rev = "11d8fb106515a4c4e6016742053356c9f0434fed";
-      sha256 = "1gjaqmkrxg5x6mpb7dnznbbzrv3iadcw7snxjx7bzmr0b24mddcp";
+      rev = "069349e5dbba9fbb24b88ebedb89f728387fae79";
+      sha256 = "1rrzhg8qpvgvcm9fkr05hmkw95gn37pys0h0d6rii6qhbx9z95vs";
     };
     meta.homepage = "https://github.com/vifm/vifm.vim/";
   };
 
+  vim-CtrlXA = buildVimPluginFrom2Nix {
+    pname = "vim-CtrlXA";
+    version = "2021-08-09";
+    src = fetchFromGitHub {
+      owner = "Konfekt";
+      repo = "vim-CtrlXA";
+      rev = "404ea1e055921db5679b3734108d72850d6faa76";
+      sha256 = "10bgyqnwcqly3sxl27np1b690hnj1snqbcvg8pzh4zgdysfgy9xg";
+    };
+    meta.homepage = "https://github.com/Konfekt/vim-CtrlXA/";
+  };
+
+  vim-DetectSpellLang = buildVimPluginFrom2Nix {
+    pname = "vim-DetectSpellLang";
+    version = "2022-03-15";
+    src = fetchFromGitHub {
+      owner = "konfekt";
+      repo = "vim-DetectSpellLang";
+      rev = "d5b55e3307e72e45f8d736818c76884016583538";
+      sha256 = "0l9bdgqaxfpndpf4v5kxn34zx5pnhf62chp4flzyyhhzlz52dqjw";
+    };
+    meta.homepage = "https://github.com/konfekt/vim-DetectSpellLang/";
+  };
+
+  vim-LanguageTool = buildVimPluginFrom2Nix {
+    pname = "vim-LanguageTool";
+    version = "2021-02-08";
+    src = fetchFromGitHub {
+      owner = "dpelle";
+      repo = "vim-LanguageTool";
+      rev = "0372ffae78aa3eac3bfa48ba3bf2f4015a86385a";
+      sha256 = "00476l49lczj1rw5gb6vs7s9r0zi1khw0g1v6bsfwl5r32699l7r";
+    };
+    meta.homepage = "https://github.com/dpelle/vim-LanguageTool/";
+  };
+
+  vim-ReplaceWithRegister = buildVimPluginFrom2Nix {
+    pname = "vim-ReplaceWithRegister";
+    version = "2021-07-05";
+    src = fetchFromGitHub {
+      owner = "inkarkat";
+      repo = "vim-ReplaceWithRegister";
+      rev = "aad1e8fa31cb4722f20fe40679caa56e25120032";
+      sha256 = "1cfgixq5smwbp55x2baaj1kw736w2mykysppphair44vb4w9rlgm";
+    };
+    meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithRegister/";
+  };
+
+  vim-ReplaceWithSameIndentRegister = buildVimPluginFrom2Nix {
+    pname = "vim-ReplaceWithSameIndentRegister";
+    version = "2020-06-17";
+    src = fetchFromGitHub {
+      owner = "inkarkat";
+      repo = "vim-ReplaceWithSameIndentRegister";
+      rev = "0b7f542560bd21822a004e8accdf472eb477c9cf";
+      sha256 = "04zvhqh9rjfiwfk8r0zci608pw09svqb42nvp8pvqb11xp2ydg2y";
+    };
+    meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/";
+  };
+
+  vim-SyntaxRange = buildVimPluginFrom2Nix {
+    pname = "vim-SyntaxRange";
+    version = "2021-01-16";
+    src = fetchFromGitHub {
+      owner = "inkarkat";
+      repo = "vim-SyntaxRange";
+      rev = "3a7fd9ff50fabafe61df12522ed2f275c8e2f45e";
+      sha256 = "1b5xyacbn87z8wkacjpnjk82xmxzivlb111427kwb5kxxdh4w7gq";
+    };
+    meta.homepage = "https://github.com/inkarkat/vim-SyntaxRange/";
+  };
+
   vim-abolish = buildVimPluginFrom2Nix {
     pname = "vim-abolish";
     version = "2021-03-20";
@@ -7484,12 +7532,12 @@ final: prev:
 
   vim-airline = buildVimPluginFrom2Nix {
     pname = "vim-airline";
-    version = "2022-03-23";
+    version = "2022-03-30";
     src = fetchFromGitHub {
       owner = "vim-airline";
       repo = "vim-airline";
-      rev = "a306a7abfd8b4450fcfdc0384dadb996148d2c1b";
-      sha256 = "0qvz41rpdbcsszh0n4jhjrw9anyzsh4r1j694a3ryjj58gg9smjy";
+      rev = "dc65eea5d9225758d4556278b3d808baa6ab4d0e";
+      sha256 = "1mkfssssgsaqx770rarpgryp4zimfq7ljv14jzmb2bqx9iyqz5xb";
     };
     meta.homepage = "https://github.com/vim-airline/vim-airline/";
   };
@@ -8024,12 +8072,12 @@ final: prev:
 
   vim-cool = buildVimPluginFrom2Nix {
     pname = "vim-cool";
-    version = "2020-04-18";
+    version = "2022-03-30";
     src = fetchFromGitHub {
       owner = "romainl";
       repo = "vim-cool";
-      rev = "27ad4ecf7532b750fadca9f36e1c5498fc225af2";
-      sha256 = "1in44gf7hs978nc9328zh1kj3jh04kcinw0m8spcbgj079782sg8";
+      rev = "0ad6a212a910cef0aac7af244ee008ddd39a75c2";
+      sha256 = "1jv3nl6vdn562zhd387yggwflncmy7vf89md5kkacmkvjz8rkis5";
     };
     meta.homepage = "https://github.com/romainl/vim-cool/";
   };
@@ -8082,18 +8130,6 @@ final: prev:
     meta.homepage = "https://github.com/ap/vim-css-color/";
   };
 
-  vim-CtrlXA = buildVimPluginFrom2Nix {
-    pname = "vim-CtrlXA";
-    version = "2021-08-09";
-    src = fetchFromGitHub {
-      owner = "Konfekt";
-      repo = "vim-CtrlXA";
-      rev = "404ea1e055921db5679b3734108d72850d6faa76";
-      sha256 = "10bgyqnwcqly3sxl27np1b690hnj1snqbcvg8pzh4zgdysfgy9xg";
-    };
-    meta.homepage = "https://github.com/Konfekt/vim-CtrlXA/";
-  };
-
   vim-cue = buildVimPluginFrom2Nix {
     pname = "vim-cue";
     version = "2021-06-18";
@@ -8178,18 +8214,6 @@ final: prev:
     meta.homepage = "https://github.com/sunaku/vim-dasht/";
   };
 
-  vim-DetectSpellLang = buildVimPluginFrom2Nix {
-    pname = "vim-DetectSpellLang";
-    version = "2022-03-15";
-    src = fetchFromGitHub {
-      owner = "konfekt";
-      repo = "vim-DetectSpellLang";
-      rev = "d5b55e3307e72e45f8d736818c76884016583538";
-      sha256 = "0l9bdgqaxfpndpf4v5kxn34zx5pnhf62chp4flzyyhhzlz52dqjw";
-    };
-    meta.homepage = "https://github.com/konfekt/vim-DetectSpellLang/";
-  };
-
   vim-deus = buildVimPluginFrom2Nix {
     pname = "vim-deus";
     version = "2021-03-28";
@@ -8298,18 +8322,6 @@ final: prev:
     meta.homepage = "https://github.com/jhradilek/vim-docbk/";
   };
 
-  vim-docbk-snippets = buildVimPluginFrom2Nix {
-    pname = "vim-docbk-snippets";
-    version = "2021-07-30";
-    src = fetchFromGitHub {
-      owner = "jhradilek";
-      repo = "vim-snippets";
-      rev = "81a8dcb66886a0717e9ca73c8857ee90c3989063";
-      sha256 = "0d6532qx66aiawpq2fdji0mnmvnlg5dnbvds5s4pgzafydikpr70";
-    };
-    meta.homepage = "https://github.com/jhradilek/vim-snippets/";
-  };
-
   vim-easy-align = buildVimPluginFrom2Nix {
     pname = "vim-easy-align";
     version = "2019-04-29";
@@ -8384,12 +8396,12 @@ final: prev:
 
   vim-elixir = buildVimPluginFrom2Nix {
     pname = "vim-elixir";
-    version = "2022-01-26";
+    version = "2022-03-29";
     src = fetchFromGitHub {
       owner = "elixir-editors";
       repo = "vim-elixir";
-      rev = "ff7a1223dfc5386c41bb582039a90a262d488607";
-      sha256 = "0a82c6vmdjfq1cjiakdxd9mz0ivqivrjcrppqpwch9rzp98qspag";
+      rev = "edf880c41ec1768faafc480433ae72ceffaf4362";
+      sha256 = "14jgwgwynynlipvmr02i9h4q2mc459fz4jyflcngvpyc9ady9ald";
     };
     meta.homepage = "https://github.com/elixir-editors/vim-elixir/";
   };
@@ -8420,12 +8432,12 @@ final: prev:
 
   vim-endwise = buildVimPluginFrom2Nix {
     pname = "vim-endwise";
-    version = "2022-03-24";
+    version = "2022-03-29";
     src = fetchFromGitHub {
       owner = "tpope";
       repo = "vim-endwise";
-      rev = "8faf48b69b04af120e162ce113ea21eac322e3b4";
-      sha256 = "0zfgsqs2mal1yh8x4lj1kx2ib80clsh9s9swh44cq5ga5glfkyn8";
+      rev = "720b3ee46a86fe8858baeed473e11bca54b997a9";
+      sha256 = "1rql1zbzi1ffj0bdw4qkm1rbb5zscxqaml0rx0rh4y3zr7ny7vny";
     };
     meta.homepage = "https://github.com/tpope/vim-endwise/";
   };
@@ -8480,12 +8492,12 @@ final: prev:
 
   vim-eunuch = buildVimPluginFrom2Nix {
     pname = "vim-eunuch";
-    version = "2022-03-23";
+    version = "2022-03-31";
     src = fetchFromGitHub {
       owner = "tpope";
       repo = "vim-eunuch";
-      rev = "01aa41b276b45e2df2cb680ab38e78ea7e5786c1";
-      sha256 = "149hnk9ja9vnw5vr7axliyqh0l2xz6i4l3lngdlzi1xic0xfwxf5";
+      rev = "c70b0ed50b5c0d806df012526104fc5342753749";
+      sha256 = "1pj6rzdwalnv3x8xdgfsqh79pc21b0lhlp6ry5yzjcprghw1547d";
     };
     meta.homepage = "https://github.com/tpope/vim-eunuch/";
   };
@@ -8540,12 +8552,12 @@ final: prev:
 
   vim-fireplace = buildVimPluginFrom2Nix {
     pname = "vim-fireplace";
-    version = "2022-03-11";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "tpope";
       repo = "vim-fireplace";
-      rev = "49f213283ffd79e1a397a30ce9e11849eaacf8e1";
-      sha256 = "0lk6xxbf111p1d75vagfhf1qydm1mzm4xycmyydfr46acy6a8hbk";
+      rev = "2e4540d62fd49523a3aefeab896a33ed6bbcb43b";
+      sha256 = "0h6ij4r5i6i72hkn8w7gw69asga7ka5addl74n2i1jhaznn7q1kb";
     };
     meta.homepage = "https://github.com/tpope/vim-fireplace/";
   };
@@ -8672,12 +8684,12 @@ final: prev:
 
   vim-fugitive = buildVimPluginFrom2Nix {
     pname = "vim-fugitive";
-    version = "2022-03-26";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "tpope";
       repo = "vim-fugitive";
-      rev = "321328c6c5901a597348155fc0e83b800544dcb0";
-      sha256 = "11sd87c9vw1gs9pkvv0y24yqhkack0yxv5mg50ss6v7mjjdngv66";
+      rev = "d725ef529e3de712304ab0f9c7e5e61107a00cad";
+      sha256 = "0sw3qxs7j2cqzbdcip4sphmi8jj0y665kacxpgjhry6xa36rh24l";
     };
     meta.homepage = "https://github.com/tpope/vim-fugitive/";
   };
@@ -8816,12 +8828,12 @@ final: prev:
 
   vim-go = buildVimPluginFrom2Nix {
     pname = "vim-go";
-    version = "2022-03-19";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "fatih";
       repo = "vim-go";
-      rev = "dcefd64ba251ffc3d497f8758036735c8f6cc824";
-      sha256 = "1j5jrs7kk59ilqsjs0qk5213psv33xnnifsqrjc7h63p28sv3pnw";
+      rev = "421563081bddaec1f7a66710b5c8ee305724d2a9";
+      sha256 = "0fddj4ara4zpdlri4r0rxbivr7xcf0zaakmq51m4b6k66q21f3fz";
     };
     meta.homepage = "https://github.com/fatih/vim-go/";
   };
@@ -8922,18 +8934,6 @@ final: prev:
     meta.homepage = "https://github.com/chkno/vim-haskell-module-name/";
   };
 
-  vim-haskellconceal = buildVimPluginFrom2Nix {
-    pname = "vim-haskellconceal";
-    version = "2017-06-15";
-    src = fetchFromGitHub {
-      owner = "twinside";
-      repo = "vim-haskellconceal";
-      rev = "802f82a5afee56e9e1251e6f756104a3bd114234";
-      sha256 = "1kh6853hi4rgl4z1xs8kz9l1q9w7lh0r42y2m0rabfpr6yh3091r";
-    };
-    meta.homepage = "https://github.com/twinside/vim-haskellconceal/";
-  };
-
   vim-haskellConcealPlus = buildVimPluginFrom2Nix {
     pname = "vim-haskellConcealPlus";
     version = "2020-01-21";
@@ -8946,6 +8946,18 @@ final: prev:
     meta.homepage = "https://github.com/enomsg/vim-haskellConcealPlus/";
   };
 
+  vim-haskellconceal = buildVimPluginFrom2Nix {
+    pname = "vim-haskellconceal";
+    version = "2017-06-15";
+    src = fetchFromGitHub {
+      owner = "twinside";
+      repo = "vim-haskellconceal";
+      rev = "802f82a5afee56e9e1251e6f756104a3bd114234";
+      sha256 = "1kh6853hi4rgl4z1xs8kz9l1q9w7lh0r42y2m0rabfpr6yh3091r";
+    };
+    meta.homepage = "https://github.com/twinside/vim-haskellconceal/";
+  };
+
   vim-hcl = buildVimPluginFrom2Nix {
     pname = "vim-hcl";
     version = "2022-02-25";
@@ -9117,12 +9129,12 @@ final: prev:
 
   vim-illuminate = buildVimPluginFrom2Nix {
     pname = "vim-illuminate";
-    version = "2022-03-13";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "RRethy";
       repo = "vim-illuminate";
-      rev = "487563de7ed6195fd46da178cb38dc1ff110c1ce";
-      sha256 = "1k4pzq1gxqpcrx828ywypff1cjrns34rh8q7yz1j8nhlqvgrda9s";
+      rev = "3b9b6481a659bdc37a55f488c92839e3804ca098";
+      sha256 = "1vki4g6gvmr6l9yb1xhv92yix2595b17j7m75ak15k25w1dnig7h";
     };
     meta.homepage = "https://github.com/RRethy/vim-illuminate/";
   };
@@ -9346,28 +9358,16 @@ final: prev:
 
   vim-kitty-navigator = buildVimPluginFrom2Nix {
     pname = "vim-kitty-navigator";
-    version = "2022-02-04";
+    version = "2022-03-27";
     src = fetchFromGitHub {
       owner = "knubie";
       repo = "vim-kitty-navigator";
-      rev = "8d9af030c8a74cdda6ab9a510d9a13bca80e8f9b";
-      sha256 = "03rf49w3x67aayfn6hl0jhf4gik1scq4khhnvicp1zabdn8cq175";
+      rev = "7bf84bc1253bebb86cbf63efa274a656e1faadc6";
+      sha256 = "126z01zqrpnkhi7kprl8kqwkr5ahxyrnx3pvzzmfqb9320v98d18";
     };
     meta.homepage = "https://github.com/knubie/vim-kitty-navigator/";
   };
 
-  vim-LanguageTool = buildVimPluginFrom2Nix {
-    pname = "vim-LanguageTool";
-    version = "2021-02-08";
-    src = fetchFromGitHub {
-      owner = "dpelle";
-      repo = "vim-LanguageTool";
-      rev = "0372ffae78aa3eac3bfa48ba3bf2f4015a86385a";
-      sha256 = "00476l49lczj1rw5gb6vs7s9r0zi1khw0g1v6bsfwl5r32699l7r";
-    };
-    meta.homepage = "https://github.com/dpelle/vim-LanguageTool/";
-  };
-
   vim-lastplace = buildVimPluginFrom2Nix {
     pname = "vim-lastplace";
     version = "2022-02-22";
@@ -10295,12 +10295,12 @@ final: prev:
 
   vim-projectionist = buildVimPluginFrom2Nix {
     pname = "vim-projectionist";
-    version = "2022-03-13";
+    version = "2022-03-29";
     src = fetchFromGitHub {
       owner = "tpope";
       repo = "vim-projectionist";
-      rev = "93b2af188fe0937edea414b8e05a362b74f4b31d";
-      sha256 = "13x66y0dp70s2wcz5jkcqyp1r44sn3xdn70khzgl3jlv94ij3s1y";
+      rev = "37f6867fb186191bbc99bfc9d7c465dce4b7f94e";
+      sha256 = "0siigy1p5iwn5nms94w22kzgajyscdzn8mcnwkmhxdzbs2c4nv9w";
     };
     meta.homepage = "https://github.com/tpope/vim-projectionist/";
   };
@@ -10497,30 +10497,6 @@ final: prev:
     meta.homepage = "https://github.com/tpope/vim-repeat/";
   };
 
-  vim-ReplaceWithRegister = buildVimPluginFrom2Nix {
-    pname = "vim-ReplaceWithRegister";
-    version = "2021-07-05";
-    src = fetchFromGitHub {
-      owner = "inkarkat";
-      repo = "vim-ReplaceWithRegister";
-      rev = "aad1e8fa31cb4722f20fe40679caa56e25120032";
-      sha256 = "1cfgixq5smwbp55x2baaj1kw736w2mykysppphair44vb4w9rlgm";
-    };
-    meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithRegister/";
-  };
-
-  vim-ReplaceWithSameIndentRegister = buildVimPluginFrom2Nix {
-    pname = "vim-ReplaceWithSameIndentRegister";
-    version = "2020-06-17";
-    src = fetchFromGitHub {
-      owner = "inkarkat";
-      repo = "vim-ReplaceWithSameIndentRegister";
-      rev = "0b7f542560bd21822a004e8accdf472eb477c9cf";
-      sha256 = "04zvhqh9rjfiwfk8r0zci608pw09svqb42nvp8pvqb11xp2ydg2y";
-    };
-    meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/";
-  };
-
   vim-rhubarb = buildVimPluginFrom2Nix {
     pname = "vim-rhubarb";
     version = "2021-09-13";
@@ -10739,12 +10715,12 @@ final: prev:
 
   vim-sleuth = buildVimPluginFrom2Nix {
     pname = "vim-sleuth";
-    version = "2022-03-26";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "tpope";
       repo = "vim-sleuth";
-      rev = "edffd9ee2cfafa3aba291f105a1d4f9f0e2d5701";
-      sha256 = "1rkn4qawz3p0h1pz0g712k3iz72qvapqd8k1f05kbabxymw6yqd7";
+      rev = "aade27e2b1a47ae2261d95a4dd622ca2c3d34227";
+      sha256 = "1xwav2657qhqaxsql50dh20n7r5n97xb2xb990wikf34mi9j4pn4";
     };
     meta.homepage = "https://github.com/tpope/vim-sleuth/";
   };
@@ -10835,12 +10811,12 @@ final: prev:
 
   vim-snippets = buildVimPluginFrom2Nix {
     pname = "vim-snippets";
-    version = "2022-03-27";
+    version = "2022-04-02";
     src = fetchFromGitHub {
       owner = "honza";
       repo = "vim-snippets";
-      rev = "57d23f6f44203374edcbb7d41903a491ec8cbed7";
-      sha256 = "0371pv4pl99icxhbqbqfx7ds1i1kwv1k9p28i5pxayngkyhd7l39";
+      rev = "c6d4b1cfa7a349ca561b86227cb46c4147b9c23c";
+      sha256 = "0idmrcb4xigmds1iwz5rixvdcanqvv0qx7v3yg4d4p1xd4yjsiw1";
     };
     meta.homepage = "https://github.com/honza/vim-snippets/";
   };
@@ -11013,18 +10989,6 @@ final: prev:
     meta.homepage = "https://github.com/machakann/vim-swap/";
   };
 
-  vim-SyntaxRange = buildVimPluginFrom2Nix {
-    pname = "vim-SyntaxRange";
-    version = "2021-01-16";
-    src = fetchFromGitHub {
-      owner = "inkarkat";
-      repo = "vim-SyntaxRange";
-      rev = "3a7fd9ff50fabafe61df12522ed2f275c8e2f45e";
-      sha256 = "1b5xyacbn87z8wkacjpnjk82xmxzivlb111427kwb5kxxdh4w7gq";
-    };
-    meta.homepage = "https://github.com/inkarkat/vim-SyntaxRange/";
-  };
-
   vim-table-mode = buildVimPluginFrom2Nix {
     pname = "vim-table-mode";
     version = "2022-03-01";
@@ -11662,18 +11626,6 @@ final: prev:
     meta.homepage = "https://github.com/jreybert/vimagit/";
   };
 
-  VimCompletesMe = buildVimPluginFrom2Nix {
-    pname = "VimCompletesMe";
-    version = "2022-02-18";
-    src = fetchFromGitHub {
-      owner = "ackyshake";
-      repo = "VimCompletesMe";
-      rev = "9adf692d7ae6424038458a89d4a411f0a27d1388";
-      sha256 = "1sndgb3291dyifaa8adri2mb8cgbinbar3nw1fnf67k9ahwycaz0";
-    };
-    meta.homepage = "https://github.com/ackyshake/VimCompletesMe/";
-  };
-
   vimelette = buildVimPluginFrom2Nix {
     pname = "vimelette";
     version = "2019-05-02";
@@ -11698,18 +11650,6 @@ final: prev:
     meta.homepage = "https://github.com/Shougo/vimfiler.vim/";
   };
 
-  VimOrganizer = buildVimPluginFrom2Nix {
-    pname = "VimOrganizer";
-    version = "2020-12-15";
-    src = fetchFromGitHub {
-      owner = "hsitz";
-      repo = "VimOrganizer";
-      rev = "09636aed78441a9de2767fcef6d7c567f322cc40";
-      sha256 = "0phpcxmyz562yyp88rbx9pqg46w8r1lyapb700nvxwvqkcd82pfw";
-    };
-    meta.homepage = "https://github.com/hsitz/VimOrganizer/";
-  };
-
   vimoutliner = buildVimPluginFrom2Nix {
     pname = "vimoutliner";
     version = "2021-04-24";
@@ -11772,12 +11712,12 @@ final: prev:
 
   vimspector = buildVimPluginFrom2Nix {
     pname = "vimspector";
-    version = "2022-03-23";
+    version = "2022-03-29";
     src = fetchFromGitHub {
       owner = "puremourning";
       repo = "vimspector";
-      rev = "99ce7a74699f12e05bf6059125d767b05ceb212b";
-      sha256 = "0hj26vyq8cbw5zsq94i4hay27fs9z5xxyniflz975ddii8189qa9";
+      rev = "e4b5c76b9c9e333f7cdc853af42e7ef12a1d5e58";
+      sha256 = "15ycns70fafhi0nx7sriv9fkxnkkg7hz7amc1pz5rhpnns78gbnz";
       fetchSubmodules = true;
     };
     meta.homepage = "https://github.com/puremourning/vimspector/";
@@ -11785,12 +11725,12 @@ final: prev:
 
   vimtex = buildVimPluginFrom2Nix {
     pname = "vimtex";
-    version = "2022-03-24";
+    version = "2022-04-01";
     src = fetchFromGitHub {
       owner = "lervag";
       repo = "vimtex";
-      rev = "4eccec4e9fc46a52ba832ac2f8ab749ea33d6790";
-      sha256 = "07mydwxqhk9l0ciqpczd51x4s58asmqa3f0bznw7cdvp9qa6a6sn";
+      rev = "3c14f6912318ac3d92d32eca7d66c7c1c4f3e92c";
+      sha256 = "1wnj1j38gs6xcdyhia6cmd010rv2g85s816hxd1qc1zlimfvi5gr";
     };
     meta.homepage = "https://github.com/lervag/vimtex/";
   };
@@ -11855,18 +11795,6 @@ final: prev:
     meta.homepage = "https://github.com/liuchengxu/vista.vim/";
   };
 
-  Vundle-vim = buildVimPluginFrom2Nix {
-    pname = "Vundle.vim";
-    version = "2019-08-17";
-    src = fetchFromGitHub {
-      owner = "VundleVim";
-      repo = "Vundle.vim";
-      rev = "b255382d6242d7ea3877bf059d2934125e0c4d95";
-      sha256 = "0fkmklcq3fgvd6x6irz9bgyvcdaxafykk3k89gsi9p6b0ikw3rw6";
-    };
-    meta.homepage = "https://github.com/VundleVim/Vundle.vim/";
-  };
-
   wal-vim = buildVimPluginFrom2Nix {
     pname = "wal.vim";
     version = "2020-11-08";
@@ -11905,12 +11833,12 @@ final: prev:
 
   wilder-nvim = buildVimPluginFrom2Nix {
     pname = "wilder.nvim";
-    version = "2022-03-13";
+    version = "2022-04-03";
     src = fetchFromGitHub {
       owner = "gelguy";
       repo = "wilder.nvim";
-      rev = "b59648ad8588bcba377f4eecdea317796ebd1f9d";
-      sha256 = "0aic96isjssgmlqkr30m9j3895v27f3hgkgsqbl3zwkvjqa218d6";
+      rev = "9c33d9423a3ba205ecdb90ce8a677c2b26f04908";
+      sha256 = "19dv7ai4hs04m00w37d7bmb4c5zakfpj3mhgl15ddc6bpk3sbd7h";
     };
     meta.homepage = "https://github.com/gelguy/wilder.nvim/";
   };
@@ -12011,18 +11939,6 @@ final: prev:
     meta.homepage = "https://github.com/guns/xterm-color-table.vim/";
   };
 
-  YankRing-vim = buildVimPluginFrom2Nix {
-    pname = "YankRing.vim";
-    version = "2015-07-29";
-    src = fetchFromGitHub {
-      owner = "vim-scripts";
-      repo = "YankRing.vim";
-      rev = "28854abef8fa4ebd3cb219aefcf22566997d8f65";
-      sha256 = "0zdp8pdsqgrh6lfw8ipjhrig6psvmdxkim9ik801y3r373sk2hxw";
-    };
-    meta.homepage = "https://github.com/vim-scripts/YankRing.vim/";
-  };
-
   yats-vim = buildVimPluginFrom2Nix {
     pname = "yats.vim";
     version = "2022-01-05";
@@ -12036,31 +11952,6 @@ final: prev:
     meta.homepage = "https://github.com/HerringtonDarkholme/yats.vim/";
   };
 
-  YouCompleteMe = buildVimPluginFrom2Nix {
-    pname = "YouCompleteMe";
-    version = "2022-03-23";
-    src = fetchFromGitHub {
-      owner = "ycm-core";
-      repo = "YouCompleteMe";
-      rev = "89bba25c96866662ca38c2428f73eb64b0351ba3";
-      sha256 = "0yrhvd9c0g6ay02b77sr657hn7ambcifwjfqsjywmnirr4zja45p";
-      fetchSubmodules = true;
-    };
-    meta.homepage = "https://github.com/ycm-core/YouCompleteMe/";
-  };
-
-  YUNOcommit-vim = buildVimPluginFrom2Nix {
-    pname = "YUNOcommit.vim";
-    version = "2014-11-26";
-    src = fetchFromGitHub {
-      owner = "esneider";
-      repo = "YUNOcommit.vim";
-      rev = "981082055a73ef076d7e27477874d2303153a448";
-      sha256 = "0mjc7fn405vcx1n7vadl98p5wgm6jxrlbdbkqgjq8f1m1ir81zab";
-    };
-    meta.homepage = "https://github.com/esneider/YUNOcommit.vim/";
-  };
-
   zeavim-vim = buildVimPluginFrom2Nix {
     pname = "zeavim.vim";
     version = "2019-06-07";
@@ -12145,4 +12036,124 @@ final: prev:
     meta.homepage = "https://github.com/nanotee/zoxide.vim/";
   };
 
+  catppuccin-nvim = buildVimPluginFrom2Nix {
+    pname = "catppuccin-nvim";
+    version = "2022-03-20";
+    src = fetchFromGitHub {
+      owner = "catppuccin";
+      repo = "nvim";
+      rev = "f079dda3dc23450d69b4bad11bfbd9af2c77f6f3";
+      sha256 = "1w0n96fbrkm3vdl64v1yzkly8wpcn5g9qflmpb8r1ww9hhig7a38";
+    };
+    meta.homepage = "https://github.com/catppuccin/nvim/";
+  };
+
+  chad = buildVimPluginFrom2Nix {
+    pname = "chad";
+    version = "2022-04-03";
+    src = fetchFromGitHub {
+      owner = "ms-jpq";
+      repo = "chadtree";
+      rev = "08f66a1e9f6befe914a554db90c047fe47d7e228";
+      sha256 = "1dgbddn69cd8s3mbav5rs22h6ng065p27kv4wwa2s6zn27wnysky";
+    };
+    meta.homepage = "https://github.com/ms-jpq/chadtree/";
+  };
+
+  dracula-vim = buildVimPluginFrom2Nix {
+    pname = "dracula-vim";
+    version = "2022-03-24";
+    src = fetchFromGitHub {
+      owner = "dracula";
+      repo = "vim";
+      rev = "d7723a842a6cfa2f62cf85530ab66eb418521dc2";
+      sha256 = "1qzil8rwpdzf64gq63ds0cf509ldam77l3fz02g1mia5dry75r02";
+    };
+    meta.homepage = "https://github.com/dracula/vim/";
+  };
+
+  embark-vim = buildVimPluginFrom2Nix {
+    pname = "embark-vim";
+    version = "2022-03-28";
+    src = fetchFromGitHub {
+      owner = "embark-theme";
+      repo = "vim";
+      rev = "a57dbdbd2790c52563e1194c17e6de38a0c941cf";
+      sha256 = "07yzy4yjxaf59b6pyf05jrawvc4y37v2x07n1vfc2dbsxkxdygq1";
+    };
+    meta.homepage = "https://github.com/embark-theme/vim/";
+  };
+
+  gruvbox-community = buildVimPluginFrom2Nix {
+    pname = "gruvbox-community";
+    version = "2022-03-06";
+    src = fetchFromGitHub {
+      owner = "gruvbox-community";
+      repo = "gruvbox";
+      rev = "b6f47ae7031f6746a1f1918c17574aa12c474ef0";
+      sha256 = "0m8rrm5v542a2c30sg7hlgm7r6gs4ah1n6nr5dc101l2064kg97g";
+    };
+    meta.homepage = "https://github.com/gruvbox-community/gruvbox/";
+  };
+
+  mattn-calendar-vim = buildVimPluginFrom2Nix {
+    pname = "mattn-calendar-vim";
+    version = "2022-02-10";
+    src = fetchFromGitHub {
+      owner = "mattn";
+      repo = "calendar-vim";
+      rev = "2083a41e2d310f9bbbbf644517f30e901f1fb04d";
+      sha256 = "13wakcprkh93i7afykkpavxqvxssjh573pjjljsgip3y3778ms5q";
+    };
+    meta.homepage = "https://github.com/mattn/calendar-vim/";
+  };
+
+  pure-lua = buildVimPluginFrom2Nix {
+    pname = "pure-lua";
+    version = "2021-05-16";
+    src = fetchFromGitHub {
+      owner = "shaunsingh";
+      repo = "moonlight.nvim";
+      rev = "e24e4218ec680b6396532808abf57ca0ada82e66";
+      sha256 = "0m9w3fpypsqxydjd93arbjqb5576nl40iy27i4ijlrqhgdhl49y3";
+    };
+    meta.homepage = "https://github.com/shaunsingh/moonlight.nvim/";
+  };
+
+  release = buildVimPluginFrom2Nix {
+    pname = "release";
+    version = "2022-04-02";
+    src = fetchFromGitHub {
+      owner = "neoclide";
+      repo = "coc.nvim";
+      rev = "d6a665bb13044d4899e2a3529c3ca68104d9b2f5";
+      sha256 = "0pgzygvn5x2szm0fz12rlbblf1pk92r8p5fn8c7frxnmb2nsgsvd";
+    };
+    meta.homepage = "https://github.com/neoclide/coc.nvim/";
+  };
+
+  rose-pine = buildVimPluginFrom2Nix {
+    pname = "rose-pine";
+    version = "2022-04-01";
+    src = fetchFromGitHub {
+      owner = "rose-pine";
+      repo = "neovim";
+      rev = "40c4fd7f5551710e388e0df85bb43d6e1627ca80";
+      sha256 = "0ihzf18146q9bkqa22jq6xa2i394y6bn3fnjjgjz3zf8g8pcr6bl";
+    };
+    meta.homepage = "https://github.com/rose-pine/neovim/";
+  };
+
+  vim-docbk-snippets = buildVimPluginFrom2Nix {
+    pname = "vim-docbk-snippets";
+    version = "2021-07-30";
+    src = fetchFromGitHub {
+      owner = "jhradilek";
+      repo = "vim-snippets";
+      rev = "81a8dcb66886a0717e9ca73c8857ee90c3989063";
+      sha256 = "0d6532qx66aiawpq2fdji0mnmvnlg5dnbvds5s4pgzafydikpr70";
+    };
+    meta.homepage = "https://github.com/jhradilek/vim-snippets/";
+  };
+
 }
diff --git a/pkgs/applications/editors/vim/plugins/vim-plugin-names b/pkgs/applications/editors/vim/plugins/vim-plugin-names
index f138c6d42d9..6845738e8a4 100644
--- a/pkgs/applications/editors/vim/plugins/vim-plugin-names
+++ b/pkgs/applications/editors/vim/plugins/vim-plugin-names
@@ -1,1010 +1,1012 @@
-907th/vim-auto-save
-aca/completion-tabnine
-AckslD/nvim-neoclip.lua
-AckslD/nvim-whichkey-setup.lua
-ackyshake/Spacegray.vim
-ackyshake/VimCompletesMe
-ahmedkhalf/lsp-rooter.nvim
-ahmedkhalf/project.nvim
-airblade/vim-gitgutter
-airblade/vim-rooter
-ajmwagar/vim-deus
-akinsho/bufferline.nvim
-akinsho/toggleterm.nvim
-aklt/plantuml-syntax
-allendang/nvim-expand-expr
-AlphaTechnolog/pywal.nvim
-altercation/vim-colors-solarized
-alvan/vim-closetag
-alvarosevilla95/luatab.nvim
-alx741/vim-hindent
-alx741/vim-stylishask
-AmeerTaweel/todo.nvim
-amiorin/ctrlp-z
-andersevenrud/cmp-tmux
-andersevenrud/nordic.nvim
-andrep/vimacs
-andreshazard/vim-logreview
-AndrewRadev/sideways.vim
-AndrewRadev/splitjoin.vim
-AndrewRadev/switch.vim
-AndrewRadev/tagalong.vim
-andsild/peskcolor.vim
-andviro/flake8-vim
-andweeb/presence.nvim
-andymass/vim-matchup
-andys8/vim-elm-syntax
-antoinemadec/coc-fzf
-antoinemadec/FixCursorHold.nvim
-ap/vim-css-color
-arcticicestudio/nord-vim@master
-arkav/lualine-lsp-progress
-arthurxavierx/vim-unicoder
-artur-shaik/vim-javacomplete2
-autozimu/LanguageClient-neovim
-axelf4/vim-strip-trailing-whitespace
-axieax/urlview.nvim
-ayu-theme/ayu-vim
-b0o/SchemaStore.nvim
-b3nj5m1n/kommentary
-bakpakin/fennel.vim
-bazelbuild/vim-bazel
-bbchung/clighter8
-BeneCollyridam/futhark-vim
-benizi/vim-automkdir
-bhurlow/vim-parinfer
-bitc/vim-hdevtools
-bkad/camelcasemotion
-bling/vim-bufferline
-blueballs-theme/blueballs-neovim
-blueyed/vim-diminactive
-bogado/file-line
-bohlender/vim-smt2
-brennanfee/vim-gui-position
-bronson/vim-trailing-whitespace
-brooth/far.vim
-buoto/gotests-vim
-camspiers/lens.vim
-camspiers/snap
-carlitux/deoplete-ternjs
-catppuccin/nvim as catppuccin-nvim
-ccarpita/rtorrent-syntax-file
-cespare/vim-toml
-chaoren/vim-wordmotion
-chentau/marks.nvim
-chikatoike/concealedyank.vim
-chikatoike/sourcemap.vim
-chkno/vim-haskell-module-name
-chr4/nginx.vim
-chr4/sslsecure.vim
-chrisbra/CheckAttach
-chrisbra/csv.vim
-chrisbra/NrrwRgn
-chrisbra/Recover.vim
-chrisbra/SudoEdit.vim
-chrisbra/unicode.vim
-chrisgeo/sparkup
-chriskempson/base16-vim
-ChristianChiarulli/nvcode-color-schemes.vim
-christoomey/vim-sort-motion
-christoomey/vim-tmux-navigator
-ciaranm/inkpot
-ckarnell/antonys-macro-repeater
-clojure-vim/vim-jack-in
-cloudhead/neovim-fuzzy
-CoatiSoftware/vim-sourcetrail
-coc-extensions/coc-svelte
-cocopon/iceberg.vim
-codota/tabnine-vim
-cohama/lexima.vim
-ConradIrwin/vim-bracketed-paste
-crusoexia/vim-monokai
-ctjhoa/spacevim
-ctrlpvim/ctrlp.vim
-dag/vim-fish
-dag/vim2hs
-dannyob/quickfixstatus
-darfink/starsearch.vim
-dart-lang/dart-vim-plugin
-david-a-wheeler/vim-metamath
-davidhalter/jedi-vim
-dcharbon/vim-flatbuffers
-dense-analysis/ale
-deoplete-plugins/deoplete-clang
-deoplete-plugins/deoplete-dictionary
-deoplete-plugins/deoplete-go
-deoplete-plugins/deoplete-jedi
-deoplete-plugins/deoplete-lsp
-deoplete-plugins/deoplete-zsh
-derekelkins/agda-vim
-derekwyatt/vim-scala
-dhruvasagar/vim-prosession
-dhruvasagar/vim-table-mode
-digitaltoad/vim-pug
-direnv/direnv.vim
-dleonard0/pony-vim-syntax
-dmix/elvish.vim
-doki-theme/doki-theme-vim
-dominikduda/vim_current_word
-dpelle/vim-LanguageTool
-dracula/vim as dracula-vim
-drewtempelmeyer/palenight.vim
-drmingdrmer/xptemplate
-dstein64/nvim-scrollview
-dstein64/vim-startuptime
-dylanaraps/wal.vim
-eagletmt/ghcmod-vim
-eagletmt/neco-ghc
-easymotion/vim-easymotion
-echasnovski/mini.nvim
-eddiebergman/nvim-treesitter-pyfold
-eddyekofo94/gruvbox-flat.nvim
-EdenEast/nightfox.nvim
-editorconfig/editorconfig-vim
-edkolev/tmuxline.vim
-edluffy/hologram.nvim
-edluffy/specs.nvim
-edwinb/idris2-vim
-ehamberg/vim-cute-python
-eigenfoo/stan-vim
-eikenb/acp
-elixir-editors/vim-elixir
-ellisonleao/glow.nvim
-ellisonleao/gruvbox.nvim
-elmcast/elm-vim
-elzr/vim-json
-embark-theme/vim as embark-vim
-embear/vim-localvimrc
-enomsg/vim-haskellConcealPlus
-enricobacis/vim-airline-clock
-ervandew/supertab
-esneider/YUNOcommit.vim
-euclidianAce/BetterLua.vim
-euclio/vim-markdown-composer
-evanleck/vim-svelte
-f-person/git-blame.nvim
-f3fora/cmp-spell
-famiu/bufdelete.nvim
-fannheyward/telescope-coc.nvim
-farmergreg/vim-lastplace
-fatih/vim-go
-fcpg/vim-osc52
-FelikZ/ctrlp-py-matcher
-feline-nvim/feline.nvim
-fenetikm/falcon
-fhill2/floating.nvim
-fhill2/telescope-ultisnips.nvim
-fiatjaf/neuron.vim
-filipdutescu/renamer.nvim
-fisadev/vim-isort
-flazz/vim-colorschemes
-floobits/floobits-neovim
-folke/lsp-colors.nvim
-folke/lua-dev.nvim
-folke/todo-comments.nvim
-folke/tokyonight.nvim
-folke/trouble.nvim
-folke/twilight.nvim
-folke/which-key.nvim
-folke/zen-mode.nvim
-FooSoft/vim-argwrap
-freitass/todo.txt-vim
-frigoeu/psc-ide-vim
-fruit-in/brainfuck-vim
-fruit-in/vim-nong-theme
-fsharp/vim-fsharp
-garbas/vim-snipmate
-gbrlsnchs/telescope-lsp-handlers.nvim
-gcmt/taboo.vim
-gcmt/wildfire.vim
-gelguy/wilder.nvim
-gennaro-tedesco/nvim-jqx
-gennaro-tedesco/nvim-peekup
-gentoo/gentoo-syntax
-GEverding/vim-hocon
-gfanto/fzf-lsp.nvim
-ggandor/lightspeed.nvim
-gibiansky/vim-textobj-haskell
-gioele/vim-autoswap
-github/copilot.vim
-gleam-lang/gleam.vim
-glepnir/dashboard-nvim
-glepnir/oceanic-material
-glepnir/zephyr-nvim
-glts/vim-textobj-comment
-godlygeek/csapprox
-godlygeek/tabular
-GoldsteinE/compe-latex-symbols
-google/vim-codefmt
-google/vim-jsonnet
-google/vim-maktaba
-gorkunov/smartpairs.vim
-gotcha/vimelette
-gpanders/editorconfig.nvim
-gregsexton/gitv
-gruvbox-community/gruvbox as gruvbox-community
-gu-fan/riv.vim
-guns/vim-clojure-highlight
-guns/vim-clojure-static
-guns/vim-sexp
-guns/xterm-color-table.vim
-GustavoKatel/telescope-asynctasks.nvim
-gyim/vim-boxdraw
-haringsrob/nvim_context_vt
-hashivim/vim-packer
-hashivim/vim-terraform
-hashivim/vim-vagrant
-hauleth/sad.vim
-haya14busa/incsearch-easymotion.vim
-haya14busa/incsearch.vim
-haya14busa/is.vim
-haya14busa/vim-asterisk
-haya14busa/vim-poweryank
-heavenshell/vim-jsdoc
-hecal3/vim-leader-guide
-henrik/vim-indexed-search
-HerringtonDarkholme/yats.vim
-honza/vim-snippets
-hotwatermorning/auto-git-diff
-hrsh7th/cmp-buffer
-hrsh7th/cmp-calc
-hrsh7th/cmp-cmdline
-hrsh7th/cmp-emoji
-hrsh7th/cmp-nvim-lsp
-hrsh7th/cmp-nvim-lsp-document-symbol
-hrsh7th/cmp-nvim-lua
-hrsh7th/cmp-omni
-hrsh7th/cmp-path
-hrsh7th/cmp-vsnip
-hrsh7th/nvim-cmp
-hrsh7th/nvim-compe
-hrsh7th/vim-vsnip
-hrsh7th/vim-vsnip-integ
-hsanson/vim-android
-hsitz/VimOrganizer
-https://git.sr.ht/~whynothugo/lsp_lines.nvim
-hura/vim-asymptote
-iamcco/coc-spell-checker
-iamcco/coc-tailwindcss
-iamcco/markdown-preview.nvim
-ianks/vim-tsx
-idanarye/vim-merginal
-idris-hackers/idris-vim
-Inazuma110/deoplete-greek
-inkarkat/vim-ReplaceWithRegister
-inkarkat/vim-ReplaceWithSameIndentRegister
-inkarkat/vim-SyntaxRange
-int3/vim-extradite
-Iron-E/nvim-highlite
-ishan9299/nvim-solarized-lua
-itchyny/calendar.vim
-itchyny/lightline.vim
-itchyny/thumbnail.vim
-itchyny/vim-cursorword
-itchyny/vim-gitbranch
-itspriddle/vim-shellcheck
-ivalkeen/vim-simpledb
-ivanov/vim-ipython
-j-hui/fidget.nvim
-jackguo380/vim-lsp-cxx-highlight
-jacoborus/tender.vim
-jakwings/vim-pony
-jamessan/vim-gnupg
-jaredgorski/SpaceCamp
-jasonccox/vim-wayland-clipboard
-jaxbot/semantic-highlight.vim
-JazzCore/ctrlp-cmatcher
-jbyuki/venn.nvim
-jc-doyle/cmp-pandoc-references
-jceb/vim-hier
-jceb/vim-orgmode
-jeetsukumaran/vim-buffergator
-jeetsukumaran/vim-indentwise
-jeffkreeftmeijer/neovim-sensible
-jeffkreeftmeijer/vim-numbertoggle
-jelera/vim-javascript-syntax
-jgdavey/tslime.vim
-jghauser/mkdir.nvim@main
-jhradilek/vim-docbk
-jhradilek/vim-snippets as vim-docbk-snippets
-jiangmiao/auto-pairs
-jistr/vim-nerdtree-tabs
-jjo/vim-cue
-jlanzarotta/bufexplorer
-jlesquembre/nterm.nvim
-jnurmine/zenburn
-jonbri/vim-colorstepper
-jonsmithers/vim-html-template-literals
-joonty/vim-xdebug
-joosepalviste/nvim-ts-context-commentstring
-jordwalke/vim-reasonml
-josa42/coc-lua
-josa42/nvim-lightline-lsp
-josa42/vim-lightline-coc
-jose-elias-alvarez/minsnip.nvim
-jose-elias-alvarez/null-ls.nvim
-jose-elias-alvarez/nvim-lsp-ts-utils
-joshdick/onedark.vim
-jpalardy/vim-slime
-jparise/vim-graphql
-jparise/vim-phabricator
-jreybert/vimagit
-jsfaint/gen_tags.vim
-JuliaEditorSupport/deoplete-julia
-JuliaEditorSupport/julia-vim
-Julian/lean.nvim
-Julian/vim-textobj-variable-segment
-juliosueiras/vim-terraform-completion
-junegunn/fzf.vim
-junegunn/goyo.vim
-junegunn/gv.vim
-junegunn/limelight.vim
-junegunn/seoul256.vim
-junegunn/vader.vim
-junegunn/vim-after-object
-junegunn/vim-easy-align
-junegunn/vim-emoji
-junegunn/vim-github-dashboard
-junegunn/vim-peekaboo
-junegunn/vim-plug
-junegunn/vim-slash
-justincampbell/vim-eighties
-justinj/vim-pico8-syntax
-justinmk/vim-dirvish
-justinmk/vim-sneak
-jvgrootveld/telescope-zoxide
-jvirtanen/vim-hcl
-jvoorhis/coq.vim
-KabbAmine/vCoolor.vim
-KabbAmine/zeavim.vim
-kalbasit/vim-colemak
-kana/vim-niceblock
-kana/vim-operator-replace
-kana/vim-operator-user
-kana/vim-tabpagecd
-kana/vim-textobj-entire
-kana/vim-textobj-function
-kana/vim-textobj-user
-karb94/neoscroll.nvim
-kassio/neoterm
-kbenzie/vim-spirv
-kchmck/vim-coffee-script
-kdheepak/cmp-latex-symbols
-kdheepak/lazygit.nvim
-kdheepak/tabline.nvim
-KeitaNakamura/neodark.vim
-KeitaNakamura/tex-conceal.vim
-keith/investigate.vim
-keith/rspec.vim
-keith/swift.vim
-kevinhwang91/nvim-bqf
-kevinhwang91/nvim-hlslens
-kevinhwang91/rnvimr
-kien/rainbow_parentheses.vim
-knubie/vim-kitty-navigator
-konfekt/fastfold
-Konfekt/vim-alias
-Konfekt/vim-CtrlXA
-konfekt/vim-DetectSpellLang
-kosayoda/nvim-lightbulb
-kovisoft/slimv
-kristijanhusak/defx-git
-kristijanhusak/defx-icons
-kristijanhusak/deoplete-phpactor
-kristijanhusak/vim-carbon-now-sh
-kristijanhusak/vim-dadbod-completion
-kristijanhusak/vim-dadbod-ui
-kristijanhusak/vim-dirvish-git
-kristijanhusak/vim-hybrid-material
-kshenoy/vim-signature
-kyazdani42/nvim-tree.lua
-kyazdani42/nvim-web-devicons
-l3mon4d3/luasnip
-lambdalisue/fern.vim
-lambdalisue/gina.vim
-lambdalisue/suda.vim
-lambdalisue/vim-gista
-lambdalisue/vim-manpager
-lambdalisue/vim-pager
-latex-box-team/latex-box
-ldelossa/litee-calltree.nvim
-ldelossa/litee-filetree.nvim
-ldelossa/litee-symboltree.nvim
-ldelossa/litee.nvim
-leafgarland/typescript-vim
-leanprover/lean.vim
-ledger/vim-ledger
-lepture/vim-jinja
-lervag/vimtex
-lewis6991/gitsigns.nvim
-lewis6991/impatient.nvim
-lf-lang/lingua-franca.vim
-lfe-support/vim-lfe
-lfilho/cosco.vim
-lifepillar/pgsql.vim
-lifepillar/vim-gruvbox8
-lifepillar/vim-mucomplete
-lighttiger2505/deoplete-vim-lsp
-lilydjwg/colorizer
-lilydjwg/fcitx.vim@fcitx5
-liuchengxu/graphviz.vim
-liuchengxu/space-vim
-liuchengxu/vim-clap
-liuchengxu/vim-which-key
-liuchengxu/vista.vim
-LnL7/vim-nix
-lotabout/skim.vim
-luan/vim-concourse
-LucHermitte/lh-brackets
-LucHermitte/lh-vim-lib
-ludovicchabant/vim-gutentags
-ludovicchabant/vim-lawrencium
-lukas-reineke/cmp-under-comparator
-lukas-reineke/indent-blankline.nvim
-lukaszkorecki/workflowish
-lumiliet/vim-twig
-luochen1990/rainbow
-luukvbaal/stabilize.nvim
-lyokha/vim-xkbswitch
-m-pilia/vim-ccls
-machakann/vim-highlightedyank
-machakann/vim-sandwich
-machakann/vim-swap
-maksimr/vim-jsbeautify
-MarcWeber/vim-addon-actions
-MarcWeber/vim-addon-async
-MarcWeber/vim-addon-background-cmd
-MarcWeber/vim-addon-commenting
-MarcWeber/vim-addon-completion
-MarcWeber/vim-addon-errorformats
-MarcWeber/vim-addon-goto-thing-at-cursor
-MarcWeber/vim-addon-local-vimrc
-MarcWeber/vim-addon-manager
-MarcWeber/vim-addon-mru
-MarcWeber/vim-addon-mw-utils
-MarcWeber/vim-addon-nix
-MarcWeber/vim-addon-other
-MarcWeber/vim-addon-php-manual
-MarcWeber/vim-addon-signs
-MarcWeber/vim-addon-sql
-MarcWeber/vim-addon-syntax-checker
-MarcWeber/vim-addon-toggle-buffer
-MarcWeber/vim-addon-xdebug
-marko-cerovac/material.nvim
-markonm/traces.vim
-martinda/Jenkinsfile-vim-syntax
-MattesGroeger/vim-bookmarks
-mattn/calendar-vim as mattn-calendar-vim
-mattn/emmet-vim
-mattn/vim-gist
-mattn/webapi-vim
-matze/vim-move
-max397574/better-escape.nvim
-maximbaz/lightline-ale
-maxjacobson/vim-fzf-coauthorship
-MaxMEllon/vim-jsx-pretty
-mbbill/undotree
-mboughaba/i3config.vim
-mcchrish/nnn.vim
-megaannum/forms
-megaannum/self
-mengelbrecht/lightline-bufferline
-metakirby5/codi.vim
-metalelf0/jellybeans-nvim
-mfukar/robotframework-vim
-mfussenegger/nvim-dap
-mfussenegger/nvim-jdtls
-mfussenegger/nvim-lint
-mg979/vim-visual-multi
-mg979/vim-xtabline
-mhartington/formatter.nvim
-mhartington/oceanic-next
-mhinz/vim-crates
-mhinz/vim-grepper
-mhinz/vim-janah
-mhinz/vim-sayonara@7e774f58c5865d9c10d40396850b35ab95af17c5
-mhinz/vim-signify
-mhinz/vim-startify
-michaeljsmith/vim-indent-object
-mileszs/ack.vim
-milkypostman/vim-togglelist
-mindriot101/vim-yapf
-mk12/vim-lean
-mkasa/lushtags
-mlr-msft/vim-loves-dafny
-moll/vim-bbye
-mopp/sky-color-clock.vim
-morhetz/gruvbox
-motus/pig.vim
-mpickering/hlint-refactor-vim
-ms-jpq/chadtree@chad
-ms-jpq/coq_nvim
-mtikekar/vim-bsv
-MunifTanjim/nui.nvim@main
-mustache/vim-mustache-handlebars
-mzlogin/vim-markdown-toc
-mzlogin/vim-smali
-nacro90/numb.nvim
-nanotech/jellybeans.vim
-nanotee/zoxide.vim
-natebosch/vim-lsc
-nathanaelkane/vim-indent-guides
-nathangrigg/vim-beancount
-nathanmsmith/nvim-ale-diagnostic
-navarasu/onedark.nvim
-navicore/vissort.vim
-nbouscal/vim-stylish-haskell
-ncm2/float-preview.nvim
-ncm2/ncm2
-ncm2/ncm2-bufword
-ncm2/ncm2-cssomni
-ncm2/ncm2-github
-ncm2/ncm2-html-subscope
-ncm2/ncm2-jedi
-ncm2/ncm2-markdown-subscope
-ncm2/ncm2-neoinclude
-ncm2/ncm2-neosnippet
-ncm2/ncm2-path
-ncm2/ncm2-syntax
-ncm2/ncm2-tagprefix
-ncm2/ncm2-tmux
-ncm2/ncm2-ultisnips
-ncm2/ncm2-vim
-ndmitchell/ghcid
-neoclide/coc-denite
-neoclide/coc-neco
-neoclide/coc.nvim@release
-neoclide/denite-extra
-neoclide/denite-git
-neoclide/jsonc.vim
-neoclide/vim-easygit
-neomake/neomake
-neovim/nvim-lspconfig
-neovim/nvimdev.nvim
-neovimhaskell/haskell-vim
-neovimhaskell/nvim-hs.vim
-neutaaaaan/iosvkem
-nfnty/vim-nftables
-nicoe/deoplete-khard
-nishigori/increment-activator
-nixprime/cpsm
-NLKNguyen/papercolor-theme
-noahfrederick/vim-noctu
-noc7c9/vim-iced-coffee-script
-norcalli/nvim-colorizer.lua
-norcalli/nvim-terminal.lua
-norcalli/snippets.nvim
-NTBBloodbath/galaxyline.nvim
-NTBBloodbath/rest.nvim
-ntpeters/vim-better-whitespace
-numirias/semshi
-numtostr/comment.nvim
-numToStr/FTerm.nvim
-numToStr/Navigator.nvim
-nvie/vim-flake8
-nvim-lua/completion-nvim
-nvim-lua/diagnostic-nvim
-nvim-lua/lsp-status.nvim
-nvim-lua/lsp_extensions.nvim
-nvim-lua/plenary.nvim
-nvim-lua/popup.nvim
-nvim-lualine/lualine.nvim
-nvim-neorg/neorg
-nvim-orgmode/orgmode
-nvim-pack/nvim-spectre
-nvim-telescope/telescope-cheat.nvim
-nvim-telescope/telescope-dap.nvim
-nvim-telescope/telescope-file-browser.nvim
-nvim-telescope/telescope-frecency.nvim
-nvim-telescope/telescope-fzf-native.nvim
-nvim-telescope/telescope-fzf-writer.nvim
-nvim-telescope/telescope-fzy-native.nvim
-nvim-telescope/telescope-github.nvim
-nvim-telescope/telescope-project.nvim
-nvim-telescope/telescope-symbols.nvim
-nvim-telescope/telescope-ui-select.nvim
-nvim-telescope/telescope-z.nvim
-nvim-telescope/telescope.nvim
-nvim-treesitter/completion-treesitter
-nvim-treesitter/nvim-treesitter
-nvim-treesitter/nvim-treesitter-refactor
-nvim-treesitter/nvim-treesitter-textobjects
-nvim-treesitter/playground
-oberblastmeister/neuron.nvim
-oberblastmeister/termwrapper.nvim
-ocaml/vim-ocaml
-octol/vim-cpp-enhanced-highlight
-ojroques/nvim-bufdel
-ojroques/vim-oscyank
-Olical/aniseed
-Olical/conjure
-olimorris/onedarkpro.nvim
-onsails/diaglist.nvim
-onsails/lspkind-nvim
-OrangeT/vim-csharp
-osyo-manga/shabadou.vim
-osyo-manga/vim-anzu
-osyo-manga/vim-over
-osyo-manga/vim-textobj-multiblock
-osyo-manga/vim-watchdogs
-overcache/NeoSolarized
-p00f/nvim-ts-rainbow
-pangloss/vim-javascript
-pantharshit00/vim-prisma
-parsonsmatt/intero-neovim
-PaterJason/cmp-conjure
-pearofducks/ansible-vim
-peitalin/vim-jsx-typescript
-peterbjorgensen/sved
-peterhoeg/vim-qml
-PeterRincker/vim-argumentative
-petRUShka/vim-opencl
-phaazon/hop.nvim
-phanviet/vim-monokai-pro
-Pocco81/TrueZen.nvim
-ponko2/deoplete-fish
-posva/vim-vue
-powerman/vim-plugin-AnsiEsc
-PProvost/vim-ps1
-prabirshrestha/async.vim
-prabirshrestha/asyncomplete-lsp.vim
-prabirshrestha/asyncomplete.vim
-prabirshrestha/vim-lsp
-preservim/nerdcommenter
-preservim/nerdtree
-preservim/tagbar
-preservim/vim-markdown
-preservim/vim-pencil
-preservim/vim-wordy
-preservim/vimux
-prettier/vim-prettier
-projekt0n/circles.nvim
-psliwka/vim-smoothie
-ptzz/lf.vim
-puremourning/vimspector
-purescript-contrib/purescript-vim
-pwntester/octo.nvim
-python-mode/python-mode
-qnighy/lalrpop.vim
-qpkorr/vim-bufkill
-quangnguyen30192/cmp-nvim-ultisnips
-Quramy/tsuquyomi
-racer-rust/vim-racer
-radenling/vim-dispatch-neovim
-rafamadriz/friendly-snippets
-rafamadriz/neon
-rafaqz/ranger.vim
-rafi/awesome-vim-colorschemes
-raghur/fruzzy
-raghur/vim-ghost
-Raimondi/delimitMate
-rakr/vim-one
-ray-x/aurora
-ray-x/cmp-treesitter
-ray-x/lsp_signature.nvim
-rbgrouleff/bclose.vim
-rbong/vim-flog
-rcarriga/nvim-dap-ui
-rcarriga/nvim-notify
-rcarriga/vim-ultest
-rebelot/kanagawa.nvim
-rhysd/clever-f.vim
-rhysd/committia.vim
-rhysd/conflict-marker.vim
-rhysd/devdocs.vim
-rhysd/git-messenger.vim
-rhysd/vim-clang-format
-rhysd/vim-grammarous
-rhysd/vim-operator-surround
-RishabhRD/nvim-lsputils
-RishabhRD/popfix
-rktjmp/fwatch.nvim
-rktjmp/hotpot.nvim
-rktjmp/lush.nvim
-rmagatti/auto-session
-rmagatti/goto-preview
-RobertAudi/securemodelines
-rodjek/vim-puppet
-romainl/vim-cool
-romainl/vim-qf
-romainl/vim-qlist
-roman/golden-ratio
-romgrk/barbar.nvim
-romgrk/nvim-treesitter-context
-ron-rs/ron.vim
-ron89/thesaurus_query.vim
-roxma/nvim-cm-racer
-roxma/nvim-completion-manager
-roxma/nvim-yarp
-roxma/vim-tmux-clipboard
-RRethy/nvim-base16
-RRethy/vim-hexokinase
-RRethy/vim-illuminate
-rstacruz/vim-closer
-ruanyl/vim-gh-line
-ruifm/gitlinker.nvim
-rust-lang/rust.vim
-ryanoasis/vim-devicons
-ryvnf/readline.vim
-saadparwaiz1/cmp_luasnip
-saecki/crates.nvim
-sainnhe/edge
-sainnhe/everforest
-sainnhe/gruvbox-material
-sainnhe/sonokai
-sakhnik/nvim-gdb
-samoshkin/vim-mergetool
-sbdchd/neoformat
-sblumentritt/bitbake.vim
-scalameta/nvim-metals
-sdiehl/vim-ormolu
-sebastianmarkow/deoplete-rust
-SevereOverfl0w/deoplete-github
-Shatur/neovim-ayu
-shaunsingh/moonlight.nvim@pure-lua
-shaunsingh/nord.nvim
-sheerun/vim-polyglot
-shinchu/lightline-gruvbox.vim
-Shougo/context_filetype.vim
-Shougo/defx.nvim
-Shougo/denite.nvim
-Shougo/deol.nvim
-Shougo/deoplete.nvim
-Shougo/echodoc.vim
-Shougo/neco-syntax
-Shougo/neco-vim
-Shougo/neocomplete.vim
-Shougo/neoinclude.vim
-Shougo/neomru.vim
-Shougo/neosnippet-snippets
-Shougo/neosnippet.vim
-Shougo/neoyank.vim
-Shougo/tabpagebuffer.vim
-Shougo/unite.vim
-Shougo/vimfiler.vim
-Shougo/vimproc.vim
-Shougo/vimshell.vim
-shumphrey/fugitive-gitlab.vim
-sickill/vim-pasta
-SidOfc/mkdx
-simnalamburt/vim-mundo
-simrat39/rust-tools.nvim
-simrat39/symbols-outline.nvim
-sindrets/diffview.nvim
-sindrets/winshift.nvim
-SirVer/ultisnips
-sjl/gundo.vim
-sjl/splice.vim
-sk1418/last256
-skywind3000/asyncrun.vim
-skywind3000/asynctasks.vim
-slashmili/alchemist.vim
-smiteshp/nvim-gps
-sodapopcan/vim-twiggy
-solarnz/arcanist.vim
-sonph/onehalf
-sotte/presenting.vim
-SpaceVim/SpaceVim
-spywhere/lightline-lsp
-srcery-colors/srcery-vim
-steelsojka/completion-buffers
-steelsojka/pears.nvim
-stefandtw/quickfix-reflector.vim
-stephpy/vim-yaml
-stevearc/aerial.nvim
-stevearc/dressing.nvim
-stsewd/fzf-checkout.vim
-sudormrfbin/cheatsheet.nvim
-sunaku/vim-dasht
-sunjon/Shade.nvim
-svermeulen/vim-subversive
-symphorien/vim-nixhash
-t9md/vim-choosewin
-t9md/vim-smalls
-TaDaa/vimade
-takac/vim-hardtime
-tamago324/compe-zsh
-tamago324/lir.nvim
-tami5/compe-conjure
-tami5/lispdocs.nvim
-tami5/lspsaga.nvim
-tami5/sqlite.lua
-tbastos/vim-lua
-tbodt/deoplete-tabnine
-ternjs/tern_for_vim
-terrortylor/nvim-comment
-terryma/vim-expand-region
-terryma/vim-multiple-cursors
-tex/vimpreviewpandoc
-Th3Whit3Wolf/one-nvim
-theHamsta/nvim-dap-virtual-text
-ThePrimeagen/git-worktree.nvim
-ThePrimeagen/harpoon
-theprimeagen/refactoring.nvim
-ThePrimeagen/vim-apm
-thinca/vim-ft-diff_fold
-thinca/vim-prettyprint
-thinca/vim-quickrun
-thinca/vim-scouter
-thinca/vim-themis
-thinca/vim-visualstar
-thirtythreeforty/lessspace.vim
-thosakwe/vim-flutter
-tiagofumo/vim-nerdtree-syntax-highlight
-tikhomirov/vim-glsl
-TimUntersberger/neogit
-tjdevries/colorbuddy.nvim
-tjdevries/nlua.nvim
-tjdevries/train.nvim
-tmhedberg/SimpylFold
-tmsvg/pear-tree
-tmux-plugins/vim-tmux
-tmux-plugins/vim-tmux-focus-events
-tom-anders/telescope-vim-bookmarks.nvim
-tomasiser/vim-code-dark
-tomasr/molokai
-tomlion/vim-solidity
-tommcdo/vim-exchange
-tommcdo/vim-fubitive
-tommcdo/vim-lion
-tommcdo/vim-ninja-feet
-tomtom/tcomment_vim
-tomtom/tlib_vim
-tools-life/taskwiki
-towolf/vim-helm
-tpope/vim-abolish
-tpope/vim-capslock
-tpope/vim-commentary
-tpope/vim-dadbod
-tpope/vim-dispatch
-tpope/vim-endwise
-tpope/vim-eunuch
-tpope/vim-fireplace
-tpope/vim-flagship
-tpope/vim-fugitive
-tpope/vim-git
-tpope/vim-liquid
-tpope/vim-obsession
-tpope/vim-pathogen
-tpope/vim-projectionist
-tpope/vim-ragtag
-tpope/vim-rails
-tpope/vim-repeat
-tpope/vim-rhubarb
-tpope/vim-rsi
-tpope/vim-salve
-tpope/vim-scriptease
-tpope/vim-sensible
-tpope/vim-sexp-mappings-for-regular-people
-tpope/vim-sleuth
-tpope/vim-speeddating
-tpope/vim-surround
-tpope/vim-tbone
-tpope/vim-unimpaired
-tpope/vim-vinegar
-travitch/hasksyn
-tremor-rs/tremor-vim
-triglav/vim-visual-increment
-troydm/zoomwintab.vim
-turbio/bracey.vim
-tversteeg/registers.nvim
-tweekmonster/wstrip.vim
-twerth/ir_black
-twinside/vim-haskellconceal
-Twinside/vim-hoogle
-tyru/caw.vim
-tyru/open-browser-github.vim
-tyru/open-browser.vim
-tzachar/cmp-tabnine
-tzachar/compe-tabnine
-uarun/vim-protobuf
-udalov/kotlin-vim
-ujihisa/neco-look
-unblevable/quick-scope
-ur4ltz/surround.nvim
-urbit/hoon.vim
-Valloric/MatchTagAlways
-Valodim/deoplete-notmuch
-vhda/verilog_systemverilog.vim
-vifm/vifm.vim
-vigoux/LanguageTool.nvim
-vijaymarupudi/nvim-fzf
-vijaymarupudi/nvim-fzf-commands
-vim-airline/vim-airline
-vim-airline/vim-airline-themes
-vim-autoformat/vim-autoformat
-vim-erlang/vim-erlang-compiler
-vim-erlang/vim-erlang-omnicomplete
-vim-erlang/vim-erlang-runtime
-vim-erlang/vim-erlang-tags
-vim-pandoc/vim-pandoc
-vim-pandoc/vim-pandoc-after
-vim-pandoc/vim-pandoc-syntax
-vim-python/python-syntax
-vim-ruby/vim-ruby
-vim-scripts/a.vim
-vim-scripts/align
-vim-scripts/argtextobj.vim
-vim-scripts/autoload_cscope.vim
-vim-scripts/bats.vim
-vim-scripts/BufOnly.vim
-vim-scripts/changeColorScheme.vim
-vim-scripts/Colour-Sampler-Pack
-vim-scripts/DoxygenToolkit.vim
-vim-scripts/emodeline
-vim-scripts/gitignore.vim
-vim-scripts/Improved-AnsiEsc
-vim-scripts/jdaddy.vim
-vim-scripts/matchit.zip
-vim-scripts/mayansmoke
-vim-scripts/PreserveNoEOL
-vim-scripts/prev_indent
-vim-scripts/random.vim
-vim-scripts/rcshell.vim
-vim-scripts/Rename
-vim-scripts/ReplaceWithRegister
-vim-scripts/ShowMultiBase
-vim-scripts/tabmerge
-vim-scripts/taglist.vim
-vim-scripts/timestamp.vim
-vim-scripts/utl.vim
-vim-scripts/vis
-vim-scripts/wombat256.vim
-vim-scripts/YankRing.vim
-vim-syntastic/syntastic
-vim-test/vim-test
-vim-utils/vim-husk
-Vimjas/vim-python-pep8-indent
-vimlab/split-term.vim
-vimoutliner/vimoutliner
-vimpostor/vim-tpipeline
-vimsence/vimsence
-vimwiki/vimwiki
-vito-c/jq.vim
-vmchale/ats-vim
-vmchale/dhall-vim
-vmware-archive/salt-vim
-vn-ki/coc-clap
-voldikss/vim-floaterm
-vuki656/package-info.nvim
-VundleVim/Vundle.vim
-w0ng/vim-hybrid
-wakatime/vim-wakatime
-wannesm/wmgraphviz.vim
-wbthomason/packer.nvim
-weilbith/nvim-code-action-menu
-wellle/targets.vim
-wellle/tmux-complete.vim
-wesQ3/vim-windowswap
-wfxr/minimap.vim
-whonore/Coqtail
-will133/vim-dirdiff
-wincent/command-t
-wincent/ferret
-wincent/terminus
-windwp/nvim-autopairs
-windwp/nvim-ts-autotag
-winston0410/cmd-parser.nvim
-winston0410/range-highlight.nvim
-wlangstroth/vim-racket
-wsdjeg/vim-fetch
-xavierd/clang_complete
-xolox/vim-easytags
-xolox/vim-misc
-xuhdev/vim-latex-live-preview
-Xuyuanp/nerdtree-git-plugin
-Xuyuanp/scrollbar.nvim
-yamatsum/nvim-cursorline
-yamatsum/nvim-nonicons
-ycm-core/YouCompleteMe
-yegappan/mru
-Yggdroot/hiPairs
-Yggdroot/indentLine
-Yggdroot/LeaderF
-Yilin-Yang/vim-markbar
-yssl/QFEnter
-yuki-yano/ncm2-dictionary
-yunlingz/ci_dark
-zah/nim.vim
-zhou13/vim-easyescape
-ziglang/zig.vim
+repo,branch,alias
+https://github.com/euclidianAce/BetterLua.vim/,,
+https://github.com/vim-scripts/BufOnly.vim/,,
+https://github.com/chrisbra/CheckAttach/,,
+https://github.com/vim-scripts/Colour-Sampler-Pack/,,
+https://github.com/whonore/Coqtail/,,
+https://github.com/vim-scripts/DoxygenToolkit.vim/,,
+https://github.com/numToStr/FTerm.nvim/,,
+https://github.com/antoinemadec/FixCursorHold.nvim/,,
+https://github.com/vim-scripts/Improved-AnsiEsc/,,
+https://github.com/martinda/Jenkinsfile-vim-syntax/,,
+https://github.com/autozimu/LanguageClient-neovim/,,
+https://github.com/vigoux/LanguageTool.nvim/,,
+https://github.com/Yggdroot/LeaderF/,,
+https://github.com/Valloric/MatchTagAlways/,,
+https://github.com/numToStr/Navigator.nvim/,,
+https://github.com/overcache/NeoSolarized/,,
+https://github.com/chrisbra/NrrwRgn/,,
+https://github.com/vim-scripts/PreserveNoEOL/,,
+https://github.com/yssl/QFEnter/,,
+https://github.com/chrisbra/Recover.vim/,,
+https://github.com/vim-scripts/Rename/,,
+https://github.com/vim-scripts/ReplaceWithRegister/,,
+https://github.com/b0o/SchemaStore.nvim/,,
+https://github.com/sunjon/Shade.nvim/,,
+https://github.com/vim-scripts/ShowMultiBase/,,
+https://github.com/tmhedberg/SimpylFold/,,
+https://github.com/jaredgorski/SpaceCamp/,,
+https://github.com/SpaceVim/SpaceVim/,,
+https://github.com/ackyshake/Spacegray.vim/,,
+https://github.com/chrisbra/SudoEdit.vim/,,
+https://github.com/Pocco81/TrueZen.nvim/,,
+https://github.com/ackyshake/VimCompletesMe/,,
+https://github.com/hsitz/VimOrganizer/,,
+https://github.com/VundleVim/Vundle.vim/,,
+https://github.com/esneider/YUNOcommit.vim/,,
+https://github.com/vim-scripts/YankRing.vim/,,
+https://github.com/ycm-core/YouCompleteMe/,,
+https://github.com/vim-scripts/a.vim/,,
+https://github.com/mileszs/ack.vim/,,
+https://github.com/eikenb/acp/,,
+https://github.com/stevearc/aerial.nvim/,,
+https://github.com/derekelkins/agda-vim/,,
+https://github.com/slashmili/alchemist.vim/,,
+https://github.com/dense-analysis/ale/,,
+https://github.com/vim-scripts/align/,,
+https://github.com/Olical/aniseed/,,
+https://github.com/pearofducks/ansible-vim/,,
+https://github.com/ckarnell/antonys-macro-repeater/,,
+https://github.com/solarnz/arcanist.vim/,,
+https://github.com/vim-scripts/argtextobj.vim/,,
+https://github.com/prabirshrestha/async.vim/,,
+https://github.com/prabirshrestha/asyncomplete-lsp.vim/,,
+https://github.com/prabirshrestha/asyncomplete.vim/,,
+https://github.com/skywind3000/asyncrun.vim/,,
+https://github.com/skywind3000/asynctasks.vim/,,
+https://github.com/vmchale/ats-vim/,,
+https://github.com/ray-x/aurora/,,
+https://github.com/hotwatermorning/auto-git-diff/,,
+https://github.com/jiangmiao/auto-pairs/,,
+https://github.com/rmagatti/auto-session/,,
+https://github.com/vim-scripts/autoload_cscope.vim/,,
+https://github.com/rafi/awesome-vim-colorschemes/,,
+https://github.com/ayu-theme/ayu-vim/,,
+https://github.com/romgrk/barbar.nvim/,,
+https://github.com/chriskempson/base16-vim/,,
+https://github.com/vim-scripts/bats.vim/,,
+https://github.com/rbgrouleff/bclose.vim/,,
+https://github.com/max397574/better-escape.nvim/,,
+https://github.com/sblumentritt/bitbake.vim/,,
+https://github.com/blueballs-theme/blueballs-neovim/,,
+https://github.com/turbio/bracey.vim/,,
+https://github.com/fruit-in/brainfuck-vim/,,
+https://github.com/famiu/bufdelete.nvim/,,
+https://github.com/jlanzarotta/bufexplorer/,,
+https://github.com/akinsho/bufferline.nvim/,,
+https://github.com/mattn/calendar-vim/,,mattn-calendar-vim
+https://github.com/itchyny/calendar.vim/,,
+https://github.com/bkad/camelcasemotion/,,
+https://github.com/tyru/caw.vim/,,
+https://github.com/ms-jpq/chadtree/,,chad
+https://github.com/vim-scripts/changeColorScheme.vim/,,
+https://github.com/sudormrfbin/cheatsheet.nvim/,,
+https://github.com/yunlingz/ci_dark/,,
+https://github.com/projekt0n/circles.nvim/,,
+https://github.com/xavierd/clang_complete/,,
+https://github.com/rhysd/clever-f.vim/,,
+https://github.com/bbchung/clighter8/,,
+https://github.com/winston0410/cmd-parser.nvim/,,
+https://github.com/hrsh7th/cmp-buffer/,,
+https://github.com/hrsh7th/cmp-calc/,,
+https://github.com/hrsh7th/cmp-cmdline/,,
+https://github.com/PaterJason/cmp-conjure/,,
+https://github.com/hrsh7th/cmp-emoji/,,
+https://github.com/kdheepak/cmp-latex-symbols/,,
+https://github.com/hrsh7th/cmp-nvim-lsp/,,
+https://github.com/hrsh7th/cmp-nvim-lsp-document-symbol/,,
+https://github.com/hrsh7th/cmp-nvim-lua/,,
+https://github.com/quangnguyen30192/cmp-nvim-ultisnips/,,
+https://github.com/hrsh7th/cmp-omni/,,
+https://github.com/jc-doyle/cmp-pandoc-references/,,
+https://github.com/hrsh7th/cmp-path/,,
+https://github.com/f3fora/cmp-spell/,,
+https://github.com/tzachar/cmp-tabnine/,,
+https://github.com/andersevenrud/cmp-tmux/,,
+https://github.com/ray-x/cmp-treesitter/,,
+https://github.com/lukas-reineke/cmp-under-comparator/,,
+https://github.com/hrsh7th/cmp-vsnip/,,
+https://github.com/saadparwaiz1/cmp_luasnip/,,
+https://github.com/vn-ki/coc-clap/,,
+https://github.com/neoclide/coc-denite/,,
+https://github.com/antoinemadec/coc-fzf/,,
+https://github.com/josa42/coc-lua/,,
+https://github.com/neoclide/coc-neco/,,
+https://github.com/iamcco/coc-spell-checker/,,
+https://github.com/coc-extensions/coc-svelte/,,
+https://github.com/iamcco/coc-tailwindcss/,,
+https://github.com/neoclide/coc.nvim/,,release
+https://github.com/metakirby5/codi.vim/,,
+https://github.com/tjdevries/colorbuddy.nvim/,,
+https://github.com/lilydjwg/colorizer/,,
+https://github.com/wincent/command-t/,,
+https://github.com/numtostr/comment.nvim/,,
+https://github.com/rhysd/committia.vim/,,
+https://github.com/tami5/compe-conjure/,,
+https://github.com/GoldsteinE/compe-latex-symbols/,,
+https://github.com/tzachar/compe-tabnine/,,
+https://github.com/tamago324/compe-zsh/,,
+https://github.com/steelsojka/completion-buffers/,,
+https://github.com/nvim-lua/completion-nvim/,,
+https://github.com/aca/completion-tabnine/,,
+https://github.com/nvim-treesitter/completion-treesitter/,,
+https://github.com/chikatoike/concealedyank.vim/,,
+https://github.com/rhysd/conflict-marker.vim/,,
+https://github.com/Olical/conjure/,,
+https://github.com/Shougo/context_filetype.vim/,,
+https://github.com/github/copilot.vim/,,
+https://github.com/jvoorhis/coq.vim/,,
+https://github.com/ms-jpq/coq_nvim/,,
+https://github.com/lfilho/cosco.vim/,,
+https://github.com/nixprime/cpsm/,,
+https://github.com/saecki/crates.nvim/,,
+https://github.com/godlygeek/csapprox/,,
+https://github.com/chrisbra/csv.vim/,,
+https://github.com/JazzCore/ctrlp-cmatcher/,,
+https://github.com/FelikZ/ctrlp-py-matcher/,,
+https://github.com/amiorin/ctrlp-z/,,
+https://github.com/ctrlpvim/ctrlp.vim/,,
+https://github.com/dart-lang/dart-vim-plugin/,,
+https://github.com/glepnir/dashboard-nvim/,,
+https://github.com/kristijanhusak/defx-git/,,
+https://github.com/kristijanhusak/defx-icons/,,
+https://github.com/Shougo/defx.nvim/,,
+https://github.com/Raimondi/delimitMate/,,
+https://github.com/neoclide/denite-extra/,,
+https://github.com/neoclide/denite-git/,,
+https://github.com/Shougo/denite.nvim/,,
+https://github.com/Shougo/deol.nvim/,,
+https://github.com/deoplete-plugins/deoplete-clang/,,
+https://github.com/deoplete-plugins/deoplete-dictionary/,,
+https://github.com/ponko2/deoplete-fish/,,
+https://github.com/SevereOverfl0w/deoplete-github/,,
+https://github.com/deoplete-plugins/deoplete-go/,,
+https://github.com/Inazuma110/deoplete-greek/,,
+https://github.com/deoplete-plugins/deoplete-jedi/,,
+https://github.com/JuliaEditorSupport/deoplete-julia/,,
+https://github.com/nicoe/deoplete-khard/,,
+https://github.com/deoplete-plugins/deoplete-lsp/,,
+https://github.com/Valodim/deoplete-notmuch/,,
+https://github.com/kristijanhusak/deoplete-phpactor/,,
+https://github.com/sebastianmarkow/deoplete-rust/,,
+https://github.com/tbodt/deoplete-tabnine/,,
+https://github.com/carlitux/deoplete-ternjs/,,
+https://github.com/lighttiger2505/deoplete-vim-lsp/,,
+https://github.com/deoplete-plugins/deoplete-zsh/,,
+https://github.com/Shougo/deoplete.nvim/,,
+https://github.com/rhysd/devdocs.vim/,,
+https://github.com/vmchale/dhall-vim/,,
+https://github.com/onsails/diaglist.nvim/,,
+https://github.com/nvim-lua/diagnostic-nvim/,,
+https://github.com/sindrets/diffview.nvim/,,
+https://github.com/direnv/direnv.vim/,,
+https://github.com/doki-theme/doki-theme-vim/,,
+https://github.com/stevearc/dressing.nvim/,,
+https://github.com/Shougo/echodoc.vim/,,
+https://github.com/sainnhe/edge/,,
+https://github.com/editorconfig/editorconfig-vim/,,
+https://github.com/gpanders/editorconfig.nvim/,,
+https://github.com/elmcast/elm-vim/,,
+https://github.com/dmix/elvish.vim/,,
+https://github.com/mattn/emmet-vim/,,
+https://github.com/vim-scripts/emodeline/,,
+https://github.com/sainnhe/everforest/,,
+https://github.com/fenetikm/falcon/,,
+https://github.com/brooth/far.vim/,,
+https://github.com/konfekt/fastfold/,,
+https://github.com/lilydjwg/fcitx.vim/,fcitx5,
+https://github.com/feline-nvim/feline.nvim/,,
+https://github.com/bakpakin/fennel.vim/,,
+https://github.com/lambdalisue/fern.vim/,,
+https://github.com/wincent/ferret/,,
+https://github.com/j-hui/fidget.nvim/,,
+https://github.com/bogado/file-line/,,
+https://github.com/andviro/flake8-vim/,,
+https://github.com/ncm2/float-preview.nvim/,,
+https://github.com/fhill2/floating.nvim/,,
+https://github.com/floobits/floobits-neovim/,,
+https://github.com/mhartington/formatter.nvim/,,
+https://github.com/megaannum/forms/,,
+https://github.com/rafamadriz/friendly-snippets/,,
+https://github.com/raghur/fruzzy/,,
+https://github.com/shumphrey/fugitive-gitlab.vim/,,
+https://github.com/BeneCollyridam/futhark-vim/,,
+https://github.com/rktjmp/fwatch.nvim/,,
+https://github.com/stsewd/fzf-checkout.vim/,,
+https://github.com/gfanto/fzf-lsp.nvim/,,
+https://github.com/junegunn/fzf.vim/,,
+https://github.com/NTBBloodbath/galaxyline.nvim/,,
+https://github.com/jsfaint/gen_tags.vim/,,
+https://github.com/gentoo/gentoo-syntax/,,
+https://github.com/ndmitchell/ghcid/,,
+https://github.com/eagletmt/ghcmod-vim/,,
+https://github.com/lambdalisue/gina.vim/,,
+https://github.com/f-person/git-blame.nvim/,,
+https://github.com/rhysd/git-messenger.vim/,,
+https://github.com/ThePrimeagen/git-worktree.nvim/,,
+https://github.com/vim-scripts/gitignore.vim/,,
+https://github.com/ruifm/gitlinker.nvim/,,
+https://github.com/lewis6991/gitsigns.nvim/,,
+https://github.com/gregsexton/gitv/,,
+https://github.com/gleam-lang/gleam.vim/,,
+https://github.com/ellisonleao/glow.nvim/,,
+https://github.com/roman/golden-ratio/,,
+https://github.com/buoto/gotests-vim/,,
+https://github.com/rmagatti/goto-preview/,,
+https://github.com/junegunn/goyo.vim/,,
+https://github.com/liuchengxu/graphviz.vim/,,
+https://github.com/gruvbox-community/gruvbox/,,gruvbox-community
+https://github.com/morhetz/gruvbox/,,
+https://github.com/eddyekofo94/gruvbox-flat.nvim/,,
+https://github.com/sainnhe/gruvbox-material/,,
+https://github.com/ellisonleao/gruvbox.nvim/,,
+https://github.com/sjl/gundo.vim/,,
+https://github.com/junegunn/gv.vim/,,
+https://github.com/ThePrimeagen/harpoon/,,
+https://github.com/neovimhaskell/haskell-vim/,,
+https://github.com/travitch/hasksyn/,,
+https://github.com/Yggdroot/hiPairs/,,
+https://github.com/mpickering/hlint-refactor-vim/,,
+https://github.com/edluffy/hologram.nvim/,,
+https://github.com/urbit/hoon.vim/,,
+https://github.com/phaazon/hop.nvim/,,
+https://github.com/rktjmp/hotpot.nvim/,,
+https://github.com/mboughaba/i3config.vim/,,
+https://github.com/cocopon/iceberg.vim/,,
+https://github.com/idris-hackers/idris-vim/,,
+https://github.com/edwinb/idris2-vim/,,
+https://github.com/lewis6991/impatient.nvim/,,
+https://github.com/nishigori/increment-activator/,,
+https://github.com/haya14busa/incsearch-easymotion.vim/,,
+https://github.com/haya14busa/incsearch.vim/,,
+https://github.com/lukas-reineke/indent-blankline.nvim/,,
+https://github.com/Yggdroot/indentLine/,,
+https://github.com/ciaranm/inkpot/,,
+https://github.com/parsonsmatt/intero-neovim/,,
+https://github.com/keith/investigate.vim/,,
+https://github.com/neutaaaaan/iosvkem/,,
+https://github.com/twerth/ir_black/,,
+https://github.com/haya14busa/is.vim/,,
+https://github.com/vim-scripts/jdaddy.vim/,,
+https://github.com/davidhalter/jedi-vim/,,
+https://github.com/metalelf0/jellybeans-nvim/,,
+https://github.com/nanotech/jellybeans.vim/,,
+https://github.com/vito-c/jq.vim/,,
+https://github.com/neoclide/jsonc.vim/,,
+https://github.com/JuliaEditorSupport/julia-vim/,,
+https://github.com/rebelot/kanagawa.nvim/,,
+https://github.com/b3nj5m1n/kommentary/,,
+https://github.com/udalov/kotlin-vim/,,
+https://github.com/qnighy/lalrpop.vim/,,
+https://github.com/sk1418/last256/,,
+https://github.com/latex-box-team/latex-box/,,
+https://github.com/kdheepak/lazygit.nvim/,,
+https://github.com/Julian/lean.nvim/,,
+https://github.com/leanprover/lean.vim/,,
+https://github.com/camspiers/lens.vim/,,
+https://github.com/thirtythreeforty/lessspace.vim/,,
+https://github.com/cohama/lexima.vim/,,
+https://github.com/ptzz/lf.vim/,,
+https://github.com/LucHermitte/lh-brackets/,,
+https://github.com/LucHermitte/lh-vim-lib/,,
+https://github.com/maximbaz/lightline-ale/,,
+https://github.com/mengelbrecht/lightline-bufferline/,,
+https://github.com/shinchu/lightline-gruvbox.vim/,,
+https://github.com/spywhere/lightline-lsp/,,
+https://github.com/itchyny/lightline.vim/,,
+https://github.com/ggandor/lightspeed.nvim/,,
+https://github.com/junegunn/limelight.vim/,,
+https://github.com/lf-lang/lingua-franca.vim/,,
+https://github.com/tamago324/lir.nvim/,,
+https://github.com/tami5/lispdocs.nvim/,,
+https://github.com/ldelossa/litee-calltree.nvim/,,
+https://github.com/ldelossa/litee-filetree.nvim/,,
+https://github.com/ldelossa/litee-symboltree.nvim/,,
+https://github.com/ldelossa/litee.nvim/,,
+https://github.com/folke/lsp-colors.nvim/,,
+https://github.com/ahmedkhalf/lsp-rooter.nvim/,,
+https://github.com/nvim-lua/lsp-status.nvim/,,
+https://github.com/nvim-lua/lsp_extensions.nvim/,,
+https://git.sr.ht/~whynothugo/lsp_lines.nvim,,
+https://github.com/ray-x/lsp_signature.nvim/,,
+https://github.com/onsails/lspkind-nvim/,,
+https://github.com/tami5/lspsaga.nvim/,,
+https://github.com/folke/lua-dev.nvim/,,
+https://github.com/arkav/lualine-lsp-progress/,,
+https://github.com/nvim-lualine/lualine.nvim/,,
+https://github.com/l3mon4d3/luasnip/,,
+https://github.com/alvarosevilla95/luatab.nvim/,,
+https://github.com/rktjmp/lush.nvim/,,
+https://github.com/mkasa/lushtags/,,
+https://github.com/iamcco/markdown-preview.nvim/,,
+https://github.com/chentau/marks.nvim/,,
+https://github.com/vim-scripts/matchit.zip/,,
+https://github.com/marko-cerovac/material.nvim/,,
+https://github.com/vim-scripts/mayansmoke/,,
+https://github.com/echasnovski/mini.nvim/,,
+https://github.com/wfxr/minimap.vim/,,
+https://github.com/jose-elias-alvarez/minsnip.nvim/,,
+https://github.com/jghauser/mkdir.nvim/,main,
+https://github.com/SidOfc/mkdx/,,
+https://github.com/tomasr/molokai/,,
+https://github.com/shaunsingh/moonlight.nvim/,,pure-lua
+https://github.com/yegappan/mru/,,
+https://github.com/ncm2/ncm2/,,
+https://github.com/ncm2/ncm2-bufword/,,
+https://github.com/ncm2/ncm2-cssomni/,,
+https://github.com/yuki-yano/ncm2-dictionary/,,
+https://github.com/ncm2/ncm2-github/,,
+https://github.com/ncm2/ncm2-html-subscope/,,
+https://github.com/ncm2/ncm2-jedi/,,
+https://github.com/ncm2/ncm2-markdown-subscope/,,
+https://github.com/ncm2/ncm2-neoinclude/,,
+https://github.com/ncm2/ncm2-neosnippet/,,
+https://github.com/ncm2/ncm2-path/,,
+https://github.com/ncm2/ncm2-syntax/,,
+https://github.com/ncm2/ncm2-tagprefix/,,
+https://github.com/ncm2/ncm2-tmux/,,
+https://github.com/ncm2/ncm2-ultisnips/,,
+https://github.com/ncm2/ncm2-vim/,,
+https://github.com/eagletmt/neco-ghc/,,
+https://github.com/ujihisa/neco-look/,,
+https://github.com/Shougo/neco-syntax/,,
+https://github.com/Shougo/neco-vim/,,
+https://github.com/Shougo/neocomplete.vim/,,
+https://github.com/KeitaNakamura/neodark.vim/,,
+https://github.com/sbdchd/neoformat/,,
+https://github.com/TimUntersberger/neogit/,,
+https://github.com/Shougo/neoinclude.vim/,,
+https://github.com/neomake/neomake/,,
+https://github.com/Shougo/neomru.vim/,,
+https://github.com/rafamadriz/neon/,,
+https://github.com/nvim-neorg/neorg/,,
+https://github.com/karb94/neoscroll.nvim/,,
+https://github.com/Shougo/neosnippet-snippets/,,
+https://github.com/Shougo/neosnippet.vim/,,
+https://github.com/kassio/neoterm/,,
+https://github.com/rose-pine/neovim/,main,rose-pine
+https://github.com/Shatur/neovim-ayu/,,
+https://github.com/cloudhead/neovim-fuzzy/,,
+https://github.com/jeffkreeftmeijer/neovim-sensible/,,
+https://github.com/Shougo/neoyank.vim/,,
+https://github.com/preservim/nerdcommenter/,,
+https://github.com/preservim/nerdtree/,,
+https://github.com/Xuyuanp/nerdtree-git-plugin/,,
+https://github.com/oberblastmeister/neuron.nvim/,,
+https://github.com/fiatjaf/neuron.vim/,,
+https://github.com/chr4/nginx.vim/,,
+https://github.com/EdenEast/nightfox.nvim/,,
+https://github.com/zah/nim.vim/,,
+https://github.com/tjdevries/nlua.nvim/,,
+https://github.com/mcchrish/nnn.vim/,,
+https://github.com/arcticicestudio/nord-vim/,master,
+https://github.com/shaunsingh/nord.nvim/,,
+https://github.com/andersevenrud/nordic.nvim/,,
+https://github.com/jlesquembre/nterm.nvim/,,
+https://github.com/MunifTanjim/nui.nvim/,main,
+https://github.com/jose-elias-alvarez/null-ls.nvim/,,
+https://github.com/nacro90/numb.nvim/,,
+https://github.com/ChristianChiarulli/nvcode-color-schemes.vim/,,
+https://github.com/catppuccin/nvim/,,catppuccin-nvim
+https://github.com/nathanmsmith/nvim-ale-diagnostic/,,
+https://github.com/windwp/nvim-autopairs/,,
+https://github.com/RRethy/nvim-base16/,,
+https://github.com/kevinhwang91/nvim-bqf/,,
+https://github.com/ojroques/nvim-bufdel/,,
+https://github.com/roxma/nvim-cm-racer/,,
+https://github.com/hrsh7th/nvim-cmp/,,
+https://github.com/weilbith/nvim-code-action-menu/,,
+https://github.com/norcalli/nvim-colorizer.lua/,,
+https://github.com/terrortylor/nvim-comment/,,
+https://github.com/hrsh7th/nvim-compe/,,
+https://github.com/roxma/nvim-completion-manager/,,
+https://github.com/yamatsum/nvim-cursorline/,,
+https://github.com/mfussenegger/nvim-dap/,,
+https://github.com/rcarriga/nvim-dap-ui/,,
+https://github.com/theHamsta/nvim-dap-virtual-text/,,
+https://github.com/allendang/nvim-expand-expr/,,
+https://github.com/vijaymarupudi/nvim-fzf/,,
+https://github.com/vijaymarupudi/nvim-fzf-commands/,,
+https://github.com/sakhnik/nvim-gdb/,,
+https://github.com/smiteshp/nvim-gps/,,
+https://github.com/Iron-E/nvim-highlite/,,
+https://github.com/kevinhwang91/nvim-hlslens/,,
+https://github.com/neovimhaskell/nvim-hs.vim/,,
+https://github.com/mfussenegger/nvim-jdtls/,,
+https://github.com/gennaro-tedesco/nvim-jqx/,,
+https://github.com/kosayoda/nvim-lightbulb/,,
+https://github.com/josa42/nvim-lightline-lsp/,,
+https://github.com/mfussenegger/nvim-lint/,,
+https://github.com/jose-elias-alvarez/nvim-lsp-ts-utils/,,
+https://github.com/neovim/nvim-lspconfig/,,
+https://github.com/RishabhRD/nvim-lsputils/,,
+https://github.com/scalameta/nvim-metals/,,
+https://github.com/AckslD/nvim-neoclip.lua/,,
+https://github.com/yamatsum/nvim-nonicons/,,
+https://github.com/rcarriga/nvim-notify/,,
+https://github.com/gennaro-tedesco/nvim-peekup/,,
+https://github.com/dstein64/nvim-scrollview/,,
+https://github.com/ishan9299/nvim-solarized-lua/,,
+https://github.com/nvim-pack/nvim-spectre/,,
+https://github.com/norcalli/nvim-terminal.lua/,,
+https://github.com/kyazdani42/nvim-tree.lua/,,
+https://github.com/nvim-treesitter/nvim-treesitter/,,
+https://github.com/romgrk/nvim-treesitter-context/,,
+https://github.com/eddiebergman/nvim-treesitter-pyfold/,,
+https://github.com/nvim-treesitter/nvim-treesitter-refactor/,,
+https://github.com/nvim-treesitter/nvim-treesitter-textobjects/,,
+https://github.com/windwp/nvim-ts-autotag/,,
+https://github.com/joosepalviste/nvim-ts-context-commentstring/,,
+https://github.com/p00f/nvim-ts-rainbow/,,
+https://github.com/kyazdani42/nvim-web-devicons/,,
+https://github.com/AckslD/nvim-whichkey-setup.lua/,,
+https://github.com/roxma/nvim-yarp/,,
+https://github.com/haringsrob/nvim_context_vt/,,
+https://github.com/neovim/nvimdev.nvim/,,
+https://github.com/glepnir/oceanic-material/,,
+https://github.com/mhartington/oceanic-next/,,
+https://github.com/pwntester/octo.nvim/,,
+https://github.com/Th3Whit3Wolf/one-nvim/,,
+https://github.com/navarasu/onedark.nvim/,,
+https://github.com/joshdick/onedark.vim/,,
+https://github.com/olimorris/onedarkpro.nvim/,,
+https://github.com/sonph/onehalf/,,
+https://github.com/tyru/open-browser-github.vim/,,
+https://github.com/tyru/open-browser.vim/,,
+https://github.com/nvim-orgmode/orgmode/,,
+https://github.com/vuki656/package-info.nvim/,,
+https://github.com/wbthomason/packer.nvim/,,
+https://github.com/drewtempelmeyer/palenight.vim/,,
+https://github.com/NLKNguyen/papercolor-theme/,,
+https://github.com/tmsvg/pear-tree/,,
+https://github.com/steelsojka/pears.nvim/,,
+https://github.com/andsild/peskcolor.vim/,,
+https://github.com/lifepillar/pgsql.vim/,,
+https://github.com/motus/pig.vim/,,
+https://github.com/aklt/plantuml-syntax/,,
+https://github.com/nvim-treesitter/playground/,,
+https://github.com/nvim-lua/plenary.nvim/,,
+https://github.com/dleonard0/pony-vim-syntax/,,
+https://github.com/RishabhRD/popfix/,,
+https://github.com/nvim-lua/popup.nvim/,,
+https://github.com/andweeb/presence.nvim/,,
+https://github.com/sotte/presenting.vim/,,
+https://github.com/vim-scripts/prev_indent/,,
+https://github.com/ahmedkhalf/project.nvim/,,
+https://github.com/frigoeu/psc-ide-vim/,,
+https://github.com/purescript-contrib/purescript-vim/,,
+https://github.com/python-mode/python-mode/,,
+https://github.com/vim-python/python-syntax/,,
+https://github.com/AlphaTechnolog/pywal.nvim/,,
+https://github.com/unblevable/quick-scope/,,
+https://github.com/stefandtw/quickfix-reflector.vim/,,
+https://github.com/dannyob/quickfixstatus/,,
+https://github.com/luochen1990/rainbow/,,
+https://github.com/kien/rainbow_parentheses.vim/,,
+https://github.com/vim-scripts/random.vim/,,
+https://github.com/winston0410/range-highlight.nvim/,,
+https://github.com/rafaqz/ranger.vim/,,
+https://github.com/vim-scripts/rcshell.vim/,,
+https://github.com/ryvnf/readline.vim/,,
+https://github.com/theprimeagen/refactoring.nvim/,,
+https://github.com/tversteeg/registers.nvim/,,
+https://github.com/filipdutescu/renamer.nvim/,,
+https://github.com/NTBBloodbath/rest.nvim/,,
+https://github.com/gu-fan/riv.vim/,,
+https://github.com/kevinhwang91/rnvimr/,,
+https://github.com/mfukar/robotframework-vim/,,
+https://github.com/ron-rs/ron.vim/,,
+https://github.com/keith/rspec.vim/,,
+https://github.com/ccarpita/rtorrent-syntax-file/,,
+https://github.com/simrat39/rust-tools.nvim/,,
+https://github.com/rust-lang/rust.vim/,,
+https://github.com/hauleth/sad.vim/,,
+https://github.com/vmware-archive/salt-vim/,,
+https://github.com/Xuyuanp/scrollbar.nvim/,,
+https://github.com/RobertAudi/securemodelines/,,
+https://github.com/megaannum/self/,,
+https://github.com/jaxbot/semantic-highlight.vim/,,
+https://github.com/numirias/semshi/,,
+https://github.com/junegunn/seoul256.vim/,,
+https://github.com/osyo-manga/shabadou.vim/,,
+https://github.com/AndrewRadev/sideways.vim/,,
+https://github.com/lotabout/skim.vim/,,
+https://github.com/mopp/sky-color-clock.vim/,,
+https://github.com/kovisoft/slimv/,,
+https://github.com/gorkunov/smartpairs.vim/,,
+https://github.com/camspiers/snap/,,
+https://github.com/norcalli/snippets.nvim/,,
+https://github.com/sainnhe/sonokai/,,
+https://github.com/chikatoike/sourcemap.vim/,,
+https://github.com/liuchengxu/space-vim/,,
+https://github.com/ctjhoa/spacevim/,,
+https://github.com/chrisgeo/sparkup/,,
+https://github.com/edluffy/specs.nvim/,,
+https://github.com/sjl/splice.vim/,,
+https://github.com/vimlab/split-term.vim/,,
+https://github.com/AndrewRadev/splitjoin.vim/,,
+https://github.com/tami5/sqlite.lua/,,
+https://github.com/srcery-colors/srcery-vim/,,
+https://github.com/chr4/sslsecure.vim/,,
+https://github.com/luukvbaal/stabilize.nvim/,,
+https://github.com/eigenfoo/stan-vim/,,
+https://github.com/darfink/starsearch.vim/,,
+https://github.com/lambdalisue/suda.vim/,,
+https://github.com/ervandew/supertab/,,
+https://github.com/ur4ltz/surround.nvim/,,
+https://github.com/peterbjorgensen/sved/,,
+https://github.com/keith/swift.vim/,,
+https://github.com/AndrewRadev/switch.vim/,,
+https://github.com/simrat39/symbols-outline.nvim/,,
+https://github.com/vim-syntastic/syntastic/,,
+https://github.com/kdheepak/tabline.nvim/,,
+https://github.com/vim-scripts/tabmerge/,,
+https://github.com/codota/tabnine-vim/,,
+https://github.com/gcmt/taboo.vim/,,
+https://github.com/Shougo/tabpagebuffer.vim/,,
+https://github.com/godlygeek/tabular/,,
+https://github.com/AndrewRadev/tagalong.vim/,,
+https://github.com/preservim/tagbar/,,
+https://github.com/vim-scripts/taglist.vim/,,
+https://github.com/wellle/targets.vim/,,
+https://github.com/tools-life/taskwiki/,,
+https://github.com/tomtom/tcomment_vim/,,
+https://github.com/GustavoKatel/telescope-asynctasks.nvim/,,
+https://github.com/nvim-telescope/telescope-cheat.nvim/,,
+https://github.com/fannheyward/telescope-coc.nvim/,,
+https://github.com/nvim-telescope/telescope-dap.nvim/,,
+https://github.com/nvim-telescope/telescope-file-browser.nvim/,,
+https://github.com/nvim-telescope/telescope-frecency.nvim/,,
+https://github.com/nvim-telescope/telescope-fzf-native.nvim/,,
+https://github.com/nvim-telescope/telescope-fzf-writer.nvim/,,
+https://github.com/nvim-telescope/telescope-fzy-native.nvim/,,
+https://github.com/nvim-telescope/telescope-github.nvim/,,
+https://github.com/gbrlsnchs/telescope-lsp-handlers.nvim/,,
+https://github.com/nvim-telescope/telescope-project.nvim/,,
+https://github.com/nvim-telescope/telescope-symbols.nvim/,,
+https://github.com/nvim-telescope/telescope-ui-select.nvim/,,
+https://github.com/fhill2/telescope-ultisnips.nvim/,,
+https://github.com/tom-anders/telescope-vim-bookmarks.nvim/,,
+https://github.com/nvim-telescope/telescope-z.nvim/,,
+https://github.com/jvgrootveld/telescope-zoxide/,,
+https://github.com/nvim-telescope/telescope.nvim/,,
+https://github.com/jacoborus/tender.vim/,,
+https://github.com/wincent/terminus/,,
+https://github.com/oberblastmeister/termwrapper.nvim/,,
+https://github.com/ternjs/tern_for_vim/,,
+https://github.com/KeitaNakamura/tex-conceal.vim/,,
+https://github.com/ron89/thesaurus_query.vim/,,
+https://github.com/itchyny/thumbnail.vim/,,
+https://github.com/vim-scripts/timestamp.vim/,,
+https://github.com/tomtom/tlib_vim/,,
+https://github.com/wellle/tmux-complete.vim/,,
+https://github.com/edkolev/tmuxline.vim/,,
+https://github.com/folke/todo-comments.nvim/,,
+https://github.com/AmeerTaweel/todo.nvim/,,
+https://github.com/freitass/todo.txt-vim/,,
+https://github.com/akinsho/toggleterm.nvim/,,
+https://github.com/folke/tokyonight.nvim/,,
+https://github.com/markonm/traces.vim/,,
+https://github.com/tjdevries/train.nvim/,,
+https://github.com/tremor-rs/tremor-vim/,,
+https://github.com/folke/trouble.nvim/,,
+https://github.com/jgdavey/tslime.vim/,,
+https://github.com/Quramy/tsuquyomi/,,
+https://github.com/folke/twilight.nvim/,,
+https://github.com/leafgarland/typescript-vim/,,
+https://github.com/SirVer/ultisnips/,,
+https://github.com/mbbill/undotree/,,
+https://github.com/chrisbra/unicode.vim/,,
+https://github.com/Shougo/unite.vim/,,
+https://github.com/axieax/urlview.nvim/,,
+https://github.com/vim-scripts/utl.vim/,,
+https://github.com/KabbAmine/vCoolor.vim/,,
+https://github.com/junegunn/vader.vim/,,
+https://github.com/jbyuki/venn.nvim/,,
+https://github.com/vhda/verilog_systemverilog.vim/,,
+https://github.com/vifm/vifm.vim/,,
+https://github.com/dracula/vim/,,dracula-vim
+https://github.com/embark-theme/vim/,,embark-vim
+https://github.com/Konfekt/vim-CtrlXA/,,
+https://github.com/konfekt/vim-DetectSpellLang/,,
+https://github.com/dpelle/vim-LanguageTool/,,
+https://github.com/inkarkat/vim-ReplaceWithRegister/,,
+https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/,,
+https://github.com/inkarkat/vim-SyntaxRange/,,
+https://github.com/tpope/vim-abolish/,,
+https://github.com/MarcWeber/vim-addon-actions/,,
+https://github.com/MarcWeber/vim-addon-async/,,
+https://github.com/MarcWeber/vim-addon-background-cmd/,,
+https://github.com/MarcWeber/vim-addon-commenting/,,
+https://github.com/MarcWeber/vim-addon-completion/,,
+https://github.com/MarcWeber/vim-addon-errorformats/,,
+https://github.com/MarcWeber/vim-addon-goto-thing-at-cursor/,,
+https://github.com/MarcWeber/vim-addon-local-vimrc/,,
+https://github.com/MarcWeber/vim-addon-manager/,,
+https://github.com/MarcWeber/vim-addon-mru/,,
+https://github.com/MarcWeber/vim-addon-mw-utils/,,
+https://github.com/MarcWeber/vim-addon-nix/,,
+https://github.com/MarcWeber/vim-addon-other/,,
+https://github.com/MarcWeber/vim-addon-php-manual/,,
+https://github.com/MarcWeber/vim-addon-signs/,,
+https://github.com/MarcWeber/vim-addon-sql/,,
+https://github.com/MarcWeber/vim-addon-syntax-checker/,,
+https://github.com/MarcWeber/vim-addon-toggle-buffer/,,
+https://github.com/MarcWeber/vim-addon-xdebug/,,
+https://github.com/junegunn/vim-after-object/,,
+https://github.com/vim-airline/vim-airline/,,
+https://github.com/enricobacis/vim-airline-clock/,,
+https://github.com/vim-airline/vim-airline-themes/,,
+https://github.com/Konfekt/vim-alias/,,
+https://github.com/hsanson/vim-android/,,
+https://github.com/osyo-manga/vim-anzu/,,
+https://github.com/ThePrimeagen/vim-apm/,,
+https://github.com/PeterRincker/vim-argumentative/,,
+https://github.com/FooSoft/vim-argwrap/,,
+https://github.com/haya14busa/vim-asterisk/,,
+https://github.com/hura/vim-asymptote/,,
+https://github.com/907th/vim-auto-save/,,
+https://github.com/vim-autoformat/vim-autoformat/,,
+https://github.com/benizi/vim-automkdir/,,
+https://github.com/gioele/vim-autoswap/,,
+https://github.com/bazelbuild/vim-bazel/,,
+https://github.com/moll/vim-bbye/,,
+https://github.com/nathangrigg/vim-beancount/,,
+https://github.com/ntpeters/vim-better-whitespace/,,
+https://github.com/MattesGroeger/vim-bookmarks/,,
+https://github.com/gyim/vim-boxdraw/,,
+https://github.com/ConradIrwin/vim-bracketed-paste/,,
+https://github.com/mtikekar/vim-bsv/,,
+https://github.com/jeetsukumaran/vim-buffergator/,,
+https://github.com/bling/vim-bufferline/,,
+https://github.com/qpkorr/vim-bufkill/,,
+https://github.com/tpope/vim-capslock/,,
+https://github.com/kristijanhusak/vim-carbon-now-sh/,,
+https://github.com/m-pilia/vim-ccls/,,
+https://github.com/t9md/vim-choosewin/,,
+https://github.com/rhysd/vim-clang-format/,,
+https://github.com/liuchengxu/vim-clap/,,
+https://github.com/guns/vim-clojure-highlight/,,
+https://github.com/guns/vim-clojure-static/,,
+https://github.com/rstacruz/vim-closer/,,
+https://github.com/alvan/vim-closetag/,,
+https://github.com/tomasiser/vim-code-dark/,,
+https://github.com/google/vim-codefmt/,,
+https://github.com/kchmck/vim-coffee-script/,,
+https://github.com/kalbasit/vim-colemak/,,
+https://github.com/altercation/vim-colors-solarized/,,
+https://github.com/flazz/vim-colorschemes/,,
+https://github.com/jonbri/vim-colorstepper/,,
+https://github.com/tpope/vim-commentary/,,
+https://github.com/luan/vim-concourse/,,
+https://github.com/romainl/vim-cool/,,
+https://github.com/octol/vim-cpp-enhanced-highlight/,,
+https://github.com/mhinz/vim-crates/,,
+https://github.com/OrangeT/vim-csharp/,,
+https://github.com/ap/vim-css-color/,,
+https://github.com/jjo/vim-cue/,,
+https://github.com/itchyny/vim-cursorword/,,
+https://github.com/ehamberg/vim-cute-python/,,
+https://github.com/tpope/vim-dadbod/,,
+https://github.com/kristijanhusak/vim-dadbod-completion/,,
+https://github.com/kristijanhusak/vim-dadbod-ui/,,
+https://github.com/sunaku/vim-dasht/,,
+https://github.com/ajmwagar/vim-deus/,,
+https://github.com/ryanoasis/vim-devicons/,,
+https://github.com/blueyed/vim-diminactive/,,
+https://github.com/will133/vim-dirdiff/,,
+https://github.com/justinmk/vim-dirvish/,,
+https://github.com/kristijanhusak/vim-dirvish-git/,,
+https://github.com/tpope/vim-dispatch/,,
+https://github.com/radenling/vim-dispatch-neovim/,,
+https://github.com/jhradilek/vim-docbk/,,
+https://github.com/junegunn/vim-easy-align/,,
+https://github.com/zhou13/vim-easyescape/,,
+https://github.com/neoclide/vim-easygit/,,
+https://github.com/easymotion/vim-easymotion/,,
+https://github.com/xolox/vim-easytags/,,
+https://github.com/justincampbell/vim-eighties/,,
+https://github.com/elixir-editors/vim-elixir/,,
+https://github.com/andys8/vim-elm-syntax/,,
+https://github.com/junegunn/vim-emoji/,,
+https://github.com/tpope/vim-endwise/,,
+https://github.com/vim-erlang/vim-erlang-compiler/,,
+https://github.com/vim-erlang/vim-erlang-omnicomplete/,,
+https://github.com/vim-erlang/vim-erlang-runtime/,,
+https://github.com/vim-erlang/vim-erlang-tags/,,
+https://github.com/tpope/vim-eunuch/,,
+https://github.com/tommcdo/vim-exchange/,,
+https://github.com/terryma/vim-expand-region/,,
+https://github.com/int3/vim-extradite/,,
+https://github.com/wsdjeg/vim-fetch/,,
+https://github.com/tpope/vim-fireplace/,,
+https://github.com/dag/vim-fish/,,
+https://github.com/tpope/vim-flagship/,,
+https://github.com/nvie/vim-flake8/,,
+https://github.com/dcharbon/vim-flatbuffers/,,
+https://github.com/voldikss/vim-floaterm/,,
+https://github.com/rbong/vim-flog/,,
+https://github.com/thosakwe/vim-flutter/,,
+https://github.com/fsharp/vim-fsharp/,,
+https://github.com/thinca/vim-ft-diff_fold/,,
+https://github.com/tommcdo/vim-fubitive/,,
+https://github.com/tpope/vim-fugitive/,,
+https://github.com/maxjacobson/vim-fzf-coauthorship/,,
+https://github.com/ruanyl/vim-gh-line/,,
+https://github.com/raghur/vim-ghost/,,
+https://github.com/mattn/vim-gist/,,
+https://github.com/lambdalisue/vim-gista/,,
+https://github.com/tpope/vim-git/,,
+https://github.com/itchyny/vim-gitbranch/,,
+https://github.com/airblade/vim-gitgutter/,,
+https://github.com/junegunn/vim-github-dashboard/,,
+https://github.com/tikhomirov/vim-glsl/,,
+https://github.com/jamessan/vim-gnupg/,,
+https://github.com/fatih/vim-go/,,
+https://github.com/rhysd/vim-grammarous/,,
+https://github.com/jparise/vim-graphql/,,
+https://github.com/mhinz/vim-grepper/,,
+https://github.com/lifepillar/vim-gruvbox8/,,
+https://github.com/brennanfee/vim-gui-position/,,
+https://github.com/ludovicchabant/vim-gutentags/,,
+https://github.com/takac/vim-hardtime/,,
+https://github.com/chkno/vim-haskell-module-name/,,
+https://github.com/enomsg/vim-haskellConcealPlus/,,
+https://github.com/twinside/vim-haskellconceal/,,
+https://github.com/jvirtanen/vim-hcl/,,
+https://github.com/bitc/vim-hdevtools/,,
+https://github.com/towolf/vim-helm/,,
+https://github.com/RRethy/vim-hexokinase/,,
+https://github.com/jceb/vim-hier/,,
+https://github.com/machakann/vim-highlightedyank/,,
+https://github.com/alx741/vim-hindent/,,
+https://github.com/GEverding/vim-hocon/,,
+https://github.com/Twinside/vim-hoogle/,,
+https://github.com/jonsmithers/vim-html-template-literals/,,
+https://github.com/vim-utils/vim-husk/,,
+https://github.com/w0ng/vim-hybrid/,,
+https://github.com/kristijanhusak/vim-hybrid-material/,,
+https://github.com/noc7c9/vim-iced-coffee-script/,,
+https://github.com/RRethy/vim-illuminate/,,
+https://github.com/nathanaelkane/vim-indent-guides/,,
+https://github.com/michaeljsmith/vim-indent-object/,,
+https://github.com/jeetsukumaran/vim-indentwise/,,
+https://github.com/henrik/vim-indexed-search/,,
+https://github.com/ivanov/vim-ipython/,,
+https://github.com/fisadev/vim-isort/,,
+https://github.com/clojure-vim/vim-jack-in/,,
+https://github.com/mhinz/vim-janah/,,
+https://github.com/artur-shaik/vim-javacomplete2/,,
+https://github.com/pangloss/vim-javascript/,,
+https://github.com/jelera/vim-javascript-syntax/,,
+https://github.com/lepture/vim-jinja/,,
+https://github.com/maksimr/vim-jsbeautify/,,
+https://github.com/heavenshell/vim-jsdoc/,,
+https://github.com/elzr/vim-json/,,
+https://github.com/google/vim-jsonnet/,,
+https://github.com/MaxMEllon/vim-jsx-pretty/,,
+https://github.com/peitalin/vim-jsx-typescript/,,
+https://github.com/knubie/vim-kitty-navigator/,,
+https://github.com/farmergreg/vim-lastplace/,,
+https://github.com/xuhdev/vim-latex-live-preview/,,
+https://github.com/ludovicchabant/vim-lawrencium/,,
+https://github.com/hecal3/vim-leader-guide/,,
+https://github.com/mk12/vim-lean/,,
+https://github.com/ledger/vim-ledger/,,
+https://github.com/lfe-support/vim-lfe/,,
+https://github.com/josa42/vim-lightline-coc/,,
+https://github.com/tommcdo/vim-lion/,,
+https://github.com/tpope/vim-liquid/,,
+https://github.com/embear/vim-localvimrc/,,
+https://github.com/andreshazard/vim-logreview/,,
+https://github.com/mlr-msft/vim-loves-dafny/,,
+https://github.com/natebosch/vim-lsc/,,
+https://github.com/prabirshrestha/vim-lsp/,,
+https://github.com/jackguo380/vim-lsp-cxx-highlight/,,
+https://github.com/tbastos/vim-lua/,,
+https://github.com/google/vim-maktaba/,,
+https://github.com/lambdalisue/vim-manpager/,,
+https://github.com/Yilin-Yang/vim-markbar/,,
+https://github.com/preservim/vim-markdown/,,
+https://github.com/euclio/vim-markdown-composer/,,
+https://github.com/mzlogin/vim-markdown-toc/,,
+https://github.com/andymass/vim-matchup/,,
+https://github.com/samoshkin/vim-mergetool/,,
+https://github.com/idanarye/vim-merginal/,,
+https://github.com/david-a-wheeler/vim-metamath/,,
+https://github.com/xolox/vim-misc/,,
+https://github.com/crusoexia/vim-monokai/,,
+https://github.com/phanviet/vim-monokai-pro/,,
+https://github.com/matze/vim-move/,,
+https://github.com/lifepillar/vim-mucomplete/,,
+https://github.com/terryma/vim-multiple-cursors/,,
+https://github.com/simnalamburt/vim-mundo/,,
+https://github.com/mustache/vim-mustache-handlebars/,,
+https://github.com/tiagofumo/vim-nerdtree-syntax-highlight/,,
+https://github.com/jistr/vim-nerdtree-tabs/,,
+https://github.com/nfnty/vim-nftables/,,
+https://github.com/kana/vim-niceblock/,,
+https://github.com/tommcdo/vim-ninja-feet/,,
+https://github.com/LnL7/vim-nix/,,
+https://github.com/symphorien/vim-nixhash/,,
+https://github.com/noahfrederick/vim-noctu/,,
+https://github.com/fruit-in/vim-nong-theme/,,
+https://github.com/jeffkreeftmeijer/vim-numbertoggle/,,
+https://github.com/tpope/vim-obsession/,,
+https://github.com/ocaml/vim-ocaml/,,
+https://github.com/rakr/vim-one/,,
+https://github.com/petRUShka/vim-opencl/,,
+https://github.com/kana/vim-operator-replace/,,
+https://github.com/rhysd/vim-operator-surround/,,
+https://github.com/kana/vim-operator-user/,,
+https://github.com/jceb/vim-orgmode/,,
+https://github.com/sdiehl/vim-ormolu/,,
+https://github.com/fcpg/vim-osc52/,,
+https://github.com/ojroques/vim-oscyank/,,
+https://github.com/osyo-manga/vim-over/,,
+https://github.com/hashivim/vim-packer/,,
+https://github.com/lambdalisue/vim-pager/,,
+https://github.com/vim-pandoc/vim-pandoc/,,
+https://github.com/vim-pandoc/vim-pandoc-after/,,
+https://github.com/vim-pandoc/vim-pandoc-syntax/,,
+https://github.com/bhurlow/vim-parinfer/,,
+https://github.com/sickill/vim-pasta/,,
+https://github.com/tpope/vim-pathogen/,,
+https://github.com/junegunn/vim-peekaboo/,,
+https://github.com/preservim/vim-pencil/,,
+https://github.com/jparise/vim-phabricator/,,
+https://github.com/justinj/vim-pico8-syntax/,,
+https://github.com/junegunn/vim-plug/,,
+https://github.com/powerman/vim-plugin-AnsiEsc/,,
+https://github.com/sheerun/vim-polyglot/,,
+https://github.com/jakwings/vim-pony/,,
+https://github.com/haya14busa/vim-poweryank/,,
+https://github.com/prettier/vim-prettier/,,
+https://github.com/thinca/vim-prettyprint/,,
+https://github.com/pantharshit00/vim-prisma/,,
+https://github.com/tpope/vim-projectionist/,,
+https://github.com/dhruvasagar/vim-prosession/,,
+https://github.com/uarun/vim-protobuf/,,
+https://github.com/PProvost/vim-ps1/,,
+https://github.com/digitaltoad/vim-pug/,,
+https://github.com/rodjek/vim-puppet/,,
+https://github.com/Vimjas/vim-python-pep8-indent/,,
+https://github.com/romainl/vim-qf/,,
+https://github.com/romainl/vim-qlist/,,
+https://github.com/peterhoeg/vim-qml/,,
+https://github.com/thinca/vim-quickrun/,,
+https://github.com/racer-rust/vim-racer/,,
+https://github.com/wlangstroth/vim-racket/,,
+https://github.com/tpope/vim-ragtag/,,
+https://github.com/tpope/vim-rails/,,
+https://github.com/jordwalke/vim-reasonml/,,
+https://github.com/tpope/vim-repeat/,,
+https://github.com/tpope/vim-rhubarb/,,
+https://github.com/airblade/vim-rooter/,,
+https://github.com/tpope/vim-rsi/,,
+https://github.com/vim-ruby/vim-ruby/,,
+https://github.com/tpope/vim-salve/,,
+https://github.com/machakann/vim-sandwich/,,
+https://github.com/mhinz/vim-sayonara/,7e774f58c5865d9c10d40396850b35ab95af17c5,
+https://github.com/derekwyatt/vim-scala/,,
+https://github.com/thinca/vim-scouter/,,
+https://github.com/tpope/vim-scriptease/,,
+https://github.com/tpope/vim-sensible/,,
+https://github.com/guns/vim-sexp/,,
+https://github.com/tpope/vim-sexp-mappings-for-regular-people/,,
+https://github.com/itspriddle/vim-shellcheck/,,
+https://github.com/kshenoy/vim-signature/,,
+https://github.com/mhinz/vim-signify/,,
+https://github.com/ivalkeen/vim-simpledb/,,
+https://github.com/junegunn/vim-slash/,,
+https://github.com/tpope/vim-sleuth/,,
+https://github.com/jpalardy/vim-slime/,,
+https://github.com/mzlogin/vim-smali/,,
+https://github.com/t9md/vim-smalls/,,
+https://github.com/psliwka/vim-smoothie/,,
+https://github.com/bohlender/vim-smt2/,,
+https://github.com/justinmk/vim-sneak/,,
+https://github.com/garbas/vim-snipmate/,,
+https://github.com/honza/vim-snippets/,,
+https://github.com/jhradilek/vim-snippets/,,vim-docbk-snippets
+https://github.com/tomlion/vim-solidity/,,
+https://github.com/christoomey/vim-sort-motion/,,
+https://github.com/CoatiSoftware/vim-sourcetrail/,,
+https://github.com/tpope/vim-speeddating/,,
+https://github.com/kbenzie/vim-spirv/,,
+https://github.com/mhinz/vim-startify/,,
+https://github.com/dstein64/vim-startuptime/,,
+https://github.com/axelf4/vim-strip-trailing-whitespace/,,
+https://github.com/nbouscal/vim-stylish-haskell/,,
+https://github.com/alx741/vim-stylishask/,,
+https://github.com/svermeulen/vim-subversive/,,
+https://github.com/tpope/vim-surround/,,
+https://github.com/evanleck/vim-svelte/,,
+https://github.com/machakann/vim-swap/,,
+https://github.com/dhruvasagar/vim-table-mode/,,
+https://github.com/kana/vim-tabpagecd/,,
+https://github.com/tpope/vim-tbone/,,
+https://github.com/hashivim/vim-terraform/,,
+https://github.com/juliosueiras/vim-terraform-completion/,,
+https://github.com/vim-test/vim-test/,,
+https://github.com/glts/vim-textobj-comment/,,
+https://github.com/kana/vim-textobj-entire/,,
+https://github.com/kana/vim-textobj-function/,,
+https://github.com/gibiansky/vim-textobj-haskell/,,
+https://github.com/osyo-manga/vim-textobj-multiblock/,,
+https://github.com/kana/vim-textobj-user/,,
+https://github.com/Julian/vim-textobj-variable-segment/,,
+https://github.com/thinca/vim-themis/,,
+https://github.com/tmux-plugins/vim-tmux/,,
+https://github.com/roxma/vim-tmux-clipboard/,,
+https://github.com/tmux-plugins/vim-tmux-focus-events/,,
+https://github.com/christoomey/vim-tmux-navigator/,,
+https://github.com/milkypostman/vim-togglelist/,,
+https://github.com/cespare/vim-toml/,,
+https://github.com/vimpostor/vim-tpipeline/,,
+https://github.com/bronson/vim-trailing-whitespace/,,
+https://github.com/ianks/vim-tsx/,,
+https://github.com/lumiliet/vim-twig/,,
+https://github.com/sodapopcan/vim-twiggy/,,
+https://github.com/rcarriga/vim-ultest/,,
+https://github.com/arthurxavierx/vim-unicoder/,,
+https://github.com/tpope/vim-unimpaired/,,
+https://github.com/hashivim/vim-vagrant/,,
+https://github.com/tpope/vim-vinegar/,,
+https://github.com/triglav/vim-visual-increment/,,
+https://github.com/mg979/vim-visual-multi/,,
+https://github.com/thinca/vim-visualstar/,,
+https://github.com/hrsh7th/vim-vsnip/,,
+https://github.com/hrsh7th/vim-vsnip-integ/,,
+https://github.com/posva/vim-vue/,,
+https://github.com/wakatime/vim-wakatime/,,
+https://github.com/osyo-manga/vim-watchdogs/,,
+https://github.com/jasonccox/vim-wayland-clipboard/,,
+https://github.com/liuchengxu/vim-which-key/,,
+https://github.com/wesQ3/vim-windowswap/,,
+https://github.com/chaoren/vim-wordmotion/,,
+https://github.com/preservim/vim-wordy/,,
+https://github.com/joonty/vim-xdebug/,,
+https://github.com/lyokha/vim-xkbswitch/,,
+https://github.com/mg979/vim-xtabline/,,
+https://github.com/stephpy/vim-yaml/,,
+https://github.com/mindriot101/vim-yapf/,,
+https://github.com/dag/vim2hs/,,
+https://github.com/dominikduda/vim_current_word/,,
+https://github.com/andrep/vimacs/,,
+https://github.com/TaDaa/vimade/,,
+https://github.com/jreybert/vimagit/,,
+https://github.com/gotcha/vimelette/,,
+https://github.com/Shougo/vimfiler.vim/,,
+https://github.com/vimoutliner/vimoutliner/,,
+https://github.com/tex/vimpreviewpandoc/,,
+https://github.com/Shougo/vimproc.vim/,,
+https://github.com/vimsence/vimsence/,,
+https://github.com/Shougo/vimshell.vim/,,
+https://github.com/puremourning/vimspector/,,
+https://github.com/lervag/vimtex/,,
+https://github.com/preservim/vimux/,,
+https://github.com/vimwiki/vimwiki/,,
+https://github.com/vim-scripts/vis/,,
+https://github.com/navicore/vissort.vim/,,
+https://github.com/liuchengxu/vista.vim/,,
+https://github.com/dylanaraps/wal.vim/,,
+https://github.com/mattn/webapi-vim/,,
+https://github.com/folke/which-key.nvim/,,
+https://github.com/gelguy/wilder.nvim/,,
+https://github.com/gcmt/wildfire.vim/,,
+https://github.com/sindrets/winshift.nvim/,,
+https://github.com/wannesm/wmgraphviz.vim/,,
+https://github.com/vim-scripts/wombat256.vim/,,
+https://github.com/lukaszkorecki/workflowish/,,
+https://github.com/tweekmonster/wstrip.vim/,,
+https://github.com/drmingdrmer/xptemplate/,,
+https://github.com/guns/xterm-color-table.vim/,,
+https://github.com/HerringtonDarkholme/yats.vim/,,
+https://github.com/KabbAmine/zeavim.vim/,,
+https://github.com/folke/zen-mode.nvim/,,
+https://github.com/jnurmine/zenburn/,,
+https://github.com/glepnir/zephyr-nvim/,,
+https://github.com/ziglang/zig.vim/,,
+https://github.com/troydm/zoomwintab.vim/,,
+https://github.com/nanotee/zoxide.vim/,,
diff --git a/pkgs/applications/graphics/imgbrd-grabber/default.nix b/pkgs/applications/graphics/imgbrd-grabber/default.nix
index 59d1e6817bd..b9f838c016f 100644
--- a/pkgs/applications/graphics/imgbrd-grabber/default.nix
+++ b/pkgs/applications/graphics/imgbrd-grabber/default.nix
@@ -33,12 +33,12 @@ stdenv.mkDerivation rec {
 
   buildInputs = [
     openssl
-    makeWrapper
     libpulseaudio
     typescript
   ];
 
   nativeBuildInputs = [
+    makeWrapper
     qtmultimedia
     qtbase
     qtdeclarative
diff --git a/pkgs/applications/graphics/jpegrescan/default.nix b/pkgs/applications/graphics/jpegrescan/default.nix
index 1a7320bf693..f96742e6c06 100644
--- a/pkgs/applications/graphics/jpegrescan/default.nix
+++ b/pkgs/applications/graphics/jpegrescan/default.nix
@@ -28,8 +28,12 @@ stdenv.mkDerivation rec {
 
   propagatedBuildInputs = [ perlPackages.FileSlurp ];
 
+  nativeBuildInputs = [
+    makeWrapper
+  ];
+
   buildInputs = [
-    perl libjpeg_turbo makeWrapper
+    perl libjpeg_turbo
   ];
 
   meta = with lib; {
diff --git a/pkgs/applications/graphics/synfigstudio/default.nix b/pkgs/applications/graphics/synfigstudio/default.nix
index 2b9fee974b3..57f35602336 100644
--- a/pkgs/applications/graphics/synfigstudio/default.nix
+++ b/pkgs/applications/graphics/synfigstudio/default.nix
@@ -103,10 +103,10 @@ stdenv.mkDerivation {
 
   preConfigure = "./bootstrap.sh";
 
-  nativeBuildInputs = [ pkg-config autoreconfHook gettext ];
+  nativeBuildInputs = [ pkg-config autoreconfHook gettext makeWrapper ];
   buildInputs = [
     ETL boost cairo glibmm gtk3 gtkmm3 imagemagick intltool
-    libjack2 libsigcxx libxmlxx makeWrapper mlt-qt5
+    libjack2 libsigcxx libxmlxx mlt-qt5
     synfig which gnome.adwaita-icon-theme
   ];
 
diff --git a/pkgs/applications/misc/gnome-solanum/default.nix b/pkgs/applications/misc/gnome-solanum/default.nix
index 8ad1267afa9..e7d2489bdb5 100644
--- a/pkgs/applications/misc/gnome-solanum/default.nix
+++ b/pkgs/applications/misc/gnome-solanum/default.nix
@@ -1,6 +1,7 @@
 { lib
 , stdenv
 , fetchFromGitLab
+, fetchpatch
 , rustPlatform
 , desktop-file-utils
 , meson
@@ -27,6 +28,15 @@ stdenv.mkDerivation rec {
     sha256 = "0cga6cz6jfbipzp008rjznkz7844licdc34lk133fcyqil0cg0ap";
   };
 
+  patches = [
+    # Fix build with meson 0.61, can be removed on next update
+    # https://gitlab.gnome.org/World/Solanum/-/merge_requests/49
+    (fetchpatch {
+      url = "https://gitlab.gnome.org/World/Solanum/-/commit/e5c5d88f95b0fe4145c9ed346b8ca98a613d7cfe.patch";
+      sha256 = "j84P9KzMr0o38u4OD4ZPst+yqw1LCRoa1awT3nelFDI=";
+    })
+  ];
+
   cargoDeps = rustPlatform.fetchCargoTarball {
     inherit src;
     name = "${pname}-${version}";
diff --git a/pkgs/applications/networking/sniffers/wireshark/default.nix b/pkgs/applications/networking/sniffers/wireshark/default.nix
index 931606f3248..468a06af209 100644
--- a/pkgs/applications/networking/sniffers/wireshark/default.nix
+++ b/pkgs/applications/networking/sniffers/wireshark/default.nix
@@ -1,6 +1,6 @@
 { lib, stdenv, fetchurl, pkg-config, pcre, perl, flex, bison, gettext, libpcap, libnl, c-ares
 , gnutls, libgcrypt, libgpg-error, geoip, openssl, lua5, python3, libcap, glib
-, libssh, nghttp2, zlib, cmake, makeWrapper
+, libssh, nghttp2, zlib, cmake, makeWrapper, wrapGAppsHook
 , withQt ? true, qt5 ? null
 , ApplicationServices, SystemConfiguration, gmp
 , asciidoctor
@@ -34,7 +34,8 @@ in stdenv.mkDerivation {
   # Avoid referencing -dev paths because of debug assertions.
   NIX_CFLAGS_COMPILE = [ "-DQT_NO_DEBUG" ];
 
-  nativeBuildInputs = [ asciidoctor bison cmake flex makeWrapper pkg-config ] ++ optional withQt qt5.wrapQtAppsHook;
+  nativeBuildInputs = [ asciidoctor bison cmake flex makeWrapper pkg-config ]
+    ++ optionals withQt [ qt5.wrapQtAppsHook wrapGAppsHook ];
 
   buildInputs = [
     gettext pcre perl libpcap lua5 libssh nghttp2 openssl libgcrypt
@@ -85,6 +86,12 @@ in stdenv.mkDerivation {
 
   dontFixCmake = true;
 
+  # Prevent double-wrapping, inject wrapper args manually instead.
+  dontWrapGApps = true;
+  preFixup = ''
+    qtWrapperArgs+=("''${gappsWrapperArgs[@]}")
+  '';
+
   shellHook = ''
     # to be able to run the resulting binary
     export WIRESHARK_RUN_FROM_BUILD_DIRECTORY=1
diff --git a/pkgs/applications/science/chemistry/jmol/default.nix b/pkgs/applications/science/chemistry/jmol/default.nix
index a747b96dd18..fe3e05b6562 100644
--- a/pkgs/applications/science/chemistry/jmol/default.nix
+++ b/pkgs/applications/science/chemistry/jmol/default.nix
@@ -25,14 +25,14 @@ let
   };
 in
 stdenv.mkDerivation rec {
-  version = "14.32.39";
+  version = "14.32.45";
   pname = "jmol";
 
   src = let
     baseVersion = "${lib.versions.major version}.${lib.versions.minor version}";
   in fetchurl {
     url = "mirror://sourceforge/jmol/Jmol/Version%20${baseVersion}/Jmol%20${version}/Jmol-${version}-binary.tar.gz";
-    sha256 = "sha256-ekwipWWGsXYECJBOmw0+uIWHDpdF8T8jZUo6LeqD6Io=";
+    sha256 = "sha256-9bcOwORHLZfn95RFur4JdP3Djpq8K8utnWIsniqKAI4=";
   };
 
   patchPhase = ''
diff --git a/pkgs/build-support/docker/default.nix b/pkgs/build-support/docker/default.nix
index 96ea363c811..5a4e30ede8a 100644
--- a/pkgs/build-support/docker/default.nix
+++ b/pkgs/build-support/docker/default.nix
@@ -16,8 +16,8 @@
 , makeWrapper
 , moreutils
 , nix
+, nixosTests
 , pigz
-, pkgs
 , rsync
 , runCommand
 , runtimeShell
@@ -26,6 +26,7 @@
 , storeDir ? builtins.storeDir
 , substituteAll
 , symlinkJoin
+, tarsum
 , util-linux
 , vmTools
 , writeReferencesToFile
@@ -81,6 +82,15 @@ rec {
     inherit buildImage buildLayeredImage fakeNss pullImage shadowSetup buildImageWithNixDb;
   };
 
+  tests = {
+    inherit (nixosTests)
+      docker-tools
+      docker-tools-overlay
+      # requires remote builder
+      # docker-tools-cross
+      ;
+  };
+
   pullImage =
     let
       fixName = name: builtins.replaceStrings [ "/" ":" ] [ "-" "-" ] name;
@@ -113,7 +123,7 @@ rec {
         outputHashAlgo = "sha256";
         outputHash = sha256;
 
-        nativeBuildInputs = lib.singleton skopeo;
+        nativeBuildInputs = [ skopeo ];
         SSL_CERT_FILE = "${cacert.out}/etc/ssl/certs/ca-bundle.crt";
 
         sourceURL = "docker://${imageName}@${imageDigest}";
@@ -132,7 +142,7 @@ rec {
 
   # We need to sum layer.tar, not a directory, hence tarsum instead of nix-hash.
   # And we cannot untar it, because then we cannot preserve permissions etc.
-  tarsum = pkgs.tarsum;
+  inherit tarsum; # pkgs.dockerTools.tarsum
 
   # buildEnv creates symlinks to dirs, which is hard to edit inside the overlay VM
   mergeDrvs =
@@ -754,7 +764,7 @@ rec {
   # "#!/usr/bin/env executable" shebang.
   usrBinEnv = runCommand "usr-bin-env" { } ''
     mkdir -p $out/usr/bin
-    ln -s ${pkgs.coreutils}/bin/env $out/usr/bin
+    ln -s ${coreutils}/bin/env $out/usr/bin
   '';
 
   # This provides /bin/sh, pointing to bashInteractive.
diff --git a/pkgs/build-support/docker/examples.nix b/pkgs/build-support/docker/examples.nix
index 941ee048666..169edb171db 100644
--- a/pkgs/build-support/docker/examples.nix
+++ b/pkgs/build-support/docker/examples.nix
@@ -486,7 +486,7 @@ rec {
   cross = let
     # Cross compile for x86_64 if on aarch64
     crossPkgs =
-      if pkgs.system == "aarch64-linux" then pkgsCross.gnu64
+      if pkgs.stdenv.hostPlatform.system == "aarch64-linux" then pkgsCross.gnu64
       else pkgsCross.aarch64-multiplatform;
   in crossPkgs.dockerTools.buildImage {
     name = "hello-cross";
diff --git a/pkgs/desktops/pantheon/apps/elementary-code/default.nix b/pkgs/desktops/pantheon/apps/elementary-code/default.nix
index f1cd335459e..25acfc28062 100644
--- a/pkgs/desktops/pantheon/apps/elementary-code/default.nix
+++ b/pkgs/desktops/pantheon/apps/elementary-code/default.nix
@@ -1,7 +1,6 @@
 { lib
 , stdenv
 , fetchFromGitHub
-, fetchpatch
 , nix-update-script
 , appstream
 , desktop-file-utils
@@ -28,24 +27,15 @@
 
 stdenv.mkDerivation rec {
   pname = "elementary-code";
-  version = "6.1.0";
+  version = "6.2.0";
 
   src = fetchFromGitHub {
     owner = "elementary";
     repo = "code";
     rev = version;
-    sha256 = "sha256-AXmMcPj2hf33G5v3TUg+eZwaKOdVlRvoVXglMJFHRjw=";
+    sha256 = "sha256-QhJNRhYgGbPMd7B1X3kG+pnC/lGUoF7gc7O1PdG49LI=";
   };
 
-  patches = [
-    # Fix build with meson 0.61
-    # https://github.com/elementary/code/pull/1165
-    (fetchpatch {
-      url = "https://github.com/elementary/code/commit/a2607cce3a6b1bb62d02456456d3cbc3c6530bb0.patch";
-      sha256 = "sha256-VKR83IOUYsQhBRlU9JUTlMJtXWv/AyG4wDsjMU2vmU8=";
-    })
-  ];
-
   nativeBuildInputs = [
     appstream
     desktop-file-utils
diff --git a/pkgs/development/compilers/julia/1.6-bin.nix b/pkgs/development/compilers/julia/1.6-bin.nix
index ece5a2a2471..acdd8a034e7 100644
--- a/pkgs/development/compilers/julia/1.6-bin.nix
+++ b/pkgs/development/compilers/julia/1.6-bin.nix
@@ -2,12 +2,12 @@
 
 stdenv.mkDerivation rec {
   pname = "julia-bin";
-  version = "1.6.5";
+  version = "1.6.6";
 
   src = {
     x86_64-linux = fetchurl {
       url = "https://julialang-s3.julialang.org/bin/linux/x64/${lib.versions.majorMinor version}/julia-${version}-linux-x86_64.tar.gz";
-      sha256 = "0b4fmcfd5q5wzvasmsfqq838rivpxn274n5y2kza4m3jakp27zmq";
+      sha256 = "0ia9a4h7w0n5rg57fkl1kzcyj500ymfwq3qsd2r7l82288dgfpy2";
     };
   }.${stdenv.hostPlatform.system} or (throw "Unsupported system: ${stdenv.hostPlatform.system}");
 
diff --git a/pkgs/development/libraries/hivex/default.nix b/pkgs/development/libraries/hivex/default.nix
index 204af0a92b5..85fa8fc4c6e 100644
--- a/pkgs/development/libraries/hivex/default.nix
+++ b/pkgs/development/libraries/hivex/default.nix
@@ -12,9 +12,9 @@ stdenv.mkDerivation rec {
 
   patches = [ ./hivex-syms.patch ];
 
-  nativeBuildInputs = [ pkg-config ];
+  nativeBuildInputs = [ autoreconfHook makeWrapper pkg-config ];
   buildInputs = [
-    autoreconfHook makeWrapper libxml2
+    libxml2
   ]
   ++ (with perlPackages; [ perl IOStringy ])
   ++ lib.optionals stdenv.isDarwin [ libiconv ];
diff --git a/pkgs/development/ocaml-modules/eliom/default.nix b/pkgs/development/ocaml-modules/eliom/default.nix
index e3af173edc9..f3c587428a4 100644
--- a/pkgs/development/ocaml-modules/eliom/default.nix
+++ b/pkgs/development/ocaml-modules/eliom/default.nix
@@ -16,17 +16,18 @@
 , js_of_ocaml-tyxml
 , lwt_ppx
 , ocamlnet
+, ocsipersist
 }:
 
 stdenv.mkDerivation rec {
   pname = "eliom";
-  version = "8.9.0";
+  version = "9.4.0";
 
   src = fetchFromGitHub {
     owner = "ocsigen";
     repo = "eliom";
     rev = version;
-    sha256 = "sha256-VNxzpVpXEGlixyjadbW0GjL83jcKV5TWd46UReNYO6w=";
+    sha256 = "sha256:1yn8mqxv9yz51x81j8wv1jn7l7crm8azp1m2g4zn5nz2s4nmfv6q";
   };
 
   nativeBuildInputs = [
@@ -49,12 +50,17 @@ stdenv.mkDerivation rec {
     lwt_ppx
     lwt_react
     ocsigen_server
+    ocsipersist
     ppx_deriving
   ];
 
   strictDeps = true;
 
-  installPhase = "opaline -prefix $out -libdir $OCAMLFIND_DESTDIR";
+  installPhase = ''
+    runHook preInstall
+    opaline -prefix $out -libdir $OCAMLFIND_DESTDIR
+    runHook postInstall
+  '';
 
   setupHook = [ ./setup-hook.sh ];
 
diff --git a/pkgs/development/ocaml-modules/ocsigen-server/default.nix b/pkgs/development/ocaml-modules/ocsigen-server/default.nix
index 67ec458a122..daa64b7e301 100644
--- a/pkgs/development/ocaml-modules/ocsigen-server/default.nix
+++ b/pkgs/development/ocaml-modules/ocsigen-server/default.nix
@@ -2,7 +2,7 @@
 , bigstringaf, lwt, cstruct, mirage-crypto, zarith, mirage-crypto-ec, ptime, mirage-crypto-rng, mtime, ca-certs
 , cohttp, cohttp-lwt-unix, hmap
 , lwt_log, ocaml_pcre, cryptokit, xml-light, ipaddr
-, pgocaml, camlzip, ocaml_sqlite3
+, camlzip
 , makeWrapper
 }:
 
@@ -17,7 +17,7 @@ let caml_ld_library_path =
 ; in
 
 buildDunePackage rec {
-  version = "4.0.1";
+  version = "5.0.1";
   pname = "ocsigenserver";
 
   useDune2 = true;
@@ -27,11 +27,11 @@ buildDunePackage rec {
     owner = "ocsigen";
     repo = "ocsigenserver";
     rev = version;
-    sha256 = "0pid4irkmdmx1d6n2rvcvx5mnljl3hazzdqc3bql72by35izfac6";
+    sha256 = "sha256:1vzza33hd41740dqrx4854rqpyd8wv7kwpsvvmlpck841i9lh8h5";
   };
 
   nativeBuildInputs = [ makeWrapper which ];
-  buildInputs = [ lwt_react pgocaml camlzip ocaml_sqlite3 ];
+  buildInputs = [ lwt_react camlzip ];
 
   propagatedBuildInputs = [ cohttp cohttp-lwt-unix cryptokit hmap ipaddr lwt_log lwt_ssl
     ocaml_pcre xml-light
diff --git a/pkgs/development/ocaml-modules/ocsigen-start/default.nix b/pkgs/development/ocaml-modules/ocsigen-start/default.nix
index 118138dc8fd..4f439733740 100644
--- a/pkgs/development/ocaml-modules/ocsigen-start/default.nix
+++ b/pkgs/development/ocaml-modules/ocsigen-start/default.nix
@@ -6,7 +6,7 @@
 
 stdenv.mkDerivation rec {
   pname = "ocaml${ocaml.version}-ocsigen-start";
-  version = "4.3.0";
+  version = "4.5.0";
 
   nativeBuildInputs = [ ocaml findlib eliom ];
   propagatedBuildInputs = [ pgocaml_ppx safepass ocsigen-toolkit yojson resource-pooling cohttp-lwt-unix ocamlnet ];
@@ -19,7 +19,7 @@ stdenv.mkDerivation rec {
     owner = "ocsigen";
     repo = "ocsigen-start";
     rev = version;
-    sha256 = "0lkl59dwzyqq2lyr46fyjr27ms0fp9h59xfsn37faaavdd7v0h98";
+    sha256 = "sha256:1n94r8rbkzxbgcz5w135n6f2cwpc91bdvf7yslcdq4cn713rncmq";
   };
 
   preInstall = ''
diff --git a/pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix b/pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix
index 1b2dd72a2ec..12a92c5be39 100644
--- a/pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix
+++ b/pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix
@@ -5,7 +5,7 @@
 stdenv.mkDerivation rec {
  pname = "ocsigen-toolkit";
  name = "ocaml${ocaml.version}-${pname}-${version}";
- version = "3.0.1";
+ version = "3.1.1";
 
  propagatedBuildInputs = [ calendar js_of_ocaml-ppx_deriving_json eliom ];
  nativeBuildInputs = [ ocaml findlib opaline eliom ];
@@ -25,7 +25,7 @@ stdenv.mkDerivation rec {
     owner = "ocsigen";
     repo = pname;
     rev = version;
-    sha256 = "1yx50ja2wcs5vfy4rk9szgwccpnihkjn14i4ywchx4yr4ppr00fm";
+    sha256 = "sha256:1fm0vvccmjib9yj5m2760vhzb4z3392swlprp51az53g3vk4q218";
   };
 
   meta = {
diff --git a/pkgs/development/ocaml-modules/ocsipersist/default.nix b/pkgs/development/ocaml-modules/ocsipersist/default.nix
new file mode 100644
index 00000000000..8006477dad9
--- /dev/null
+++ b/pkgs/development/ocaml-modules/ocsipersist/default.nix
@@ -0,0 +1,20 @@
+{ buildDunePackage, ocsipersist-lib
+, ocsipersist-pgsql
+, ocsipersist-sqlite
+}:
+
+buildDunePackage {
+  pname = "ocsipersist";
+  inherit (ocsipersist-lib) src version useDune2;
+
+  buildInputs = [
+    ocsipersist-pgsql
+    ocsipersist-sqlite
+  ];
+
+  propagatedBuildInputs = [ ocsipersist-lib ];
+
+  meta = ocsipersist-lib.meta // {
+    description = "Persistent key/value storage (for Ocsigen) using multiple backends";
+  };
+}
diff --git a/pkgs/development/ocaml-modules/ocsipersist/lib.nix b/pkgs/development/ocaml-modules/ocsipersist/lib.nix
new file mode 100644
index 00000000000..a2abc5d9b39
--- /dev/null
+++ b/pkgs/development/ocaml-modules/ocsipersist/lib.nix
@@ -0,0 +1,27 @@
+{ lib, buildDunePackage, fetchFromGitHub
+, lwt_ppx, lwt
+}:
+
+buildDunePackage rec {
+  pname = "ocsipersist-lib";
+  version = "1.1.0";
+
+  useDune2 = true;
+
+  src = fetchFromGitHub {
+    owner = "ocsigen";
+    repo = "ocsipersist";
+    rev = version;
+    sha256 = "sha256:1d6kdcfjvrz0dl764mnyxc477aa57rvmzkg154qc915w2y1nbz9a";
+  };
+
+  buildInputs = [ lwt_ppx ];
+  propagatedBuildInputs = [ lwt ];
+
+  meta = {
+    description = "Persistent key/value storage (for Ocsigen) - support library";
+    license = lib.licenses.lgpl21Only;
+    maintainers = [ lib.maintainers.vbgl ];
+    inherit (src.meta) homepage;
+  };
+}
diff --git a/pkgs/development/ocaml-modules/ocsipersist/pgsql.nix b/pkgs/development/ocaml-modules/ocsipersist/pgsql.nix
new file mode 100644
index 00000000000..e93c8b47903
--- /dev/null
+++ b/pkgs/development/ocaml-modules/ocsipersist/pgsql.nix
@@ -0,0 +1,24 @@
+{ buildDunePackage, ocsipersist-lib
+, lwt_log
+, ocsigen_server
+, pgocaml
+, xml-light
+}:
+
+buildDunePackage {
+  pname = "ocsipersist-pgsql";
+  inherit (ocsipersist-lib) version src useDune2;
+
+  propagatedBuildInputs = [
+    lwt_log
+    ocsigen_server
+    ocsipersist-lib
+    pgocaml
+    xml-light
+  ];
+
+  meta = ocsipersist-lib.meta // {
+    description = "Persistent key/value storage (for Ocsigen) using PostgreSQL";
+  };
+}
+
diff --git a/pkgs/development/ocaml-modules/ocsipersist/sqlite.nix b/pkgs/development/ocaml-modules/ocsipersist/sqlite.nix
new file mode 100644
index 00000000000..2cfa30bc908
--- /dev/null
+++ b/pkgs/development/ocaml-modules/ocsipersist/sqlite.nix
@@ -0,0 +1,23 @@
+{ buildDunePackage, ocsipersist-lib
+, lwt_log
+, ocaml_sqlite3
+, ocsigen_server
+, xml-light
+}:
+
+buildDunePackage {
+  pname = "ocsipersist-sqlite";
+  inherit (ocsipersist-lib) version src useDune2;
+
+  propagatedBuildInputs = [
+    lwt_log
+    ocaml_sqlite3
+    ocsigen_server
+    ocsipersist-lib
+    xml-light
+  ];
+
+  meta = ocsipersist-lib.meta // {
+    description = "Persistent key/value storage (for Ocsigen) using SQLite";
+  };
+}
diff --git a/pkgs/development/python-modules/faraday-plugins/default.nix b/pkgs/development/python-modules/faraday-plugins/default.nix
index 42f8a486050..e1c6fee726e 100644
--- a/pkgs/development/python-modules/faraday-plugins/default.nix
+++ b/pkgs/development/python-modules/faraday-plugins/default.nix
@@ -16,14 +16,14 @@
 
 buildPythonPackage rec {
   pname = "faraday-plugins";
-  version = "1.6.1";
+  version = "1.6.2";
   format = "setuptools";
 
   src = fetchFromGitHub {
     owner = "infobyte";
     repo = "faraday_plugins";
     rev = "v${version}";
-    sha256 = "sha256-NpPVA+fruI/xX0KMjRuRuMK8HYc/0ErbDhJOCNXKhyY=";
+    sha256 = "sha256-1YROdQvwfV5Wp7vsNYCy2X6yR6mplunchD0U4xGUNBc=";
   };
 
   propagatedBuildInputs = [
diff --git a/pkgs/development/python-modules/hachoir/default.nix b/pkgs/development/python-modules/hachoir/default.nix
index 2c46b14a274..c7d4178e3bf 100644
--- a/pkgs/development/python-modules/hachoir/default.nix
+++ b/pkgs/development/python-modules/hachoir/default.nix
@@ -3,17 +3,21 @@
 , fetchFromGitHub
 , pytestCheckHook
 , urwid
+, pythonOlder
 }:
 
 buildPythonPackage rec {
   pname = "hachoir";
-  version = "3.1.2";
+  version = "3.1.3";
+  format = "setuptools";
+
+  disabled = pythonOlder "3.7";
 
   src = fetchFromGitHub {
     owner = "vstinner";
     repo = pname;
     rev = version;
-    sha256 = "06544qmmimvaznwcjs8wwfih1frdd7anwcw5z07cf69l8p146p0y";
+    hash = "sha256-HlxDwkU0GccO+IUzbtVpLbsAo+Mcacm4/WrXWCsmpBg=";
   };
 
   propagatedBuildInputs = [
@@ -24,7 +28,9 @@ buildPythonPackage rec {
     pytestCheckHook
   ];
 
-  pythonImportsCheck = [ "hachoir" ];
+  pythonImportsCheck = [
+    "hachoir"
+  ];
 
   meta = with lib; {
     description = "Python library to view and edit a binary stream";
diff --git a/pkgs/development/python-modules/hahomematic/default.nix b/pkgs/development/python-modules/hahomematic/default.nix
index b70c8081975..512f92deb1b 100644
--- a/pkgs/development/python-modules/hahomematic/default.nix
+++ b/pkgs/development/python-modules/hahomematic/default.nix
@@ -14,7 +14,7 @@
 
 buildPythonPackage rec {
   pname = "hahomematic";
-  version = "1.0.4";
+  version = "1.0.5";
   format = "setuptools";
 
   disabled = pythonOlder "3.9";
@@ -23,7 +23,7 @@ buildPythonPackage rec {
     owner = "danielperna84";
     repo = pname;
     rev = version;
-    sha256 = "sha256-YpsZKhuK3IzUZFNmBToBOuUacaDgbMC/N7pZDjuSzbE=";
+    sha256 = "sha256-8iLQpNax0xgjf+vUo6OcXMF1aZuaRFZBos8EC1gJEPA=";
   };
 
   propagatedBuildInputs = [
diff --git a/pkgs/development/python-modules/md-toc/default.nix b/pkgs/development/python-modules/md-toc/default.nix
index a37e82a62d3..5f0f9a434b4 100644
--- a/pkgs/development/python-modules/md-toc/default.nix
+++ b/pkgs/development/python-modules/md-toc/default.nix
@@ -8,7 +8,7 @@
 
 buildPythonPackage rec {
   pname = "md-toc";
-  version = "8.1.1";
+  version = "8.1.2";
   format = "setuptools";
 
   disabled = pythonOlder "3.5";
@@ -17,7 +17,7 @@ buildPythonPackage rec {
     owner = "frnmst";
     repo = pname;
     rev = version;
-    sha256 = "sha256-Dlqia+B7WJZlFGlIhgUWdND1qhSS/FOPoFH+uim6i8I=";
+    sha256 = "sha256-EmhCZhxUCzBMqScPeawvcWmP9rrthow1vhTZachjCDI=";
   };
 
   propagatedBuildInputs = [
diff --git a/pkgs/development/python-modules/pex/default.nix b/pkgs/development/python-modules/pex/default.nix
index 0c22823d565..4d6085e6deb 100644
--- a/pkgs/development/python-modules/pex/default.nix
+++ b/pkgs/development/python-modules/pex/default.nix
@@ -7,14 +7,14 @@
 
 buildPythonPackage rec {
   pname = "pex";
-  version = "2.1.75";
+  version = "2.1.76";
   format = "flit";
 
   disabled = pythonOlder "3.7";
 
   src = fetchPypi {
     inherit pname version;
-    hash = "sha256-G5JE4/ZWZYo8Fpy3ZhIaWNzGfEkWb9qA9vL3UVTqf0Q=";
+    hash = "sha256-a/e0tz67QR7SSYQRt3tJqgCGJLn6oi0+3HMpg8NKRH8=";
   };
 
   nativeBuildInputs = [
diff --git a/pkgs/development/python-modules/pyvesync/default.nix b/pkgs/development/python-modules/pyvesync/default.nix
index 96669c52634..c0800c3a8cc 100644
--- a/pkgs/development/python-modules/pyvesync/default.nix
+++ b/pkgs/development/python-modules/pyvesync/default.nix
@@ -7,14 +7,14 @@
 
 buildPythonPackage rec {
   pname = "pyvesync";
-  version = "2.0.0";
+  version = "2.0.1";
   format = "setuptools";
 
   disabled = pythonOlder "3.6";
 
   src = fetchPypi {
     inherit pname version;
-    sha256 = "sha256-+054tFirjMF3sGLRpTVCZ3V2KN627b57+fFl6GBMMcU=";
+    sha256 = "sha256-7eGsRy8S6IZQ+UVNN8SoS7tBIYLlujSFr2qFldaxtJE=";
   };
 
   propagatedBuildInputs = [
diff --git a/pkgs/development/python-modules/sqlmap/default.nix b/pkgs/development/python-modules/sqlmap/default.nix
index a435b363a0f..6313f413c6a 100644
--- a/pkgs/development/python-modules/sqlmap/default.nix
+++ b/pkgs/development/python-modules/sqlmap/default.nix
@@ -7,11 +7,11 @@
 
 buildPythonPackage rec {
   pname = "sqlmap";
-  version = "1.6.3";
+  version = "1.6.4";
 
   src = fetchPypi {
     inherit pname version;
-    sha256 = "sha256-W/UdJPLcFOEHHz7VYeQ3CcXysNju5DuxqvYA+xMkb20=";
+    sha256 = "sha256-6RKJ5a8Yl+SnWgdfrTIwY0m1JyY6W9fhZk6pTZiBVx8=";
   };
 
   postPatch = ''
diff --git a/pkgs/development/python-modules/typed-settings/default.nix b/pkgs/development/python-modules/typed-settings/default.nix
index 6e903b68407..d9696122f15 100644
--- a/pkgs/development/python-modules/typed-settings/default.nix
+++ b/pkgs/development/python-modules/typed-settings/default.nix
@@ -12,13 +12,13 @@
 
 buildPythonPackage rec {
   pname = "typed-settings";
-  version = "1.0.0";
+  version = "1.0.1";
   format = "pyproject";
   disabled = pythonOlder "3.7";
 
   src = fetchPypi {
     inherit pname version;
-    sha256 = "sha256-c+iOb1F8+9IoRbwpMTdyDfOPW2ZEo4xDAlbzLAxgSfk=";
+    sha256 = "sha256-xrIJgQiAaSXcANMnyXMnqEkLNUP+VyxjRoi9DkX+SLA=";
   };
 
   nativeBuildInputs = [
diff --git a/pkgs/development/python-modules/weasyprint/default.nix b/pkgs/development/python-modules/weasyprint/default.nix
index 3d752596dec..a1a7470b8b5 100644
--- a/pkgs/development/python-modules/weasyprint/default.nix
+++ b/pkgs/development/python-modules/weasyprint/default.nix
@@ -27,7 +27,7 @@
 
 buildPythonPackage rec {
   pname = "weasyprint";
-  version = "54.2";
+  version = "54.3";
   disabled = !isPy3k;
 
   format = "pyproject";
@@ -35,7 +35,7 @@ buildPythonPackage rec {
   src = fetchPypi {
     inherit version;
     pname = "weasyprint";
-    sha256 = "sha256-1eiqguPiokd6RUPwZG2fsUCAybo0oIWXUesjdXzABGY=";
+    sha256 = "sha256-4E2gQGMFZsRMqiAgM/B/hYdl9TZwkEWoCXOfPQSOidY=";
   };
 
   patches = [
diff --git a/pkgs/development/tools/analysis/checkov/default.nix b/pkgs/development/tools/analysis/checkov/default.nix
index 8cda4a0b212..77bf4c5dfb1 100644
--- a/pkgs/development/tools/analysis/checkov/default.nix
+++ b/pkgs/development/tools/analysis/checkov/default.nix
@@ -32,13 +32,13 @@ with py.pkgs;
 
 buildPythonApplication rec {
   pname = "checkov";
-  version = "2.0.988";
+  version = "2.0.1034";
 
   src = fetchFromGitHub {
     owner = "bridgecrewio";
     repo = pname;
     rev = version;
-    hash = "sha256-0/SL20N5d/oqWdyvVMZ+pzpPbehrYepaPi8P8SS8DSA=";
+    hash = "sha256-amSgg/6yYaLKzwkO7dq06zvh4744RyTVhd/tdurHKa4=";
   };
 
   nativeBuildInputs = with py.pkgs; [
@@ -94,7 +94,8 @@ buildPythonApplication rec {
   postPatch = ''
     substituteInPlace setup.py \
       --replace "cyclonedx-python-lib>=0.11.0,<1.0.0" "cyclonedx-python-lib>=0.11.0" \
-      --replace "prettytable>=3.0.0" "prettytable"
+      --replace "prettytable>=3.0.0" "prettytable" \
+      --replace "pycep-parser==0.3.3" "pycep-parser"
   '';
 
   preCheck = ''
@@ -114,6 +115,8 @@ buildPythonApplication rec {
     "test_skipped_check_exists"
     # AssertionError: 0 not greater than 0
     "test_skip_mapping_default"
+    # Test is failing
+    "test_SQLServerAuditingEnabled"
   ];
 
   disabledTestPaths = [
diff --git a/pkgs/development/tools/continuous-integration/buildkite-agent/default.nix b/pkgs/development/tools/continuous-integration/buildkite-agent/default.nix
index 32be3e43238..bd345d73109 100644
--- a/pkgs/development/tools/continuous-integration/buildkite-agent/default.nix
+++ b/pkgs/development/tools/continuous-integration/buildkite-agent/default.nix
@@ -3,16 +3,16 @@
   nixosTests }:
 buildGoModule rec {
   pname = "buildkite-agent";
-  version = "3.34.1";
+  version = "3.35.0";
 
   src = fetchFromGitHub {
     owner = "buildkite";
     repo = "agent";
     rev = "v${version}";
-    sha256 = "sha256-OxZcMPJx83hBQOe4Pc8ERhO9QOc4euVVs+OMbPjA4U0=";
+    sha256 = "sha256-Ql6Oe58a5z4UhANDVRGwcmwVgrCfkRKyN5DVXPshf3w=";
   };
 
-  vendorSha256 = "sha256-n3XRxpEKjHf7L7fcGscWTVKBtot9waZbLoS9cG0kHfI=";
+  vendorSha256 = "sha256-YnOOJDzdirikFbS9451A/TWOSWv04QsqO68/cSXK82k=";
 
   postPatch = ''
     substituteInPlace bootstrap/shell/shell.go --replace /bin/bash ${bash}/bin/bash
@@ -46,7 +46,7 @@ buildGoModule rec {
     '';
     homepage = "https://buildkite.com/docs/agent";
     license = licenses.mit;
-    maintainers = with maintainers; [ pawelpacana zimbatm rvl ];
+    maintainers = with maintainers; [ pawelpacana zimbatm rvl techknowlogick ];
     platforms = with platforms; unix ++ darwin;
   };
 }
diff --git a/pkgs/development/tools/misc/gef/default.nix b/pkgs/development/tools/misc/gef/default.nix
index 0352ebc7cf3..b09cc795d8c 100644
--- a/pkgs/development/tools/misc/gef/default.nix
+++ b/pkgs/development/tools/misc/gef/default.nix
@@ -4,6 +4,7 @@
 , makeWrapper
 , gdb
 , python3
+, bintools-unwrapped
 , file
 , ps
 , git
@@ -39,7 +40,12 @@ in stdenv.mkDerivation rec {
     makeWrapper ${gdb}/bin/gdb $out/bin/gef \
       --add-flags "-q -x $out/share/gef/gef.py" \
       --set NIX_PYTHONPATH ${pythonPath} \
-      --prefix PATH : ${lib.makeBinPath [ python3 file ps ]}
+      --prefix PATH : ${lib.makeBinPath [
+        python3
+        bintools-unwrapped # for readelf
+        file
+        ps
+      ]}
   '';
 
   checkInputs = [
diff --git a/pkgs/development/tools/neil/default.nix b/pkgs/development/tools/neil/default.nix
index 643ca8773cb..c0d1ec44f9e 100644
--- a/pkgs/development/tools/neil/default.nix
+++ b/pkgs/development/tools/neil/default.nix
@@ -7,13 +7,13 @@
 
 stdenv.mkDerivation rec {
   pname = "neil";
-  version = "0.0.13";
+  version = "0.0.23";
 
   src = fetchFromGitHub {
     owner = "babashka";
     repo = "neil";
     rev = "v${version}";
-    sha256 = "0jiyl0d39d8kk5bpangwxiy90vqipj4lgp8x84rh4z5m53knjpkd";
+    sha256 = "0fx34gkhkklzq3hzk1cj2l4rgqrq9vif5y8b0nx9gg4136yj85cg";
   };
 
   nativeBuildInputs = [ makeWrapper ];
diff --git a/pkgs/development/tools/phantomjs2/default.nix b/pkgs/development/tools/phantomjs2/default.nix
index d9e4ec1fb19..5093553824d 100644
--- a/pkgs/development/tools/phantomjs2/default.nix
+++ b/pkgs/development/tools/phantomjs2/default.nix
@@ -25,11 +25,10 @@ in stdenv.mkDerivation rec {
     sha256 = "1zsbpk1sgh9a16f1a5nx3qvk77ibjn812wqkxqck8n6fia85m5iq";
   };
 
-  nativeBuildInputs = [ qmake ];
+  nativeBuildInputs = [ qmake makeWrapper ];
   buildInputs = [
     bison flex fontconfig freetype gperf icu openssl
     libjpeg libpng perl python2 ruby sqlite qtwebkit qtbase
-    makeWrapper
   ] ++ lib.optionals stdenv.isDarwin (with darwin.apple_sdk.frameworks; [
     AGL ApplicationServices AppKit Cocoa OpenGL
     darwin.libobjc fakeClang cups
diff --git a/pkgs/development/tools/skaffold/default.nix b/pkgs/development/tools/skaffold/default.nix
index 4f286cb22d7..0a7a1823baa 100644
--- a/pkgs/development/tools/skaffold/default.nix
+++ b/pkgs/development/tools/skaffold/default.nix
@@ -2,13 +2,13 @@
 
 buildGoModule rec {
   pname = "skaffold";
-  version = "1.37.0";
+  version = "1.37.1";
 
   src = fetchFromGitHub {
     owner = "GoogleContainerTools";
     repo = "skaffold";
     rev = "v${version}";
-    sha256 = "sha256-mS+q+WOdEMMHjoqoIlDOqkoaRRLlou7FbMjC436k96A=";
+    sha256 = "sha256-hcP0BGzPQoYGvK+5Ro9Ts5882JhQYRT63mdTJbXhnzg=";
   };
 
   vendorSha256 = "sha256-LiNnTAI7iJkWL657eBw5OsCdvgWE2ZFZ3e+8vJtMhoE=";
diff --git a/pkgs/development/tools/skopeo/default.nix b/pkgs/development/tools/skopeo/default.nix
index 6618c024851..c25a27e6d95 100644
--- a/pkgs/development/tools/skopeo/default.nix
+++ b/pkgs/development/tools/skopeo/default.nix
@@ -10,6 +10,7 @@
 , installShellFiles
 , makeWrapper
 , fuse-overlayfs
+, dockerTools
 }:
 
 buildGoModule rec {
@@ -53,6 +54,10 @@ buildGoModule rec {
     runHook postInstall
   '';
 
+  passthru.tests = {
+    inherit (dockerTools.examples) testNixFromDockerHub;
+  };
+
   meta = with lib; {
     description = "A command line utility for various operations on container images and image repositories";
     homepage = "https://github.com/containers/skopeo";
diff --git a/pkgs/os-specific/linux/pam_usb/default.nix b/pkgs/os-specific/linux/pam_usb/default.nix
index 0091accd57a..ebd45246ae8 100644
--- a/pkgs/os-specific/linux/pam_usb/default.nix
+++ b/pkgs/os-specific/linux/pam_usb/default.nix
@@ -41,8 +41,12 @@ stdenv.mkDerivation rec {
     sha256 = "1g1w0s9d8mfld8abrn405ll5grv3xgs0b0hsganrz6qafdq9j7q1";
   };
 
-  buildInputs = [
+  nativeBuildInputs = [
     makeWrapper
+    pkg-config
+  ];
+
+  buildInputs = [
     # pam_usb dependencies
     dbus libxml2 pam pmount pkg-config
     # pam_usb's tools dependencies
diff --git a/pkgs/servers/monitoring/munin/default.nix b/pkgs/servers/monitoring/munin/default.nix
index 258247c34f4..e8fa4feb6af 100644
--- a/pkgs/servers/monitoring/munin/default.nix
+++ b/pkgs/servers/monitoring/munin/default.nix
@@ -13,8 +13,11 @@ stdenv.mkDerivation rec {
     sha256 = "sha256-p273O5JLFX1dA2caV3lVVL9YNTcGMSrC7DWieUfUmqI=";
   };
 
-  buildInputs = [
+  nativeBuildInputs = [
     makeWrapper
+  ];
+
+  buildInputs = [
     which
     coreutils
     rrdtool
diff --git a/pkgs/servers/owncast/default.nix b/pkgs/servers/owncast/default.nix
index 774f51bc0f6..313d17e8e8d 100644
--- a/pkgs/servers/owncast/default.nix
+++ b/pkgs/servers/owncast/default.nix
@@ -15,7 +15,7 @@ buildGoModule rec {
 
   propagatedBuildInputs = [ ffmpeg ];
 
-  buildInputs = [ makeWrapper ];
+  nativeBuildInputs = [ makeWrapper ];
 
   preInstall = ''
     mkdir -p $out
diff --git a/pkgs/servers/rt/default.nix b/pkgs/servers/rt/default.nix
index ff0bbd6b97d..2b5188f743a 100644
--- a/pkgs/servers/rt/default.nix
+++ b/pkgs/servers/rt/default.nix
@@ -18,10 +18,10 @@ stdenv.mkDerivation rec {
 
   nativeBuildInputs = [
     autoreconfHook
+    makeWrapper
   ];
 
   buildInputs = [
-    makeWrapper
     perl
     (buildEnv {
       name = "rt-perl-deps";
diff --git a/pkgs/tools/X11/obconf/default.nix b/pkgs/tools/X11/obconf/default.nix
index 8074e52c7cf..5ffef951d51 100644
--- a/pkgs/tools/X11/obconf/default.nix
+++ b/pkgs/tools/X11/obconf/default.nix
@@ -13,6 +13,7 @@ stdenv.mkDerivation rec {
 
   nativeBuildInputs = [
     autoreconfHook
+    makeWrapper
     pkg-config
   ];
 
@@ -22,7 +23,6 @@ stdenv.mkDerivation rec {
     libSM
     libstartup_notification
     libxml2
-    makeWrapper
     openbox
   ];
 
diff --git a/pkgs/tools/misc/kisslicer/default.nix b/pkgs/tools/misc/kisslicer/default.nix
index 31bc0b2b6a1..f80e15b3b3c 100644
--- a/pkgs/tools/misc/kisslicer/default.nix
+++ b/pkgs/tools/misc/kisslicer/default.nix
@@ -27,8 +27,11 @@ stdenv.mkDerivation rec {
     stripRoot = false;
   };
 
-  buildInputs = [
+  nativeBuildInputs = [
     makeWrapper
+  ];
+
+  buildInputs = [
     libGLU libGL
     libX11
   ];
diff --git a/pkgs/tools/misc/logstash/6.x.nix b/pkgs/tools/misc/logstash/6.x.nix
index 0b3e17818dc..c1136ed8876 100644
--- a/pkgs/tools/misc/logstash/6.x.nix
+++ b/pkgs/tools/misc/logstash/6.x.nix
@@ -26,8 +26,12 @@ let this = stdenv.mkDerivation rec {
   dontStrip         = true;
   dontPatchShebangs = true;
 
+  nativeBuildInputs = [
+    makeWrapper
+  ];
+
   buildInputs = [
-    makeWrapper jre
+    jre
   ];
 
   installPhase = ''
diff --git a/pkgs/tools/misc/logstash/7.x.nix b/pkgs/tools/misc/logstash/7.x.nix
index 636c380817c..6cf64691efb 100644
--- a/pkgs/tools/misc/logstash/7.x.nix
+++ b/pkgs/tools/misc/logstash/7.x.nix
@@ -41,8 +41,11 @@ let
     dontStrip = true;
     dontPatchShebangs = true;
 
-    buildInputs = [
+    nativeBuildInputs = [
       makeWrapper
+    ];
+
+    buildInputs = [
       jre
     ];
 
diff --git a/pkgs/tools/package-management/nix/default.nix b/pkgs/tools/package-management/nix/default.nix
index 4510948b436..4ad17072dc8 100644
--- a/pkgs/tools/package-management/nix/default.nix
+++ b/pkgs/tools/package-management/nix/default.nix
@@ -68,6 +68,17 @@ in lib.makeExtensible (self: {
   nix_2_7 = common {
     version = "2.7.0";
     sha256 = "sha256-m8tqCS6uHveDon5GSro5yZor9H+sHeh+v/veF1IGw24=";
+    patches = [
+      # remove when there's a 2.7.1 release
+      # https://github.com/NixOS/nix/pull/6297
+      # https://github.com/NixOS/nix/issues/6243
+      # https://github.com/NixOS/nixpkgs/issues/163374
+      (fetchpatch {
+        url = "https://github.com/NixOS/nix/commit/c9afca59e87afe7d716101e6a75565b4f4b631f7.patch";
+        sha256 = "sha256-xz7QnWVCI12lX1+K/Zr9UpB93b10t1HS9y/5n5FYf8Q=";
+      })
+    ];
+
   };
 
   stable = self.nix_2_7;
diff --git a/pkgs/tools/security/aeskeyfind/default.nix b/pkgs/tools/security/aeskeyfind/default.nix
new file mode 100644
index 00000000000..08b2481ff00
--- /dev/null
+++ b/pkgs/tools/security/aeskeyfind/default.nix
@@ -0,0 +1,30 @@
+{ lib
+, stdenv
+, fetchurl
+}:
+
+stdenv.mkDerivation rec {
+  pname = "aeskeyfind";
+  version = "1.0";
+
+  src = fetchurl {
+    url = "https://citpsite.s3.amazonaws.com/memory-content/src/aeskeyfind-${version}.tar.gz";
+    sha256 = "sha256-FBflwbYehruVJ9sfW+4ZlaDuqCR12zy8iA4Ev3Bgg+Q=";
+  };
+
+  installPhase = ''
+    runHook preInstall
+    mkdir -p $out/bin
+    cp aeskeyfind $out/bin
+    runHook postInstall
+  '';
+
+  meta = with lib; {
+    description = "Locates 128-bit and 256-bit AES keys in a captured memory image";
+    homepage = "https://citp.princeton.edu/our-work/memory/";
+    license = licenses.bsd3;
+    maintainers = with maintainers; [ fedx-sudo ];
+  };
+
+}
+
diff --git a/pkgs/top-level/all-packages.nix b/pkgs/top-level/all-packages.nix
index 83015e1c633..852bbf74d0d 100644
--- a/pkgs/top-level/all-packages.nix
+++ b/pkgs/top-level/all-packages.nix
@@ -201,6 +201,8 @@ with pkgs;
 
   aesfix = callPackage ../tools/security/aesfix { };
 
+  aeskeyfind = callPackage ../tools/security/aeskeyfind { };
+
   astrolog = callPackage ../applications/science/astronomy/astrolog { };
 
   atkinson-hyperlegible = callPackage ../data/fonts/atkinson-hyperlegible { };
diff --git a/pkgs/top-level/ocaml-packages.nix b/pkgs/top-level/ocaml-packages.nix
index 255ba4eb478..62394a00c6d 100644
--- a/pkgs/top-level/ocaml-packages.nix
+++ b/pkgs/top-level/ocaml-packages.nix
@@ -982,6 +982,14 @@ let
 
     ocsigen-toolkit = callPackage ../development/ocaml-modules/ocsigen-toolkit { };
 
+    ocsipersist = callPackage ../development/ocaml-modules/ocsipersist {};
+
+    ocsipersist-lib = callPackage ../development/ocaml-modules/ocsipersist/lib.nix { };
+
+    ocsipersist-pgsql = callPackage ../development/ocaml-modules/ocsipersist/pgsql.nix { };
+
+    ocsipersist-sqlite = callPackage ../development/ocaml-modules/ocsipersist/sqlite.nix { };
+
     octavius = callPackage ../development/ocaml-modules/octavius { };
 
     odate = callPackage ../development/ocaml-modules/odate { };