diff options
author | sternenseemann <sternenseemann@systemli.org> | 2022-04-05 21:21:42 +0200 |
---|---|---|
committer | sternenseemann <sternenseemann@systemli.org> | 2022-04-05 21:21:42 +0200 |
commit | fb2fc3b4a4fc71d53e89c661428ca59abce1706c (patch) | |
tree | 847cb4ba60c7a1592458afa229a838595a3a1a20 | |
parent | a964dcad739fe70ed5e01646594aafdfb2be4560 (diff) | |
parent | bef07673d323a9c489a664ba7dee3dd10468a293 (diff) | |
download | nixpkgs-fb2fc3b4a4fc71d53e89c661428ca59abce1706c.tar nixpkgs-fb2fc3b4a4fc71d53e89c661428ca59abce1706c.tar.gz nixpkgs-fb2fc3b4a4fc71d53e89c661428ca59abce1706c.tar.bz2 nixpkgs-fb2fc3b4a4fc71d53e89c661428ca59abce1706c.tar.lz nixpkgs-fb2fc3b4a4fc71d53e89c661428ca59abce1706c.tar.xz nixpkgs-fb2fc3b4a4fc71d53e89c661428ca59abce1706c.tar.zst nixpkgs-fb2fc3b4a4fc71d53e89c661428ca59abce1706c.zip |
Merge remote-tracking branch 'origin/master' into haskell-updates
893 files changed, 9403 insertions, 6852 deletions
diff --git a/.github/CODEOWNERS b/.github/CODEOWNERS index 008d51b29aa..07dfe176f49 100644 --- a/.github/CODEOWNERS +++ b/.github/CODEOWNERS @@ -242,9 +242,8 @@ # Docker tools /pkgs/build-support/docker @roberth -/nixos/tests/docker-tools-overlay.nix @roberth -/nixos/tests/docker-tools.nix @roberth -/doc/builders/images/dockertools.xml @roberth +/nixos/tests/docker-tools* @roberth +/doc/builders/images/dockertools.section.md @roberth # Blockchains /pkgs/applications/blockchains @mmahut @RaghavSood diff --git a/doc/languages-frameworks/go.section.md b/doc/languages-frameworks/go.section.md index 411205d08e4..9c67a514335 100644 --- a/doc/languages-frameworks/go.section.md +++ b/doc/languages-frameworks/go.section.md @@ -142,4 +142,8 @@ Removes the pre-existing vendor directory. This should only be used if the depen ### `subPackages` {#var-go-subPackages} -Limits the builder from building child packages that have not been listed. If `subPackages` is not specified, all child packages will be built. +Specified as a string or list of strings. Limits the builder from building child packages that have not been listed. If `subPackages` is not specified, all child packages will be built. + +### `excludedPackages` {#var-go-excludedPackages} + +Specified as a string or list of strings. Causes the builder to skip building child packages that match any of the provided values. If `excludedPackages` is not specified, all child packages will be built. diff --git a/lib/strings.nix b/lib/strings.nix index d34263c9949..820d1901f94 100644 --- a/lib/strings.nix +++ b/lib/strings.nix @@ -756,7 +756,14 @@ rec { sanitizeDerivationName pkgs.hello => "-nix-store-2g75chlbpxlrqn15zlby2dfh8hr9qwbk-hello-2.10" */ - sanitizeDerivationName = string: lib.pipe string [ + sanitizeDerivationName = + let okRegex = match "[[:alnum:]+_?=-][[:alnum:]+._?=-]*"; + in + string: + # First detect the common case of already valid strings, to speed those up + if stringLength string <= 207 && okRegex string != null + then unsafeDiscardStringContext string + else lib.pipe string [ # Get rid of string context. This is safe under the assumption that the # resulting string is only used as a derivation name unsafeDiscardStringContext diff --git a/lib/tests/misc.nix b/lib/tests/misc.nix index 1eb2d953ebb..c7cef2a9059 100644 --- a/lib/tests/misc.nix +++ b/lib/tests/misc.nix @@ -649,6 +649,11 @@ runTests { expected = "foo"; }; + testSanitizeDerivationNameUnicode = testSanitizeDerivationName { + name = "fö"; + expected = "f-"; + }; + testSanitizeDerivationNameAscii = testSanitizeDerivationName { name = " !\"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\\]^_`abcdefghijklmnopqrstuvwxyz{|}~"; expected = "-+--.-0123456789-=-?-ABCDEFGHIJKLMNOPQRSTUVWXYZ-_-abcdefghijklmnopqrstuvwxyz-"; diff --git a/maintainers/scripts/dep-licenses.sh b/maintainers/scripts/dep-licenses.sh index 28ad22c334f..816dcf6d7f7 100755 --- a/maintainers/scripts/dep-licenses.sh +++ b/maintainers/scripts/dep-licenses.sh @@ -9,7 +9,7 @@ tmp=$(mktemp --tmpdir -d nixpkgs-dep-license.XXXXXX) exitHandler() { exitCode=$? rm -rf "$tmp" - exit $exitCode + return $exitCode } trap "exitHandler" EXIT diff --git a/maintainers/scripts/pluginupdate.py b/maintainers/scripts/pluginupdate.py index 017e3ac758a..3cfdb138705 100644 --- a/maintainers/scripts/pluginupdate.py +++ b/maintainers/scripts/pluginupdate.py @@ -8,6 +8,7 @@ # $ nix run nixpkgs.python3Packages.flake8 -c flake8 --ignore E501,E265 update.py import argparse +import csv import functools import http import json @@ -28,7 +29,7 @@ from pathlib import Path from typing import Dict, List, Optional, Tuple, Union, Any, Callable from urllib.parse import urljoin, urlparse from tempfile import NamedTemporaryFile -from dataclasses import dataclass +from dataclasses import dataclass, asdict import git @@ -85,21 +86,30 @@ def make_request(url: str, token=None) -> urllib.request.Request: headers["Authorization"] = f"token {token}" return urllib.request.Request(url, headers=headers) + +Redirects = Dict['Repo', 'Repo'] + class Repo: def __init__( - self, uri: str, branch: str, alias: Optional[str] + self, uri: str, branch: str ) -> None: self.uri = uri '''Url to the repo''' - self.branch = branch - self.alias = alias - self.redirect: Dict[str, str] = {} + self._branch = branch + # {old_uri: new_uri} + self.redirect: Redirects = {} self.token = "dummy_token" @property def name(self): return self.uri.split('/')[-1] + @property + def branch(self): + return self._branch or "HEAD" + + def __str__(self) -> str: + return f"{self.uri}" def __repr__(self) -> str: return f"Repo({self.name}, {self.uri})" @@ -109,6 +119,7 @@ class Repo: @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def latest_commit(self) -> Tuple[str, datetime]: + log.debug("Latest commit") loaded = self._prefetch(None) updated = datetime.strptime(loaded['date'], "%Y-%m-%dT%H:%M:%S%z") @@ -124,6 +135,7 @@ class Repo: return loaded def prefetch(self, ref: Optional[str]) -> str: + print("Prefetching") loaded = self._prefetch(ref) return loaded["sha256"] @@ -137,21 +149,22 @@ class Repo: class RepoGitHub(Repo): def __init__( - self, owner: str, repo: str, branch: str, alias: Optional[str] + self, owner: str, repo: str, branch: str ) -> None: self.owner = owner self.repo = repo self.token = None '''Url to the repo''' - super().__init__(self.url(""), branch, alias) - log.debug("Instantiating github repo %s/%s", self.owner, self.repo) + super().__init__(self.url(""), branch) + log.debug("Instantiating github repo owner=%s and repo=%s", self.owner, self.repo) @property def name(self): return self.repo def url(self, path: str) -> str: - return urljoin(f"https://github.com/{self.owner}/{self.name}/", path) + res = urljoin(f"https://github.com/{self.owner}/{self.repo}/", path) + return res @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def has_submodules(self) -> bool: @@ -168,6 +181,7 @@ class RepoGitHub(Repo): @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def latest_commit(self) -> Tuple[str, datetime]: commit_url = self.url(f"commits/{self.branch}.atom") + log.debug("Sending request to %s", commit_url) commit_req = make_request(commit_url, self.token) with urllib.request.urlopen(commit_req, timeout=10) as req: self._check_for_redirect(commit_url, req) @@ -191,12 +205,9 @@ class RepoGitHub(Repo): new_owner, new_name = ( urllib.parse.urlsplit(response_url).path.strip("/").split("/")[:2] ) - end_line = "\n" if self.alias is None else f" as {self.alias}\n" - plugin_line = "{owner}/{name}" + end_line - old_plugin = plugin_line.format(owner=self.owner, name=self.name) - new_plugin = plugin_line.format(owner=new_owner, name=new_name) - self.redirect[old_plugin] = new_plugin + new_repo = RepoGitHub(owner=new_owner, repo=new_name, branch=self.branch) + self.redirect[self] = new_repo def prefetch(self, commit: str) -> str: @@ -207,9 +218,9 @@ class RepoGitHub(Repo): return sha256 def prefetch_github(self, ref: str) -> str: - data = subprocess.check_output( - ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")] - ) + cmd = ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")] + log.debug("Running %s", cmd) + data = subprocess.check_output(cmd) return data.strip().decode("utf-8") def as_nix(self, plugin: "Plugin") -> str: @@ -239,21 +250,38 @@ class PluginDesc: else: return self.alias + def __lt__(self, other): + return self.repo.name < other.repo.name + + @staticmethod + def load_from_csv(config: FetchConfig, row: Dict[str, str]) -> 'PluginDesc': + branch = row["branch"] + repo = make_repo(row['repo'], branch.strip()) + repo.token = config.github_token + return PluginDesc(repo, branch.strip(), row["alias"]) + + + @staticmethod + def load_from_string(config: FetchConfig, line: str) -> 'PluginDesc': + branch = "HEAD" + alias = None + uri = line + if " as " in uri: + uri, alias = uri.split(" as ") + alias = alias.strip() + if "@" in uri: + uri, branch = uri.split("@") + repo = make_repo(uri.strip(), branch.strip()) + repo.token = config.github_token + return PluginDesc(repo, branch.strip(), alias) +@dataclass class Plugin: - def __init__( - self, - name: str, - commit: str, - has_submodules: bool, - sha256: str, - date: Optional[datetime] = None, - ) -> None: - self.name = name - self.commit = commit - self.has_submodules = has_submodules - self.sha256 = sha256 - self.date = date + name: str + commit: str + has_submodules: bool + sha256: str + date: Optional[datetime] = None @property def normalized_name(self) -> str: @@ -270,6 +298,17 @@ class Plugin: return copy +def load_plugins_from_csv(config: FetchConfig, input_file: Path,) -> List[PluginDesc]: + log.debug("Load plugins from csv %s", input_file) + plugins = [] + with open(input_file, newline='') as csvfile: + log.debug("Writing into %s", input_file) + reader = csv.DictReader(csvfile,) + for line in reader: + plugin = PluginDesc.load_from_csv(config, line) + plugins.append(plugin) + + return plugins class Editor: """The configuration of the update script.""" @@ -298,14 +337,8 @@ class Editor: return get_current_plugins(self) def load_plugin_spec(self, config: FetchConfig, plugin_file) -> List[PluginDesc]: - plugins = [] - with open(plugin_file) as f: - for line in f: - if line.startswith("#"): - continue - plugin = parse_plugin_line(config, line) - plugins.append(plugin) - return plugins + '''CSV spec''' + return load_plugins_from_csv(config, plugin_file) def generate_nix(self, plugins, outfile: str): '''Returns nothing for now, writes directly to outfile''' @@ -316,11 +349,11 @@ class Editor: _prefetch = functools.partial(prefetch, cache=cache) def update() -> dict: - plugin_names = self.load_plugin_spec(config, input_file) + plugins = self.load_plugin_spec(config, input_file) try: pool = Pool(processes=config.proc) - results = pool.map(_prefetch, plugin_names) + results = pool.map(_prefetch, plugins) finally: cache.store() @@ -423,6 +456,7 @@ def get_current_plugins(editor: Editor) -> List[Plugin]: data = json.loads(out) plugins = [] for name, attr in data.items(): + print("get_current_plugins: name %s" % name) p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"]) plugins.append(p) return plugins @@ -431,7 +465,7 @@ def get_current_plugins(editor: Editor) -> List[Plugin]: def prefetch_plugin( p: PluginDesc, cache: "Optional[Cache]" = None, -) -> Tuple[Plugin, Dict[str, str]]: +) -> Tuple[Plugin, Redirects]: repo, branch, alias = p.repo, p.branch, p.alias name = alias or p.repo.name commit = None @@ -454,11 +488,6 @@ def prefetch_plugin( ) -def fetch_plugin_from_pluginline(config: FetchConfig, plugin_line: str) -> Plugin: - plugin, _ = prefetch_plugin(parse_plugin_line(config, plugin_line)) - return plugin - - def print_download_error(plugin: str, ex: Exception): print(f"{plugin}: {ex}", file=sys.stderr) ex_traceback = ex.__traceback__ @@ -468,14 +497,14 @@ def print_download_error(plugin: str, ex: Exception): ] print("\n".join(tb_lines)) - def check_results( - results: List[Tuple[PluginDesc, Union[Exception, Plugin], Dict[str, str]]] -) -> Tuple[List[Tuple[PluginDesc, Plugin]], Dict[str, str]]: + results: List[Tuple[PluginDesc, Union[Exception, Plugin], Redirects]] +) -> Tuple[List[Tuple[PluginDesc, Plugin]], Redirects]: ''' ''' failures: List[Tuple[str, Exception]] = [] plugins = [] - redirects: Dict[str, str] = {} + # {old: new} plugindesc + redirects: Dict[Repo, Repo] = {} for (pdesc, result, redirect) in results: if isinstance(result, Exception): failures.append((pdesc.name, result)) @@ -495,31 +524,17 @@ def check_results( sys.exit(1) -def make_repo(uri, branch, alias) -> Repo: +def make_repo(uri: str, branch) -> Repo: '''Instantiate a Repo with the correct specialization depending on server (gitub spec)''' # dumb check to see if it's of the form owner/repo (=> github) or https://... - res = uri.split('/') - if len(res) <= 2: - repo = RepoGitHub(res[0], res[1], branch, alias) + res = urlparse(uri) + if res.netloc in [ "github.com", ""]: + res = res.path.strip('/').split('/') + repo = RepoGitHub(res[0], res[1], branch) else: - repo = Repo(uri.strip(), branch, alias) + repo = Repo(uri.strip(), branch) return repo -def parse_plugin_line(config: FetchConfig, line: str) -> PluginDesc: - branch = "HEAD" - alias = None - uri = line - if " as " in uri: - uri, alias = uri.split(" as ") - alias = alias.strip() - if "@" in uri: - uri, branch = uri.split("@") - - repo = make_repo(uri.strip(), branch.strip(), alias) - repo.token = config.github_token - - return PluginDesc(repo, branch.strip(), alias) - def get_cache_path(cache_file_name: str) -> Optional[Path]: xdg_cache = os.environ.get("XDG_CACHE_HOME", None) @@ -585,27 +600,27 @@ def prefetch( return (pluginDesc, e, {}) + def rewrite_input( config: FetchConfig, input_file: Path, deprecated: Path, - redirects: Dict[str, str] = None, - append: Tuple = (), + # old pluginDesc and the new + redirects: Dict[PluginDesc, PluginDesc] = {}, + append: List[PluginDesc] = [], ): - with open(input_file, "r") as f: - lines = f.readlines() + plugins = load_plugins_from_csv(config, input_file,) - lines.extend(append) + plugins.extend(append) if redirects: - lines = [redirects.get(line, line) for line in lines] cur_date_iso = datetime.now().strftime("%Y-%m-%d") with open(deprecated, "r") as f: deprecations = json.load(f) for old, new in redirects.items(): - old_plugin = fetch_plugin_from_pluginline(config, old) - new_plugin = fetch_plugin_from_pluginline(config, new) + old_plugin, _ = prefetch_plugin(old) + new_plugin, _ = prefetch_plugin(new) if old_plugin.normalized_name != new_plugin.normalized_name: deprecations[old_plugin.normalized_name] = { "new": new_plugin.normalized_name, @@ -615,10 +630,14 @@ def rewrite_input( json.dump(deprecations, f, indent=4, sort_keys=True) f.write("\n") - lines = sorted(lines, key=str.casefold) - with open(input_file, "w") as f: - f.writelines(lines) + log.debug("Writing into %s", input_file) + # fields = dataclasses.fields(PluginDesc) + fieldnames = ['repo', 'branch', 'alias'] + writer = csv.DictWriter(f, fieldnames, dialect='unix', quoting=csv.QUOTE_NONE) + writer.writeheader() + for plugin in sorted(plugins): + writer.writerow(asdict(plugin)) def commit(repo: git.Repo, message: str, files: List[Path]) -> None: @@ -660,9 +679,11 @@ def update_plugins(editor: Editor, args): ) for plugin_line in args.add_plugins: - editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=(plugin_line + "\n",)) + pdesc = PluginDesc.load_from_string(fetch_config, plugin_line) + append = [ pdesc ] + editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=append) update() - plugin = fetch_plugin_from_pluginline(fetch_config, plugin_line) + plugin, _ = prefetch_plugin(pdesc, ) if autocommit: commit( nixpkgs_repo, diff --git a/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml b/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml index f54f6129e0d..910cad467e9 100644 --- a/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml +++ b/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml @@ -866,6 +866,14 @@ package. </para> </listitem> + <listitem> + <para> + The vim/kakoune plugin updater now reads from a CSV file: + check + <literal>pkgs/applications/editors/vim/plugins/vim-plugin-names</literal> + out to see the new format + </para> + </listitem> </itemizedlist> </section> </section> diff --git a/nixos/doc/manual/from_md/release-notes/rl-2205.section.xml b/nixos/doc/manual/from_md/release-notes/rl-2205.section.xml index 38dd7b3894d..dc428b533e3 100644 --- a/nixos/doc/manual/from_md/release-notes/rl-2205.section.xml +++ b/nixos/doc/manual/from_md/release-notes/rl-2205.section.xml @@ -70,6 +70,11 @@ </listitem> <listitem> <para> + Systemd has been upgraded to the version 250. + </para> + </listitem> + <listitem> + <para> <link xlink:href="https://kops.sigs.k8s.io"><literal>kops</literal></link> defaults to 1.22.4, which will enable <link xlink:href="https://docs.aws.amazon.com/AWSEC2/latest/UserGuide/configuring-instance-metadata-service.html">Instance @@ -446,6 +451,12 @@ </listitem> <listitem> <para> + <literal>openssh</literal> has been update to 8.9p1, changing + the FIDO security key middleware interface. + </para> + </listitem> + <listitem> + <para> <literal>services.k3s.enable</literal> no longer implies <literal>systemd.enableUnifiedCgroupHierarchy = false</literal>, and will default to the <quote>systemd</quote> cgroup driver @@ -1512,9 +1523,11 @@ <para> <link linkend="opt-programs.ssh.knownHosts">programs.ssh.knownHosts</link> has gained an <literal>extraHostNames</literal> option to - replace <literal>hostNames</literal>. - <literal>hostNames</literal> is deprecated, but still - available for now. + augment <literal>hostNames</literal>. It is now possible to + use the attribute name of a <literal>knownHosts</literal> + entry as the primary host name and specify secondary host + names using <literal>extraHostNames</literal> without having + to duplicate the primary host name. </para> </listitem> <listitem> diff --git a/nixos/doc/manual/release-notes/rl-1803.section.md b/nixos/doc/manual/release-notes/rl-1803.section.md index e4e46798104..c5146015d44 100644 --- a/nixos/doc/manual/release-notes/rl-1803.section.md +++ b/nixos/doc/manual/release-notes/rl-1803.section.md @@ -282,3 +282,5 @@ When upgrading from a previous release, please be aware of the following incompa - The NixOS test driver supports user services declared by `systemd.user.services`. The methods `waitForUnit`, `getUnitInfo`, `startJob` and `stopJob` provide an optional `$user` argument for that purpose. - Enabling bash completion on NixOS, `programs.bash.enableCompletion`, will now also enable completion for the Nix command line tools by installing the [nix-bash-completions](https://github.com/hedning/nix-bash-completions) package. + +- The vim/kakoune plugin updater now reads from a CSV file: check `pkgs/applications/editors/vim/plugins/vim-plugin-names` out to see the new format diff --git a/nixos/doc/manual/release-notes/rl-2205.section.md b/nixos/doc/manual/release-notes/rl-2205.section.md index 82f1b97d5cb..b8b070bd6cf 100644 --- a/nixos/doc/manual/release-notes/rl-2205.section.md +++ b/nixos/doc/manual/release-notes/rl-2205.section.md @@ -25,6 +25,8 @@ In addition to numerous new and upgraded packages, this release has the followin - systemd services can now set [systemd.services.\<name\>.reloadTriggers](#opt-systemd.services) instead of `reloadIfChanged` for a more granular distinction between reloads and restarts. +- Systemd has been upgraded to the version 250. + - [`kops`](https://kops.sigs.k8s.io) defaults to 1.22.4, which will enable [Instance Metadata Service Version 2](https://docs.aws.amazon.com/AWSEC2/latest/UserGuide/configuring-instance-metadata-service.html) and require tokens on new clusters with Kubernetes 1.22. This will increase security by default, but may break some types of workloads. See the [release notes](https://kops.sigs.k8s.io/releases/1.22-notes/) for details. - Module authors can use `mkRenamedOptionModuleWith` to automate the deprecation cycle without annoying out-of-tree module authors and their users. @@ -143,6 +145,8 @@ In addition to numerous new and upgraded packages, this release has the followin - `services.kubernetes.scheduler.{port,address}` now set `--secure-port` and `--bind-address` instead of `--port` and `--address`, since the former have been deprecated and are no longer functional in kubernetes>=1.23. Ensure that you are not relying on the insecure behaviour before upgrading. +- `openssh` has been update to 8.9p1, changing the FIDO security key middleware interface. + - `services.k3s.enable` no longer implies `systemd.enableUnifiedCgroupHierarchy = false`, and will default to the 'systemd' cgroup driver when using `services.k3s.docker = true`. This change may require a reboot to take effect, and k3s may not be able to run if the boot cgroup hierarchy does not match its configuration. The previous behavior may be retained by explicitly setting `systemd.enableUnifiedCgroupHierarchy = false` in your configuration. @@ -537,7 +541,9 @@ In addition to numerous new and upgraded packages, this release has the followin e.g. Wayland. - [programs.ssh.knownHosts](#opt-programs.ssh.knownHosts) has gained an `extraHostNames` - option to replace `hostNames`. `hostNames` is deprecated, but still available for now. + option to augment `hostNames`. It is now possible to use the attribute name of a `knownHosts` + entry as the primary host name and specify secondary host names using `extraHostNames` without + having to duplicate the primary host name. - The `services.stubby` module was converted to a [settings-style](https://github.com/NixOS/rfcs/blob/master/rfcs/0042-config-option.md) configuration. diff --git a/nixos/lib/make-disk-image.nix b/nixos/lib/make-disk-image.nix index 15302ae8241..e784ec9e677 100644 --- a/nixos/lib/make-disk-image.nix +++ b/nixos/lib/make-disk-image.nix @@ -170,6 +170,7 @@ let format' = format; in let config.system.build.nixos-install config.system.build.nixos-enter nix + systemdMinimal ] ++ stdenv.initialPath); # I'm preserving the line below because I'm going to search for it across nixpkgs to consolidate diff --git a/nixos/modules/programs/ssh.nix b/nixos/modules/programs/ssh.nix index b31fce91524..75685de4f04 100644 --- a/nixos/modules/programs/ssh.nix +++ b/nixos/modules/programs/ssh.nix @@ -157,9 +157,13 @@ in default = [ name ] ++ config.extraHostNames; defaultText = literalExpression "[ ${name} ] ++ config.${options.extraHostNames}"; description = '' - DEPRECATED, please use <literal>extraHostNames</literal>. A list of host names and/or IP numbers used for accessing - the host's ssh service. + the host's ssh service. This list includes the name of the + containing <literal>knownHosts</literal> attribute by default + for convenience. If you wish to configure multiple host keys + for the same host use multiple <literal>knownHosts</literal> + entries with different attribute names and the same + <literal>hostNames</literal> list. ''; }; extraHostNames = mkOption { @@ -167,7 +171,8 @@ in default = []; description = '' A list of additional host names and/or IP numbers used for - accessing the host's ssh service. + accessing the host's ssh service. This list is ignored if + <literal>hostNames</literal> is set explicitly. ''; }; publicKey = mkOption { @@ -198,7 +203,12 @@ in }; })); description = '' - The set of system-wide known SSH hosts. + The set of system-wide known SSH hosts. To make simple setups more + convenient the name of an attribute in this set is used as a host name + for the entry. This behaviour can be disabled by setting + <literal>hostNames</literal> explicitly. You can use + <literal>extraHostNames</literal> to add additional host names without + disabling this default. ''; example = literalExpression '' { @@ -207,6 +217,10 @@ in publicKeyFile = ./pubkeys/myhost_ssh_host_dsa_key.pub; }; "myhost2.net".publicKey = "ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAILIRuJ8p1Fi+m6WkHV0KWnRfpM1WxoW8XAS+XvsSKsTK"; + "myhost2.net/dsa" = { + hostNames = [ "myhost2.net" ]; + publicKeyFile = ./pubkeys/myhost2_ssh_host_dsa_key.pub; + }; } ''; }; @@ -279,9 +293,6 @@ in message = "knownHost ${name} must contain either a publicKey or publicKeyFile"; }); - warnings = mapAttrsToList (name: _: ''programs.ssh.knownHosts.${name}.hostNames is deprecated, use programs.ssh.knownHosts.${name}.extraHostNames'') - (filterAttrs (name: {hostNames, extraHostNames, ...}: hostNames != [ name ] ++ extraHostNames) cfg.knownHosts); - # SSH configuration. Slight duplication of the sshd_config # generation in the sshd service. environment.etc."ssh/ssh_config".text = diff --git a/nixos/modules/services/misc/nix-daemon.nix b/nixos/modules/services/misc/nix-daemon.nix index 4bc5b04d3a0..a4d2d10af70 100644 --- a/nixos/modules/services/misc/nix-daemon.nix +++ b/nixos/modules/services/misc/nix-daemon.nix @@ -708,6 +708,14 @@ in systemd.packages = [ nixPackage ]; + # Will only work once https://github.com/NixOS/nix/pull/6285 is merged + # systemd.tmpfiles.packages = [ nixPackage ]; + + # Can be dropped for Nix > https://github.com/NixOS/nix/pull/6285 + systemd.tmpfiles.rules = [ + "d /nix/var/nix/daemon-socket 0755 root root - -" + ]; + systemd.sockets.nix-daemon.wantedBy = [ "sockets.target" ]; systemd.services.nix-daemon = diff --git a/nixos/modules/services/network-filesystems/ipfs.nix b/nixos/modules/services/network-filesystems/ipfs.nix index 7e96179b3ca..a670551d9f3 100644 --- a/nixos/modules/services/network-filesystems/ipfs.nix +++ b/nixos/modules/services/network-filesystems/ipfs.nix @@ -267,11 +267,15 @@ in '' + '' ipfs --offline config show \ | ${pkgs.jq}/bin/jq '. * $extraConfig' --argjson extraConfig ${ - escapeShellArg (builtins.toJSON ({ - Addresses.API = cfg.apiAddress; - Addresses.Gateway = cfg.gatewayAddress; - Addresses.Swarm = cfg.swarmAddress; - } // cfg.extraConfig)) + escapeShellArg (builtins.toJSON ( + recursiveUpdate + { + Addresses.API = cfg.apiAddress; + Addresses.Gateway = cfg.gatewayAddress; + Addresses.Swarm = cfg.swarmAddress; + } + cfg.extraConfig + )) } \ | ipfs --offline config replace - ''; diff --git a/nixos/modules/system/boot/networkd.nix b/nixos/modules/system/boot/networkd.nix index 092b7b8863a..1e9f870b32f 100644 --- a/nixos/modules/system/boot/networkd.nix +++ b/nixos/modules/system/boot/networkd.nix @@ -281,6 +281,8 @@ let "PrivateKeyFile" "ListenPort" "FirewallMark" + "RouteTable" + "RouteMetric" ]) (assertInt "FirewallMark") (assertRange "FirewallMark" 1 4294967295) @@ -296,6 +298,8 @@ let "AllowedIPs" "Endpoint" "PersistentKeepalive" + "RouteTable" + "RouteMetric" ]) (assertInt "PersistentKeepalive") (assertRange "PersistentKeepalive" 0 65535) diff --git a/nixos/modules/system/boot/stage-1-init.sh b/nixos/modules/system/boot/stage-1-init.sh index 8fcc1f02972..31758366980 100644 --- a/nixos/modules/system/boot/stage-1-init.sh +++ b/nixos/modules/system/boot/stage-1-init.sh @@ -232,7 +232,8 @@ done mkdir -p /lib ln -s @modulesClosure@/lib/modules /lib/modules ln -s @modulesClosure@/lib/firmware /lib/firmware -echo @extraUtils@/bin/modprobe > /proc/sys/kernel/modprobe +# see comment in stage-1.nix for explanation +echo @extraUtils@/bin/modprobe-kernel > /proc/sys/kernel/modprobe for i in @kernelModules@; do info "loading module $(basename $i)..." modprobe $i diff --git a/nixos/modules/system/boot/stage-1.nix b/nixos/modules/system/boot/stage-1.nix index 1bafec30b53..04753a6767d 100644 --- a/nixos/modules/system/boot/stage-1.nix +++ b/nixos/modules/system/boot/stage-1.nix @@ -131,6 +131,26 @@ let copy_bin_and_libs ${pkgs.kmod}/bin/kmod ln -sf kmod $out/bin/modprobe + # Dirty hack to make sure the kernel properly loads modules + # such as ext4 on demand (e.g. on a `mount(2)` syscall). This is necessary + # because `kmod` isn't linked against `libpthread.so.0` anymore (since + # it was merged into `libc.so.6` since version `2.34`), but still needs + # to access it for some reason. This is not an issue in stage-1 itself + # because of the `LD_LIBRARY_PATH`-variable and anytime later because the rpath of + # kmod/modprobe points to glibc's `$out/lib` where `libpthread.so.6` exists. + # However, this is a problem when the kernel calls `modprobe` inside + # the initial ramdisk because it doesn't know about the + # `LD_LIBRARY_PATH` and the rpath was nuked. + # + # Also, we can't use `makeWrapper` here because `kmod` only does + # `modprobe` functionality if `argv[0] == "modprobe"`. + cat >$out/bin/modprobe-kernel <<EOF + #!$out/bin/ash + export LD_LIBRARY_PATH=$out/lib + exec $out/bin/modprobe "\$@" + EOF + chmod +x $out/bin/modprobe-kernel + # Copy resize2fs if any ext* filesystems are to be resized ${optionalString (any (fs: fs.autoResize && (lib.hasPrefix "ext" fs.fsType)) fileSystems) '' # We need mke2fs in the initrd. diff --git a/nixos/modules/system/boot/systemd/initrd.nix b/nixos/modules/system/boot/systemd/initrd.nix index c87cddc6914..c383486bb0b 100644 --- a/nixos/modules/system/boot/systemd/initrd.nix +++ b/nixos/modules/system/boot/systemd/initrd.nix @@ -108,7 +108,7 @@ let fileSystems = filter utils.fsNeededForBoot config.system.build.fileSystems; - fstab = pkgs.writeText "fstab" (lib.concatMapStringsSep "\n" + fstab = pkgs.writeText "initrd-fstab" (lib.concatMapStringsSep "\n" ({ fsType, mountPoint, device, options, autoFormat, autoResize, ... }@fs: let opts = options ++ optional autoFormat "x-systemd.makefs" ++ optional autoResize "x-systemd.growfs"; in "${device} /sysroot${mountPoint} ${fsType} ${lib.concatStringsSep "," opts}") fileSystems); @@ -128,11 +128,7 @@ let name = "initrd-emergency-env"; paths = map getBin cfg.initrdBin; pathsToLink = ["/bin" "/sbin"]; - # Make recovery easier - postBuild = '' - ln -s ${cfg.package.util-linux}/bin/mount $out/bin/ - ln -s ${cfg.package.util-linux}/bin/umount $out/bin/ - ''; + postBuild = concatStringsSep "\n" (mapAttrsToList (n: v: "ln -s '${v}' $out/bin/'${n}'") cfg.extraBin); }; initialRamdisk = pkgs.makeInitrdNG { @@ -205,6 +201,19 @@ in { default = []; }; + extraBin = mkOption { + description = '' + Tools to add to /bin + ''; + example = literalExpression '' + { + umount = ''${pkgs.util-linux}/bin/umount; + } + ''; + type = types.attrsOf types.path; + default = {}; + }; + suppressedStorePaths = mkOption { description = '' Store paths specified in the storePaths option that @@ -342,8 +351,15 @@ in { config = mkIf (config.boot.initrd.enable && cfg.enable) { system.build = { inherit initialRamdisk; }; + + boot.initrd.availableKernelModules = [ "autofs4" ]; # systemd needs this for some features + boot.initrd.systemd = { initrdBin = [pkgs.bash pkgs.coreutils pkgs.kmod cfg.package] ++ config.system.fsPackages; + extraBin = { + mount = "${cfg.package.util-linux}/bin/mount"; + umount = "${cfg.package.util-linux}/bin/umount"; + }; contents = { "/init".source = "${cfg.package}/lib/systemd/systemd"; diff --git a/nixos/modules/system/boot/timesyncd.nix b/nixos/modules/system/boot/timesyncd.nix index 5f35a154769..6279957fcd6 100644 --- a/nixos/modules/system/boot/timesyncd.nix +++ b/nixos/modules/system/boot/timesyncd.nix @@ -60,15 +60,27 @@ with lib; }; users.groups.systemd-timesync.gid = config.ids.gids.systemd-timesync; - system.activationScripts.systemd-timesyncd-migration = mkIf (versionOlder config.system.stateVersion "19.09") '' + system.activationScripts.systemd-timesyncd-migration = # workaround an issue of systemd-timesyncd not starting due to upstream systemd reverting their dynamic users changes # - https://github.com/NixOS/nixpkgs/pull/61321#issuecomment-492423742 # - https://github.com/systemd/systemd/issues/12131 - if [ -L /var/lib/systemd/timesync ]; then - rm /var/lib/systemd/timesync - mv /var/lib/private/systemd/timesync /var/lib/systemd/timesync + mkIf (versionOlder config.system.stateVersion "19.09") '' + if [ -L /var/lib/systemd/timesync ]; then + rm /var/lib/systemd/timesync + mv /var/lib/private/systemd/timesync /var/lib/systemd/timesync + fi + ''; + system.activationScripts.systemd-timesyncd-init-clock = + # Ensure that we have some stored time to prevent systemd-timesyncd to + # resort back to the fallback time. + # If the file doesn't exist we assume that our current system clock is + # good enough to provide an initial value. + '' + if ! [ -f /var/lib/systemd/timesync/clock ]; then + test -d /var/lib/systemd/timesync || mkdir -p /var/lib/systemd/timesync + touch /var/lib/systemd/timesync/clock fi - ''; + ''; }; } diff --git a/nixos/modules/tasks/lvm.nix b/nixos/modules/tasks/lvm.nix index 35316603c38..59711f90dce 100644 --- a/nixos/modules/tasks/lvm.nix +++ b/nixos/modules/tasks/lvm.nix @@ -7,17 +7,18 @@ in { options.services.lvm = { package = mkOption { type = types.package; - default = if cfg.dmeventd.enable then pkgs.lvm2_dmeventd else pkgs.lvm2; + default = pkgs.lvm2; internal = true; defaultText = literalExpression "pkgs.lvm2"; description = '' This option allows you to override the LVM package that's used on the system (udev rules, tmpfiles, systemd services). - Defaults to pkgs.lvm2, or pkgs.lvm2_dmeventd if dmeventd is enabled. + Defaults to pkgs.lvm2, pkgs.lvm2_dmeventd if dmeventd or pkgs.lvm2_vdo if vdo is enabled. ''; }; dmeventd.enable = mkEnableOption "the LVM dmevent daemon"; boot.thin.enable = mkEnableOption "support for booting from ThinLVs"; + boot.vdo.enable = mkEnableOption "support for booting from VDOLVs"; }; config = mkMerge [ @@ -40,6 +41,7 @@ in { environment.etc."lvm/lvm.conf".text = '' dmeventd/executable = "${cfg.package}/bin/dmeventd" ''; + services.lvm.package = mkDefault pkgs.lvm2_dmeventd; }) (mkIf cfg.boot.thin.enable { boot.initrd = { @@ -61,6 +63,32 @@ in { environment.etc."lvm/lvm.conf".text = concatMapStringsSep "\n" (bin: "global/${bin}_executable = ${pkgs.thin-provisioning-tools}/bin/${bin}") [ "thin_check" "thin_dump" "thin_repair" "cache_check" "cache_dump" "cache_repair" ]; + + environment.systemPackages = [ pkgs.thin-provisioning-tools ]; + }) + (mkIf cfg.boot.vdo.enable { + boot = { + initrd = { + kernelModules = [ "kvdo" ]; + + extraUtilsCommands = '' + ls ${pkgs.vdo}/bin/ | grep -v adaptLVMVDO | while read BIN; do + copy_bin_and_libs ${pkgs.vdo}/bin/$BIN + done + ''; + + extraUtilsCommandsTest = '' + ls ${pkgs.vdo}/bin/ | grep -v adaptLVMVDO | while read BIN; do + $out/bin/$(basename $BIN) --help > /dev/null + done + ''; + }; + extraModulePackages = [ config.boot.kernelPackages.kvdo ]; + }; + + services.lvm.package = mkOverride 999 pkgs.lvm2_vdo; # this overrides mkDefault + + environment.systemPackages = [ pkgs.vdo ]; }) (mkIf (cfg.dmeventd.enable || cfg.boot.thin.enable) { boot.initrd.preLVMCommands = '' diff --git a/nixos/tests/all-tests.nix b/nixos/tests/all-tests.nix index dcbdf34e944..799ce9b4017 100644 --- a/nixos/tests/all-tests.nix +++ b/nixos/tests/all-tests.nix @@ -274,6 +274,7 @@ in login = handleTest ./login.nix {}; logrotate = handleTest ./logrotate.nix {}; loki = handleTest ./loki.nix {}; + lvm2 = handleTest ./lvm2 {}; lxd = handleTest ./lxd.nix {}; lxd-image = handleTest ./lxd-image.nix {}; lxd-nftables = handleTest ./lxd-nftables.nix {}; diff --git a/nixos/tests/atop.nix b/nixos/tests/atop.nix index d9304834692..ec10369a24f 100644 --- a/nixos/tests/atop.nix +++ b/nixos/tests/atop.nix @@ -182,10 +182,6 @@ in atopgpu = makeTest { name = "atop-atopgpu"; nodes.machine = { - nixpkgs.config.allowUnfreePredicate = pkg: builtins.elem (getName pkg) [ - "cudatoolkit" - ]; - programs.atop = { enable = true; atopgpu.enable = true; @@ -205,10 +201,6 @@ in everything = makeTest { name = "atop-everthing"; nodes.machine = { - nixpkgs.config.allowUnfreePredicate = pkg: builtins.elem (getName pkg) [ - "cudatoolkit" - ]; - programs.atop = { enable = true; settings = { diff --git a/nixos/tests/docker-tools-cross.nix b/nixos/tests/docker-tools-cross.nix index a7a6a31475d..8791ec25812 100644 --- a/nixos/tests/docker-tools-cross.nix +++ b/nixos/tests/docker-tools-cross.nix @@ -7,7 +7,7 @@ import ./make-test-python.nix ({ pkgs, ... }: let remoteSystem = - if pkgs.system == "aarch64-linux" + if pkgs.stdenv.hostPlatform.system == "aarch64-linux" then "x86_64-linux" else "aarch64-linux"; @@ -18,7 +18,7 @@ let # NOTE: Since this file can't control where the test will be _run_ we don't # cross-compile _to_ a different system but _from_ a different system - crossSystem = pkgs.system; + crossSystem = pkgs.stdenv.hostPlatform.system; }; hello1 = remoteCrossPkgs.dockerTools.buildImage { diff --git a/nixos/tests/docker-tools.nix b/nixos/tests/docker-tools.nix index 8a240ddb17f..80859ac7a96 100644 --- a/nixos/tests/docker-tools.nix +++ b/nixos/tests/docker-tools.nix @@ -315,7 +315,7 @@ import ./make-test-python.nix ({ pkgs, ... }: { "docker inspect ${pkgs.dockerTools.examples.cross.imageName} " + "| ${pkgs.jq}/bin/jq -r .[].Architecture" ).strip() - == "${if pkgs.system == "aarch64-linux" then "amd64" else "arm64"}" + == "${if pkgs.stdenv.hostPlatform.system == "aarch64-linux" then "amd64" else "arm64"}" ) with subtest("buildLayeredImage doesn't dereference /nix/store symlink layers"): diff --git a/nixos/tests/installer.nix b/nixos/tests/installer.nix index 2cfadf85c93..30a5b5c45b3 100644 --- a/nixos/tests/installer.nix +++ b/nixos/tests/installer.nix @@ -312,6 +312,7 @@ let desktop-file-utils docbook5 docbook_xsl_ns + kmod.dev libxml2.bin libxslt.bin nixos-artwork.wallpapers.simple-dark-gray-bottom diff --git a/nixos/tests/lvm2/default.nix b/nixos/tests/lvm2/default.nix new file mode 100644 index 00000000000..2ba17809569 --- /dev/null +++ b/nixos/tests/lvm2/default.nix @@ -0,0 +1,27 @@ +{ system ? builtins.currentSystem +, config ? { } +, pkgs ? import ../../.. { inherit system config; } +, lib ? pkgs.lib +, kernelVersionsToTest ? [ "4.19" "5.4" "5.10" "5.15" "latest" ] +}: + +# For quickly running a test, the nixosTests.lvm2.lvm-thinpool-linux-latest attribute is recommended +let + tests = let callTest = p: lib.flip (import p) { inherit system pkgs; }; in { + thinpool = { test = callTest ./thinpool.nix; kernelFilter = lib.id; }; + # we would like to test all versions, but the kernel module currently does not compile against the other versions + vdo = { test = callTest ./vdo.nix; kernelFilter = lib.filter (v: v == "5.15"); }; + }; +in +lib.listToAttrs ( + lib.filter (x: x.value != {}) ( + lib.flip lib.concatMap kernelVersionsToTest (version: + let + v' = lib.replaceStrings [ "." ] [ "_" ] version; + in + lib.flip lib.mapAttrsToList tests (name: t: + lib.nameValuePair "lvm-${name}-linux-${v'}" (lib.optionalAttrs (builtins.elem version (t.kernelFilter kernelVersionsToTest)) (t.test { kernelPackages = pkgs."linuxPackages_${v'}"; })) + ) + ) + ) +) diff --git a/nixos/tests/lvm2/thinpool.nix b/nixos/tests/lvm2/thinpool.nix new file mode 100644 index 00000000000..82c6460a890 --- /dev/null +++ b/nixos/tests/lvm2/thinpool.nix @@ -0,0 +1,32 @@ +{ kernelPackages ? null }: +import ../make-test-python.nix ({ pkgs, ... }: { + name = "lvm2-thinpool"; + meta.maintainers = with pkgs.lib.maintainers; [ ajs124 ]; + + nodes.machine = { pkgs, lib, ... }: { + virtualisation.emptyDiskImages = [ 4096 ]; + services.lvm = { + boot.thin.enable = true; + dmeventd.enable = true; + }; + environment.systemPackages = with pkgs; [ xfsprogs ]; + environment.etc."lvm/lvm.conf".text = '' + activation/thin_pool_autoextend_percent = 10 + activation/thin_pool_autoextend_threshold = 80 + ''; + boot = lib.mkIf (kernelPackages != null) { inherit kernelPackages; }; + }; + + testScript = '' + machine.succeed("vgcreate test_vg /dev/vdb") + machine.succeed("lvcreate -L 512M -T test_vg/test_thin_pool") + machine.succeed("lvcreate -n test_lv -V 16G --thinpool test_thin_pool test_vg") + machine.succeed("mkfs.xfs /dev/test_vg/test_lv") + machine.succeed("mkdir /mnt; mount /dev/test_vg/test_lv /mnt") + assert "/dev/mapper/test_vg-test_lv" == machine.succeed("findmnt -no SOURCE /mnt").strip() + machine.succeed("dd if=/dev/zero of=/mnt/empty.file bs=1M count=1024") + machine.succeed("journalctl -u dm-event.service | grep \"successfully resized\"") + machine.succeed("umount /mnt") + machine.succeed("vgchange -a n") + ''; +}) diff --git a/nixos/tests/lvm2/vdo.nix b/nixos/tests/lvm2/vdo.nix new file mode 100644 index 00000000000..5b014c2f722 --- /dev/null +++ b/nixos/tests/lvm2/vdo.nix @@ -0,0 +1,27 @@ +{ kernelPackages ? null }: +import ../make-test-python.nix ({ pkgs, ... }: { + name = "lvm2-vdo"; + meta.maintainers = with pkgs.lib.maintainers; [ ajs124 ]; + + nodes.machine = { pkgs, lib, ... }: { + # Minimum required size for VDO volume: 5063921664 bytes + virtualisation.emptyDiskImages = [ 8192 ]; + services.lvm = { + boot.vdo.enable = true; + dmeventd.enable = true; + }; + environment.systemPackages = with pkgs; [ xfsprogs ]; + boot = lib.mkIf (kernelPackages != null) { inherit kernelPackages; }; + }; + + testScript = '' + machine.succeed("vgcreate test_vg /dev/vdb") + machine.succeed("lvcreate --type vdo -n vdo_lv -L 6G -V 12G test_vg/vdo_pool_lv") + machine.succeed("mkfs.xfs -K /dev/test_vg/vdo_lv") + machine.succeed("mkdir /mnt; mount /dev/test_vg/vdo_lv /mnt") + assert "/dev/mapper/test_vg-vdo_lv" == machine.succeed("findmnt -no SOURCE /mnt").strip() + machine.succeed("umount /mnt") + machine.succeed("vdostats") + machine.succeed("vgchange -a n") + ''; +}) diff --git a/nixos/tests/nixops/default.nix b/nixos/tests/nixops/default.nix index f0834c51f0b..227b3881507 100644 --- a/nixos/tests/nixops/default.nix +++ b/nixos/tests/nixops/default.nix @@ -97,7 +97,7 @@ let derivations and all build dependency outputs, all the way down. */ allDrvOutputs = pkg: - let name = lib.strings.sanitizeDerivationName "allDrvOutputs-${pkg.pname or pkg.name or "unknown"}"; + let name = "allDrvOutputs-${pkg.pname or pkg.name or "unknown"}"; in pkgs.runCommand name { refs = pkgs.writeReferencesToFile pkg.drvPath; } '' touch $out diff --git a/nixos/tests/vaultwarden.nix b/nixos/tests/vaultwarden.nix index 56f1d245d50..814d8d7c0ab 100644 --- a/nixos/tests/vaultwarden.nix +++ b/nixos/tests/vaultwarden.nix @@ -113,7 +113,6 @@ let driver.find_element_by_css_selector('input#masterPasswordRetype').send_keys( '${userPassword}' ) - driver.find_element_by_css_selector('input#acceptPolicies').click() driver.find_element_by_xpath("//button[contains(., 'Submit')]").click() diff --git a/pkgs/applications/audio/flac/default.nix b/pkgs/applications/audio/flac/default.nix index 0b1a2edc3ba..621804840bf 100644 --- a/pkgs/applications/audio/flac/default.nix +++ b/pkgs/applications/audio/flac/default.nix @@ -2,21 +2,13 @@ stdenv.mkDerivation rec { pname = "flac"; - version = "1.3.3"; + version = "1.3.4"; src = fetchurl { url = "http://downloads.xiph.org/releases/flac/${pname}-${version}.tar.xz"; - sha256 = "0j0p9sf56a2fm2hkjnf7x3py5ir49jyavg4q5zdyd7bcf6yq4gi1"; + sha256 = "0dz7am8kbc97a6afml1h4yp085274prg8j7csryds8m3fmz61w4g"; }; - patches = [ - (fetchpatch { - name = "CVE-2020-0499.patch"; - url = "https://github.com/xiph/flac/commit/2e7931c27eb15e387da440a37f12437e35b22dd4.patch"; - sha256 = "160qzq9ms5addz7sx06pnyjjkqrffr54r4wd8735vy4x008z71ah"; - }) - ]; - buildInputs = [ libogg ]; #doCheck = true; # takes lots of time diff --git a/pkgs/applications/audio/sfizz/default.nix b/pkgs/applications/audio/sfizz/default.nix index 54acc782c60..aaa79bd3e39 100644 --- a/pkgs/applications/audio/sfizz/default.nix +++ b/pkgs/applications/audio/sfizz/default.nix @@ -1,6 +1,7 @@ { lib, stdenv, fetchFromGitHub, libjack2, libsndfile, xorg, freetype , libxkbcommon, cairo, glib, gnome, flac, libogg, libvorbis, libopus, cmake -, pango, pkg-config }: +, pango, pkg-config, catch2 +}: stdenv.mkDerivation rec { pname = "sfizz"; @@ -40,6 +41,8 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ cmake pkg-config ]; postPatch = '' + cp ${catch2}/include/catch2/catch.hpp tests/catch2/catch.hpp + substituteInPlace plugins/editor/external/vstgui4/vstgui/lib/platform/linux/x11fileselector.cpp \ --replace 'zenitypath = "zenity"' 'zenitypath = "${gnome.zenity}/bin/zenity"' substituteInPlace plugins/editor/src/editor/NativeHelpers.cpp \ @@ -48,6 +51,8 @@ stdenv.mkDerivation rec { cmakeFlags = [ "-DCMAKE_BUILD_TYPE=Release" "-DSFIZZ_TESTS=ON" ]; + doCheck = true; + meta = with lib; { homepage = "https://github.com/sfztools/sfizz"; description = "SFZ jack client and LV2 plugin"; diff --git a/pkgs/applications/audio/sfxr-qt/default.nix b/pkgs/applications/audio/sfxr-qt/default.nix index 0ffd754c047..2b264cfd56b 100644 --- a/pkgs/applications/audio/sfxr-qt/default.nix +++ b/pkgs/applications/audio/sfxr-qt/default.nix @@ -8,6 +8,7 @@ , qtquickcontrols2 , SDL , python3 +, catch2 , callPackage , nixosTests }: @@ -24,6 +25,10 @@ mkDerivation rec { fetchSubmodules = true; }; + postPatch = '' + cp ${catch2}/include/catch2/catch.hpp 3rdparty/catch2/single_include/catch2/catch.hpp + ''; + # Remove on next release patches = [(fetchpatch { name = "sfxr-qr-missing-qpainterpath-include"; @@ -43,6 +48,8 @@ mkDerivation rec { SDL ]; + doCheck = true; + passthru.tests = { export-square-wave = callPackage ./test-export-square-wave {}; sfxr-qt-starts = nixosTests.sfxr-qt; diff --git a/pkgs/applications/blockchains/ledger-live-desktop/default.nix b/pkgs/applications/blockchains/ledger-live-desktop/default.nix index 6dc644fbb96..d72da2c060f 100644 --- a/pkgs/applications/blockchains/ledger-live-desktop/default.nix +++ b/pkgs/applications/blockchains/ledger-live-desktop/default.nix @@ -2,12 +2,12 @@ let pname = "ledger-live-desktop"; - version = "2.39.2"; + version = "2.40.2"; name = "${pname}-${version}"; src = fetchurl { url = "https://github.com/LedgerHQ/${pname}/releases/download/v${version}/${pname}-${version}-linux-x86_64.AppImage"; - hash = "sha256-zVefF5CsyVVMNffec/xwA3KmMtZepM51C3Xh0ZCGl0c="; + hash = "sha256-2L1iVPLCCIQ6qBqkg+GmiqMmknHmdDLUrysN8vcW2YQ="; }; appimageContents = appimageTools.extractType2 { diff --git a/pkgs/applications/blockchains/lndmanage/default.nix b/pkgs/applications/blockchains/lndmanage/default.nix index ebbe653c96b..c9e655448d2 100644 --- a/pkgs/applications/blockchains/lndmanage/default.nix +++ b/pkgs/applications/blockchains/lndmanage/default.nix @@ -2,13 +2,13 @@ python3Packages.buildPythonApplication rec { pname = "lndmanage"; - version = "0.14.0"; + version = "0.14.1"; src = fetchFromGitHub { owner = "bitromortac"; repo = pname; rev = "v${version}"; - hash = "sha256-wPr/R+WGACyhv2Qh9JeLJwvr2vQfxpqj2XjEkrRoSX4="; + hash = "sha256-c36AbND01bUr0Klme4fU7GrY1oYcmoEREQI9cwsK7YM="; }; propagatedBuildInputs = with python3Packages; [ diff --git a/pkgs/applications/editors/emacs/27.nix b/pkgs/applications/editors/emacs/27.nix index 436785c34f6..064231b2456 100644 --- a/pkgs/applications/editors/emacs/27.nix +++ b/pkgs/applications/editors/emacs/27.nix @@ -7,5 +7,10 @@ import ./generic.nix (rec { url = "https://git.savannah.gnu.org/cgit/emacs.git/patch/?id=a88f63500e475f842e5fbdd9abba4ce122cdb082"; sha256 = "sha256-RF9b5PojFUAjh2TDUW4+HaWveV30Spy1iAXhaWf1ZVg="; }) + # glibc 2.34 compat + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/emacs/raw/181aafcdb7ee2fded9fce4cfc448f27edccc927f/f/emacs-glibc-2.34.patch"; + sha256 = "sha256-2o3C/jhZPl2OW/LmVPt/fhdwbS9NOdF9lVEF1Kn9aEk="; + }) ]; }) diff --git a/pkgs/applications/editors/helix/default.nix b/pkgs/applications/editors/helix/default.nix index 6cc5714fb83..fb1abcd6cff 100644 --- a/pkgs/applications/editors/helix/default.nix +++ b/pkgs/applications/editors/helix/default.nix @@ -1,18 +1,18 @@ -{ fetchFromGitHub, lib, rustPlatform, makeWrapper }: +{ fetchzip, lib, rustPlatform, makeWrapper }: rustPlatform.buildRustPackage rec { pname = "helix"; - version = "0.6.0"; + version = "22.03"; - src = fetchFromGitHub { - owner = "helix-editor"; - repo = pname; - rev = "v${version}"; - fetchSubmodules = true; - sha256 = "sha256-d/USOtcPLjdgzN7TBCouBRmoSDH5LZD4R5Qq7lUrWZw="; + # This release tarball includes source code for the tree-sitter grammars, + # which is not ordinarily part of the repository. + src = fetchzip { + url = "https://github.com/helix-editor/helix/releases/download/${version}/helix-${version}-source.tar.xz"; + sha256 = "DP/hh6JfnyHdW2bg0cvhwlWvruNDvL9bmXM46iAUQzA="; + stripRoot = false; }; - cargoSha256 = "sha256-/EATU7HsGNB35YOBp8sofbPd1nl4d3Ggj1ay3QuHkCI="; + cargoSha256 = "zJQ+KvO+6iUIb0eJ+LnMbitxaqTxfqgu7XXj3j0GiX4="; nativeBuildInputs = [ makeWrapper ]; @@ -29,6 +29,6 @@ rustPlatform.buildRustPackage rec { homepage = "https://helix-editor.com"; license = licenses.mpl20; mainProgram = "hx"; - maintainers = with maintainers; [ yusdacra ]; + maintainers = with maintainers; [ danth yusdacra ]; }; } diff --git a/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names b/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names index 6cf7d30f274..a6cae7a4505 100644 --- a/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names +++ b/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names @@ -1,19 +1,20 @@ -alexherbo2/auto-pairs.kak -alexherbo2/replace-mode.kak -alexherbo2/sleuth.kak -andreyorst/fzf.kak -andreyorst/powerline.kak -basbebe/pandoc.kak -danr/kakoune-easymotion -Delapouite/kakoune-buffers -Delapouite/kakoune-registers -enricozb/tabs.kak@main -greenfork/active-window.kak -kakoune-editor/kakoune-extra-filetypes -kakounedotcom/connect.kak -kakounedotcom/prelude.kak -lePerdu/kakboard -listentolist/kakoune-rainbow -mayjs/openscad.kak -occivink/kakoune-buffer-switcher -occivink/kakoune-vertical-selection +repo,branch,alias +alexherbo2/auto-pairs.kak,, +alexherbo2/replace-mode.kak,, +alexherbo2/sleuth.kak,, +andreyorst/fzf.kak,, +andreyorst/powerline.kak,, +basbebe/pandoc.kak,, +danr/kakoune-easymotion,, +Delapouite/kakoune-buffers,, +Delapouite/kakoune-registers,, +enricozb/tabs.kak@main,, +greenfork/active-window.kak,, +kakoune-editor/kakoune-extra-filetypes,, +kakounedotcom/connect.kak,, +kakounedotcom/prelude.kak,, +lePerdu/kakboard,, +listentolist/kakoune-rainbow,, +mayjs/openscad.kak,, +occivink/kakoune-buffer-switcher,, +occivink/kakoune-vertical-selection,, diff --git a/pkgs/applications/editors/poke/default.nix b/pkgs/applications/editors/poke/default.nix index c2ade207d60..77466cfdbea 100644 --- a/pkgs/applications/editors/poke/default.nix +++ b/pkgs/applications/editors/poke/default.nix @@ -22,11 +22,11 @@ let isCross = stdenv.hostPlatform != stdenv.buildPlatform; in stdenv.mkDerivation rec { pname = "poke"; - version = "2.2"; + version = "2.3"; src = fetchurl { url = "mirror://gnu/${pname}/${pname}-${version}.tar.gz"; - sha256 = "sha256-xF6k5xpRohhTZzhcAc65dZbsW3EDOGm+xKYLHLciWQM="; + sha256 = "sha256-NpDPERbafLOp7GtPcAPiU+JotRAhKiiP04qv7Q68x2Y="; }; outputs = [ "out" "dev" "info" "lib" "man" ]; diff --git a/pkgs/applications/editors/vim/plugins/generated.nix b/pkgs/applications/editors/vim/plugins/generated.nix index 92578520b98..59fe030b241 100644 --- a/pkgs/applications/editors/vim/plugins/generated.nix +++ b/pkgs/applications/editors/vim/plugins/generated.nix @@ -3,6 +3,451 @@ final: prev: { + BetterLua-vim = buildVimPluginFrom2Nix { + pname = "BetterLua.vim"; + version = "2020-08-14"; + src = fetchFromGitHub { + owner = "euclidianAce"; + repo = "BetterLua.vim"; + rev = "d2d6c115575d09258a794a6f20ac60233eee59d5"; + sha256 = "1rvlx21kw8865dg6q97hx9i2s1n8mn1nyhn0m7dkx625pghsx3js"; + }; + meta.homepage = "https://github.com/euclidianAce/BetterLua.vim/"; + }; + + BufOnly-vim = buildVimPluginFrom2Nix { + pname = "BufOnly.vim"; + version = "2010-10-18"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "BufOnly.vim"; + rev = "43dd92303979bdb234a3cb2f5662847f7a3affe7"; + sha256 = "1gvpaqvvxjma0dl1zai68bpv42608api4054appwkw9pgczkkcdl"; + }; + meta.homepage = "https://github.com/vim-scripts/BufOnly.vim/"; + }; + + CheckAttach = buildVimPluginFrom2Nix { + pname = "CheckAttach"; + version = "2019-05-08"; + src = fetchFromGitHub { + owner = "chrisbra"; + repo = "CheckAttach"; + rev = "8f0b1350431d1d34655a147e6f1cfe6cb5dda5f7"; + sha256 = "1z9a40nbdjd3pnp28nfsi2bijsbaiphc0ia816f5flkchn07gmmj"; + }; + meta.homepage = "https://github.com/chrisbra/CheckAttach/"; + }; + + Colour-Sampler-Pack = buildVimPluginFrom2Nix { + pname = "Colour-Sampler-Pack"; + version = "2012-11-30"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "Colour-Sampler-Pack"; + rev = "05cded87b2ef29aaa9e930230bb88e23abff4441"; + sha256 = "03v2r18sfgs0xbgy9p56pxfdg0lsk6m7wyr5hw63wm1nzpwiipg3"; + }; + meta.homepage = "https://github.com/vim-scripts/Colour-Sampler-Pack/"; + }; + + Coqtail = buildVimPluginFrom2Nix { + pname = "Coqtail"; + version = "2022-03-28"; + src = fetchFromGitHub { + owner = "whonore"; + repo = "Coqtail"; + rev = "cb8f43b2f09f3d41e2821e458901666a82a61298"; + sha256 = "0h5r0r7hh4g7p874l7fajq30k4z3a88vm3db6583q611h9bwcfrf"; + }; + meta.homepage = "https://github.com/whonore/Coqtail/"; + }; + + DoxygenToolkit-vim = buildVimPluginFrom2Nix { + pname = "DoxygenToolkit.vim"; + version = "2010-11-06"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "DoxygenToolkit.vim"; + rev = "afd8663d36d2ec19d26befdb10e89e912d26bbd3"; + sha256 = "1za8li02j4nhqjjsyxg4p78638h5af4izim37zc0p1x55zr3i85r"; + }; + meta.homepage = "https://github.com/vim-scripts/DoxygenToolkit.vim/"; + }; + + FTerm-nvim = buildVimPluginFrom2Nix { + pname = "FTerm.nvim"; + version = "2022-03-13"; + src = fetchFromGitHub { + owner = "numToStr"; + repo = "FTerm.nvim"; + rev = "233633a5f6fe8398187a4eba93eba0828ef3d5f3"; + sha256 = "0sxnii921xia4mrf67qz7ichi9xqr9zf193hb9dx199l7hl6k1p8"; + }; + meta.homepage = "https://github.com/numToStr/FTerm.nvim/"; + }; + + FixCursorHold-nvim = buildVimPluginFrom2Nix { + pname = "FixCursorHold.nvim"; + version = "2022-02-17"; + src = fetchFromGitHub { + owner = "antoinemadec"; + repo = "FixCursorHold.nvim"; + rev = "1bfb32e7ba1344925ad815cb0d7f901dbc0ff7c1"; + sha256 = "0b1iffk6pa2zwd9fvlgqli72r8qj74b7hqkhlw6awhc7r1qj8m1q"; + }; + meta.homepage = "https://github.com/antoinemadec/FixCursorHold.nvim/"; + }; + + Improved-AnsiEsc = buildVimPluginFrom2Nix { + pname = "Improved-AnsiEsc"; + version = "2015-08-26"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "Improved-AnsiEsc"; + rev = "e1c59a8e9203fab6b9150721f30548916da73351"; + sha256 = "1smjs4kz2kmzprzp9az4957675nakb43146hshbby39j5xz4jsbz"; + }; + meta.homepage = "https://github.com/vim-scripts/Improved-AnsiEsc/"; + }; + + Jenkinsfile-vim-syntax = buildVimPluginFrom2Nix { + pname = "Jenkinsfile-vim-syntax"; + version = "2021-01-26"; + src = fetchFromGitHub { + owner = "martinda"; + repo = "Jenkinsfile-vim-syntax"; + rev = "0d05729168ea44d60862f17cffa80024ab30bcc9"; + sha256 = "05z30frs4f5z0l4qgxk08r7mb19bzhqs36hi213yin78cz62b9gy"; + }; + meta.homepage = "https://github.com/martinda/Jenkinsfile-vim-syntax/"; + }; + + LanguageClient-neovim = buildVimPluginFrom2Nix { + pname = "LanguageClient-neovim"; + version = "2020-12-10"; + src = fetchFromGitHub { + owner = "autozimu"; + repo = "LanguageClient-neovim"; + rev = "a42594c9c320b1283e9b9058b85a8097d8325fed"; + sha256 = "0lj9na3g2cl0vj56jz8rhz9lm2d3xps5glk8ds491i2ixy4vdm37"; + }; + meta.homepage = "https://github.com/autozimu/LanguageClient-neovim/"; + }; + + LanguageTool-nvim = buildVimPluginFrom2Nix { + pname = "LanguageTool.nvim"; + version = "2020-10-19"; + src = fetchFromGitHub { + owner = "vigoux"; + repo = "LanguageTool.nvim"; + rev = "809e7d77fec834597f495fec737c59292a10025b"; + sha256 = "1g12dz85xq8qd92dgna0a3w6zgxa74njlvmvly4k20610r63bzrn"; + }; + meta.homepage = "https://github.com/vigoux/LanguageTool.nvim/"; + }; + + LeaderF = buildVimPluginFrom2Nix { + pname = "LeaderF"; + version = "2022-04-05"; + src = fetchFromGitHub { + owner = "Yggdroot"; + repo = "LeaderF"; + rev = "7292967624ba89e2c3ab2f374959d5a25d5c9d9f"; + sha256 = "0l2vnickmgcvnlqv13bcqgvpsygkbwzgc70bx253cfbnddqssbpj"; + }; + meta.homepage = "https://github.com/Yggdroot/LeaderF/"; + }; + + MatchTagAlways = buildVimPluginFrom2Nix { + pname = "MatchTagAlways"; + version = "2017-05-20"; + src = fetchFromGitHub { + owner = "Valloric"; + repo = "MatchTagAlways"; + rev = "352eb479a4ad1608e0880b79ab2357aac2cf4bed"; + sha256 = "0y8gq4cs0wm2ijagc2frpmm664z355iridxyl5893576v5aqp8z1"; + }; + meta.homepage = "https://github.com/Valloric/MatchTagAlways/"; + }; + + Navigator-nvim = buildVimPluginFrom2Nix { + pname = "Navigator.nvim"; + version = "2022-03-28"; + src = fetchFromGitHub { + owner = "numToStr"; + repo = "Navigator.nvim"; + rev = "6c50f278482dc5388743cb5c6eddb146059252f9"; + sha256 = "1qr2blrr6ihr1adld1cyc98b64s2s4y2876bmlbxg4q17y1zv3l6"; + }; + meta.homepage = "https://github.com/numToStr/Navigator.nvim/"; + }; + + NeoSolarized = buildVimPluginFrom2Nix { + pname = "NeoSolarized"; + version = "2020-08-07"; + src = fetchFromGitHub { + owner = "overcache"; + repo = "NeoSolarized"; + rev = "b94b1a9ad51e2de015266f10fdc6e142f97bd617"; + sha256 = "019nz56yirpg1ahg8adfafrxznalw056qwm3xjm9kzg6da8j6v48"; + }; + meta.homepage = "https://github.com/overcache/NeoSolarized/"; + }; + + NrrwRgn = buildVimPluginFrom2Nix { + pname = "NrrwRgn"; + version = "2022-02-13"; + src = fetchFromGitHub { + owner = "chrisbra"; + repo = "NrrwRgn"; + rev = "e027db9d94f94947153cd7b5ac9abd04371ab2b0"; + sha256 = "0mcwyqbfc2m865w44s96ra2k0v1mn5kkkxf8i71iqhvc7fvnrfah"; + }; + meta.homepage = "https://github.com/chrisbra/NrrwRgn/"; + }; + + PreserveNoEOL = buildVimPluginFrom2Nix { + pname = "PreserveNoEOL"; + version = "2013-06-14"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "PreserveNoEOL"; + rev = "940e3ce90e54d8680bec1135a21dcfbd6c9bfb62"; + sha256 = "1726jpr2zf6jrb00pp082ikbx4mll3a877pnzs6i18f9fgpaqqgd"; + }; + meta.homepage = "https://github.com/vim-scripts/PreserveNoEOL/"; + }; + + QFEnter = buildVimPluginFrom2Nix { + pname = "QFEnter"; + version = "2020-10-09"; + src = fetchFromGitHub { + owner = "yssl"; + repo = "QFEnter"; + rev = "df0a75b287c210f98ae353a12bbfdaf73d858beb"; + sha256 = "0gdp7nmjlp8ng2rp2v66d8bincnkwrqqpbggb079f0f9szrqlp54"; + }; + meta.homepage = "https://github.com/yssl/QFEnter/"; + }; + + Recover-vim = buildVimPluginFrom2Nix { + pname = "Recover.vim"; + version = "2015-08-14"; + src = fetchFromGitHub { + owner = "chrisbra"; + repo = "Recover.vim"; + rev = "efa491f6121f65e025f42d79a93081abb8db69d4"; + sha256 = "17szim82bwnhf9q4n0n4jfmqkmhq6p0lh0j4y77a2x6lkn0pns5s"; + }; + meta.homepage = "https://github.com/chrisbra/Recover.vim/"; + }; + + Rename = buildVimPluginFrom2Nix { + pname = "Rename"; + version = "2011-08-31"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "Rename"; + rev = "b240f28d2ede65fa77cd99fe045efe79202f7a34"; + sha256 = "1d1myg4zyc281zcc1ba9idbgcgxndb4a0jwqr4yqxhhzdgszw46r"; + }; + meta.homepage = "https://github.com/vim-scripts/Rename/"; + }; + + ReplaceWithRegister = buildVimPluginFrom2Nix { + pname = "ReplaceWithRegister"; + version = "2014-10-31"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "ReplaceWithRegister"; + rev = "832efc23111d19591d495dc72286de2fb0b09345"; + sha256 = "0mb0sx85j1k59b1zz95r4vkq4kxlb4krhncq70mq7fxrs5bnhq8g"; + }; + meta.homepage = "https://github.com/vim-scripts/ReplaceWithRegister/"; + }; + + SchemaStore-nvim = buildVimPluginFrom2Nix { + pname = "SchemaStore.nvim"; + version = "2022-04-03"; + src = fetchFromGitHub { + owner = "b0o"; + repo = "SchemaStore.nvim"; + rev = "6598caa4ca4f6fa28f975025bec411611abbcb4d"; + sha256 = "1p0w9i471gqknb8w89ifggsa4hdgdx5zm09mzypqq9344w68fsds"; + }; + meta.homepage = "https://github.com/b0o/SchemaStore.nvim/"; + }; + + Shade-nvim = buildVimPluginFrom2Nix { + pname = "Shade.nvim"; + version = "2022-02-01"; + src = fetchFromGitHub { + owner = "sunjon"; + repo = "Shade.nvim"; + rev = "4286b5abc47d62d0c9ffb22a4f388b7bf2ac2461"; + sha256 = "0mb0cnf8065qmjq85hlgb4a1mqk1nwl7966l1imb54hpzw828rzl"; + }; + meta.homepage = "https://github.com/sunjon/Shade.nvim/"; + }; + + ShowMultiBase = buildVimPluginFrom2Nix { + pname = "ShowMultiBase"; + version = "2010-10-18"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "ShowMultiBase"; + rev = "85a39fd12668ce973d3d9282263912b2b8f0d338"; + sha256 = "0hg5352ahzgh2kwqha5v8ai024fld93xag93hb53wjf5b8nzsz8i"; + }; + meta.homepage = "https://github.com/vim-scripts/ShowMultiBase/"; + }; + + SimpylFold = buildVimPluginFrom2Nix { + pname = "SimpylFold"; + version = "2021-11-04"; + src = fetchFromGitHub { + owner = "tmhedberg"; + repo = "SimpylFold"; + rev = "b4a87e509c3d873238a39d1c85d0b97d6819f283"; + sha256 = "0ff5x7ay67wn9c0mi8sb6110i93zrf97c4whg0bd7pr2nmadpvk0"; + }; + meta.homepage = "https://github.com/tmhedberg/SimpylFold/"; + }; + + SpaceCamp = buildVimPluginFrom2Nix { + pname = "SpaceCamp"; + version = "2021-04-07"; + src = fetchFromGitHub { + owner = "jaredgorski"; + repo = "SpaceCamp"; + rev = "376af5c2204de61726ea86b596acb2dab9795e1f"; + sha256 = "0h3wxkswd5z9y46d6272sr210i73j5pwf5faw7qhr1plilfgx4gb"; + }; + meta.homepage = "https://github.com/jaredgorski/SpaceCamp/"; + }; + + SpaceVim = buildVimPluginFrom2Nix { + pname = "SpaceVim"; + version = "2022-04-05"; + src = fetchFromGitHub { + owner = "SpaceVim"; + repo = "SpaceVim"; + rev = "77378e06df9c7ac4345fee932b9c1923a15e8ef9"; + sha256 = "1274xhabkhkla2qljsdby4klyr05hf5vpbrra6i08pm5jhzp5h90"; + }; + meta.homepage = "https://github.com/SpaceVim/SpaceVim/"; + }; + + Spacegray-vim = buildVimPluginFrom2Nix { + pname = "Spacegray.vim"; + version = "2021-07-06"; + src = fetchFromGitHub { + owner = "ackyshake"; + repo = "Spacegray.vim"; + rev = "c699ca10ed421c462bd1c87a158faaa570dc8e28"; + sha256 = "0ma8w6p5jh6llka49x5j5ql8fmhv0bx5hhsn5b2phak79yqg1k61"; + }; + meta.homepage = "https://github.com/ackyshake/Spacegray.vim/"; + }; + + SudoEdit-vim = buildVimPluginFrom2Nix { + pname = "SudoEdit.vim"; + version = "2020-02-27"; + src = fetchFromGitHub { + owner = "chrisbra"; + repo = "SudoEdit.vim"; + rev = "e203eada5b563e9134ce2aae26b09edae0904fd7"; + sha256 = "0pf9iix50pw3p430ky51rv11ra1hppdpwa5flzcd5kciybr76n0n"; + }; + meta.homepage = "https://github.com/chrisbra/SudoEdit.vim/"; + }; + + TrueZen-nvim = buildVimPluginFrom2Nix { + pname = "TrueZen.nvim"; + version = "2021-10-12"; + src = fetchFromGitHub { + owner = "Pocco81"; + repo = "TrueZen.nvim"; + rev = "508b977d71650da5c9243698614a9a1416f116d4"; + sha256 = "0sr4y1mg83l28l5ias2pv0gxkcgwailfjn2skx35z63f2il3zkbx"; + }; + meta.homepage = "https://github.com/Pocco81/TrueZen.nvim/"; + }; + + VimCompletesMe = buildVimPluginFrom2Nix { + pname = "VimCompletesMe"; + version = "2022-02-18"; + src = fetchFromGitHub { + owner = "ackyshake"; + repo = "VimCompletesMe"; + rev = "9adf692d7ae6424038458a89d4a411f0a27d1388"; + sha256 = "1sndgb3291dyifaa8adri2mb8cgbinbar3nw1fnf67k9ahwycaz0"; + }; + meta.homepage = "https://github.com/ackyshake/VimCompletesMe/"; + }; + + VimOrganizer = buildVimPluginFrom2Nix { + pname = "VimOrganizer"; + version = "2020-12-15"; + src = fetchFromGitHub { + owner = "hsitz"; + repo = "VimOrganizer"; + rev = "09636aed78441a9de2767fcef6d7c567f322cc40"; + sha256 = "0phpcxmyz562yyp88rbx9pqg46w8r1lyapb700nvxwvqkcd82pfw"; + }; + meta.homepage = "https://github.com/hsitz/VimOrganizer/"; + }; + + Vundle-vim = buildVimPluginFrom2Nix { + pname = "Vundle.vim"; + version = "2019-08-17"; + src = fetchFromGitHub { + owner = "VundleVim"; + repo = "Vundle.vim"; + rev = "b255382d6242d7ea3877bf059d2934125e0c4d95"; + sha256 = "0fkmklcq3fgvd6x6irz9bgyvcdaxafykk3k89gsi9p6b0ikw3rw6"; + }; + meta.homepage = "https://github.com/VundleVim/Vundle.vim/"; + }; + + YUNOcommit-vim = buildVimPluginFrom2Nix { + pname = "YUNOcommit.vim"; + version = "2014-11-26"; + src = fetchFromGitHub { + owner = "esneider"; + repo = "YUNOcommit.vim"; + rev = "981082055a73ef076d7e27477874d2303153a448"; + sha256 = "0mjc7fn405vcx1n7vadl98p5wgm6jxrlbdbkqgjq8f1m1ir81zab"; + }; + meta.homepage = "https://github.com/esneider/YUNOcommit.vim/"; + }; + + YankRing-vim = buildVimPluginFrom2Nix { + pname = "YankRing.vim"; + version = "2015-07-29"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "YankRing.vim"; + rev = "28854abef8fa4ebd3cb219aefcf22566997d8f65"; + sha256 = "0zdp8pdsqgrh6lfw8ipjhrig6psvmdxkim9ik801y3r373sk2hxw"; + }; + meta.homepage = "https://github.com/vim-scripts/YankRing.vim/"; + }; + + YouCompleteMe = buildVimPluginFrom2Nix { + pname = "YouCompleteMe"; + version = "2022-04-02"; + src = fetchFromGitHub { + owner = "ycm-core"; + repo = "YouCompleteMe"; + rev = "3ededaed2f9923d50bf3860ba8dace0f7d2724cd"; + sha256 = "1n2h5wsp9vclsvzr40m1ffb6kjmcg0mccfj790giw77qa2i9s1rl"; + fetchSubmodules = true; + }; + meta.homepage = "https://github.com/ycm-core/YouCompleteMe/"; + }; + a-vim = buildVimPluginFrom2Nix { pname = "a.vim"; version = "2010-11-06"; @@ -41,12 +486,12 @@ final: prev: aerial-nvim = buildVimPluginFrom2Nix { pname = "aerial.nvim"; - version = "2022-03-24"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "stevearc"; repo = "aerial.nvim"; - rev = "b9f6067529ef123b8ace705ea356869f66aad320"; - sha256 = "1wcdshvq2nw1dx8xxzplvq519bzzb3qgf7lh0sqafjd19nzgwiji"; + rev = "85c9bbb69f0cdf7949ace27030e4d130cb9ffca3"; + sha256 = "1lpl9f96m9vkz8lzpq68rvycapy29dbzfm0sdmpx6mccygdb6ds1"; }; meta.homepage = "https://github.com/stevearc/aerial.nvim/"; }; @@ -77,12 +522,12 @@ final: prev: ale = buildVimPluginFrom2Nix { pname = "ale"; - version = "2022-03-23"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "dense-analysis"; repo = "ale"; - rev = "80dcd648d389965603246c2c5a4554e3e4aa184c"; - sha256 = "1a38q83sgv13aw3iy40mjzkg1wsc5zmf5mmkjqpdcgv5aixyb8m5"; + rev = "cae550f07b608ab591f7fd37ffcab78a07caad8f"; + sha256 = "0dfhqbfarynnw6p3fq81k2wadinm1fz3z6c3as5kv1bn34y528rn"; }; meta.homepage = "https://github.com/dense-analysis/ale/"; }; @@ -101,12 +546,12 @@ final: prev: aniseed = buildVimPluginFrom2Nix { pname = "aniseed"; - version = "2022-03-21"; + version = "2022-03-26"; src = fetchFromGitHub { owner = "Olical"; repo = "aniseed"; - rev = "bd79727af8a21037222a08ec9bcaf1c85488aaa4"; - sha256 = "0l4hvhmf9cgw921956rh97x6aqhjzs2jxsdnk2m38a9fr738hknk"; + rev = "68ad878e7d7546b291ebff43fd53544b2f6de401"; + sha256 = "16jsvpfacks2nw4s7qk8qh1xf9jkg6hnvnryp4p2gi0s3x5rfsws"; }; meta.homepage = "https://github.com/Olical/aniseed/"; }; @@ -161,12 +606,12 @@ final: prev: async-vim = buildVimPluginFrom2Nix { pname = "async.vim"; - version = "2022-01-04"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "prabirshrestha"; repo = "async.vim"; - rev = "f20569020d65bec3249222606c073c0943045b5e"; - sha256 = "0lff0v2vd06amcjirnpa4wc4l4nsbngcrdqcv34kszyqgzd7phka"; + rev = "2082d13bb195f3203d41a308b89417426a7deca1"; + sha256 = "08mblrrkxn1hivj1yjrn3vx3skd6l3xl96800i6qrsbsjlx5s5k3"; }; meta.homepage = "https://github.com/prabirshrestha/async.vim/"; }; @@ -365,28 +810,16 @@ final: prev: better-escape-nvim = buildVimPluginFrom2Nix { pname = "better-escape.nvim"; - version = "2022-03-14"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "max397574"; repo = "better-escape.nvim"; - rev = "d2efbf0093235525e81f537f8f4e63f23acedf06"; - sha256 = "1xx23v9jgpzdhyp1diyq0vc36vlxzljx36qnax2cms36kfnc398l"; + rev = "d5ee0cef56a7e41a86048c14f25e964876ac20c1"; + sha256 = "04hi2zmaz02fiyvjs94lqn7imp20fn2vpwww37sg7gim18b1mpl4"; }; meta.homepage = "https://github.com/max397574/better-escape.nvim/"; }; - BetterLua-vim = buildVimPluginFrom2Nix { - pname = "BetterLua.vim"; - version = "2020-08-14"; - src = fetchFromGitHub { - owner = "euclidianAce"; - repo = "BetterLua.vim"; - rev = "d2d6c115575d09258a794a6f20ac60233eee59d5"; - sha256 = "1rvlx21kw8865dg6q97hx9i2s1n8mn1nyhn0m7dkx625pghsx3js"; - }; - meta.homepage = "https://github.com/euclidianAce/BetterLua.vim/"; - }; - bitbake-vim = buildVimPluginFrom2Nix { pname = "bitbake.vim"; version = "2021-02-06"; @@ -461,28 +894,16 @@ final: prev: bufferline-nvim = buildVimPluginFrom2Nix { pname = "bufferline.nvim"; - version = "2022-03-21"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "akinsho"; repo = "bufferline.nvim"; - rev = "e1202c6569353d03ef0cb3da11b839dba26854dd"; - sha256 = "1nd5pvbg0yw8jl4rn56dzhabmiwkvlzb8iv595rrkqdb2msdl4qx"; + rev = "004cd5734fb21e39d48c1fb1469fa63e2797880b"; + sha256 = "1rr69n4mpkr6ky093fxabf3dcnngam3a01zl71ylvz27lv7gphqh"; }; meta.homepage = "https://github.com/akinsho/bufferline.nvim/"; }; - BufOnly-vim = buildVimPluginFrom2Nix { - pname = "BufOnly.vim"; - version = "2010-10-18"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "BufOnly.vim"; - rev = "43dd92303979bdb234a3cb2f5662847f7a3affe7"; - sha256 = "1gvpaqvvxjma0dl1zai68bpv42608api4054appwkw9pgczkkcdl"; - }; - meta.homepage = "https://github.com/vim-scripts/BufOnly.vim/"; - }; - calendar-vim = buildVimPluginFrom2Nix { pname = "calendar.vim"; version = "2022-03-21"; @@ -507,18 +928,6 @@ final: prev: meta.homepage = "https://github.com/bkad/camelcasemotion/"; }; - catppuccin-nvim = buildVimPluginFrom2Nix { - pname = "catppuccin-nvim"; - version = "2022-03-20"; - src = fetchFromGitHub { - owner = "catppuccin"; - repo = "nvim"; - rev = "f079dda3dc23450d69b4bad11bfbd9af2c77f6f3"; - sha256 = "1w0n96fbrkm3vdl64v1yzkly8wpcn5g9qflmpb8r1ww9hhig7a38"; - }; - meta.homepage = "https://github.com/catppuccin/nvim/"; - }; - caw-vim = buildVimPluginFrom2Nix { pname = "caw.vim"; version = "2021-09-20"; @@ -531,18 +940,6 @@ final: prev: meta.homepage = "https://github.com/tyru/caw.vim/"; }; - chadtree = buildVimPluginFrom2Nix { - pname = "chadtree"; - version = "2022-03-24"; - src = fetchFromGitHub { - owner = "ms-jpq"; - repo = "chadtree"; - rev = "e9606bfa350f277d54a61742d560e6122dc4d32c"; - sha256 = "1vyg48ghr8fd15fh41pk5qlgngdqkw8gwhkkyq9hbvs2mxw8x80c"; - }; - meta.homepage = "https://github.com/ms-jpq/chadtree/"; - }; - changeColorScheme-vim = buildVimPluginFrom2Nix { pname = "changeColorScheme.vim"; version = "2010-10-18"; @@ -567,18 +964,6 @@ final: prev: meta.homepage = "https://github.com/sudormrfbin/cheatsheet.nvim/"; }; - CheckAttach = buildVimPluginFrom2Nix { - pname = "CheckAttach"; - version = "2019-05-08"; - src = fetchFromGitHub { - owner = "chrisbra"; - repo = "CheckAttach"; - rev = "8f0b1350431d1d34655a147e6f1cfe6cb5dda5f7"; - sha256 = "1z9a40nbdjd3pnp28nfsi2bijsbaiphc0ia816f5flkchn07gmmj"; - }; - meta.homepage = "https://github.com/chrisbra/CheckAttach/"; - }; - ci_dark = buildVimPluginFrom2Nix { pname = "ci_dark"; version = "2022-03-27"; @@ -821,12 +1206,12 @@ final: prev: cmp-tabnine = buildVimPluginFrom2Nix { pname = "cmp-tabnine"; - version = "2022-01-26"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "tzachar"; repo = "cmp-tabnine"; - rev = "2a051347190a22b738e9784426199b9db745e1da"; - sha256 = "1z3imhw4jgswd957aqhf1yf5dihb1k9dfd22abshziv45fb0fggy"; + rev = "1c6e5c55f3a879354891c59cf27da733890bfc88"; + sha256 = "1hmif83kl2h4zz4xqkxb0xc003wzlirr26znx0r1f8z54f1j1hik"; }; meta.homepage = "https://github.com/tzachar/cmp-tabnine/"; }; @@ -881,12 +1266,12 @@ final: prev: cmp_luasnip = buildVimPluginFrom2Nix { pname = "cmp_luasnip"; - version = "2022-03-26"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "saadparwaiz1"; repo = "cmp_luasnip"; - rev = "85f2767842a35064f61128b71b8dab1e38c413c4"; - sha256 = "13s04x9vx3n854q9abb0knls5aycxigbwqgllfmp2xgaycgxqksa"; + rev = "b10829736542e7cc9291e60bab134df1273165c9"; + sha256 = "1qygdas99m7py98rqxyza88lmk2as8yi9khjac603x6anxmq766l"; }; meta.homepage = "https://github.com/saadparwaiz1/cmp_luasnip/"; }; @@ -989,12 +1374,12 @@ final: prev: coc-nvim = buildVimPluginFrom2Nix { pname = "coc.nvim"; - version = "2022-03-26"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "neoclide"; repo = "coc.nvim"; - rev = "16e74f9b31d20b8dfc8933132beed4c175d824ea"; - sha256 = "0nrfm8517fz31qrg0gfh888q7wcbxxkbpcp39ycvwkdfxpq1bzwr"; + rev = "1d85f511f9966b445b5200f35f8db8d4cc0af805"; + sha256 = "0yk9wghix3mh63p7w6hqk7crv4z6c2hi7ywdg6cnnkhnxviih7lp"; }; meta.homepage = "https://github.com/neoclide/coc.nvim/"; }; @@ -1035,18 +1420,6 @@ final: prev: meta.homepage = "https://github.com/lilydjwg/colorizer/"; }; - Colour-Sampler-Pack = buildVimPluginFrom2Nix { - pname = "Colour-Sampler-Pack"; - version = "2012-11-30"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "Colour-Sampler-Pack"; - rev = "05cded87b2ef29aaa9e930230bb88e23abff4441"; - sha256 = "03v2r18sfgs0xbgy9p56pxfdg0lsk6m7wyr5hw63wm1nzpwiipg3"; - }; - meta.homepage = "https://github.com/vim-scripts/Colour-Sampler-Pack/"; - }; - command-t = buildVimPluginFrom2Nix { pname = "command-t"; version = "2022-02-25"; @@ -1062,12 +1435,12 @@ final: prev: comment-nvim = buildVimPluginFrom2Nix { pname = "comment.nvim"; - version = "2022-03-25"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "numtostr"; repo = "comment.nvim"; - rev = "03b2a8f81102f2994f4888760e0f08385d841c3f"; - sha256 = "1ilzpdyis41p1x6wbkavjpva5hvxclagw6hjn76vpmwibnz99pfy"; + rev = "0aaea32f27315e2a99ba4c12ab9def5cbb4842e4"; + sha256 = "17vs6k71x6j6gzs1xhsvsmwh2lvpvwgshi2axg9b6ad20wv2v4dr"; }; meta.homepage = "https://github.com/numtostr/comment.nvim/"; }; @@ -1206,12 +1579,12 @@ final: prev: conjure = buildVimPluginFrom2Nix { pname = "conjure"; - version = "2022-02-15"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "Olical"; repo = "conjure"; - rev = "6c53d863c0843be0f68a138def146d6b8f725b22"; - sha256 = "1f5z99ac72433f2nj714fk6xd76mq7yr5i5z1afwgrhx61zbwn5h"; + rev = "0c85b2ecce542ce8ee336bf01f433950cf51f31e"; + sha256 = "15nqxzf2q8iwkc3b09crd66cb38cnh2sv4q49vv9x6nkxar69hgc"; }; meta.homepage = "https://github.com/Olical/conjure/"; }; @@ -1254,28 +1627,16 @@ final: prev: coq_nvim = buildVimPluginFrom2Nix { pname = "coq_nvim"; - version = "2022-03-26"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "ms-jpq"; repo = "coq_nvim"; - rev = "ad255350b66809d4af3aae75f4fb4dd576a06ab4"; - sha256 = "17l6ajaj03d5v8abi8m754ypqwhz1nw232n15y8av15ll0pb7gk0"; + rev = "60df9082402acb1d9d258fb9f9763a085ca04952"; + sha256 = "0gv4h0imxbfgw0g3z6xwqk7iczcs1zq5jdvpbn20gwsizrfgk6ap"; }; meta.homepage = "https://github.com/ms-jpq/coq_nvim/"; }; - Coqtail = buildVimPluginFrom2Nix { - pname = "Coqtail"; - version = "2022-03-25"; - src = fetchFromGitHub { - owner = "whonore"; - repo = "Coqtail"; - rev = "7a1cb8fb1cbdf136bba50a22ddcc056e83dc435c"; - sha256 = "0jj966bansbfzbhbfgyqciis36s7z46n9n8ihy2m7vxynibbf9yp"; - }; - meta.homepage = "https://github.com/whonore/Coqtail/"; - }; - cosco-vim = buildVimPluginFrom2Nix { pname = "cosco.vim"; version = "2018-08-07"; @@ -1772,12 +2133,12 @@ final: prev: diffview-nvim = buildVimPluginFrom2Nix { pname = "diffview.nvim"; - version = "2022-02-21"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "sindrets"; repo = "diffview.nvim"; - rev = "cf32c3fcdbc2f6855f6bb883302c9f290e9c3d88"; - sha256 = "0vikawxr40pkprsn8yzpacs33hfakpb98j5lmpf7sjmvyzkb1x8b"; + rev = "71e972ecec34cc9b4917ccdacbbd29062ef9657c"; + sha256 = "0ksq9d0glhn4d4s0png3pbvf7a5rbv1xgna49fz81d5qy5ih0rsl"; }; meta.homepage = "https://github.com/sindrets/diffview.nvim/"; }; @@ -1796,48 +2157,24 @@ final: prev: doki-theme-vim = buildVimPluginFrom2Nix { pname = "doki-theme-vim"; - version = "2022-02-16"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "doki-theme"; repo = "doki-theme-vim"; - rev = "fe7112ce7db0c8c65420e82aabfe7a98be2b538b"; - sha256 = "07vy5kf7pqsdqsz5jmqj6lm2aizcncfi4j1vmkpnjw9rpp3c733r"; + rev = "047caeccfe2052d5be42f0e26986c31bd2e0d5f0"; + sha256 = "0zbq3c25q03frav7scch5sghwa27swbamlrdnvkmiqw1qfk27r72"; }; meta.homepage = "https://github.com/doki-theme/doki-theme-vim/"; }; - DoxygenToolkit-vim = buildVimPluginFrom2Nix { - pname = "DoxygenToolkit.vim"; - version = "2010-11-06"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "DoxygenToolkit.vim"; - rev = "afd8663d36d2ec19d26befdb10e89e912d26bbd3"; - sha256 = "1za8li02j4nhqjjsyxg4p78638h5af4izim37zc0p1x55zr3i85r"; - }; - meta.homepage = "https://github.com/vim-scripts/DoxygenToolkit.vim/"; - }; - - dracula-vim = buildVimPluginFrom2Nix { - pname = "dracula-vim"; - version = "2022-03-24"; - src = fetchFromGitHub { - owner = "dracula"; - repo = "vim"; - rev = "d7723a842a6cfa2f62cf85530ab66eb418521dc2"; - sha256 = "1qzil8rwpdzf64gq63ds0cf509ldam77l3fz02g1mia5dry75r02"; - }; - meta.homepage = "https://github.com/dracula/vim/"; - }; - dressing-nvim = buildVimPluginFrom2Nix { pname = "dressing.nvim"; - version = "2022-03-24"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "stevearc"; repo = "dressing.nvim"; - rev = "31f12fff6e71a14ddce30bfc7ec9b29a2137ccde"; - sha256 = "0kjx04q2hnbvw68wh3d9li9p9s5d07j308kfhawpnhnmv6g57nzw"; + rev = "cad08fac5ed6d5e8384d8c0759268e2f6b89b217"; + sha256 = "0lc04cvq6iasg724zhpzp1j3bhwj4gphvqbzfh41ikzsy8d2jrpy"; }; meta.homepage = "https://github.com/stevearc/dressing.nvim/"; }; @@ -1856,12 +2193,12 @@ final: prev: edge = buildVimPluginFrom2Nix { pname = "edge"; - version = "2022-03-21"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "sainnhe"; repo = "edge"; - rev = "36c08622c4420129fa576ceafa4ed3388d3beb56"; - sha256 = "0hai4ns9chvqb8x7vgcl0i0lxqvqwxwhpa489zsqsp1lb436bwqc"; + rev = "ee4c9b797bce2d5fdcdb3904d2f3916d4ef3e615"; + sha256 = "123xp6hqjz3ys34dii8rbl6l9i5s2sbnjh80sax7d9l22jqcv1qf"; }; meta.homepage = "https://github.com/sainnhe/edge/"; }; @@ -1905,28 +2242,16 @@ final: prev: elvish-vim = buildVimPluginFrom2Nix { pname = "elvish.vim"; - version = "2019-06-29"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "dmix"; repo = "elvish.vim"; - rev = "67ef8e89bff7cb8ea936f2164c8c268bbb3295f0"; - sha256 = "133hr3i7zxysf2gnnimhz3gf3nda3fyfxmqq7mhq544v2mki4x9m"; + rev = "ab3f9cff31fb3c2871d437dd058b13526ddf66a0"; + sha256 = "1y1adg42iv0xhww2vxmxw3pky5syjc3djc1h2s7mm0bjg2marlha"; }; meta.homepage = "https://github.com/dmix/elvish.vim/"; }; - embark-vim = buildVimPluginFrom2Nix { - pname = "embark-vim"; - version = "2022-03-26"; - src = fetchFromGitHub { - owner = "embark-theme"; - repo = "vim"; - rev = "3f7f03aa2ae0d4185792aaf9b960bca0d22c48fd"; - sha256 = "0gv2ivrwsrhnsr2kh56yj3m1l4ydwq27vllzxa5vkpbb11jydf3d"; - }; - meta.homepage = "https://github.com/embark-theme/vim/"; - }; - emmet-vim = buildVimPluginFrom2Nix { pname = "emmet-vim"; version = "2021-12-04"; @@ -1954,12 +2279,12 @@ final: prev: everforest = buildVimPluginFrom2Nix { pname = "everforest"; - version = "2022-03-21"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "sainnhe"; repo = "everforest"; - rev = "764e36cf49a5845217ef09281adf708ab5abd9e3"; - sha256 = "03byh70krkcgcj6yis7x73bzs8b21qic5qhi01az057rp7mx462l"; + rev = "1a2c447fc014e55b5347b85df090b67af6ed28a6"; + sha256 = "1cx5gm629r23prrn3j9awcmqi7zslzgk6aikws38x0mm9jlr3bxg"; }; meta.homepage = "https://github.com/sainnhe/everforest/"; }; @@ -2038,12 +2363,12 @@ final: prev: fern-vim = buildVimPluginFrom2Nix { pname = "fern.vim"; - version = "2022-03-24"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "lambdalisue"; repo = "fern.vim"; - rev = "45950d39965150a6c6bff1979303e735460379d0"; - sha256 = "067aild4sr5zd08fn2dna9ndycf5i4w524kkz88yzhyr7h5rc0w4"; + rev = "53d8cf7cd96fcde4138ba1ad67971a594b4abbd4"; + sha256 = "1dicpzqmpxclrv3v48ipk79yfblhlva42kzrl8hxly95isq2kznp"; }; meta.homepage = "https://github.com/lambdalisue/fern.vim/"; }; @@ -2084,18 +2409,6 @@ final: prev: meta.homepage = "https://github.com/bogado/file-line/"; }; - FixCursorHold-nvim = buildVimPluginFrom2Nix { - pname = "FixCursorHold.nvim"; - version = "2022-02-17"; - src = fetchFromGitHub { - owner = "antoinemadec"; - repo = "FixCursorHold.nvim"; - rev = "1bfb32e7ba1344925ad815cb0d7f901dbc0ff7c1"; - sha256 = "0b1iffk6pa2zwd9fvlgqli72r8qj74b7hqkhlw6awhc7r1qj8m1q"; - }; - meta.homepage = "https://github.com/antoinemadec/FixCursorHold.nvim/"; - }; - flake8-vim = buildVimPluginFrom2Nix { pname = "flake8-vim"; version = "2020-10-20"; @@ -2147,12 +2460,12 @@ final: prev: formatter-nvim = buildVimPluginFrom2Nix { pname = "formatter.nvim"; - version = "2022-03-22"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "mhartington"; repo = "formatter.nvim"; - rev = "cc42c16a793cba102ac75574ab187a77995ba06b"; - sha256 = "1qz87l2da378wcbbck6n9p82apl594x2kxldl4sxhy88rbbqi2vb"; + rev = "bec8a57d6e990a503e87eb71ae530cd2c1402e31"; + sha256 = "14llli9s5x58m7z4ay5b9d2pypq378h3i4062rasdqi5c5and07n"; }; meta.homepage = "https://github.com/mhartington/formatter.nvim/"; }; @@ -2193,18 +2506,6 @@ final: prev: meta.homepage = "https://github.com/raghur/fruzzy/"; }; - FTerm-nvim = buildVimPluginFrom2Nix { - pname = "FTerm.nvim"; - version = "2022-03-13"; - src = fetchFromGitHub { - owner = "numToStr"; - repo = "FTerm.nvim"; - rev = "233633a5f6fe8398187a4eba93eba0828ef3d5f3"; - sha256 = "0sxnii921xia4mrf67qz7ichi9xqr9zf193hb9dx199l7hl6k1p8"; - }; - meta.homepage = "https://github.com/numToStr/FTerm.nvim/"; - }; - fugitive-gitlab-vim = buildVimPluginFrom2Nix { pname = "fugitive-gitlab.vim"; version = "2021-09-20"; @@ -2339,12 +2640,12 @@ final: prev: gina-vim = buildVimPluginFrom2Nix { pname = "gina.vim"; - version = "2021-06-12"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "lambdalisue"; repo = "gina.vim"; - rev = "abdbe0fe33f3b6fc59e94f7cc3072768f8dfd8ac"; - sha256 = "1f3shh6jxr5i1an2dbb1vmc0l2xg03fm6ava25ahxg4b5ka59bc5"; + rev = "ff6c2ddeca98f886b57fb42283c12e167d6ab575"; + sha256 = "09jlnpix2dy6kggiz96mrm5l1f9x1gl5afpdmfrxgkighn2rwpzq"; }; meta.homepage = "https://github.com/lambdalisue/gina.vim/"; }; @@ -2411,12 +2712,12 @@ final: prev: gitsigns-nvim = buildVimPluginFrom2Nix { pname = "gitsigns.nvim"; - version = "2022-03-25"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "lewis6991"; repo = "gitsigns.nvim"; - rev = "2a107231d92fa37224efdbc475abfba71f94b5ee"; - sha256 = "0i17r2c48csff7pl0k1vvc5j61xh3qv4xq6v75raz937w0kj6hfg"; + rev = "83ab3ca26ff5038f823060dfddda7a053e579b67"; + sha256 = "1hrzk6nr1w9747h0fn9h5cm1pgx1sw6njyf3pyr7p220gnh87vzp"; }; meta.homepage = "https://github.com/lewis6991/gitsigns.nvim/"; }; @@ -2529,18 +2830,6 @@ final: prev: meta.homepage = "https://github.com/morhetz/gruvbox/"; }; - gruvbox-community = buildVimPluginFrom2Nix { - pname = "gruvbox-community"; - version = "2022-03-06"; - src = fetchFromGitHub { - owner = "gruvbox-community"; - repo = "gruvbox"; - rev = "b6f47ae7031f6746a1f1918c17574aa12c474ef0"; - sha256 = "0m8rrm5v542a2c30sg7hlgm7r6gs4ah1n6nr5dc101l2064kg97g"; - }; - meta.homepage = "https://github.com/gruvbox-community/gruvbox/"; - }; - gruvbox-flat-nvim = buildVimPluginFrom2Nix { pname = "gruvbox-flat.nvim"; version = "2022-01-19"; @@ -2555,12 +2844,12 @@ final: prev: gruvbox-material = buildVimPluginFrom2Nix { pname = "gruvbox-material"; - version = "2022-03-21"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "sainnhe"; repo = "gruvbox-material"; - rev = "b8b63c81637c845e8a7c2dff4c206b714f7b93e4"; - sha256 = "0ds72yyca1sgrr5b7i683i0lpfz6n75vrij94vc8z07ivn33qy2r"; + rev = "5b98f2121ff3ece1e0b2ea037b86dd9ce0a346ad"; + sha256 = "0gp4dmrf33m6hpsnqqqv8ab8hflqgwdinr8c8w1k4qkipvg6xkpf"; }; meta.homepage = "https://github.com/sainnhe/gruvbox-material/"; }; @@ -2603,12 +2892,12 @@ final: prev: harpoon = buildVimPluginFrom2Nix { pname = "harpoon"; - version = "2022-02-16"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "ThePrimeagen"; repo = "harpoon"; - rev = "b2bb0d6f2b8a55895afda53f0ad04527998d3411"; - sha256 = "0izsscglfk6lpisxvarr0qw4m9br8854wi6jhyp2msd8r9gcrzi7"; + rev = "b6a363c037505c30a41042580729dc09e9bd00ed"; + sha256 = "0v917h34fha7ww2shrnwaqajp5f0s6qb9rbcmf4f504rpkfbnavl"; }; meta.homepage = "https://github.com/ThePrimeagen/harpoon/"; }; @@ -2759,28 +3048,16 @@ final: prev: impatient-nvim = buildVimPluginFrom2Nix { pname = "impatient.nvim"; - version = "2022-03-22"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "lewis6991"; repo = "impatient.nvim"; - rev = "989eefca3539b9958df100e8e3130f55eafe1709"; - sha256 = "0cypb6nm0jlgf4cbsazwplvniiqrnda32nk2nkaqm0dbprs920sv"; + rev = "2337df7d778e17a58d8709f651653b9039946d8d"; + sha256 = "06gz1qsdqil1f2wsfyslk8vsdxxjjrsak0gfar2298ardaqb3dhp"; }; meta.homepage = "https://github.com/lewis6991/impatient.nvim/"; }; - Improved-AnsiEsc = buildVimPluginFrom2Nix { - pname = "Improved-AnsiEsc"; - version = "2015-08-26"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "Improved-AnsiEsc"; - rev = "e1c59a8e9203fab6b9150721f30548916da73351"; - sha256 = "1smjs4kz2kmzprzp9az4957675nakb43146hshbby39j5xz4jsbz"; - }; - meta.homepage = "https://github.com/vim-scripts/Improved-AnsiEsc/"; - }; - increment-activator = buildVimPluginFrom2Nix { pname = "increment-activator"; version = "2021-09-16"; @@ -2819,12 +3096,12 @@ final: prev: indent-blankline-nvim = buildVimPluginFrom2Nix { pname = "indent-blankline.nvim"; - version = "2022-03-25"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "lukas-reineke"; repo = "indent-blankline.nvim"; - rev = "ebedbed53690a53cd15b53c124eb29f9faffc1d2"; - sha256 = "1wsxvlpq78vyvgz6g0ji07dy1b10bsfr1qk9qdpj2n5592zp8zlk"; + rev = "9920ceb79bffd0e6b7064be63439e38da0741d03"; + sha256 = "15wqnd72j98w15i7dhzjdxbyxk766vcb844xdrvany3zwqn5p58x"; }; meta.homepage = "https://github.com/lukas-reineke/indent-blankline.nvim/"; }; @@ -2962,18 +3239,6 @@ final: prev: meta.homepage = "https://github.com/nanotech/jellybeans.vim/"; }; - Jenkinsfile-vim-syntax = buildVimPluginFrom2Nix { - pname = "Jenkinsfile-vim-syntax"; - version = "2021-01-26"; - src = fetchFromGitHub { - owner = "martinda"; - repo = "Jenkinsfile-vim-syntax"; - rev = "0d05729168ea44d60862f17cffa80024ab30bcc9"; - sha256 = "05z30frs4f5z0l4qgxk08r7mb19bzhqs36hi213yin78cz62b9gy"; - }; - meta.homepage = "https://github.com/martinda/Jenkinsfile-vim-syntax/"; - }; - jq-vim = buildVimPluginFrom2Nix { pname = "jq.vim"; version = "2019-05-21"; @@ -3058,30 +3323,6 @@ final: prev: meta.homepage = "https://github.com/qnighy/lalrpop.vim/"; }; - LanguageClient-neovim = buildVimPluginFrom2Nix { - pname = "LanguageClient-neovim"; - version = "2020-12-10"; - src = fetchFromGitHub { - owner = "autozimu"; - repo = "LanguageClient-neovim"; - rev = "a42594c9c320b1283e9b9058b85a8097d8325fed"; - sha256 = "0lj9na3g2cl0vj56jz8rhz9lm2d3xps5glk8ds491i2ixy4vdm37"; - }; - meta.homepage = "https://github.com/autozimu/LanguageClient-neovim/"; - }; - - LanguageTool-nvim = buildVimPluginFrom2Nix { - pname = "LanguageTool.nvim"; - version = "2020-10-19"; - src = fetchFromGitHub { - owner = "vigoux"; - repo = "LanguageTool.nvim"; - rev = "809e7d77fec834597f495fec737c59292a10025b"; - sha256 = "1g12dz85xq8qd92dgna0a3w6zgxa74njlvmvly4k20610r63bzrn"; - }; - meta.homepage = "https://github.com/vigoux/LanguageTool.nvim/"; - }; - last256 = buildVimPluginFrom2Nix { pname = "last256"; version = "2020-12-09"; @@ -3118,26 +3359,14 @@ final: prev: meta.homepage = "https://github.com/kdheepak/lazygit.nvim/"; }; - LeaderF = buildVimPluginFrom2Nix { - pname = "LeaderF"; - version = "2022-03-22"; - src = fetchFromGitHub { - owner = "Yggdroot"; - repo = "LeaderF"; - rev = "60e14a5bbd52a22578d6335c606d0539067b9327"; - sha256 = "05bx5wm8r5rs4y51pkgb2m6bxzddacn7f3bdsgnmbvxz0rxyq8dp"; - }; - meta.homepage = "https://github.com/Yggdroot/LeaderF/"; - }; - lean-nvim = buildVimPluginFrom2Nix { pname = "lean.nvim"; - version = "2022-03-23"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "Julian"; repo = "lean.nvim"; - rev = "c22a0a6d288488a05a74aaa53dac4d2d71f7a30d"; - sha256 = "0rb1gw3ndrjw5k1l2ckm936xp83krrwi3ylr27il8mdf4xllw3y8"; + rev = "ca6a46c5ecba9f8957948e26b71c226d738f1efa"; + sha256 = "0mxd9xgnfgal9dd56vchqhkg0hhw4jn6mrqm0b885j9krl78hbvq"; }; meta.homepage = "https://github.com/Julian/lean.nvim/"; }; @@ -3192,12 +3421,12 @@ final: prev: lf-vim = buildVimPluginFrom2Nix { pname = "lf.vim"; - version = "2021-02-18"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "ptzz"; repo = "lf.vim"; - rev = "73fb502c6d1470243b1f4d8afa81e289d9edd94b"; - sha256 = "1whrzpavv46r64l3b7vax4sj23kjdfjiwmhfpssb6bprhc9c4j97"; + rev = "eab8f04b2953f08e3fcd425585598d176369ae4b"; + sha256 = "125qdj8grw1vilhfqzmjwcwk3r4f1m2kxnxga9klmgypjmcgnkxd"; }; meta.homepage = "https://github.com/ptzz/lf.vim/"; }; @@ -3288,12 +3517,12 @@ final: prev: lightspeed-nvim = buildVimPluginFrom2Nix { pname = "lightspeed.nvim"; - version = "2022-03-09"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "ggandor"; repo = "lightspeed.nvim"; - rev = "58c9e321b188e040703b01f16922623911f11117"; - sha256 = "1x9w6nk69a6xzhr9jpcvnw3jby09k49y7gikasxyq5gpq6rp9dfs"; + rev = "cfde2b2fe0dafc5684780399961595357998f611"; + sha256 = "0zcippcfv87vcsbld0kka4mn2lixg0r6m2c82g9bssf304skfhfr"; }; meta.homepage = "https://github.com/ggandor/lightspeed.nvim/"; }; @@ -3360,12 +3589,12 @@ final: prev: litee-filetree-nvim = buildVimPluginFrom2Nix { pname = "litee-filetree.nvim"; - version = "2022-03-08"; + version = "2022-03-26"; src = fetchFromGitHub { owner = "ldelossa"; repo = "litee-filetree.nvim"; - rev = "4f54ff9708c59385dd2f08aad1ba7df879e638fc"; - sha256 = "076wyp90mr43xniv0zc7wh6rfk1wr50cpfw5lvaj6ai7dyys466n"; + rev = "59259b0d0716b628a3e4f44098bd87ff54cf9cba"; + sha256 = "02awfwdzgcqsvs8p8a4m29c648phy6h5x1l49gklrmp8ymg2xgq3"; }; meta.homepage = "https://github.com/ldelossa/litee-filetree.nvim/"; }; @@ -3515,24 +3744,24 @@ final: prev: lualine-nvim = buildVimPluginFrom2Nix { pname = "lualine.nvim"; - version = "2022-03-27"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "nvim-lualine"; repo = "lualine.nvim"; - rev = "f14175e142825c69c5b39e8f1564b9945a97d4aa"; - sha256 = "0x6f88ixb6xd5nh3d8y5sql8yfyqs5fnpvdkdv9ywp7swzaydgqc"; + rev = "c8e5a69085e89c2bac6bd01c74fcb98f9ffa5cdc"; + sha256 = "0b2fwz1kxg0j8pgb1bzr82k916ii4k2vnbyz69w657v5mqmlpcbm"; }; meta.homepage = "https://github.com/nvim-lualine/lualine.nvim/"; }; luasnip = buildVimPluginFrom2Nix { pname = "luasnip"; - version = "2022-03-27"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "l3mon4d3"; repo = "luasnip"; - rev = "d03f0c32b2aa763915401421f6b084315936590f"; - sha256 = "0qrryj40v70wl1mwn3jc0f50ygslc0848gppki5sxv1aq56a58ps"; + rev = "69cb81cf7490666890545fef905d31a414edc15b"; + sha256 = "1dj86wljkhxri6k536ihds9v27wvs672rgmaj5i4migwxjlh6jb8"; }; meta.homepage = "https://github.com/l3mon4d3/luasnip/"; }; @@ -3587,12 +3816,12 @@ final: prev: marks-nvim = buildVimPluginFrom2Nix { pname = "marks.nvim"; - version = "2022-03-03"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "chentau"; repo = "marks.nvim"; - rev = "74885b10abf792f61a612f5724030678b9704dab"; - sha256 = "12653fd7h1s0hf55399vdk2w3aqyx8n8v62kgpvb62mywbg37bam"; + rev = "8e80a20a170434bc77decc97bc4364c3ba848925"; + sha256 = "0bah5xjrwq43ihw37gw8nxsj3qdh9fjqs9n7fkfhsg6hyp1qy4fc"; }; meta.homepage = "https://github.com/chentau/marks.nvim/"; }; @@ -3609,42 +3838,18 @@ final: prev: meta.homepage = "https://github.com/vim-scripts/matchit.zip/"; }; - MatchTagAlways = buildVimPluginFrom2Nix { - pname = "MatchTagAlways"; - version = "2017-05-20"; - src = fetchFromGitHub { - owner = "Valloric"; - repo = "MatchTagAlways"; - rev = "352eb479a4ad1608e0880b79ab2357aac2cf4bed"; - sha256 = "0y8gq4cs0wm2ijagc2frpmm664z355iridxyl5893576v5aqp8z1"; - }; - meta.homepage = "https://github.com/Valloric/MatchTagAlways/"; - }; - material-nvim = buildVimPluginFrom2Nix { pname = "material.nvim"; - version = "2022-03-25"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "marko-cerovac"; repo = "material.nvim"; - rev = "82f74e8ec5d21a8ec9ebe1175c330a0b6e490212"; - sha256 = "0hgcgj84d92js6i6skwzznz0ym8cgzwr4pz5aqi038g8ldpcx0ki"; + rev = "fc3e3d04f9646404dcbf3692e83ad0eecee8bfe8"; + sha256 = "0zqs3hn946gzcsm4qggakd45qnw5mvas1j6i71l8i55xabkgiffj"; }; meta.homepage = "https://github.com/marko-cerovac/material.nvim/"; }; - mattn-calendar-vim = buildVimPluginFrom2Nix { - pname = "mattn-calendar-vim"; - version = "2022-02-10"; - src = fetchFromGitHub { - owner = "mattn"; - repo = "calendar-vim"; - rev = "2083a41e2d310f9bbbbf644517f30e901f1fb04d"; - sha256 = "13wakcprkh93i7afykkpavxqvxssjh573pjjljsgip3y3778ms5q"; - }; - meta.homepage = "https://github.com/mattn/calendar-vim/"; - }; - mayansmoke = buildVimPluginFrom2Nix { pname = "mayansmoke"; version = "2010-10-18"; @@ -3659,12 +3864,12 @@ final: prev: mini-nvim = buildVimPluginFrom2Nix { pname = "mini.nvim"; - version = "2022-03-26"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "echasnovski"; repo = "mini.nvim"; - rev = "b0763e58ccb8b203f87fcd58fe2fecb095119f96"; - sha256 = "0qbyvz7l9p9iia7mh41119zdgz2v8xrkp8wcxl6hyxqri18j49yn"; + rev = "10b1fb8ead63309be01f48da78d7d83d0f2b041f"; + sha256 = "015ls360cwifh1jdzf6zxbqlc0dd0mgl029vs3brsn8h7b78rbv0"; }; meta.homepage = "https://github.com/echasnovski/mini.nvim/"; }; @@ -3729,18 +3934,6 @@ final: prev: meta.homepage = "https://github.com/tomasr/molokai/"; }; - moonlight-nvim = buildVimPluginFrom2Nix { - pname = "moonlight.nvim"; - version = "2021-05-16"; - src = fetchFromGitHub { - owner = "shaunsingh"; - repo = "moonlight.nvim"; - rev = "e24e4218ec680b6396532808abf57ca0ada82e66"; - sha256 = "0m9w3fpypsqxydjd93arbjqb5576nl40iy27i4ijlrqhgdhl49y3"; - }; - meta.homepage = "https://github.com/shaunsingh/moonlight.nvim/"; - }; - mru = buildVimPluginFrom2Nix { pname = "mru"; version = "2022-03-12"; @@ -3753,18 +3946,6 @@ final: prev: meta.homepage = "https://github.com/yegappan/mru/"; }; - Navigator-nvim = buildVimPluginFrom2Nix { - pname = "Navigator.nvim"; - version = "2022-03-25"; - src = fetchFromGitHub { - owner = "numToStr"; - repo = "Navigator.nvim"; - rev = "58d07e658c15b61ef7b6e375073b1f06934bc28f"; - sha256 = "0d40rilwcxi7q36fnk4xpyx1cq3nb4yf22j8k8zq6mwg5h4j648r"; - }; - meta.homepage = "https://github.com/numToStr/Navigator.nvim/"; - }; - ncm2 = buildVimPluginFrom2Nix { pname = "ncm2"; version = "2022-03-17"; @@ -4103,12 +4284,12 @@ final: prev: neorg = buildVimPluginFrom2Nix { pname = "neorg"; - version = "2022-03-26"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "nvim-neorg"; repo = "neorg"; - rev = "8f8c1ae889ffe666423a89271933272ebffec3ef"; - sha256 = "10fgkrr9wn6jj35qa42c353k4rnys9a2wrckjk0kwrx6kvx7m6l6"; + rev = "aec45ca94975c0072516523fec32d69044db36b6"; + sha256 = "1g1kyhwqdxbshbfqzrwzav9afkl7psys8w5i2h4gkn8dda1h59g6"; }; meta.homepage = "https://github.com/nvim-neorg/neorg/"; }; @@ -4127,12 +4308,12 @@ final: prev: neosnippet-snippets = buildVimPluginFrom2Nix { pname = "neosnippet-snippets"; - version = "2021-10-02"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "Shougo"; repo = "neosnippet-snippets"; - rev = "8a6655a034eb7c12138dad505ef1004bf383a45d"; - sha256 = "0mwvcjdrk324azqy5m2lpl3z1gi92jspxvmcjcxqnppfjsv1iyhd"; + rev = "725c989f18e9c134cddd63a7c6b15bed5c244657"; + sha256 = "0657ial95l0jgyj9ld6qbncnnrl5qkh6pqp40lr703ddqkz10s03"; }; meta.homepage = "https://github.com/Shougo/neosnippet-snippets/"; }; @@ -4149,18 +4330,6 @@ final: prev: meta.homepage = "https://github.com/Shougo/neosnippet.vim/"; }; - NeoSolarized = buildVimPluginFrom2Nix { - pname = "NeoSolarized"; - version = "2020-08-07"; - src = fetchFromGitHub { - owner = "overcache"; - repo = "NeoSolarized"; - rev = "b94b1a9ad51e2de015266f10fdc6e142f97bd617"; - sha256 = "019nz56yirpg1ahg8adfafrxznalw056qwm3xjm9kzg6da8j6v48"; - }; - meta.homepage = "https://github.com/overcache/NeoSolarized/"; - }; - neoterm = buildVimPluginFrom2Nix { pname = "neoterm"; version = "2022-01-20"; @@ -4295,12 +4464,12 @@ final: prev: nightfox-nvim = buildVimPluginFrom2Nix { pname = "nightfox.nvim"; - version = "2022-03-27"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "EdenEast"; repo = "nightfox.nvim"; - rev = "2b19e2ad758f078b607408b15bdaf39f3beafac6"; - sha256 = "0xn78z74wldjq7p5xzlbv4562b6i5nha3lj0bc2hv6w9n3m7q494"; + rev = "0670b85c5322da682498be9f355e050507fa6622"; + sha256 = "11gzi6kx1f57a6b5w7rqjwh0qah757g9814fw7qv76wc9cwbki1v"; }; meta.homepage = "https://github.com/EdenEast/nightfox.nvim/"; }; @@ -4377,18 +4546,6 @@ final: prev: meta.homepage = "https://github.com/andersevenrud/nordic.nvim/"; }; - NrrwRgn = buildVimPluginFrom2Nix { - pname = "NrrwRgn"; - version = "2022-02-13"; - src = fetchFromGitHub { - owner = "chrisbra"; - repo = "NrrwRgn"; - rev = "e027db9d94f94947153cd7b5ac9abd04371ab2b0"; - sha256 = "0mcwyqbfc2m865w44s96ra2k0v1mn5kkkxf8i71iqhvc7fvnrfah"; - }; - meta.homepage = "https://github.com/chrisbra/NrrwRgn/"; - }; - nterm-nvim = buildVimPluginFrom2Nix { pname = "nterm.nvim"; version = "2021-11-10"; @@ -4415,12 +4572,12 @@ final: prev: null-ls-nvim = buildVimPluginFrom2Nix { pname = "null-ls.nvim"; - version = "2022-03-25"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "jose-elias-alvarez"; repo = "null-ls.nvim"; - rev = "7253974f8bd8c805a2a1cf7456b4d47913f4a094"; - sha256 = "0xy80c1wra3ir8v0ywrrmyswprbzknlwf69q9g33g29zsmgfx9dr"; + rev = "f3107c3b211d62f53d34cbf0ca100fc948bc42d4"; + sha256 = "07x55chr28f9azqgjjwv0dnn9l0gm0n4z1wdf6libikbnh9jm522"; }; meta.homepage = "https://github.com/jose-elias-alvarez/null-ls.nvim/"; }; @@ -4463,36 +4620,36 @@ final: prev: nvim-autopairs = buildVimPluginFrom2Nix { pname = "nvim-autopairs"; - version = "2022-03-25"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "windwp"; repo = "nvim-autopairs"; - rev = "f3ebca37d6ef1ff22d1f2c764a9e619d1fe5f3c7"; - sha256 = "0w5xsj55iz30khiw4y47h43i40z2ly607bm8hvddpvrd50i5vcz1"; + rev = "06535b1f1aefc98df464d180efa693bb696736c4"; + sha256 = "12ii6vap3s2c58fmr01r900cidifr50pdpbl2ssx78w26qvc7qz4"; }; meta.homepage = "https://github.com/windwp/nvim-autopairs/"; }; nvim-base16 = buildVimPluginFrom2Nix { pname = "nvim-base16"; - version = "2022-03-13"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "RRethy"; repo = "nvim-base16"; - rev = "9893a06a11b448e05c0bd1f44970acbb7712e8ba"; - sha256 = "0hhlyw9nacyc4pyx2537y145lm9p3s4m4ckh8cwbambp5ypnn8kl"; + rev = "f3c8eaa6c8c0dcd752aa28042f9435c464349776"; + sha256 = "18xlhyyg9yq54p6jnq4dri47zfw62xfnx4ci9j9iiiii1dyzwr2z"; }; meta.homepage = "https://github.com/RRethy/nvim-base16/"; }; nvim-bqf = buildVimPluginFrom2Nix { pname = "nvim-bqf"; - version = "2022-03-21"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "kevinhwang91"; repo = "nvim-bqf"; - rev = "7d3630f1616c2e5cf9f1c8efc1cf186b9249ce7b"; - sha256 = "0y9kp05qgs7mmivs52ab26jhiqj1izz4jhj1n4x26zmaqbpw4viw"; + rev = "d67a9b5173806e3f2297ee42b298d1345acb9c24"; + sha256 = "1g6jvlx78s4a56p0nxg5z3s2g06snnsyq3bllvqf48qy2s43g286"; }; meta.homepage = "https://github.com/kevinhwang91/nvim-bqf/"; }; @@ -4523,12 +4680,12 @@ final: prev: nvim-cmp = buildVimPluginFrom2Nix { pname = "nvim-cmp"; - version = "2022-03-22"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "hrsh7th"; repo = "nvim-cmp"; - rev = "272cbdca3e327bf43e8df85c6f4f00921656c4e4"; - sha256 = "1z3nsrkla35sl6d66bjnk0qvqn1a5m8vn670qyb8y9nqs344fy8d"; + rev = "7dbe34e36d9de4912a5f3aa5279540445765814c"; + sha256 = "0v5z1m7n6q183l9a6pajfqbg6n2cxdkcpx7xmalyh99x9ax0pazf"; }; meta.homepage = "https://github.com/hrsh7th/nvim-cmp/"; }; @@ -4607,24 +4764,24 @@ final: prev: nvim-dap = buildVimPluginFrom2Nix { pname = "nvim-dap"; - version = "2022-03-25"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "mfussenegger"; repo = "nvim-dap"; - rev = "e6d7ba5847fbe5f33ba211cf28d3cea72cfa9865"; - sha256 = "0w57cxj07law5igbxvblfk59pv5c8z714dm80njb168ldgy26kz6"; + rev = "c20c78d7c6c82f16a2d1abec31f4273194e3987b"; + sha256 = "16vlsydx950s6v1nzpw0h38vmykcp9f3wsaxg09sjvc2isgd4f8b"; }; meta.homepage = "https://github.com/mfussenegger/nvim-dap/"; }; nvim-dap-ui = buildVimPluginFrom2Nix { pname = "nvim-dap-ui"; - version = "2022-03-21"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "rcarriga"; repo = "nvim-dap-ui"; - rev = "45805d69273f1ca0753a096abd419e89af8e5f8a"; - sha256 = "03jjhsdl0w5w0s7d9a64fmvwdpm1pkvjvd5gh1hgsavbpf0w71mb"; + rev = "33f33dfced1d7d98e2b934bd663175a062d8db39"; + sha256 = "00achlynnv1qhs0vqp0q40pzx95bxf9cgsgrpwg6p3fwb2f4ssdi"; }; meta.homepage = "https://github.com/rcarriga/nvim-dap-ui/"; }; @@ -4667,12 +4824,12 @@ final: prev: nvim-fzf-commands = buildVimPluginFrom2Nix { pname = "nvim-fzf-commands"; - version = "2021-05-31"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "vijaymarupudi"; repo = "nvim-fzf-commands"; - rev = "c6188c8618ca6b579af37cbc242414e1016bcd45"; - sha256 = "0nn04gpz3n0jqb9kyxbmipkixzp1lk2f67knxqzzzlxm27m839fy"; + rev = "015e77ea3185ca9175544e879e2cbb2cfb08323f"; + sha256 = "1w6s1kl83fyvwycym3i5azcx4q5ryzsjszh6wvk5pxqm2pmzs8lx"; }; meta.homepage = "https://github.com/vijaymarupudi/nvim-fzf-commands/"; }; @@ -4691,12 +4848,12 @@ final: prev: nvim-gps = buildVimPluginFrom2Nix { pname = "nvim-gps"; - version = "2022-03-27"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "smiteshp"; repo = "nvim-gps"; - rev = "1ad35eada2972c055b181c73852438a6ea51b484"; - sha256 = "1kv7p2lcilvkvzl9whdkxgg94vk9fa9d1bikwhahxv2zxzk10qkz"; + rev = "9f2adbce23a383243458f41654c07e57dc1b7635"; + sha256 = "1gwq7qrbcmh4nqdgl4pv83b8x5wxaks4vxgq3yryjj6n4x5b56fw"; }; meta.homepage = "https://github.com/smiteshp/nvim-gps/"; }; @@ -4715,12 +4872,12 @@ final: prev: nvim-hlslens = buildVimPluginFrom2Nix { pname = "nvim-hlslens"; - version = "2022-03-20"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "kevinhwang91"; repo = "nvim-hlslens"; - rev = "22f7df73283c6f947a56fef0355f5a3ee2971152"; - sha256 = "1qjy4n0ly5vmkpfyjanqb76jvh6qa5ldqvhgfgxk91b9l35ca95l"; + rev = "1944094111217db8d40aac697ffc71f16136d9ec"; + sha256 = "0f0lqldrgzi72qrafzwqk3i71v74xvsrhgrfnidnbnvd3jc7sa0b"; }; meta.homepage = "https://github.com/kevinhwang91/nvim-hlslens/"; }; @@ -4787,36 +4944,36 @@ final: prev: nvim-lint = buildVimPluginFrom2Nix { pname = "nvim-lint"; - version = "2022-03-09"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "mfussenegger"; repo = "nvim-lint"; - rev = "8cc31931859dc3cc187fd68509f8649599f72cba"; - sha256 = "006d9l0p86s08vhr5jjm6gi2j27wjbk3c3vfdbq9yi3bz974hgf1"; + rev = "4040e71c86022cf7937bef5d483156c163df8ca1"; + sha256 = "0492x97bl0p9kn2fsb6p587m6lsbn4qgdg7k7sr7vrfi73xw4s3k"; }; meta.homepage = "https://github.com/mfussenegger/nvim-lint/"; }; nvim-lsp-ts-utils = buildVimPluginFrom2Nix { pname = "nvim-lsp-ts-utils"; - version = "2022-03-15"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "jose-elias-alvarez"; repo = "nvim-lsp-ts-utils"; - rev = "1d2c585cb69a91cf53f17a90d2544ed10eb03193"; - sha256 = "07vf3xzcld2h3j6hnrrib60p2gnjkcb96h33sm8kfdvaj1578pbd"; + rev = "1826275ee0fc7fded65e8716b231db86a17080e3"; + sha256 = "129zjds8c69hahv307wnpdsjzfh29flsr99lkjma8dymsan96lb0"; }; meta.homepage = "https://github.com/jose-elias-alvarez/nvim-lsp-ts-utils/"; }; nvim-lspconfig = buildVimPluginFrom2Nix { pname = "nvim-lspconfig"; - version = "2022-03-23"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "neovim"; repo = "nvim-lspconfig"; - rev = "7d5a6dc46dd2ebaeb74b573922f289ae33089fe7"; - sha256 = "1dz2q6n2ibq9l2js088wfp2y5md6z8lqs6hy02xajglvb0d9g3fg"; + rev = "3d1baa811b351078e5711be1a1158e33b074be9e"; + sha256 = "0470h3vaw6zmmayfd9rzlh5myzmdc2wa5qlfmax21k0jna62zzr1"; }; meta.homepage = "https://github.com/neovim/nvim-lspconfig/"; }; @@ -4835,12 +4992,12 @@ final: prev: nvim-metals = buildVimPluginFrom2Nix { pname = "nvim-metals"; - version = "2022-03-20"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "scalameta"; repo = "nvim-metals"; - rev = "3312490ef74ea149121a82fde578a13b1921cef9"; - sha256 = "0xi13qji716kdbbq579pj7rxbjfkwjrsdp3qvfb937spwzbak2jc"; + rev = "6da18b24f1215f05c7c7edbf460c93cefb9b5688"; + sha256 = "1mv41ryxsx6wm909yby6z84xmhw3ibigw8zk34prhyvszz3psmvl"; }; meta.homepage = "https://github.com/scalameta/nvim-metals/"; }; @@ -4895,12 +5052,12 @@ final: prev: nvim-scrollview = buildVimPluginFrom2Nix { pname = "nvim-scrollview"; - version = "2022-03-15"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "dstein64"; repo = "nvim-scrollview"; - rev = "f1cdec5869de70359c8dff06e9057b99a56a0e48"; - sha256 = "028wvmdbj2fllkw6nr2sasxpamqpl3gmrzdn8lw2bjfzy5xf88x1"; + rev = "0e463065dd2b213d9c6adb00c88000c1bdb5c633"; + sha256 = "1k47r446a850bxwb70n00w5wz835jgj7sg175nldp6brq4lrd1x5"; }; meta.homepage = "https://github.com/dstein64/nvim-scrollview/"; }; @@ -4919,12 +5076,12 @@ final: prev: nvim-spectre = buildVimPluginFrom2Nix { pname = "nvim-spectre"; - version = "2022-03-22"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "nvim-pack"; repo = "nvim-spectre"; - rev = "3bbf9cb2e36200d67c150d71d49011c133d3bbb8"; - sha256 = "1jif3knz78mqf6sgckfwin1wx6ad4wppdc2y0hcxlj2kwm17xqzk"; + rev = "fbb03990539d5d484fe10de805772b4b86792c1a"; + sha256 = "1iw4gnsc72r5rj7z5g3jbxqcnfzzhi9r84zpik8pfjnx8r79ncnj"; }; meta.homepage = "https://github.com/nvim-pack/nvim-spectre/"; }; @@ -4943,24 +5100,24 @@ final: prev: nvim-tree-lua = buildVimPluginFrom2Nix { pname = "nvim-tree.lua"; - version = "2022-03-27"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "kyazdani42"; repo = "nvim-tree.lua"; - rev = "524758a207f9c5bf3888b446d9f93192a837b8a7"; - sha256 = "0kz7qhirm7gkklmyysanndm4pimvfm0p0qzz3q96hv01hpm3d17y"; + rev = "924aa290921426682f86495cf64f48fcdab3c2fd"; + sha256 = "01wn4vfk23ciyd69drh49jz67x254dn0q6k55akqc9pxlllds4pg"; }; meta.homepage = "https://github.com/kyazdani42/nvim-tree.lua/"; }; nvim-treesitter = buildVimPluginFrom2Nix { pname = "nvim-treesitter"; - version = "2022-03-27"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "nvim-treesitter"; repo = "nvim-treesitter"; - rev = "b995eebe84df88092a41cbfd591bfc1565f70d8e"; - sha256 = "1738mssq22n1njrpi004apgfv00fxn7yx00r3175qn57bjw9bks9"; + rev = "f083b7bbfe9480df00a45ab5a0978cb2586dddf2"; + sha256 = "0zhgkbzr2hnwy94zfg2mk9l364rcmw7z2bvhbbriywg5k7drpla8"; }; meta.homepage = "https://github.com/nvim-treesitter/nvim-treesitter/"; }; @@ -5003,12 +5160,12 @@ final: prev: nvim-treesitter-textobjects = buildVimPluginFrom2Nix { pname = "nvim-treesitter-textobjects"; - version = "2022-03-25"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "nvim-treesitter"; repo = "nvim-treesitter-textobjects"; - rev = "2885b60e9f9b90b4e2a32b0f8adf8571bf1f390e"; - sha256 = "0q1dph3pz2ygz1wccjgcdfqyb4faj47rv2v9a4p4ngw2vd00qjgy"; + rev = "c4b41e42dad700b23c6ea86ecb69c9deb55a8fbb"; + sha256 = "1l8fbn1rvyifvaplmyp38sf73payy1wlglnrb5xl4dxpcfd6yvzc"; }; meta.homepage = "https://github.com/nvim-treesitter/nvim-treesitter-textobjects/"; }; @@ -5039,12 +5196,12 @@ final: prev: nvim-ts-rainbow = buildVimPluginFrom2Nix { pname = "nvim-ts-rainbow"; - version = "2022-03-20"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "p00f"; repo = "nvim-ts-rainbow"; - rev = "af1a18d2577ba0be5b59bc4b32aebd2569ff085e"; - sha256 = "1z100akjipzp3zyr7d54vbwwf53dj4f8y8qzf7fv32la142a7idq"; + rev = "dee11b86ae2419e3f7484197c597a0e634a37a56"; + sha256 = "1rmv8lmxx4ji4lacgws3vfaaj8df2zbc3vs6sbj9mmzmfg3q38py"; }; meta.homepage = "https://github.com/p00f/nvim-ts-rainbow/"; }; @@ -5099,12 +5256,12 @@ final: prev: nvimdev-nvim = buildVimPluginFrom2Nix { pname = "nvimdev.nvim"; - version = "2022-03-15"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "neovim"; repo = "nvimdev.nvim"; - rev = "cb0fcc1cdbe3864554a7b1ecbe706eb4de4ec680"; - sha256 = "063fyzawn6i67cv3221s282ln5gpms3qw97blrd80l18syykj2b9"; + rev = "ebe8f689a9867c6ce57d748a80a2157b49764f13"; + sha256 = "0r07x8i7w9rk8n1zrdyvqr9pfjv3dihb2hy1100jl4xxc11g43an"; }; meta.homepage = "https://github.com/neovim/nvimdev.nvim/"; }; @@ -5135,12 +5292,12 @@ final: prev: octo-nvim = buildVimPluginFrom2Nix { pname = "octo.nvim"; - version = "2022-02-28"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "pwntester"; repo = "octo.nvim"; - rev = "5e461b944fbf9b6207cf06102ca09fd7778854f7"; - sha256 = "0s04m3xg98sj74fhhvdmafijmjhpa70hgcylg43yxlgdcscqbd72"; + rev = "50d58b195ea1f1ac620d775f39c95fe524f051d1"; + sha256 = "0cmzb6cp8n8jwzjmv3h0ikv5gn3dn3aq8kgsnmrkqlafh19692rr"; }; meta.homepage = "https://github.com/pwntester/octo.nvim/"; }; @@ -5183,12 +5340,12 @@ final: prev: onedarkpro-nvim = buildVimPluginFrom2Nix { pname = "onedarkpro.nvim"; - version = "2022-03-25"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "olimorris"; repo = "onedarkpro.nvim"; - rev = "46b0ffb97f3778a1f6f5da6471a42f3f64bbf238"; - sha256 = "13gyfz9fxgzvmcwwv19f8csmanv52144gvr5xdgvcg5nygkmydcp"; + rev = "86d633963bfbd6ff5448589a20a41deb8c19f90e"; + sha256 = "0nrq65gd2arxg4r0sqh4y4ikaadlrsbgcz1zq7yfpfbb76cia26w"; }; meta.homepage = "https://github.com/olimorris/onedarkpro.nvim/"; }; @@ -5231,12 +5388,12 @@ final: prev: orgmode = buildVimPluginFrom2Nix { pname = "orgmode"; - version = "2022-03-10"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "nvim-orgmode"; repo = "orgmode"; - rev = "e1f3054987ce054525258d9a3cc5837bf6e75212"; - sha256 = "0hwsajd7lhc04da7yzx770f3bgn2jsibcg1pjhxyib1prr17mpy0"; + rev = "8e52714a1851bb3c781a744489c31bf8fb2c4e28"; + sha256 = "1h3rzab981y0yp7kfkjpgjlj03kf6lyxxg2wikbdbkyz1c2bbkvk"; }; meta.homepage = "https://github.com/nvim-orgmode/orgmode/"; }; @@ -5363,24 +5520,24 @@ final: prev: playground = buildVimPluginFrom2Nix { pname = "playground"; - version = "2022-02-16"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "nvim-treesitter"; repo = "playground"; - rev = "9df82a27a49e1c14e9d7416b537517a79d675086"; - sha256 = "1hhrcsrgcy3vqxn9gsm68r77n6z5bw4cr0r47darffan5rxykz21"; + rev = "7dbcd4d647010a80d135804b3fc1da3fb77083d6"; + sha256 = "0g7rqw2vm00rrbbnhc8b9hyljc7q8qc0lywg63lkj63ks9j4m8y7"; }; meta.homepage = "https://github.com/nvim-treesitter/playground/"; }; plenary-nvim = buildVimPluginFrom2Nix { pname = "plenary.nvim"; - version = "2022-03-20"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "nvim-lua"; repo = "plenary.nvim"; - rev = "0d660152000a40d52158c155625865da2aa7aa1b"; - sha256 = "0r8amnlaqxg9jpqk6v4rzlfrc8q161jy1bpy35jrk7gva76kp9hm"; + rev = "f9c65cd76ffa76a0818923c6bce5771687dfe64c"; + sha256 = "1kgi4q7n8m0hv6hn82bs8xhm8n34qmzcq4l8prki1127gfa2gpqj"; }; meta.homepage = "https://github.com/nvim-lua/plenary.nvim/"; }; @@ -5436,28 +5593,16 @@ final: prev: presenting-vim = buildVimPluginFrom2Nix { pname = "presenting.vim"; - version = "2021-06-02"; + version = "2022-03-27"; src = fetchFromGitHub { owner = "sotte"; repo = "presenting.vim"; - rev = "fd826318582ffccf2f79aff7bef365d68f2ca4fc"; - sha256 = "1s2c44ngv5vpszwg0nkcghb5flzq9pby1m0l7gr7vwb9p7xl3b83"; + rev = "e960e204d8e4526d2650c23eaea908317c6becb9"; + sha256 = "1hpid82gdczis0g0pxvx445n2wg7j4zx66fm43zxq08kcv3k5ara"; }; meta.homepage = "https://github.com/sotte/presenting.vim/"; }; - PreserveNoEOL = buildVimPluginFrom2Nix { - pname = "PreserveNoEOL"; - version = "2013-06-14"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "PreserveNoEOL"; - rev = "940e3ce90e54d8680bec1135a21dcfbd6c9bfb62"; - sha256 = "1726jpr2zf6jrb00pp082ikbx4mll3a877pnzs6i18f9fgpaqqgd"; - }; - meta.homepage = "https://github.com/vim-scripts/PreserveNoEOL/"; - }; - prev_indent = buildVimPluginFrom2Nix { pname = "prev_indent"; version = "2014-03-08"; @@ -5539,23 +5684,10 @@ final: prev: repo = "pywal.nvim"; rev = "bd58195939d31dd0f15a720fba2956e91598cefe"; sha256 = "10fs5assp96rvlcxckd8cwnkfwfckjmf0j8cqq91vb2wx8knxc8g"; - fetchSubmodules = true; }; meta.homepage = "https://github.com/AlphaTechnolog/pywal.nvim/"; }; - QFEnter = buildVimPluginFrom2Nix { - pname = "QFEnter"; - version = "2020-10-09"; - src = fetchFromGitHub { - owner = "yssl"; - repo = "QFEnter"; - rev = "df0a75b287c210f98ae353a12bbfdaf73d858beb"; - sha256 = "0gdp7nmjlp8ng2rp2v66d8bincnkwrqqpbggb079f0f9szrqlp54"; - }; - meta.homepage = "https://github.com/yssl/QFEnter/"; - }; - quick-scope = buildVimPluginFrom2Nix { pname = "quick-scope"; version = "2022-01-29"; @@ -5676,18 +5808,6 @@ final: prev: meta.homepage = "https://github.com/ryvnf/readline.vim/"; }; - Recover-vim = buildVimPluginFrom2Nix { - pname = "Recover.vim"; - version = "2015-08-14"; - src = fetchFromGitHub { - owner = "chrisbra"; - repo = "Recover.vim"; - rev = "efa491f6121f65e025f42d79a93081abb8db69d4"; - sha256 = "17szim82bwnhf9q4n0n4jfmqkmhq6p0lh0j4y77a2x6lkn0pns5s"; - }; - meta.homepage = "https://github.com/chrisbra/Recover.vim/"; - }; - refactoring-nvim = buildVimPluginFrom2Nix { pname = "refactoring.nvim"; version = "2022-03-23"; @@ -5712,18 +5832,6 @@ final: prev: meta.homepage = "https://github.com/tversteeg/registers.nvim/"; }; - Rename = buildVimPluginFrom2Nix { - pname = "Rename"; - version = "2011-08-31"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "Rename"; - rev = "b240f28d2ede65fa77cd99fe045efe79202f7a34"; - sha256 = "1d1myg4zyc281zcc1ba9idbgcgxndb4a0jwqr4yqxhhzdgszw46r"; - }; - meta.homepage = "https://github.com/vim-scripts/Rename/"; - }; - renamer-nvim = buildVimPluginFrom2Nix { pname = "renamer.nvim"; version = "2022-01-15"; @@ -5736,18 +5844,6 @@ final: prev: meta.homepage = "https://github.com/filipdutescu/renamer.nvim/"; }; - ReplaceWithRegister = buildVimPluginFrom2Nix { - pname = "ReplaceWithRegister"; - version = "2014-10-31"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "ReplaceWithRegister"; - rev = "832efc23111d19591d495dc72286de2fb0b09345"; - sha256 = "0mb0sx85j1k59b1zz95r4vkq4kxlb4krhncq70mq7fxrs5bnhq8g"; - }; - meta.homepage = "https://github.com/vim-scripts/ReplaceWithRegister/"; - }; - rest-nvim = buildVimPluginFrom2Nix { pname = "rest.nvim"; version = "2022-01-26"; @@ -5880,18 +5976,6 @@ final: prev: meta.homepage = "https://github.com/vmware-archive/salt-vim/"; }; - SchemaStore-nvim = buildVimPluginFrom2Nix { - pname = "SchemaStore.nvim"; - version = "2022-03-25"; - src = fetchFromGitHub { - owner = "b0o"; - repo = "SchemaStore.nvim"; - rev = "f665a87f88b7b891aa5e1f91236b5bab29c2faaf"; - sha256 = "1i90yyrm7ji8wf3if431al9ggcnps37k3lsnga3ixqa5pr7xsrg9"; - }; - meta.homepage = "https://github.com/b0o/SchemaStore.nvim/"; - }; - scrollbar-nvim = buildVimPluginFrom2Nix { pname = "scrollbar.nvim"; version = "2021-11-16"; @@ -5976,30 +6060,6 @@ final: prev: meta.homepage = "https://github.com/osyo-manga/shabadou.vim/"; }; - Shade-nvim = buildVimPluginFrom2Nix { - pname = "Shade.nvim"; - version = "2022-02-01"; - src = fetchFromGitHub { - owner = "sunjon"; - repo = "Shade.nvim"; - rev = "4286b5abc47d62d0c9ffb22a4f388b7bf2ac2461"; - sha256 = "0mb0cnf8065qmjq85hlgb4a1mqk1nwl7966l1imb54hpzw828rzl"; - }; - meta.homepage = "https://github.com/sunjon/Shade.nvim/"; - }; - - ShowMultiBase = buildVimPluginFrom2Nix { - pname = "ShowMultiBase"; - version = "2010-10-18"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "ShowMultiBase"; - rev = "85a39fd12668ce973d3d9282263912b2b8f0d338"; - sha256 = "0hg5352ahzgh2kwqha5v8ai024fld93xag93hb53wjf5b8nzsz8i"; - }; - meta.homepage = "https://github.com/vim-scripts/ShowMultiBase/"; - }; - sideways-vim = buildVimPluginFrom2Nix { pname = "sideways.vim"; version = "2022-02-12"; @@ -6013,18 +6073,6 @@ final: prev: meta.homepage = "https://github.com/AndrewRadev/sideways.vim/"; }; - SimpylFold = buildVimPluginFrom2Nix { - pname = "SimpylFold"; - version = "2021-11-04"; - src = fetchFromGitHub { - owner = "tmhedberg"; - repo = "SimpylFold"; - rev = "b4a87e509c3d873238a39d1c85d0b97d6819f283"; - sha256 = "0ff5x7ay67wn9c0mi8sb6110i93zrf97c4whg0bd7pr2nmadpvk0"; - }; - meta.homepage = "https://github.com/tmhedberg/SimpylFold/"; - }; - skim-vim = buildVimPluginFrom2Nix { pname = "skim.vim"; version = "2020-11-11"; @@ -6051,12 +6099,12 @@ final: prev: slimv = buildVimPluginFrom2Nix { pname = "slimv"; - version = "2022-02-11"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "kovisoft"; repo = "slimv"; - rev = "1b88c3a67948b446720883ed8eadb8c2b83a21ef"; - sha256 = "0m0kkc75ifg7lvk8p3vgq5iy8hr254ywj7hhjgxwzm2zbrwkr04s"; + rev = "eb5856c616466b0f463e27a30965ea142003a552"; + sha256 = "1c4hprzqzxkf0yqkqc8261qr7xk817nm28cp38dw4z1rmjcg1l04"; }; meta.homepage = "https://github.com/kovisoft/slimv/"; }; @@ -6099,12 +6147,12 @@ final: prev: sonokai = buildVimPluginFrom2Nix { pname = "sonokai"; - version = "2022-03-21"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "sainnhe"; repo = "sonokai"; - rev = "774ccdb95a04539530be34fa17a34c0f64139aca"; - sha256 = "1myz05j6i7h0yyffbip6a2gpfb61y35w48aa1wlh8i3m9bhy7g4a"; + rev = "444e40de8dac0afb3654b860d4d005cb34547840"; + sha256 = "10jnvax4fmvmgham3s632j7v7f3cbz96yxciscx9rrsfgcrlm9d4"; }; meta.homepage = "https://github.com/sainnhe/sonokai/"; }; @@ -6133,30 +6181,6 @@ final: prev: meta.homepage = "https://github.com/liuchengxu/space-vim/"; }; - SpaceCamp = buildVimPluginFrom2Nix { - pname = "SpaceCamp"; - version = "2021-04-07"; - src = fetchFromGitHub { - owner = "jaredgorski"; - repo = "SpaceCamp"; - rev = "376af5c2204de61726ea86b596acb2dab9795e1f"; - sha256 = "0h3wxkswd5z9y46d6272sr210i73j5pwf5faw7qhr1plilfgx4gb"; - }; - meta.homepage = "https://github.com/jaredgorski/SpaceCamp/"; - }; - - Spacegray-vim = buildVimPluginFrom2Nix { - pname = "Spacegray.vim"; - version = "2021-07-06"; - src = fetchFromGitHub { - owner = "ackyshake"; - repo = "Spacegray.vim"; - rev = "c699ca10ed421c462bd1c87a158faaa570dc8e28"; - sha256 = "0ma8w6p5jh6llka49x5j5ql8fmhv0bx5hhsn5b2phak79yqg1k61"; - }; - meta.homepage = "https://github.com/ackyshake/Spacegray.vim/"; - }; - spacevim = buildVimPluginFrom2Nix { pname = "spacevim"; version = "2018-03-29"; @@ -6169,18 +6193,6 @@ final: prev: meta.homepage = "https://github.com/ctjhoa/spacevim/"; }; - SpaceVim = buildVimPluginFrom2Nix { - pname = "SpaceVim"; - version = "2022-03-27"; - src = fetchFromGitHub { - owner = "SpaceVim"; - repo = "SpaceVim"; - rev = "a8d183fdd97de3c1ee54c0e5f0efe9e95a19d866"; - sha256 = "0rhpasj5jw7jhij6pqjrsb48gwf4hrpadh8ab9d611v6akkkxlvv"; - }; - meta.homepage = "https://github.com/SpaceVim/SpaceVim/"; - }; - sparkup = buildVimPluginFrom2Nix { pname = "sparkup"; version = "2012-06-11"; @@ -6231,12 +6243,12 @@ final: prev: splitjoin-vim = buildVimPluginFrom2Nix { pname = "splitjoin.vim"; - version = "2022-03-21"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "AndrewRadev"; repo = "splitjoin.vim"; - rev = "c32b18751a81715e3c13cff22fea9fb5ce31ef35"; - sha256 = "12kp185ndag507b7l4qvhr369zyikwgh0wyi9lrjyr2ar5impjqc"; + rev = "dbcd3069fb2b4ecfdd964c1e93aa59fcf7f850b6"; + sha256 = "1rgc9cbfpjnk8pf7wh9pyyljckbn1i88z5bggyn15q3lfhskvidc"; fetchSubmodules = true; }; meta.homepage = "https://github.com/AndrewRadev/splitjoin.vim/"; @@ -6326,18 +6338,6 @@ final: prev: meta.homepage = "https://github.com/lambdalisue/suda.vim/"; }; - SudoEdit-vim = buildVimPluginFrom2Nix { - pname = "SudoEdit.vim"; - version = "2020-02-27"; - src = fetchFromGitHub { - owner = "chrisbra"; - repo = "SudoEdit.vim"; - rev = "e203eada5b563e9134ce2aae26b09edae0904fd7"; - sha256 = "0pf9iix50pw3p430ky51rv11ra1hppdpwa5flzcd5kciybr76n0n"; - }; - meta.homepage = "https://github.com/chrisbra/SudoEdit.vim/"; - }; - supertab = buildVimPluginFrom2Nix { pname = "supertab"; version = "2021-04-30"; @@ -6510,12 +6510,12 @@ final: prev: tagbar = buildVimPluginFrom2Nix { pname = "tagbar"; - version = "2022-03-15"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "preservim"; repo = "tagbar"; - rev = "69659cfc9d081caf31c8d548dd4c19593839317b"; - sha256 = "1wdrn0zvqhz7pd0rgl5z3zri3sy4hb947nmw9imvwi62mpdhsh7d"; + rev = "2137c1437012afc82b5d50404b1404aec8699f7b"; + sha256 = "099000mv3d2l7aidvrwgfrks48xa5xv38fvqrs6svabqg20k2wwk"; }; meta.homepage = "https://github.com/preservim/tagbar/"; }; @@ -6594,12 +6594,12 @@ final: prev: telescope-coc-nvim = buildVimPluginFrom2Nix { pname = "telescope-coc.nvim"; - version = "2022-02-21"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "fannheyward"; repo = "telescope-coc.nvim"; - rev = "33a8785dc0d0a5fdd243875eba48bfec95e2cebc"; - sha256 = "1zf4x7jwy0p52nq2yhzap9bi8kc4npbdvxs6gbwy9kd1ddidfrkb"; + rev = "9748123aafbe915f34ddcfe583fc868f301f51ba"; + sha256 = "0kvwp5bpqw5vygacrq9cdr3237w7fmj3sqx1vk12sxbx85cdcvz9"; }; meta.homepage = "https://github.com/fannheyward/telescope-coc.nvim/"; }; @@ -6787,12 +6787,12 @@ final: prev: telescope-nvim = buildVimPluginFrom2Nix { pname = "telescope.nvim"; - version = "2022-03-26"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "nvim-telescope"; repo = "telescope.nvim"; - rev = "cf2d6d34282afd90f0f5d2aba265a23b068494c2"; - sha256 = "042w0l8hdcxaj3pmbp0w1mqmivfm48pv3vlcz6d423qiljbkrk9k"; + rev = "6e7ee3829225d5c97c1ebfff686050142ffe5867"; + sha256 = "0qlv63jll4ja4x2njxvz1h9mlh92akzif06qy8gr7f61gfvfaaca"; }; meta.homepage = "https://github.com/nvim-telescope/telescope.nvim/"; }; @@ -6968,12 +6968,12 @@ final: prev: toggleterm-nvim = buildVimPluginFrom2Nix { pname = "toggleterm.nvim"; - version = "2022-03-24"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "akinsho"; repo = "toggleterm.nvim"; - rev = "9f969e7f72d19966756318d61f2562f67dbb1f9c"; - sha256 = "118hwkn9cw2wsqigqvbpvbhbag6ywc325lvn088dfpzbn9k7vfmr"; + rev = "5733b24c684d202f978ccedca4a8c7571889bf28"; + sha256 = "00z21wvgjks5mqrqja1kc1wnwxpjyy2fl3sn8f16692hz2wcavrd"; }; meta.homepage = "https://github.com/akinsho/toggleterm.nvim/"; }; @@ -7038,18 +7038,6 @@ final: prev: meta.homepage = "https://github.com/folke/trouble.nvim/"; }; - TrueZen-nvim = buildVimPluginFrom2Nix { - pname = "TrueZen.nvim"; - version = "2021-10-12"; - src = fetchFromGitHub { - owner = "Pocco81"; - repo = "TrueZen.nvim"; - rev = "508b977d71650da5c9243698614a9a1416f116d4"; - sha256 = "0sr4y1mg83l28l5ias2pv0gxkcgwailfjn2skx35z63f2il3zkbx"; - }; - meta.homepage = "https://github.com/Pocco81/TrueZen.nvim/"; - }; - tslime-vim = buildVimPluginFrom2Nix { pname = "tslime.vim"; version = "2020-09-09"; @@ -7148,12 +7136,12 @@ final: prev: urlview-nvim = buildVimPluginFrom2Nix { pname = "urlview.nvim"; - version = "2022-03-29"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "axieax"; repo = "urlview.nvim"; - rev = "4ca1b22d914ff3187acd5a9486421769928c9d8f"; - sha256 = "1vy977y7favs76mpk6v3x18ph40y0d20kmm6bssvnlql1nh3ihbd"; + rev = "8815c06145f36dce7734ba4b95eb50c3e24074c4"; + sha256 = "1n46x1v2rw70ad6b6z04ik9rjvpkl8bbw62l8wfn7lkzdjgwi50d"; }; meta.homepage = "https://github.com/axieax/urlview.nvim/"; }; @@ -7170,18 +7158,6 @@ final: prev: meta.homepage = "https://github.com/vim-scripts/utl.vim/"; }; - vader-vim = buildVimPluginFrom2Nix { - pname = "vader.vim"; - version = "2020-02-13"; - src = fetchFromGitHub { - owner = "junegunn"; - repo = "vader.vim"; - rev = "6fff477431ac3191c69a3a5e5f187925466e275a"; - sha256 = "153cr1mrf5w5lyr8374brwx1z5yl9h0cnijxnd3xikh3yi3pbmwk"; - }; - meta.homepage = "https://github.com/junegunn/vader.vim/"; - }; - vCoolor-vim = buildVimPluginFrom2Nix { pname = "vCoolor.vim"; version = "2020-10-14"; @@ -7194,6 +7170,18 @@ final: prev: meta.homepage = "https://github.com/KabbAmine/vCoolor.vim/"; }; + vader-vim = buildVimPluginFrom2Nix { + pname = "vader.vim"; + version = "2020-02-13"; + src = fetchFromGitHub { + owner = "junegunn"; + repo = "vader.vim"; + rev = "6fff477431ac3191c69a3a5e5f187925466e275a"; + sha256 = "153cr1mrf5w5lyr8374brwx1z5yl9h0cnijxnd3xikh3yi3pbmwk"; + }; + meta.homepage = "https://github.com/junegunn/vader.vim/"; + }; + venn-nvim = buildVimPluginFrom2Nix { pname = "venn.nvim"; version = "2021-10-19"; @@ -7220,16 +7208,88 @@ final: prev: vifm-vim = buildVimPluginFrom2Nix { pname = "vifm.vim"; - version = "2022-03-24"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "vifm"; repo = "vifm.vim"; - rev = "11d8fb106515a4c4e6016742053356c9f0434fed"; - sha256 = "1gjaqmkrxg5x6mpb7dnznbbzrv3iadcw7snxjx7bzmr0b24mddcp"; + rev = "069349e5dbba9fbb24b88ebedb89f728387fae79"; + sha256 = "1rrzhg8qpvgvcm9fkr05hmkw95gn37pys0h0d6rii6qhbx9z95vs"; }; meta.homepage = "https://github.com/vifm/vifm.vim/"; }; + vim-CtrlXA = buildVimPluginFrom2Nix { + pname = "vim-CtrlXA"; + version = "2021-08-09"; + src = fetchFromGitHub { + owner = "Konfekt"; + repo = "vim-CtrlXA"; + rev = "404ea1e055921db5679b3734108d72850d6faa76"; + sha256 = "10bgyqnwcqly3sxl27np1b690hnj1snqbcvg8pzh4zgdysfgy9xg"; + }; + meta.homepage = "https://github.com/Konfekt/vim-CtrlXA/"; + }; + + vim-DetectSpellLang = buildVimPluginFrom2Nix { + pname = "vim-DetectSpellLang"; + version = "2022-03-15"; + src = fetchFromGitHub { + owner = "konfekt"; + repo = "vim-DetectSpellLang"; + rev = "d5b55e3307e72e45f8d736818c76884016583538"; + sha256 = "0l9bdgqaxfpndpf4v5kxn34zx5pnhf62chp4flzyyhhzlz52dqjw"; + }; + meta.homepage = "https://github.com/konfekt/vim-DetectSpellLang/"; + }; + + vim-LanguageTool = buildVimPluginFrom2Nix { + pname = "vim-LanguageTool"; + version = "2021-02-08"; + src = fetchFromGitHub { + owner = "dpelle"; + repo = "vim-LanguageTool"; + rev = "0372ffae78aa3eac3bfa48ba3bf2f4015a86385a"; + sha256 = "00476l49lczj1rw5gb6vs7s9r0zi1khw0g1v6bsfwl5r32699l7r"; + }; + meta.homepage = "https://github.com/dpelle/vim-LanguageTool/"; + }; + + vim-ReplaceWithRegister = buildVimPluginFrom2Nix { + pname = "vim-ReplaceWithRegister"; + version = "2021-07-05"; + src = fetchFromGitHub { + owner = "inkarkat"; + repo = "vim-ReplaceWithRegister"; + rev = "aad1e8fa31cb4722f20fe40679caa56e25120032"; + sha256 = "1cfgixq5smwbp55x2baaj1kw736w2mykysppphair44vb4w9rlgm"; + }; + meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithRegister/"; + }; + + vim-ReplaceWithSameIndentRegister = buildVimPluginFrom2Nix { + pname = "vim-ReplaceWithSameIndentRegister"; + version = "2020-06-17"; + src = fetchFromGitHub { + owner = "inkarkat"; + repo = "vim-ReplaceWithSameIndentRegister"; + rev = "0b7f542560bd21822a004e8accdf472eb477c9cf"; + sha256 = "04zvhqh9rjfiwfk8r0zci608pw09svqb42nvp8pvqb11xp2ydg2y"; + }; + meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/"; + }; + + vim-SyntaxRange = buildVimPluginFrom2Nix { + pname = "vim-SyntaxRange"; + version = "2021-01-16"; + src = fetchFromGitHub { + owner = "inkarkat"; + repo = "vim-SyntaxRange"; + rev = "3a7fd9ff50fabafe61df12522ed2f275c8e2f45e"; + sha256 = "1b5xyacbn87z8wkacjpnjk82xmxzivlb111427kwb5kxxdh4w7gq"; + }; + meta.homepage = "https://github.com/inkarkat/vim-SyntaxRange/"; + }; + vim-abolish = buildVimPluginFrom2Nix { pname = "vim-abolish"; version = "2021-03-20"; @@ -7484,12 +7544,12 @@ final: prev: vim-airline = buildVimPluginFrom2Nix { pname = "vim-airline"; - version = "2022-03-23"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "vim-airline"; repo = "vim-airline"; - rev = "a306a7abfd8b4450fcfdc0384dadb996148d2c1b"; - sha256 = "0qvz41rpdbcsszh0n4jhjrw9anyzsh4r1j694a3ryjj58gg9smjy"; + rev = "dc65eea5d9225758d4556278b3d808baa6ab4d0e"; + sha256 = "1mkfssssgsaqx770rarpgryp4zimfq7ljv14jzmb2bqx9iyqz5xb"; }; meta.homepage = "https://github.com/vim-airline/vim-airline/"; }; @@ -7784,12 +7844,12 @@ final: prev: vim-bufkill = buildVimPluginFrom2Nix { pname = "vim-bufkill"; - version = "2020-08-04"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "qpkorr"; repo = "vim-bufkill"; - rev = "2bd6d7e791668ea52bb26be2639406fcf617271f"; - sha256 = "1cvma03bg9psil67kg1x90lny7a31ljz5shybcl1jrfpzsybcqvg"; + rev = "ba6253de82f982722ef7eaee6751d788aefd568a"; + sha256 = "187pj4dw78xd3wlpf24nll89kggk4q38gi51dnq95qywfk4w2k5h"; }; meta.homepage = "https://github.com/qpkorr/vim-bufkill/"; }; @@ -8024,12 +8084,12 @@ final: prev: vim-cool = buildVimPluginFrom2Nix { pname = "vim-cool"; - version = "2020-04-18"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "romainl"; repo = "vim-cool"; - rev = "27ad4ecf7532b750fadca9f36e1c5498fc225af2"; - sha256 = "1in44gf7hs978nc9328zh1kj3jh04kcinw0m8spcbgj079782sg8"; + rev = "0ad6a212a910cef0aac7af244ee008ddd39a75c2"; + sha256 = "1jv3nl6vdn562zhd387yggwflncmy7vf89md5kkacmkvjz8rkis5"; }; meta.homepage = "https://github.com/romainl/vim-cool/"; }; @@ -8082,18 +8142,6 @@ final: prev: meta.homepage = "https://github.com/ap/vim-css-color/"; }; - vim-CtrlXA = buildVimPluginFrom2Nix { - pname = "vim-CtrlXA"; - version = "2021-08-09"; - src = fetchFromGitHub { - owner = "Konfekt"; - repo = "vim-CtrlXA"; - rev = "404ea1e055921db5679b3734108d72850d6faa76"; - sha256 = "10bgyqnwcqly3sxl27np1b690hnj1snqbcvg8pzh4zgdysfgy9xg"; - }; - meta.homepage = "https://github.com/Konfekt/vim-CtrlXA/"; - }; - vim-cue = buildVimPluginFrom2Nix { pname = "vim-cue"; version = "2021-06-18"; @@ -8178,18 +8226,6 @@ final: prev: meta.homepage = "https://github.com/sunaku/vim-dasht/"; }; - vim-DetectSpellLang = buildVimPluginFrom2Nix { - pname = "vim-DetectSpellLang"; - version = "2022-03-15"; - src = fetchFromGitHub { - owner = "konfekt"; - repo = "vim-DetectSpellLang"; - rev = "d5b55e3307e72e45f8d736818c76884016583538"; - sha256 = "0l9bdgqaxfpndpf4v5kxn34zx5pnhf62chp4flzyyhhzlz52dqjw"; - }; - meta.homepage = "https://github.com/konfekt/vim-DetectSpellLang/"; - }; - vim-deus = buildVimPluginFrom2Nix { pname = "vim-deus"; version = "2021-03-28"; @@ -8298,18 +8334,6 @@ final: prev: meta.homepage = "https://github.com/jhradilek/vim-docbk/"; }; - vim-docbk-snippets = buildVimPluginFrom2Nix { - pname = "vim-docbk-snippets"; - version = "2021-07-30"; - src = fetchFromGitHub { - owner = "jhradilek"; - repo = "vim-snippets"; - rev = "81a8dcb66886a0717e9ca73c8857ee90c3989063"; - sha256 = "0d6532qx66aiawpq2fdji0mnmvnlg5dnbvds5s4pgzafydikpr70"; - }; - meta.homepage = "https://github.com/jhradilek/vim-snippets/"; - }; - vim-easy-align = buildVimPluginFrom2Nix { pname = "vim-easy-align"; version = "2019-04-29"; @@ -8348,12 +8372,12 @@ final: prev: vim-easymotion = buildVimPluginFrom2Nix { pname = "vim-easymotion"; - version = "2020-12-17"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "easymotion"; repo = "vim-easymotion"; - rev = "d75d9591e415652b25d9e0a3669355550325263d"; - sha256 = "1j2kgh1iri0fqkbgbgvfjqgsksfipnmr1xbj554i602pnm0hbg19"; + rev = "b3cfab2a6302b3b39f53d9fd2cd997e1127d7878"; + sha256 = "1h30ak0ir5320asd5p7a9bqiv5whakv3022b3rakgnsjg503nxz1"; }; meta.homepage = "https://github.com/easymotion/vim-easymotion/"; }; @@ -8384,12 +8408,12 @@ final: prev: vim-elixir = buildVimPluginFrom2Nix { pname = "vim-elixir"; - version = "2022-01-26"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "elixir-editors"; repo = "vim-elixir"; - rev = "ff7a1223dfc5386c41bb582039a90a262d488607"; - sha256 = "0a82c6vmdjfq1cjiakdxd9mz0ivqivrjcrppqpwch9rzp98qspag"; + rev = "edf880c41ec1768faafc480433ae72ceffaf4362"; + sha256 = "14jgwgwynynlipvmr02i9h4q2mc459fz4jyflcngvpyc9ady9ald"; }; meta.homepage = "https://github.com/elixir-editors/vim-elixir/"; }; @@ -8420,12 +8444,12 @@ final: prev: vim-endwise = buildVimPluginFrom2Nix { pname = "vim-endwise"; - version = "2022-03-24"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-endwise"; - rev = "8faf48b69b04af120e162ce113ea21eac322e3b4"; - sha256 = "0zfgsqs2mal1yh8x4lj1kx2ib80clsh9s9swh44cq5ga5glfkyn8"; + rev = "720b3ee46a86fe8858baeed473e11bca54b997a9"; + sha256 = "1rql1zbzi1ffj0bdw4qkm1rbb5zscxqaml0rx0rh4y3zr7ny7vny"; }; meta.homepage = "https://github.com/tpope/vim-endwise/"; }; @@ -8480,12 +8504,12 @@ final: prev: vim-eunuch = buildVimPluginFrom2Nix { pname = "vim-eunuch"; - version = "2022-03-23"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-eunuch"; - rev = "01aa41b276b45e2df2cb680ab38e78ea7e5786c1"; - sha256 = "149hnk9ja9vnw5vr7axliyqh0l2xz6i4l3lngdlzi1xic0xfwxf5"; + rev = "c70b0ed50b5c0d806df012526104fc5342753749"; + sha256 = "1pj6rzdwalnv3x8xdgfsqh79pc21b0lhlp6ry5yzjcprghw1547d"; }; meta.homepage = "https://github.com/tpope/vim-eunuch/"; }; @@ -8540,12 +8564,12 @@ final: prev: vim-fireplace = buildVimPluginFrom2Nix { pname = "vim-fireplace"; - version = "2022-03-11"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-fireplace"; - rev = "49f213283ffd79e1a397a30ce9e11849eaacf8e1"; - sha256 = "0lk6xxbf111p1d75vagfhf1qydm1mzm4xycmyydfr46acy6a8hbk"; + rev = "2e4540d62fd49523a3aefeab896a33ed6bbcb43b"; + sha256 = "0h6ij4r5i6i72hkn8w7gw69asga7ka5addl74n2i1jhaznn7q1kb"; }; meta.homepage = "https://github.com/tpope/vim-fireplace/"; }; @@ -8672,12 +8696,12 @@ final: prev: vim-fugitive = buildVimPluginFrom2Nix { pname = "vim-fugitive"; - version = "2022-03-26"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-fugitive"; - rev = "321328c6c5901a597348155fc0e83b800544dcb0"; - sha256 = "11sd87c9vw1gs9pkvv0y24yqhkack0yxv5mg50ss6v7mjjdngv66"; + rev = "cba863444c9e970bc7282f76df0f559b5fc830bd"; + sha256 = "09g9cgs89c02qsjyp3n343dkqkwzr9jwrhn6l51c8c3dclp07870"; }; meta.homepage = "https://github.com/tpope/vim-fugitive/"; }; @@ -8816,12 +8840,12 @@ final: prev: vim-go = buildVimPluginFrom2Nix { pname = "vim-go"; - version = "2022-03-19"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "fatih"; repo = "vim-go"; - rev = "dcefd64ba251ffc3d497f8758036735c8f6cc824"; - sha256 = "1j5jrs7kk59ilqsjs0qk5213psv33xnnifsqrjc7h63p28sv3pnw"; + rev = "119797938eeb875e91182d6bd86eb001d0ef9029"; + sha256 = "1rclpd2nf26slz38imq8g5h1pknkwdbgnv4iz04vhq7k3gvls6vk"; }; meta.homepage = "https://github.com/fatih/vim-go/"; }; @@ -8922,18 +8946,6 @@ final: prev: meta.homepage = "https://github.com/chkno/vim-haskell-module-name/"; }; - vim-haskellconceal = buildVimPluginFrom2Nix { - pname = "vim-haskellconceal"; - version = "2017-06-15"; - src = fetchFromGitHub { - owner = "twinside"; - repo = "vim-haskellconceal"; - rev = "802f82a5afee56e9e1251e6f756104a3bd114234"; - sha256 = "1kh6853hi4rgl4z1xs8kz9l1q9w7lh0r42y2m0rabfpr6yh3091r"; - }; - meta.homepage = "https://github.com/twinside/vim-haskellconceal/"; - }; - vim-haskellConcealPlus = buildVimPluginFrom2Nix { pname = "vim-haskellConcealPlus"; version = "2020-01-21"; @@ -8946,6 +8958,18 @@ final: prev: meta.homepage = "https://github.com/enomsg/vim-haskellConcealPlus/"; }; + vim-haskellconceal = buildVimPluginFrom2Nix { + pname = "vim-haskellconceal"; + version = "2017-06-15"; + src = fetchFromGitHub { + owner = "twinside"; + repo = "vim-haskellconceal"; + rev = "802f82a5afee56e9e1251e6f756104a3bd114234"; + sha256 = "1kh6853hi4rgl4z1xs8kz9l1q9w7lh0r42y2m0rabfpr6yh3091r"; + }; + meta.homepage = "https://github.com/twinside/vim-haskellconceal/"; + }; + vim-hcl = buildVimPluginFrom2Nix { pname = "vim-hcl"; version = "2022-02-25"; @@ -9117,12 +9141,12 @@ final: prev: vim-illuminate = buildVimPluginFrom2Nix { pname = "vim-illuminate"; - version = "2022-03-13"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "RRethy"; repo = "vim-illuminate"; - rev = "487563de7ed6195fd46da178cb38dc1ff110c1ce"; - sha256 = "1k4pzq1gxqpcrx828ywypff1cjrns34rh8q7yz1j8nhlqvgrda9s"; + rev = "3b9b6481a659bdc37a55f488c92839e3804ca098"; + sha256 = "1vki4g6gvmr6l9yb1xhv92yix2595b17j7m75ak15k25w1dnig7h"; }; meta.homepage = "https://github.com/RRethy/vim-illuminate/"; }; @@ -9201,12 +9225,12 @@ final: prev: vim-jack-in = buildVimPluginFrom2Nix { pname = "vim-jack-in"; - version = "2021-03-27"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "clojure-vim"; repo = "vim-jack-in"; - rev = "80c69cc021486d1cfa5dac7d9d6ab6954ff20c27"; - sha256 = "11dw8kngzznzf91n6iyvw7yi1l35vgpva32dck3n25vpxc24krpn"; + rev = "5467e00e26f15680b0a7998f8aa20d5a7dd44cd5"; + sha256 = "1wi379l8d793v6hjx11v0dhgdn8a9ihx64gv51v9wpmjlvp9xbzd"; }; meta.homepage = "https://github.com/clojure-vim/vim-jack-in/"; }; @@ -9346,28 +9370,16 @@ final: prev: vim-kitty-navigator = buildVimPluginFrom2Nix { pname = "vim-kitty-navigator"; - version = "2022-02-04"; + version = "2022-03-27"; src = fetchFromGitHub { owner = "knubie"; repo = "vim-kitty-navigator"; - rev = "8d9af030c8a74cdda6ab9a510d9a13bca80e8f9b"; - sha256 = "03rf49w3x67aayfn6hl0jhf4gik1scq4khhnvicp1zabdn8cq175"; + rev = "7bf84bc1253bebb86cbf63efa274a656e1faadc6"; + sha256 = "126z01zqrpnkhi7kprl8kqwkr5ahxyrnx3pvzzmfqb9320v98d18"; }; meta.homepage = "https://github.com/knubie/vim-kitty-navigator/"; }; - vim-LanguageTool = buildVimPluginFrom2Nix { - pname = "vim-LanguageTool"; - version = "2021-02-08"; - src = fetchFromGitHub { - owner = "dpelle"; - repo = "vim-LanguageTool"; - rev = "0372ffae78aa3eac3bfa48ba3bf2f4015a86385a"; - sha256 = "00476l49lczj1rw5gb6vs7s9r0zi1khw0g1v6bsfwl5r32699l7r"; - }; - meta.homepage = "https://github.com/dpelle/vim-LanguageTool/"; - }; - vim-lastplace = buildVimPluginFrom2Nix { pname = "vim-lastplace"; version = "2022-02-22"; @@ -9538,12 +9550,12 @@ final: prev: vim-lsp = buildVimPluginFrom2Nix { pname = "vim-lsp"; - version = "2022-03-04"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "prabirshrestha"; repo = "vim-lsp"; - rev = "bfb7541eb88eb9804287af39aca70102e60d2bf0"; - sha256 = "1kaa92ylw5i8ysb2yxyqf666194wwcixgagi7gq3apkddr35a6g0"; + rev = "edd6629f0940e37ca988620e404e79e600962a6f"; + sha256 = "0qc2x0la72xhbbwdrm6iyjlip3pcfj0wk4msi6zfz9zmyrzcfnhb"; }; meta.homepage = "https://github.com/prabirshrestha/vim-lsp/"; }; @@ -9911,12 +9923,12 @@ final: prev: vim-obsession = buildVimPluginFrom2Nix { pname = "vim-obsession"; - version = "2022-03-25"; + version = "2022-04-05"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-obsession"; - rev = "d2818a614ec3a5d174c6bb19e87e2eeb207f4900"; - sha256 = "08scgvpc5rmcc6xwbqir1b8y4fx58im5gn55fpg33s5346lxwd62"; + rev = "7d39576149d17bde3c096fd57e3a2cdae65deaf5"; + sha256 = "0g716c3dvd7068lfgcbxlzn86529kji4zms5n2xgrn3h0vn722zz"; }; meta.homepage = "https://github.com/tpope/vim-obsession/"; }; @@ -10199,12 +10211,12 @@ final: prev: vim-plug = buildVimPluginFrom2Nix { pname = "vim-plug"; - version = "2022-01-03"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "junegunn"; repo = "vim-plug"; - rev = "e300178a0e2fb04b56de8957281837f13ecf0b27"; - sha256 = "0bfgadn31n516x0m0kr88jk9x79rl6zllnwij759wpazmw1p0xg8"; + rev = "93ab5909784e09134e90f15cafa8a5edcc9a00fe"; + sha256 = "0cq2ilqqq90bpp8pzylqi759hqb9ni6l1rqkvj6aj7a4b29a59nv"; }; meta.homepage = "https://github.com/junegunn/vim-plug/"; }; @@ -10295,12 +10307,12 @@ final: prev: vim-projectionist = buildVimPluginFrom2Nix { pname = "vim-projectionist"; - version = "2022-03-13"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-projectionist"; - rev = "93b2af188fe0937edea414b8e05a362b74f4b31d"; - sha256 = "13x66y0dp70s2wcz5jkcqyp1r44sn3xdn70khzgl3jlv94ij3s1y"; + rev = "37f6867fb186191bbc99bfc9d7c465dce4b7f94e"; + sha256 = "0siigy1p5iwn5nms94w22kzgajyscdzn8mcnwkmhxdzbs2c4nv9w"; }; meta.homepage = "https://github.com/tpope/vim-projectionist/"; }; @@ -10497,30 +10509,6 @@ final: prev: meta.homepage = "https://github.com/tpope/vim-repeat/"; }; - vim-ReplaceWithRegister = buildVimPluginFrom2Nix { - pname = "vim-ReplaceWithRegister"; - version = "2021-07-05"; - src = fetchFromGitHub { - owner = "inkarkat"; - repo = "vim-ReplaceWithRegister"; - rev = "aad1e8fa31cb4722f20fe40679caa56e25120032"; - sha256 = "1cfgixq5smwbp55x2baaj1kw736w2mykysppphair44vb4w9rlgm"; - }; - meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithRegister/"; - }; - - vim-ReplaceWithSameIndentRegister = buildVimPluginFrom2Nix { - pname = "vim-ReplaceWithSameIndentRegister"; - version = "2020-06-17"; - src = fetchFromGitHub { - owner = "inkarkat"; - repo = "vim-ReplaceWithSameIndentRegister"; - rev = "0b7f542560bd21822a004e8accdf472eb477c9cf"; - sha256 = "04zvhqh9rjfiwfk8r0zci608pw09svqb42nvp8pvqb11xp2ydg2y"; - }; - meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/"; - }; - vim-rhubarb = buildVimPluginFrom2Nix { pname = "vim-rhubarb"; version = "2021-09-13"; @@ -10739,12 +10727,12 @@ final: prev: vim-sleuth = buildVimPluginFrom2Nix { pname = "vim-sleuth"; - version = "2022-03-26"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-sleuth"; - rev = "edffd9ee2cfafa3aba291f105a1d4f9f0e2d5701"; - sha256 = "1rkn4qawz3p0h1pz0g712k3iz72qvapqd8k1f05kbabxymw6yqd7"; + rev = "aade27e2b1a47ae2261d95a4dd622ca2c3d34227"; + sha256 = "1xwav2657qhqaxsql50dh20n7r5n97xb2xb990wikf34mi9j4pn4"; }; meta.homepage = "https://github.com/tpope/vim-sleuth/"; }; @@ -10835,12 +10823,12 @@ final: prev: vim-snippets = buildVimPluginFrom2Nix { pname = "vim-snippets"; - version = "2022-03-27"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "honza"; repo = "vim-snippets"; - rev = "57d23f6f44203374edcbb7d41903a491ec8cbed7"; - sha256 = "0371pv4pl99icxhbqbqfx7ds1i1kwv1k9p28i5pxayngkyhd7l39"; + rev = "c6d4b1cfa7a349ca561b86227cb46c4147b9c23c"; + sha256 = "0idmrcb4xigmds1iwz5rixvdcanqvv0qx7v3yg4d4p1xd4yjsiw1"; }; meta.homepage = "https://github.com/honza/vim-snippets/"; }; @@ -11013,18 +11001,6 @@ final: prev: meta.homepage = "https://github.com/machakann/vim-swap/"; }; - vim-SyntaxRange = buildVimPluginFrom2Nix { - pname = "vim-SyntaxRange"; - version = "2021-01-16"; - src = fetchFromGitHub { - owner = "inkarkat"; - repo = "vim-SyntaxRange"; - rev = "3a7fd9ff50fabafe61df12522ed2f275c8e2f45e"; - sha256 = "1b5xyacbn87z8wkacjpnjk82xmxzivlb111427kwb5kxxdh4w7gq"; - }; - meta.homepage = "https://github.com/inkarkat/vim-SyntaxRange/"; - }; - vim-table-mode = buildVimPluginFrom2Nix { pname = "vim-table-mode"; version = "2022-03-01"; @@ -11088,12 +11064,12 @@ final: prev: vim-test = buildVimPluginFrom2Nix { pname = "vim-test"; - version = "2022-03-26"; + version = "2022-04-04"; src = fetchFromGitHub { owner = "vim-test"; repo = "vim-test"; - rev = "56bbfa295fe62123d2ebe8ed57dd002afab46097"; - sha256 = "0ggk1c5767hjjfg1nwdm880bj9cgj6bgvf25dgjhwx83xxhzpp6d"; + rev = "d340f840725e6ee1b8abc63e852d80ded496ffc9"; + sha256 = "08y4x97l0749i6d7qc512irql5zpxdwyzrbsw6h507jq7cvaw8hb"; }; meta.homepage = "https://github.com/vim-test/vim-test/"; }; @@ -11662,18 +11638,6 @@ final: prev: meta.homepage = "https://github.com/jreybert/vimagit/"; }; - VimCompletesMe = buildVimPluginFrom2Nix { - pname = "VimCompletesMe"; - version = "2022-02-18"; - src = fetchFromGitHub { - owner = "ackyshake"; - repo = "VimCompletesMe"; - rev = "9adf692d7ae6424038458a89d4a411f0a27d1388"; - sha256 = "1sndgb3291dyifaa8adri2mb8cgbinbar3nw1fnf67k9ahwycaz0"; - }; - meta.homepage = "https://github.com/ackyshake/VimCompletesMe/"; - }; - vimelette = buildVimPluginFrom2Nix { pname = "vimelette"; version = "2019-05-02"; @@ -11698,18 +11662,6 @@ final: prev: meta.homepage = "https://github.com/Shougo/vimfiler.vim/"; }; - VimOrganizer = buildVimPluginFrom2Nix { - pname = "VimOrganizer"; - version = "2020-12-15"; - src = fetchFromGitHub { - owner = "hsitz"; - repo = "VimOrganizer"; - rev = "09636aed78441a9de2767fcef6d7c567f322cc40"; - sha256 = "0phpcxmyz562yyp88rbx9pqg46w8r1lyapb700nvxwvqkcd82pfw"; - }; - meta.homepage = "https://github.com/hsitz/VimOrganizer/"; - }; - vimoutliner = buildVimPluginFrom2Nix { pname = "vimoutliner"; version = "2021-04-24"; @@ -11772,12 +11724,12 @@ final: prev: vimspector = buildVimPluginFrom2Nix { pname = "vimspector"; - version = "2022-03-23"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "puremourning"; repo = "vimspector"; - rev = "99ce7a74699f12e05bf6059125d767b05ceb212b"; - sha256 = "0hj26vyq8cbw5zsq94i4hay27fs9z5xxyniflz975ddii8189qa9"; + rev = "da851334c72c44de95d00a152f98ee8e628be68f"; + sha256 = "16390g548y5bp6c08d481jafav83rbg4zd69r6fbfcnhzxmv7vhs"; fetchSubmodules = true; }; meta.homepage = "https://github.com/puremourning/vimspector/"; @@ -11785,12 +11737,12 @@ final: prev: vimtex = buildVimPluginFrom2Nix { pname = "vimtex"; - version = "2022-03-24"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "lervag"; repo = "vimtex"; - rev = "4eccec4e9fc46a52ba832ac2f8ab749ea33d6790"; - sha256 = "07mydwxqhk9l0ciqpczd51x4s58asmqa3f0bznw7cdvp9qa6a6sn"; + rev = "3c14f6912318ac3d92d32eca7d66c7c1c4f3e92c"; + sha256 = "1wnj1j38gs6xcdyhia6cmd010rv2g85s816hxd1qc1zlimfvi5gr"; }; meta.homepage = "https://github.com/lervag/vimtex/"; }; @@ -11855,18 +11807,6 @@ final: prev: meta.homepage = "https://github.com/liuchengxu/vista.vim/"; }; - Vundle-vim = buildVimPluginFrom2Nix { - pname = "Vundle.vim"; - version = "2019-08-17"; - src = fetchFromGitHub { - owner = "VundleVim"; - repo = "Vundle.vim"; - rev = "b255382d6242d7ea3877bf059d2934125e0c4d95"; - sha256 = "0fkmklcq3fgvd6x6irz9bgyvcdaxafykk3k89gsi9p6b0ikw3rw6"; - }; - meta.homepage = "https://github.com/VundleVim/Vundle.vim/"; - }; - wal-vim = buildVimPluginFrom2Nix { pname = "wal.vim"; version = "2020-11-08"; @@ -11905,12 +11845,12 @@ final: prev: wilder-nvim = buildVimPluginFrom2Nix { pname = "wilder.nvim"; - version = "2022-03-13"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "gelguy"; repo = "wilder.nvim"; - rev = "b59648ad8588bcba377f4eecdea317796ebd1f9d"; - sha256 = "0aic96isjssgmlqkr30m9j3895v27f3hgkgsqbl3zwkvjqa218d6"; + rev = "9c33d9423a3ba205ecdb90ce8a677c2b26f04908"; + sha256 = "19dv7ai4hs04m00w37d7bmb4c5zakfpj3mhgl15ddc6bpk3sbd7h"; }; meta.homepage = "https://github.com/gelguy/wilder.nvim/"; }; @@ -12011,18 +11951,6 @@ final: prev: meta.homepage = "https://github.com/guns/xterm-color-table.vim/"; }; - YankRing-vim = buildVimPluginFrom2Nix { - pname = "YankRing.vim"; - version = "2015-07-29"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "YankRing.vim"; - rev = "28854abef8fa4ebd3cb219aefcf22566997d8f65"; - sha256 = "0zdp8pdsqgrh6lfw8ipjhrig6psvmdxkim9ik801y3r373sk2hxw"; - }; - meta.homepage = "https://github.com/vim-scripts/YankRing.vim/"; - }; - yats-vim = buildVimPluginFrom2Nix { pname = "yats.vim"; version = "2022-01-05"; @@ -12036,31 +11964,6 @@ final: prev: meta.homepage = "https://github.com/HerringtonDarkholme/yats.vim/"; }; - YouCompleteMe = buildVimPluginFrom2Nix { - pname = "YouCompleteMe"; - version = "2022-03-23"; - src = fetchFromGitHub { - owner = "ycm-core"; - repo = "YouCompleteMe"; - rev = "89bba25c96866662ca38c2428f73eb64b0351ba3"; - sha256 = "0yrhvd9c0g6ay02b77sr657hn7ambcifwjfqsjywmnirr4zja45p"; - fetchSubmodules = true; - }; - meta.homepage = "https://github.com/ycm-core/YouCompleteMe/"; - }; - - YUNOcommit-vim = buildVimPluginFrom2Nix { - pname = "YUNOcommit.vim"; - version = "2014-11-26"; - src = fetchFromGitHub { - owner = "esneider"; - repo = "YUNOcommit.vim"; - rev = "981082055a73ef076d7e27477874d2303153a448"; - sha256 = "0mjc7fn405vcx1n7vadl98p5wgm6jxrlbdbkqgjq8f1m1ir81zab"; - }; - meta.homepage = "https://github.com/esneider/YUNOcommit.vim/"; - }; - zeavim-vim = buildVimPluginFrom2Nix { pname = "zeavim.vim"; version = "2019-06-07"; @@ -12145,4 +12048,112 @@ final: prev: meta.homepage = "https://github.com/nanotee/zoxide.vim/"; }; + catppuccin-nvim = buildVimPluginFrom2Nix { + pname = "catppuccin-nvim"; + version = "2022-03-20"; + src = fetchFromGitHub { + owner = "catppuccin"; + repo = "nvim"; + rev = "f079dda3dc23450d69b4bad11bfbd9af2c77f6f3"; + sha256 = "1w0n96fbrkm3vdl64v1yzkly8wpcn5g9qflmpb8r1ww9hhig7a38"; + }; + meta.homepage = "https://github.com/catppuccin/nvim/"; + }; + + chad = buildVimPluginFrom2Nix { + pname = "chad"; + version = "2022-04-05"; + src = fetchFromGitHub { + owner = "ms-jpq"; + repo = "chadtree"; + rev = "e03f7c8cbaeb85272d2d3d2c24af5065be4f5e71"; + sha256 = "08971zkma4zwz5511vzhgi99000xin5psy1hkancxr4v2bw68dh3"; + }; + meta.homepage = "https://github.com/ms-jpq/chadtree/"; + }; + + dracula-vim = buildVimPluginFrom2Nix { + pname = "dracula-vim"; + version = "2022-03-24"; + src = fetchFromGitHub { + owner = "dracula"; + repo = "vim"; + rev = "d7723a842a6cfa2f62cf85530ab66eb418521dc2"; + sha256 = "1qzil8rwpdzf64gq63ds0cf509ldam77l3fz02g1mia5dry75r02"; + }; + meta.homepage = "https://github.com/dracula/vim/"; + }; + + embark-vim = buildVimPluginFrom2Nix { + pname = "embark-vim"; + version = "2022-03-28"; + src = fetchFromGitHub { + owner = "embark-theme"; + repo = "vim"; + rev = "a57dbdbd2790c52563e1194c17e6de38a0c941cf"; + sha256 = "07yzy4yjxaf59b6pyf05jrawvc4y37v2x07n1vfc2dbsxkxdygq1"; + }; + meta.homepage = "https://github.com/embark-theme/vim/"; + }; + + gruvbox-community = buildVimPluginFrom2Nix { + pname = "gruvbox-community"; + version = "2022-03-06"; + src = fetchFromGitHub { + owner = "gruvbox-community"; + repo = "gruvbox"; + rev = "b6f47ae7031f6746a1f1918c17574aa12c474ef0"; + sha256 = "0m8rrm5v542a2c30sg7hlgm7r6gs4ah1n6nr5dc101l2064kg97g"; + }; + meta.homepage = "https://github.com/gruvbox-community/gruvbox/"; + }; + + mattn-calendar-vim = buildVimPluginFrom2Nix { + pname = "mattn-calendar-vim"; + version = "2022-02-10"; + src = fetchFromGitHub { + owner = "mattn"; + repo = "calendar-vim"; + rev = "2083a41e2d310f9bbbbf644517f30e901f1fb04d"; + sha256 = "13wakcprkh93i7afykkpavxqvxssjh573pjjljsgip3y3778ms5q"; + }; + meta.homepage = "https://github.com/mattn/calendar-vim/"; + }; + + pure-lua = buildVimPluginFrom2Nix { + pname = "pure-lua"; + version = "2021-05-16"; + src = fetchFromGitHub { + owner = "shaunsingh"; + repo = "moonlight.nvim"; + rev = "e24e4218ec680b6396532808abf57ca0ada82e66"; + sha256 = "0m9w3fpypsqxydjd93arbjqb5576nl40iy27i4ijlrqhgdhl49y3"; + }; + meta.homepage = "https://github.com/shaunsingh/moonlight.nvim/"; + }; + + rose-pine = buildVimPluginFrom2Nix { + pname = "rose-pine"; + version = "2022-04-01"; + src = fetchFromGitHub { + owner = "rose-pine"; + repo = "neovim"; + rev = "40c4fd7f5551710e388e0df85bb43d6e1627ca80"; + sha256 = "0ihzf18146q9bkqa22jq6xa2i394y6bn3fnjjgjz3zf8g8pcr6bl"; + }; + meta.homepage = "https://github.com/rose-pine/neovim/"; + }; + + vim-docbk-snippets = buildVimPluginFrom2Nix { + pname = "vim-docbk-snippets"; + version = "2021-07-30"; + src = fetchFromGitHub { + owner = "jhradilek"; + repo = "vim-snippets"; + rev = "81a8dcb66886a0717e9ca73c8857ee90c3989063"; + sha256 = "0d6532qx66aiawpq2fdji0mnmvnlg5dnbvds5s4pgzafydikpr70"; + }; + meta.homepage = "https://github.com/jhradilek/vim-snippets/"; + }; + } diff --git a/pkgs/applications/editors/vim/plugins/vim-plugin-names b/pkgs/applications/editors/vim/plugins/vim-plugin-names index f138c6d42d9..065063091a5 100644 --- a/pkgs/applications/editors/vim/plugins/vim-plugin-names +++ b/pkgs/applications/editors/vim/plugins/vim-plugin-names @@ -1,1010 +1,1012 @@ -907th/vim-auto-save -aca/completion-tabnine -AckslD/nvim-neoclip.lua -AckslD/nvim-whichkey-setup.lua -ackyshake/Spacegray.vim -ackyshake/VimCompletesMe -ahmedkhalf/lsp-rooter.nvim -ahmedkhalf/project.nvim -airblade/vim-gitgutter -airblade/vim-rooter -ajmwagar/vim-deus -akinsho/bufferline.nvim -akinsho/toggleterm.nvim -aklt/plantuml-syntax -allendang/nvim-expand-expr -AlphaTechnolog/pywal.nvim -altercation/vim-colors-solarized -alvan/vim-closetag -alvarosevilla95/luatab.nvim -alx741/vim-hindent -alx741/vim-stylishask -AmeerTaweel/todo.nvim -amiorin/ctrlp-z -andersevenrud/cmp-tmux -andersevenrud/nordic.nvim -andrep/vimacs -andreshazard/vim-logreview -AndrewRadev/sideways.vim -AndrewRadev/splitjoin.vim -AndrewRadev/switch.vim -AndrewRadev/tagalong.vim -andsild/peskcolor.vim -andviro/flake8-vim -andweeb/presence.nvim -andymass/vim-matchup -andys8/vim-elm-syntax -antoinemadec/coc-fzf -antoinemadec/FixCursorHold.nvim -ap/vim-css-color -arcticicestudio/nord-vim@master -arkav/lualine-lsp-progress -arthurxavierx/vim-unicoder -artur-shaik/vim-javacomplete2 -autozimu/LanguageClient-neovim -axelf4/vim-strip-trailing-whitespace -axieax/urlview.nvim -ayu-theme/ayu-vim -b0o/SchemaStore.nvim -b3nj5m1n/kommentary -bakpakin/fennel.vim -bazelbuild/vim-bazel -bbchung/clighter8 -BeneCollyridam/futhark-vim -benizi/vim-automkdir -bhurlow/vim-parinfer -bitc/vim-hdevtools -bkad/camelcasemotion -bling/vim-bufferline -blueballs-theme/blueballs-neovim -blueyed/vim-diminactive -bogado/file-line -bohlender/vim-smt2 -brennanfee/vim-gui-position -bronson/vim-trailing-whitespace -brooth/far.vim -buoto/gotests-vim -camspiers/lens.vim -camspiers/snap -carlitux/deoplete-ternjs -catppuccin/nvim as catppuccin-nvim -ccarpita/rtorrent-syntax-file -cespare/vim-toml -chaoren/vim-wordmotion -chentau/marks.nvim -chikatoike/concealedyank.vim -chikatoike/sourcemap.vim -chkno/vim-haskell-module-name -chr4/nginx.vim -chr4/sslsecure.vim -chrisbra/CheckAttach -chrisbra/csv.vim -chrisbra/NrrwRgn -chrisbra/Recover.vim -chrisbra/SudoEdit.vim -chrisbra/unicode.vim -chrisgeo/sparkup -chriskempson/base16-vim -ChristianChiarulli/nvcode-color-schemes.vim -christoomey/vim-sort-motion -christoomey/vim-tmux-navigator -ciaranm/inkpot -ckarnell/antonys-macro-repeater -clojure-vim/vim-jack-in -cloudhead/neovim-fuzzy -CoatiSoftware/vim-sourcetrail -coc-extensions/coc-svelte -cocopon/iceberg.vim -codota/tabnine-vim -cohama/lexima.vim -ConradIrwin/vim-bracketed-paste -crusoexia/vim-monokai -ctjhoa/spacevim -ctrlpvim/ctrlp.vim -dag/vim-fish -dag/vim2hs -dannyob/quickfixstatus -darfink/starsearch.vim -dart-lang/dart-vim-plugin -david-a-wheeler/vim-metamath -davidhalter/jedi-vim -dcharbon/vim-flatbuffers -dense-analysis/ale -deoplete-plugins/deoplete-clang -deoplete-plugins/deoplete-dictionary -deoplete-plugins/deoplete-go -deoplete-plugins/deoplete-jedi -deoplete-plugins/deoplete-lsp -deoplete-plugins/deoplete-zsh -derekelkins/agda-vim -derekwyatt/vim-scala -dhruvasagar/vim-prosession -dhruvasagar/vim-table-mode -digitaltoad/vim-pug -direnv/direnv.vim -dleonard0/pony-vim-syntax -dmix/elvish.vim -doki-theme/doki-theme-vim -dominikduda/vim_current_word -dpelle/vim-LanguageTool -dracula/vim as dracula-vim -drewtempelmeyer/palenight.vim -drmingdrmer/xptemplate -dstein64/nvim-scrollview -dstein64/vim-startuptime -dylanaraps/wal.vim -eagletmt/ghcmod-vim -eagletmt/neco-ghc -easymotion/vim-easymotion -echasnovski/mini.nvim -eddiebergman/nvim-treesitter-pyfold -eddyekofo94/gruvbox-flat.nvim -EdenEast/nightfox.nvim -editorconfig/editorconfig-vim -edkolev/tmuxline.vim -edluffy/hologram.nvim -edluffy/specs.nvim -edwinb/idris2-vim -ehamberg/vim-cute-python -eigenfoo/stan-vim -eikenb/acp -elixir-editors/vim-elixir -ellisonleao/glow.nvim -ellisonleao/gruvbox.nvim -elmcast/elm-vim -elzr/vim-json -embark-theme/vim as embark-vim -embear/vim-localvimrc -enomsg/vim-haskellConcealPlus -enricobacis/vim-airline-clock -ervandew/supertab -esneider/YUNOcommit.vim -euclidianAce/BetterLua.vim -euclio/vim-markdown-composer -evanleck/vim-svelte -f-person/git-blame.nvim -f3fora/cmp-spell -famiu/bufdelete.nvim -fannheyward/telescope-coc.nvim -farmergreg/vim-lastplace -fatih/vim-go -fcpg/vim-osc52 -FelikZ/ctrlp-py-matcher -feline-nvim/feline.nvim -fenetikm/falcon -fhill2/floating.nvim -fhill2/telescope-ultisnips.nvim -fiatjaf/neuron.vim -filipdutescu/renamer.nvim -fisadev/vim-isort -flazz/vim-colorschemes -floobits/floobits-neovim -folke/lsp-colors.nvim -folke/lua-dev.nvim -folke/todo-comments.nvim -folke/tokyonight.nvim -folke/trouble.nvim -folke/twilight.nvim -folke/which-key.nvim -folke/zen-mode.nvim -FooSoft/vim-argwrap -freitass/todo.txt-vim -frigoeu/psc-ide-vim -fruit-in/brainfuck-vim -fruit-in/vim-nong-theme -fsharp/vim-fsharp -garbas/vim-snipmate -gbrlsnchs/telescope-lsp-handlers.nvim -gcmt/taboo.vim -gcmt/wildfire.vim -gelguy/wilder.nvim -gennaro-tedesco/nvim-jqx -gennaro-tedesco/nvim-peekup -gentoo/gentoo-syntax -GEverding/vim-hocon -gfanto/fzf-lsp.nvim -ggandor/lightspeed.nvim -gibiansky/vim-textobj-haskell -gioele/vim-autoswap -github/copilot.vim -gleam-lang/gleam.vim -glepnir/dashboard-nvim -glepnir/oceanic-material -glepnir/zephyr-nvim -glts/vim-textobj-comment -godlygeek/csapprox -godlygeek/tabular -GoldsteinE/compe-latex-symbols -google/vim-codefmt -google/vim-jsonnet -google/vim-maktaba -gorkunov/smartpairs.vim -gotcha/vimelette -gpanders/editorconfig.nvim -gregsexton/gitv -gruvbox-community/gruvbox as gruvbox-community -gu-fan/riv.vim -guns/vim-clojure-highlight -guns/vim-clojure-static -guns/vim-sexp -guns/xterm-color-table.vim -GustavoKatel/telescope-asynctasks.nvim -gyim/vim-boxdraw -haringsrob/nvim_context_vt -hashivim/vim-packer -hashivim/vim-terraform -hashivim/vim-vagrant -hauleth/sad.vim -haya14busa/incsearch-easymotion.vim -haya14busa/incsearch.vim -haya14busa/is.vim -haya14busa/vim-asterisk -haya14busa/vim-poweryank -heavenshell/vim-jsdoc -hecal3/vim-leader-guide -henrik/vim-indexed-search -HerringtonDarkholme/yats.vim -honza/vim-snippets -hotwatermorning/auto-git-diff -hrsh7th/cmp-buffer -hrsh7th/cmp-calc -hrsh7th/cmp-cmdline -hrsh7th/cmp-emoji -hrsh7th/cmp-nvim-lsp -hrsh7th/cmp-nvim-lsp-document-symbol -hrsh7th/cmp-nvim-lua -hrsh7th/cmp-omni -hrsh7th/cmp-path -hrsh7th/cmp-vsnip -hrsh7th/nvim-cmp -hrsh7th/nvim-compe -hrsh7th/vim-vsnip -hrsh7th/vim-vsnip-integ -hsanson/vim-android -hsitz/VimOrganizer -https://git.sr.ht/~whynothugo/lsp_lines.nvim -hura/vim-asymptote -iamcco/coc-spell-checker -iamcco/coc-tailwindcss -iamcco/markdown-preview.nvim -ianks/vim-tsx -idanarye/vim-merginal -idris-hackers/idris-vim -Inazuma110/deoplete-greek -inkarkat/vim-ReplaceWithRegister -inkarkat/vim-ReplaceWithSameIndentRegister -inkarkat/vim-SyntaxRange -int3/vim-extradite -Iron-E/nvim-highlite -ishan9299/nvim-solarized-lua -itchyny/calendar.vim -itchyny/lightline.vim -itchyny/thumbnail.vim -itchyny/vim-cursorword -itchyny/vim-gitbranch -itspriddle/vim-shellcheck -ivalkeen/vim-simpledb -ivanov/vim-ipython -j-hui/fidget.nvim -jackguo380/vim-lsp-cxx-highlight -jacoborus/tender.vim -jakwings/vim-pony -jamessan/vim-gnupg -jaredgorski/SpaceCamp -jasonccox/vim-wayland-clipboard -jaxbot/semantic-highlight.vim -JazzCore/ctrlp-cmatcher -jbyuki/venn.nvim -jc-doyle/cmp-pandoc-references -jceb/vim-hier -jceb/vim-orgmode -jeetsukumaran/vim-buffergator -jeetsukumaran/vim-indentwise -jeffkreeftmeijer/neovim-sensible -jeffkreeftmeijer/vim-numbertoggle -jelera/vim-javascript-syntax -jgdavey/tslime.vim -jghauser/mkdir.nvim@main -jhradilek/vim-docbk -jhradilek/vim-snippets as vim-docbk-snippets -jiangmiao/auto-pairs -jistr/vim-nerdtree-tabs -jjo/vim-cue -jlanzarotta/bufexplorer -jlesquembre/nterm.nvim -jnurmine/zenburn -jonbri/vim-colorstepper -jonsmithers/vim-html-template-literals -joonty/vim-xdebug -joosepalviste/nvim-ts-context-commentstring -jordwalke/vim-reasonml -josa42/coc-lua -josa42/nvim-lightline-lsp -josa42/vim-lightline-coc -jose-elias-alvarez/minsnip.nvim -jose-elias-alvarez/null-ls.nvim -jose-elias-alvarez/nvim-lsp-ts-utils -joshdick/onedark.vim -jpalardy/vim-slime -jparise/vim-graphql -jparise/vim-phabricator -jreybert/vimagit -jsfaint/gen_tags.vim -JuliaEditorSupport/deoplete-julia -JuliaEditorSupport/julia-vim -Julian/lean.nvim -Julian/vim-textobj-variable-segment -juliosueiras/vim-terraform-completion -junegunn/fzf.vim -junegunn/goyo.vim -junegunn/gv.vim -junegunn/limelight.vim -junegunn/seoul256.vim -junegunn/vader.vim -junegunn/vim-after-object -junegunn/vim-easy-align -junegunn/vim-emoji -junegunn/vim-github-dashboard -junegunn/vim-peekaboo -junegunn/vim-plug -junegunn/vim-slash -justincampbell/vim-eighties -justinj/vim-pico8-syntax -justinmk/vim-dirvish -justinmk/vim-sneak -jvgrootveld/telescope-zoxide -jvirtanen/vim-hcl -jvoorhis/coq.vim -KabbAmine/vCoolor.vim -KabbAmine/zeavim.vim -kalbasit/vim-colemak -kana/vim-niceblock -kana/vim-operator-replace -kana/vim-operator-user -kana/vim-tabpagecd -kana/vim-textobj-entire -kana/vim-textobj-function -kana/vim-textobj-user -karb94/neoscroll.nvim -kassio/neoterm -kbenzie/vim-spirv -kchmck/vim-coffee-script -kdheepak/cmp-latex-symbols -kdheepak/lazygit.nvim -kdheepak/tabline.nvim -KeitaNakamura/neodark.vim -KeitaNakamura/tex-conceal.vim -keith/investigate.vim -keith/rspec.vim -keith/swift.vim -kevinhwang91/nvim-bqf -kevinhwang91/nvim-hlslens -kevinhwang91/rnvimr -kien/rainbow_parentheses.vim -knubie/vim-kitty-navigator -konfekt/fastfold -Konfekt/vim-alias -Konfekt/vim-CtrlXA -konfekt/vim-DetectSpellLang -kosayoda/nvim-lightbulb -kovisoft/slimv -kristijanhusak/defx-git -kristijanhusak/defx-icons -kristijanhusak/deoplete-phpactor -kristijanhusak/vim-carbon-now-sh -kristijanhusak/vim-dadbod-completion -kristijanhusak/vim-dadbod-ui -kristijanhusak/vim-dirvish-git -kristijanhusak/vim-hybrid-material -kshenoy/vim-signature -kyazdani42/nvim-tree.lua -kyazdani42/nvim-web-devicons -l3mon4d3/luasnip -lambdalisue/fern.vim -lambdalisue/gina.vim -lambdalisue/suda.vim -lambdalisue/vim-gista -lambdalisue/vim-manpager -lambdalisue/vim-pager -latex-box-team/latex-box -ldelossa/litee-calltree.nvim -ldelossa/litee-filetree.nvim -ldelossa/litee-symboltree.nvim -ldelossa/litee.nvim -leafgarland/typescript-vim -leanprover/lean.vim -ledger/vim-ledger -lepture/vim-jinja -lervag/vimtex -lewis6991/gitsigns.nvim -lewis6991/impatient.nvim -lf-lang/lingua-franca.vim -lfe-support/vim-lfe -lfilho/cosco.vim -lifepillar/pgsql.vim -lifepillar/vim-gruvbox8 -lifepillar/vim-mucomplete -lighttiger2505/deoplete-vim-lsp -lilydjwg/colorizer -lilydjwg/fcitx.vim@fcitx5 -liuchengxu/graphviz.vim -liuchengxu/space-vim -liuchengxu/vim-clap -liuchengxu/vim-which-key -liuchengxu/vista.vim -LnL7/vim-nix -lotabout/skim.vim -luan/vim-concourse -LucHermitte/lh-brackets -LucHermitte/lh-vim-lib -ludovicchabant/vim-gutentags -ludovicchabant/vim-lawrencium -lukas-reineke/cmp-under-comparator -lukas-reineke/indent-blankline.nvim -lukaszkorecki/workflowish -lumiliet/vim-twig -luochen1990/rainbow -luukvbaal/stabilize.nvim -lyokha/vim-xkbswitch -m-pilia/vim-ccls -machakann/vim-highlightedyank -machakann/vim-sandwich -machakann/vim-swap -maksimr/vim-jsbeautify -MarcWeber/vim-addon-actions -MarcWeber/vim-addon-async -MarcWeber/vim-addon-background-cmd -MarcWeber/vim-addon-commenting -MarcWeber/vim-addon-completion -MarcWeber/vim-addon-errorformats -MarcWeber/vim-addon-goto-thing-at-cursor -MarcWeber/vim-addon-local-vimrc -MarcWeber/vim-addon-manager -MarcWeber/vim-addon-mru -MarcWeber/vim-addon-mw-utils -MarcWeber/vim-addon-nix -MarcWeber/vim-addon-other -MarcWeber/vim-addon-php-manual -MarcWeber/vim-addon-signs -MarcWeber/vim-addon-sql -MarcWeber/vim-addon-syntax-checker -MarcWeber/vim-addon-toggle-buffer -MarcWeber/vim-addon-xdebug -marko-cerovac/material.nvim -markonm/traces.vim -martinda/Jenkinsfile-vim-syntax -MattesGroeger/vim-bookmarks -mattn/calendar-vim as mattn-calendar-vim -mattn/emmet-vim -mattn/vim-gist -mattn/webapi-vim -matze/vim-move -max397574/better-escape.nvim -maximbaz/lightline-ale -maxjacobson/vim-fzf-coauthorship -MaxMEllon/vim-jsx-pretty -mbbill/undotree -mboughaba/i3config.vim -mcchrish/nnn.vim -megaannum/forms -megaannum/self -mengelbrecht/lightline-bufferline -metakirby5/codi.vim -metalelf0/jellybeans-nvim -mfukar/robotframework-vim -mfussenegger/nvim-dap -mfussenegger/nvim-jdtls -mfussenegger/nvim-lint -mg979/vim-visual-multi -mg979/vim-xtabline -mhartington/formatter.nvim -mhartington/oceanic-next -mhinz/vim-crates -mhinz/vim-grepper -mhinz/vim-janah -mhinz/vim-sayonara@7e774f58c5865d9c10d40396850b35ab95af17c5 -mhinz/vim-signify -mhinz/vim-startify -michaeljsmith/vim-indent-object -mileszs/ack.vim -milkypostman/vim-togglelist -mindriot101/vim-yapf -mk12/vim-lean -mkasa/lushtags -mlr-msft/vim-loves-dafny -moll/vim-bbye -mopp/sky-color-clock.vim -morhetz/gruvbox -motus/pig.vim -mpickering/hlint-refactor-vim -ms-jpq/chadtree@chad -ms-jpq/coq_nvim -mtikekar/vim-bsv -MunifTanjim/nui.nvim@main -mustache/vim-mustache-handlebars -mzlogin/vim-markdown-toc -mzlogin/vim-smali -nacro90/numb.nvim -nanotech/jellybeans.vim -nanotee/zoxide.vim -natebosch/vim-lsc -nathanaelkane/vim-indent-guides -nathangrigg/vim-beancount -nathanmsmith/nvim-ale-diagnostic -navarasu/onedark.nvim -navicore/vissort.vim -nbouscal/vim-stylish-haskell -ncm2/float-preview.nvim -ncm2/ncm2 -ncm2/ncm2-bufword -ncm2/ncm2-cssomni -ncm2/ncm2-github -ncm2/ncm2-html-subscope -ncm2/ncm2-jedi -ncm2/ncm2-markdown-subscope -ncm2/ncm2-neoinclude -ncm2/ncm2-neosnippet -ncm2/ncm2-path -ncm2/ncm2-syntax -ncm2/ncm2-tagprefix -ncm2/ncm2-tmux -ncm2/ncm2-ultisnips -ncm2/ncm2-vim -ndmitchell/ghcid -neoclide/coc-denite -neoclide/coc-neco -neoclide/coc.nvim@release -neoclide/denite-extra -neoclide/denite-git -neoclide/jsonc.vim -neoclide/vim-easygit -neomake/neomake -neovim/nvim-lspconfig -neovim/nvimdev.nvim -neovimhaskell/haskell-vim -neovimhaskell/nvim-hs.vim -neutaaaaan/iosvkem -nfnty/vim-nftables -nicoe/deoplete-khard -nishigori/increment-activator -nixprime/cpsm -NLKNguyen/papercolor-theme -noahfrederick/vim-noctu -noc7c9/vim-iced-coffee-script -norcalli/nvim-colorizer.lua -norcalli/nvim-terminal.lua -norcalli/snippets.nvim -NTBBloodbath/galaxyline.nvim -NTBBloodbath/rest.nvim -ntpeters/vim-better-whitespace -numirias/semshi -numtostr/comment.nvim -numToStr/FTerm.nvim -numToStr/Navigator.nvim -nvie/vim-flake8 -nvim-lua/completion-nvim -nvim-lua/diagnostic-nvim -nvim-lua/lsp-status.nvim -nvim-lua/lsp_extensions.nvim -nvim-lua/plenary.nvim -nvim-lua/popup.nvim -nvim-lualine/lualine.nvim -nvim-neorg/neorg -nvim-orgmode/orgmode -nvim-pack/nvim-spectre -nvim-telescope/telescope-cheat.nvim -nvim-telescope/telescope-dap.nvim -nvim-telescope/telescope-file-browser.nvim -nvim-telescope/telescope-frecency.nvim -nvim-telescope/telescope-fzf-native.nvim -nvim-telescope/telescope-fzf-writer.nvim -nvim-telescope/telescope-fzy-native.nvim -nvim-telescope/telescope-github.nvim -nvim-telescope/telescope-project.nvim -nvim-telescope/telescope-symbols.nvim -nvim-telescope/telescope-ui-select.nvim -nvim-telescope/telescope-z.nvim -nvim-telescope/telescope.nvim -nvim-treesitter/completion-treesitter -nvim-treesitter/nvim-treesitter -nvim-treesitter/nvim-treesitter-refactor -nvim-treesitter/nvim-treesitter-textobjects -nvim-treesitter/playground -oberblastmeister/neuron.nvim -oberblastmeister/termwrapper.nvim -ocaml/vim-ocaml -octol/vim-cpp-enhanced-highlight -ojroques/nvim-bufdel -ojroques/vim-oscyank -Olical/aniseed -Olical/conjure -olimorris/onedarkpro.nvim -onsails/diaglist.nvim -onsails/lspkind-nvim -OrangeT/vim-csharp -osyo-manga/shabadou.vim -osyo-manga/vim-anzu -osyo-manga/vim-over -osyo-manga/vim-textobj-multiblock -osyo-manga/vim-watchdogs -overcache/NeoSolarized -p00f/nvim-ts-rainbow -pangloss/vim-javascript -pantharshit00/vim-prisma -parsonsmatt/intero-neovim -PaterJason/cmp-conjure -pearofducks/ansible-vim -peitalin/vim-jsx-typescript -peterbjorgensen/sved -peterhoeg/vim-qml -PeterRincker/vim-argumentative -petRUShka/vim-opencl -phaazon/hop.nvim -phanviet/vim-monokai-pro -Pocco81/TrueZen.nvim -ponko2/deoplete-fish -posva/vim-vue -powerman/vim-plugin-AnsiEsc -PProvost/vim-ps1 -prabirshrestha/async.vim -prabirshrestha/asyncomplete-lsp.vim -prabirshrestha/asyncomplete.vim -prabirshrestha/vim-lsp -preservim/nerdcommenter -preservim/nerdtree -preservim/tagbar -preservim/vim-markdown -preservim/vim-pencil -preservim/vim-wordy -preservim/vimux -prettier/vim-prettier -projekt0n/circles.nvim -psliwka/vim-smoothie -ptzz/lf.vim -puremourning/vimspector -purescript-contrib/purescript-vim -pwntester/octo.nvim -python-mode/python-mode -qnighy/lalrpop.vim -qpkorr/vim-bufkill -quangnguyen30192/cmp-nvim-ultisnips -Quramy/tsuquyomi -racer-rust/vim-racer -radenling/vim-dispatch-neovim -rafamadriz/friendly-snippets -rafamadriz/neon -rafaqz/ranger.vim -rafi/awesome-vim-colorschemes -raghur/fruzzy -raghur/vim-ghost -Raimondi/delimitMate -rakr/vim-one -ray-x/aurora -ray-x/cmp-treesitter -ray-x/lsp_signature.nvim -rbgrouleff/bclose.vim -rbong/vim-flog -rcarriga/nvim-dap-ui -rcarriga/nvim-notify -rcarriga/vim-ultest -rebelot/kanagawa.nvim -rhysd/clever-f.vim -rhysd/committia.vim -rhysd/conflict-marker.vim -rhysd/devdocs.vim -rhysd/git-messenger.vim -rhysd/vim-clang-format -rhysd/vim-grammarous -rhysd/vim-operator-surround -RishabhRD/nvim-lsputils -RishabhRD/popfix -rktjmp/fwatch.nvim -rktjmp/hotpot.nvim -rktjmp/lush.nvim -rmagatti/auto-session -rmagatti/goto-preview -RobertAudi/securemodelines -rodjek/vim-puppet -romainl/vim-cool -romainl/vim-qf -romainl/vim-qlist -roman/golden-ratio -romgrk/barbar.nvim -romgrk/nvim-treesitter-context -ron-rs/ron.vim -ron89/thesaurus_query.vim -roxma/nvim-cm-racer -roxma/nvim-completion-manager -roxma/nvim-yarp -roxma/vim-tmux-clipboard -RRethy/nvim-base16 -RRethy/vim-hexokinase -RRethy/vim-illuminate -rstacruz/vim-closer -ruanyl/vim-gh-line -ruifm/gitlinker.nvim -rust-lang/rust.vim -ryanoasis/vim-devicons -ryvnf/readline.vim -saadparwaiz1/cmp_luasnip -saecki/crates.nvim -sainnhe/edge -sainnhe/everforest -sainnhe/gruvbox-material -sainnhe/sonokai -sakhnik/nvim-gdb -samoshkin/vim-mergetool -sbdchd/neoformat -sblumentritt/bitbake.vim -scalameta/nvim-metals -sdiehl/vim-ormolu -sebastianmarkow/deoplete-rust -SevereOverfl0w/deoplete-github -Shatur/neovim-ayu -shaunsingh/moonlight.nvim@pure-lua -shaunsingh/nord.nvim -sheerun/vim-polyglot -shinchu/lightline-gruvbox.vim -Shougo/context_filetype.vim -Shougo/defx.nvim -Shougo/denite.nvim -Shougo/deol.nvim -Shougo/deoplete.nvim -Shougo/echodoc.vim -Shougo/neco-syntax -Shougo/neco-vim -Shougo/neocomplete.vim -Shougo/neoinclude.vim -Shougo/neomru.vim -Shougo/neosnippet-snippets -Shougo/neosnippet.vim -Shougo/neoyank.vim -Shougo/tabpagebuffer.vim -Shougo/unite.vim -Shougo/vimfiler.vim -Shougo/vimproc.vim -Shougo/vimshell.vim -shumphrey/fugitive-gitlab.vim -sickill/vim-pasta -SidOfc/mkdx -simnalamburt/vim-mundo -simrat39/rust-tools.nvim -simrat39/symbols-outline.nvim -sindrets/diffview.nvim -sindrets/winshift.nvim -SirVer/ultisnips -sjl/gundo.vim -sjl/splice.vim -sk1418/last256 -skywind3000/asyncrun.vim -skywind3000/asynctasks.vim -slashmili/alchemist.vim -smiteshp/nvim-gps -sodapopcan/vim-twiggy -solarnz/arcanist.vim -sonph/onehalf -sotte/presenting.vim -SpaceVim/SpaceVim -spywhere/lightline-lsp -srcery-colors/srcery-vim -steelsojka/completion-buffers -steelsojka/pears.nvim -stefandtw/quickfix-reflector.vim -stephpy/vim-yaml -stevearc/aerial.nvim -stevearc/dressing.nvim -stsewd/fzf-checkout.vim -sudormrfbin/cheatsheet.nvim -sunaku/vim-dasht -sunjon/Shade.nvim -svermeulen/vim-subversive -symphorien/vim-nixhash -t9md/vim-choosewin -t9md/vim-smalls -TaDaa/vimade -takac/vim-hardtime -tamago324/compe-zsh -tamago324/lir.nvim -tami5/compe-conjure -tami5/lispdocs.nvim -tami5/lspsaga.nvim -tami5/sqlite.lua -tbastos/vim-lua -tbodt/deoplete-tabnine -ternjs/tern_for_vim -terrortylor/nvim-comment -terryma/vim-expand-region -terryma/vim-multiple-cursors -tex/vimpreviewpandoc -Th3Whit3Wolf/one-nvim -theHamsta/nvim-dap-virtual-text -ThePrimeagen/git-worktree.nvim -ThePrimeagen/harpoon -theprimeagen/refactoring.nvim -ThePrimeagen/vim-apm -thinca/vim-ft-diff_fold -thinca/vim-prettyprint -thinca/vim-quickrun -thinca/vim-scouter -thinca/vim-themis -thinca/vim-visualstar -thirtythreeforty/lessspace.vim -thosakwe/vim-flutter -tiagofumo/vim-nerdtree-syntax-highlight -tikhomirov/vim-glsl -TimUntersberger/neogit -tjdevries/colorbuddy.nvim -tjdevries/nlua.nvim -tjdevries/train.nvim -tmhedberg/SimpylFold -tmsvg/pear-tree -tmux-plugins/vim-tmux -tmux-plugins/vim-tmux-focus-events -tom-anders/telescope-vim-bookmarks.nvim -tomasiser/vim-code-dark -tomasr/molokai -tomlion/vim-solidity -tommcdo/vim-exchange -tommcdo/vim-fubitive -tommcdo/vim-lion -tommcdo/vim-ninja-feet -tomtom/tcomment_vim -tomtom/tlib_vim -tools-life/taskwiki -towolf/vim-helm -tpope/vim-abolish -tpope/vim-capslock -tpope/vim-commentary -tpope/vim-dadbod -tpope/vim-dispatch -tpope/vim-endwise -tpope/vim-eunuch -tpope/vim-fireplace -tpope/vim-flagship -tpope/vim-fugitive -tpope/vim-git -tpope/vim-liquid -tpope/vim-obsession -tpope/vim-pathogen -tpope/vim-projectionist -tpope/vim-ragtag -tpope/vim-rails -tpope/vim-repeat -tpope/vim-rhubarb -tpope/vim-rsi -tpope/vim-salve -tpope/vim-scriptease -tpope/vim-sensible -tpope/vim-sexp-mappings-for-regular-people -tpope/vim-sleuth -tpope/vim-speeddating -tpope/vim-surround -tpope/vim-tbone -tpope/vim-unimpaired -tpope/vim-vinegar -travitch/hasksyn -tremor-rs/tremor-vim -triglav/vim-visual-increment -troydm/zoomwintab.vim -turbio/bracey.vim -tversteeg/registers.nvim -tweekmonster/wstrip.vim -twerth/ir_black -twinside/vim-haskellconceal -Twinside/vim-hoogle -tyru/caw.vim -tyru/open-browser-github.vim -tyru/open-browser.vim -tzachar/cmp-tabnine -tzachar/compe-tabnine -uarun/vim-protobuf -udalov/kotlin-vim -ujihisa/neco-look -unblevable/quick-scope -ur4ltz/surround.nvim -urbit/hoon.vim -Valloric/MatchTagAlways -Valodim/deoplete-notmuch -vhda/verilog_systemverilog.vim -vifm/vifm.vim -vigoux/LanguageTool.nvim -vijaymarupudi/nvim-fzf -vijaymarupudi/nvim-fzf-commands -vim-airline/vim-airline -vim-airline/vim-airline-themes -vim-autoformat/vim-autoformat -vim-erlang/vim-erlang-compiler -vim-erlang/vim-erlang-omnicomplete -vim-erlang/vim-erlang-runtime -vim-erlang/vim-erlang-tags -vim-pandoc/vim-pandoc -vim-pandoc/vim-pandoc-after -vim-pandoc/vim-pandoc-syntax -vim-python/python-syntax -vim-ruby/vim-ruby -vim-scripts/a.vim -vim-scripts/align -vim-scripts/argtextobj.vim -vim-scripts/autoload_cscope.vim -vim-scripts/bats.vim -vim-scripts/BufOnly.vim -vim-scripts/changeColorScheme.vim -vim-scripts/Colour-Sampler-Pack -vim-scripts/DoxygenToolkit.vim -vim-scripts/emodeline -vim-scripts/gitignore.vim -vim-scripts/Improved-AnsiEsc -vim-scripts/jdaddy.vim -vim-scripts/matchit.zip -vim-scripts/mayansmoke -vim-scripts/PreserveNoEOL -vim-scripts/prev_indent -vim-scripts/random.vim -vim-scripts/rcshell.vim -vim-scripts/Rename -vim-scripts/ReplaceWithRegister -vim-scripts/ShowMultiBase -vim-scripts/tabmerge -vim-scripts/taglist.vim -vim-scripts/timestamp.vim -vim-scripts/utl.vim -vim-scripts/vis -vim-scripts/wombat256.vim -vim-scripts/YankRing.vim -vim-syntastic/syntastic -vim-test/vim-test -vim-utils/vim-husk -Vimjas/vim-python-pep8-indent -vimlab/split-term.vim -vimoutliner/vimoutliner -vimpostor/vim-tpipeline -vimsence/vimsence -vimwiki/vimwiki -vito-c/jq.vim -vmchale/ats-vim -vmchale/dhall-vim -vmware-archive/salt-vim -vn-ki/coc-clap -voldikss/vim-floaterm -vuki656/package-info.nvim -VundleVim/Vundle.vim -w0ng/vim-hybrid -wakatime/vim-wakatime -wannesm/wmgraphviz.vim -wbthomason/packer.nvim -weilbith/nvim-code-action-menu -wellle/targets.vim -wellle/tmux-complete.vim -wesQ3/vim-windowswap -wfxr/minimap.vim -whonore/Coqtail -will133/vim-dirdiff -wincent/command-t -wincent/ferret -wincent/terminus -windwp/nvim-autopairs -windwp/nvim-ts-autotag -winston0410/cmd-parser.nvim -winston0410/range-highlight.nvim -wlangstroth/vim-racket -wsdjeg/vim-fetch -xavierd/clang_complete -xolox/vim-easytags -xolox/vim-misc -xuhdev/vim-latex-live-preview -Xuyuanp/nerdtree-git-plugin -Xuyuanp/scrollbar.nvim -yamatsum/nvim-cursorline -yamatsum/nvim-nonicons -ycm-core/YouCompleteMe -yegappan/mru -Yggdroot/hiPairs -Yggdroot/indentLine -Yggdroot/LeaderF -Yilin-Yang/vim-markbar -yssl/QFEnter -yuki-yano/ncm2-dictionary -yunlingz/ci_dark -zah/nim.vim -zhou13/vim-easyescape -ziglang/zig.vim +repo,branch,alias +https://github.com/euclidianAce/BetterLua.vim/,, +https://github.com/vim-scripts/BufOnly.vim/,, +https://github.com/chrisbra/CheckAttach/,, +https://github.com/vim-scripts/Colour-Sampler-Pack/,, +https://github.com/whonore/Coqtail/,, +https://github.com/vim-scripts/DoxygenToolkit.vim/,, +https://github.com/numToStr/FTerm.nvim/,, +https://github.com/antoinemadec/FixCursorHold.nvim/,, +https://github.com/vim-scripts/Improved-AnsiEsc/,, +https://github.com/martinda/Jenkinsfile-vim-syntax/,, +https://github.com/autozimu/LanguageClient-neovim/,, +https://github.com/vigoux/LanguageTool.nvim/,, +https://github.com/Yggdroot/LeaderF/,, +https://github.com/Valloric/MatchTagAlways/,, +https://github.com/numToStr/Navigator.nvim/,, +https://github.com/overcache/NeoSolarized/,, +https://github.com/chrisbra/NrrwRgn/,, +https://github.com/vim-scripts/PreserveNoEOL/,, +https://github.com/yssl/QFEnter/,, +https://github.com/chrisbra/Recover.vim/,, +https://github.com/vim-scripts/Rename/,, +https://github.com/vim-scripts/ReplaceWithRegister/,, +https://github.com/b0o/SchemaStore.nvim/,, +https://github.com/sunjon/Shade.nvim/,, +https://github.com/vim-scripts/ShowMultiBase/,, +https://github.com/tmhedberg/SimpylFold/,, +https://github.com/jaredgorski/SpaceCamp/,, +https://github.com/SpaceVim/SpaceVim/,, +https://github.com/ackyshake/Spacegray.vim/,, +https://github.com/chrisbra/SudoEdit.vim/,, +https://github.com/Pocco81/TrueZen.nvim/,, +https://github.com/ackyshake/VimCompletesMe/,, +https://github.com/hsitz/VimOrganizer/,, +https://github.com/VundleVim/Vundle.vim/,, +https://github.com/esneider/YUNOcommit.vim/,, +https://github.com/vim-scripts/YankRing.vim/,, +https://github.com/ycm-core/YouCompleteMe/,, +https://github.com/vim-scripts/a.vim/,, +https://github.com/mileszs/ack.vim/,, +https://github.com/eikenb/acp/,, +https://github.com/stevearc/aerial.nvim/,, +https://github.com/derekelkins/agda-vim/,, +https://github.com/slashmili/alchemist.vim/,, +https://github.com/dense-analysis/ale/,, +https://github.com/vim-scripts/align/,, +https://github.com/Olical/aniseed/,, +https://github.com/pearofducks/ansible-vim/,, +https://github.com/ckarnell/antonys-macro-repeater/,, +https://github.com/solarnz/arcanist.vim/,, +https://github.com/vim-scripts/argtextobj.vim/,, +https://github.com/prabirshrestha/async.vim/,, +https://github.com/prabirshrestha/asyncomplete-lsp.vim/,, +https://github.com/prabirshrestha/asyncomplete.vim/,, +https://github.com/skywind3000/asyncrun.vim/,, +https://github.com/skywind3000/asynctasks.vim/,, +https://github.com/vmchale/ats-vim/,, +https://github.com/ray-x/aurora/,, +https://github.com/hotwatermorning/auto-git-diff/,, +https://github.com/jiangmiao/auto-pairs/,, +https://github.com/rmagatti/auto-session/,, +https://github.com/vim-scripts/autoload_cscope.vim/,, +https://github.com/rafi/awesome-vim-colorschemes/,, +https://github.com/ayu-theme/ayu-vim/,, +https://github.com/romgrk/barbar.nvim/,, +https://github.com/chriskempson/base16-vim/,, +https://github.com/vim-scripts/bats.vim/,, +https://github.com/rbgrouleff/bclose.vim/,, +https://github.com/max397574/better-escape.nvim/,, +https://github.com/sblumentritt/bitbake.vim/,, +https://github.com/blueballs-theme/blueballs-neovim/,, +https://github.com/turbio/bracey.vim/,, +https://github.com/fruit-in/brainfuck-vim/,, +https://github.com/famiu/bufdelete.nvim/,, +https://github.com/jlanzarotta/bufexplorer/,, +https://github.com/akinsho/bufferline.nvim/,, +https://github.com/mattn/calendar-vim/,,mattn-calendar-vim +https://github.com/itchyny/calendar.vim/,, +https://github.com/bkad/camelcasemotion/,, +https://github.com/tyru/caw.vim/,, +https://github.com/ms-jpq/chadtree/,,chad +https://github.com/vim-scripts/changeColorScheme.vim/,, +https://github.com/sudormrfbin/cheatsheet.nvim/,, +https://github.com/yunlingz/ci_dark/,, +https://github.com/projekt0n/circles.nvim/,, +https://github.com/xavierd/clang_complete/,, +https://github.com/rhysd/clever-f.vim/,, +https://github.com/bbchung/clighter8/,, +https://github.com/winston0410/cmd-parser.nvim/,, +https://github.com/hrsh7th/cmp-buffer/,, +https://github.com/hrsh7th/cmp-calc/,, +https://github.com/hrsh7th/cmp-cmdline/,, +https://github.com/PaterJason/cmp-conjure/,, +https://github.com/hrsh7th/cmp-emoji/,, +https://github.com/kdheepak/cmp-latex-symbols/,, +https://github.com/hrsh7th/cmp-nvim-lsp/,, +https://github.com/hrsh7th/cmp-nvim-lsp-document-symbol/,, +https://github.com/hrsh7th/cmp-nvim-lua/,, +https://github.com/quangnguyen30192/cmp-nvim-ultisnips/,, +https://github.com/hrsh7th/cmp-omni/,, +https://github.com/jc-doyle/cmp-pandoc-references/,, +https://github.com/hrsh7th/cmp-path/,, +https://github.com/f3fora/cmp-spell/,, +https://github.com/tzachar/cmp-tabnine/,, +https://github.com/andersevenrud/cmp-tmux/,, +https://github.com/ray-x/cmp-treesitter/,, +https://github.com/lukas-reineke/cmp-under-comparator/,, +https://github.com/hrsh7th/cmp-vsnip/,, +https://github.com/saadparwaiz1/cmp_luasnip/,, +https://github.com/vn-ki/coc-clap/,, +https://github.com/neoclide/coc-denite/,, +https://github.com/antoinemadec/coc-fzf/,, +https://github.com/josa42/coc-lua/,, +https://github.com/neoclide/coc-neco/,, +https://github.com/iamcco/coc-spell-checker/,, +https://github.com/coc-extensions/coc-svelte/,, +https://github.com/iamcco/coc-tailwindcss/,, +https://github.com/neoclide/coc.nvim/,release, +https://github.com/metakirby5/codi.vim/,, +https://github.com/tjdevries/colorbuddy.nvim/,, +https://github.com/lilydjwg/colorizer/,, +https://github.com/wincent/command-t/,, +https://github.com/numtostr/comment.nvim/,, +https://github.com/rhysd/committia.vim/,, +https://github.com/tami5/compe-conjure/,, +https://github.com/GoldsteinE/compe-latex-symbols/,, +https://github.com/tzachar/compe-tabnine/,, +https://github.com/tamago324/compe-zsh/,, +https://github.com/steelsojka/completion-buffers/,, +https://github.com/nvim-lua/completion-nvim/,, +https://github.com/aca/completion-tabnine/,, +https://github.com/nvim-treesitter/completion-treesitter/,, +https://github.com/chikatoike/concealedyank.vim/,, +https://github.com/rhysd/conflict-marker.vim/,, +https://github.com/Olical/conjure/,, +https://github.com/Shougo/context_filetype.vim/,, +https://github.com/github/copilot.vim/,, +https://github.com/jvoorhis/coq.vim/,, +https://github.com/ms-jpq/coq_nvim/,, +https://github.com/lfilho/cosco.vim/,, +https://github.com/nixprime/cpsm/,, +https://github.com/saecki/crates.nvim/,, +https://github.com/godlygeek/csapprox/,, +https://github.com/chrisbra/csv.vim/,, +https://github.com/JazzCore/ctrlp-cmatcher/,, +https://github.com/FelikZ/ctrlp-py-matcher/,, +https://github.com/amiorin/ctrlp-z/,, +https://github.com/ctrlpvim/ctrlp.vim/,, +https://github.com/dart-lang/dart-vim-plugin/,, +https://github.com/glepnir/dashboard-nvim/,, +https://github.com/kristijanhusak/defx-git/,, +https://github.com/kristijanhusak/defx-icons/,, +https://github.com/Shougo/defx.nvim/,, +https://github.com/Raimondi/delimitMate/,, +https://github.com/neoclide/denite-extra/,, +https://github.com/neoclide/denite-git/,, +https://github.com/Shougo/denite.nvim/,, +https://github.com/Shougo/deol.nvim/,, +https://github.com/deoplete-plugins/deoplete-clang/,, +https://github.com/deoplete-plugins/deoplete-dictionary/,, +https://github.com/ponko2/deoplete-fish/,, +https://github.com/SevereOverfl0w/deoplete-github/,, +https://github.com/deoplete-plugins/deoplete-go/,, +https://github.com/Inazuma110/deoplete-greek/,, +https://github.com/deoplete-plugins/deoplete-jedi/,, +https://github.com/JuliaEditorSupport/deoplete-julia/,, +https://github.com/nicoe/deoplete-khard/,, +https://github.com/deoplete-plugins/deoplete-lsp/,, +https://github.com/Valodim/deoplete-notmuch/,, +https://github.com/kristijanhusak/deoplete-phpactor/,, +https://github.com/sebastianmarkow/deoplete-rust/,, +https://github.com/tbodt/deoplete-tabnine/,, +https://github.com/carlitux/deoplete-ternjs/,, +https://github.com/lighttiger2505/deoplete-vim-lsp/,, +https://github.com/deoplete-plugins/deoplete-zsh/,, +https://github.com/Shougo/deoplete.nvim/,, +https://github.com/rhysd/devdocs.vim/,, +https://github.com/vmchale/dhall-vim/,, +https://github.com/onsails/diaglist.nvim/,, +https://github.com/nvim-lua/diagnostic-nvim/,, +https://github.com/sindrets/diffview.nvim/,, +https://github.com/direnv/direnv.vim/,, +https://github.com/doki-theme/doki-theme-vim/,, +https://github.com/stevearc/dressing.nvim/,, +https://github.com/Shougo/echodoc.vim/,, +https://github.com/sainnhe/edge/,, +https://github.com/editorconfig/editorconfig-vim/,, +https://github.com/gpanders/editorconfig.nvim/,, +https://github.com/elmcast/elm-vim/,, +https://github.com/dmix/elvish.vim/,, +https://github.com/mattn/emmet-vim/,, +https://github.com/vim-scripts/emodeline/,, +https://github.com/sainnhe/everforest/,, +https://github.com/fenetikm/falcon/,, +https://github.com/brooth/far.vim/,, +https://github.com/konfekt/fastfold/,, +https://github.com/lilydjwg/fcitx.vim/,fcitx5, +https://github.com/feline-nvim/feline.nvim/,, +https://github.com/bakpakin/fennel.vim/,, +https://github.com/lambdalisue/fern.vim/,, +https://github.com/wincent/ferret/,, +https://github.com/j-hui/fidget.nvim/,, +https://github.com/bogado/file-line/,, +https://github.com/andviro/flake8-vim/,, +https://github.com/ncm2/float-preview.nvim/,, +https://github.com/fhill2/floating.nvim/,, +https://github.com/floobits/floobits-neovim/,, +https://github.com/mhartington/formatter.nvim/,, +https://github.com/megaannum/forms/,, +https://github.com/rafamadriz/friendly-snippets/,, +https://github.com/raghur/fruzzy/,, +https://github.com/shumphrey/fugitive-gitlab.vim/,, +https://github.com/BeneCollyridam/futhark-vim/,, +https://github.com/rktjmp/fwatch.nvim/,, +https://github.com/stsewd/fzf-checkout.vim/,, +https://github.com/gfanto/fzf-lsp.nvim/,, +https://github.com/junegunn/fzf.vim/,, +https://github.com/NTBBloodbath/galaxyline.nvim/,, +https://github.com/jsfaint/gen_tags.vim/,, +https://github.com/gentoo/gentoo-syntax/,, +https://github.com/ndmitchell/ghcid/,, +https://github.com/eagletmt/ghcmod-vim/,, +https://github.com/lambdalisue/gina.vim/,, +https://github.com/f-person/git-blame.nvim/,, +https://github.com/rhysd/git-messenger.vim/,, +https://github.com/ThePrimeagen/git-worktree.nvim/,, +https://github.com/vim-scripts/gitignore.vim/,, +https://github.com/ruifm/gitlinker.nvim/,, +https://github.com/lewis6991/gitsigns.nvim/,, +https://github.com/gregsexton/gitv/,, +https://github.com/gleam-lang/gleam.vim/,, +https://github.com/ellisonleao/glow.nvim/,, +https://github.com/roman/golden-ratio/,, +https://github.com/buoto/gotests-vim/,, +https://github.com/rmagatti/goto-preview/,, +https://github.com/junegunn/goyo.vim/,, +https://github.com/liuchengxu/graphviz.vim/,, +https://github.com/gruvbox-community/gruvbox/,,gruvbox-community +https://github.com/morhetz/gruvbox/,, +https://github.com/eddyekofo94/gruvbox-flat.nvim/,, +https://github.com/sainnhe/gruvbox-material/,, +https://github.com/ellisonleao/gruvbox.nvim/,, +https://github.com/sjl/gundo.vim/,, +https://github.com/junegunn/gv.vim/,, +https://github.com/ThePrimeagen/harpoon/,, +https://github.com/neovimhaskell/haskell-vim/,, +https://github.com/travitch/hasksyn/,, +https://github.com/Yggdroot/hiPairs/,, +https://github.com/mpickering/hlint-refactor-vim/,, +https://github.com/edluffy/hologram.nvim/,, +https://github.com/urbit/hoon.vim/,, +https://github.com/phaazon/hop.nvim/,, +https://github.com/rktjmp/hotpot.nvim/,, +https://github.com/mboughaba/i3config.vim/,, +https://github.com/cocopon/iceberg.vim/,, +https://github.com/idris-hackers/idris-vim/,, +https://github.com/edwinb/idris2-vim/,, +https://github.com/lewis6991/impatient.nvim/,, +https://github.com/nishigori/increment-activator/,, +https://github.com/haya14busa/incsearch-easymotion.vim/,, +https://github.com/haya14busa/incsearch.vim/,, +https://github.com/lukas-reineke/indent-blankline.nvim/,, +https://github.com/Yggdroot/indentLine/,, +https://github.com/ciaranm/inkpot/,, +https://github.com/parsonsmatt/intero-neovim/,, +https://github.com/keith/investigate.vim/,, +https://github.com/neutaaaaan/iosvkem/,, +https://github.com/twerth/ir_black/,, +https://github.com/haya14busa/is.vim/,, +https://github.com/vim-scripts/jdaddy.vim/,, +https://github.com/davidhalter/jedi-vim/,, +https://github.com/metalelf0/jellybeans-nvim/,, +https://github.com/nanotech/jellybeans.vim/,, +https://github.com/vito-c/jq.vim/,, +https://github.com/neoclide/jsonc.vim/,, +https://github.com/JuliaEditorSupport/julia-vim/,, +https://github.com/rebelot/kanagawa.nvim/,, +https://github.com/b3nj5m1n/kommentary/,, +https://github.com/udalov/kotlin-vim/,, +https://github.com/qnighy/lalrpop.vim/,, +https://github.com/sk1418/last256/,, +https://github.com/latex-box-team/latex-box/,, +https://github.com/kdheepak/lazygit.nvim/,, +https://github.com/Julian/lean.nvim/,, +https://github.com/leanprover/lean.vim/,, +https://github.com/camspiers/lens.vim/,, +https://github.com/thirtythreeforty/lessspace.vim/,, +https://github.com/cohama/lexima.vim/,, +https://github.com/ptzz/lf.vim/,, +https://github.com/LucHermitte/lh-brackets/,, +https://github.com/LucHermitte/lh-vim-lib/,, +https://github.com/maximbaz/lightline-ale/,, +https://github.com/mengelbrecht/lightline-bufferline/,, +https://github.com/shinchu/lightline-gruvbox.vim/,, +https://github.com/spywhere/lightline-lsp/,, +https://github.com/itchyny/lightline.vim/,, +https://github.com/ggandor/lightspeed.nvim/,, +https://github.com/junegunn/limelight.vim/,, +https://github.com/lf-lang/lingua-franca.vim/,, +https://github.com/tamago324/lir.nvim/,, +https://github.com/tami5/lispdocs.nvim/,, +https://github.com/ldelossa/litee-calltree.nvim/,, +https://github.com/ldelossa/litee-filetree.nvim/,, +https://github.com/ldelossa/litee-symboltree.nvim/,, +https://github.com/ldelossa/litee.nvim/,, +https://github.com/folke/lsp-colors.nvim/,, +https://github.com/ahmedkhalf/lsp-rooter.nvim/,, +https://github.com/nvim-lua/lsp-status.nvim/,, +https://github.com/nvim-lua/lsp_extensions.nvim/,, +https://git.sr.ht/~whynothugo/lsp_lines.nvim,, +https://github.com/ray-x/lsp_signature.nvim/,, +https://github.com/onsails/lspkind-nvim/,, +https://github.com/tami5/lspsaga.nvim/,, +https://github.com/folke/lua-dev.nvim/,, +https://github.com/arkav/lualine-lsp-progress/,, +https://github.com/nvim-lualine/lualine.nvim/,, +https://github.com/l3mon4d3/luasnip/,, +https://github.com/alvarosevilla95/luatab.nvim/,, +https://github.com/rktjmp/lush.nvim/,, +https://github.com/mkasa/lushtags/,, +https://github.com/iamcco/markdown-preview.nvim/,, +https://github.com/chentau/marks.nvim/,, +https://github.com/vim-scripts/matchit.zip/,, +https://github.com/marko-cerovac/material.nvim/,, +https://github.com/vim-scripts/mayansmoke/,, +https://github.com/echasnovski/mini.nvim/,, +https://github.com/wfxr/minimap.vim/,, +https://github.com/jose-elias-alvarez/minsnip.nvim/,, +https://github.com/jghauser/mkdir.nvim/,main, +https://github.com/SidOfc/mkdx/,, +https://github.com/tomasr/molokai/,, +https://github.com/shaunsingh/moonlight.nvim/,,pure-lua +https://github.com/yegappan/mru/,, +https://github.com/ncm2/ncm2/,, +https://github.com/ncm2/ncm2-bufword/,, +https://github.com/ncm2/ncm2-cssomni/,, +https://github.com/yuki-yano/ncm2-dictionary/,, +https://github.com/ncm2/ncm2-github/,, +https://github.com/ncm2/ncm2-html-subscope/,, +https://github.com/ncm2/ncm2-jedi/,, +https://github.com/ncm2/ncm2-markdown-subscope/,, +https://github.com/ncm2/ncm2-neoinclude/,, +https://github.com/ncm2/ncm2-neosnippet/,, +https://github.com/ncm2/ncm2-path/,, +https://github.com/ncm2/ncm2-syntax/,, +https://github.com/ncm2/ncm2-tagprefix/,, +https://github.com/ncm2/ncm2-tmux/,, +https://github.com/ncm2/ncm2-ultisnips/,, +https://github.com/ncm2/ncm2-vim/,, +https://github.com/eagletmt/neco-ghc/,, +https://github.com/ujihisa/neco-look/,, +https://github.com/Shougo/neco-syntax/,, +https://github.com/Shougo/neco-vim/,, +https://github.com/Shougo/neocomplete.vim/,, +https://github.com/KeitaNakamura/neodark.vim/,, +https://github.com/sbdchd/neoformat/,, +https://github.com/TimUntersberger/neogit/,, +https://github.com/Shougo/neoinclude.vim/,, +https://github.com/neomake/neomake/,, +https://github.com/Shougo/neomru.vim/,, +https://github.com/rafamadriz/neon/,, +https://github.com/nvim-neorg/neorg/,, +https://github.com/karb94/neoscroll.nvim/,, +https://github.com/Shougo/neosnippet-snippets/,, +https://github.com/Shougo/neosnippet.vim/,, +https://github.com/kassio/neoterm/,, +https://github.com/rose-pine/neovim/,main,rose-pine +https://github.com/Shatur/neovim-ayu/,, +https://github.com/cloudhead/neovim-fuzzy/,, +https://github.com/jeffkreeftmeijer/neovim-sensible/,, +https://github.com/Shougo/neoyank.vim/,, +https://github.com/preservim/nerdcommenter/,, +https://github.com/preservim/nerdtree/,, +https://github.com/Xuyuanp/nerdtree-git-plugin/,, +https://github.com/oberblastmeister/neuron.nvim/,, +https://github.com/fiatjaf/neuron.vim/,, +https://github.com/chr4/nginx.vim/,, +https://github.com/EdenEast/nightfox.nvim/,, +https://github.com/zah/nim.vim/,, +https://github.com/tjdevries/nlua.nvim/,, +https://github.com/mcchrish/nnn.vim/,, +https://github.com/arcticicestudio/nord-vim/,master, +https://github.com/shaunsingh/nord.nvim/,, +https://github.com/andersevenrud/nordic.nvim/,, +https://github.com/jlesquembre/nterm.nvim/,, +https://github.com/MunifTanjim/nui.nvim/,main, +https://github.com/jose-elias-alvarez/null-ls.nvim/,, +https://github.com/nacro90/numb.nvim/,, +https://github.com/ChristianChiarulli/nvcode-color-schemes.vim/,, +https://github.com/catppuccin/nvim/,,catppuccin-nvim +https://github.com/nathanmsmith/nvim-ale-diagnostic/,, +https://github.com/windwp/nvim-autopairs/,, +https://github.com/RRethy/nvim-base16/,, +https://github.com/kevinhwang91/nvim-bqf/,, +https://github.com/ojroques/nvim-bufdel/,, +https://github.com/roxma/nvim-cm-racer/,, +https://github.com/hrsh7th/nvim-cmp/,, +https://github.com/weilbith/nvim-code-action-menu/,, +https://github.com/norcalli/nvim-colorizer.lua/,, +https://github.com/terrortylor/nvim-comment/,, +https://github.com/hrsh7th/nvim-compe/,, +https://github.com/roxma/nvim-completion-manager/,, +https://github.com/yamatsum/nvim-cursorline/,, +https://github.com/mfussenegger/nvim-dap/,, +https://github.com/rcarriga/nvim-dap-ui/,, +https://github.com/theHamsta/nvim-dap-virtual-text/,, +https://github.com/allendang/nvim-expand-expr/,, +https://github.com/vijaymarupudi/nvim-fzf/,, +https://github.com/vijaymarupudi/nvim-fzf-commands/,, +https://github.com/sakhnik/nvim-gdb/,, +https://github.com/smiteshp/nvim-gps/,, +https://github.com/Iron-E/nvim-highlite/,, +https://github.com/kevinhwang91/nvim-hlslens/,, +https://github.com/neovimhaskell/nvim-hs.vim/,, +https://github.com/mfussenegger/nvim-jdtls/,, +https://github.com/gennaro-tedesco/nvim-jqx/,, +https://github.com/kosayoda/nvim-lightbulb/,, +https://github.com/josa42/nvim-lightline-lsp/,, +https://github.com/mfussenegger/nvim-lint/,, +https://github.com/jose-elias-alvarez/nvim-lsp-ts-utils/,, +https://github.com/neovim/nvim-lspconfig/,, +https://github.com/RishabhRD/nvim-lsputils/,, +https://github.com/scalameta/nvim-metals/,, +https://github.com/AckslD/nvim-neoclip.lua/,, +https://github.com/yamatsum/nvim-nonicons/,, +https://github.com/rcarriga/nvim-notify/,, +https://github.com/gennaro-tedesco/nvim-peekup/,, +https://github.com/dstein64/nvim-scrollview/,, +https://github.com/ishan9299/nvim-solarized-lua/,, +https://github.com/nvim-pack/nvim-spectre/,, +https://github.com/norcalli/nvim-terminal.lua/,, +https://github.com/kyazdani42/nvim-tree.lua/,, +https://github.com/nvim-treesitter/nvim-treesitter/,, +https://github.com/romgrk/nvim-treesitter-context/,, +https://github.com/eddiebergman/nvim-treesitter-pyfold/,, +https://github.com/nvim-treesitter/nvim-treesitter-refactor/,, +https://github.com/nvim-treesitter/nvim-treesitter-textobjects/,, +https://github.com/windwp/nvim-ts-autotag/,, +https://github.com/joosepalviste/nvim-ts-context-commentstring/,, +https://github.com/p00f/nvim-ts-rainbow/,, +https://github.com/kyazdani42/nvim-web-devicons/,, +https://github.com/AckslD/nvim-whichkey-setup.lua/,, +https://github.com/roxma/nvim-yarp/,, +https://github.com/haringsrob/nvim_context_vt/,, +https://github.com/neovim/nvimdev.nvim/,, +https://github.com/glepnir/oceanic-material/,, +https://github.com/mhartington/oceanic-next/,, +https://github.com/pwntester/octo.nvim/,, +https://github.com/Th3Whit3Wolf/one-nvim/,, +https://github.com/navarasu/onedark.nvim/,, +https://github.com/joshdick/onedark.vim/,, +https://github.com/olimorris/onedarkpro.nvim/,, +https://github.com/sonph/onehalf/,, +https://github.com/tyru/open-browser-github.vim/,, +https://github.com/tyru/open-browser.vim/,, +https://github.com/nvim-orgmode/orgmode/,, +https://github.com/vuki656/package-info.nvim/,, +https://github.com/wbthomason/packer.nvim/,, +https://github.com/drewtempelmeyer/palenight.vim/,, +https://github.com/NLKNguyen/papercolor-theme/,, +https://github.com/tmsvg/pear-tree/,, +https://github.com/steelsojka/pears.nvim/,, +https://github.com/andsild/peskcolor.vim/,, +https://github.com/lifepillar/pgsql.vim/,, +https://github.com/motus/pig.vim/,, +https://github.com/aklt/plantuml-syntax/,, +https://github.com/nvim-treesitter/playground/,, +https://github.com/nvim-lua/plenary.nvim/,, +https://github.com/dleonard0/pony-vim-syntax/,, +https://github.com/RishabhRD/popfix/,, +https://github.com/nvim-lua/popup.nvim/,, +https://github.com/andweeb/presence.nvim/,, +https://github.com/sotte/presenting.vim/,, +https://github.com/vim-scripts/prev_indent/,, +https://github.com/ahmedkhalf/project.nvim/,, +https://github.com/frigoeu/psc-ide-vim/,, +https://github.com/purescript-contrib/purescript-vim/,, +https://github.com/python-mode/python-mode/,, +https://github.com/vim-python/python-syntax/,, +https://github.com/AlphaTechnolog/pywal.nvim/,, +https://github.com/unblevable/quick-scope/,, +https://github.com/stefandtw/quickfix-reflector.vim/,, +https://github.com/dannyob/quickfixstatus/,, +https://github.com/luochen1990/rainbow/,, +https://github.com/kien/rainbow_parentheses.vim/,, +https://github.com/vim-scripts/random.vim/,, +https://github.com/winston0410/range-highlight.nvim/,, +https://github.com/rafaqz/ranger.vim/,, +https://github.com/vim-scripts/rcshell.vim/,, +https://github.com/ryvnf/readline.vim/,, +https://github.com/theprimeagen/refactoring.nvim/,, +https://github.com/tversteeg/registers.nvim/,, +https://github.com/filipdutescu/renamer.nvim/,, +https://github.com/NTBBloodbath/rest.nvim/,, +https://github.com/gu-fan/riv.vim/,, +https://github.com/kevinhwang91/rnvimr/,, +https://github.com/mfukar/robotframework-vim/,, +https://github.com/ron-rs/ron.vim/,, +https://github.com/keith/rspec.vim/,, +https://github.com/ccarpita/rtorrent-syntax-file/,, +https://github.com/simrat39/rust-tools.nvim/,, +https://github.com/rust-lang/rust.vim/,, +https://github.com/hauleth/sad.vim/,, +https://github.com/vmware-archive/salt-vim/,, +https://github.com/Xuyuanp/scrollbar.nvim/,, +https://github.com/RobertAudi/securemodelines/,, +https://github.com/megaannum/self/,, +https://github.com/jaxbot/semantic-highlight.vim/,, +https://github.com/numirias/semshi/,, +https://github.com/junegunn/seoul256.vim/,, +https://github.com/osyo-manga/shabadou.vim/,, +https://github.com/AndrewRadev/sideways.vim/,, +https://github.com/lotabout/skim.vim/,, +https://github.com/mopp/sky-color-clock.vim/,, +https://github.com/kovisoft/slimv/,, +https://github.com/gorkunov/smartpairs.vim/,, +https://github.com/camspiers/snap/,, +https://github.com/norcalli/snippets.nvim/,, +https://github.com/sainnhe/sonokai/,, +https://github.com/chikatoike/sourcemap.vim/,, +https://github.com/liuchengxu/space-vim/,, +https://github.com/ctjhoa/spacevim/,, +https://github.com/chrisgeo/sparkup/,, +https://github.com/edluffy/specs.nvim/,, +https://github.com/sjl/splice.vim/,, +https://github.com/vimlab/split-term.vim/,, +https://github.com/AndrewRadev/splitjoin.vim/,, +https://github.com/tami5/sqlite.lua/,, +https://github.com/srcery-colors/srcery-vim/,, +https://github.com/chr4/sslsecure.vim/,, +https://github.com/luukvbaal/stabilize.nvim/,, +https://github.com/eigenfoo/stan-vim/,, +https://github.com/darfink/starsearch.vim/,, +https://github.com/lambdalisue/suda.vim/,, +https://github.com/ervandew/supertab/,, +https://github.com/ur4ltz/surround.nvim/,, +https://github.com/peterbjorgensen/sved/,, +https://github.com/keith/swift.vim/,, +https://github.com/AndrewRadev/switch.vim/,, +https://github.com/simrat39/symbols-outline.nvim/,, +https://github.com/vim-syntastic/syntastic/,, +https://github.com/kdheepak/tabline.nvim/,, +https://github.com/vim-scripts/tabmerge/,, +https://github.com/codota/tabnine-vim/,, +https://github.com/gcmt/taboo.vim/,, +https://github.com/Shougo/tabpagebuffer.vim/,, +https://github.com/godlygeek/tabular/,, +https://github.com/AndrewRadev/tagalong.vim/,, +https://github.com/preservim/tagbar/,, +https://github.com/vim-scripts/taglist.vim/,, +https://github.com/wellle/targets.vim/,, +https://github.com/tools-life/taskwiki/,, +https://github.com/tomtom/tcomment_vim/,, +https://github.com/GustavoKatel/telescope-asynctasks.nvim/,, +https://github.com/nvim-telescope/telescope-cheat.nvim/,, +https://github.com/fannheyward/telescope-coc.nvim/,, +https://github.com/nvim-telescope/telescope-dap.nvim/,, +https://github.com/nvim-telescope/telescope-file-browser.nvim/,, +https://github.com/nvim-telescope/telescope-frecency.nvim/,, +https://github.com/nvim-telescope/telescope-fzf-native.nvim/,, +https://github.com/nvim-telescope/telescope-fzf-writer.nvim/,, +https://github.com/nvim-telescope/telescope-fzy-native.nvim/,, +https://github.com/nvim-telescope/telescope-github.nvim/,, +https://github.com/gbrlsnchs/telescope-lsp-handlers.nvim/,, +https://github.com/nvim-telescope/telescope-project.nvim/,, +https://github.com/nvim-telescope/telescope-symbols.nvim/,, +https://github.com/nvim-telescope/telescope-ui-select.nvim/,, +https://github.com/fhill2/telescope-ultisnips.nvim/,, +https://github.com/tom-anders/telescope-vim-bookmarks.nvim/,, +https://github.com/nvim-telescope/telescope-z.nvim/,, +https://github.com/jvgrootveld/telescope-zoxide/,, +https://github.com/nvim-telescope/telescope.nvim/,, +https://github.com/jacoborus/tender.vim/,, +https://github.com/wincent/terminus/,, +https://github.com/oberblastmeister/termwrapper.nvim/,, +https://github.com/ternjs/tern_for_vim/,, +https://github.com/KeitaNakamura/tex-conceal.vim/,, +https://github.com/ron89/thesaurus_query.vim/,, +https://github.com/itchyny/thumbnail.vim/,, +https://github.com/vim-scripts/timestamp.vim/,, +https://github.com/tomtom/tlib_vim/,, +https://github.com/wellle/tmux-complete.vim/,, +https://github.com/edkolev/tmuxline.vim/,, +https://github.com/folke/todo-comments.nvim/,, +https://github.com/AmeerTaweel/todo.nvim/,, +https://github.com/freitass/todo.txt-vim/,, +https://github.com/akinsho/toggleterm.nvim/,, +https://github.com/folke/tokyonight.nvim/,, +https://github.com/markonm/traces.vim/,, +https://github.com/tjdevries/train.nvim/,, +https://github.com/tremor-rs/tremor-vim/,, +https://github.com/folke/trouble.nvim/,, +https://github.com/jgdavey/tslime.vim/,, +https://github.com/Quramy/tsuquyomi/,, +https://github.com/folke/twilight.nvim/,, +https://github.com/leafgarland/typescript-vim/,, +https://github.com/SirVer/ultisnips/,, +https://github.com/mbbill/undotree/,, +https://github.com/chrisbra/unicode.vim/,, +https://github.com/Shougo/unite.vim/,, +https://github.com/axieax/urlview.nvim/,, +https://github.com/vim-scripts/utl.vim/,, +https://github.com/KabbAmine/vCoolor.vim/,, +https://github.com/junegunn/vader.vim/,, +https://github.com/jbyuki/venn.nvim/,, +https://github.com/vhda/verilog_systemverilog.vim/,, +https://github.com/vifm/vifm.vim/,, +https://github.com/dracula/vim/,,dracula-vim +https://github.com/embark-theme/vim/,,embark-vim +https://github.com/Konfekt/vim-CtrlXA/,, +https://github.com/konfekt/vim-DetectSpellLang/,, +https://github.com/dpelle/vim-LanguageTool/,, +https://github.com/inkarkat/vim-ReplaceWithRegister/,, +https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/,, +https://github.com/inkarkat/vim-SyntaxRange/,, +https://github.com/tpope/vim-abolish/,, +https://github.com/MarcWeber/vim-addon-actions/,, +https://github.com/MarcWeber/vim-addon-async/,, +https://github.com/MarcWeber/vim-addon-background-cmd/,, +https://github.com/MarcWeber/vim-addon-commenting/,, +https://github.com/MarcWeber/vim-addon-completion/,, +https://github.com/MarcWeber/vim-addon-errorformats/,, +https://github.com/MarcWeber/vim-addon-goto-thing-at-cursor/,, +https://github.com/MarcWeber/vim-addon-local-vimrc/,, +https://github.com/MarcWeber/vim-addon-manager/,, +https://github.com/MarcWeber/vim-addon-mru/,, +https://github.com/MarcWeber/vim-addon-mw-utils/,, +https://github.com/MarcWeber/vim-addon-nix/,, +https://github.com/MarcWeber/vim-addon-other/,, +https://github.com/MarcWeber/vim-addon-php-manual/,, +https://github.com/MarcWeber/vim-addon-signs/,, +https://github.com/MarcWeber/vim-addon-sql/,, +https://github.com/MarcWeber/vim-addon-syntax-checker/,, +https://github.com/MarcWeber/vim-addon-toggle-buffer/,, +https://github.com/MarcWeber/vim-addon-xdebug/,, +https://github.com/junegunn/vim-after-object/,, +https://github.com/vim-airline/vim-airline/,, +https://github.com/enricobacis/vim-airline-clock/,, +https://github.com/vim-airline/vim-airline-themes/,, +https://github.com/Konfekt/vim-alias/,, +https://github.com/hsanson/vim-android/,, +https://github.com/osyo-manga/vim-anzu/,, +https://github.com/ThePrimeagen/vim-apm/,, +https://github.com/PeterRincker/vim-argumentative/,, +https://github.com/FooSoft/vim-argwrap/,, +https://github.com/haya14busa/vim-asterisk/,, +https://github.com/hura/vim-asymptote/,, +https://github.com/907th/vim-auto-save/,, +https://github.com/vim-autoformat/vim-autoformat/,, +https://github.com/benizi/vim-automkdir/,, +https://github.com/gioele/vim-autoswap/,, +https://github.com/bazelbuild/vim-bazel/,, +https://github.com/moll/vim-bbye/,, +https://github.com/nathangrigg/vim-beancount/,, +https://github.com/ntpeters/vim-better-whitespace/,, +https://github.com/MattesGroeger/vim-bookmarks/,, +https://github.com/gyim/vim-boxdraw/,, +https://github.com/ConradIrwin/vim-bracketed-paste/,, +https://github.com/mtikekar/vim-bsv/,, +https://github.com/jeetsukumaran/vim-buffergator/,, +https://github.com/bling/vim-bufferline/,, +https://github.com/qpkorr/vim-bufkill/,, +https://github.com/tpope/vim-capslock/,, +https://github.com/kristijanhusak/vim-carbon-now-sh/,, +https://github.com/m-pilia/vim-ccls/,, +https://github.com/t9md/vim-choosewin/,, +https://github.com/rhysd/vim-clang-format/,, +https://github.com/liuchengxu/vim-clap/,, +https://github.com/guns/vim-clojure-highlight/,, +https://github.com/guns/vim-clojure-static/,, +https://github.com/rstacruz/vim-closer/,, +https://github.com/alvan/vim-closetag/,, +https://github.com/tomasiser/vim-code-dark/,, +https://github.com/google/vim-codefmt/,, +https://github.com/kchmck/vim-coffee-script/,, +https://github.com/kalbasit/vim-colemak/,, +https://github.com/altercation/vim-colors-solarized/,, +https://github.com/flazz/vim-colorschemes/,, +https://github.com/jonbri/vim-colorstepper/,, +https://github.com/tpope/vim-commentary/,, +https://github.com/luan/vim-concourse/,, +https://github.com/romainl/vim-cool/,, +https://github.com/octol/vim-cpp-enhanced-highlight/,, +https://github.com/mhinz/vim-crates/,, +https://github.com/OrangeT/vim-csharp/,, +https://github.com/ap/vim-css-color/,, +https://github.com/jjo/vim-cue/,, +https://github.com/itchyny/vim-cursorword/,, +https://github.com/ehamberg/vim-cute-python/,, +https://github.com/tpope/vim-dadbod/,, +https://github.com/kristijanhusak/vim-dadbod-completion/,, +https://github.com/kristijanhusak/vim-dadbod-ui/,, +https://github.com/sunaku/vim-dasht/,, +https://github.com/ajmwagar/vim-deus/,, +https://github.com/ryanoasis/vim-devicons/,, +https://github.com/blueyed/vim-diminactive/,, +https://github.com/will133/vim-dirdiff/,, +https://github.com/justinmk/vim-dirvish/,, +https://github.com/kristijanhusak/vim-dirvish-git/,, +https://github.com/tpope/vim-dispatch/,, +https://github.com/radenling/vim-dispatch-neovim/,, +https://github.com/jhradilek/vim-docbk/,, +https://github.com/junegunn/vim-easy-align/,, +https://github.com/zhou13/vim-easyescape/,, +https://github.com/neoclide/vim-easygit/,, +https://github.com/easymotion/vim-easymotion/,, +https://github.com/xolox/vim-easytags/,, +https://github.com/justincampbell/vim-eighties/,, +https://github.com/elixir-editors/vim-elixir/,, +https://github.com/andys8/vim-elm-syntax/,, +https://github.com/junegunn/vim-emoji/,, +https://github.com/tpope/vim-endwise/,, +https://github.com/vim-erlang/vim-erlang-compiler/,, +https://github.com/vim-erlang/vim-erlang-omnicomplete/,, +https://github.com/vim-erlang/vim-erlang-runtime/,, +https://github.com/vim-erlang/vim-erlang-tags/,, +https://github.com/tpope/vim-eunuch/,, +https://github.com/tommcdo/vim-exchange/,, +https://github.com/terryma/vim-expand-region/,, +https://github.com/int3/vim-extradite/,, +https://github.com/wsdjeg/vim-fetch/,, +https://github.com/tpope/vim-fireplace/,, +https://github.com/dag/vim-fish/,, +https://github.com/tpope/vim-flagship/,, +https://github.com/nvie/vim-flake8/,, +https://github.com/dcharbon/vim-flatbuffers/,, +https://github.com/voldikss/vim-floaterm/,, +https://github.com/rbong/vim-flog/,, +https://github.com/thosakwe/vim-flutter/,, +https://github.com/fsharp/vim-fsharp/,, +https://github.com/thinca/vim-ft-diff_fold/,, +https://github.com/tommcdo/vim-fubitive/,, +https://github.com/tpope/vim-fugitive/,, +https://github.com/maxjacobson/vim-fzf-coauthorship/,, +https://github.com/ruanyl/vim-gh-line/,, +https://github.com/raghur/vim-ghost/,, +https://github.com/mattn/vim-gist/,, +https://github.com/lambdalisue/vim-gista/,, +https://github.com/tpope/vim-git/,, +https://github.com/itchyny/vim-gitbranch/,, +https://github.com/airblade/vim-gitgutter/,, +https://github.com/junegunn/vim-github-dashboard/,, +https://github.com/tikhomirov/vim-glsl/,, +https://github.com/jamessan/vim-gnupg/,, +https://github.com/fatih/vim-go/,, +https://github.com/rhysd/vim-grammarous/,, +https://github.com/jparise/vim-graphql/,, +https://github.com/mhinz/vim-grepper/,, +https://github.com/lifepillar/vim-gruvbox8/,, +https://github.com/brennanfee/vim-gui-position/,, +https://github.com/ludovicchabant/vim-gutentags/,, +https://github.com/takac/vim-hardtime/,, +https://github.com/chkno/vim-haskell-module-name/,, +https://github.com/enomsg/vim-haskellConcealPlus/,, +https://github.com/twinside/vim-haskellconceal/,, +https://github.com/jvirtanen/vim-hcl/,, +https://github.com/bitc/vim-hdevtools/,, +https://github.com/towolf/vim-helm/,, +https://github.com/RRethy/vim-hexokinase/,, +https://github.com/jceb/vim-hier/,, +https://github.com/machakann/vim-highlightedyank/,, +https://github.com/alx741/vim-hindent/,, +https://github.com/GEverding/vim-hocon/,, +https://github.com/Twinside/vim-hoogle/,, +https://github.com/jonsmithers/vim-html-template-literals/,, +https://github.com/vim-utils/vim-husk/,, +https://github.com/w0ng/vim-hybrid/,, +https://github.com/kristijanhusak/vim-hybrid-material/,, +https://github.com/noc7c9/vim-iced-coffee-script/,, +https://github.com/RRethy/vim-illuminate/,, +https://github.com/nathanaelkane/vim-indent-guides/,, +https://github.com/michaeljsmith/vim-indent-object/,, +https://github.com/jeetsukumaran/vim-indentwise/,, +https://github.com/henrik/vim-indexed-search/,, +https://github.com/ivanov/vim-ipython/,, +https://github.com/fisadev/vim-isort/,, +https://github.com/clojure-vim/vim-jack-in/,, +https://github.com/mhinz/vim-janah/,, +https://github.com/artur-shaik/vim-javacomplete2/,, +https://github.com/pangloss/vim-javascript/,, +https://github.com/jelera/vim-javascript-syntax/,, +https://github.com/lepture/vim-jinja/,, +https://github.com/maksimr/vim-jsbeautify/,, +https://github.com/heavenshell/vim-jsdoc/,, +https://github.com/elzr/vim-json/,, +https://github.com/google/vim-jsonnet/,, +https://github.com/MaxMEllon/vim-jsx-pretty/,, +https://github.com/peitalin/vim-jsx-typescript/,, +https://github.com/knubie/vim-kitty-navigator/,, +https://github.com/farmergreg/vim-lastplace/,, +https://github.com/xuhdev/vim-latex-live-preview/,, +https://github.com/ludovicchabant/vim-lawrencium/,, +https://github.com/hecal3/vim-leader-guide/,, +https://github.com/mk12/vim-lean/,, +https://github.com/ledger/vim-ledger/,, +https://github.com/lfe-support/vim-lfe/,, +https://github.com/josa42/vim-lightline-coc/,, +https://github.com/tommcdo/vim-lion/,, +https://github.com/tpope/vim-liquid/,, +https://github.com/embear/vim-localvimrc/,, +https://github.com/andreshazard/vim-logreview/,, +https://github.com/mlr-msft/vim-loves-dafny/,, +https://github.com/natebosch/vim-lsc/,, +https://github.com/prabirshrestha/vim-lsp/,, +https://github.com/jackguo380/vim-lsp-cxx-highlight/,, +https://github.com/tbastos/vim-lua/,, +https://github.com/google/vim-maktaba/,, +https://github.com/lambdalisue/vim-manpager/,, +https://github.com/Yilin-Yang/vim-markbar/,, +https://github.com/preservim/vim-markdown/,, +https://github.com/euclio/vim-markdown-composer/,, +https://github.com/mzlogin/vim-markdown-toc/,, +https://github.com/andymass/vim-matchup/,, +https://github.com/samoshkin/vim-mergetool/,, +https://github.com/idanarye/vim-merginal/,, +https://github.com/david-a-wheeler/vim-metamath/,, +https://github.com/xolox/vim-misc/,, +https://github.com/crusoexia/vim-monokai/,, +https://github.com/phanviet/vim-monokai-pro/,, +https://github.com/matze/vim-move/,, +https://github.com/lifepillar/vim-mucomplete/,, +https://github.com/terryma/vim-multiple-cursors/,, +https://github.com/simnalamburt/vim-mundo/,, +https://github.com/mustache/vim-mustache-handlebars/,, +https://github.com/tiagofumo/vim-nerdtree-syntax-highlight/,, +https://github.com/jistr/vim-nerdtree-tabs/,, +https://github.com/nfnty/vim-nftables/,, +https://github.com/kana/vim-niceblock/,, +https://github.com/tommcdo/vim-ninja-feet/,, +https://github.com/LnL7/vim-nix/,, +https://github.com/symphorien/vim-nixhash/,, +https://github.com/noahfrederick/vim-noctu/,, +https://github.com/fruit-in/vim-nong-theme/,, +https://github.com/jeffkreeftmeijer/vim-numbertoggle/,, +https://github.com/tpope/vim-obsession/,, +https://github.com/ocaml/vim-ocaml/,, +https://github.com/rakr/vim-one/,, +https://github.com/petRUShka/vim-opencl/,, +https://github.com/kana/vim-operator-replace/,, +https://github.com/rhysd/vim-operator-surround/,, +https://github.com/kana/vim-operator-user/,, +https://github.com/jceb/vim-orgmode/,, +https://github.com/sdiehl/vim-ormolu/,, +https://github.com/fcpg/vim-osc52/,, +https://github.com/ojroques/vim-oscyank/,, +https://github.com/osyo-manga/vim-over/,, +https://github.com/hashivim/vim-packer/,, +https://github.com/lambdalisue/vim-pager/,, +https://github.com/vim-pandoc/vim-pandoc/,, +https://github.com/vim-pandoc/vim-pandoc-after/,, +https://github.com/vim-pandoc/vim-pandoc-syntax/,, +https://github.com/bhurlow/vim-parinfer/,, +https://github.com/sickill/vim-pasta/,, +https://github.com/tpope/vim-pathogen/,, +https://github.com/junegunn/vim-peekaboo/,, +https://github.com/preservim/vim-pencil/,, +https://github.com/jparise/vim-phabricator/,, +https://github.com/justinj/vim-pico8-syntax/,, +https://github.com/junegunn/vim-plug/,, +https://github.com/powerman/vim-plugin-AnsiEsc/,, +https://github.com/sheerun/vim-polyglot/,, +https://github.com/jakwings/vim-pony/,, +https://github.com/haya14busa/vim-poweryank/,, +https://github.com/prettier/vim-prettier/,, +https://github.com/thinca/vim-prettyprint/,, +https://github.com/pantharshit00/vim-prisma/,, +https://github.com/tpope/vim-projectionist/,, +https://github.com/dhruvasagar/vim-prosession/,, +https://github.com/uarun/vim-protobuf/,, +https://github.com/PProvost/vim-ps1/,, +https://github.com/digitaltoad/vim-pug/,, +https://github.com/rodjek/vim-puppet/,, +https://github.com/Vimjas/vim-python-pep8-indent/,, +https://github.com/romainl/vim-qf/,, +https://github.com/romainl/vim-qlist/,, +https://github.com/peterhoeg/vim-qml/,, +https://github.com/thinca/vim-quickrun/,, +https://github.com/racer-rust/vim-racer/,, +https://github.com/wlangstroth/vim-racket/,, +https://github.com/tpope/vim-ragtag/,, +https://github.com/tpope/vim-rails/,, +https://github.com/jordwalke/vim-reasonml/,, +https://github.com/tpope/vim-repeat/,, +https://github.com/tpope/vim-rhubarb/,, +https://github.com/airblade/vim-rooter/,, +https://github.com/tpope/vim-rsi/,, +https://github.com/vim-ruby/vim-ruby/,, +https://github.com/tpope/vim-salve/,, +https://github.com/machakann/vim-sandwich/,, +https://github.com/mhinz/vim-sayonara/,7e774f58c5865d9c10d40396850b35ab95af17c5, +https://github.com/derekwyatt/vim-scala/,, +https://github.com/thinca/vim-scouter/,, +https://github.com/tpope/vim-scriptease/,, +https://github.com/tpope/vim-sensible/,, +https://github.com/guns/vim-sexp/,, +https://github.com/tpope/vim-sexp-mappings-for-regular-people/,, +https://github.com/itspriddle/vim-shellcheck/,, +https://github.com/kshenoy/vim-signature/,, +https://github.com/mhinz/vim-signify/,, +https://github.com/ivalkeen/vim-simpledb/,, +https://github.com/junegunn/vim-slash/,, +https://github.com/tpope/vim-sleuth/,, +https://github.com/jpalardy/vim-slime/,, +https://github.com/mzlogin/vim-smali/,, +https://github.com/t9md/vim-smalls/,, +https://github.com/psliwka/vim-smoothie/,, +https://github.com/bohlender/vim-smt2/,, +https://github.com/justinmk/vim-sneak/,, +https://github.com/garbas/vim-snipmate/,, +https://github.com/honza/vim-snippets/,, +https://github.com/jhradilek/vim-snippets/,,vim-docbk-snippets +https://github.com/tomlion/vim-solidity/,, +https://github.com/christoomey/vim-sort-motion/,, +https://github.com/CoatiSoftware/vim-sourcetrail/,, +https://github.com/tpope/vim-speeddating/,, +https://github.com/kbenzie/vim-spirv/,, +https://github.com/mhinz/vim-startify/,, +https://github.com/dstein64/vim-startuptime/,, +https://github.com/axelf4/vim-strip-trailing-whitespace/,, +https://github.com/nbouscal/vim-stylish-haskell/,, +https://github.com/alx741/vim-stylishask/,, +https://github.com/svermeulen/vim-subversive/,, +https://github.com/tpope/vim-surround/,, +https://github.com/evanleck/vim-svelte/,, +https://github.com/machakann/vim-swap/,, +https://github.com/dhruvasagar/vim-table-mode/,, +https://github.com/kana/vim-tabpagecd/,, +https://github.com/tpope/vim-tbone/,, +https://github.com/hashivim/vim-terraform/,, +https://github.com/juliosueiras/vim-terraform-completion/,, +https://github.com/vim-test/vim-test/,, +https://github.com/glts/vim-textobj-comment/,, +https://github.com/kana/vim-textobj-entire/,, +https://github.com/kana/vim-textobj-function/,, +https://github.com/gibiansky/vim-textobj-haskell/,, +https://github.com/osyo-manga/vim-textobj-multiblock/,, +https://github.com/kana/vim-textobj-user/,, +https://github.com/Julian/vim-textobj-variable-segment/,, +https://github.com/thinca/vim-themis/,, +https://github.com/tmux-plugins/vim-tmux/,, +https://github.com/roxma/vim-tmux-clipboard/,, +https://github.com/tmux-plugins/vim-tmux-focus-events/,, +https://github.com/christoomey/vim-tmux-navigator/,, +https://github.com/milkypostman/vim-togglelist/,, +https://github.com/cespare/vim-toml/,, +https://github.com/vimpostor/vim-tpipeline/,, +https://github.com/bronson/vim-trailing-whitespace/,, +https://github.com/ianks/vim-tsx/,, +https://github.com/lumiliet/vim-twig/,, +https://github.com/sodapopcan/vim-twiggy/,, +https://github.com/rcarriga/vim-ultest/,, +https://github.com/arthurxavierx/vim-unicoder/,, +https://github.com/tpope/vim-unimpaired/,, +https://github.com/hashivim/vim-vagrant/,, +https://github.com/tpope/vim-vinegar/,, +https://github.com/triglav/vim-visual-increment/,, +https://github.com/mg979/vim-visual-multi/,, +https://github.com/thinca/vim-visualstar/,, +https://github.com/hrsh7th/vim-vsnip/,, +https://github.com/hrsh7th/vim-vsnip-integ/,, +https://github.com/posva/vim-vue/,, +https://github.com/wakatime/vim-wakatime/,, +https://github.com/osyo-manga/vim-watchdogs/,, +https://github.com/jasonccox/vim-wayland-clipboard/,, +https://github.com/liuchengxu/vim-which-key/,, +https://github.com/wesQ3/vim-windowswap/,, +https://github.com/chaoren/vim-wordmotion/,, +https://github.com/preservim/vim-wordy/,, +https://github.com/joonty/vim-xdebug/,, +https://github.com/lyokha/vim-xkbswitch/,, +https://github.com/mg979/vim-xtabline/,, +https://github.com/stephpy/vim-yaml/,, +https://github.com/mindriot101/vim-yapf/,, +https://github.com/dag/vim2hs/,, +https://github.com/dominikduda/vim_current_word/,, +https://github.com/andrep/vimacs/,, +https://github.com/TaDaa/vimade/,, +https://github.com/jreybert/vimagit/,, +https://github.com/gotcha/vimelette/,, +https://github.com/Shougo/vimfiler.vim/,, +https://github.com/vimoutliner/vimoutliner/,, +https://github.com/tex/vimpreviewpandoc/,, +https://github.com/Shougo/vimproc.vim/,, +https://github.com/vimsence/vimsence/,, +https://github.com/Shougo/vimshell.vim/,, +https://github.com/puremourning/vimspector/,, +https://github.com/lervag/vimtex/,, +https://github.com/preservim/vimux/,, +https://github.com/vimwiki/vimwiki/,, +https://github.com/vim-scripts/vis/,, +https://github.com/navicore/vissort.vim/,, +https://github.com/liuchengxu/vista.vim/,, +https://github.com/dylanaraps/wal.vim/,, +https://github.com/mattn/webapi-vim/,, +https://github.com/folke/which-key.nvim/,, +https://github.com/gelguy/wilder.nvim/,, +https://github.com/gcmt/wildfire.vim/,, +https://github.com/sindrets/winshift.nvim/,, +https://github.com/wannesm/wmgraphviz.vim/,, +https://github.com/vim-scripts/wombat256.vim/,, +https://github.com/lukaszkorecki/workflowish/,, +https://github.com/tweekmonster/wstrip.vim/,, +https://github.com/drmingdrmer/xptemplate/,, +https://github.com/guns/xterm-color-table.vim/,, +https://github.com/HerringtonDarkholme/yats.vim/,, +https://github.com/KabbAmine/zeavim.vim/,, +https://github.com/folke/zen-mode.nvim/,, +https://github.com/jnurmine/zenburn/,, +https://github.com/glepnir/zephyr-nvim/,, +https://github.com/ziglang/zig.vim/,, +https://github.com/troydm/zoomwintab.vim/,, +https://github.com/nanotee/zoxide.vim/,, diff --git a/pkgs/applications/graphics/apitrace/default.nix b/pkgs/applications/graphics/apitrace/default.nix index f842cf6f5c4..756f0da9f34 100644 --- a/pkgs/applications/graphics/apitrace/default.nix +++ b/pkgs/applications/graphics/apitrace/default.nix @@ -11,6 +11,12 @@ stdenv.mkDerivation rec { owner = "apitrace"; }; + patches = [ + # glibc 2.34 compat + # derived from https://github.com/apitrace/apitrace/commit/d28a980802ad48568c87da02d630c8babfe163bb + ./glibc-2.34-compat.patch + ]; + # LD_PRELOAD wrappers need to be statically linked to work against all kinds # of games -- so it's fine to use e.g. bundled snappy. buildInputs = [ libX11 procps python2 libdwarf qtbase qtwebkit ]; diff --git a/pkgs/applications/graphics/apitrace/glibc-2.34-compat.patch b/pkgs/applications/graphics/apitrace/glibc-2.34-compat.patch new file mode 100644 index 00000000000..3f8cebe030c --- /dev/null +++ b/pkgs/applications/graphics/apitrace/glibc-2.34-compat.patch @@ -0,0 +1,13 @@ +diff --git a/wrappers/dlsym.cpp b/wrappers/dlsym.cpp +index 2eda082..0c0c8ee 100644 +--- a/wrappers/dlsym.cpp ++++ b/wrappers/dlsym.cpp +@@ -34,7 +34,7 @@ + #include "os.hpp" + + +-#ifdef __GLIBC__ ++#if defined(__GLIBC__) && __GLIBC__ == 2 && __GLIBC_MINOR__ < 34 + + + #include <dlfcn.h> diff --git a/pkgs/applications/graphics/imgbrd-grabber/default.nix b/pkgs/applications/graphics/imgbrd-grabber/default.nix index 59d1e6817bd..b9f838c016f 100644 --- a/pkgs/applications/graphics/imgbrd-grabber/default.nix +++ b/pkgs/applications/graphics/imgbrd-grabber/default.nix @@ -33,12 +33,12 @@ stdenv.mkDerivation rec { buildInputs = [ openssl - makeWrapper libpulseaudio typescript ]; nativeBuildInputs = [ + makeWrapper qtmultimedia qtbase qtdeclarative diff --git a/pkgs/applications/graphics/jpegrescan/default.nix b/pkgs/applications/graphics/jpegrescan/default.nix index 1a7320bf693..f96742e6c06 100644 --- a/pkgs/applications/graphics/jpegrescan/default.nix +++ b/pkgs/applications/graphics/jpegrescan/default.nix @@ -28,8 +28,12 @@ stdenv.mkDerivation rec { propagatedBuildInputs = [ perlPackages.FileSlurp ]; + nativeBuildInputs = [ + makeWrapper + ]; + buildInputs = [ - perl libjpeg_turbo makeWrapper + perl libjpeg_turbo ]; meta = with lib; { diff --git a/pkgs/applications/graphics/shotwell/default.nix b/pkgs/applications/graphics/shotwell/default.nix index 56d41d3dd50..098d330f004 100644 --- a/pkgs/applications/graphics/shotwell/default.nix +++ b/pkgs/applications/graphics/shotwell/default.nix @@ -41,11 +41,11 @@ stdenv.mkDerivation rec { pname = "shotwell"; - version = "0.30.14"; + version = "0.30.15"; src = fetchurl { url = "mirror://gnome/sources/${pname}/${lib.versions.majorMinor version}/${pname}-${version}.tar.xz"; - sha256 = "sha256-McLkgzkI02GcssNnWgXw2lnCuqduKLkFOF/VbADBKJU="; + sha256 = "sha256-OlKtYLEC2g31902wMcRdTM8mNRPJVGFu4WZL9PTpvck="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/graphics/synfigstudio/default.nix b/pkgs/applications/graphics/synfigstudio/default.nix index 2b9fee974b3..57f35602336 100644 --- a/pkgs/applications/graphics/synfigstudio/default.nix +++ b/pkgs/applications/graphics/synfigstudio/default.nix @@ -103,10 +103,10 @@ stdenv.mkDerivation { preConfigure = "./bootstrap.sh"; - nativeBuildInputs = [ pkg-config autoreconfHook gettext ]; + nativeBuildInputs = [ pkg-config autoreconfHook gettext makeWrapper ]; buildInputs = [ ETL boost cairo glibmm gtk3 gtkmm3 imagemagick intltool - libjack2 libsigcxx libxmlxx makeWrapper mlt-qt5 + libjack2 libsigcxx libxmlxx mlt-qt5 synfig which gnome.adwaita-icon-theme ]; diff --git a/pkgs/applications/kde/fetch.sh b/pkgs/applications/kde/fetch.sh index 72b76131f64..a24ef563f3e 100644 --- a/pkgs/applications/kde/fetch.sh +++ b/pkgs/applications/kde/fetch.sh @@ -1 +1 @@ -WGET_ARGS=( https://download.kde.org/stable/release-service/21.12.2/src -A '*.tar.xz' ) +WGET_ARGS=( https://download.kde.org/stable/release-service/21.12.3/src -A '*.tar.xz' ) diff --git a/pkgs/applications/kde/kitinerary.nix b/pkgs/applications/kde/kitinerary.nix index 83763ba965a..f69e705bb2f 100644 --- a/pkgs/applications/kde/kitinerary.nix +++ b/pkgs/applications/kde/kitinerary.nix @@ -1,4 +1,4 @@ -{ mkDerivation, fetchpatch, lib, extra-cmake-modules +{ mkDerivation, lib, extra-cmake-modules , qtdeclarative, ki18n, kmime, kpkpass , poppler, kcontacts, kcalendarcore , shared-mime-info @@ -10,15 +10,6 @@ mkDerivation { license = with lib.licenses; [ lgpl21 ]; maintainers = [ lib.maintainers.bkchr ]; }; - - patches = [ - # Fix build with poppler 22.03 - (fetchpatch { - url = "https://github.com/KDE/kitinerary/commit/e21d1ffc5fa81a636245f49c97fe7cda63abbb1d.patch"; - sha256 = "1/zgq9QIOCPplqplDqgpoqzuYFf/m1Ixxawe50t2F04="; - }) - ]; - nativeBuildInputs = [ extra-cmake-modules shared-mime-info # for update-mime-database diff --git a/pkgs/applications/kde/srcs.nix b/pkgs/applications/kde/srcs.nix index af8e47dd749..3d5948c290d 100644 --- a/pkgs/applications/kde/srcs.nix +++ b/pkgs/applications/kde/srcs.nix @@ -4,1843 +4,1843 @@ { akonadi = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadi-21.12.2.tar.xz"; - sha256 = "1i1q8zda3hl564w02478wyqv35wj8npkqayy7b13shkq9b9j3nj8"; - name = "akonadi-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadi-21.12.3.tar.xz"; + sha256 = "026srxk7da20vfhbj7jh8aip3sylpm61czwblj3wxxps0vbxxs2g"; + name = "akonadi-21.12.3.tar.xz"; }; }; akonadi-calendar = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadi-calendar-21.12.2.tar.xz"; - sha256 = "001ndvgqn6x70s7gdya1f1vr080mfkypam3k6z0i2ivlpymc3wly"; - name = "akonadi-calendar-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadi-calendar-21.12.3.tar.xz"; + sha256 = "0hzy6y9pxa06k0pp5yr84i0sv15qgzjn7nrlmsylm6iy7fspqqbq"; + name = "akonadi-calendar-21.12.3.tar.xz"; }; }; akonadi-calendar-tools = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadi-calendar-tools-21.12.2.tar.xz"; - sha256 = "0f0l6wj3h2afbmvnq60cg0x03a412849dg4l9dwgdn8yxvnxkhw6"; - name = "akonadi-calendar-tools-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadi-calendar-tools-21.12.3.tar.xz"; + sha256 = "1idh6kf8h9158rgw3b5lld7z9mvvif00jrvpz891cziblvr19p4a"; + name = "akonadi-calendar-tools-21.12.3.tar.xz"; }; }; akonadi-contacts = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadi-contacts-21.12.2.tar.xz"; - sha256 = "1aq81569kz529n66dl5jjzamy6kxw0xk5bcmjfvb3wpxznhiigqm"; - name = "akonadi-contacts-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadi-contacts-21.12.3.tar.xz"; + sha256 = "04ixj09s27q8pbmfrb1475bc0h84sb5ikfxzpc4i5b3whx40g9dm"; + name = "akonadi-contacts-21.12.3.tar.xz"; }; }; akonadi-import-wizard = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadi-import-wizard-21.12.2.tar.xz"; - sha256 = "0b4mphxbqzf3akhafxc4fvil83l3z4qcf8xnblw23ficqqs8s0di"; - name = "akonadi-import-wizard-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadi-import-wizard-21.12.3.tar.xz"; + sha256 = "1fbxx53zdcqp98mzdx45ccncppnxqfhc7j9qwwxcik0ygrmg9wcj"; + name = "akonadi-import-wizard-21.12.3.tar.xz"; }; }; akonadi-mime = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadi-mime-21.12.2.tar.xz"; - sha256 = "1nd6bf26lb5wfhzh4kn37iwmb6savcq9wsaph5c7jg6m0bdix1fn"; - name = "akonadi-mime-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadi-mime-21.12.3.tar.xz"; + sha256 = "1bcrbf5z9175p206cvm5s6zq882nb32cf9akdcbnadqiibrpxkxv"; + name = "akonadi-mime-21.12.3.tar.xz"; }; }; akonadi-notes = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadi-notes-21.12.2.tar.xz"; - sha256 = "1s3bxnqsjnlgsnia0nvqyc3m1ppzanzna9598lgwbmz053rgn7ck"; - name = "akonadi-notes-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadi-notes-21.12.3.tar.xz"; + sha256 = "0xkcw9izgxfzglciig2i4wiz6iflzjg0d6dp1nq6p1kwxwc899sb"; + name = "akonadi-notes-21.12.3.tar.xz"; }; }; akonadi-search = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadi-search-21.12.2.tar.xz"; - sha256 = "1hp2x8y59azl59znrqhrjn4n1bs2iqnkdsldv1f2k1ima6z5f4qy"; - name = "akonadi-search-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadi-search-21.12.3.tar.xz"; + sha256 = "1id6zzjxc9zvpz1ryj2zn1yff5ak04r1mlk9cklbj99frzf0wv6p"; + name = "akonadi-search-21.12.3.tar.xz"; }; }; akonadiconsole = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akonadiconsole-21.12.2.tar.xz"; - sha256 = "1rqfmhi1mzh6yzjg7jf6adf1xqvpbhcxgld2pp4rd9g5mi9rlxlk"; - name = "akonadiconsole-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akonadiconsole-21.12.3.tar.xz"; + sha256 = "1chb0ars9w05pq6ij2l8qfj1ac7pmzwg2mq1i4z8syhdklyryir1"; + name = "akonadiconsole-21.12.3.tar.xz"; }; }; akregator = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/akregator-21.12.2.tar.xz"; - sha256 = "1srsm25qvbww0hl7r878n32b71g0p222zxyys7chzrg8izrh12b8"; - name = "akregator-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/akregator-21.12.3.tar.xz"; + sha256 = "1yy5c29zxpli4cddknmdvjkgii3j7pvw6lhwqfrqjc8jh83gm8f8"; + name = "akregator-21.12.3.tar.xz"; }; }; analitza = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/analitza-21.12.2.tar.xz"; - sha256 = "1ak2wyfx67cwx85d5053f6flxwas973mhnm25mf4jw0qll72vid4"; - name = "analitza-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/analitza-21.12.3.tar.xz"; + sha256 = "0rgims4c80nficibg3lh764csh0kjsfnf7h303kyfd9yk59xa3in"; + name = "analitza-21.12.3.tar.xz"; }; }; ark = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ark-21.12.2.tar.xz"; - sha256 = "1g05lyv8ll85myw0i62bxr4kmfd3dhldvmbgpgym9r1rgan12q90"; - name = "ark-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ark-21.12.3.tar.xz"; + sha256 = "1p30bgnb3aw0f2jnaksz7jfqqcz45b2x3bjrri0w5w580204a5s8"; + name = "ark-21.12.3.tar.xz"; }; }; artikulate = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/artikulate-21.12.2.tar.xz"; - sha256 = "1g0h0dqqsf3x8q292hfhrizl9dlqzm8gjynzcyrzx0gvbfadj2l1"; - name = "artikulate-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/artikulate-21.12.3.tar.xz"; + sha256 = "0fbgmd3yfyv1pzz24874a0v7cl4yk6wlfryn8sn21smi054wqz6z"; + name = "artikulate-21.12.3.tar.xz"; }; }; audiocd-kio = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/audiocd-kio-21.12.2.tar.xz"; - sha256 = "07nk060vkyn94ihs9v054zhsckfwpn8z911gy3hnyf1wdmnpfh2n"; - name = "audiocd-kio-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/audiocd-kio-21.12.3.tar.xz"; + sha256 = "1alyn7w0v1by3fkb6xfnwj0hayjrrnmwnajnrnpvn8skbqsbzlgc"; + name = "audiocd-kio-21.12.3.tar.xz"; }; }; baloo-widgets = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/baloo-widgets-21.12.2.tar.xz"; - sha256 = "1ax7pak9qb60yzdca8frkb8qs4khs6f2wbkwyb48s7zmdxqyw1bj"; - name = "baloo-widgets-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/baloo-widgets-21.12.3.tar.xz"; + sha256 = "0cfcfmsgbaxi53a3r0f013lskm5yll7zaxw98nlj6r8fsq2slrhv"; + name = "baloo-widgets-21.12.3.tar.xz"; }; }; blinken = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/blinken-21.12.2.tar.xz"; - sha256 = "0h0nw79zr891f54y2r3d3n837bzn24pfvkxsab1f0a228kjakw09"; - name = "blinken-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/blinken-21.12.3.tar.xz"; + sha256 = "1pbwb7q4p705k31kd62gira0x9qccjsn07d6h1w44wydc3lfdjnc"; + name = "blinken-21.12.3.tar.xz"; }; }; bomber = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/bomber-21.12.2.tar.xz"; - sha256 = "1348mdiykfg1c3gr5fkcf71mxf7lyapwg5ym3jqp9vyc56vhwfjs"; - name = "bomber-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/bomber-21.12.3.tar.xz"; + sha256 = "1mlxs2dbsycq7mw9g1hl2l17gl0z33mrry5r0zmz74i67nfijg8w"; + name = "bomber-21.12.3.tar.xz"; }; }; bovo = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/bovo-21.12.2.tar.xz"; - sha256 = "0i2i5ici9v402lrh83mhfsrxmqi0fs75rkfvhsbza3wab7b165kc"; - name = "bovo-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/bovo-21.12.3.tar.xz"; + sha256 = "1jzvazqy5vcwkyhnbzw7sh8ngff5clclq98vbbhzd9dmnacirdbq"; + name = "bovo-21.12.3.tar.xz"; }; }; calendarsupport = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/calendarsupport-21.12.2.tar.xz"; - sha256 = "021rr06ln7l0v2xjzsij4r71jwpy1w1r761bjad0ywprwkdc93bm"; - name = "calendarsupport-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/calendarsupport-21.12.3.tar.xz"; + sha256 = "0annni037cp1ga2lj2gkjxlkygnaxna4fs095lbaqp5zljz3g8vp"; + name = "calendarsupport-21.12.3.tar.xz"; }; }; cantor = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/cantor-21.12.2.tar.xz"; - sha256 = "0vq8yvdglf43y5r2f9bvamm9bp82q92hw9sr8xmgb5hqz5mkap78"; - name = "cantor-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/cantor-21.12.3.tar.xz"; + sha256 = "0v0xcgaz3rag044wmpiq8gs7pp6n7wcca0q1hzav7i651pgqjjks"; + name = "cantor-21.12.3.tar.xz"; }; }; cervisia = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/cervisia-21.12.2.tar.xz"; - sha256 = "1vpm3cjknpa4s9mjdfngpvidqihfh5sb427yhnydr1q2dmllr9nn"; - name = "cervisia-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/cervisia-21.12.3.tar.xz"; + sha256 = "106x0xrscc6xvgijmqy892r1hrirjh32nj8lqhc7g7dzjaa7lhsj"; + name = "cervisia-21.12.3.tar.xz"; }; }; dolphin = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/dolphin-21.12.2.tar.xz"; - sha256 = "0c0gk1djgl1d1qzibw5f1w29cnlxl6kan8pkg0izaqvnbmmx53wn"; - name = "dolphin-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/dolphin-21.12.3.tar.xz"; + sha256 = "0m5nqa8j0mcsrx9wxfcf8z39kxas51k03lschr721vm4x65j64jq"; + name = "dolphin-21.12.3.tar.xz"; }; }; dolphin-plugins = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/dolphin-plugins-21.12.2.tar.xz"; - sha256 = "1mrsampq1zq5rri1kx77dz0afz4a6s8pvb1255q0pl7imgxhiaqc"; - name = "dolphin-plugins-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/dolphin-plugins-21.12.3.tar.xz"; + sha256 = "0rbz6fw98c71h10ry1xjc0pgzvphajmj18lnjm4hf7bbrizsmdb5"; + name = "dolphin-plugins-21.12.3.tar.xz"; }; }; dragon = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/dragon-21.12.2.tar.xz"; - sha256 = "07zn4ishffh9g8hvkpfgm7j9cimw3plcabzk9p157nhgxr62z4sb"; - name = "dragon-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/dragon-21.12.3.tar.xz"; + sha256 = "09iwwlbv4jmxs92dz20z9fqg1sfnqih54izz8459ibl8vydfgfp1"; + name = "dragon-21.12.3.tar.xz"; }; }; elisa = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/elisa-21.12.2.tar.xz"; - sha256 = "0zwy0bi4s25y6adgjhrhw992i2c1kjwpgvp9yg902h8zpsdynwh5"; - name = "elisa-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/elisa-21.12.3.tar.xz"; + sha256 = "0cg9v438fclqnv1rgx2k86mzfp5ggfcp7d5kr8xh4kjbmy17rzca"; + name = "elisa-21.12.3.tar.xz"; }; }; eventviews = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/eventviews-21.12.2.tar.xz"; - sha256 = "1v3bpd0b3ph7v0kg8pyp4rr4j8cxy7y4csym5dlqn6l81db7d3gr"; - name = "eventviews-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/eventviews-21.12.3.tar.xz"; + sha256 = "01x9ccwspn1dwkmcxcr8p6pazj6w31pxhx0bzlfr6bgpccicp2w2"; + name = "eventviews-21.12.3.tar.xz"; }; }; ffmpegthumbs = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ffmpegthumbs-21.12.2.tar.xz"; - sha256 = "17cyrimlnf1npffmxinnj3q5ynqg3agx35b55iqnw3xixrz4snzr"; - name = "ffmpegthumbs-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ffmpegthumbs-21.12.3.tar.xz"; + sha256 = "0x2gpx30azkz61p3xj1nm7hckyrmyh0qhs29ah30z6a5xw7336ws"; + name = "ffmpegthumbs-21.12.3.tar.xz"; }; }; filelight = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/filelight-21.12.2.tar.xz"; - sha256 = "0khhwnms2ysy9ijpmmagm68w1zixmxs7svaaldd30xb3w52f78v2"; - name = "filelight-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/filelight-21.12.3.tar.xz"; + sha256 = "1w3q0l9p5ry2crwdzcyb1d4ms2y4gp3y0a3j5drpy8clmxn0gz18"; + name = "filelight-21.12.3.tar.xz"; }; }; granatier = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/granatier-21.12.2.tar.xz"; - sha256 = "0j7yizbljqx1a4wd4prmb3463r67f3lk5gv5x8j1yx2zmiaq0qki"; - name = "granatier-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/granatier-21.12.3.tar.xz"; + sha256 = "16yriharl66frglmdy6750nixczh0l4c19nnr6dav15m8qfb3g6b"; + name = "granatier-21.12.3.tar.xz"; }; }; grantlee-editor = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/grantlee-editor-21.12.2.tar.xz"; - sha256 = "0wxkg56s83i61i17cb2y6ziminaq2gammynrwm5jvkpi5vqwvi2s"; - name = "grantlee-editor-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/grantlee-editor-21.12.3.tar.xz"; + sha256 = "00qy1ncgwylc995g051x5l679s16wjpcj7il62ck7d0j02rah0n2"; + name = "grantlee-editor-21.12.3.tar.xz"; }; }; grantleetheme = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/grantleetheme-21.12.2.tar.xz"; - sha256 = "0z1p0s7fakfbscppmrgp1irf3dm2ayadyd3yb5zdsr9xahs0b9md"; - name = "grantleetheme-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/grantleetheme-21.12.3.tar.xz"; + sha256 = "1w83slbkj2y1wk78srq2k95ybs66sb4mbaa0zm7fl9pkwhqxbnb7"; + name = "grantleetheme-21.12.3.tar.xz"; }; }; gwenview = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/gwenview-21.12.2.tar.xz"; - sha256 = "1jkv34llga981dq08npk8alrg9h27prdpffcxkm368i77mvp9hv6"; - name = "gwenview-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/gwenview-21.12.3.tar.xz"; + sha256 = "0zbsyrwlwbc9zmdxcgk02dvcb0f8izhlcbbzqw8cgr4l2c90xl98"; + name = "gwenview-21.12.3.tar.xz"; }; }; incidenceeditor = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/incidenceeditor-21.12.2.tar.xz"; - sha256 = "151jhn84d5amv3abvp6cd2q10mf4mmv3q5hn0inqrmapy3v6bn8i"; - name = "incidenceeditor-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/incidenceeditor-21.12.3.tar.xz"; + sha256 = "1sbflfggpqhwhg3iw46462z3p83sjhlx6f1fvgz251m020vqq9xa"; + name = "incidenceeditor-21.12.3.tar.xz"; }; }; itinerary = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/itinerary-21.12.2.tar.xz"; - sha256 = "02w6696kdzgz2r9677nr1jyhd9mfhc2zhmasy70nblz0jn22bcq7"; - name = "itinerary-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/itinerary-21.12.3.tar.xz"; + sha256 = "0gvkhwnxichvpwrsb6wjiv5q80v8k2yqvgpvfdapxnd7sx6qp7fp"; + name = "itinerary-21.12.3.tar.xz"; }; }; juk = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/juk-21.12.2.tar.xz"; - sha256 = "1qgxpy1ksrgvdik69vppzdl1crscn69284q4wvwc5qh9v6rhv1xn"; - name = "juk-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/juk-21.12.3.tar.xz"; + sha256 = "1ipzx031996h83f9w3fzbx5vf5nnskq9kf71a6aypqckk65vcqcs"; + name = "juk-21.12.3.tar.xz"; }; }; k3b = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/k3b-21.12.2.tar.xz"; - sha256 = "0rjg3zs85gw62r3z3msp438jnf0ghc6y577br59ig19m10x33rz9"; - name = "k3b-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/k3b-21.12.3.tar.xz"; + sha256 = "0igqb6zw76j2hl9xclcwfny2831phdg9s2msa1y87zyc3c7g9nxc"; + name = "k3b-21.12.3.tar.xz"; }; }; kaccounts-integration = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kaccounts-integration-21.12.2.tar.xz"; - sha256 = "0c4yxrhbas0wsmrxr0pwkpgw9gzdvvf5r5nxd15f656bwwhmqlwy"; - name = "kaccounts-integration-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kaccounts-integration-21.12.3.tar.xz"; + sha256 = "13q4d7ln98vdpb6ryk49zakx5bysdnjxifi7cma10fgk9gcqqhpb"; + name = "kaccounts-integration-21.12.3.tar.xz"; }; }; kaccounts-providers = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kaccounts-providers-21.12.2.tar.xz"; - sha256 = "1srz43xf6kz7xfz8np94pdnhmvashk7y2f2a275rwpnlrl0yw1yd"; - name = "kaccounts-providers-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kaccounts-providers-21.12.3.tar.xz"; + sha256 = "0kcyvpa0b872q7s4amagqcrzpl8cxlb91nwc9yg91wg56mmfv7m0"; + name = "kaccounts-providers-21.12.3.tar.xz"; }; }; kaddressbook = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kaddressbook-21.12.2.tar.xz"; - sha256 = "04ac5z9603lxylc6x55chnc0w59mx3z92nyvfnvjvp1ga77si36b"; - name = "kaddressbook-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kaddressbook-21.12.3.tar.xz"; + sha256 = "1hzq0fdy99l1kqw14d582l0s56gvrw86abihib6k4az4c6g3c0md"; + name = "kaddressbook-21.12.3.tar.xz"; }; }; kajongg = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kajongg-21.12.2.tar.xz"; - sha256 = "04s3f8nj0rh1zy7sfa5kq0smbfsyylz9w3lxm2z69g7x5sb08k53"; - name = "kajongg-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kajongg-21.12.3.tar.xz"; + sha256 = "1sffssfpzsd83ippkwpmqdx8rfh9cpd7i22nsv8asnaylylvy3zd"; + name = "kajongg-21.12.3.tar.xz"; }; }; kalarm = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kalarm-21.12.2.tar.xz"; - sha256 = "0f3hcsql20lim9nqb0ha5lpsrbh131rwcla9i6aax5sgw4m6nyfh"; - name = "kalarm-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kalarm-21.12.3.tar.xz"; + sha256 = "1miwcxim46hiabp2rbs874np544ip4x5nl1dc62h9li9784a9k3i"; + name = "kalarm-21.12.3.tar.xz"; }; }; kalarmcal = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kalarmcal-21.12.2.tar.xz"; - sha256 = "15l893iv4smlppk7k682m9hwrph84p5chx5mgxixjxl28c1blcc8"; - name = "kalarmcal-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kalarmcal-21.12.3.tar.xz"; + sha256 = "160pmr702b68hys9l02azvrv6pagy1r2whw0zp3jlf6863p9fkqr"; + name = "kalarmcal-21.12.3.tar.xz"; }; }; kalgebra = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kalgebra-21.12.2.tar.xz"; - sha256 = "0w1h3as6dip4hrp2ay61sz9gixf4s887jp42v7zjajwwhjs6xs1m"; - name = "kalgebra-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kalgebra-21.12.3.tar.xz"; + sha256 = "0870kdqha0nk2cm8hq8d9l2fqfw6hn0rx2qc9f9w8l4014rcn127"; + name = "kalgebra-21.12.3.tar.xz"; }; }; kalzium = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kalzium-21.12.2.tar.xz"; - sha256 = "0kvrmvd2vgl6fklxq9sr46p6nnh0fk0l6licj9b5q9rz82xwbr50"; - name = "kalzium-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kalzium-21.12.3.tar.xz"; + sha256 = "1qha1dh638ms785j1b73j19pj8y3c7v1n4jd1m93026a292m8jll"; + name = "kalzium-21.12.3.tar.xz"; }; }; kamera = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kamera-21.12.2.tar.xz"; - sha256 = "07n1xlmg7m6p5ca0i4hjjyv564cqrn4p6h5yqx4pw3pcq8nizqfz"; - name = "kamera-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kamera-21.12.3.tar.xz"; + sha256 = "1xwxmlnra9qdhvf1hhy04v72ar02pqxkg0l16a53809ilyss2wrm"; + name = "kamera-21.12.3.tar.xz"; }; }; kamoso = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kamoso-21.12.2.tar.xz"; - sha256 = "09qn1px0mmcjhw9ikaz8xcjbdabh657ij3sa4ps37jbfzyyv45fb"; - name = "kamoso-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kamoso-21.12.3.tar.xz"; + sha256 = "1q98f6ni4p19pk0svbfw4mbfwnc9i5p9csms2aj76mp2dn78xpib"; + name = "kamoso-21.12.3.tar.xz"; }; }; kanagram = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kanagram-21.12.2.tar.xz"; - sha256 = "1l4j2fy8mwdywp0prswng1f06rpwkfi54dc8z5z02b13p47hz5cy"; - name = "kanagram-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kanagram-21.12.3.tar.xz"; + sha256 = "131flw9pjvin4w1m36qkwgzna3llvxp1vq0ynzwfnvhs49i3g5gc"; + name = "kanagram-21.12.3.tar.xz"; }; }; kapman = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kapman-21.12.2.tar.xz"; - sha256 = "0n1iz9jfgzpcpavb4ijfqp3hym7z53wzp5a5hiad8i6nws408grn"; - name = "kapman-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kapman-21.12.3.tar.xz"; + sha256 = "1974z7g3ylvf48xh3xhf3gr7iphgmj83ir9hss1a2ba0hpgg463k"; + name = "kapman-21.12.3.tar.xz"; }; }; kapptemplate = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kapptemplate-21.12.2.tar.xz"; - sha256 = "1sjyji533x9ph9l63zf0llsb0m5fzb1lka03h5blm7fdyw570bad"; - name = "kapptemplate-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kapptemplate-21.12.3.tar.xz"; + sha256 = "16jgybcq3ixqwi7wli11ns7w4zdlj8rgw4chzsjcqxn6c0sqy8zq"; + name = "kapptemplate-21.12.3.tar.xz"; }; }; kate = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kate-21.12.2.tar.xz"; - sha256 = "0r59rfyrbs50w9brl4rrq1wdfmrr3sz7plw2pqlc5xpzngrdlhs1"; - name = "kate-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kate-21.12.3.tar.xz"; + sha256 = "1pp0k00kvih0xkkv1q1gha4na2bwqc7dhyyrla7c2vvln8gi99dg"; + name = "kate-21.12.3.tar.xz"; }; }; katomic = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/katomic-21.12.2.tar.xz"; - sha256 = "123ls2p6az9bpy741xg85azs0p1qbssgcg4fh8cqazkz0kgzr0hf"; - name = "katomic-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/katomic-21.12.3.tar.xz"; + sha256 = "1y4mnvkd6ajk0m0j2xph5zbw3a14clm2sswc4y8c9r4ipk3hqsgh"; + name = "katomic-21.12.3.tar.xz"; }; }; kbackup = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kbackup-21.12.2.tar.xz"; - sha256 = "1yadxlqfz2a4lirxf2xmivggvdpbjiaw5zn7aw72jb3yjs7x6j03"; - name = "kbackup-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kbackup-21.12.3.tar.xz"; + sha256 = "0r1cqkfzpdqpwv5pds8l0p7lxlwpv0mr7rjys1icsp8gl4hbpv60"; + name = "kbackup-21.12.3.tar.xz"; }; }; kblackbox = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kblackbox-21.12.2.tar.xz"; - sha256 = "1y5l5l5p3s2gf69rih3mjdv42h9ydfk66v10ad5na3b4sqbi2qi7"; - name = "kblackbox-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kblackbox-21.12.3.tar.xz"; + sha256 = "10j8rnpr3gjaqspx4mxqj9cncqj6v2jn5rkldr46bv7yxgjb5rw3"; + name = "kblackbox-21.12.3.tar.xz"; }; }; kblocks = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kblocks-21.12.2.tar.xz"; - sha256 = "13anvyy3br7ybl74jcrnjmw5qjfyk4z6s7ncziw8l37ggg4k7n91"; - name = "kblocks-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kblocks-21.12.3.tar.xz"; + sha256 = "1n3jc96ws8078gk1il61dc96p3pzvj3z9brnwi274pk4cif63bli"; + name = "kblocks-21.12.3.tar.xz"; }; }; kbounce = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kbounce-21.12.2.tar.xz"; - sha256 = "07k5vmfkh9l4b4sb4an5qlnq0b9hmhh6dax0bjgia0ng9vxd011q"; - name = "kbounce-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kbounce-21.12.3.tar.xz"; + sha256 = "1am4j11cjzlmav2zh5802kasy0kdcx78slycadnf96bmhxs8hvyv"; + name = "kbounce-21.12.3.tar.xz"; }; }; kbreakout = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kbreakout-21.12.2.tar.xz"; - sha256 = "08rykfi82hgzg5l2bhs8nvh8si06nisy60653n6r7m8g327yyn1m"; - name = "kbreakout-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kbreakout-21.12.3.tar.xz"; + sha256 = "0vqlxaggzvvrb439ybsvd5kr9j2jzpwk4xy3yni83y830h1mmhhc"; + name = "kbreakout-21.12.3.tar.xz"; }; }; kbruch = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kbruch-21.12.2.tar.xz"; - sha256 = "0vvl2rk636zpg27hj2jly1awg4z3fm6mk75qrda3hl6gm8rddw1v"; - name = "kbruch-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kbruch-21.12.3.tar.xz"; + sha256 = "1kcwbpa5lawkqqwn40r6d7savwvi7kkdgdxfxqxkviwnif2qkssx"; + name = "kbruch-21.12.3.tar.xz"; }; }; kcachegrind = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kcachegrind-21.12.2.tar.xz"; - sha256 = "1fg7fn8a3bjbjr6bi298gqr4mr838v96bz9773pd7rnhffvvip8z"; - name = "kcachegrind-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kcachegrind-21.12.3.tar.xz"; + sha256 = "1cssjywnhfbnsvly4mralpx3af2pqkmhg1jj2q3cjiqx44i3gkyx"; + name = "kcachegrind-21.12.3.tar.xz"; }; }; kcalc = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kcalc-21.12.2.tar.xz"; - sha256 = "037xk57gjfbjpw1q4gm9k1xkc3x5xxjr4d8xmnrnc6ni090648q4"; - name = "kcalc-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kcalc-21.12.3.tar.xz"; + sha256 = "15yqzhrlzcix8wvgaah8wf12msylgzyqwk58f58k5agxh97ahv4q"; + name = "kcalc-21.12.3.tar.xz"; }; }; kcalutils = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kcalutils-21.12.2.tar.xz"; - sha256 = "0i474by8pyv64b7i807kym2q4wkhnyyn21vn56dbgp1awpi198i8"; - name = "kcalutils-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kcalutils-21.12.3.tar.xz"; + sha256 = "006sfkjzyid8byl2mmyn1is4nra9wjqh21ksd5g1kv948hf1jdcs"; + name = "kcalutils-21.12.3.tar.xz"; }; }; kcharselect = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kcharselect-21.12.2.tar.xz"; - sha256 = "1czkni7wrl2l5v0zpvxfwdaqd5i0x6knzbjhzh8shdg3h19sgqrm"; - name = "kcharselect-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kcharselect-21.12.3.tar.xz"; + sha256 = "1aaiz9f9y2fmf284617pfnncgxjjjyfvdv08h900sc0bdlfmh4y7"; + name = "kcharselect-21.12.3.tar.xz"; }; }; kcolorchooser = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kcolorchooser-21.12.2.tar.xz"; - sha256 = "12s2vfa3i7b5dh8c10xbqsy1xi9pq13vdj2xcpm5chkgw22595hv"; - name = "kcolorchooser-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kcolorchooser-21.12.3.tar.xz"; + sha256 = "0jnnbwaj9xb0ifcc95xay8yc4bx9f29wqkj3h4kffzdlwvw3vp7s"; + name = "kcolorchooser-21.12.3.tar.xz"; }; }; kcron = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kcron-21.12.2.tar.xz"; - sha256 = "0ddgl61vw4mj8sa6zg1m4s6qagwygdkvw9pjmfs8fsa1anhlillk"; - name = "kcron-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kcron-21.12.3.tar.xz"; + sha256 = "0ffc71inp1kyd4xh39x6vbfggz0kpipd6r6vabfn187lpnpwcmpm"; + name = "kcron-21.12.3.tar.xz"; }; }; kde-dev-scripts = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kde-dev-scripts-21.12.2.tar.xz"; - sha256 = "1vdssqwyi25j3saz5cw8n40y2i6bhq5l0rxbarh8m3iwcvx4ki3c"; - name = "kde-dev-scripts-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kde-dev-scripts-21.12.3.tar.xz"; + sha256 = "04w4kk7vpfkjj2fzylmq590kk7xskw3a0id3wndw8066pfafsfg3"; + name = "kde-dev-scripts-21.12.3.tar.xz"; }; }; kde-dev-utils = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kde-dev-utils-21.12.2.tar.xz"; - sha256 = "0flzc0kl252imng2mpg9mp71k8jrxc3yy7dzqlfdnpjz36dwpaqf"; - name = "kde-dev-utils-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kde-dev-utils-21.12.3.tar.xz"; + sha256 = "1jdqv5zdigwazh3m580rmnylr6h6a6l5g2cpxy54v9sdvh3qb1yr"; + name = "kde-dev-utils-21.12.3.tar.xz"; }; }; kdebugsettings = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdebugsettings-21.12.2.tar.xz"; - sha256 = "0cimipq45c36nwk3alg738jl93zxja3xi77zjqk0k28ffn6qn7c2"; - name = "kdebugsettings-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdebugsettings-21.12.3.tar.xz"; + sha256 = "19ng7hvqpyh3kh0pahrknh89c113mqx1kxjq4r26xbww1ypkz8zq"; + name = "kdebugsettings-21.12.3.tar.xz"; }; }; kdeconnect-kde = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdeconnect-kde-21.12.2.tar.xz"; - sha256 = "0crw0navhdsix0rpsya4vhffj35vlascpcflrs04vyws3v8xr026"; - name = "kdeconnect-kde-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdeconnect-kde-21.12.3.tar.xz"; + sha256 = "1n9km7czif19cvrsdfcjbb02i1xgpa1z4ycn20d3g8azmli4zj4g"; + name = "kdeconnect-kde-21.12.3.tar.xz"; }; }; kdeedu-data = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdeedu-data-21.12.2.tar.xz"; - sha256 = "1cpbi5gkbq7xrv276vm0jlcjc5y9x1kw8l8x0z7syy06s4s3pvg9"; - name = "kdeedu-data-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdeedu-data-21.12.3.tar.xz"; + sha256 = "11mxxcca6jxz4qcmba12p6xbv845xa16b8ag529409f3276w4915"; + name = "kdeedu-data-21.12.3.tar.xz"; }; }; kdegraphics-mobipocket = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdegraphics-mobipocket-21.12.2.tar.xz"; - sha256 = "0zbiz47mqa176gcina8v03fw2qqrc5v1l8mg2fcpnl5dxc9d56c4"; - name = "kdegraphics-mobipocket-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdegraphics-mobipocket-21.12.3.tar.xz"; + sha256 = "091ix343p9vs4iyj8abq6mw9lbm1fx5167gykhm4g8bjk5vdri2q"; + name = "kdegraphics-mobipocket-21.12.3.tar.xz"; }; }; kdegraphics-thumbnailers = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdegraphics-thumbnailers-21.12.2.tar.xz"; - sha256 = "09adinkdfbn5hfic92zbdhq9ldxpnbgf9pybsp4ibpw2097l2k5f"; - name = "kdegraphics-thumbnailers-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdegraphics-thumbnailers-21.12.3.tar.xz"; + sha256 = "0shdrl6n1724i8jrkmy8z6ayhflg93401jia87mcc1apaw9s8y83"; + name = "kdegraphics-thumbnailers-21.12.3.tar.xz"; }; }; kdenetwork-filesharing = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdenetwork-filesharing-21.12.2.tar.xz"; - sha256 = "0q7gndwvki3r9vhkxmwr8xzc54cjpk9nzhk2665wsk1msfp3xqw6"; - name = "kdenetwork-filesharing-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdenetwork-filesharing-21.12.3.tar.xz"; + sha256 = "1y6sa22j2165j3x6ql1cfm30vv9ifb94mczbqbcjzmhqsypp5pw2"; + name = "kdenetwork-filesharing-21.12.3.tar.xz"; }; }; kdenlive = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdenlive-21.12.2.tar.xz"; - sha256 = "1h668q91pcq3km7pq75krgq06x8gglmp8al52b0imyc9g9wy28z6"; - name = "kdenlive-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdenlive-21.12.3.tar.xz"; + sha256 = "1hamdi2v3rx5zjmvpx1bximdppmzgsk9gbjxwgr691lkybkgx8vs"; + name = "kdenlive-21.12.3.tar.xz"; }; }; kdepim-addons = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdepim-addons-21.12.2.tar.xz"; - sha256 = "00j67rvkvm1sri6ij5ziqjh340cmpsyfwwmw8hr1dsi3vlva4gk1"; - name = "kdepim-addons-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdepim-addons-21.12.3.tar.xz"; + sha256 = "1pv780z29ccx05z12l2w5zdmby9d1q993jr0cyzvpapnmck9146h"; + name = "kdepim-addons-21.12.3.tar.xz"; }; }; kdepim-runtime = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdepim-runtime-21.12.2.tar.xz"; - sha256 = "0y1hgab16h9ypqh9isabbb4km2907vzdydfkd1m5b63vfbambz0j"; - name = "kdepim-runtime-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdepim-runtime-21.12.3.tar.xz"; + sha256 = "1ahrnnc9vn0556s4nrsjgc9vbf5rb6yby7fn33p3jjnpgja0mc7m"; + name = "kdepim-runtime-21.12.3.tar.xz"; }; }; kdesdk-kioslaves = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdesdk-kioslaves-21.12.2.tar.xz"; - sha256 = "0vz6dk5an0bhnyglyqdgf3lqxdlc61k4vsbh8a4fky1zpvpwya84"; - name = "kdesdk-kioslaves-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdesdk-kioslaves-21.12.3.tar.xz"; + sha256 = "1nhsvx5pznm3adf0scrcqqb2ibl52a241ki2gbwvxk2qpwwwx6jd"; + name = "kdesdk-kioslaves-21.12.3.tar.xz"; }; }; kdesdk-thumbnailers = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdesdk-thumbnailers-21.12.2.tar.xz"; - sha256 = "1w90zjnwnqh1a47kgmijr8xp6z096f6ij250qfcl3bwvhxqmsrb0"; - name = "kdesdk-thumbnailers-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdesdk-thumbnailers-21.12.3.tar.xz"; + sha256 = "0337rhgil42wychi5anq2v61xq8mbcvma4gb50smapcrjfl7fkdy"; + name = "kdesdk-thumbnailers-21.12.3.tar.xz"; }; }; kdev-php = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdev-php-21.12.2.tar.xz"; - sha256 = "0ghxfllh8pkyrvsaz4iwc9bm98mkq6z3wr558w4wjykgjp69r08j"; - name = "kdev-php-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdev-php-21.12.3.tar.xz"; + sha256 = "0z5iqgsh7w0hw0pw2522zlh5sd88zlplrxm3vjp3yvmza65471aa"; + name = "kdev-php-21.12.3.tar.xz"; }; }; kdev-python = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdev-python-21.12.2.tar.xz"; - sha256 = "05jj7q7agkgpbrxzwh0n2ipc854cgm8skjyjkqmxp2kdf3fdm8lj"; - name = "kdev-python-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdev-python-21.12.3.tar.xz"; + sha256 = "1iyg1cfldf5mk62anw8schiw3ii0gp20qwg6ljk1r9hv583iwrq6"; + name = "kdev-python-21.12.3.tar.xz"; }; }; kdevelop = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdevelop-21.12.2.tar.xz"; - sha256 = "13kgkxvbjcb60ckapqrcr4m0y5kyag948xx6gwrvzhrhn46ynfgz"; - name = "kdevelop-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdevelop-21.12.3.tar.xz"; + sha256 = "1shp8zlxr7iyysn1c8d3fp6rg6g2krj2v3zw5apalxcnal16bww6"; + name = "kdevelop-21.12.3.tar.xz"; }; }; kdf = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdf-21.12.2.tar.xz"; - sha256 = "1fs8bab6q7imfpqqgasvr98k57nm68ignfch2i76rdcywhx3q268"; - name = "kdf-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdf-21.12.3.tar.xz"; + sha256 = "179ygy4kxkapfyxqj8h5xlvp1160vd72af34vd0a4r5az7wfd1m7"; + name = "kdf-21.12.3.tar.xz"; }; }; kdialog = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdialog-21.12.2.tar.xz"; - sha256 = "1k6zlh1gbpj0y40h1i8pan28d8chqjsnhd6pvsvr95b91d0pj2xn"; - name = "kdialog-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdialog-21.12.3.tar.xz"; + sha256 = "04d1dqc5f02s867lllx1ix0nc55xw9hrpg7jxiy3v4c8vlzg0w53"; + name = "kdialog-21.12.3.tar.xz"; }; }; kdiamond = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kdiamond-21.12.2.tar.xz"; - sha256 = "08b2a13bmxw3h6rhip619jvzgjrjgpz2v83i2azbqccfynisjnyh"; - name = "kdiamond-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kdiamond-21.12.3.tar.xz"; + sha256 = "1d3c4pckddnri9i19g2pi2ygpqakllrgy6azgvnh5hn20kgsw7d9"; + name = "kdiamond-21.12.3.tar.xz"; }; }; keditbookmarks = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/keditbookmarks-21.12.2.tar.xz"; - sha256 = "1fxm0mm3sqp2frk2fcs2jw86wjxb2j5z9vyb34x7g80k5j17j57m"; - name = "keditbookmarks-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/keditbookmarks-21.12.3.tar.xz"; + sha256 = "0wfb7j1lhhdfw2x03p692mglmy9i9qys8mn4f3gxlb5imrd2hmnk"; + name = "keditbookmarks-21.12.3.tar.xz"; }; }; kfind = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kfind-21.12.2.tar.xz"; - sha256 = "0kx6p4hyyalx5i8g4aq81aj30c9ac0380xvia9130g95pgkzd96c"; - name = "kfind-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kfind-21.12.3.tar.xz"; + sha256 = "1v1yxsbmzv4q5m5rbvl9n095d9fq0b1zphnl6vrzff5r8i53pzx0"; + name = "kfind-21.12.3.tar.xz"; }; }; kfloppy = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kfloppy-21.12.2.tar.xz"; - sha256 = "10245c87379576n11xcjkll3rkvzv815qsavr4alsj1jr8w6zyg8"; - name = "kfloppy-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kfloppy-21.12.3.tar.xz"; + sha256 = "1phkigxd6bkwlcjrsfhlhn44ra9imfq0flcvp4vmza6c9ylsx6m8"; + name = "kfloppy-21.12.3.tar.xz"; }; }; kfourinline = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kfourinline-21.12.2.tar.xz"; - sha256 = "1kz7ff31h8lvz7snqmjs6cma9i3py7dyd91i6ik2pwiar80sin1x"; - name = "kfourinline-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kfourinline-21.12.3.tar.xz"; + sha256 = "0rb5jcmmf19bidwywj56dn0wfrnrfi5kc75c20d7mxnlgygfdnkg"; + name = "kfourinline-21.12.3.tar.xz"; }; }; kgeography = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kgeography-21.12.2.tar.xz"; - sha256 = "09h5zp8pxzr47s7j50l6xfssvk9zk56cqgnsjx75yh1n077z1d0j"; - name = "kgeography-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kgeography-21.12.3.tar.xz"; + sha256 = "1s1xyfffqkhmf4n74a4ksjz62rdiyl1fk1v57s9gnr6qw71wqql0"; + name = "kgeography-21.12.3.tar.xz"; }; }; kget = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kget-21.12.2.tar.xz"; - sha256 = "0jmy2yxzrgq592dq075k7gp7ynk42i899jsbw0gbn79x69cxlkmv"; - name = "kget-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kget-21.12.3.tar.xz"; + sha256 = "1w249gvzz47ac7n1mnxxf20d9l7jmbh18m5dijy55ck61s4zcq4l"; + name = "kget-21.12.3.tar.xz"; }; }; kgoldrunner = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kgoldrunner-21.12.2.tar.xz"; - sha256 = "0by6cq31jsls3qaqn4agrdhvd9jqg84plm6nbgh3rc85pnj5h22p"; - name = "kgoldrunner-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kgoldrunner-21.12.3.tar.xz"; + sha256 = "0gzz58407zjmk311kyyj5l2c1ciczcq9i8ckpwbd341dvwaww27q"; + name = "kgoldrunner-21.12.3.tar.xz"; }; }; kgpg = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kgpg-21.12.2.tar.xz"; - sha256 = "1f193fyn1azwhm7b8gd5ffyb11acg1269mh1d2ly60ax83qjs48c"; - name = "kgpg-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kgpg-21.12.3.tar.xz"; + sha256 = "1mzq3g4xwg459k0mp9xvg8bhilizadbh4gck1764wq69bxlcyav3"; + name = "kgpg-21.12.3.tar.xz"; }; }; khangman = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/khangman-21.12.2.tar.xz"; - sha256 = "0xih54w33vigvm3x2xp5lf29k4aga4yil0qv263965nxn9djnlaw"; - name = "khangman-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/khangman-21.12.3.tar.xz"; + sha256 = "000vn11pp4hwfh2689rmnwrrssrmrhx5569k02h4ynswkiykvbv6"; + name = "khangman-21.12.3.tar.xz"; }; }; khelpcenter = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/khelpcenter-21.12.2.tar.xz"; - sha256 = "09ddkc7kiayx852mpgdmv04l19vrrc0yrf30hnyzkci58kbavvcq"; - name = "khelpcenter-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/khelpcenter-21.12.3.tar.xz"; + sha256 = "1fj1c57bqs009rx9db4ifvfmhhl4b35r5sfly3wvbfr4dapjqfqr"; + name = "khelpcenter-21.12.3.tar.xz"; }; }; kidentitymanagement = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kidentitymanagement-21.12.2.tar.xz"; - sha256 = "00fwjax3kfvr8jsy04hp1jyihvskvprbg83z2avhcy6lvr7g25kk"; - name = "kidentitymanagement-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kidentitymanagement-21.12.3.tar.xz"; + sha256 = "18xwvlmqhih5jmig2mj3a6mc5awlxdv8f81da6cgm123imhrirk4"; + name = "kidentitymanagement-21.12.3.tar.xz"; }; }; kig = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kig-21.12.2.tar.xz"; - sha256 = "100ds4728lfnb6r6c52rdzk2n4rcpc5jiv35q5qd7d6cszmxvhvx"; - name = "kig-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kig-21.12.3.tar.xz"; + sha256 = "0rl0z1djsf9ha0q94v0cnj5qm4ij6yjsil2s57r3v666h64yradn"; + name = "kig-21.12.3.tar.xz"; }; }; kigo = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kigo-21.12.2.tar.xz"; - sha256 = "0g1sl7bw9aln7fm2786sgh0m44da6vfxc9g0rizw31ff8papnyb8"; - name = "kigo-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kigo-21.12.3.tar.xz"; + sha256 = "14pp73b9mbf0ny75b90vs7z9l61m7zp8cll7hl4bplqh1kig1szf"; + name = "kigo-21.12.3.tar.xz"; }; }; killbots = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/killbots-21.12.2.tar.xz"; - sha256 = "1qryy2g2i6iqc6rsw8jz4c14x67glpm3zvcx2dghyll6q9hns43z"; - name = "killbots-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/killbots-21.12.3.tar.xz"; + sha256 = "1ncr55xq04vrx6bss1ahk86c3l9ckhv4zjbc6gq4krhjw0lkdfiv"; + name = "killbots-21.12.3.tar.xz"; }; }; kimagemapeditor = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kimagemapeditor-21.12.2.tar.xz"; - sha256 = "11j55jvfxdpam3gkfv7355av9d6mz8z6djhplhmfd56llkmvw4n2"; - name = "kimagemapeditor-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kimagemapeditor-21.12.3.tar.xz"; + sha256 = "0qdmyrlf0jp3737p7x31wk428676xv77lx0mgyd9h2hdl0ipnbvr"; + name = "kimagemapeditor-21.12.3.tar.xz"; }; }; kimap = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kimap-21.12.2.tar.xz"; - sha256 = "0sdas8knk6wa8hhgc3w62famdpq6pcxfhl4vmpw0r3aqskaci4q3"; - name = "kimap-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kimap-21.12.3.tar.xz"; + sha256 = "11jd9zkvflfh3gqs36fhj8mla3k44xf7zdb0z4nl9sk5nhhgm5px"; + name = "kimap-21.12.3.tar.xz"; }; }; kio-extras = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kio-extras-21.12.2.tar.xz"; - sha256 = "0133cww4k2svn7cvw0fbdcwwv0zg09d27gz59gkpfswjmpsxdqj4"; - name = "kio-extras-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kio-extras-21.12.3.tar.xz"; + sha256 = "11zpnjdri7z4sz6zx26d9iv52aj4vf5lr9c114gg4pvz2l4h4h5i"; + name = "kio-extras-21.12.3.tar.xz"; }; }; kio-gdrive = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kio-gdrive-21.12.2.tar.xz"; - sha256 = "1n3khrx5fczffwzg4bzxjhzy2kxf72dmb7fqs9hqfn1qkaahfv49"; - name = "kio-gdrive-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kio-gdrive-21.12.3.tar.xz"; + sha256 = "0bm3c7g6q7z2ydnha2x5c456x9wlgachi9453mlrd2zcsc7c5h87"; + name = "kio-gdrive-21.12.3.tar.xz"; }; }; kipi-plugins = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kipi-plugins-21.12.2.tar.xz"; - sha256 = "11f3qmgqxdlzvv2zldjawn7a3kdigj5pb535rc9v9a8fp8mjvk88"; - name = "kipi-plugins-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kipi-plugins-21.12.3.tar.xz"; + sha256 = "1h6107d2a6jcyjsd191cg2ykgwm580j7wr0blg328ff6wwk1aizy"; + name = "kipi-plugins-21.12.3.tar.xz"; }; }; kirigami-gallery = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kirigami-gallery-21.12.2.tar.xz"; - sha256 = "0rg9lg4iqxycfbhs62qs4ms4qadz1ii1dcv3ykkgn3w2brx77wad"; - name = "kirigami-gallery-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kirigami-gallery-21.12.3.tar.xz"; + sha256 = "0pjd9bq965v9x433p8rbhd7w3fj0808qd7x4c11ziyhy4cg9gwml"; + name = "kirigami-gallery-21.12.3.tar.xz"; }; }; kiriki = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kiriki-21.12.2.tar.xz"; - sha256 = "1blj3vl87jdrr8qv2cyng20nr4d54gbk7w72z9rl02l62c9gkw5j"; - name = "kiriki-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kiriki-21.12.3.tar.xz"; + sha256 = "0qbm0zjjqnbcdm39zi8h240nblpa1pa7g1ls9mghzbqrdrh7n3a0"; + name = "kiriki-21.12.3.tar.xz"; }; }; kiten = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kiten-21.12.2.tar.xz"; - sha256 = "18kxqrhfgch32583ra4422h7csd5ajijf9989bxz9hwi9mn3r2vl"; - name = "kiten-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kiten-21.12.3.tar.xz"; + sha256 = "0z0haqxxkh7m2510b5qfwbx8s45vcahbk503jp1x0bwz03mrwflw"; + name = "kiten-21.12.3.tar.xz"; }; }; kitinerary = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kitinerary-21.12.2.tar.xz"; - sha256 = "0g7z6408nhrv54h6xxd2rd9wj2hmwzc3lg5risyqbg2zii9j0sp2"; - name = "kitinerary-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kitinerary-21.12.3.tar.xz"; + sha256 = "0kccrjiyib2zljr6rnc89y29jgi8cnhwfh1yq8psyzmca2n8lpxi"; + name = "kitinerary-21.12.3.tar.xz"; }; }; kjumpingcube = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kjumpingcube-21.12.2.tar.xz"; - sha256 = "1abv3yi716n88b19rmimhw0vnnwyw28ab6fbcy9g1lgpbi69g5ax"; - name = "kjumpingcube-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kjumpingcube-21.12.3.tar.xz"; + sha256 = "1wlk6my6pawmdv3zgcpnyyzpjwz0wii0h8i1z0gxhbpg9nc8iy1r"; + name = "kjumpingcube-21.12.3.tar.xz"; }; }; kldap = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kldap-21.12.2.tar.xz"; - sha256 = "1xda42f1q5ih3hdhmcbdz0fx2nchirlwips3gq0jb6lfzi5dbqpl"; - name = "kldap-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kldap-21.12.3.tar.xz"; + sha256 = "13llsfhx9lfvhf90a3vmpkyh02fjg5sp4fmrwrqyx9hjrbmy1g0a"; + name = "kldap-21.12.3.tar.xz"; }; }; kleopatra = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kleopatra-21.12.2.tar.xz"; - sha256 = "1b2nq823gq1v20dnh3hm298fva7cmbn9hh0kmbq22kh98kv8chhh"; - name = "kleopatra-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kleopatra-21.12.3.tar.xz"; + sha256 = "10f61m0qrs0qipn94jd32gibyj8pcvprs8j7gmac0mym0b3djjls"; + name = "kleopatra-21.12.3.tar.xz"; }; }; klettres = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/klettres-21.12.2.tar.xz"; - sha256 = "1wi1byr36x7z9scsy1gffna36m8x9vyfcqzndvx6042i2y0smhwz"; - name = "klettres-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/klettres-21.12.3.tar.xz"; + sha256 = "0l4zgfqd6l2bk67s2a0zldbcy8v7nwbv7yahvnyw4jf4jyv9q9rv"; + name = "klettres-21.12.3.tar.xz"; }; }; klickety = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/klickety-21.12.2.tar.xz"; - sha256 = "19rn9p7cbxhn471b65nhwhpnfnhykjwj6n5lrsd431391dyhvshc"; - name = "klickety-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/klickety-21.12.3.tar.xz"; + sha256 = "03liv3fax764ngfkwp3ga96irn8qb509b08ljnhz5aw5v9yrssnk"; + name = "klickety-21.12.3.tar.xz"; }; }; klines = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/klines-21.12.2.tar.xz"; - sha256 = "1r004rsy98lxh5vd3r4bc0l4d7ymija13barg9xglj53xzbyij3k"; - name = "klines-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/klines-21.12.3.tar.xz"; + sha256 = "1ypi64wdsw1zsj03wcxj02v27y1by113v89as8dyk9wr0pfmbpqf"; + name = "klines-21.12.3.tar.xz"; }; }; kmag = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmag-21.12.2.tar.xz"; - sha256 = "03kzahsr80wnbx6ky112ka3zm01pnc5h85l28a4186617swx344l"; - name = "kmag-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmag-21.12.3.tar.xz"; + sha256 = "067x65gmip89rdgii2nwnxn7zi96cf7vfbhqzg0499pd2d69p3sl"; + name = "kmag-21.12.3.tar.xz"; }; }; kmahjongg = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmahjongg-21.12.2.tar.xz"; - sha256 = "1w8v6fchrkvsbyvnx8vvs801cvg52pr78ihvdjv6c0vpd0q7z9rz"; - name = "kmahjongg-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmahjongg-21.12.3.tar.xz"; + sha256 = "02yvvpwkk5gbj445zv5xhfragk8220rlx0pkxf32pj0jsv7dnz1x"; + name = "kmahjongg-21.12.3.tar.xz"; }; }; kmail = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmail-21.12.2.tar.xz"; - sha256 = "003bnp00figa09qcp2hl45sivdk3d0j3amxdidyrn47q9vy40554"; - name = "kmail-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmail-21.12.3.tar.xz"; + sha256 = "1knh6cf72hidc6jyiw250b708b410fla0c5w83zaavmwv37ah8z0"; + name = "kmail-21.12.3.tar.xz"; }; }; kmail-account-wizard = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmail-account-wizard-21.12.2.tar.xz"; - sha256 = "1nmg8qns3iglcc4l4g5nffnji1vgg43a9fa9rz1hacvlkarm98m4"; - name = "kmail-account-wizard-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmail-account-wizard-21.12.3.tar.xz"; + sha256 = "0ar2rm6viissfipbak07fxivrgqgsdfilsprsqmvab44inw2g4pg"; + name = "kmail-account-wizard-21.12.3.tar.xz"; }; }; kmailtransport = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmailtransport-21.12.2.tar.xz"; - sha256 = "0rs6qihzy8q2n204zkhakgnjxwqy9pz9i0kv1j3amw2xv3f51rvw"; - name = "kmailtransport-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmailtransport-21.12.3.tar.xz"; + sha256 = "0l3pgs781a6is937i0bkz9ykr40l36rwlrirsr4g8wh0gkc3ifi6"; + name = "kmailtransport-21.12.3.tar.xz"; }; }; kmbox = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmbox-21.12.2.tar.xz"; - sha256 = "1mfwaw4d480kbb60wb0kvl5z35ly2hn6h73kx9wdb5y7mz05rvn1"; - name = "kmbox-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmbox-21.12.3.tar.xz"; + sha256 = "04cl2khj3a7n81nlmxsg8kgszrl22qm6s2kvbrhz39yfzi31cwqr"; + name = "kmbox-21.12.3.tar.xz"; }; }; kmime = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmime-21.12.2.tar.xz"; - sha256 = "0qxb0gf4pqfa0540fsbnf24nh9qwiamwl65q7vaanb80b211qp2g"; - name = "kmime-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmime-21.12.3.tar.xz"; + sha256 = "03s7l4lywdvp97h4qjgq06qqcclvnhy83qsrfzv0w2wcl631nnpw"; + name = "kmime-21.12.3.tar.xz"; }; }; kmines = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmines-21.12.2.tar.xz"; - sha256 = "0dsqlqmbaggab38zzjyhnx318sn2mw6y51k52c7blm2l53a8zp3j"; - name = "kmines-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmines-21.12.3.tar.xz"; + sha256 = "1wxy0cyz733wvnxfjhirqf41wnda4f6aqdiqmb5r1ngzzllgbglc"; + name = "kmines-21.12.3.tar.xz"; }; }; kmix = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmix-21.12.2.tar.xz"; - sha256 = "0fyjzzv6x9xf0g222jjsvrywnm3blhbzm2zwhxagrfkjvjpb2cvk"; - name = "kmix-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmix-21.12.3.tar.xz"; + sha256 = "1zk2xljis1pv3m4vs5zr6wza6iv5y6wmh1csx3rn8ylfkrpk7h8k"; + name = "kmix-21.12.3.tar.xz"; }; }; kmousetool = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmousetool-21.12.2.tar.xz"; - sha256 = "1hh7sql04hpwvb8hbi7snvh2d6922a2yraah9hd1jiwniv3cv175"; - name = "kmousetool-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmousetool-21.12.3.tar.xz"; + sha256 = "013qr1md3gbin7hcahnv14y9i2cg35r433s2w81fvgcakd38qvkj"; + name = "kmousetool-21.12.3.tar.xz"; }; }; kmouth = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmouth-21.12.2.tar.xz"; - sha256 = "0vxssxchh23bl237qw9pznbrkwyqx1bhbnp2fq9baw1bn88d18i5"; - name = "kmouth-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmouth-21.12.3.tar.xz"; + sha256 = "0xvkp2pm2szbgzdsfmwrykma8npmlwmx2pb1iakbx3x1wyyjsbim"; + name = "kmouth-21.12.3.tar.xz"; }; }; kmplot = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kmplot-21.12.2.tar.xz"; - sha256 = "025n51s7i5nr63knsd78pg48wfs4cldhplr68jmwv2k8pb5w9kxs"; - name = "kmplot-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kmplot-21.12.3.tar.xz"; + sha256 = "1vmrzfcdyaxgvyp9la2gvy3h5fhksmn24lsnrpvr6alj880mh8bq"; + name = "kmplot-21.12.3.tar.xz"; }; }; knavalbattle = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/knavalbattle-21.12.2.tar.xz"; - sha256 = "1z1qqr5jjinm49p7rhr0pzf8ir2nvdq157zqxnnr6i11xqk2mnkj"; - name = "knavalbattle-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/knavalbattle-21.12.3.tar.xz"; + sha256 = "1mpj1783za6b7a7cjawy4v0z24dvcd34gdb25qch4gi9cx1lc28z"; + name = "knavalbattle-21.12.3.tar.xz"; }; }; knetwalk = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/knetwalk-21.12.2.tar.xz"; - sha256 = "1gnir7h1iam51frdajp4h6xw4biz545nljdfcck17jiw6ad9py4j"; - name = "knetwalk-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/knetwalk-21.12.3.tar.xz"; + sha256 = "0ahms3imvkdknp1z2h6j42k9g1i20ygd2633icjv37d2cbij128m"; + name = "knetwalk-21.12.3.tar.xz"; }; }; knights = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/knights-21.12.2.tar.xz"; - sha256 = "0k9hqgz3zw7vhrgbwnmy0v3j9kflz6wx8wavckg1i2l4qadprc1y"; - name = "knights-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/knights-21.12.3.tar.xz"; + sha256 = "1m2big16rdw3w347m5vi0qhypnb2rgz6804kkxs7ln0yx658y4x4"; + name = "knights-21.12.3.tar.xz"; }; }; knotes = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/knotes-21.12.2.tar.xz"; - sha256 = "0f8ra6nkgndgkfnw194y5976kkrm7qdj1w7l27znwalzaydnxvjg"; - name = "knotes-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/knotes-21.12.3.tar.xz"; + sha256 = "07pj0aqwsy1xi5mx7x0h3zmxfg0n4afgjax9a9ihc553xs6k48d7"; + name = "knotes-21.12.3.tar.xz"; }; }; kolf = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kolf-21.12.2.tar.xz"; - sha256 = "0as18rc45daak3xsmwn6k789yni46nsdkv83bfmbj3jcjhzv9x5k"; - name = "kolf-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kolf-21.12.3.tar.xz"; + sha256 = "00dhjy82d9964z94nn4vkkwynql3bfa6djwrgsq93f9d7grgkd7g"; + name = "kolf-21.12.3.tar.xz"; }; }; kollision = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kollision-21.12.2.tar.xz"; - sha256 = "1ycim9gjn9p6w6yyzsipqn7zpvi946s287mp4br35zavsf25gzn0"; - name = "kollision-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kollision-21.12.3.tar.xz"; + sha256 = "0avin6s1lglfps6qlvz19i27nb0x0hgrl4q2brpq4kax7azs1nc3"; + name = "kollision-21.12.3.tar.xz"; }; }; kolourpaint = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kolourpaint-21.12.2.tar.xz"; - sha256 = "0z53hp31sq4ksarvpzqmx9f3gac8ygrcj0ncppgbwwjkq63wr6v1"; - name = "kolourpaint-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kolourpaint-21.12.3.tar.xz"; + sha256 = "0kbz8jz33bk4zr7kk6mb1y42mdq6nykdfqm2cs08sxldd3nrs6fj"; + name = "kolourpaint-21.12.3.tar.xz"; }; }; kompare = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kompare-21.12.2.tar.xz"; - sha256 = "0ps6ng77kzcqf6b2sh8xmqh5d4jwkmj3qnbyxh4v4xxjbwy0mrwm"; - name = "kompare-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kompare-21.12.3.tar.xz"; + sha256 = "097aawmziplsndj42bdjf3x3smal1fy67c2y7cik9p1qw9wgn24h"; + name = "kompare-21.12.3.tar.xz"; }; }; konqueror = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/konqueror-21.12.2.tar.xz"; - sha256 = "0ia8qqas9x261ixa6jzih273ypqhdv5hijk042bcdmqd1z1s4n55"; - name = "konqueror-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/konqueror-21.12.3.tar.xz"; + sha256 = "0z3zq71n0lnpx5ggfg835zbmgf2ly4zsmz01yyyxn9n9d9b6d3px"; + name = "konqueror-21.12.3.tar.xz"; }; }; konquest = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/konquest-21.12.2.tar.xz"; - sha256 = "1arxp4x8pcmv8yqg1xy5b23avh5a7x660vvh6kaviimysad5wmc5"; - name = "konquest-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/konquest-21.12.3.tar.xz"; + sha256 = "0lrahq9s70rx24dw4cgpvchr4s6pcl565vh343ggg24s1rd3ly80"; + name = "konquest-21.12.3.tar.xz"; }; }; konsole = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/konsole-21.12.2.tar.xz"; - sha256 = "00gyzhcacd3467sv5ijihqva7pnvcy1chywfpy8qh2hcdkkvyfxa"; - name = "konsole-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/konsole-21.12.3.tar.xz"; + sha256 = "06sqm2xmairicrdcxnf7imvyvw0wyknrrym334scx2w7mfhjg5qs"; + name = "konsole-21.12.3.tar.xz"; }; }; kontact = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kontact-21.12.2.tar.xz"; - sha256 = "16ld08sx5lvrm9r0ync7r8bpd540gxsssvhxj5p43chq6b9hr5lm"; - name = "kontact-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kontact-21.12.3.tar.xz"; + sha256 = "16p17b4llral0g48l3s9yg838x6hhc4dprlcpd00b8sy58c27f90"; + name = "kontact-21.12.3.tar.xz"; }; }; kontactinterface = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kontactinterface-21.12.2.tar.xz"; - sha256 = "1qvjm27v797hcdqbr6jwdkwn3vpsy3f1i92slrwks03zj498ydlj"; - name = "kontactinterface-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kontactinterface-21.12.3.tar.xz"; + sha256 = "1qwx0q4bbk3d720ij37wbd54g9alw6ispjl1mq19hkk3gs5l1c78"; + name = "kontactinterface-21.12.3.tar.xz"; }; }; kontrast = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kontrast-21.12.2.tar.xz"; - sha256 = "0mk2i2x1yz0ykbnqvdbdpi9kplyzjxlwhhsvl4rbq0726g3q6pas"; - name = "kontrast-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kontrast-21.12.3.tar.xz"; + sha256 = "1rp279mfq18p5kzw3788m8w6kkj8w7zfdv97rnl3n5jir4j94yxl"; + name = "kontrast-21.12.3.tar.xz"; }; }; konversation = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/konversation-21.12.2.tar.xz"; - sha256 = "0lpkah6z12c4f77z6r5z31q5np3xwyb3y6xnsv1iq1rdzj0daxch"; - name = "konversation-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/konversation-21.12.3.tar.xz"; + sha256 = "05dxzkpadz29b5fm6pf225xqq0gaz9w50paz9341kzz4k3rnzq80"; + name = "konversation-21.12.3.tar.xz"; }; }; kopeninghours = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kopeninghours-21.12.2.tar.xz"; - sha256 = "1s4wcnk7p0vjqdhyf8131l3s6bn86gfkwl45zwpi7lpyacwgdf6k"; - name = "kopeninghours-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kopeninghours-21.12.3.tar.xz"; + sha256 = "0pfkrns576ll6wc33c8i6pgzd9wf543w2isbvh393zyb1rr3bzgd"; + name = "kopeninghours-21.12.3.tar.xz"; }; }; kopete = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kopete-21.12.2.tar.xz"; - sha256 = "1py45nk6bv5x2hnfzh5srq17lprkqrmpqr2h0fpmkmffx66njz5q"; - name = "kopete-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kopete-21.12.3.tar.xz"; + sha256 = "1v519sw2lzlap6xci3j55k8c48755sc9p3mgvj566b6jjq64xi5k"; + name = "kopete-21.12.3.tar.xz"; }; }; korganizer = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/korganizer-21.12.2.tar.xz"; - sha256 = "1kablp0x65jmdz5n3y19rgplcvvmq8vxz0ljw7lkrwr3pvvhyv3q"; - name = "korganizer-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/korganizer-21.12.3.tar.xz"; + sha256 = "072pyzs38dv07mwi4hlfb4rh9jx40dpxac3ywy7kj6nyvbfjmh0r"; + name = "korganizer-21.12.3.tar.xz"; }; }; kosmindoormap = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kosmindoormap-21.12.2.tar.xz"; - sha256 = "0max3mfwd5x8m3kqybnkrb4v93rdk1r007xw31l52j2rq2gh8pj2"; - name = "kosmindoormap-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kosmindoormap-21.12.3.tar.xz"; + sha256 = "06i616c873lkkpy2iwdjcgwnm6adjrr6rcain2rrb1j4pgzmmbvw"; + name = "kosmindoormap-21.12.3.tar.xz"; }; }; kpat = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kpat-21.12.2.tar.xz"; - sha256 = "0vra8n9xsba67as0ybmbjy235v3s7dmrwlf18avnb3ygxy0h8swf"; - name = "kpat-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kpat-21.12.3.tar.xz"; + sha256 = "1jd9457hf15d2l6njkfyj9a7lfyabcm80vz3zjb2cykm16x3sdb8"; + name = "kpat-21.12.3.tar.xz"; }; }; kpimtextedit = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kpimtextedit-21.12.2.tar.xz"; - sha256 = "06d42k433dvkfrnzfdx0b1qarrnmhnb4gyq7vgy6251ah8smild8"; - name = "kpimtextedit-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kpimtextedit-21.12.3.tar.xz"; + sha256 = "19hrqbjcmpi81vmnggrkrv0fcc9inhz5aa5klx0141aylnzfgwsl"; + name = "kpimtextedit-21.12.3.tar.xz"; }; }; kpkpass = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kpkpass-21.12.2.tar.xz"; - sha256 = "0p2l1z4blfq1iz3x9cnwwx2p9cs6bb4vw1csj29s09i6237ippzx"; - name = "kpkpass-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kpkpass-21.12.3.tar.xz"; + sha256 = "05f88hlqxfak94jy8afiv91dgzxd9qgrkarnqi9rv1f5a3j7k3k7"; + name = "kpkpass-21.12.3.tar.xz"; }; }; kpmcore = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kpmcore-21.12.2.tar.xz"; - sha256 = "1iyirvf04br0r8vclcpx0qrlm8wgqm9ww6xds3h9qjyqj1w8ng41"; - name = "kpmcore-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kpmcore-21.12.3.tar.xz"; + sha256 = "19h0ag54xzv4hwh950hshjghd4fb9xkdg8rlx6lvqa0w9b8admva"; + name = "kpmcore-21.12.3.tar.xz"; }; }; kpublictransport = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kpublictransport-21.12.2.tar.xz"; - sha256 = "02ffpgki4mdyczxa5bqb9wmg2c6anwxnsmlfdn1k47ry7ny2k9sl"; - name = "kpublictransport-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kpublictransport-21.12.3.tar.xz"; + sha256 = "1jcba5bq320afzfs5ly3vyyicdix8fprpr02x67v8p7mdzg58cq6"; + name = "kpublictransport-21.12.3.tar.xz"; }; }; kqtquickcharts = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kqtquickcharts-21.12.2.tar.xz"; - sha256 = "1sjm1vaksvp73866w09xadd1d0lakh00fwiic498siws4dvhhpif"; - name = "kqtquickcharts-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kqtquickcharts-21.12.3.tar.xz"; + sha256 = "0gl9c8zfn440202l82y4nfng0hyhivby8a4hf91rphi8f1xfxxmr"; + name = "kqtquickcharts-21.12.3.tar.xz"; }; }; krdc = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/krdc-21.12.2.tar.xz"; - sha256 = "005i3a7l9aq63nxsivj28kzjy2zdl759snwm56cgwq9rgc6sc003"; - name = "krdc-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/krdc-21.12.3.tar.xz"; + sha256 = "09np9clvmdll7v2p9aswnlhz4cgsnly82za7k3k9fs66h5c8q20j"; + name = "krdc-21.12.3.tar.xz"; }; }; kreversi = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kreversi-21.12.2.tar.xz"; - sha256 = "03b4c28297dzdzplmg818r27r9gpqj48rha9884h22fz9davgmhw"; - name = "kreversi-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kreversi-21.12.3.tar.xz"; + sha256 = "0lbypkh6lc5af43c2p19gs2c53icxd26abxf5rhs2c8182gr39b8"; + name = "kreversi-21.12.3.tar.xz"; }; }; krfb = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/krfb-21.12.2.tar.xz"; - sha256 = "1989q0mig516hz0lbq2m8p85x8ikpyrhj36cvq4c32sd2nasxkvc"; - name = "krfb-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/krfb-21.12.3.tar.xz"; + sha256 = "1r8lvvh2z8xi0l3pizlpl12nm4fnbpgiwqmx18w8i51x4j27dv0n"; + name = "krfb-21.12.3.tar.xz"; }; }; kross-interpreters = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kross-interpreters-21.12.2.tar.xz"; - sha256 = "14j7z6lwl0j7zdz29c1kjyhw0my6qfgnyxibwn9z87paxl8nv6z0"; - name = "kross-interpreters-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kross-interpreters-21.12.3.tar.xz"; + sha256 = "0wyr3xwdkb2fiadzh5lhjli1g0mbxjw353q7k1vbi2wxg5b9042g"; + name = "kross-interpreters-21.12.3.tar.xz"; }; }; kruler = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kruler-21.12.2.tar.xz"; - sha256 = "1w5dw3qda69d4ycbiaj18gfn6w28dj2lc37x2d86kx5skv8adxbw"; - name = "kruler-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kruler-21.12.3.tar.xz"; + sha256 = "0jmb3a907jx0s80865lmd7in8ggdf30gdbgykpalzfrv7nkjamzr"; + name = "kruler-21.12.3.tar.xz"; }; }; kshisen = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kshisen-21.12.2.tar.xz"; - sha256 = "0wjr9fnkmbylfq13zy3hifr4byj4y46f8cwh0w61ypgc0wjxnhhg"; - name = "kshisen-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kshisen-21.12.3.tar.xz"; + sha256 = "1i11gh87gfza58rpdd44pjb423an9a44cls117ba9gznxm67cph5"; + name = "kshisen-21.12.3.tar.xz"; }; }; ksirk = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ksirk-21.12.2.tar.xz"; - sha256 = "1lif8n8n2pj4vaf7zifqj7mjv5dbhki75wbwjd4q061wpr434vfj"; - name = "ksirk-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ksirk-21.12.3.tar.xz"; + sha256 = "1ipnkg2mgj37g5s5ihlys176kn2c11f3d57xr9zhqf8fvkvrkfm0"; + name = "ksirk-21.12.3.tar.xz"; }; }; ksmtp = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ksmtp-21.12.2.tar.xz"; - sha256 = "0hg5g401map67kjcgrd1a07iwyss5jnryhpsajffwz19sra855jp"; - name = "ksmtp-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ksmtp-21.12.3.tar.xz"; + sha256 = "0kdy5gsg1sgccvdk1fpf866xl9m8v8z034jpgf6s7n2pr5r5mni2"; + name = "ksmtp-21.12.3.tar.xz"; }; }; ksnakeduel = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ksnakeduel-21.12.2.tar.xz"; - sha256 = "0rdbsyfd3bink5cb0k5l713jw4syhz82kchn95cbg5zgc2iclfw4"; - name = "ksnakeduel-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ksnakeduel-21.12.3.tar.xz"; + sha256 = "06rill73xhhxra7kmbvwwriv9vbi91641z334ry1m4rr1qm2cdd6"; + name = "ksnakeduel-21.12.3.tar.xz"; }; }; kspaceduel = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kspaceduel-21.12.2.tar.xz"; - sha256 = "1kmwn55a4555g5m21jcr88k3f9aj87yifgrab6sx6gcw5q51d7vz"; - name = "kspaceduel-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kspaceduel-21.12.3.tar.xz"; + sha256 = "0dv539jlpkj8hr4cz0ncqm3scg6ja3s41p37bpqd94zicfvzxw84"; + name = "kspaceduel-21.12.3.tar.xz"; }; }; ksquares = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ksquares-21.12.2.tar.xz"; - sha256 = "12k09lasxyaxq4bp4fhczj8bpi8l6h1gn4nj6ka3zbc4mxxz34yc"; - name = "ksquares-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ksquares-21.12.3.tar.xz"; + sha256 = "1wbrakq1wnwp558y140j9vbid3g0k332rwbilky7z11c0giiv76x"; + name = "ksquares-21.12.3.tar.xz"; }; }; ksudoku = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ksudoku-21.12.2.tar.xz"; - sha256 = "1din2i3d9lhca5kw06ivixgk2prh1kfy8ikm0byl8qaqj4v89lji"; - name = "ksudoku-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ksudoku-21.12.3.tar.xz"; + sha256 = "1gw0ybwhvg1z8pcs72f73y52jvzvrw367g275axf2rw50iik6jwv"; + name = "ksudoku-21.12.3.tar.xz"; }; }; ksystemlog = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ksystemlog-21.12.2.tar.xz"; - sha256 = "0cvx13859bm4kfz75iia3chzi5pbbv70lkmspvjpa6cpsn05zy53"; - name = "ksystemlog-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ksystemlog-21.12.3.tar.xz"; + sha256 = "0jkd0rx0xlzwsxa3s40sp5x4r19a9rg1x9klpnjfw0b326vgf2m9"; + name = "ksystemlog-21.12.3.tar.xz"; }; }; kteatime = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kteatime-21.12.2.tar.xz"; - sha256 = "1m7ni3w82lqykgs5qfi0a43p9973244k8lr6rk30x7w551rc7yyw"; - name = "kteatime-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kteatime-21.12.3.tar.xz"; + sha256 = "0i3ps1a8y8crmxf1631q4zjfa0zglqhq1rk6id5v2xx8f10rkh54"; + name = "kteatime-21.12.3.tar.xz"; }; }; ktimer = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktimer-21.12.2.tar.xz"; - sha256 = "0jprayxn54pw7brrcb1b70y5sal9j6pfpwrphd2nyw5rkb2a484l"; - name = "ktimer-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktimer-21.12.3.tar.xz"; + sha256 = "0s6zbygxnk69dciyz1iv1d6whfcv637licsd07n7fc8bsygqjl5p"; + name = "ktimer-21.12.3.tar.xz"; }; }; ktnef = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktnef-21.12.2.tar.xz"; - sha256 = "0cl589z0v6h1z3aszk4160y99gpihpk203rn73dmb7c6qsk11cbl"; - name = "ktnef-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktnef-21.12.3.tar.xz"; + sha256 = "1in991n8alkxf40p0wvkr7gdaaz8w4kdw1rsq6sbjil6cs4cr5nl"; + name = "ktnef-21.12.3.tar.xz"; }; }; ktorrent = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktorrent-21.12.2.tar.xz"; - sha256 = "1zwakqp5j2795j4pln4sq595bc2zlw8cy8qdzwj365clfbpcbyc3"; - name = "ktorrent-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktorrent-21.12.3.tar.xz"; + sha256 = "021x6qcbk4kdh5ay5mqmf92129s42j2rhrs0q350b0wcnpad55zd"; + name = "ktorrent-21.12.3.tar.xz"; }; }; ktouch = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktouch-21.12.2.tar.xz"; - sha256 = "1rq2n8395sb17rqd295axv2pbwzhqs8ikjqx5ryn4lv1713alabl"; - name = "ktouch-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktouch-21.12.3.tar.xz"; + sha256 = "0wi01gr85sxs4qhvnwkkp1230wnvz7gdr74zar03rc3wzwgv22nd"; + name = "ktouch-21.12.3.tar.xz"; }; }; ktp-accounts-kcm = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-accounts-kcm-21.12.2.tar.xz"; - sha256 = "14niidb9kza6sms9rhhnvrba6rdwhc890b5inmlhdllnqbdrrcbl"; - name = "ktp-accounts-kcm-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-accounts-kcm-21.12.3.tar.xz"; + sha256 = "1ydsfiw67avgwswvpy85s3siggyi4w610yqz5dyl535i6my1kl5n"; + name = "ktp-accounts-kcm-21.12.3.tar.xz"; }; }; ktp-approver = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-approver-21.12.2.tar.xz"; - sha256 = "11scv978silxrprkyd66b4xkdww05xpgk8kvrknlwp33rmhm05sn"; - name = "ktp-approver-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-approver-21.12.3.tar.xz"; + sha256 = "0mvczpc0dy2m0dn25r2h2js3hw7s0qr8zl3syvqbyqqs51s59xnl"; + name = "ktp-approver-21.12.3.tar.xz"; }; }; ktp-auth-handler = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-auth-handler-21.12.2.tar.xz"; - sha256 = "006an8bva8zawnirv3ai3kjb59ffgany124ip546r5wg06zkk069"; - name = "ktp-auth-handler-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-auth-handler-21.12.3.tar.xz"; + sha256 = "0lgg0ify9mbsd8has8ingkq3m0g91r9gvfq85s2xf90cwc1s429c"; + name = "ktp-auth-handler-21.12.3.tar.xz"; }; }; ktp-call-ui = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-call-ui-21.12.2.tar.xz"; - sha256 = "0n8yirlsig37839rl73azg8vf8ppdxlf1dqgkf5bz8g3jcs92gcm"; - name = "ktp-call-ui-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-call-ui-21.12.3.tar.xz"; + sha256 = "1npr8qbpxx25pm9mky9sd0qngc5wphmy5blvl6qy7nvs2rqszgam"; + name = "ktp-call-ui-21.12.3.tar.xz"; }; }; ktp-common-internals = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-common-internals-21.12.2.tar.xz"; - sha256 = "0c7kfrgf8bqm7q9hp9fd8q49vakiihzl0dgdklpvgly48zfa2yan"; - name = "ktp-common-internals-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-common-internals-21.12.3.tar.xz"; + sha256 = "0spr2gs5d561agvipkipwcxk2zjlhzvp6swdh8rcv23qr6igqjq6"; + name = "ktp-common-internals-21.12.3.tar.xz"; }; }; ktp-contact-list = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-contact-list-21.12.2.tar.xz"; - sha256 = "0pw5kl0lh0ph3y9hyws7h7phh475lw07gydxxjsfxsd4nb70hkz8"; - name = "ktp-contact-list-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-contact-list-21.12.3.tar.xz"; + sha256 = "1qn3bmwl4kvm5ikbr0ycy2znm4c2yv4m5863d4vakr8xhhappamp"; + name = "ktp-contact-list-21.12.3.tar.xz"; }; }; ktp-contact-runner = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-contact-runner-21.12.2.tar.xz"; - sha256 = "0as41gba7ra65i6ml8j8fqh70x165cnmp9ry13ijrdf9vx21a45k"; - name = "ktp-contact-runner-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-contact-runner-21.12.3.tar.xz"; + sha256 = "0bwi0j733jnwiqlxv8nik1whdvk4aggfayy2bcwwpj5zdzr3mbga"; + name = "ktp-contact-runner-21.12.3.tar.xz"; }; }; ktp-desktop-applets = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-desktop-applets-21.12.2.tar.xz"; - sha256 = "0675hlcjq6xyzl1sz3a45inc3g69z5ilxyhhicxns8by3ydmb82x"; - name = "ktp-desktop-applets-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-desktop-applets-21.12.3.tar.xz"; + sha256 = "01h26jsdb7mkw8isxpy4sfpdn11q209xqhhpnk7xvchs8fpl5fni"; + name = "ktp-desktop-applets-21.12.3.tar.xz"; }; }; ktp-filetransfer-handler = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-filetransfer-handler-21.12.2.tar.xz"; - sha256 = "1cw2y06zcdfm9vixw99gbipgkl63vpkf73giq5ibal2g2yq9c2r5"; - name = "ktp-filetransfer-handler-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-filetransfer-handler-21.12.3.tar.xz"; + sha256 = "0aq5ii7b2kk0qan4qph9glapp81sgqm2zzbdknggxz7vkhj5y6lk"; + name = "ktp-filetransfer-handler-21.12.3.tar.xz"; }; }; ktp-kded-module = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-kded-module-21.12.2.tar.xz"; - sha256 = "1mwmdnr2c6ilhhjlq8bwd7gwvjmiq1k3lph5vlb5hy8nrp9x2p1r"; - name = "ktp-kded-module-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-kded-module-21.12.3.tar.xz"; + sha256 = "0921lahpqjx094ngk68pphkv306ajgxbp6yb0hkckmlic4f2hm37"; + name = "ktp-kded-module-21.12.3.tar.xz"; }; }; ktp-send-file = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-send-file-21.12.2.tar.xz"; - sha256 = "0083z5al3jgl1szmzddzkjln9ci37906mmnrcy9f0yxfq5v2gr44"; - name = "ktp-send-file-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-send-file-21.12.3.tar.xz"; + sha256 = "0vvg0qz2zxckqqwfibsl88w0mpa7a0lzskwhzbvzir03x14rwjlc"; + name = "ktp-send-file-21.12.3.tar.xz"; }; }; ktp-text-ui = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktp-text-ui-21.12.2.tar.xz"; - sha256 = "0lhbsmhp23sil3rckk51156qhz15hjyp943mgh4s3w49lwxgjpc8"; - name = "ktp-text-ui-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktp-text-ui-21.12.3.tar.xz"; + sha256 = "046611abkdn7qqh6n4v8ssdzg10q4g14rji7klypmccfng0px2xg"; + name = "ktp-text-ui-21.12.3.tar.xz"; }; }; ktuberling = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/ktuberling-21.12.2.tar.xz"; - sha256 = "0w9gx0i895vd0gi8wgd6hqikqjz5ir4li14i15k4akc7i7niy46r"; - name = "ktuberling-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/ktuberling-21.12.3.tar.xz"; + sha256 = "1awsn285j9nggyypkra9ladgi46w2m7m09d8364w5d0sygpzmgsg"; + name = "ktuberling-21.12.3.tar.xz"; }; }; kturtle = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kturtle-21.12.2.tar.xz"; - sha256 = "0xkl12albs66vnsbilkwpnw5qaqx2ss8wldsnigmf0x5d5hd554k"; - name = "kturtle-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kturtle-21.12.3.tar.xz"; + sha256 = "1689skwk2dwm4mrl2mrakb1cn74nyxd6xa8ipxsip5zhjgkkvg23"; + name = "kturtle-21.12.3.tar.xz"; }; }; kubrick = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kubrick-21.12.2.tar.xz"; - sha256 = "1sd8biyndnc7y4d3zsy4bmi409js9viyd4q5ql6fd2wcz656y1im"; - name = "kubrick-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kubrick-21.12.3.tar.xz"; + sha256 = "0hx81cp1lql74c9067dw7mi78c6sp6p1a035j2nzjn9drpxal6p2"; + name = "kubrick-21.12.3.tar.xz"; }; }; kwalletmanager = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kwalletmanager-21.12.2.tar.xz"; - sha256 = "0d2ma7dzn0nc25fj7lwaysfjfgqfl5nsisc01lp42n9k1bg0s0i5"; - name = "kwalletmanager-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kwalletmanager-21.12.3.tar.xz"; + sha256 = "01xif44iz1ik32swlrzzjycizy4hjlis1f336qc9p7affjyv2797"; + name = "kwalletmanager-21.12.3.tar.xz"; }; }; kwave = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kwave-21.12.2.tar.xz"; - sha256 = "01bjsm3aj7m1mq3nr6iwmcxswq8sxdxhhdyc5zlgffifpym53dc5"; - name = "kwave-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kwave-21.12.3.tar.xz"; + sha256 = "07xbbii5gpllbpmkxfv5kwxawd390zp0angh94xjk0yq71lvdav2"; + name = "kwave-21.12.3.tar.xz"; }; }; kwordquiz = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/kwordquiz-21.12.2.tar.xz"; - sha256 = "1na113adrd9djxk016riz3ajwrn9rbpc0ib34adfvp6nw48d9snp"; - name = "kwordquiz-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/kwordquiz-21.12.3.tar.xz"; + sha256 = "1p06ki75zy4il6k9siavqddpr9j02z3lbnd14pxwk42fhfmbx057"; + name = "kwordquiz-21.12.3.tar.xz"; }; }; libgravatar = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libgravatar-21.12.2.tar.xz"; - sha256 = "0xj3v0cknkvr8ac5iipxpz1azr0hk42zgaaip5ivn7qjfhp0zvv0"; - name = "libgravatar-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libgravatar-21.12.3.tar.xz"; + sha256 = "1bihy3dfagwc7aday40myqjbn555mkzzaaq7c14ywkmhh99dhvh7"; + name = "libgravatar-21.12.3.tar.xz"; }; }; libkcddb = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkcddb-21.12.2.tar.xz"; - sha256 = "07bcbmf3z5l0v5b6ra1h36yvbjpim1kzz1npd2h30iq09ibx6dr8"; - name = "libkcddb-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkcddb-21.12.3.tar.xz"; + sha256 = "14f1mzsfm0vyqzsyja0p8ln1105sw5dr6fssj25j0qw4rnf9yw32"; + name = "libkcddb-21.12.3.tar.xz"; }; }; libkcompactdisc = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkcompactdisc-21.12.2.tar.xz"; - sha256 = "08abnybd0fa0vvpaixi18ljfz0s8a5pmbblzpcc8rvwzdjc7az6q"; - name = "libkcompactdisc-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkcompactdisc-21.12.3.tar.xz"; + sha256 = "1vmaf3b41sj0sm4k9zdliy5ba4ps5z0cwabggfish152wzw34kgn"; + name = "libkcompactdisc-21.12.3.tar.xz"; }; }; libkdcraw = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkdcraw-21.12.2.tar.xz"; - sha256 = "0mzq0nha7mq5v3lb03xbspc0y2a7mg1mzlwbp3706ph6jp4m7mwa"; - name = "libkdcraw-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkdcraw-21.12.3.tar.xz"; + sha256 = "1pyqsaaficwxbg6hk8xg8srq79i6xdxvghkn2rf54zj1435d9kva"; + name = "libkdcraw-21.12.3.tar.xz"; }; }; libkdegames = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkdegames-21.12.2.tar.xz"; - sha256 = "1m1qz59fb82bsj9ri3b8a1ph2ihgs97wlqq91pbgqw0kgvyvka1j"; - name = "libkdegames-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkdegames-21.12.3.tar.xz"; + sha256 = "0x5mw25c8hmnxhcxc2xm19xmgdxfbx89nrxfl6mzfrh8myr3ybsb"; + name = "libkdegames-21.12.3.tar.xz"; }; }; libkdepim = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkdepim-21.12.2.tar.xz"; - sha256 = "0qqz9b17fz3kgh3gcyq30ds8fq7zkm14k85g4mywsn3lnn8bj6z9"; - name = "libkdepim-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkdepim-21.12.3.tar.xz"; + sha256 = "0g9jx6z5jf9yqn01xc1k038b4ljr9sil7bwvifc64s38qxl9wmww"; + name = "libkdepim-21.12.3.tar.xz"; }; }; libkeduvocdocument = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkeduvocdocument-21.12.2.tar.xz"; - sha256 = "16vh1bycq92bh47phv7nk62r5vjaiv1p8fvq5p5idsz9ipzb1wzp"; - name = "libkeduvocdocument-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkeduvocdocument-21.12.3.tar.xz"; + sha256 = "16kk7ij2qxy5abgv9hgk1ycbx0f2gnpc9lxqbhl5sq9vxd4nblv0"; + name = "libkeduvocdocument-21.12.3.tar.xz"; }; }; libkexiv2 = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkexiv2-21.12.2.tar.xz"; - sha256 = "1j1p1pw2l32q7lk8kp6r0nz9mzjdw6mxr2gi0p770k3k0arrsg87"; - name = "libkexiv2-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkexiv2-21.12.3.tar.xz"; + sha256 = "0r2m6d9rw0r6rm6xqpj1i3w0hplhivy8h90zggqynfzvfyr9c529"; + name = "libkexiv2-21.12.3.tar.xz"; }; }; libkgapi = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkgapi-21.12.2.tar.xz"; - sha256 = "0n6x0vdirv5qbi9qmd8956i307dz0lp80bw5cqxgk4gr4f8hzi8w"; - name = "libkgapi-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkgapi-21.12.3.tar.xz"; + sha256 = "1vbk8786mk1irm94bsm97270gnd149nz7w0zqnvwz499f72d21jx"; + name = "libkgapi-21.12.3.tar.xz"; }; }; libkipi = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkipi-21.12.2.tar.xz"; - sha256 = "0zlga9gy45cs3icx56gvq2nab7i3z5ydrmisa46vpca63w8swmys"; - name = "libkipi-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkipi-21.12.3.tar.xz"; + sha256 = "0w2kwi6djwp8mhmpfrr16v8fgmwjmsc89rcwpfhgii1p68xia8gc"; + name = "libkipi-21.12.3.tar.xz"; }; }; libkleo = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkleo-21.12.2.tar.xz"; - sha256 = "0vqgycmj2v91car7ckksnjxbq3b5nzk31p4x3577dgck9jmi30zd"; - name = "libkleo-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkleo-21.12.3.tar.xz"; + sha256 = "19q128ldi0aspy7vc03r54vrf7wz7l1181x9pbmax8340nbnaz7l"; + name = "libkleo-21.12.3.tar.xz"; }; }; libkmahjongg = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkmahjongg-21.12.2.tar.xz"; - sha256 = "10fgk8nhcr3rbdnh8az46jvl6w6xankdxzw4djj3qs4dpkl52vk4"; - name = "libkmahjongg-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkmahjongg-21.12.3.tar.xz"; + sha256 = "114viyqq7zlwsdnm96iyyvj8ma4p06m69hs641yv42xlbkspwbal"; + name = "libkmahjongg-21.12.3.tar.xz"; }; }; libkomparediff2 = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libkomparediff2-21.12.2.tar.xz"; - sha256 = "07yzzc6ns1yx92gpcvhnxw0xna6ly1j4l4lx1rbw3d94z796694z"; - name = "libkomparediff2-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libkomparediff2-21.12.3.tar.xz"; + sha256 = "1j93lf9adyw581a9i8kc1pj6vadscibw49wvwfs750f0kxn5p0d2"; + name = "libkomparediff2-21.12.3.tar.xz"; }; }; libksane = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libksane-21.12.2.tar.xz"; - sha256 = "1iksfjwkibn1i8n541nngalrp8krc94qy9in801q10d291clwz9i"; - name = "libksane-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libksane-21.12.3.tar.xz"; + sha256 = "0ci2284ysh4q8sbhqcg5bis2v02bp5x64h8n0qik14yy24x852zg"; + name = "libksane-21.12.3.tar.xz"; }; }; libksieve = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libksieve-21.12.2.tar.xz"; - sha256 = "03aaqqb5g9iv49crrf7zbmsri8jjszn5wfvmcw559swalmmyzb4i"; - name = "libksieve-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libksieve-21.12.3.tar.xz"; + sha256 = "1li9cc5y6xbn4m4qa21qmsjd4xzshp67mxwh2nvr17mfs8ray7vd"; + name = "libksieve-21.12.3.tar.xz"; }; }; libktorrent = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/libktorrent-21.12.2.tar.xz"; - sha256 = "06ak3bsy5x6a0r3l9hbfih9m41y3l357rpd42x8qp08djbs11xbf"; - name = "libktorrent-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/libktorrent-21.12.3.tar.xz"; + sha256 = "0i976al9bsc3gbplqbxkxr03sdhxv3yzjlfkdaghga8fkihzkkl0"; + name = "libktorrent-21.12.3.tar.xz"; }; }; lokalize = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/lokalize-21.12.2.tar.xz"; - sha256 = "1x6sb1fw0fqvk3vg299xvih1v2xm9hviv5h1b624maasw071nfyy"; - name = "lokalize-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/lokalize-21.12.3.tar.xz"; + sha256 = "1gzfiajy377kx0iar85z72zqxh7y9vhp1hs03zzqymazawm9lqnn"; + name = "lokalize-21.12.3.tar.xz"; }; }; lskat = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/lskat-21.12.2.tar.xz"; - sha256 = "0v16rg6d2l41xgkrkj8ibh5a0zjyb4jn7am6rbgl6k9g9mfqwdx7"; - name = "lskat-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/lskat-21.12.3.tar.xz"; + sha256 = "1cfs1lfwgxwpn2g56y7jb2c6ijd81bi8ba8ap0yyx6nhv6na072b"; + name = "lskat-21.12.3.tar.xz"; }; }; mailcommon = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/mailcommon-21.12.2.tar.xz"; - sha256 = "01kirl4lk1xq7y474438jv0av3ccg18krlchllcigd9c0vcp67qj"; - name = "mailcommon-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/mailcommon-21.12.3.tar.xz"; + sha256 = "1zi8zkhv9g4vsylqzjm2wr9v6b20irfxhf4q467cmpqqrqpcp3af"; + name = "mailcommon-21.12.3.tar.xz"; }; }; mailimporter = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/mailimporter-21.12.2.tar.xz"; - sha256 = "1ng8w4byq4iiwfzh4acl2glndlr7r9hr62qpj10kpn4fi0qblakb"; - name = "mailimporter-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/mailimporter-21.12.3.tar.xz"; + sha256 = "0lcr9zzdf16f82spr9x33jnzr23sx7xk2zvfpzdki3b5jxvapnsk"; + name = "mailimporter-21.12.3.tar.xz"; }; }; marble = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/marble-21.12.2.tar.xz"; - sha256 = "093drig77dyxwfavx30h2nzdqkn52h6pjn54j7fnwygz4742qv7n"; - name = "marble-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/marble-21.12.3.tar.xz"; + sha256 = "0v6qd9cl6g8k55mjq2lswsfcxzf88w33nlm1193ps3ac0awjaaa4"; + name = "marble-21.12.3.tar.xz"; }; }; markdownpart = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/markdownpart-21.12.2.tar.xz"; - sha256 = "0g7j15s15blqr0lfagmhvxxggdplvmnkf8g2b9ysjkrr49lgk7b6"; - name = "markdownpart-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/markdownpart-21.12.3.tar.xz"; + sha256 = "1drvjrvmd2c36xj3x7kxb7lvk23cmaw8mi976pdfnxn5pdamv6wl"; + name = "markdownpart-21.12.3.tar.xz"; }; }; mbox-importer = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/mbox-importer-21.12.2.tar.xz"; - sha256 = "0qakmg86978zjm2m98602zbaiyiryrmlx2vk93yyv5xg352gphjb"; - name = "mbox-importer-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/mbox-importer-21.12.3.tar.xz"; + sha256 = "01bh0yzv23vkicc7lj217rp8c36kyyjlxmkwylss3hakr4b3afan"; + name = "mbox-importer-21.12.3.tar.xz"; }; }; messagelib = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/messagelib-21.12.2.tar.xz"; - sha256 = "0ln473gdwsscjpsh50h2cbazxbc8qy1mmll9lsfngfw1qq49dwsp"; - name = "messagelib-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/messagelib-21.12.3.tar.xz"; + sha256 = "0xrhnkahqirsz37lbvx505ll7bfhr25lbq89yqq81bxbzkbvamsw"; + name = "messagelib-21.12.3.tar.xz"; }; }; minuet = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/minuet-21.12.2.tar.xz"; - sha256 = "050pmw3srfb800h91x6pqn1vz7s6458w94r2innwc1j04pr8jaxv"; - name = "minuet-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/minuet-21.12.3.tar.xz"; + sha256 = "0r68z3j0j2gbwzj77wvsx1idrfkagj0pjai9j7fbqa0r6q833flr"; + name = "minuet-21.12.3.tar.xz"; }; }; okular = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/okular-21.12.2.tar.xz"; - sha256 = "1k0bwyhk73gshc7f0j6mply2m9ykfd07mhkxwnzj874sby5rxhv9"; - name = "okular-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/okular-21.12.3.tar.xz"; + sha256 = "054rzdqsqkjx2sncyfcnfdvm9bp45sdw3rycmpzicnwpn5j4hcb3"; + name = "okular-21.12.3.tar.xz"; }; }; palapeli = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/palapeli-21.12.2.tar.xz"; - sha256 = "0v5456hm56c7f9d49l5zjql6f4ap72wmkf8in8s95lqmpn42dl17"; - name = "palapeli-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/palapeli-21.12.3.tar.xz"; + sha256 = "076igql89sx55hfxjb79248ih4cjbkr1s1jnz46y3dk793rscm8g"; + name = "palapeli-21.12.3.tar.xz"; }; }; parley = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/parley-21.12.2.tar.xz"; - sha256 = "1cwnlv57yqjm52i0jwl33pz4h9h448h0ljrg598ghby8p3b2i5w7"; - name = "parley-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/parley-21.12.3.tar.xz"; + sha256 = "10hv885l0gz5aymf72f42bhkncfarj768nb12q9fxqk4x5rviiw0"; + name = "parley-21.12.3.tar.xz"; }; }; partitionmanager = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/partitionmanager-21.12.2.tar.xz"; - sha256 = "0rr7ic2ivm7lp3lj20b8rfbx1sr91s24fzxfzfwnw9znl9vj410q"; - name = "partitionmanager-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/partitionmanager-21.12.3.tar.xz"; + sha256 = "0x0k3vsbngcb7kvcgqj2w025fn9xvfd2232lx51xfar5r3jb7h1p"; + name = "partitionmanager-21.12.3.tar.xz"; }; }; picmi = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/picmi-21.12.2.tar.xz"; - sha256 = "0qp8b1di3qnv4xrnpcmyi6myrrwzdlijhvxmacx4ijv7b7wlg4r7"; - name = "picmi-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/picmi-21.12.3.tar.xz"; + sha256 = "0gk1yq5ac55k6lxbxszxpd393fb9k6yphisb71lx2zv9gchl44n6"; + name = "picmi-21.12.3.tar.xz"; }; }; pim-data-exporter = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/pim-data-exporter-21.12.2.tar.xz"; - sha256 = "0m4dq3x5kbncnvixjigb85j6siws6q600piw53qabiwd6w6rp1xy"; - name = "pim-data-exporter-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/pim-data-exporter-21.12.3.tar.xz"; + sha256 = "0qcwsbb4zsjgc15fhq9pp341wwm35y9v1lq8gnpjdsvfq2pczq5q"; + name = "pim-data-exporter-21.12.3.tar.xz"; }; }; pim-sieve-editor = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/pim-sieve-editor-21.12.2.tar.xz"; - sha256 = "1cpazs6q6hv15ib6isif5syvpywxfdi7d3w8vc4pnfj94wkcq3gm"; - name = "pim-sieve-editor-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/pim-sieve-editor-21.12.3.tar.xz"; + sha256 = "1gp4gpagv6pfiy6gyfh14z1rb16iqm1npmngw6ybjlhh6d424n90"; + name = "pim-sieve-editor-21.12.3.tar.xz"; }; }; pimcommon = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/pimcommon-21.12.2.tar.xz"; - sha256 = "1pnhjhnjx98wdc3dg71qgjjj3dsncl56d86cagkk2spicv901p69"; - name = "pimcommon-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/pimcommon-21.12.3.tar.xz"; + sha256 = "1k1d100lr277lgwyzn2ssxsx9x2yd9nfd5657r95vmdnkh2qs517"; + name = "pimcommon-21.12.3.tar.xz"; }; }; poxml = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/poxml-21.12.2.tar.xz"; - sha256 = "1zzw9jwwd5nx12ma2ihffj6nhr3zlpahnj8k0r8mxcyn99j51kyn"; - name = "poxml-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/poxml-21.12.3.tar.xz"; + sha256 = "19hrb75fbh102fw8ajflj4777s7hq7vxv6kbwjir6wzsvdfanwdb"; + name = "poxml-21.12.3.tar.xz"; }; }; print-manager = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/print-manager-21.12.2.tar.xz"; - sha256 = "0xqv7f9p27maa0p20nc92g6240qkcin9s3dldr5b5q944hkkxizq"; - name = "print-manager-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/print-manager-21.12.3.tar.xz"; + sha256 = "1q9vv5v9hivm583hcx8qa7xik9yv4zicrd02abcsn6hvgwmdav8b"; + name = "print-manager-21.12.3.tar.xz"; }; }; rocs = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/rocs-21.12.2.tar.xz"; - sha256 = "1mjrgh0vfc1kvici5m1dx23s1c7qpvfx1br91yglgll1biajzqlq"; - name = "rocs-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/rocs-21.12.3.tar.xz"; + sha256 = "1fgjap71qnaydar9q155is7vwjlkpa8wi1162dsqxr5ywy464wrg"; + name = "rocs-21.12.3.tar.xz"; }; }; signon-kwallet-extension = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/signon-kwallet-extension-21.12.2.tar.xz"; - sha256 = "0qfim8ahklwkixpxcm9sj1w49cmb0wz5r8np6ga3r2rh4vlqdxbf"; - name = "signon-kwallet-extension-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/signon-kwallet-extension-21.12.3.tar.xz"; + sha256 = "0sv0g50bxxd442ia7wzk2lkqwr8lsjxk5wm3zsskxhql851y0ybm"; + name = "signon-kwallet-extension-21.12.3.tar.xz"; }; }; skanlite = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/skanlite-21.12.2.tar.xz"; - sha256 = "1fvdrzyvps0iqb9irnpdn81gmlmfhgfsfb5mg4i259sms6rq3h8m"; - name = "skanlite-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/skanlite-21.12.3.tar.xz"; + sha256 = "06dwmdjrss7cqqigg4rwsy5dya35577qwdaxj2jbvs2pkzp9rq3p"; + name = "skanlite-21.12.3.tar.xz"; }; }; spectacle = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/spectacle-21.12.2.tar.xz"; - sha256 = "1966ynfdkaya1iydi2hfmcr13adk7agjr9ndz2hjrwgjagd29pyr"; - name = "spectacle-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/spectacle-21.12.3.tar.xz"; + sha256 = "155xin26lkjr0swb281afha906nqy2821lf2spmzzxa3xalzq3sv"; + name = "spectacle-21.12.3.tar.xz"; }; }; step = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/step-21.12.2.tar.xz"; - sha256 = "1paq5wpya82s92zwacwbjf96nj52gy1sydk0gndyqi8jdplhlnps"; - name = "step-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/step-21.12.3.tar.xz"; + sha256 = "0j3w63bxj3b4lrfb0mnchlvsr987v5zwwjw5jrgvqidrhv1rh7dc"; + name = "step-21.12.3.tar.xz"; }; }; svgpart = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/svgpart-21.12.2.tar.xz"; - sha256 = "15624gfcn85xkh6lypkw73iidnclprhqhpxrjggbng1x22jg2iwc"; - name = "svgpart-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/svgpart-21.12.3.tar.xz"; + sha256 = "0yg8sn1z9zfb7a6y61nw7vya516sfaydkgxh7cfwiz7sljl87z8j"; + name = "svgpart-21.12.3.tar.xz"; }; }; sweeper = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/sweeper-21.12.2.tar.xz"; - sha256 = "07rqshzjjzqgmm5z0fn1hjd09prcwlnyilp3s61nl5fciby6m8fh"; - name = "sweeper-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/sweeper-21.12.3.tar.xz"; + sha256 = "1l4ag2nhy0da9z4nlf7fmjrim7pmwpm3m4v4y50jlpdv73f63246"; + name = "sweeper-21.12.3.tar.xz"; }; }; umbrello = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/umbrello-21.12.2.tar.xz"; - sha256 = "07bp3rf31x5c1vag6pw0lal9b6zmvsqa8wg8a30kj7k9wabvjprb"; - name = "umbrello-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/umbrello-21.12.3.tar.xz"; + sha256 = "1i94l5hnn8hl0dgdq8sj5xm2vk372zfcnch9qvf9gcvhg08gdif6"; + name = "umbrello-21.12.3.tar.xz"; }; }; yakuake = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/yakuake-21.12.2.tar.xz"; - sha256 = "1xkdyn944ga1xvwbbblnffvlnwgypspr909yvdy6xf5j0qaldsdk"; - name = "yakuake-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/yakuake-21.12.3.tar.xz"; + sha256 = "10mkr8svkjf2s023mf21cil2c5v986s5b2yp1hm0fzdgmawpwrh9"; + name = "yakuake-21.12.3.tar.xz"; }; }; zanshin = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/zanshin-21.12.2.tar.xz"; - sha256 = "1ilgswm4jbjk1mbvcrdi451f1w4vwx3ah6y32a3y5a9blbh9bh6c"; - name = "zanshin-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/zanshin-21.12.3.tar.xz"; + sha256 = "1cwawpmx5hc60zkdkyh484lp3bwiipn6c3yh164gzw769vz9zr71"; + name = "zanshin-21.12.3.tar.xz"; }; }; zeroconf-ioslave = { - version = "21.12.2"; + version = "21.12.3"; src = fetchurl { - url = "${mirror}/stable/release-service/21.12.2/src/zeroconf-ioslave-21.12.2.tar.xz"; - sha256 = "0b59npqhmf3yvp9x0jm29bwzlyl0vm9l56jlsgwgiq7pwis5njwd"; - name = "zeroconf-ioslave-21.12.2.tar.xz"; + url = "${mirror}/stable/release-service/21.12.3/src/zeroconf-ioslave-21.12.3.tar.xz"; + sha256 = "09jmf233njbqam1swzvpzfgdplpjzdx48vjy6kcpmjvg2qlm7i2l"; + name = "zeroconf-ioslave-21.12.3.tar.xz"; }; }; } diff --git a/pkgs/applications/misc/gnome-solanum/default.nix b/pkgs/applications/misc/gnome-solanum/default.nix index 8ad1267afa9..e7d2489bdb5 100644 --- a/pkgs/applications/misc/gnome-solanum/default.nix +++ b/pkgs/applications/misc/gnome-solanum/default.nix @@ -1,6 +1,7 @@ { lib , stdenv , fetchFromGitLab +, fetchpatch , rustPlatform , desktop-file-utils , meson @@ -27,6 +28,15 @@ stdenv.mkDerivation rec { sha256 = "0cga6cz6jfbipzp008rjznkz7844licdc34lk133fcyqil0cg0ap"; }; + patches = [ + # Fix build with meson 0.61, can be removed on next update + # https://gitlab.gnome.org/World/Solanum/-/merge_requests/49 + (fetchpatch { + url = "https://gitlab.gnome.org/World/Solanum/-/commit/e5c5d88f95b0fe4145c9ed346b8ca98a613d7cfe.patch"; + sha256 = "j84P9KzMr0o38u4OD4ZPst+yqw1LCRoa1awT3nelFDI="; + }) + ]; + cargoDeps = rustPlatform.fetchCargoTarball { inherit src; name = "${pname}-${version}"; diff --git a/pkgs/applications/misc/pdfslicer/default.nix b/pkgs/applications/misc/pdfslicer/default.nix index 31bc4714015..ed20f460a16 100644 --- a/pkgs/applications/misc/pdfslicer/default.nix +++ b/pkgs/applications/misc/pdfslicer/default.nix @@ -24,6 +24,12 @@ stdenv.mkDerivation rec { sha256 = "0sja0ddd9c8wjjpzk2ag8q1lxpj09adgmhd7wnsylincqnj2jyls"; }; + postPatch = '' + # Don't build tests, vendored catch doesn't build with latest glibc. + substituteInPlace CMakeLists.txt \ + --replace "add_subdirectory (tests)" "" + ''; + nativeBuildInputs = [ cmake gettext diff --git a/pkgs/applications/misc/trenchbroom/default.nix b/pkgs/applications/misc/trenchbroom/default.nix index 8a702506060..a49fbf71191 100644 --- a/pkgs/applications/misc/trenchbroom/default.nix +++ b/pkgs/applications/misc/trenchbroom/default.nix @@ -21,6 +21,19 @@ stdenv.mkDerivation rec { --subst-var-by APP_VERSION_YEAR ${lib.versions.major version} \ --subst-var-by APP_VERSION_NUMBER ${lib.versions.minor version} \ --subst-var-by GIT_DESCRIBE v${version} + + # Tests don't compile because of vendored `catch2` being incompatible with glibc-2.34. + # Also, no need to since we don't even run them. + substituteInPlace lib/CMakeLists.txt \ + --replace "add_subdirectory(Catch2)" "" + substituteInPlace lib/vecmath/CMakeLists.txt \ + --replace "add_subdirectory(test)" "" \ + --replace "add_subdirectory(lib)" "" + substituteInPlace lib/kdl/CMakeLists.txt \ + --replace "add_subdirectory(test)" "" + substituteInPlace common/CMakeLists.txt \ + --replace "add_subdirectory(test)" "" \ + --replace "add_subdirectory(benchmark)" "" ''; nativeBuildInputs = [ cmake git pandoc wrapQtAppsHook copyDesktopItems ]; diff --git a/pkgs/applications/networking/cluster/arkade/default.nix b/pkgs/applications/networking/cluster/arkade/default.nix index 297e12a80a2..2ee7374e81b 100644 --- a/pkgs/applications/networking/cluster/arkade/default.nix +++ b/pkgs/applications/networking/cluster/arkade/default.nix @@ -6,13 +6,13 @@ buildGoModule rec { pname = "arkade"; - version = "0.8.18"; + version = "0.8.19"; src = fetchFromGitHub { owner = "alexellis"; repo = "arkade"; rev = version; - sha256 = "sha256-VQI2eAxOkOkwYkTM/UyyK6lnXFoLFHWE/ekm5qLN9OE="; + sha256 = "sha256-GbuDL0JSG0r2LVcdJgQFBMNDpAl2WbhjIX0Ls9yCDYg="; }; CGO_ENABLED = 0; diff --git a/pkgs/applications/networking/cluster/kube3d/default.nix b/pkgs/applications/networking/cluster/kube3d/default.nix index 0da63fae421..ebcb3bda738 100644 --- a/pkgs/applications/networking/cluster/kube3d/default.nix +++ b/pkgs/applications/networking/cluster/kube3d/default.nix @@ -15,7 +15,7 @@ buildGoModule rec { nativeBuildInputs = [ installShellFiles ]; - excludedPackages = "\\(tools\\|docgen\\)"; + excludedPackages = [ "tools" "docgen" ]; ldflags = let t = "github.com/rancher/k3d/v5/version"; in diff --git a/pkgs/applications/networking/cluster/kubeless/default.nix b/pkgs/applications/networking/cluster/kubeless/default.nix deleted file mode 100644 index 537fb611783..00000000000 --- a/pkgs/applications/networking/cluster/kubeless/default.nix +++ /dev/null @@ -1,38 +0,0 @@ -{ lib, buildGoPackage, fetchFromGitHub, installShellFiles }: - -buildGoPackage rec { - pname = "kubeless"; - version = "1.0.7"; - - src = fetchFromGitHub { - owner = "kubeless"; - repo = "kubeless"; - rev = "v${version}"; - sha256 = "0x2hydywnnlh6arzz71p7gg9yzq5z2y2lppn1jszvkbgh11kkqfr"; - }; - - goPackagePath = "github.com/kubeless/kubeless"; - - nativeBuildInputs = [ installShellFiles ]; - - subPackages = [ "cmd/kubeless" ]; - - ldflags = [ - "-s" "-w" "-X github.com/kubeless/kubeless/pkg/version.Version=${version}" - ]; - - postInstall = '' - for shell in bash; do - $out/bin/kubeless completion $shell > kubeless.$shell - installShellCompletion kubeless.$shell - done - ''; - - meta = with lib; { - homepage = "https://kubeless.io"; - description = "The Kubernetes Native Serverless Framework"; - license = licenses.asl20; - maintainers = with maintainers; []; - platforms = platforms.unix; - }; -} diff --git a/pkgs/applications/networking/cluster/tektoncd-cli/default.nix b/pkgs/applications/networking/cluster/tektoncd-cli/default.nix index bdd538ef804..673a8c9a8f0 100644 --- a/pkgs/applications/networking/cluster/tektoncd-cli/default.nix +++ b/pkgs/applications/networking/cluster/tektoncd-cli/default.nix @@ -19,7 +19,7 @@ buildGoModule rec { # third_party/VENDOR-LICENSE breaks build/check as go files are still included # docs is a tool for generating docs - excludedPackages = "\\(third_party\\|cmd/docs\\)"; + excludedPackages = [ "third_party" "cmd/docs" ]; preCheck = '' # some tests try to write to the home dir diff --git a/pkgs/applications/networking/instant-messengers/alfaview/default.nix b/pkgs/applications/networking/instant-messengers/alfaview/default.nix index ebed984c4d5..a810dbdc3a1 100644 --- a/pkgs/applications/networking/instant-messengers/alfaview/default.nix +++ b/pkgs/applications/networking/instant-messengers/alfaview/default.nix @@ -5,11 +5,11 @@ stdenv.mkDerivation rec { pname = "alfaview"; - version = "8.40.0"; + version = "8.41.0"; src = fetchurl { url = "https://production-alfaview-assets.alfaview.com/stable/linux/${pname}_${version}.deb"; - sha256 = "sha256-meiIDIG7OXxF2aclHA/8FN8aSz5KWJliDbm2p/flD4k="; + sha256 = "sha256-qW+MB71sylKJQycSX6hiBgxAO4MuhnBaPGFjm+6y4vk="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/networking/instant-messengers/pond/default.nix b/pkgs/applications/networking/instant-messengers/pond/default.nix index c7b5d56dbba..568a2a5bd51 100644 --- a/pkgs/applications/networking/instant-messengers/pond/default.nix +++ b/pkgs/applications/networking/instant-messengers/pond/default.nix @@ -24,7 +24,7 @@ buildGoPackage rec { ++ lib.optional stdenv.hostPlatform.isx86_64 dclxvi ++ lib.optionals gui [ wrapGAppsHook ]; tags = lib.optionals (!gui) [ "nogui" ]; - excludedPackages = "\\(appengine\\|bn256cgo\\)"; + excludedPackages = [ "appengine" "bn256cgo" ]; postPatch = lib.optionalString stdenv.hostPlatform.isx86_64 '' grep -r 'bn256' | awk -F: '{print $1}' | xargs sed -i \ -e "s,golang.org/x/crypto/bn256,github.com/agl/pond/bn256cgo,g" \ diff --git a/pkgs/applications/networking/sniffers/wireshark/default.nix b/pkgs/applications/networking/sniffers/wireshark/default.nix index 931606f3248..468a06af209 100644 --- a/pkgs/applications/networking/sniffers/wireshark/default.nix +++ b/pkgs/applications/networking/sniffers/wireshark/default.nix @@ -1,6 +1,6 @@ { lib, stdenv, fetchurl, pkg-config, pcre, perl, flex, bison, gettext, libpcap, libnl, c-ares , gnutls, libgcrypt, libgpg-error, geoip, openssl, lua5, python3, libcap, glib -, libssh, nghttp2, zlib, cmake, makeWrapper +, libssh, nghttp2, zlib, cmake, makeWrapper, wrapGAppsHook , withQt ? true, qt5 ? null , ApplicationServices, SystemConfiguration, gmp , asciidoctor @@ -34,7 +34,8 @@ in stdenv.mkDerivation { # Avoid referencing -dev paths because of debug assertions. NIX_CFLAGS_COMPILE = [ "-DQT_NO_DEBUG" ]; - nativeBuildInputs = [ asciidoctor bison cmake flex makeWrapper pkg-config ] ++ optional withQt qt5.wrapQtAppsHook; + nativeBuildInputs = [ asciidoctor bison cmake flex makeWrapper pkg-config ] + ++ optionals withQt [ qt5.wrapQtAppsHook wrapGAppsHook ]; buildInputs = [ gettext pcre perl libpcap lua5 libssh nghttp2 openssl libgcrypt @@ -85,6 +86,12 @@ in stdenv.mkDerivation { dontFixCmake = true; + # Prevent double-wrapping, inject wrapper args manually instead. + dontWrapGApps = true; + preFixup = '' + qtWrapperArgs+=("''${gappsWrapperArgs[@]}") + ''; + shellHook = '' # to be able to run the resulting binary export WIRESHARK_RUN_FROM_BUILD_DIRECTORY=1 diff --git a/pkgs/applications/science/chemistry/jmol/default.nix b/pkgs/applications/science/chemistry/jmol/default.nix index a747b96dd18..fe3e05b6562 100644 --- a/pkgs/applications/science/chemistry/jmol/default.nix +++ b/pkgs/applications/science/chemistry/jmol/default.nix @@ -25,14 +25,14 @@ let }; in stdenv.mkDerivation rec { - version = "14.32.39"; + version = "14.32.45"; pname = "jmol"; src = let baseVersion = "${lib.versions.major version}.${lib.versions.minor version}"; in fetchurl { url = "mirror://sourceforge/jmol/Jmol/Version%20${baseVersion}/Jmol%20${version}/Jmol-${version}-binary.tar.gz"; - sha256 = "sha256-ekwipWWGsXYECJBOmw0+uIWHDpdF8T8jZUo6LeqD6Io="; + sha256 = "sha256-9bcOwORHLZfn95RFur4JdP3Djpq8K8utnWIsniqKAI4="; }; patchPhase = '' diff --git a/pkgs/applications/science/logic/potassco/clingcon.nix b/pkgs/applications/science/logic/potassco/clingcon.nix index 1614adf4553..d7ec2e72433 100644 --- a/pkgs/applications/science/logic/potassco/clingcon.nix +++ b/pkgs/applications/science/logic/potassco/clingcon.nix @@ -2,6 +2,7 @@ , fetchFromGitHub , cmake , clingo +, catch2 }: stdenv.mkDerivation rec { @@ -15,6 +16,10 @@ stdenv.mkDerivation rec { sha256 = "1g2xkz9nsgqnrw3fdf5jchl16f0skj5mm32va61scc2yrchll166"; }; + postPatch = '' + cp ${catch2}/include/catch2/catch.hpp libclingcon/tests/catch.hpp + ''; + nativeBuildInputs = [ cmake clingo ]; cmakeFlags = [ diff --git a/pkgs/applications/version-management/git-and-tools/git/default.nix b/pkgs/applications/version-management/git-and-tools/git/default.nix index 13da857b790..1f08cd26ef3 100644 --- a/pkgs/applications/version-management/git-and-tools/git/default.nix +++ b/pkgs/applications/version-management/git-and-tools/git/default.nix @@ -32,7 +32,9 @@ let in stdenv.mkDerivation { - pname = "git"; + pname = "git" + + lib.optionalString svnSupport "-with-svn" + + lib.optionalString (!svnSupport && !guiSupport && !sendEmailSupport && !withManual && !pythonSupport && !withpcre2) "-minimal"; inherit version; src = fetchurl { @@ -166,8 +168,13 @@ stdenv.mkDerivation { cp -a contrib $out/share/git/ mkdir -p $out/share/bash-completion/completions ln -s $out/share/git/contrib/completion/git-completion.bash $out/share/bash-completion/completions/git - mkdir -p $out/share/bash-completion/completions ln -s $out/share/git/contrib/completion/git-prompt.sh $out/share/bash-completion/completions/ + # only readme, developed in another repo + rm -r contrib/hooks/multimail + mkdir -p $out/share/git-core/contrib + cp -a contrib/hooks/ $out/share/git-core/contrib/ + substituteInPlace $out/share/git-core/contrib/hooks/pre-auto-gc-battery \ + --replace ' grep' ' ${gnugrep}/bin/grep' \ # grep is a runtime dependency, need to patch so that it's found substituteInPlace $out/libexec/git-core/git-sh-setup \ diff --git a/pkgs/applications/version-management/git-and-tools/hut/default.nix b/pkgs/applications/version-management/git-and-tools/hut/default.nix index ad0c02aa2e0..49e5fa675a9 100644 --- a/pkgs/applications/version-management/git-and-tools/hut/default.nix +++ b/pkgs/applications/version-management/git-and-tools/hut/default.nix @@ -2,21 +2,20 @@ , buildGoModule , fetchFromSourcehut , scdoc -, unstableGitUpdater }: -buildGoModule { +buildGoModule rec { pname = "hut"; - version = "unstable-2022-03-02"; + version = "0.1.0"; src = fetchFromSourcehut { owner = "~emersion"; repo = "hut"; - rev = "55ad2fbd9ceeeb9e7dc203c15476fa785f1209e0"; - sha256 = "sha256-j2IVwCm7iq3JKccPL8noRBhqw+V+4qfcpAwV65xhZk0="; + rev = "v${version}"; + sha256 = "sha256-2YUrDPulpLQQGw31nEasHoQ/AppECg7acwwqu6JDT5U="; }; - vendorSha256 = "sha256-zdQvk0M1a+Y90pnhqIpKxLJnlVJqMoSycewTep2Oux4="; + vendorSha256 = "sha256-EmokL3JlyM6C5/NOarCAJuqNsDO2tgHwqQdv0rAk+Xk="; nativeBuildInputs = [ scdoc @@ -32,8 +31,6 @@ buildGoModule { make $makeFlags install ''; - passthru.updateScript = unstableGitUpdater { }; - meta = with lib; { homepage = "https://sr.ht/~emersion/hut/"; description = "A CLI tool for Sourcehut / sr.ht"; diff --git a/pkgs/applications/version-management/github-desktop/default.nix b/pkgs/applications/version-management/github-desktop/default.nix index 83991407fd4..6017d105fed 100644 --- a/pkgs/applications/version-management/github-desktop/default.nix +++ b/pkgs/applications/version-management/github-desktop/default.nix @@ -19,11 +19,11 @@ stdenv.mkDerivation rec { pname = "github-desktop"; - version = "2.9.9"; + version = "2.9.12"; src = fetchurl { url = "https://github.com/shiftkey/desktop/releases/download/release-${version}-linux1/GitHubDesktop-linux-${version}-linux1.deb"; - sha256 = "sha256-LMKOxQR3Bgw00LnKqAe2hq+eASgwC7y0cxNSSt/sjWA="; + sha256 = "sha256-tr1u6q7sHI1Otor53d1F7J0f9eV9tKtLZx8+40I16y8="; }; nativeBuildInputs = [ diff --git a/pkgs/applications/version-management/mercurial/default.nix b/pkgs/applications/version-management/mercurial/default.nix index 9dc3e0329e3..48987291599 100644 --- a/pkgs/applications/version-management/mercurial/default.nix +++ b/pkgs/applications/version-management/mercurial/default.nix @@ -21,18 +21,13 @@ let self = python3Packages.buildPythonApplication rec { pname = "mercurial${lib.optionalString fullBuild "-full"}"; - version = "6.1"; + version = "6.1.1"; src = fetchurl { url = "https://mercurial-scm.org/release/mercurial-${version}.tar.gz"; - sha256 = "sha256-hvmGReRWWpJWmR3N4it3uOfSLKb7tgwfTNvYRpo4zB8="; + sha256 = "sha256-V7ikYdDOE9muOBfYqL35Ay407fqsPbzLO2a4NdzpM4g="; }; - patches = [ - # Fix the type of libc buffer for aarch64-linux - ./fix-rhg-type-aarch64.patch - ]; - format = "other"; passthru = { inherit python; }; # pass it so that the same version can be used in hg2git @@ -40,7 +35,7 @@ let cargoDeps = if rustSupport then rustPlatform.fetchCargoTarball { inherit src; name = "mercurial-${version}"; - sha256 = "sha256-+Y91gEC8vmyutNpVFAAL4MSg4KnpFbhH12CIuMRx0Mc="; + sha256 = "sha256-HYH7+OD11kdZdxFrx1KVle1NesS3fAgwVXJpAeiXDTo="; sourceRoot = "mercurial-${version}/rust"; } else null; cargoRoot = if rustSupport then "rust" else null; diff --git a/pkgs/applications/version-management/mercurial/fix-rhg-type-aarch64.patch b/pkgs/applications/version-management/mercurial/fix-rhg-type-aarch64.patch deleted file mode 100644 index 84417b497c0..00000000000 --- a/pkgs/applications/version-management/mercurial/fix-rhg-type-aarch64.patch +++ /dev/null @@ -1,12 +0,0 @@ -diff --git a/rust/hg-core/src/lock.rs b/rust/hg-core/src/lock.rs ---- a/rust/hg-core/src/lock.rs -+++ b/rust/hg-core/src/lock.rs -@@ -145,7 +145,7 @@ lazy_static::lazy_static! { - - /// Same as https://github.com/python/cpython/blob/v3.10.0/Modules/socketmodule.c#L5414 - const BUFFER_SIZE: usize = 1024; -- let mut buffer = [0_i8; BUFFER_SIZE]; -+ let mut buffer = [0 as libc::c_char; BUFFER_SIZE]; - let hostname_bytes = unsafe { - let result = libc::gethostname(buffer.as_mut_ptr(), BUFFER_SIZE); - if result != 0 { diff --git a/pkgs/applications/version-management/rcs/default.nix b/pkgs/applications/version-management/rcs/default.nix index d46a67a8601..6982bd43b26 100644 --- a/pkgs/applications/version-management/rcs/default.nix +++ b/pkgs/applications/version-management/rcs/default.nix @@ -9,6 +9,14 @@ stdenv.mkDerivation rec { sha256 = "sha256-Q93+EHJKi4XiRo9kA7YABzcYbwHmDgvWL95p2EIjTMU="; }; + patches = [ + # glibc 2.34 compat + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/rcs/raw/f8e07cd37f4abfb36e37d41852bb8f9e234d3fb1/f/rcs-5.10.0-SIGSTKSZ.patch"; + sha256 = "sha256-mc6Uye9mdEsLBcOnf1m1TUb1BV0ncNU//iKBpLGBjho="; + }) + ]; + ac_cv_path_ED = "${ed}/bin/ed"; DIFF = "${diffutils}/bin/diff"; DIFF3 = "${diffutils}/bin/diff3"; diff --git a/pkgs/applications/video/ani-cli/default.nix b/pkgs/applications/video/ani-cli/default.nix index 6883587b4b8..1cd44bd3488 100644 --- a/pkgs/applications/video/ani-cli/default.nix +++ b/pkgs/applications/video/ani-cli/default.nix @@ -12,13 +12,13 @@ stdenvNoCC.mkDerivation rec { pname = "ani-cli"; - version = "1.9"; + version = "2.0"; src = fetchFromGitHub { owner = "pystardust"; repo = "ani-cli"; rev = "v${version}"; - sha256 = "sha256-oYiq3Mnuhba5NELJXqVN3gY/d0RfQIqW13YtdcmYKK4="; + sha256 = "sha256-cDxb/IcpzR5akWnA8RN+fKQn0+QnpBV8tAbUjjPICsA="; }; nativeBuildInputs = [ makeWrapper ]; diff --git a/pkgs/applications/video/quvi/library.nix b/pkgs/applications/video/quvi/library.nix index 071e67a1721..548b3d7f972 100644 --- a/pkgs/applications/video/quvi/library.nix +++ b/pkgs/applications/video/quvi/library.nix @@ -18,5 +18,6 @@ stdenv.mkDerivation rec { license = lib.licenses.lgpl21Plus; platforms = lib.platforms.linux; maintainers = [ ]; + broken = true; # missing glibc-2.34 support, no upstream activity }; } diff --git a/pkgs/applications/video/quvi/scripts.nix b/pkgs/applications/video/quvi/scripts.nix index 676d073900c..a31ef6e72ae 100644 --- a/pkgs/applications/video/quvi/scripts.nix +++ b/pkgs/applications/video/quvi/scripts.nix @@ -17,5 +17,6 @@ stdenv.mkDerivation rec { license = lib.licenses.lgpl21Plus; platforms = lib.platforms.linux; maintainers = [ ]; + broken = true; # missing glibc-2.34 support, no upstream activity }; } diff --git a/pkgs/applications/video/quvi/tool.nix b/pkgs/applications/video/quvi/tool.nix index 87c8066a976..ad6233cbd00 100644 --- a/pkgs/applications/video/quvi/tool.nix +++ b/pkgs/applications/video/quvi/tool.nix @@ -21,5 +21,6 @@ stdenv.mkDerivation rec { license = lib.licenses.lgpl21Plus; platforms = lib.platforms.linux; maintainers = [ ]; + broken = true; # missing glibc-2.34 support, no upstream activity }; } diff --git a/pkgs/build-support/docker/default.nix b/pkgs/build-support/docker/default.nix index 96ea363c811..5a4e30ede8a 100644 --- a/pkgs/build-support/docker/default.nix +++ b/pkgs/build-support/docker/default.nix @@ -16,8 +16,8 @@ , makeWrapper , moreutils , nix +, nixosTests , pigz -, pkgs , rsync , runCommand , runtimeShell @@ -26,6 +26,7 @@ , storeDir ? builtins.storeDir , substituteAll , symlinkJoin +, tarsum , util-linux , vmTools , writeReferencesToFile @@ -81,6 +82,15 @@ rec { inherit buildImage buildLayeredImage fakeNss pullImage shadowSetup buildImageWithNixDb; }; + tests = { + inherit (nixosTests) + docker-tools + docker-tools-overlay + # requires remote builder + # docker-tools-cross + ; + }; + pullImage = let fixName = name: builtins.replaceStrings [ "/" ":" ] [ "-" "-" ] name; @@ -113,7 +123,7 @@ rec { outputHashAlgo = "sha256"; outputHash = sha256; - nativeBuildInputs = lib.singleton skopeo; + nativeBuildInputs = [ skopeo ]; SSL_CERT_FILE = "${cacert.out}/etc/ssl/certs/ca-bundle.crt"; sourceURL = "docker://${imageName}@${imageDigest}"; @@ -132,7 +142,7 @@ rec { # We need to sum layer.tar, not a directory, hence tarsum instead of nix-hash. # And we cannot untar it, because then we cannot preserve permissions etc. - tarsum = pkgs.tarsum; + inherit tarsum; # pkgs.dockerTools.tarsum # buildEnv creates symlinks to dirs, which is hard to edit inside the overlay VM mergeDrvs = @@ -754,7 +764,7 @@ rec { # "#!/usr/bin/env executable" shebang. usrBinEnv = runCommand "usr-bin-env" { } '' mkdir -p $out/usr/bin - ln -s ${pkgs.coreutils}/bin/env $out/usr/bin + ln -s ${coreutils}/bin/env $out/usr/bin ''; # This provides /bin/sh, pointing to bashInteractive. diff --git a/pkgs/build-support/docker/examples.nix b/pkgs/build-support/docker/examples.nix index 941ee048666..169edb171db 100644 --- a/pkgs/build-support/docker/examples.nix +++ b/pkgs/build-support/docker/examples.nix @@ -486,7 +486,7 @@ rec { cross = let # Cross compile for x86_64 if on aarch64 crossPkgs = - if pkgs.system == "aarch64-linux" then pkgsCross.gnu64 + if pkgs.stdenv.hostPlatform.system == "aarch64-linux" then pkgsCross.gnu64 else pkgsCross.aarch64-multiplatform; in crossPkgs.dockerTools.buildImage { name = "hello-cross"; diff --git a/pkgs/build-support/make-desktopitem/default.nix b/pkgs/build-support/make-desktopitem/default.nix index d831fe24d33..e09fd0e20f2 100644 --- a/pkgs/build-support/make-desktopitem/default.nix +++ b/pkgs/build-support/make-desktopitem/default.nix @@ -34,11 +34,6 @@ , extraConfig ? {} # Additional values to be added literally to the final item, e.g. vendor extensions }: let - # FIXME: workaround until https://github.com/NixOS/nixpkgs/pull/162246 lands - cleanName = if lib.hasInfix " " name - then throw "makeDesktopItem: name must not contain spaces!" - else name; - # There are multiple places in the FDO spec that make "boolean" values actually tristate, # e.g. StartupNotify, where "unset" is literally defined as "do something reasonable". # So, handle null values separately. @@ -116,8 +111,8 @@ let content = [ mainSectionRendered ] ++ actionsRendered; in writeTextFile { - name = "${cleanName}.desktop"; - destination = "/share/applications/${cleanName}.desktop"; + name = "${name}.desktop"; + destination = "/share/applications/${name}.desktop"; text = builtins.concatStringsSep "\n" content; - checkPhase = "${buildPackages.desktop-file-utils}/bin/desktop-file-validate $target"; + checkPhase = ''${buildPackages.desktop-file-utils}/bin/desktop-file-validate "$target"''; } diff --git a/pkgs/build-support/test-equal-derivation.nix b/pkgs/build-support/test-equal-derivation.nix index 5d2185ce165..652f3716b2a 100644 --- a/pkgs/build-support/test-equal-derivation.nix +++ b/pkgs/build-support/test-equal-derivation.nix @@ -23,7 +23,7 @@ let drvB = builtins.unsafeDiscardOutputDependency b.drvPath or (throw "testEqualDerivation third argument must be a package"); name = if a?name - then lib.strings.sanitizeDerivationName "testEqualDerivation-${a.name}" + then "testEqualDerivation-${a.name}" else "testEqualDerivation"; in if drvA == drvB then diff --git a/pkgs/build-support/trivial-builders.nix b/pkgs/build-support/trivial-builders.nix index 68f0f1bc4dd..4a3d3778881 100644 --- a/pkgs/build-support/trivial-builders.nix +++ b/pkgs/build-support/trivial-builders.nix @@ -70,8 +70,7 @@ rec { # name of the resulting derivation }: buildCommand: stdenv.mkDerivation ({ - name = lib.strings.sanitizeDerivationName name; - inherit buildCommand; + inherit buildCommand name; passAsFile = [ "buildCommand" ] ++ (derivationArgs.passAsFile or []); } @@ -121,7 +120,7 @@ rec { allowSubstitutes = false; } '' - target=$out${destination} + target=$out${lib.escapeShellArg destination} mkdir -p "$(dirname "$target")" if [ -e "$textPath" ]; then diff --git a/pkgs/build-support/trivial-builders/test/write-text-file.nix b/pkgs/build-support/trivial-builders/test/write-text-file.nix new file mode 100644 index 00000000000..ac83a75fca4 --- /dev/null +++ b/pkgs/build-support/trivial-builders/test/write-text-file.nix @@ -0,0 +1,34 @@ +{ writeTextFile }: +let + veryWeirdName = ''here's a name with some "bad" characters, like spaces and quotes''; +in writeTextFile { + name = "weird-names"; + destination = "/etc/${veryWeirdName}"; + text = ''passed!''; + checkPhase = '' + # intentionally hardcode everything here, to make sure + # Nix does not mess with file paths + + name="here's a name with some \"bad\" characters, like spaces and quotes" + fullPath="$out/etc/$name" + + if [ -f "$fullPath" ]; then + echo "[PASS] File exists!" + else + echo "[FAIL] File was not created at expected path!" + exit 1 + fi + + content=$(<"$fullPath") + expected="passed!" + + if [ "$content" = "$expected" ]; then + echo "[PASS] Contents match!" + else + echo "[FAIL] File contents don't match!" + echo " Expected: $expected" + echo " Got: $content" + exit 2 + fi + ''; +} diff --git a/pkgs/data/icons/hicolor-icon-theme/default.nix b/pkgs/data/icons/hicolor-icon-theme/default.nix index 3a8839844f1..4a58b8fb89a 100644 --- a/pkgs/data/icons/hicolor-icon-theme/default.nix +++ b/pkgs/data/icons/hicolor-icon-theme/default.nix @@ -1,10 +1,11 @@ { lib, stdenv, fetchurl }: stdenv.mkDerivation rec { - name = "hicolor-icon-theme-0.17"; + pname = "hicolor-icon-theme"; + version = "0.17"; src = fetchurl { - url = "https://icon-theme.freedesktop.org/releases/${name}.tar.xz"; + url = "https://icon-theme.freedesktop.org/releases/hicolor-icon-theme-${version}.tar.xz"; sha256 = "1n59i3al3zx6p90ff0l43gzpzmlqnzm6hf5cryxqrlbi48sq8x1i"; }; diff --git a/pkgs/data/misc/iana-etc/default.nix b/pkgs/data/misc/iana-etc/default.nix index 5e7e70a1b05..cab93d737c3 100644 --- a/pkgs/data/misc/iana-etc/default.nix +++ b/pkgs/data/misc/iana-etc/default.nix @@ -1,9 +1,8 @@ { lib, fetchzip, stdenvNoCC, writeText }: -let +stdenvNoCC.mkDerivation rec { + pname = "iana-etc"; version = "20211124"; -in stdenvNoCC.mkDerivation { - name = "iana-etc-${version}"; src = fetchzip { url = "https://github.com/Mic92/iana-etc/releases/download/${version}/iana-etc-${version}.tar.gz"; sha256 = "sha256-4mM/ZeGd91e1AklGHFK5UB4llg9IgCo9DKcM0iXcBls="; diff --git a/pkgs/data/misc/tzdata/default.nix b/pkgs/data/misc/tzdata/default.nix index 78c93b05033..b149f448da7 100644 --- a/pkgs/data/misc/tzdata/default.nix +++ b/pkgs/data/misc/tzdata/default.nix @@ -2,16 +2,16 @@ stdenv.mkDerivation rec { pname = "tzdata"; - version = "2021e"; + version = "2022a"; srcs = [ (fetchurl { url = "https://data.iana.org/time-zones/releases/tzdata${version}.tar.gz"; - sha256 = "1cdjdcxl0s9xf0dg1z64kh7llm80byxqlzrkkjzcdlyh6yvl5v07"; + sha256 = "0r0nhwpk9nyxj5kkvjy58nr5d85568m04dcb69c4y3zmykczyzzg"; }) (fetchurl { url = "https://data.iana.org/time-zones/releases/tzcode${version}.tar.gz"; - sha256 = "0x8pcfmjvxk29yfh8bklchv2f0vpl4yih0gc4wyx292l78wncijq"; + sha256 = "1iysv8fdkm79k8wh8jizmjmq075q4qjhk090vxjy57my6dz5wmzq"; }) ]; diff --git a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook-ebnf/default.nix b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook-ebnf/default.nix index 1c6e57b3e7a..6be2e89dcd2 100644 --- a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook-ebnf/default.nix +++ b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook-ebnf/default.nix @@ -1,10 +1,11 @@ {lib, stdenv, fetchurl}: -stdenv.mkDerivation { - name = "docbook-xml-ebnf-1.2b1"; +stdenv.mkDerivation rec { + pname = "docbook-xml-ebnf"; + version = "1.2b1"; dtd = fetchurl { - url = "http://www.docbook.org/xml/ebnf/1.2b1/dbebnf.dtd"; + url = "https://docbook.org/xml/ebnf/${version}/dbebnf.dtd"; sha256 = "0min5dsc53my13b94g2yd65q1nkjcf4x1dak00bsc4ckf86mrx95"; }; catalog = ./docbook-ebnf.cat; diff --git a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.1.2.nix b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.1.2.nix index 8a10defa0fb..c367e2a1d0c 100644 --- a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.1.2.nix +++ b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.1.2.nix @@ -1,27 +1,22 @@ {lib, stdenv, fetchurl, unzip, findXMLCatalogs}: let - # Urgh, DocBook 4.1.2 doesn't come with an XML catalog. Use the one # from 4.2. docbook42catalog = fetchurl { - url = "http://www.docbook.org/xml/4.2/catalog.xml"; + url = "https://docbook.org/xml/4.2/catalog.xml"; sha256 = "18lhp6q2l0753s855r638shkbdwq9blm6akdjsc9nrik24k38j17"; }; - in import ./generic.nix { inherit lib stdenv unzip findXMLCatalogs; - name = "docbook-xml-4.1.2"; + version = "4.1.2"; src = fetchurl { - url = "http://www.docbook.org/xml/4.1.2/docbkx412.zip"; + url = "https://docbook.org/xml/4.1.2/docbkx412.zip"; sha256 = "0wkp5rvnqj0ghxia0558mnn4c7s3n501j99q2isp3sp0ci069w1h"; }; postInstall = " sed 's|V4.2|V4.1.2|g' < ${docbook42catalog} > catalog.xml "; - meta = { - branch = "4.1.2"; - }; } diff --git a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.2.nix b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.2.nix index 9a9abc0588b..8f778ea7505 100644 --- a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.2.nix +++ b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.2.nix @@ -2,12 +2,9 @@ import ./generic.nix { inherit lib stdenv unzip findXMLCatalogs; - name = "docbook-xml-4.2"; + version = "4.2"; src = fetchurl { - url = "http://www.docbook.org/xml/4.2/docbook-xml-4.2.zip"; + url = "https://docbook.org/xml/4.2/docbook-xml-4.2.zip"; sha256 = "acc4601e4f97a196076b7e64b368d9248b07c7abf26b34a02cca40eeebe60fa2"; }; - meta = { - branch = "4.2"; - }; } diff --git a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.3.nix b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.3.nix index 4d821ce2ffb..a58370ec4ac 100644 --- a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.3.nix +++ b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.3.nix @@ -2,12 +2,9 @@ import ./generic.nix { inherit lib stdenv unzip findXMLCatalogs; - name = "docbook-xml-4.3"; + version = "4.3"; src = fetchurl { - url = "http://www.docbook.org/xml/4.3/docbook-xml-4.3.zip"; + url = "https://docbook.org/xml/4.3/docbook-xml-4.3.zip"; sha256 = "0r1l2if1z4wm2v664sqdizm4gak6db1kx9y50jq89m3gxaa8l1i3"; }; - meta = { - branch = "4.3"; - }; } diff --git a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.4.nix b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.4.nix index ca847d3e436..3b46fe81bd7 100644 --- a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.4.nix +++ b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.4.nix @@ -2,12 +2,9 @@ import ./generic.nix { inherit lib stdenv unzip findXMLCatalogs; - name = "docbook-xml-4.4"; + version = "4.4"; src = fetchurl { - url = "http://www.docbook.org/xml/4.4/docbook-xml-4.4.zip"; + url = "https://docbook.org/xml/4.4/docbook-xml-4.4.zip"; sha256 = "141h4zsyc71sfi2zzd89v4bb4qqq9ca1ri9ix2als9f4i3mmkw82"; }; - meta = { - branch = "4.4"; - }; } diff --git a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.5.nix b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.5.nix index 7be810fe307..c4ab1f6f3a9 100644 --- a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.5.nix +++ b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/4.5.nix @@ -2,12 +2,9 @@ import ./generic.nix { inherit lib stdenv unzip findXMLCatalogs; - name = "docbook-xml-4.5"; + version = "4.5"; src = fetchurl { - url = "http://www.docbook.org/xml/4.5/docbook-xml-4.5.zip"; + url = "https://docbook.org/xml/4.5/docbook-xml-4.5.zip"; sha256 = "1d671lcjckjri28xfbf6dq7y3xnkppa910w1jin8rjc35dx06kjf"; }; - meta = { - branch = "4.5"; - }; } diff --git a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/generic.nix b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/generic.nix index 3d6edd300ec..7a635f612af 100644 --- a/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/generic.nix +++ b/pkgs/data/sgml+xml/schemas/xml-dtd/docbook/generic.nix @@ -1,9 +1,10 @@ -{ lib, stdenv, unzip, src, name, postInstall ? "true", meta ? {}, findXMLCatalogs }: +{ lib, stdenv, unzip, src, version, postInstall ? "true", findXMLCatalogs }: stdenv.mkDerivation { - inherit src name postInstall; + inherit version src postInstall; + pname = "docbook-xml"; - nativeBuildInputs = [unzip]; + nativeBuildInputs = [ unzip ]; propagatedNativeBuildInputs = [ findXMLCatalogs ]; unpackPhase = '' @@ -17,7 +18,8 @@ stdenv.mkDerivation { runHook postInstall ''; - meta = meta // { + meta = { + branch = version; platforms = lib.platforms.unix; }; } diff --git a/pkgs/data/sgml+xml/schemas/xml-dtd/xhtml1/default.nix b/pkgs/data/sgml+xml/schemas/xml-dtd/xhtml1/default.nix index c698098e6c1..f05788076a6 100644 --- a/pkgs/data/sgml+xml/schemas/xml-dtd/xhtml1/default.nix +++ b/pkgs/data/sgml+xml/schemas/xml-dtd/xhtml1/default.nix @@ -1,10 +1,11 @@ { lib, stdenv, fetchurl, libxml2 }: stdenv.mkDerivation { - name = "xhtml1-20020801"; + pname = "xhtml1"; + version = "unstable-2002-08-01"; src = fetchurl { - url = "http://www.w3.org/TR/xhtml1/xhtml1.tgz"; + url = "https://www.w3.org/TR/xhtml1/xhtml1.tgz"; sha256 = "0rr0d89i0z75qvjbm8il93bippx09hbmjwy0y2sj44n9np69x3hl"; }; diff --git a/pkgs/desktops/gnome-2/bindings/gnome-python/default.nix b/pkgs/desktops/gnome-2/bindings/gnome-python/default.nix index 1e7d726d557..0c636ffa541 100644 --- a/pkgs/desktops/gnome-2/bindings/gnome-python/default.nix +++ b/pkgs/desktops/gnome-2/bindings/gnome-python/default.nix @@ -5,11 +5,11 @@ with lib; let inherit (python2.pkgs) python pygobject2 pygtk dbus-python; in stdenv.mkDerivation rec { - version = "2.28"; - name = "gnome-python-${version}.1"; + pname = "gnome-python"; + version = "2.28.1"; src = fetchurl { - url = "mirror://gnome/sources/gnome-python/${version}/${name}.tar.bz2"; + url = "mirror://gnome/sources/gnome-python/${lib.versions.majorMinor version}/gnome-python-${version}.tar.bz2"; sha256 = "759ce9344cbf89cf7f8449d945822a0c9f317a494f56787782a901e4119b96d8"; }; @@ -20,7 +20,7 @@ in stdenv.mkDerivation rec { # gnome-python expects that .pth file is already installed by PyGTK in the # same directory. This is not the case for Nix. postInstall = '' - echo "gtk-2.0" > $out/${python2.sitePackages}/${name}.pth + echo "gtk-2.0" > $out/${python2.sitePackages}/gnome-python-${version}.pth ''; meta = with lib; { diff --git a/pkgs/desktops/gnome-2/desktop/scrollkeeper/default.nix b/pkgs/desktops/gnome-2/desktop/scrollkeeper/default.nix index 258789140c8..521800b4aa0 100644 --- a/pkgs/desktops/gnome-2/desktop/scrollkeeper/default.nix +++ b/pkgs/desktops/gnome-2/desktop/scrollkeeper/default.nix @@ -1,9 +1,11 @@ -{stdenv, fetchurl, pkg-config, perlPackages, libxml2, libxslt, docbook_xml_dtd_42, automake, gettext}: +{ lib, stdenv, fetchurl, pkg-config, perlPackages, libxml2, libxslt, docbook_xml_dtd_42, automake, gettext }: + +stdenv.mkDerivation rec { + pname = "scrollkeeper"; + version = "0.3.14"; -stdenv.mkDerivation { - name = "scrollkeeper-0.3.14"; src = fetchurl { - url = "mirror://gnome/sources/scrollkeeper/0.3/scrollkeeper-0.3.14.tar.bz2"; + url = "mirror://gnome/sources/scrollkeeper/${lib.versions.majorMinor version}/scrollkeeper-${version}.tar.bz2"; sha256 = "08n1xgj1f53zahwm0wpn3jid3rfbhi3iwby0ilaaldnid5qriqgc"; }; diff --git a/pkgs/desktops/gnome-2/platform/ORBit2/default.nix b/pkgs/desktops/gnome-2/platform/ORBit2/default.nix index bf5ae4ebbb1..a45095ba497 100644 --- a/pkgs/desktops/gnome-2/platform/ORBit2/default.nix +++ b/pkgs/desktops/gnome-2/platform/ORBit2/default.nix @@ -1,11 +1,11 @@ { lib, stdenv, fetchurl, pkg-config, glib, libIDL, libintl }: stdenv.mkDerivation rec { - name = "ORBit2-${minVer}.19"; - minVer = "2.14"; + pname = "ORBit2"; + version = "2.14.19"; src = fetchurl { - url = "mirror://gnome/sources/ORBit2/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/ORBit2/${lib.versions.majorMinor version}/ORBit2-${version}.tar.bz2"; sha256 = "0l3mhpyym9m5iz09fz0rgiqxl2ym6kpkwpsp1xrr4aa80nlh1jam"; }; diff --git a/pkgs/desktops/gnome-2/platform/gnome-common/default.nix b/pkgs/desktops/gnome-2/platform/gnome-common/default.nix index 54a2bd526a9..eba913c80c2 100644 --- a/pkgs/desktops/gnome-2/platform/gnome-common/default.nix +++ b/pkgs/desktops/gnome-2/platform/gnome-common/default.nix @@ -1,11 +1,11 @@ -{ stdenv, fetchurl, which }: +{ lib, stdenv, fetchurl, which }: stdenv.mkDerivation rec { - name = "gnome-common-${minVer}.0"; - minVer = "2.34"; + pname = "gnome-common"; + version = "2.34.0"; src = fetchurl { - url = "mirror://gnome/sources/gnome-common/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/gnome-common/${lib.versions.majorMinor version}/gnome-common-${version}.tar.bz2"; sha256 = "1pz13mpp09q5s3bikm8ml92s1g0scihsm4iipqv1ql3mp6d4z73s"; }; diff --git a/pkgs/desktops/gnome-2/platform/gnome-mime-data/default.nix b/pkgs/desktops/gnome-2/platform/gnome-mime-data/default.nix index d5af0e362b4..1604dbe0cf0 100644 --- a/pkgs/desktops/gnome-2/platform/gnome-mime-data/default.nix +++ b/pkgs/desktops/gnome-2/platform/gnome-mime-data/default.nix @@ -1,9 +1,10 @@ -{stdenv, fetchurl, intltool}: +{ lib, stdenv, fetchurl, intltool }: -stdenv.mkDerivation { - name = "gnome-mime-data-2.18.0"; +stdenv.mkDerivation rec { + pname = "gnome-mime-data"; + version = "2.18.0"; src = fetchurl { - url = "mirror://gnome/sources/gnome-mime-data/2.18/gnome-mime-data-2.18.0.tar.bz2"; + url = "mirror://gnome/sources/gnome-mime-data/${lib.versions.majorMinor version}/gnome-mime-data-${version}.tar.bz2"; sha256 = "1mvg8glb2a40yilmyabmb7fkbzlqd3i3d31kbkabqnq86xdnn69p"; }; nativeBuildInputs = [ intltool ]; diff --git a/pkgs/desktops/gnome-2/platform/gnome-vfs/default.nix b/pkgs/desktops/gnome-2/platform/gnome-vfs/default.nix index 4196cf21c27..4c9f28230c3 100644 --- a/pkgs/desktops/gnome-2/platform/gnome-vfs/default.nix +++ b/pkgs/desktops/gnome-2/platform/gnome-vfs/default.nix @@ -1,12 +1,12 @@ -{ stdenv, fetchurl, fetchpatch, pkg-config, libxml2, bzip2, openssl, dbus-glib +{ lib, stdenv, fetchurl, fetchpatch, pkg-config, libxml2, bzip2, openssl, dbus-glib , glib, gamin, cdparanoia, intltool, GConf, gnome_mime_data, avahi, acl }: stdenv.mkDerivation rec { - name = "gnome-vfs-${minVer}.4"; - minVer = "2.24"; + pname = "gnome-vfs"; + version = "2.24.4"; src = fetchurl { - url = "mirror://gnome/sources/gnome-vfs/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/gnome-vfs/${lib.versions.majorMinor version}/gnome-vfs-${version}.tar.bz2"; sha256 = "1ajg8jb8k3snxc7rrgczlh8daxkjidmcv3zr9w809sq4p2sn9pk2"; }; diff --git a/pkgs/desktops/gnome-2/platform/gtkhtml/default.nix b/pkgs/desktops/gnome-2/platform/gtkhtml/default.nix index ec87bafc998..4f4e0503f81 100644 --- a/pkgs/desktops/gnome-2/platform/gtkhtml/default.nix +++ b/pkgs/desktops/gnome-2/platform/gtkhtml/default.nix @@ -1,11 +1,12 @@ -{ stdenv, fetchurl, pkg-config, gtk2, intltool, +{ lib, stdenv, fetchurl, pkg-config, gtk2, intltool, GConf, enchant, isocodes, gnome-icon-theme }: stdenv.mkDerivation rec { - name = "gtkhtml-3.32.2"; + pname = "gtkhtml"; + version = "3.32.2"; src = fetchurl { - url = "mirror://gnome/sources/gtkhtml/3.32/${name}.tar.bz2"; + url = "mirror://gnome/sources/gtkhtml/${lib.versions.majorMinor version}/gtkhtml-${version}.tar.bz2"; sha256 = "17z3jwvpn8waz7bhwrk7a6vs9pad6sqmlxxcqwvxxq89ywy0ail7"; }; diff --git a/pkgs/desktops/gnome-2/platform/libIDL/default.nix b/pkgs/desktops/gnome-2/platform/libIDL/default.nix index 4e9376d5c82..61b21ba88c0 100644 --- a/pkgs/desktops/gnome-2/platform/libIDL/default.nix +++ b/pkgs/desktops/gnome-2/platform/libIDL/default.nix @@ -1,11 +1,11 @@ -{stdenv, fetchurl, flex, bison, pkg-config, glib, gettext}: +{ lib, stdenv, fetchurl, flex, bison, pkg-config, glib, gettext }: stdenv.mkDerivation rec { - name = "libIDL-${minVer}.14"; - minVer = "0.8"; + pname = "libIDL"; + version = "0.8.14"; src = fetchurl { - url = "mirror://gnome/sources/libIDL/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/libIDL/${lib.versions.majorMinor version}/libIDL-${version}.tar.bz2"; sha256 = "08129my8s9fbrk0vqvnmx6ph4nid744g5vbwphzkaik51664vln5"; }; diff --git a/pkgs/desktops/gnome-2/platform/libart_lgpl/default.nix b/pkgs/desktops/gnome-2/platform/libart_lgpl/default.nix index 7b1ccb97dc4..80ea3d02d93 100644 --- a/pkgs/desktops/gnome-2/platform/libart_lgpl/default.nix +++ b/pkgs/desktops/gnome-2/platform/libart_lgpl/default.nix @@ -1,9 +1,10 @@ -{stdenv, fetchurl}: +{ lib, stdenv, fetchurl }: stdenv.mkDerivation rec { - name = "libart_lgpl-2.3.21"; + pname = "libart_lgpl"; + version = "2.3.21"; src = fetchurl { - url = "mirror://gnome/sources/libart_lgpl/2.3/${name}.tar.bz2"; + url = "mirror://gnome/sources/libart_lgpl/${lib.versions.majorMinor version}/libart_lgpl-${version}.tar.bz2"; sha256 = "1yknfkyzgz9s616is0l9gp5aray0f2ry4dw533jgzj8gq5s1xhgx"; }; } diff --git a/pkgs/desktops/gnome-2/platform/libbonobo/default.nix b/pkgs/desktops/gnome-2/platform/libbonobo/default.nix index 8d991d743be..e928052a476 100644 --- a/pkgs/desktops/gnome-2/platform/libbonobo/default.nix +++ b/pkgs/desktops/gnome-2/platform/libbonobo/default.nix @@ -1,12 +1,12 @@ -{ stdenv, fetchurl, flex, bison, pkg-config, glib, libxml2, popt +{ lib, stdenv, fetchurl, flex, bison, pkg-config, glib, libxml2, popt , intltool, ORBit2, procps }: stdenv.mkDerivation rec { - name = "libbonobo-${minVer}.1"; - minVer = "2.32"; + pname = "libbonobo"; + version = "2.32.1"; src = fetchurl { - url = "mirror://gnome/sources/libbonobo/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/libbonobo/${lib.versions.majorMinor version}/libbonobo-${version}.tar.bz2"; sha256 = "0swp4kk6x7hy1rvd1f9jba31lvfc6qvafkvbpg9h0r34fzrd8q4i"; }; diff --git a/pkgs/desktops/gnome-2/platform/libbonoboui/default.nix b/pkgs/desktops/gnome-2/platform/libbonoboui/default.nix index 4f9176acf10..36ab293f5f1 100644 --- a/pkgs/desktops/gnome-2/platform/libbonoboui/default.nix +++ b/pkgs/desktops/gnome-2/platform/libbonoboui/default.nix @@ -1,12 +1,12 @@ -{ stdenv, fetchurl, bison, pkg-config, popt, libxml2, gtk2, libtool +{ lib, stdenv, fetchurl, bison, pkg-config, popt, libxml2, gtk2, libtool , intltool, libbonobo, GConf, libgnomecanvas, libgnome, libglade }: stdenv.mkDerivation rec { - name = "libbonoboui-${minVer}.5"; - minVer = "2.24"; + pname = "libbonoboui"; + version = "2.24.5"; src = fetchurl { - url = "mirror://gnome/sources/libbonoboui/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/libbonoboui/${lib.versions.majorMinor version}/libbonoboui-${version}.tar.bz2"; sha256 = "1kbgqh7bw0fdx4f1a1aqwpff7gp5mwhbaz60c6c98bc4djng5dgs"; }; diff --git a/pkgs/desktops/gnome-2/platform/libglade/default.nix b/pkgs/desktops/gnome-2/platform/libglade/default.nix index 3eb7b533f09..3ed162cd8d5 100644 --- a/pkgs/desktops/gnome-2/platform/libglade/default.nix +++ b/pkgs/desktops/gnome-2/platform/libglade/default.nix @@ -2,11 +2,12 @@ assert withLibgladeConvert -> python2 != null; -stdenv.mkDerivation { - name = "libglade-2.6.4"; +stdenv.mkDerivation rec { + pname = "libglade"; + version = "2.6.4"; src = fetchurl { - url = "mirror://gnome/sources/libglade/2.6/libglade-2.6.4.tar.bz2"; + url = "mirror://gnome/sources/libglade/${lib.versions.majorMinor version}/libglade-${version}.tar.bz2"; sha256 = "1v2x2s04jry4gpabws92i0wq2ghd47yr5n9nhgnkd7c38xv1wdk4"; }; diff --git a/pkgs/desktops/gnome-2/platform/libgnome/default.nix b/pkgs/desktops/gnome-2/platform/libgnome/default.nix index ee477cb63c1..2c70338a900 100644 --- a/pkgs/desktops/gnome-2/platform/libgnome/default.nix +++ b/pkgs/desktops/gnome-2/platform/libgnome/default.nix @@ -1,13 +1,13 @@ -{ stdenv, fetchurl, pkg-config, glib, popt, zlib, libcanberra-gtk2 +{ lib, stdenv, fetchurl, pkg-config, glib, popt, zlib, libcanberra-gtk2 , intltool, libbonobo, GConf, gnome_vfs, libtool, libogg }: stdenv.mkDerivation rec { - name = "libgnome-${minVer}.1"; - minVer = "2.32"; + pname = "libgnome"; + version = "2.32.1"; src = fetchurl { - url = "mirror://gnome/sources/libgnome/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/libgnome/${lib.versions.majorMinor version}/libgnome-${version}.tar.bz2"; sha256 = "197pnq8y0knqjhm2fg4j6hbqqm3qfzfnd0irhwxpk1b4hqb3kimj"; }; diff --git a/pkgs/desktops/gnome-2/platform/libgnomecanvas/default.nix b/pkgs/desktops/gnome-2/platform/libgnomecanvas/default.nix index eb40c5ec0b5..b856442290a 100644 --- a/pkgs/desktops/gnome-2/platform/libgnomecanvas/default.nix +++ b/pkgs/desktops/gnome-2/platform/libgnomecanvas/default.nix @@ -1,11 +1,11 @@ -{ stdenv, fetchurl, pkg-config, gtk2, intltool, libart_lgpl, libglade }: +{ lib, stdenv, fetchurl, pkg-config, gtk2, intltool, libart_lgpl, libglade }: stdenv.mkDerivation rec { - name = "libgnomecanvas-${minVer}.3"; - minVer = "2.30"; + pname = "libgnomecanvas"; + version = "2.30.3"; src = fetchurl { - url = "mirror://gnome/sources/libgnomecanvas/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/libgnomecanvas/${lib.versions.majorMinor version}/libgnomecanvas-${version}.tar.bz2"; sha256 = "0h6xvswbqspdifnyh5pm2pqq55yp3kn6yrswq7ay9z49hkh7i6w5"; }; diff --git a/pkgs/desktops/gnome-2/platform/libgnomecanvasmm/default.nix b/pkgs/desktops/gnome-2/platform/libgnomecanvasmm/default.nix index 2811a138cb6..9cc2d169b7c 100644 --- a/pkgs/desktops/gnome-2/platform/libgnomecanvasmm/default.nix +++ b/pkgs/desktops/gnome-2/platform/libgnomecanvasmm/default.nix @@ -1,10 +1,11 @@ -{ stdenv, fetchurl, pkg-config, libgnomecanvas, gtkmm2 }: +{ lib, stdenv, fetchurl, pkg-config, libgnomecanvas, gtkmm2 }: -stdenv.mkDerivation { - name = "libgnomecanvasmm-2.26.0"; +stdenv.mkDerivation rec { + pname = "libgnomecanvasmm"; + version = "2.26.0"; src = fetchurl { - url = "mirror://gnome/sources/libgnomecanvasmm/2.26/libgnomecanvasmm-2.26.0.tar.bz2"; + url = "mirror://gnome/sources/libgnomecanvasmm/${lib.versions.majorMinor version}/libgnomecanvasmm-${version}.tar.bz2"; sha256 = "996577f97f459a574919e15ba7fee6af8cda38a87a98289e9a4f54752d83e918"; }; diff --git a/pkgs/desktops/gnome-2/platform/libgnomecups/default.nix b/pkgs/desktops/gnome-2/platform/libgnomecups/default.nix index 7e33ee91285..42de8c2471a 100644 --- a/pkgs/desktops/gnome-2/platform/libgnomecups/default.nix +++ b/pkgs/desktops/gnome-2/platform/libgnomecups/default.nix @@ -1,10 +1,11 @@ -{ stdenv, fetchurl, pkg-config, gtk2, gettext, libxml2, intltool, libart_lgpl }: +{ lib, stdenv, fetchurl, pkg-config, gtk2, gettext, libxml2, intltool, libart_lgpl }: stdenv.mkDerivation rec { - name = "libgnomecups-0.2.3"; + pname = "libgnomecups"; + version = "0.2.3"; src = fetchurl { - url = "mirror://gnome/sources/libgnomecups/0.2/${name}.tar.bz2"; + url = "mirror://gnome/sources/libgnomecups/${lib.versions.majorMinor version}/libgnomecups-${version}.tar.bz2"; sha256 = "0a8xdaxzz2wc0n1fjcav65093gixzyac3948l8cxx1mk884yhc71"; }; diff --git a/pkgs/desktops/gnome-2/platform/libgnomeprint/default.nix b/pkgs/desktops/gnome-2/platform/libgnomeprint/default.nix index b67be2b7f5b..bb2e435f422 100644 --- a/pkgs/desktops/gnome-2/platform/libgnomeprint/default.nix +++ b/pkgs/desktops/gnome-2/platform/libgnomeprint/default.nix @@ -2,10 +2,11 @@ , libgnomecups, bison, flex }: stdenv.mkDerivation rec { - name = "libgnomeprint-2.18.8"; + pname = "libgnomeprint"; + version = "2.18.8"; src = fetchurl { - url = "mirror://gnome/sources/libgnomeprint/2.18/${name}.tar.bz2"; + url = "mirror://gnome/sources/libgnomeprint/${lib.versions.majorMinor version}/libgnomeprint-${version}.tar.bz2"; sha256 = "1034ec8651051f84d2424e7a1da61c530422cc20ce5b2d9e107e1e46778d9691"; }; diff --git a/pkgs/desktops/gnome-2/platform/libgnomeprintui/default.nix b/pkgs/desktops/gnome-2/platform/libgnomeprintui/default.nix index 80d2c2050af..a95ee70bca1 100644 --- a/pkgs/desktops/gnome-2/platform/libgnomeprintui/default.nix +++ b/pkgs/desktops/gnome-2/platform/libgnomeprintui/default.nix @@ -1,10 +1,11 @@ -{stdenv, fetchurl, pkg-config, gtk2, gettext, intltool, libgnomecanvas, libgnomeprint, gnome-icon-theme}: +{ lib, stdenv, fetchurl, pkg-config, gtk2, gettext, intltool, libgnomecanvas, libgnomeprint, gnome-icon-theme }: -stdenv.mkDerivation { - name = "libgnomeprintui-2.18.6"; +stdenv.mkDerivation rec { + pname = "libgnomeprintui"; + version = "2.18.6"; src = fetchurl { - url = "mirror://gnome/sources/libgnomeprintui/2.18/libgnomeprintui-2.18.6.tar.bz2"; + url = "mirror://gnome/sources/libgnomeprintui/${lib.versions.majorMinor version}/libgnomeprintui-${version}.tar.bz2"; sha256 = "0spl8vinb5n6n1krnfnr61dwaxidg67h8j94z9p59k2xdsvfashm"; }; diff --git a/pkgs/desktops/gnome-2/platform/libgnomeui/default.nix b/pkgs/desktops/gnome-2/platform/libgnomeui/default.nix index 0fa3847d9bd..0a84e0ea3ec 100644 --- a/pkgs/desktops/gnome-2/platform/libgnomeui/default.nix +++ b/pkgs/desktops/gnome-2/platform/libgnomeui/default.nix @@ -1,13 +1,13 @@ -{ stdenv, fetchurl, fetchpatch, pkg-config, libxml2, xorg, glib, pango +{ lib, stdenv, fetchurl, fetchpatch, pkg-config, libxml2, xorg, glib, pango , intltool, libgnome, libgnomecanvas, libbonoboui, GConf, libtool , gnome_vfs, libgnome-keyring, libglade }: stdenv.mkDerivation rec { - name = "libgnomeui-${minVer}.5"; - minVer = "2.24"; + pname = "libgnomeui"; + version = "2.24.5"; src = fetchurl { - url = "mirror://gnome/sources/libgnomeui/${minVer}/${name}.tar.bz2"; + url = "mirror://gnome/sources/libgnomeui/${lib.versions.majorMinor version}/libgnomeui-${version}.tar.bz2"; sha256 = "03rwbli76crkjl6gp422wrc9lqpl174k56cp9i96b7l8jlj2yddf"; }; diff --git a/pkgs/desktops/gnome-2/platform/libgtkhtml/default.nix b/pkgs/desktops/gnome-2/platform/libgtkhtml/default.nix index e7cf117ecdb..9c7189c117a 100644 --- a/pkgs/desktops/gnome-2/platform/libgtkhtml/default.nix +++ b/pkgs/desktops/gnome-2/platform/libgtkhtml/default.nix @@ -1,10 +1,11 @@ -{stdenv, fetchurl, pkg-config, gtk2, gettext, libxml2 }: +{ lib, stdenv, fetchurl, pkg-config, gtk2, gettext, libxml2 }: -stdenv.mkDerivation { - name = "libgtkhtml-2.11.1"; +stdenv.mkDerivation rec { + pname = "libgtkhtml"; + version = "2.11.1"; src = fetchurl { - url = "mirror://gnome/sources/libgtkhtml/2.11/libgtkhtml-2.11.1.tar.bz2"; + url = "mirror://gnome/sources/libgtkhtml/${lib.versions.majorMinor version}/libgtkhtml-${version}.tar.bz2"; sha256 = "0msajafd42545dxzyr5zqka990cjrxw2yz09ajv4zs8m1w6pm9rw"; }; diff --git a/pkgs/desktops/pantheon/apps/elementary-code/default.nix b/pkgs/desktops/pantheon/apps/elementary-code/default.nix index f1cd335459e..25acfc28062 100644 --- a/pkgs/desktops/pantheon/apps/elementary-code/default.nix +++ b/pkgs/desktops/pantheon/apps/elementary-code/default.nix @@ -1,7 +1,6 @@ { lib , stdenv , fetchFromGitHub -, fetchpatch , nix-update-script , appstream , desktop-file-utils @@ -28,24 +27,15 @@ stdenv.mkDerivation rec { pname = "elementary-code"; - version = "6.1.0"; + version = "6.2.0"; src = fetchFromGitHub { owner = "elementary"; repo = "code"; rev = version; - sha256 = "sha256-AXmMcPj2hf33G5v3TUg+eZwaKOdVlRvoVXglMJFHRjw="; + sha256 = "sha256-QhJNRhYgGbPMd7B1X3kG+pnC/lGUoF7gc7O1PdG49LI="; }; - patches = [ - # Fix build with meson 0.61 - # https://github.com/elementary/code/pull/1165 - (fetchpatch { - url = "https://github.com/elementary/code/commit/a2607cce3a6b1bb62d02456456d3cbc3c6530bb0.patch"; - sha256 = "sha256-VKR83IOUYsQhBRlU9JUTlMJtXWv/AyG4wDsjMU2vmU8="; - }) - ]; - nativeBuildInputs = [ appstream desktop-file-utils diff --git a/pkgs/development/compilers/adoptopenjdk-bin/jdk-darwin-base.nix b/pkgs/development/compilers/adoptopenjdk-bin/jdk-darwin-base.nix index ef3e4b7219e..68d33b657c6 100644 --- a/pkgs/development/compilers/adoptopenjdk-bin/jdk-darwin-base.nix +++ b/pkgs/development/compilers/adoptopenjdk-bin/jdk-darwin-base.nix @@ -10,9 +10,10 @@ assert (stdenv.isDarwin && stdenv.isx86_64); let cpuName = stdenv.hostPlatform.parsed.cpu.name; result = stdenv.mkDerivation { - name = if sourcePerArch.packageType == "jdk" - then "adoptopenjdk-${sourcePerArch.vmType}-bin-${sourcePerArch.${cpuName}.version}" - else "adoptopenjdk-${sourcePerArch.packageType}-${sourcePerArch.vmType}-bin-${sourcePerArch.${cpuName}.version}"; + pname = if sourcePerArch.packageType == "jdk" + then "adoptopenjdk-${sourcePerArch.vmType}-bin" + else "adoptopenjdk-${sourcePerArch.packageType}-${sourcePerArch.vmType}-bin"; + version = sourcePerArch.${cpuName}.version or (throw "unsupported CPU ${cpuName}"); src = fetchurl { inherit (sourcePerArch.${cpuName}) url sha256; diff --git a/pkgs/development/compilers/adoptopenjdk-bin/jdk-linux-base.nix b/pkgs/development/compilers/adoptopenjdk-bin/jdk-linux-base.nix index 39685131edd..6fc96b4d182 100644 --- a/pkgs/development/compilers/adoptopenjdk-bin/jdk-linux-base.nix +++ b/pkgs/development/compilers/adoptopenjdk-bin/jdk-linux-base.nix @@ -33,9 +33,9 @@ let in let result = stdenv.mkDerivation rec { - name = if sourcePerArch.packageType == "jdk" - then "adoptopenjdk-${sourcePerArch.vmType}-bin-${version}" - else "adoptopenjdk-${sourcePerArch.packageType}-${sourcePerArch.vmType}-bin-${version}"; + pname = if sourcePerArch.packageType == "jdk" + then "adoptopenjdk-${sourcePerArch.vmType}-bin" + else "adoptopenjdk-${sourcePerArch.packageType}-${sourcePerArch.vmType}-bin"; version = sourcePerArch.${cpuName}.version or (throw "unsupported CPU ${cpuName}"); diff --git a/pkgs/development/compilers/gcc/10/default.nix b/pkgs/development/compilers/gcc/10/default.nix index a26aaf771af..d00d428a695 100644 --- a/pkgs/development/compilers/gcc/10/default.nix +++ b/pkgs/development/compilers/gcc/10/default.nix @@ -8,12 +8,7 @@ , profiledCompiler ? false , langJit ? false , staticCompiler ? false -, # N.B. the defult is intentionally not from an `isStatic`. See - # https://gcc.gnu.org/install/configure.html - this is about target - # platform libraries not host platform ones unlike normal. But since - # we can't rebuild those without also rebuilding the compiler itself, - # we opt to always build everything unlike our usual policy. - enableShared ? true +, enableShared ? !stdenv.targetPlatform.isStatic , enableLTO ? !stdenv.hostPlatform.isStatic , texinfo ? null , perl ? null # optional, for texi2pod (then pod2man) @@ -61,8 +56,8 @@ let majorVersion = "10"; inherit (stdenv) buildPlatform hostPlatform targetPlatform; - patches = - optional (targetPlatform != hostPlatform) ../libstdc++-target.patch + patches = [ ./gcc10-asan-glibc-2.34.patch ] + ++ optional (targetPlatform != hostPlatform) ../libstdc++-target.patch ++ optional noSysDirs ../no-sys-dirs.patch ++ optional (noSysDirs && hostPlatform.isRiscV) ../no-sys-dirs-riscv.patch /* ++ optional (hostPlatform != buildPlatform) (fetchpatch { # XXX: Refine when this should be applied @@ -266,7 +261,7 @@ stdenv.mkDerivation ({ }; enableParallelBuilding = true; - inherit enableMultilib; + inherit enableMultilib enableShared; inherit (stdenv) is64bit; diff --git a/pkgs/development/compilers/gcc/10/gcc10-asan-glibc-2.34.patch b/pkgs/development/compilers/gcc/10/gcc10-asan-glibc-2.34.patch new file mode 100644 index 00000000000..d6d4f41ffdf --- /dev/null +++ b/pkgs/development/compilers/gcc/10/gcc10-asan-glibc-2.34.patch @@ -0,0 +1,70 @@ +From 950bac27d63c1c2ac3a6ed867692d6a13f21feb3 Mon Sep 17 00:00:00 2001 +From: Jakub Jelinek <jakub@redhat.com> +Date: Sat, 17 Apr 2021 11:27:14 +0200 +Subject: [PATCH] sanitizer: Fix asan against glibc 2.34 [PR100114] + +As mentioned in the PR, SIGSTKSZ is no longer a compile time constant in +glibc 2.34 and later, so +static const uptr kAltStackSize = SIGSTKSZ * 4; +needs dynamic initialization, but is used by a function called indirectly +from .preinit_array and therefore before the variable is constructed. +This results in using 0 size instead and all asan instrumented programs +die with: +==91==ERROR: AddressSanitizer failed to allocate 0x0 (0) bytes of SetAlternateSignalStack (error code: 22) + +Here is a cherry-pick from upstream to fix this. + +2021-04-17 Jakub Jelinek <jakub@redhat.com> + + PR sanitizer/100114 + * sanitizer_common/sanitizer_posix_libcdep.cpp: Cherry-pick + llvm-project revisions 82150606fb11d28813ae6da1101f5bda638165fe + and b93629dd335ffee2fc4b9b619bf86c3f9e6b0023. + +(cherry picked from commit d9f462fb372fb02da032cefd6b091d7582c425ae) +--- + .../sanitizer_common/sanitizer_posix_libcdep.cpp | 13 ++++++++----- + 1 file changed, 8 insertions(+), 5 deletions(-) + +diff --git a/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cpp b/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cpp +index 304b3a01a08..ac88fbe074e 100644 +--- a/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cpp ++++ b/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cpp +@@ -169,7 +169,11 @@ bool SupportsColoredOutput(fd_t fd) { + + #if !SANITIZER_GO + // TODO(glider): different tools may require different altstack size. +-static const uptr kAltStackSize = SIGSTKSZ * 4; // SIGSTKSZ is not enough. ++static uptr GetAltStackSize() { ++ // SIGSTKSZ is not enough. ++ static const uptr kAltStackSize = SIGSTKSZ * 4; ++ return kAltStackSize; ++} + + void SetAlternateSignalStack() { + stack_t altstack, oldstack; +@@ -180,10 +184,9 @@ void SetAlternateSignalStack() { + // TODO(glider): the mapped stack should have the MAP_STACK flag in the + // future. It is not required by man 2 sigaltstack now (they're using + // malloc()). +- void* base = MmapOrDie(kAltStackSize, __func__); +- altstack.ss_sp = (char*) base; ++ altstack.ss_size = GetAltStackSize(); ++ altstack.ss_sp = (char *)MmapOrDie(altstack.ss_size, __func__); + altstack.ss_flags = 0; +- altstack.ss_size = kAltStackSize; + CHECK_EQ(0, sigaltstack(&altstack, nullptr)); + } + +@@ -191,7 +194,7 @@ void UnsetAlternateSignalStack() { + stack_t altstack, oldstack; + altstack.ss_sp = nullptr; + altstack.ss_flags = SS_DISABLE; +- altstack.ss_size = kAltStackSize; // Some sane value required on Darwin. ++ altstack.ss_size = GetAltStackSize(); // Some sane value required on Darwin. + CHECK_EQ(0, sigaltstack(&altstack, &oldstack)); + UnmapOrDie(oldstack.ss_sp, oldstack.ss_size); + } +-- +2.27.0 + diff --git a/pkgs/development/compilers/gcc/11/default.nix b/pkgs/development/compilers/gcc/11/default.nix index b78ca339fb8..79e682e88c4 100644 --- a/pkgs/development/compilers/gcc/11/default.nix +++ b/pkgs/development/compilers/gcc/11/default.nix @@ -8,12 +8,7 @@ , profiledCompiler ? false , langJit ? false , staticCompiler ? false -, # N.B. the defult is intentionally not from an `isStatic`. See - # https://gcc.gnu.org/install/configure.html - this is about target - # platform libraries not host platform ones unlike normal. But since - # we can't rebuild those without also rebuilding the compiler itself, - # we opt to always build everything unlike our usual policy. - enableShared ? true +, enableShared ? !stdenv.targetPlatform.isStatic , enableLTO ? !stdenv.hostPlatform.isStatic , texinfo ? null , perl ? null # optional, for texi2pod (then pod2man) @@ -269,7 +264,7 @@ stdenv.mkDerivation ({ }; enableParallelBuilding = true; - inherit enableMultilib; + inherit enableShared enableMultilib; inherit (stdenv) is64bit; diff --git a/pkgs/development/compilers/gcc/4.8/default.nix b/pkgs/development/compilers/gcc/4.8/default.nix index bc7868cc460..ef1a04635f9 100644 --- a/pkgs/development/compilers/gcc/4.8/default.nix +++ b/pkgs/development/compilers/gcc/4.8/default.nix @@ -8,12 +8,7 @@ , profiledCompiler ? false , langJit ? false , staticCompiler ? false -, # N.B. the defult is intentionally not from an `isStatic`. See - # https://gcc.gnu.org/install/configure.html - this is about target - # platform libraries not host platform ones unlike normal. But since - # we can't rebuild those without also rebuilding the compiler itself, - # we opt to always build everything unlike our usual policy. - enableShared ? true +, enableShared ? !stdenv.targetPlatform.isStatic , enableLTO ? !stdenv.hostPlatform.isStatic , texinfo ? null , perl ? null # optional, for texi2pod (then pod2man); required for Java @@ -295,7 +290,7 @@ stdenv.mkDerivation ({ }; enableParallelBuilding = true; - inherit enableMultilib; + inherit enableShared enableMultilib; inherit (stdenv) is64bit; diff --git a/pkgs/development/compilers/gcc/4.9/default.nix b/pkgs/development/compilers/gcc/4.9/default.nix index bb1a3dd7d63..289df07d031 100644 --- a/pkgs/development/compilers/gcc/4.9/default.nix +++ b/pkgs/development/compilers/gcc/4.9/default.nix @@ -8,12 +8,7 @@ , profiledCompiler ? false , langJit ? false , staticCompiler ? false -, # N.B. the defult is intentionally not from an `isStatic`. See - # https://gcc.gnu.org/install/configure.html - this is about target - # platform libraries not host platform ones unlike normal. But since - # we can't rebuild those without also rebuilding the compiler itself, - # we opt to always build everything unlike our usual policy. - enableShared ? true +, enableShared ? !stdenv.targetPlatform.isStatic , enableLTO ? !stdenv.hostPlatform.isStatic , texinfo ? null , perl ? null # optional, for texi2pod (then pod2man); required for Java @@ -311,7 +306,7 @@ stdenv.mkDerivation ({ }; enableParallelBuilding = true; - inherit enableMultilib; + inherit enableShared enableMultilib; inherit (stdenv) is64bit; diff --git a/pkgs/development/compilers/gcc/6/default.nix b/pkgs/development/compilers/gcc/6/default.nix index 7548ec56c75..a577c61bdf5 100644 --- a/pkgs/development/compilers/gcc/6/default.nix +++ b/pkgs/development/compilers/gcc/6/default.nix @@ -9,12 +9,7 @@ , profiledCompiler ? false , langJit ? false , staticCompiler ? false -, # N.B. the defult is intentionally not from an `isStatic`. See - # https://gcc.gnu.org/install/configure.html - this is about target - # platform libraries not host platform ones unlike normal. But since - # we can't rebuild those without also rebuilding the compiler itself, - # we opt to always build everything unlike our usual policy. - enableShared ? true +, enableShared ? !stdenv.targetPlatform.isStatic , enableLTO ? !stdenv.hostPlatform.isStatic , texinfo ? null , flex @@ -79,6 +74,7 @@ let majorVersion = "6"; ] ++ optional (targetPlatform != hostPlatform) ../libstdc++-target.patch ++ optional noSysDirs ../no-sys-dirs.patch ++ optional langAda ../gnat-cflags.patch + ++ optional langAda ./gnat-glibc234.patch ++ optional langFortran ../gfortran-driving.patch ++ optional (targetPlatform.libc == "musl") ../libgomp-dont-force-initial-exec.patch @@ -325,7 +321,7 @@ stdenv.mkDerivation ({ }; enableParallelBuilding = true; - inherit enableMultilib; + inherit enableShared enableMultilib; inherit (stdenv) is64bit; diff --git a/pkgs/development/compilers/gcc/6/gnat-glibc234.patch b/pkgs/development/compilers/gcc/6/gnat-glibc234.patch new file mode 100644 index 00000000000..2d29cd7fa77 --- /dev/null +++ b/pkgs/development/compilers/gcc/6/gnat-glibc234.patch @@ -0,0 +1,30 @@ +Fix build with glibc 2.34. Adapted from: +https://github.com/gcc-mirror/gcc/commit/331763de7d4850702a0f67298f36017c73cdb103 +--- a/gcc/ada/init.c ++++ b/gcc/ada/init.c +@@ -579,12 +579,8 @@ + + #ifndef __ia64__ + #define HAVE_GNAT_ALTERNATE_STACK 1 +-/* This must be in keeping with System.OS_Interface.Alternate_Stack_Size. +- It must be larger than MINSIGSTKSZ and hopefully near 2 * SIGSTKSZ. */ +-# if 16 * 1024 < MINSIGSTKSZ +-# error "__gnat_alternate_stack too small" +-# endif +-char __gnat_alternate_stack[16 * 1024]; ++/* This must be in keeping with System.OS_Interface.Alternate_Stack_Size. */ ++char __gnat_alternate_stack[32 * 1024]; + #endif + + #ifdef __XENO__ +--- a/gcc/ada/s-osinte-linux.ads ++++ b/gcc/ada/s-osinte-linux.ads +@@ -328,7 +328,7 @@ + oss : access stack_t) return int; + pragma Import (C, sigaltstack, "sigaltstack"); + +- Alternate_Stack_Size : constant := 16 * 1024; ++ Alternate_Stack_Size : constant := 32 * 1024; + -- This must be in keeping with init.c:__gnat_alternate_stack + + Alternate_Stack : aliased char_array (1 .. Alternate_Stack_Size); diff --git a/pkgs/development/compilers/gcc/7/default.nix b/pkgs/development/compilers/gcc/7/default.nix index dfac97104eb..937ccbb3510 100644 --- a/pkgs/development/compilers/gcc/7/default.nix +++ b/pkgs/development/compilers/gcc/7/default.nix @@ -7,12 +7,7 @@ , profiledCompiler ? false , langJit ? false , staticCompiler ? false -, # N.B. the defult is intentionally not from an `isStatic`. See - # https://gcc.gnu.org/install/configure.html - this is about target - # platform libraries not host platform ones unlike normal. But since - # we can't rebuild those without also rebuilding the compiler itself, - # we opt to always build everything unlike our usual policy. - enableShared ? true +, enableShared ? !stdenv.targetPlatform.isStatic , enableLTO ? !stdenv.hostPlatform.isStatic , texinfo ? null , perl ? null # optional, for texi2pod (then pod2man) @@ -63,6 +58,9 @@ let majorVersion = "7"; ./riscv-pthread-reentrant.patch # https://gcc.gnu.org/ml/gcc-patches/2018-03/msg00297.html ./riscv-no-relax.patch + # Fix for asan w/glibc-2.34. Although there's no upstream backport to v7, + # the patch from gcc 8 seems to work perfectly fine. + ./gcc8-asan-glibc-2.34.patch ./0001-Fix-build-for-glibc-2.31.patch ] @@ -277,7 +275,7 @@ stdenv.mkDerivation ({ }; enableParallelBuilding = true; - inherit enableMultilib; + inherit enableShared enableMultilib; inherit (stdenv) is64bit; diff --git a/pkgs/development/compilers/gcc/7/gcc8-asan-glibc-2.34.patch b/pkgs/development/compilers/gcc/7/gcc8-asan-glibc-2.34.patch new file mode 100644 index 00000000000..5645b97c1d8 --- /dev/null +++ b/pkgs/development/compilers/gcc/7/gcc8-asan-glibc-2.34.patch @@ -0,0 +1,70 @@ +From ef195a39d0d3b929cc676302d074b42c25460601 Mon Sep 17 00:00:00 2001 +From: Jakub Jelinek <jakub@redhat.com> +Date: Sat, 17 Apr 2021 11:27:14 +0200 +Subject: [PATCH] sanitizer: Fix asan against glibc 2.34 [PR100114] + +As mentioned in the PR, SIGSTKSZ is no longer a compile time constant in +glibc 2.34 and later, so +static const uptr kAltStackSize = SIGSTKSZ * 4; +needs dynamic initialization, but is used by a function called indirectly +from .preinit_array and therefore before the variable is constructed. +This results in using 0 size instead and all asan instrumented programs +die with: +==91==ERROR: AddressSanitizer failed to allocate 0x0 (0) bytes of SetAlternateSignalStack (error code: 22) + +Here is a cherry-pick from upstream to fix this. + +2021-04-17 Jakub Jelinek <jakub@redhat.com> + + PR sanitizer/100114 + * sanitizer_common/sanitizer_posix_libcdep.cc: Cherry-pick + llvm-project revisions 82150606fb11d28813ae6da1101f5bda638165fe + and b93629dd335ffee2fc4b9b619bf86c3f9e6b0023. + +(cherry picked from commit 950bac27d63c1c2ac3a6ed867692d6a13f21feb3) +--- + .../sanitizer_common/sanitizer_posix_libcdep.cc | 13 ++++++++----- + 1 file changed, 8 insertions(+), 5 deletions(-) + +diff --git a/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cc b/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cc +index 1a37118c299..066079b3954 100644 +--- a/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cc ++++ b/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cc +@@ -159,7 +159,11 @@ bool SupportsColoredOutput(fd_t fd) { + + #if !SANITIZER_GO + // TODO(glider): different tools may require different altstack size. +-static const uptr kAltStackSize = SIGSTKSZ * 4; // SIGSTKSZ is not enough. ++static uptr GetAltStackSize() { ++ // SIGSTKSZ is not enough. ++ static const uptr kAltStackSize = SIGSTKSZ * 4; ++ return kAltStackSize; ++} + + void SetAlternateSignalStack() { + stack_t altstack, oldstack; +@@ -170,10 +174,9 @@ void SetAlternateSignalStack() { + // TODO(glider): the mapped stack should have the MAP_STACK flag in the + // future. It is not required by man 2 sigaltstack now (they're using + // malloc()). +- void* base = MmapOrDie(kAltStackSize, __func__); +- altstack.ss_sp = (char*) base; ++ altstack.ss_size = GetAltStackSize(); ++ altstack.ss_sp = (char *)MmapOrDie(altstack.ss_size, __func__); + altstack.ss_flags = 0; +- altstack.ss_size = kAltStackSize; + CHECK_EQ(0, sigaltstack(&altstack, nullptr)); + } + +@@ -181,7 +184,7 @@ void UnsetAlternateSignalStack() { + stack_t altstack, oldstack; + altstack.ss_sp = nullptr; + altstack.ss_flags = SS_DISABLE; +- altstack.ss_size = kAltStackSize; // Some sane value required on Darwin. ++ altstack.ss_size = GetAltStackSize(); // Some sane value required on Darwin. + CHECK_EQ(0, sigaltstack(&altstack, &oldstack)); + UnmapOrDie(oldstack.ss_sp, oldstack.ss_size); + } +-- +2.27.0 + diff --git a/pkgs/development/compilers/gcc/8/default.nix b/pkgs/development/compilers/gcc/8/default.nix index 609dfa722a6..e9819783695 100644 --- a/pkgs/development/compilers/gcc/8/default.nix +++ b/pkgs/development/compilers/gcc/8/default.nix @@ -7,12 +7,7 @@ , profiledCompiler ? false , langJit ? false , staticCompiler ? false -, # N.B. the defult is intentionally not from an `isStatic`. See - # https://gcc.gnu.org/install/configure.html - this is about target - # platform libraries not host platform ones unlike normal. But since - # we can't rebuild those without also rebuilding the compiler itself, - # we opt to always build everything unlike our usual policy. - enableShared ? true +, enableShared ? !stdenv.targetPlatform.isStatic , enableLTO ? !stdenv.hostPlatform.isStatic , texinfo ? null , perl ? null # optional, for texi2pod (then pod2man) @@ -259,7 +254,7 @@ stdenv.mkDerivation ({ }; enableParallelBuilding = true; - inherit enableMultilib; + inherit enableShared enableMultilib; inherit (stdenv) is64bit; diff --git a/pkgs/development/compilers/gcc/9/default.nix b/pkgs/development/compilers/gcc/9/default.nix index ea429682666..dd1a53e172a 100644 --- a/pkgs/development/compilers/gcc/9/default.nix +++ b/pkgs/development/compilers/gcc/9/default.nix @@ -9,12 +9,7 @@ , profiledCompiler ? false , langJit ? false , staticCompiler ? false -, # N.B. the defult is intentionally not from an `isStatic`. See - # https://gcc.gnu.org/install/configure.html - this is about target - # platform libraries not host platform ones unlike normal. But since - # we can't rebuild those without also rebuilding the compiler itself, - # we opt to always build everything unlike our usual policy. - enableShared ? true +, enableShared ? !stdenv.targetPlatform.isStatic , enableLTO ? !stdenv.hostPlatform.isStatic , texinfo ? null , perl ? null # optional, for texi2pod (then pod2man) @@ -78,7 +73,7 @@ let majorVersion = "9"; # https://gcc.gnu.org/bugzilla/show_bug.cgi?id=96796 # # This patch can most likely be removed by a post 9.3.0-release. - [ ./avoid-cycling-subreg-reloads.patch ] + [ ./avoid-cycling-subreg-reloads.patch ./gcc9-asan-glibc-2.34.patch ] ++ optional (targetPlatform != hostPlatform) ../libstdc++-target.patch ++ optional targetPlatform.isNetBSD ../libstdc++-netbsd-ctypes.patch ++ optional noSysDirs ../no-sys-dirs.patch @@ -88,6 +83,11 @@ let majorVersion = "9"; sha256 = ""; # TODO: uncomment and check hash when available. }) */ ++ optional langAda ../gnat-cflags.patch + ++ optional langAda (fetchpatch { + name = "gnat-glibc-234.diff"; + url = "https://github.com/gcc-mirror/gcc/commit/331763de7d4850702a0f67298f36017c73cdb103.diff"; + sha256 = "eS4B7vJasnv2N+5v5yB8/iDpKPX8CJDAy2xabWWj+aU="; + }) ++ optional langD ../libphobos.patch ++ optional langFortran ../gfortran-driving.patch ++ optional (targetPlatform.libc == "musl" && targetPlatform.isPower) ../ppc-musl.patch @@ -285,7 +285,7 @@ stdenv.mkDerivation ({ }; enableParallelBuilding = true; - inherit enableMultilib; + inherit enableShared enableMultilib; inherit (stdenv) is64bit; diff --git a/pkgs/development/compilers/gcc/9/gcc9-asan-glibc-2.34.patch b/pkgs/development/compilers/gcc/9/gcc9-asan-glibc-2.34.patch new file mode 100644 index 00000000000..1aea1f9b18a --- /dev/null +++ b/pkgs/development/compilers/gcc/9/gcc9-asan-glibc-2.34.patch @@ -0,0 +1,70 @@ +From 3d0135bf3be416bbe2531dc763d19b749eb2b856 Mon Sep 17 00:00:00 2001 +From: Jakub Jelinek <jakub@redhat.com> +Date: Sat, 17 Apr 2021 11:27:14 +0200 +Subject: [PATCH] sanitizer: Fix asan against glibc 2.34 [PR100114] + +As mentioned in the PR, SIGSTKSZ is no longer a compile time constant in +glibc 2.34 and later, so +static const uptr kAltStackSize = SIGSTKSZ * 4; +needs dynamic initialization, but is used by a function called indirectly +from .preinit_array and therefore before the variable is constructed. +This results in using 0 size instead and all asan instrumented programs +die with: +==91==ERROR: AddressSanitizer failed to allocate 0x0 (0) bytes of SetAlternateSignalStack (error code: 22) + +Here is a cherry-pick from upstream to fix this. + +2021-04-17 Jakub Jelinek <jakub@redhat.com> + + PR sanitizer/100114 + * sanitizer_common/sanitizer_posix_libcdep.cc: Cherry-pick + llvm-project revisions 82150606fb11d28813ae6da1101f5bda638165fe + and b93629dd335ffee2fc4b9b619bf86c3f9e6b0023. + +(cherry picked from commit 950bac27d63c1c2ac3a6ed867692d6a13f21feb3) +--- + .../sanitizer_common/sanitizer_posix_libcdep.cc | 13 ++++++++----- + 1 file changed, 8 insertions(+), 5 deletions(-) + +diff --git a/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cc b/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cc +index d2fd76a6d36..1917e29ced2 100644 +--- a/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cc ++++ b/libsanitizer/sanitizer_common/sanitizer_posix_libcdep.cc +@@ -169,7 +169,11 @@ bool SupportsColoredOutput(fd_t fd) { + + #if !SANITIZER_GO + // TODO(glider): different tools may require different altstack size. +-static const uptr kAltStackSize = SIGSTKSZ * 4; // SIGSTKSZ is not enough. ++static uptr GetAltStackSize() { ++ // SIGSTKSZ is not enough. ++ static const uptr kAltStackSize = SIGSTKSZ * 4; ++ return kAltStackSize; ++} + + void SetAlternateSignalStack() { + stack_t altstack, oldstack; +@@ -180,10 +184,9 @@ void SetAlternateSignalStack() { + // TODO(glider): the mapped stack should have the MAP_STACK flag in the + // future. It is not required by man 2 sigaltstack now (they're using + // malloc()). +- void* base = MmapOrDie(kAltStackSize, __func__); +- altstack.ss_sp = (char*) base; ++ altstack.ss_size = GetAltStackSize(); ++ altstack.ss_sp = (char *)MmapOrDie(altstack.ss_size, __func__); + altstack.ss_flags = 0; +- altstack.ss_size = kAltStackSize; + CHECK_EQ(0, sigaltstack(&altstack, nullptr)); + } + +@@ -191,7 +194,7 @@ void UnsetAlternateSignalStack() { + stack_t altstack, oldstack; + altstack.ss_sp = nullptr; + altstack.ss_flags = SS_DISABLE; +- altstack.ss_size = kAltStackSize; // Some sane value required on Darwin. ++ altstack.ss_size = GetAltStackSize(); // Some sane value required on Darwin. + CHECK_EQ(0, sigaltstack(&altstack, &oldstack)); + UnmapOrDie(oldstack.ss_sp, oldstack.ss_size); + } +-- +2.27.0 + diff --git a/pkgs/development/compilers/gcc/builder.sh b/pkgs/development/compilers/gcc/builder.sh index e6d41d7b29a..9d0514f1759 100644 --- a/pkgs/development/compilers/gcc/builder.sh +++ b/pkgs/development/compilers/gcc/builder.sh @@ -222,6 +222,10 @@ postInstall() { moveToOutput "${targetConfig+$targetConfig/}lib/lib*.dll.a" "${!outputLib}" moveToOutput "share/gcc-*/python" "${!outputLib}" + if [ -z "$enableShared" ]; then + moveToOutput "${targetConfig+$targetConfig/}lib/lib*.a" "${!outputLib}" + fi + for i in "${!outputLib}/${targetConfig}"/lib/*.{la,py}; do substituteInPlace "$i" --replace "$out" "${!outputLib}" done diff --git a/pkgs/development/compilers/go/1.17.nix b/pkgs/development/compilers/go/1.17.nix index 69537dc899e..28d5ffdc6df 100644 --- a/pkgs/development/compilers/go/1.17.nix +++ b/pkgs/development/compilers/go/1.17.nix @@ -55,11 +55,11 @@ in stdenv.mkDerivation rec { pname = "go"; - version = "1.17.7"; + version = "1.17.8"; src = fetchurl { url = "https://dl.google.com/go/go${version}.src.tar.gz"; - sha256 = "sha256-wQjNM7c7GRGgK2l3Qd896kPgGlxOCOQJ6LOg43RdK00="; + sha256 = "sha256-Lv/NiYFA2nmgYfN4TKT42LE9gR+yq+na0kBEQtq733o="; }; # perl is used for testing go vet diff --git a/pkgs/development/compilers/julia/1.6-bin.nix b/pkgs/development/compilers/julia/1.6-bin.nix index ece5a2a2471..acdd8a034e7 100644 --- a/pkgs/development/compilers/julia/1.6-bin.nix +++ b/pkgs/development/compilers/julia/1.6-bin.nix @@ -2,12 +2,12 @@ stdenv.mkDerivation rec { pname = "julia-bin"; - version = "1.6.5"; + version = "1.6.6"; src = { x86_64-linux = fetchurl { url = "https://julialang-s3.julialang.org/bin/linux/x64/${lib.versions.majorMinor version}/julia-${version}-linux-x86_64.tar.gz"; - sha256 = "0b4fmcfd5q5wzvasmsfqq838rivpxn274n5y2kza4m3jakp27zmq"; + sha256 = "0ia9a4h7w0n5rg57fkl1kzcyj500ymfwq3qsd2r7l82288dgfpy2"; }; }.${stdenv.hostPlatform.system} or (throw "Unsupported system: ${stdenv.hostPlatform.system}"); diff --git a/pkgs/development/compilers/llvm/multi.nix b/pkgs/development/compilers/llvm/multi.nix index 60db622a73a..ecea5d44037 100644 --- a/pkgs/development/compilers/llvm/multi.nix +++ b/pkgs/development/compilers/llvm/multi.nix @@ -19,9 +19,9 @@ let lib = gcc_multi_sysroot; }; } '' - mkdir -p $out/lib/gcc + mkdir -p $out/lib{,64}/gcc - ln -s ${combine gcc64}/lib/gcc/* $out/lib/gcc/ + ln -s ${combine gcc64}/lib/gcc/* $out/lib64/gcc/ ln -s ${combine gcc32}/lib/gcc/* $out/lib/gcc/ # XXX: This shouldn't be needed, clang just doesn't look for "i686-unknown" ln -s $out/lib/gcc/i686-unknown-linux-gnu $out/lib/gcc/i686-pc-linux-gnu diff --git a/pkgs/development/compilers/ocaml/4.10.nix b/pkgs/development/compilers/ocaml/4.10.nix index 78051040b57..48d01a5a8c8 100644 --- a/pkgs/development/compilers/ocaml/4.10.nix +++ b/pkgs/development/compilers/ocaml/4.10.nix @@ -3,4 +3,7 @@ import ./generic.nix { minor_version = "10"; patch_version = "2"; sha256 = "sha256-locUYQeCgtXbAiB32JveJchfteN2YStE+MN9ToTwAOM="; + patches = [ + ./glibc-2.34-for-ocaml-4.10-and-11.patch + ]; } diff --git a/pkgs/development/compilers/ocaml/4.11.nix b/pkgs/development/compilers/ocaml/4.11.nix index 3e5aefc11f1..6a2e4f61f80 100644 --- a/pkgs/development/compilers/ocaml/4.11.nix +++ b/pkgs/development/compilers/ocaml/4.11.nix @@ -3,4 +3,7 @@ import ./generic.nix { minor_version = "11"; patch_version = "2"; sha256 = "1m3wrgkkv3f77wvcymjm0i2srxzmx62y6jln3i0a2px07ng08l9z"; + patches = [ + ./glibc-2.34-for-ocaml-4.10-and-11.patch + ]; } diff --git a/pkgs/development/compilers/ocaml/4.12.nix b/pkgs/development/compilers/ocaml/4.12.nix index 4be2bcf5f9d..2066d0d5ad3 100644 --- a/pkgs/development/compilers/ocaml/4.12.nix +++ b/pkgs/development/compilers/ocaml/4.12.nix @@ -3,4 +3,9 @@ import ./generic.nix { minor_version = "12"; patch_version = "1"; sha256 = "1jbjjnmqq6ymsy81x188i256bz4z5jrz1pws8g1qf59c32ganjkf"; + patches = [ + { url = "https://src.fedoraproject.org/rpms/ocaml/raw/129153b85109944bf0b2922949f77ef8f32b39a1/f/0004-Dynamically-allocate-the-alternate-signal-stack-1026.patch"; + sha256 = "sha256-FdQ1HkMKHU9QvgLPUBvMdPiEa7w7IL3+1F3SLv63Gog="; + } + ]; } diff --git a/pkgs/development/compilers/ocaml/Makefile.nixpkgs b/pkgs/development/compilers/ocaml/Makefile.nixpkgs new file mode 100644 index 00000000000..2d6457852fc --- /dev/null +++ b/pkgs/development/compilers/ocaml/Makefile.nixpkgs @@ -0,0 +1,16 @@ +# ocaml build system does not allow for parallel building of some +# top-level targets like 'world', 'bootstrap', 'world.opt' as +# then spawn '$(MAKE) all' subprocesses that conflict among each +# other. But we would still like to run each target in parallel +# individually. This file defines such entry points. + +# Re-export all existing phases to make 'make install' work as is. +include Makefile + +nixpkgs_world: + $(MAKE) world + +nixpkgs_world_bootstrap_world_opt: + $(MAKE) world + $(MAKE) bootstrap + $(MAKE) world.opt diff --git a/pkgs/development/compilers/ocaml/generic.nix b/pkgs/development/compilers/ocaml/generic.nix index ec52e56c1fa..0573b43f5e2 100644 --- a/pkgs/development/compilers/ocaml/generic.nix +++ b/pkgs/development/compilers/ocaml/generic.nix @@ -1,4 +1,4 @@ -{ minor_version, major_version, patch_version +{ minor_version, major_version, patch_version, patches ? [] , ...}@args: let versionNoPatch = "${toString major_version}.${toString minor_version}"; @@ -6,7 +6,7 @@ let safeX11 = stdenv: !(stdenv.isAarch32 || stdenv.isMips || stdenv.hostPlatform.isStatic); in -{ lib, stdenv, fetchurl, ncurses, buildEnv, libunwind +{ lib, stdenv, fetchurl, ncurses, buildEnv, libunwind, fetchpatch , libX11, xorgproto, useX11 ? safeX11 stdenv && !lib.versionAtLeast version "4.09" , aflSupport ? false , flambdaSupport ? false @@ -28,21 +28,22 @@ in let useNativeCompilers = !stdenv.isMips; inherit (lib) optional optionals optionalString; - name = "ocaml${optionalString aflSupport "+afl"}${optionalString spaceTimeSupport "+spacetime"}${optionalString flambdaSupport "+flambda"}-${version}"; + pname = "ocaml${optionalString aflSupport "+afl"}${optionalString spaceTimeSupport "+spacetime"}${optionalString flambdaSupport "+flambda"}"; in let x11env = buildEnv { name = "x11env"; paths = [libX11 xorgproto]; }; x11lib = x11env + "/lib"; x11inc = x11env + "/include"; + + fetchpatch' = x: if builtins.isAttrs x then fetchpatch x else x; in stdenv.mkDerivation (args // { - inherit name; - inherit version; + inherit pname version src; - inherit src; + patches = map fetchpatch' patches; strictDeps = true; @@ -74,7 +75,18 @@ stdenv.mkDerivation (args // { hardeningDisable = lib.optional (lib.versionAtLeast version "4.09" && stdenv.hostPlatform.isMusl) "pie" ++ lib.optionals (args ? hardeningDisable) args.hardeningDisable; - buildFlags = [ "world" ] ++ optionals useNativeCompilers [ "bootstrap" "world.opt" ]; + # Older versions have some race: + # cp: cannot stat 'boot/ocamlrun': No such file or directory + # make[2]: *** [Makefile:199: backup] Error 1 + enableParallelBuilding = lib.versionAtLeast version "4.08"; + + # Workaround lack of parallelism support among top-level targets: + # we place nixpkgs-specific targets to a separate file and set + # sequential order among them as a single rule. + makefile = ./Makefile.nixpkgs; + buildFlags = if useNativeCompilers + then ["nixpkgs_world_bootstrap_world_opt"] + else ["nixpkgs_world"]; buildInputs = optional (!lib.versionAtLeast version "4.07") ncurses ++ optionals useX11 [ libX11 xorgproto ]; propagatedBuildInputs = optional spaceTimeSupport libunwind; diff --git a/pkgs/development/compilers/ocaml/glibc-2.34-for-ocaml-4.10-and-11.patch b/pkgs/development/compilers/ocaml/glibc-2.34-for-ocaml-4.10-and-11.patch new file mode 100644 index 00000000000..4ff9e6fddba --- /dev/null +++ b/pkgs/development/compilers/ocaml/glibc-2.34-for-ocaml-4.10-and-11.patch @@ -0,0 +1,37 @@ +From dfb5e954a04f59b0456cc4c0ddf3acaf22e0ff07 Mon Sep 17 00:00:00 2001 +From: Richard W.M. Jones <rjones@redhat.com> +Date: Feb 28 2021 20:45:47 +0000 +Subject: Workaround for glibc non-constant SIGSTKSZ + + +https://github.com/ocaml/ocaml/issues/10250 + +Signed-off-by: Richard W.M. Jones <rjones@redhat.com> + +--- + +diff --git a/runtime/signals_nat.c b/runtime/signals_nat.c +index 8b64ab4..7f0a975 100644 +--- a/runtime/signals_nat.c ++++ b/runtime/signals_nat.c +@@ -181,7 +181,19 @@ DECLARE_SIGNAL_HANDLER(trap_handler) + #error "CONTEXT_SP is required if HAS_STACK_OVERFLOW_DETECTION is defined" + #endif + ++#ifndef __GLIBC__ + static char sig_alt_stack[SIGSTKSZ]; ++#else ++/* glibc 2.34 has non-constant SIGSTKSZ */ ++static char *sig_alt_stack; ++ ++static void allocate_sig_alt_stack(void) __attribute__((constructor)); ++static void ++allocate_sig_alt_stack(void) ++{ ++ sig_alt_stack = malloc(SIGSTKSZ); ++} ++#endif + + /* Code compiled with ocamlopt never accesses more than + EXTRA_STACK bytes below the stack pointer. */ + diff --git a/pkgs/development/compilers/openjdk/11.nix b/pkgs/development/compilers/openjdk/11.nix index 6f4b78286d6..8c45bece9ad 100644 --- a/pkgs/development/compilers/openjdk/11.nix +++ b/pkgs/development/compilers/openjdk/11.nix @@ -40,6 +40,7 @@ let ./currency-date-range-jdk10.patch ./increase-javadoc-heap.patch ./fix-library-path-jdk11.patch + ./fix-glibc-2.34.patch ] ++ lib.optionals (!headless && enableGnome2) [ ./swing-use-gtk-jdk10.patch ]; diff --git a/pkgs/development/compilers/openjdk/16.nix b/pkgs/development/compilers/openjdk/16.nix index e6fd12a632b..0a4a8e1de41 100644 --- a/pkgs/development/compilers/openjdk/16.nix +++ b/pkgs/development/compilers/openjdk/16.nix @@ -48,6 +48,7 @@ let url = "https://src.fedoraproject.org/rpms/java-openjdk/raw/06c001c7d87f2e9fe4fedeef2d993bcd5d7afa2a/f/rh1673833-remove_removal_of_wformat_during_test_compilation.patch"; sha256 = "082lmc30x64x583vqq00c8y0wqih3y4r0mp1c4bqq36l22qv6b6r"; }) + ./fix-glibc-2.34.patch ] ++ lib.optionals (!headless && enableGnome2) [ ./swing-use-gtk-jdk13.patch ]; diff --git a/pkgs/development/compilers/openjdk/fix-glibc-2.34.patch b/pkgs/development/compilers/openjdk/fix-glibc-2.34.patch new file mode 100644 index 00000000000..7bf8b2b1674 --- /dev/null +++ b/pkgs/development/compilers/openjdk/fix-glibc-2.34.patch @@ -0,0 +1,24 @@ +Taken from https://build.opensuse.org/package/view_file/Java:Factory/java-15-openjdk/openjdk-glibc234.patch + +--- openjdk/test/hotspot/jtreg/runtime/StackGuardPages/exeinvoke.c 2021-04-09 11:36:58.000000000 +0200 ++++ openjdk/test/hotspot/jtreg/runtime/StackGuardPages/exeinvoke.c 2021-08-26 15:42:52.326232581 +0200 +@@ -67,8 +67,17 @@ + longjmp(context, 1); + } + ++static char* altstack = NULL; ++ + void set_signal_handler() { +- static char altstack[SIGSTKSZ]; ++ if (altstack == NULL) { ++ // Dynamically allocated in case SIGSTKSZ is not constant ++ altstack = malloc(SIGSTKSZ); ++ if (altstack == NULL) { ++ fprintf(stderr, "Test ERROR. Unable to malloc altstack space\n"); ++ exit(7); ++ } ++ } + + stack_t ss = { + .ss_size = SIGSTKSZ, + diff --git a/pkgs/development/compilers/polyml/5.6.nix b/pkgs/development/compilers/polyml/5.6.nix index 7858e3f6dc1..4354ce7e2d6 100644 --- a/pkgs/development/compilers/polyml/5.6.nix +++ b/pkgs/development/compilers/polyml/5.6.nix @@ -1,4 +1,4 @@ -{lib, stdenv, fetchurl, autoreconfHook}: +{lib, stdenv, fetchurl, autoreconfHook, fetchpatch }: let version = "5.6"; @@ -12,6 +12,14 @@ stdenv.mkDerivation { substituteInPlace configure.ac --replace stdc++ c++ ''; + patches = [ + # glibc 2.34 compat + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/polyml/raw/4d8868ca5a1ce3268f212599a321f8011c950496/f/polyml-pthread-stack-min.patch"; + sha256 = "1h5ihg2sxld9ymrl3f2mpnbn2242ka1fsa0h4gl9h90kndvg6kby"; + }) + ]; + buildInputs = lib.optional stdenv.isDarwin autoreconfHook; src = fetchurl { diff --git a/pkgs/development/compilers/polyml/5.7.nix b/pkgs/development/compilers/polyml/5.7.nix index 5ac6990383c..efd3d1bfd40 100644 --- a/pkgs/development/compilers/polyml/5.7.nix +++ b/pkgs/development/compilers/polyml/5.7.nix @@ -1,4 +1,4 @@ -{ lib, stdenv, fetchFromGitHub, autoreconfHook, gmp, libffi }: +{ lib, stdenv, fetchFromGitHub, autoreconfHook, gmp, libffi, fetchpatch }: stdenv.mkDerivation rec { pname = "polyml"; @@ -8,7 +8,15 @@ stdenv.mkDerivation rec { substituteInPlace configure.ac --replace stdc++ c++ ''; - patches = [ ./5.7-new-libffi-FFI_SYSV.patch ]; + patches = [ + ./5.7-new-libffi-FFI_SYSV.patch + + # glibc 2.34 compat + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/polyml/raw/4d8868ca5a1ce3268f212599a321f8011c950496/f/polyml-pthread-stack-min.patch"; + sha256 = "1h5ihg2sxld9ymrl3f2mpnbn2242ka1fsa0h4gl9h90kndvg6kby"; + }) + ]; buildInputs = [ libffi gmp ]; diff --git a/pkgs/development/compilers/polyml/default.nix b/pkgs/development/compilers/polyml/default.nix index 8a283bb6cf9..2f22f8cd616 100644 --- a/pkgs/development/compilers/polyml/default.nix +++ b/pkgs/development/compilers/polyml/default.nix @@ -1,4 +1,10 @@ -{ lib, stdenv, fetchFromGitHub, fetchpatch, autoreconfHook, gmp, libffi }: +{ lib +, stdenv +, fetchFromGitHub +, autoreconfHook +, gmp +, libffi +}: stdenv.mkDerivation rec { pname = "polyml"; diff --git a/pkgs/development/compilers/rust/1_58.nix b/pkgs/development/compilers/rust/1_59.nix index c854bfdd37a..98125851655 100644 --- a/pkgs/development/compilers/rust/1_58.nix +++ b/pkgs/development/compilers/rust/1_59.nix @@ -20,8 +20,8 @@ } @ args: import ./default.nix { - rustcVersion = "1.58.1"; - rustcSha256 = "1iq7kj16qfpkx8gvw50d8rf7glbm6s0pj2y1qkrz7mi56vfsyfd8"; + rustcVersion = "1.59.0"; + rustcSha256 = "sha256-p8juruhb/O+EyWsCsxcdHmVA0VF5/4Pd3Z6vuhhfhfk="; llvmSharedForBuild = pkgsBuildBuild.llvmPackages_13.libllvm.override { enableSharedLibraries = true; }; llvmSharedForHost = pkgsBuildHost.llvmPackages_13.libllvm.override { enableSharedLibraries = true; }; @@ -37,24 +37,25 @@ import ./default.nix { # Note: the version MUST be one version prior to the version we're # building - bootstrapVersion = "1.57.0"; + bootstrapVersion = "1.58.1"; # fetch hashes by running `print-hashes.sh ${bootstrapVersion}` bootstrapHashes = { - i686-unknown-linux-gnu = "7e4ac8ca2874897099a3ceb89039ceee170f474a98ee247589fd6bca8dda7cfa"; - x86_64-unknown-linux-gnu = "ea0253784b2e5c22659ff148d492a68d2e11da734491714ebc61cc93896efcda"; - x86_64-unknown-linux-musl = "56876ebca0e46236208c8bd3c3425dba553abe49639e1040ee8b95bc66a45d33"; - arm-unknown-linux-gnueabihf = "b4448f7a96da4feee99a2c4b16b5738b99ab7e86e22d284ea6f7dca5921bca9b"; - armv7-unknown-linux-gnueabihf = "577682b1405e8901f971839407daaad06d8ae68ad370305b75d569ba293c4fb4"; - aarch64-unknown-linux-gnu = "d66847f7cf7b548ecb328c400ac4f691ee2aea6ff5cd9286ad8733239569556c"; - aarch64-unknown-linux-musl = "91c8e5171e5715261f7f635142a10a9415a4e5ba55374daf76f0b713c8b08132"; - x86_64-apple-darwin = "15ceffc4743434c19d08f73fb4edd6642b7fd8162ed7101d3e6ca2c691fcb699"; - aarch64-apple-darwin = "7511075e28b715e2d9c7ee74221779f8444681a4bb60ac3a0270a5fdf08bdd5a"; - powerpc64le-unknown-linux-gnu = "3ddc1abed6b7535c4150bf54291901fa856806c948bc21b711e24a3c8d810be7"; - riscv64gc-unknown-linux-gnu = "f809df1c6ac0adc9bd37eb871dfb0d9809f3ed7f61ba611f9305e9eb8f8c9226"; + i686-unknown-linux-gnu = "c3d282cd96cc9e5292e62db1ebb9fa6d5b738f4684d5ece9883f7472e2f76ad4"; + x86_64-unknown-linux-gnu = "4fac6df9ea49447682c333e57945bebf4f9f45ec7b08849e507a64b2ccd5f8fb"; + x86_64-unknown-linux-musl = "7036e34eadc8ce22d16b0625919d9f2244ca49a5441d6599f4822116c181d272"; + arm-unknown-linux-gnueabihf = "739389d46c5862b0e67d01dece99aa3db2229e055a3d7f7624679c55b6c33e06"; + armv7-unknown-linux-gnueabihf = "6cede2c7795e8126b0f17b1032d52500e594bac64c7d190bdc0ac1c832ef30bd"; + aarch64-unknown-linux-gnu = "ce557516593e4526709b0f33c2e1d7c932b3ddf76af94c2417d8d667921ce90c"; + aarch64-unknown-linux-musl = "b1533fdeeda483a3633617fd18a79d8fad7821331614b8dc13efd8b22acc30f5"; + x86_64-apple-darwin = "d0044680fc132a721481b130a0a4282a444867f423efdb890fe13e447966412f"; + aarch64-apple-darwin = "00b44985bc87e53c53d92622fb10226f09e9f25c79db48a77c0a769a36f83b1e"; + powerpc64le-unknown-linux-gnu = "b15baef702cbd6f0ea2bef7bf98ca7ce5644f2beb219028e8a12e7053da4c849"; + riscv64gc-unknown-linux-gnu = "d8ea2b11a4b24d1169fa3190127488b951b8bdef28293a4129ddd46c0ba9469b"; + mips64el-unknown-linux-gnuabi64 = "4f03bc972ae784d4f66cfa77215b369723531e67f647de9f49ce9fc21e5691af"; }; - selectRustPackage = pkgs: pkgs.rust_1_58; + selectRustPackage = pkgs: pkgs.rust_1_59; rustcPatches = [ ]; diff --git a/pkgs/development/compilers/rust/binary.nix b/pkgs/development/compilers/rust/binary.nix index ce4250f675e..1145f4da8f6 100644 --- a/pkgs/development/compilers/rust/binary.nix +++ b/pkgs/development/compilers/rust/binary.nix @@ -19,7 +19,7 @@ in rec { rustc = stdenv.mkDerivation { - name = "rustc-${versionType}-${version}"; + pname = "rustc-${versionType}"; inherit version; inherit src; @@ -71,7 +71,7 @@ rec { }; cargo = stdenv.mkDerivation { - name = "cargo-${versionType}-${version}"; + pname = "cargo-${versionType}"; inherit version; inherit src; diff --git a/pkgs/development/compilers/rust/cargo.nix b/pkgs/development/compilers/rust/cargo.nix index ee909e973a3..b50f36f0d9b 100644 --- a/pkgs/development/compilers/rust/cargo.nix +++ b/pkgs/development/compilers/rust/cargo.nix @@ -5,7 +5,7 @@ }: rustPlatform.buildRustPackage { - name = "cargo-${rustc.version}"; + pname = "cargo"; inherit (rustc) version src; # the rust source tarball already has all the dependencies vendored, no need to fetch them again diff --git a/pkgs/development/embedded/platformio/core.nix b/pkgs/development/embedded/platformio/core.nix index f19458fa84f..c40f2f45f31 100644 --- a/pkgs/development/embedded/platformio/core.nix +++ b/pkgs/development/embedded/platformio/core.nix @@ -153,7 +153,8 @@ with python.pkgs; buildPythonApplication rec { --subst-var-by SPDX_LICENSE_LIST_DATA '${spdx-license-list-data.json}' substituteInPlace setup.py \ - --replace "zeroconf==0.37.*" "zeroconf" + --replace "wsproto==1.0.*" "wsproto" \ + --replace "zeroconf==0.38.*" "zeroconf" ''; meta = with lib; { diff --git a/pkgs/development/go-modules/generic/default.nix b/pkgs/development/go-modules/generic/default.nix index 76d0dc961c5..e2428edbb26 100644 --- a/pkgs/development/go-modules/generic/default.nix +++ b/pkgs/development/go-modules/generic/default.nix @@ -153,13 +153,13 @@ let export GOCACHE=$TMPDIR/go-cache export GOPATH="$TMPDIR/go" + export GOPROXY=off export GOSUMDB=off cd "$modRoot" - '' + lib.optionalString (go-modules != "") '' + '' + lib.optionalString (vendorSha256 != null) '' ${if proxyVendor then '' export GOPROXY=file://${go-modules} '' else '' - export GOPROXY=off rm -rf vendor cp -r --reflink=auto ${go-modules} vendor ''} @@ -171,13 +171,20 @@ let buildPhase = args.buildPhase or '' runHook preBuild + exclude='\(/_\|examples\|Godeps\|testdata' + if [[ -n "$excludedPackages" ]]; then + IFS=' ' read -r -a excludedArr <<<$excludedPackages + printf -v excludedAlternates '%s\\|' "''${excludedArr[@]}" + excludedAlternates=''${excludedAlternates%\\|} # drop final \| added by printf + exclude+='\|'"$excludedAlternates" + fi + exclude+='\)' + buildGoDir() { local d; local cmd; cmd="$1" d="$2" . $TMPDIR/buildFlagsArray - echo "$d" | grep -q "\(/_\|examples\|Godeps\|testdata\)" && return 0 - [ -n "$excludedPackages" ] && echo "$d" | grep -q "$excludedPackages" && return 0 local OUT if ! OUT="$(go $cmd $buildFlags "''${buildFlagsArray[@]}" ''${tags:+-tags=${lib.concatStringsSep "," tags}} ''${ldflags:+-ldflags="$ldflags"} -v -p $NIX_BUILD_CORES $d 2>&1)"; then if ! echo "$OUT" | grep -qE '(no( buildable| non-test)?|build constraints exclude all) Go (source )?files'; then @@ -214,6 +221,7 @@ let export NIX_BUILD_CORES=1 fi for pkg in $(getGoDirs ""); do + grep -q "$exclude" <<<$pkg && continue echo "Building subPackage $pkg" buildGoDir install "$pkg" done diff --git a/pkgs/development/go-packages/generic/default.nix b/pkgs/development/go-packages/generic/default.nix index 7c4d173b937..3d633324eef 100644 --- a/pkgs/development/go-packages/generic/default.nix +++ b/pkgs/development/go-packages/generic/default.nix @@ -150,13 +150,20 @@ let runHook renameImports + exclude='\(/_\|examples\|Godeps\|testdata' + if [[ -n "$excludedPackages" ]]; then + IFS=' ' read -r -a excludedArr <<<$excludedPackages + printf -v excludedAlternates '%s\\|' "''${excludedArr[@]}" + excludedAlternates=''${excludedAlternates%\\|} # drop final \| added by printf + exclude+='\|'"$excludedAlternates" + fi + exclude+='\)' + buildGoDir() { local d; local cmd; cmd="$1" d="$2" . $TMPDIR/buildFlagsArray - echo "$d" | grep -q "\(/_\|examples\|Godeps\)" && return 0 - [ -n "$excludedPackages" ] && echo "$d" | grep -q "$excludedPackages" && return 0 local OUT if ! OUT="$(go $cmd $buildFlags "''${buildFlagsArray[@]}" ''${tags:+-tags=${lib.concatStringsSep "," tags}} ''${ldflags:+-ldflags="$ldflags"} -v -p $NIX_BUILD_CORES $d 2>&1)"; then if ! echo "$OUT" | grep -qE '(no( buildable| non-test)?|build constraints exclude all) Go (source )?files'; then @@ -195,6 +202,8 @@ let export NIX_BUILD_CORES=1 fi for pkg in $(getGoDirs ""); do + grep -q "$exclude" <<<$pkg && continue + echo "Building subPackage $pkg" buildGoDir install "$pkg" done '' + lib.optionalString (stdenv.hostPlatform != stdenv.buildPlatform) '' diff --git a/pkgs/development/interpreters/clojure/babashka.nix b/pkgs/development/interpreters/clojure/babashka.nix index c3dcd0a0f71..de46d33bdf6 100644 --- a/pkgs/development/interpreters/clojure/babashka.nix +++ b/pkgs/development/interpreters/clojure/babashka.nix @@ -2,11 +2,11 @@ buildGraalvmNativeImage rec { pname = "babashka"; - version = "0.7.8"; + version = "0.8.0"; src = fetchurl { url = "https://github.com/babashka/${pname}/releases/download/v${version}/${pname}-${version}-standalone.jar"; - sha256 = "sha256-VbDivl92YYWzIbkbOgDijzf9bZ5ZyodcapPPG4EiGXc="; + sha256 = "sha256-xe+WL2V56ETnWv6ey+3xrvC21MfhT5AMtmOkVPbX5N0="; }; executable = "bb"; diff --git a/pkgs/development/interpreters/janet/default.nix b/pkgs/development/interpreters/janet/default.nix index 4601faafb06..098a7fe7d3a 100644 --- a/pkgs/development/interpreters/janet/default.nix +++ b/pkgs/development/interpreters/janet/default.nix @@ -2,13 +2,13 @@ stdenv.mkDerivation rec { pname = "janet"; - version = "1.21.1"; + version = "1.21.2"; src = fetchFromGitHub { owner = "janet-lang"; repo = pname; rev = "v${version}"; - sha256 = "sha256-wJwlGliXoj0XmC9qb6SCo8mUy4aqHvJtFiigUB7PFLE="; + sha256 = "sha256-6E726+DLs1hCUbr2/rqIdSn8u94LLFdKBBHkbB4rgm0="; }; # This release fails the test suite on darwin, remove when debugged. diff --git a/pkgs/development/interpreters/maude/default.nix b/pkgs/development/interpreters/maude/default.nix index 860f9ac3a5e..30055dc7a3d 100644 --- a/pkgs/development/interpreters/maude/default.nix +++ b/pkgs/development/interpreters/maude/default.nix @@ -30,6 +30,10 @@ stdenv.mkDerivation { hardeningDisable = [ "stackprotector" ] ++ lib.optionals stdenv.isi686 [ "pic" "fortify" ]; + # Fix for glibc-2.34, see + # https://gitweb.gentoo.org/repo/gentoo.git/commit/dev-lang/maude/maude-3.1-r1.ebuild?id=f021cc6cfa1e35eb9c59955830f1fd89bfcb26b4 + configureFlags = [ "--without-libsigsegv" ]; + preConfigure = '' configureFlagsArray=( --datadir="$out/share/maude" diff --git a/pkgs/development/interpreters/perl/default.nix b/pkgs/development/interpreters/perl/default.nix index 54769a03b7b..f29e61d1105 100644 --- a/pkgs/development/interpreters/perl/default.nix +++ b/pkgs/development/interpreters/perl/default.nix @@ -19,11 +19,10 @@ let common = { perl, buildPerl, version, sha256 }: stdenv.mkDerivation (rec { inherit version; - - name = "perl-${version}"; + pname = "perl"; src = fetchurl { - url = "mirror://cpan/src/5.0/${name}.tar.gz"; + url = "mirror://cpan/src/5.0/perl-${version}.tar.gz"; inherit sha256; }; diff --git a/pkgs/development/interpreters/python/default.nix b/pkgs/development/interpreters/python/default.nix index bac5ba69c44..6c566544f32 100644 --- a/pkgs/development/interpreters/python/default.nix +++ b/pkgs/development/interpreters/python/default.nix @@ -124,19 +124,19 @@ with pkgs; sourceVersion = { major = "3"; minor = "9"; - patch = "10"; + patch = "11"; suffix = ""; }; - sha256 = "sha256-Co+/tSh+vDoT6brz1U4I+gZ3j/7M9jEa74Ibs6ZYbMg="; + sha256 = "sha256-ZnZ6NTCdck83DfnlA8FytO5ET0nWK5i8TspyUSPibEk="; }; python310 = { sourceVersion = { major = "3"; minor = "10"; - patch = "2"; + patch = "3"; suffix = ""; }; - sha256 = "sha256-F946x9qfJRmqnWQ3jGA6c6DprVjf+ogS5FFgwIbeZMc="; + sha256 = "sha256-WWxy3pmNw5IFvE9w7w2/ft7HQKMG0JtJqb0Kd4BnMNw="; }; }; diff --git a/pkgs/development/interpreters/python/update-python-libraries/update-python-libraries.py b/pkgs/development/interpreters/python/update-python-libraries/update-python-libraries.py index 5f55ed5ecaf..3843497d94e 100755 --- a/pkgs/development/interpreters/python/update-python-libraries/update-python-libraries.py +++ b/pkgs/development/interpreters/python/update-python-libraries/update-python-libraries.py @@ -356,17 +356,19 @@ def _update_package(path, target): text = _replace_value('hash', sri_hash, text) if fetcher == 'fetchFromGitHub': - # in the case of fetchFromGitHub, it's common to see `rev = version;` - # in which no string value is meant to be substituted. - # Verify that the attribute is set to a variable - regex = '(rev\s+=\s+([_a-zA-Z][_a-zA-Z0-9\.]*);)' + # in the case of fetchFromGitHub, it's common to see `rev = version;` or `rev = "v${version}";` + # in which no string value is meant to be substituted. However, we can just overwrite the previous value. + regex = '(rev\s+=\s+[^;]*;)' regex = re.compile(regex) - value = regex.findall(text) - n = len(value) + matches = regex.findall(text) + n = len(matches) if n == 0: - # value is set to a string, e.g. `rev = "v${version}";` - text = _replace_value('rev', f"{prefix}${{version}}", text) + raise ValueError("Unable to find rev value for {}.".format(pname)) + else: + # forcefully rewrite rev, incase tagging conventions changed for a release + match = matches[0] + text = text.replace(match, f'rev = "refs/tags/{prefix}${{version}}";') # incase there's no prefix, just rewrite without interpolation text = text.replace('"${version}";', 'version;') diff --git a/pkgs/development/interpreters/ruby/rubygems/default.nix b/pkgs/development/interpreters/ruby/rubygems/default.nix index 4150f7683d5..6a8e171ee6e 100644 --- a/pkgs/development/interpreters/ruby/rubygems/default.nix +++ b/pkgs/development/interpreters/ruby/rubygems/default.nix @@ -1,7 +1,7 @@ { stdenv, lib, fetchurl }: stdenv.mkDerivation rec { - name = "rubygems"; + pname = "rubygems"; version = "3.2.26"; src = fetchurl { diff --git a/pkgs/development/libraries/SDL2/default.nix b/pkgs/development/libraries/SDL2/default.nix index d1086de3718..d8d81492f91 100644 --- a/pkgs/development/libraries/SDL2/default.nix +++ b/pkgs/development/libraries/SDL2/default.nix @@ -65,6 +65,14 @@ stdenv.mkDerivation rec { outputs = [ "out" "dev" ]; outputBin = "dev"; # sdl-config + patches = [ + # `sdl2-config --cflags` from Nixpkgs returns include path to just SDL2. + # On a normal distro this is enough for includes from all SDL2* packages to work, + # but on NixOS they're spread across different paths. + # This patch + the setup-hook will ensure that `sdl2-config --cflags` works correctly. + ./find-headers.patch + ]; + depsBuildBuild = [ pkg-config ]; nativeBuildInputs = [ pkg-config ] ++ optionals waylandSupport [ wayland ]; diff --git a/pkgs/development/libraries/SDL2/find-headers.patch b/pkgs/development/libraries/SDL2/find-headers.patch new file mode 100644 index 00000000000..4792679deb1 --- /dev/null +++ b/pkgs/development/libraries/SDL2/find-headers.patch @@ -0,0 +1,34 @@ +diff --git a/sdl2-config.cmake.in b/sdl2-config.cmake.in +index c570511fa..ca694f595 100644 +--- a/sdl2-config.cmake.in ++++ b/sdl2-config.cmake.in +@@ -7,7 +7,8 @@ set(includedir "@includedir@") + set(SDL2_PREFIX "${prefix}") + set(SDL2_EXEC_PREFIX "${exec_prefix}") + set(SDL2_LIBDIR "${libdir}") +-set(SDL2_INCLUDE_DIRS "${includedir}/SDL2") ++set(SDL2_INCLUDE_DIRS "${includedir}/SDL2" $ENV{SDL2_PATH}) ++separate_arguments(SDL2_INCLUDE_DIRS) + set(SDL2_LIBRARIES "-L${SDL2_LIBDIR} @SDL_RLD_FLAGS@ @SDL_LIBS@") + string(STRIP "${SDL2_LIBRARIES}" SDL2_LIBRARIES) + +diff --git a/sdl2-config.in b/sdl2-config.in +index 5a2aed292..7c55f0a28 100644 +--- a/sdl2-config.in ++++ b/sdl2-config.in +@@ -42,7 +42,11 @@ while test $# -gt 0; do + echo @SDL_VERSION@ + ;; + --cflags) +- echo -I@includedir@/SDL2 @SDL_CFLAGS@ ++ SDL_CFLAGS="" ++ for i in @includedir@/SDL2 $SDL2_PATH; do ++ SDL_CFLAGS="$SDL_CFLAGS -I$i" ++ done ++ echo $SDL_CFLAGS @SDL_CFLAGS@ + ;; + @ENABLE_SHARED_TRUE@ --libs) + @ENABLE_SHARED_TRUE@ echo -L@libdir@ @SDL_RLD_FLAGS@ @SDL_LIBS@ +-- +2.33.1 + diff --git a/pkgs/development/libraries/aspell/default.nix b/pkgs/development/libraries/aspell/default.nix index 777bad1e5a5..b839092228b 100644 --- a/pkgs/development/libraries/aspell/default.nix +++ b/pkgs/development/libraries/aspell/default.nix @@ -1,4 +1,8 @@ -{ lib, stdenv, fetchurl, fetchpatch, fetchzip, perl +{ lib, stdenv, fetchurl, fetchpatch, fetchzip, perl, ncurses + + # for tests +, aspell, glibc, runCommand + , searchNixProfiles ? true }: @@ -37,7 +41,7 @@ stdenv.mkDerivation rec { ''; nativeBuildInputs = [ perl ]; - buildInputs = [ perl ]; + buildInputs = [ ncurses perl ]; doCheck = true; @@ -55,6 +59,19 @@ stdenv.mkDerivation rec { cp ${devaMapsSource}/u-deva.{cmap,cset} $out/lib/aspell/ ''; + passthru.tests = { + uses-curses = runCommand "${pname}-curses" { + buildInputs = [ glibc ]; + } '' + if ! ldd ${aspell}/bin/aspell | grep -q ${ncurses} + then + echo "Test failure: It does not look like aspell picked up the curses dependency." + exit 1 + fi + touch $out + ''; + }; + meta = { description = "Spell checker for many languages"; homepage = "http://aspell.net/"; diff --git a/pkgs/development/libraries/avahi/default.nix b/pkgs/development/libraries/avahi/default.nix index a52d1be566e..1732b5df04e 100644 --- a/pkgs/development/libraries/avahi/default.nix +++ b/pkgs/development/libraries/avahi/default.nix @@ -18,7 +18,7 @@ let in stdenv.mkDerivation rec { - name = "avahi${lib.optionalString withLibdnssdCompat "-compat"}-${version}"; + pname = "avahi${lib.optionalString withLibdnssdCompat "-compat"}"; version = "0.8"; src = fetchurl { @@ -33,6 +33,10 @@ stdenv.mkDerivation rec { patches = [ ./no-mkdir-localstatedir.patch + (fetchpatch { + url = "https://github.com/lathiat/avahi/commit/9d31939e55280a733d930b15ac9e4dda4497680c.patch"; + sha256 = "sha256-BXWmrLWUvDxKPoIPRFBpMS3T4gijRw0J+rndp6iDybU="; + }) ]; buildInputs = [ libdaemon dbus glib expat libiconv libevent ] diff --git a/pkgs/development/libraries/avro-c/default.nix b/pkgs/development/libraries/avro-c/default.nix index 76d5839402c..e38a748317f 100644 --- a/pkgs/development/libraries/avro-c/default.nix +++ b/pkgs/development/libraries/avro-c/default.nix @@ -1,4 +1,4 @@ -{ lib, stdenv, cmake, fetchurl, pkg-config, jansson, zlib }: +{ lib, stdenv, cmake, fetchurl, pkg-config, jansson, lzma, snappy, zlib }: stdenv.mkDerivation rec { pname = "avro-c"; @@ -15,7 +15,7 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ pkg-config cmake ]; - buildInputs = [ jansson zlib ]; + buildInputs = [ jansson lzma snappy zlib ]; meta = with lib; { description = "A C library which implements parts of the Avro Specification"; diff --git a/pkgs/development/libraries/boost/1.69.nix b/pkgs/development/libraries/boost/1.69.nix index d934e3267fc..c8846daa64f 100644 --- a/pkgs/development/libraries/boost/1.69.nix +++ b/pkgs/development/libraries/boost/1.69.nix @@ -8,4 +8,6 @@ callPackage ./generic.nix (args // rec { # SHA256 from http://www.boost.org/users/history/version_1_69_0.html sha256 = "8f32d4617390d1c2d16f26a27ab60d97807b35440d45891fa340fc2648b04406"; }; + + patches = [ ./pthread-stack-min-fix.patch ]; }) diff --git a/pkgs/development/libraries/boost/1.70.nix b/pkgs/development/libraries/boost/1.70.nix index bc70797acda..4d50f41e49c 100644 --- a/pkgs/development/libraries/boost/1.70.nix +++ b/pkgs/development/libraries/boost/1.70.nix @@ -8,4 +8,6 @@ callPackage ./generic.nix (args // rec { # SHA256 from http://www.boost.org/users/history/version_1_70_0.html sha256 = "430ae8354789de4fd19ee52f3b1f739e1fba576f0aded0897c3c2bc00fb38778"; }; + + patches = [ ./pthread-stack-min-fix.patch ]; }) diff --git a/pkgs/development/libraries/boost/1.72.nix b/pkgs/development/libraries/boost/1.72.nix index bb2fccdfaf7..666a3cacb65 100644 --- a/pkgs/development/libraries/boost/1.72.nix +++ b/pkgs/development/libraries/boost/1.72.nix @@ -11,5 +11,7 @@ callPackage ./generic.nix (args // rec { # SHA256 from http://www.boost.org/users/history/version_1_72_0.html sha256 = "59c9b274bc451cf91a9ba1dd2c7fdcaf5d60b1b3aa83f2c9fa143417cc660722"; }; + + patches = [ ./pthread-stack-min-fix.patch ]; }) diff --git a/pkgs/development/libraries/boost/pthread-stack-min-fix.patch b/pkgs/development/libraries/boost/pthread-stack-min-fix.patch new file mode 100644 index 00000000000..b6c85f84052 --- /dev/null +++ b/pkgs/development/libraries/boost/pthread-stack-min-fix.patch @@ -0,0 +1,15 @@ +Taken from https://github.com/conan-io/conan-center-index/pull/361/files + +diff --git a/include/boost/thread/pthread/thread_data.hpp b/include/boost/thread/pthread/thread_data.hpp +index aefbeb4..bc9b136 100644 +--- a/boost/thread/pthread/thread_data.hpp ++++ b/boost/thread/pthread/thread_data.hpp +@@ -57,7 +57,7 @@ namespace boost + #else + std::size_t page_size = ::sysconf( _SC_PAGESIZE); + #endif +-#if PTHREAD_STACK_MIN > 0 ++#ifdef PTHREAD_STACK_MIN + if (size<PTHREAD_STACK_MIN) size=PTHREAD_STACK_MIN; + #endif + size = ((size+page_size-1)/page_size)*page_size; diff --git a/pkgs/development/libraries/catch/default.nix b/pkgs/development/libraries/catch/default.nix index c89fbd477c9..c4d64a0f478 100644 --- a/pkgs/development/libraries/catch/default.nix +++ b/pkgs/development/libraries/catch/default.nix @@ -20,6 +20,12 @@ stdenv.mkDerivation rec { url = "https://github.com/catchorg/Catch2/commit/bb6d08323f23a39eb65dd86671e68f4f5d3f2d6c.patch"; sha256 = "1vhbzx84nrhhf9zlbl6h5zmg3r5w5v833ihlswsysb9wp2i4isc5"; }) + + # Fix glibc-2.34 build + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/catch1/raw/23276476148a657e7a45ade547f858cbf965a33a/f/catch1-sigstksz.patch"; + sha256 = "sha256-XSsI3iDEZCUSbozlYWC0y/LZ7qr/5zwACpn1jHKD0yU="; + }) ]; doCheck = true; diff --git a/pkgs/development/libraries/cpp-hocon/default.nix b/pkgs/development/libraries/cpp-hocon/default.nix index dfe7f777670..bba2e03f8d5 100644 --- a/pkgs/development/libraries/cpp-hocon/default.nix +++ b/pkgs/development/libraries/cpp-hocon/default.nix @@ -11,6 +11,10 @@ stdenv.mkDerivation rec { owner = "puppetlabs"; }; + postPatch = '' + sed -i -e '/add_subdirectory(tests)/d' lib/CMakeLists.txt + ''; + NIX_CFLAGS_COMPILE = "-Wno-error"; nativeBuildInputs = [ cmake ]; diff --git a/pkgs/development/libraries/cwiid/default.nix b/pkgs/development/libraries/cwiid/default.nix index 31a5420e375..e640b6cbbba 100644 --- a/pkgs/development/libraries/cwiid/default.nix +++ b/pkgs/development/libraries/cwiid/default.nix @@ -1,8 +1,8 @@ { lib, stdenv, fetchFromGitHub, autoreconfHook, bison, flex, bluez, pkg-config, gtk2 }: stdenv.mkDerivation rec { - name = "cwiid-${version}-git"; - version = "2010-02-21"; + pname = "cwiid"; + version = "unstable-2010-02-21"; src = fetchFromGitHub { owner = "abstrakraft"; diff --git a/pkgs/development/libraries/cxxopts/default.nix b/pkgs/development/libraries/cxxopts/default.nix index 9d3ea6f32de..5d12b3c19ee 100644 --- a/pkgs/development/libraries/cxxopts/default.nix +++ b/pkgs/development/libraries/cxxopts/default.nix @@ -8,12 +8,12 @@ }: stdenv.mkDerivation rec { - name = "cxxopts"; + pname = "cxxopts"; version = "3.0.0"; src = fetchFromGitHub { owner = "jarro2783"; - repo = name; + repo = "cxxopts"; rev = "v${version}"; sha256 = "08x7j168l1xwj0r3rv89cgghmfhsx98lpq35r3vkh504m1pd55a6"; }; diff --git a/pkgs/development/libraries/cyrus-sasl/cyrus-sasl-ac-try-run-fix.patch b/pkgs/development/libraries/cyrus-sasl/cyrus-sasl-ac-try-run-fix.patch index 8662e812e99..f0376792e00 100644 --- a/pkgs/development/libraries/cyrus-sasl/cyrus-sasl-ac-try-run-fix.patch +++ b/pkgs/development/libraries/cyrus-sasl/cyrus-sasl-ac-try-run-fix.patch @@ -1,12 +1,13 @@ ---- a/m4/sasl2.m4 2018-11-18 22:33:29.902625600 +0300 -+++ b/m4/sasl2.m4 2018-11-18 22:33:59.828746176 +0300 -@@ -339,7 +339,8 @@ - ], - [ AC_DEFINE(HAVE_GSS_SPNEGO,,[Define if your GSSAPI implementation supports SPNEGO]) - AC_MSG_RESULT(yes) ], -- AC_MSG_RESULT(no)) -+ AC_MSG_RESULT(no), -+ AC_MSG_RESULT(no)) - LIBS="$cmu_save_LIBS" +diff --git a/m4/sasl2.m4 b/m4/sasl2.m4 +index 098c853a..91d98def 100644 +--- a/m4/sasl2.m4 ++++ b/m4/sasl2.m4 +@@ -350,7 +350,7 @@ int main(void) - else + return (!have_spnego); // 0 = success, 1 = failure + } +-],[ac_cv_gssapi_supports_spnego=yes],[ac_cv_gssapi_supports_spnego=no]) ++],[ac_cv_gssapi_supports_spnego=yes],[ac_cv_gssapi_supports_spnego=no],[ac_cv_gssapi_supports_spnego=no]) + LIBS="$cmu_save_LIBS" + ]) + AS_IF([test "$ac_cv_gssapi_supports_spnego" = yes],[ diff --git a/pkgs/development/libraries/cyrus-sasl/default.nix b/pkgs/development/libraries/cyrus-sasl/default.nix index 6e97c61a6a5..be20a9b1678 100644 --- a/pkgs/development/libraries/cyrus-sasl/default.nix +++ b/pkgs/development/libraries/cyrus-sasl/default.nix @@ -1,11 +1,11 @@ { lib, stdenv, fetchurl, openssl, openldap, libkrb5, db, gettext , pam, fixDarwinDylibNames, autoreconfHook, enableLdap ? false -, buildPackages, pruneLibtoolFiles, fetchpatch }: +, buildPackages, pruneLibtoolFiles, nixosTests }: with lib; stdenv.mkDerivation rec { pname = "cyrus-sasl"; - version = "2.1.27"; + version = "2.1.28"; src = fetchurl { urls = @@ -13,9 +13,14 @@ stdenv.mkDerivation rec { "http://www.cyrusimap.org/releases/${pname}-${version}.tar.gz" "http://www.cyrusimap.org/releases/old/${pname}-${version}.tar.gz" ]; - sha256 = "1m85zcpgfdhm43cavpdkhb1s2zq1b31472hq1w1gs3xh94anp1i6"; + sha256 = "sha256-fM/Gq9Ae1nwaCSSzU+Um8bdmsh9C1FYu5jWo6/xbs4w="; }; + patches = [ + # Fix cross-compilation + ./cyrus-sasl-ac-try-run-fix.patch + ]; + outputs = [ "bin" "dev" "out" "man" "devdoc" ]; depsBuildBuild = [ buildPackages.stdenv.cc ]; @@ -26,16 +31,6 @@ stdenv.mkDerivation rec { ++ lib.optional enableLdap openldap ++ lib.optional stdenv.isLinux pam; - patches = [ - ./missing-size_t.patch # https://bugzilla.redhat.com/show_bug.cgi?id=906519 - ./cyrus-sasl-ac-try-run-fix.patch - (fetchpatch { - name = "CVE-2019-19906.patch"; - url = "https://sources.debian.org/data/main/c/cyrus-sasl2/2.1.27+dfsg-1+deb10u1/debian/patches/0021-CVE-2019-19906.patch"; - sha256 = "1n4c5wg7l9j8rlbvx8i605j5d39xmj5wm618k8acxl4fmglcmfls"; - }) - ]; - configureFlags = [ "--with-openssl=${openssl.dev}" "--with-plugindir=${placeholder "out"}/lib/sasl2" @@ -46,6 +41,10 @@ stdenv.mkDerivation rec { installFlags = lib.optional stdenv.isDarwin [ "framedir=$(out)/Library/Frameworks/SASL2.framework" ]; + passthru.tests = { + inherit (nixosTests) parsedmarc postfix; + }; + meta = { homepage = "https://www.cyrusimap.org/sasl"; description = "Library for adding authentication support to connection-based protocols"; diff --git a/pkgs/development/libraries/cyrus-sasl/missing-size_t.patch b/pkgs/development/libraries/cyrus-sasl/missing-size_t.patch deleted file mode 100644 index da96818ca26..00000000000 --- a/pkgs/development/libraries/cyrus-sasl/missing-size_t.patch +++ /dev/null @@ -1,13 +0,0 @@ -Gentoo bug #458790 ---- a/include/sasl.h 2012-10-12 17:05:48.000000000 +0300 -+++ b/include/sasl.h 2013-02-23 16:56:44.648786268 +0200 -@@ -121,6 +121,9 @@ - #ifndef SASL_H - #define SASL_H 1 - -+/* stddef.h to get size_t defined */ -+#include <stddef.h> -+ - /* Keep in sync with win32/common.mak */ - #define SASL_VERSION_MAJOR 2 - #define SASL_VERSION_MINOR 1 diff --git a/pkgs/development/libraries/dav1d/default.nix b/pkgs/development/libraries/dav1d/default.nix index b39e0923609..180480985ac 100644 --- a/pkgs/development/libraries/dav1d/default.nix +++ b/pkgs/development/libraries/dav1d/default.nix @@ -10,14 +10,14 @@ assert useVulkan -> withExamples; stdenv.mkDerivation rec { pname = "dav1d"; - version = "0.9.2"; + version = "1.0.0"; src = fetchFromGitLab { domain = "code.videolan.org"; owner = "videolan"; repo = pname; rev = version; - sha256 = "0bkps488h9s15ylvkm4fmfywgrpbw570glawpnv6khpq9n223dzl"; + sha256 = "sha256-RVr7NFVxY+6MBD8NV7eMW8TEWuCgcfqpula1o1VZe0o="; }; nativeBuildInputs = [ meson ninja nasm pkg-config ]; @@ -31,6 +31,8 @@ stdenv.mkDerivation rec { "-Denable_examples=${lib.boolToString withExamples}" ]; + doCheck = true; + meta = with lib; { description = "A cross-platform AV1 decoder focused on speed and correctness"; longDescription = '' diff --git a/pkgs/development/libraries/dotconf/default.nix b/pkgs/development/libraries/dotconf/default.nix index 39d71eee432..fed050f64b6 100644 --- a/pkgs/development/libraries/dotconf/default.nix +++ b/pkgs/development/libraries/dotconf/default.nix @@ -1,7 +1,7 @@ { fetchFromGitHub, lib, stdenv, autoreconfHook }: stdenv.mkDerivation rec { - name = "dotconf-" + version; + pname = "dotconf"; version = "1.3"; src = fetchFromGitHub { diff --git a/pkgs/development/libraries/expat/default.nix b/pkgs/development/libraries/expat/default.nix index ac54ced75b1..a05f3b71fb4 100644 --- a/pkgs/development/libraries/expat/default.nix +++ b/pkgs/development/libraries/expat/default.nix @@ -16,11 +16,11 @@ stdenv.mkDerivation rec { pname = "expat"; - version = "2.4.6"; + version = "2.4.7"; src = fetchurl { url = "https://github.com/libexpat/libexpat/releases/download/R_${lib.replaceStrings ["."] ["_"] version}/${pname}-${version}.tar.xz"; - sha256 = "sha256-3lV5S3qbwhSFL9wHW+quzYVO/hNhWX5iaO6HlGlRKJs="; + sha256 = "0zbss0dssn17mjmvk17qfi5cmvm0lcyzs62cwvqr219hhl864xcq"; }; outputs = [ "out" "dev" ]; # TODO: fix referrers @@ -45,6 +45,7 @@ stdenv.mkDerivation rec { passthru.tests = { inherit python3; + inherit (python3.pkgs) xmltodict; inherit (haskellPackages) hexpat; inherit (perlPackages) XMLSAXExpat XMLParser; inherit (luaPackages) luaexpat; diff --git a/pkgs/development/libraries/fltk/common.nix b/pkgs/development/libraries/fltk/common.nix index 06e1c05c7d0..54c8b4094f1 100644 --- a/pkgs/development/libraries/fltk/common.nix +++ b/pkgs/development/libraries/fltk/common.nix @@ -36,7 +36,6 @@ , withDocs ? true , doxygen , graphviz -, texlive , withExamples ? true , withShared ? true @@ -44,11 +43,6 @@ let onOff = value: if value then "ON" else "OFF"; - tex = texlive.combine { - inherit (texlive) - scheme-medium varwidth multirow hanging adjustbox collectbox stackengine - sectsty tocloft newunicodechar etoc; - }; in stdenv.mkDerivation rec { pname = "fltk"; @@ -81,7 +75,6 @@ stdenv.mkDerivation rec { ] ++ lib.optionals withDocs [ doxygen graphviz - tex ]; buildInputs = lib.optionals stdenv.hostPlatform.isDarwin [ @@ -149,9 +142,9 @@ stdenv.mkDerivation rec { # Docs "-DOPTION_BUILD_HTML_DOCUMENTATION=${onOff withDocs}" - "-DOPTION_BUILD_PDF_DOCUMENTATION=${onOff withDocs}" + "-DOPTION_BUILD_PDF_DOCUMENTATION=OFF" "-DOPTION_INSTALL_HTML_DOCUMENTATION=${onOff withDocs}" - "-DOPTION_INSTALL_PDF_DOCUMENTATION=${onOff withDocs}" + "-DOPTION_INSTALL_PDF_DOCUMENTATION=OFF" "-DOPTION_INCLUDE_DRIVER_DOCUMENTATION=${onOff withDocs}" ]; diff --git a/pkgs/development/libraries/gcc/libgcc/default.nix b/pkgs/development/libraries/gcc/libgcc/default.nix index b9b7db729eb..094bb7e7a1d 100644 --- a/pkgs/development/libraries/gcc/libgcc/default.nix +++ b/pkgs/development/libraries/gcc/libgcc/default.nix @@ -4,7 +4,7 @@ }: stdenvNoLibs.mkDerivation rec { - name = "libgcc-${version}"; + pname = "libgcc"; inherit (gcc.cc) src version; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/ggz_base_libs/default.nix b/pkgs/development/libraries/ggz_base_libs/default.nix index cafb8693549..687b74fdb3a 100644 --- a/pkgs/development/libraries/ggz_base_libs/default.nix +++ b/pkgs/development/libraries/ggz_base_libs/default.nix @@ -1,12 +1,11 @@ { lib, stdenv, fetchurl, intltool, openssl, expat, libgcrypt }: stdenv.mkDerivation rec { + pname = "ggz-base-libs"; version = "0.99.5"; - baseName = "ggz-base-libs"; - name = "${baseName}-snapshot-${version}"; src = fetchurl { - url = "http://mirrors.ibiblio.org/pub/mirrors/ggzgamingzone/ggz/snapshots/${name}.tar.gz"; + url = "http://mirrors.ibiblio.org/pub/mirrors/ggzgamingzone/ggz/snapshots/ggz-base-libs-snapshot-${version}.tar.gz"; sha256 = "1cw1vg0fbj36zyggnzidx9cbjwfc1yr4zqmsipxnvns7xa2awbdk"; }; diff --git a/pkgs/development/libraries/glib/default.nix b/pkgs/development/libraries/glib/default.nix index a7b8f0d44bf..386130cc622 100644 --- a/pkgs/development/libraries/glib/default.nix +++ b/pkgs/development/libraries/glib/default.nix @@ -54,6 +54,14 @@ stdenv.mkDerivation rec { patches = optionals stdenv.isDarwin [ ./darwin-compilation.patch + + # Fix Inkscape compilation with clang++ + # https://gitlab.gnome.org/GNOME/glib/-/issues/2625 + (fetchpatch { + url = "https://gitlab.gnome.org/GNOME/glib/-/commit/97d39b745ff1f621424f68a41ce0a7c5bb554c87.patch"; + sha256 = "wftuyf3ExFfrISngCQpEUpIGfHCCLXeYv/PEb/TE6a8="; + revert = true; + }) ] ++ optionals stdenv.hostPlatform.isMusl [ ./quark_init_on_demand.patch ./gobject_init_on_demand.patch diff --git a/pkgs/development/libraries/glibc/0001-Revert-Remove-all-usage-of-BASH-or-BASH-in-installed.patch b/pkgs/development/libraries/glibc/0001-Revert-Remove-all-usage-of-BASH-or-BASH-in-installed.patch new file mode 100644 index 00000000000..45bad2867e9 --- /dev/null +++ b/pkgs/development/libraries/glibc/0001-Revert-Remove-all-usage-of-BASH-or-BASH-in-installed.patch @@ -0,0 +1,131 @@ +From f81744bae4442345ff6f40d80fdb8adaba8b330f Mon Sep 17 00:00:00 2001 +From: Maximilian Bosch <maximilian@mbosch.me> +Date: Fri, 27 Aug 2021 17:19:27 +0200 +Subject: [PATCH] Revert "Remove all usage of @BASH@ or ${BASH} in installed + files, and hardcode /bin/bash instead" + +We need the ability to override to use `/bin/sh` here to avoid having +some bootstrap tools in a final build product. + +This reverts commit 5188a9d0265cc6f7235a8af1d31ab02e4a24853d. +--- + debug/Makefile | 5 +++-- + debug/xtrace.sh | 2 +- + elf/Makefile | 4 +++- + elf/ldd.bash.in | 2 +- + elf/sotruss.sh | 2 +- + malloc/Makefile | 5 +++-- + malloc/memusage.sh | 2 +- + timezone/Makefile | 3 ++- + 8 files changed, 15 insertions(+), 10 deletions(-) + +diff --git a/debug/Makefile b/debug/Makefile +index 6893111cbf..3f66666c6c 100644 +--- a/debug/Makefile ++++ b/debug/Makefile +@@ -216,7 +216,8 @@ $(objpfx)pcprofiledump: $(objpfx)pcprofiledump.o + + $(objpfx)xtrace: xtrace.sh + rm -f $@.new +- sed -e 's|@VERSION@|$(version)|' -e 's|@SLIBDIR@|$(sLIBdir)|' \ +- -e 's|@BINDIR@|$(bindir)|' -e 's|@PKGVERSION@|$(PKGVERSION)|' \ ++ sed -e 's|@BASH@|$(BASH)|' -e 's|@VERSION@|$(version)|' \ ++ -e 's|@SLIBDIR@|$(sLIBdir)|' -e 's|@BINDIR@|$(bindir)|' \ ++ -e 's|@PKGVERSION@|$(PKGVERSION)|' \ + -e 's|@REPORT_BUGS_TO@|$(REPORT_BUGS_TO)|' $^ > $@.new \ + && rm -f $@ && mv $@.new $@ && chmod +x $@ +diff --git a/debug/xtrace.sh b/debug/xtrace.sh +index 9697fbe0b4..279fe59ac6 100755 +--- a/debug/xtrace.sh ++++ b/debug/xtrace.sh +@@ -1,4 +1,4 @@ +-#!/bin/bash ++#! @BASH@ + # Copyright (C) 1999-2021 Free Software Foundation, Inc. + # This file is part of the GNU C Library. + # Contributed by Ulrich Drepper <drepper@gnu.org>, 1999. +diff --git a/elf/Makefile b/elf/Makefile +index d05f410592..9264409fdd 100644 +--- a/elf/Makefile ++++ b/elf/Makefile +@@ -144,7 +144,8 @@ $(objpfx)sotruss-lib.so: $(common-objpfx)libc.so $(objpfx)ld.so \ + $(common-objpfx)libc_nonshared.a + + $(objpfx)sotruss: sotruss.sh $(common-objpfx)config.make +- sed -e 's%@VERSION@%$(version)%g' \ ++ sed -e 's%@BASH@%$(BASH)%g' \ ++ -e 's%@VERSION@%$(version)%g' \ + -e 's%@TEXTDOMAINDIR@%$(localedir)%g' \ + -e 's%@PREFIX@%$(prefix)%g' \ + -e 's|@PKGVERSION@|$(PKGVERSION)|g' \ +@@ -659,6 +660,7 @@ ldd-rewrite = -e 's%@RTLD@%$(rtlddir)/$(rtld-installed-name)%g' \ + -e 's%@VERSION@%$(version)%g' \ + -e 's|@PKGVERSION@|$(PKGVERSION)|g' \ + -e 's|@REPORT_BUGS_TO@|$(REPORT_BUGS_TO)|g' \ ++ -e 's%@BASH@%$(BASH)%g' \ + -e 's%@TEXTDOMAINDIR@%$(localedir)%g' + + ifeq ($(ldd-rewrite-script),no) +diff --git a/elf/ldd.bash.in b/elf/ldd.bash.in +index ba736464ac..57442bc3f2 100644 +--- a/elf/ldd.bash.in ++++ b/elf/ldd.bash.in +@@ -1,4 +1,4 @@ +-#!/bin/bash ++#! @BASH@ + # Copyright (C) 1996-2021 Free Software Foundation, Inc. + # This file is part of the GNU C Library. + +diff --git a/elf/sotruss.sh b/elf/sotruss.sh +index 003cf4d825..fd4da80244 100755 +--- a/elf/sotruss.sh ++++ b/elf/sotruss.sh +@@ -1,4 +1,4 @@ +-#!/bin/bash ++#! @BASH@ + # Copyright (C) 2011-2021 Free Software Foundation, Inc. + # This file is part of the GNU C Library. + +diff --git a/malloc/Makefile b/malloc/Makefile +index 9b70831d38..90ecadff6c 100644 +--- a/malloc/Makefile ++++ b/malloc/Makefile +@@ -271,8 +271,9 @@ $(objpfx)mtrace: mtrace.pl + + $(objpfx)memusage: memusage.sh + rm -f $@.new +- sed -e 's|@VERSION@|$(version)|' -e 's|@SLIBDIR@|$(sLIBdir)|' \ +- -e 's|@BINDIR@|$(bindir)|' -e 's|@PKGVERSION@|$(PKGVERSION)|' \ ++ sed -e 's|@BASH@|$(BASH)|' -e 's|@VERSION@|$(version)|' \ ++ -e 's|@SLIBDIR@|$(sLIBdir)|' -e 's|@BINDIR@|$(bindir)|' \ ++ -e 's|@PKGVERSION@|$(PKGVERSION)|' \ + -e 's|@REPORT_BUGS_TO@|$(REPORT_BUGS_TO)|' $^ > $@.new \ + && rm -f $@ && mv $@.new $@ && chmod +x $@ + +diff --git a/malloc/memusage.sh b/malloc/memusage.sh +index 0645f09911..c1cd4e23b7 100755 +--- a/malloc/memusage.sh ++++ b/malloc/memusage.sh +@@ -1,4 +1,4 @@ +-#!/bin/bash ++#! @BASH@ + # Copyright (C) 1999-2021 Free Software Foundation, Inc. + # This file is part of the GNU C Library. + # Contributed by Ulrich Drepper <drepper@gnu.org>, 1999. +diff --git a/timezone/Makefile b/timezone/Makefile +index c624a189b3..395abfeebd 100644 +--- a/timezone/Makefile ++++ b/timezone/Makefile +@@ -123,7 +123,8 @@ $(testdata)/XT%: testdata/XT% + cp $< $@ + + $(objpfx)tzselect: tzselect.ksh $(common-objpfx)config.make +- sed -e 's|TZDIR=[^}]*|TZDIR=$(zonedir)|' \ ++ sed -e 's|/bin/bash|$(BASH)|' \ ++ -e 's|TZDIR=[^}]*|TZDIR=$(zonedir)|' \ + -e '/TZVERSION=/s|see_Makefile|"$(version)"|' \ + -e '/PKGVERSION=/s|=.*|="$(PKGVERSION)"|' \ + -e '/REPORT_BUGS_TO=/s|=.*|="$(REPORT_BUGS_TO)"|' \ +-- +2.31.1 + diff --git a/pkgs/development/libraries/glibc/2.33-master.patch.gz b/pkgs/development/libraries/glibc/2.33-master.patch.gz deleted file mode 100644 index 777e94e2b2e..00000000000 --- a/pkgs/development/libraries/glibc/2.33-master.patch.gz +++ /dev/null Binary files differdiff --git a/pkgs/development/libraries/glibc/2.34-master.patch.gz b/pkgs/development/libraries/glibc/2.34-master.patch.gz new file mode 100644 index 00000000000..8fb02ca6d72 --- /dev/null +++ b/pkgs/development/libraries/glibc/2.34-master.patch.gz Binary files differdiff --git a/pkgs/development/libraries/glibc/common.nix b/pkgs/development/libraries/glibc/common.nix index ffec9972d28..47aa304e7d3 100644 --- a/pkgs/development/libraries/glibc/common.nix +++ b/pkgs/development/libraries/glibc/common.nix @@ -43,9 +43,9 @@ } @ args: let - version = "2.33"; - patchSuffix = "-117"; - sha256 = "sha256-LiVWAA4QXb1X8Layoy/yzxc73k8Nhd/8z9i35RoGd/8="; + version = "2.34"; + patchSuffix = "-115"; + sha256 = "sha256-RNJqH+ILiFOkj0cOrQHkJ56GmsFJsZXdpORKGV2YGrI="; in assert withLinuxHeaders -> linuxHeaders != null; @@ -62,14 +62,14 @@ stdenv.mkDerivation ({ patches = [ /* No tarballs for stable upstream branch, only https://sourceware.org/git/glibc.git and using git would complicate bootstrapping. - $ git fetch --all -p && git checkout origin/release/2.33/master && git describe - glibc-2.33-117-g55446dd8a2 - $ git show --minimal --reverse glibc-2.33.. | gzip -9n --rsyncable - > 2.33-master.patch.gz + $ git fetch --all -p && git checkout origin/release/2.34/master && git describe + glibc-2.34-115-gd5d1c95aaf + $ git show --minimal --reverse glibc-2.34.. | gzip -9n --rsyncable - > 2.34-master.patch.gz To compare the archive contents zdiff can be used. - $ zdiff -u 2.33-master.patch.gz ../nixpkgs/pkgs/development/libraries/glibc/2.33-master.patch.gz + $ zdiff -u 2.34-master.patch.gz ../nixpkgs/pkgs/development/libraries/glibc/2.34-master.patch.gz */ - ./2.33-master.patch.gz + ./2.34-master.patch.gz /* Allow NixOS and Nix to handle the locale-archive. */ ./nix-locale-archive.patch @@ -125,6 +125,8 @@ stdenv.mkDerivation ({ /* https://github.com/NixOS/nixpkgs/pull/137601 */ ./nix-nss-open-files.patch + + ./0001-Revert-Remove-all-usage-of-BASH-or-BASH-in-installed.patch ] ++ lib.optional stdenv.hostPlatform.isMusl ./fix-rpc-types-musl-conflicts.patch ++ lib.optional stdenv.buildPlatform.isDarwin ./darwin-cross-build.patch; @@ -138,6 +140,10 @@ stdenv.mkDerivation ({ # nscd needs libgcc, and we don't want it dynamically linked # because we don't want it to depend on bootstrap-tools libs. echo "LDFLAGS-nscd += -static-libgcc" >> nscd/Makefile + + # Ensure that `__nss_files_fopen` can still be wrapped by `libredirect`. + sed -i -e '/libc_hidden_def (__nss_files_fopen)/d' nss/nss_files_fopen.c + sed -i -e '/libc_hidden_proto (__nss_files_fopen)/d' include/nss_files.h '' # FIXME: find a solution for infinite recursion in cross builds. # For now it's hopefully acceptable that IDN from libc doesn't reliably work. diff --git a/pkgs/development/libraries/glibc/default.nix b/pkgs/development/libraries/glibc/default.nix index caaacfe4f43..65a622f0467 100644 --- a/pkgs/development/libraries/glibc/default.nix +++ b/pkgs/development/libraries/glibc/default.nix @@ -119,6 +119,17 @@ callPackage ./common.nix { inherit stdenv; } { # Get rid of more unnecessary stuff. rm -rf $out/var $bin/bin/sln + + # Backwards-compatibility to fix e.g. + # "configure: error: Pthreads are required to build libgomp" during `gcc`-build + # because it's not actually needed anymore to link against `pthreads` since + # it's now part of `libc.so.6` itself, but the gcc build breaks if + # this doesn't work. + ln -sf $out/lib/libpthread.so.0 $out/lib/libpthread.so + ln -sf $out/lib/librt.so.1 $out/lib/librt.so + ln -sf $out/lib/libdl.so.2 $out/lib/libdl.so + ln -sf $out/lib/libutil.so.1 $out/lib/libutil.so + touch $out/lib/libpthread.a '' # For some reason these aren't stripped otherwise and retain reference # to bootstrap-tools; on cross-arm this stripping would break objects. diff --git a/pkgs/development/libraries/glibc/nix-locale-archive.patch b/pkgs/development/libraries/glibc/nix-locale-archive.patch index 39312951fcf..2fedf2a7a7d 100644 --- a/pkgs/development/libraries/glibc/nix-locale-archive.patch +++ b/pkgs/development/libraries/glibc/nix-locale-archive.patch @@ -1,7 +1,8 @@ -diff -Naur glibc-2.27-orig/locale/loadarchive.c glibc-2.27/locale/loadarchive.c ---- glibc-2.27-orig/locale/loadarchive.c 2018-02-01 11:17:18.000000000 -0500 -+++ glibc-2.27/locale/loadarchive.c 2018-02-17 22:32:25.680169462 -0500 -@@ -123,6 +123,23 @@ +diff --git a/locale/loadarchive.c b/locale/loadarchive.c +index 512769eaec..171dbb4ad9 100644 +--- a/locale/loadarchive.c ++++ b/locale/loadarchive.c +@@ -123,6 +123,23 @@ calculate_head_size (const struct locarhead *h) return MAX (namehash_end, MAX (string_end, locrectab_end)); } @@ -25,7 +26,7 @@ diff -Naur glibc-2.27-orig/locale/loadarchive.c glibc-2.27/locale/loadarchive.c /* Find the locale *NAMEP in the locale archive, and return the internalized data structure for its CATEGORY data. If this locale has -@@ -202,7 +219,7 @@ +@@ -202,7 +219,7 @@ _nl_load_locale_from_archive (int category, const char **namep) archmapped = &headmap; /* The archive has never been opened. */ @@ -34,23 +35,25 @@ diff -Naur glibc-2.27-orig/locale/loadarchive.c glibc-2.27/locale/loadarchive.c if (fd < 0) /* Cannot open the archive, for whatever reason. */ return NULL; -@@ -397,8 +414,7 @@ +@@ -397,8 +414,7 @@ _nl_load_locale_from_archive (int category, const char **namep) if (fd == -1) { - struct stat64 st; + struct __stat64_t64 st; - fd = __open_nocancel (archfname, - O_RDONLY|O_LARGEFILE|O_CLOEXEC); -+ fd = open_locale_archive (); ++ fd = open_locale_archive(); if (fd == -1) /* Cannot open the archive, for whatever reason. */ return NULL; -diff -Naur glibc-2.27-orig/locale/programs/locale.c glibc-2.27/locale/programs/locale.c ---- glibc-2.27-orig/locale/programs/locale.c 2018-02-01 11:17:18.000000000 -0500 -+++ glibc-2.27/locale/programs/locale.c 2018-02-17 22:36:39.726293213 -0500 -@@ -633,6 +633,24 @@ +diff --git a/locale/programs/locale.c b/locale/programs/locale.c +index ca0a95be99..e484783402 100644 +--- a/locale/programs/locale.c ++++ b/locale/programs/locale.c +@@ -633,6 +633,24 @@ nameentcmp (const void *a, const void *b) + } - static int ++static int +open_locale_archive (void) +{ + int fd = -1; @@ -68,11 +71,10 @@ diff -Naur glibc-2.27-orig/locale/programs/locale.c glibc-2.27/locale/programs/l +} + + -+static int + static int write_archive_locales (void **all_datap, char *linebuf) { - struct stat64 st; -@@ -644,7 +662,7 @@ +@@ -645,7 +663,7 @@ write_archive_locales (void **all_datap, char *linebuf) int fd, ret = 0; uint32_t cnt; @@ -81,10 +83,11 @@ diff -Naur glibc-2.27-orig/locale/programs/locale.c glibc-2.27/locale/programs/l if (fd < 0) return 0; -diff -Naur glibc-2.27-orig/locale/programs/locarchive.c glibc-2.27/locale/programs/locarchive.c ---- glibc-2.27-orig/locale/programs/locarchive.c 2018-02-01 11:17:18.000000000 -0500 -+++ glibc-2.27/locale/programs/locarchive.c 2018-02-17 22:40:51.245293975 -0500 -@@ -117,6 +117,22 @@ +diff --git a/locale/programs/locarchive.c b/locale/programs/locarchive.c +index f38e835c52..779a3199fc 100644 +--- a/locale/programs/locarchive.c ++++ b/locale/programs/locarchive.c +@@ -117,6 +117,22 @@ prepare_address_space (int fd, size_t total, size_t *reserved, int *xflags, } @@ -107,7 +110,7 @@ diff -Naur glibc-2.27-orig/locale/programs/locarchive.c glibc-2.27/locale/progra static void create_archive (const char *archivefname, struct locarhandle *ah) { -@@ -578,7 +594,7 @@ +@@ -578,7 +594,7 @@ open_archive (struct locarhandle *ah, bool readonly) while (1) { /* Open the archive. We must have exclusive write access. */ diff --git a/pkgs/development/libraries/gmp/6.x.nix b/pkgs/development/libraries/gmp/6.x.nix index 9093073cecf..af4f15a151f 100644 --- a/pkgs/development/libraries/gmp/6.x.nix +++ b/pkgs/development/libraries/gmp/6.x.nix @@ -12,7 +12,7 @@ let inherit (lib) optional; in let self = stdenv.mkDerivation rec { - pname = "gmp"; + pname = "gmp${lib.optionalString cxx "-with-cxx"}"; version = "6.2.1"; src = fetchurl { # we need to use bz2, others aren't in bootstrapping stdenv diff --git a/pkgs/development/libraries/grpc/default.nix b/pkgs/development/libraries/grpc/default.nix index 28c47640ca6..37c2a1a4413 100644 --- a/pkgs/development/libraries/grpc/default.nix +++ b/pkgs/development/libraries/grpc/default.nix @@ -20,7 +20,7 @@ stdenv.mkDerivation rec { pname = "grpc"; - version = "1.43.0"; # N.B: if you change this, please update: + version = "1.44.0"; # N.B: if you change this, please update: # pythonPackages.grpcio-tools # pythonPackages.grpcio-status @@ -28,7 +28,7 @@ stdenv.mkDerivation rec { owner = "grpc"; repo = "grpc"; rev = "v${version}"; - sha256 = "sha256-NPyCQsrmD/gBs4UHPGbBACmGRTNQDj6WfnfLNdWulK4="; + sha256 = "sha256-pG8RtAJJCLnxm+3hW1YsikyeNr9pjIRANeYhDJfTPbo="; fetchSubmodules = true; }; diff --git a/pkgs/development/libraries/gtkmm/2.x.nix b/pkgs/development/libraries/gtkmm/2.x.nix index cf26e22da5b..284ee83c2d4 100644 --- a/pkgs/development/libraries/gtkmm/2.x.nix +++ b/pkgs/development/libraries/gtkmm/2.x.nix @@ -1,11 +1,11 @@ { lib, stdenv, fetchurl, pkg-config, gtk2, glibmm, cairomm, pangomm, atkmm }: stdenv.mkDerivation rec { - name = "gtkmm-${minVer}.5"; - minVer = "2.24"; + pname = "gtkmm"; + version = "2.24.5"; src = fetchurl { - url = "mirror://gnome/sources/gtkmm/${minVer}/${name}.tar.xz"; + url = "mirror://gnome/sources/gtkmm/${lib.versions.majorMinor version}/gtkmm-${version}.tar.xz"; sha256 = "0680a53b7bf90b4e4bf444d1d89e6df41c777e0bacc96e9c09fc4dd2f5fe6b72"; }; diff --git a/pkgs/development/libraries/hivex/default.nix b/pkgs/development/libraries/hivex/default.nix index 204af0a92b5..85fa8fc4c6e 100644 --- a/pkgs/development/libraries/hivex/default.nix +++ b/pkgs/development/libraries/hivex/default.nix @@ -12,9 +12,9 @@ stdenv.mkDerivation rec { patches = [ ./hivex-syms.patch ]; - nativeBuildInputs = [ pkg-config ]; + nativeBuildInputs = [ autoreconfHook makeWrapper pkg-config ]; buildInputs = [ - autoreconfHook makeWrapper libxml2 + libxml2 ] ++ (with perlPackages; [ perl IOStringy ]) ++ lib.optionals stdenv.isDarwin [ libiconv ]; diff --git a/pkgs/development/libraries/hspell/dicts.nix b/pkgs/development/libraries/hspell/dicts.nix index 83942c2c1dd..06f80bf5cf2 100644 --- a/pkgs/development/libraries/hspell/dicts.nix +++ b/pkgs/development/libraries/hspell/dicts.nix @@ -2,7 +2,7 @@ let dict = variant: a: stdenv.mkDerivation ({ - inherit (hspell) src patchPhase nativeBuildInputs; + inherit (hspell) version src patchPhase nativeBuildInputs; buildFlags = [ variant ]; meta = hspell.meta // { @@ -15,7 +15,7 @@ in recurseForDerivations = true; aspell = dict "aspell" { - name = "aspell-dict-he-${hspell.version}"; + pname = "aspell-dict-he"; installPhase = '' mkdir -p $out/lib/aspell @@ -23,7 +23,7 @@ in }; myspell = dict "myspell" { - name = "myspell-dict-he-${hspell.version}"; + pname = "myspell-dict-he"; installPhase = '' mkdir -p $out/lib/myspell @@ -31,7 +31,7 @@ in }; hunspell = dict "hunspell" { - name = "hunspell-dict-he-${hspell.version}"; + pname = "hunspell-dict-he"; installPhase = '' mkdir -p $out/lib diff --git a/pkgs/development/libraries/http-parser/default.nix b/pkgs/development/libraries/http-parser/default.nix index 36ca0b0ca0b..aff5b1ea3c1 100644 --- a/pkgs/development/libraries/http-parser/default.nix +++ b/pkgs/development/libraries/http-parser/default.nix @@ -1,4 +1,4 @@ -{ lib, stdenv, fetchFromGitHub }: +{ lib, stdenv, fetchFromGitHub, fetchpatch }: stdenv.mkDerivation rec { pname = "http-parser"; @@ -12,7 +12,14 @@ stdenv.mkDerivation rec { }; NIX_CFLAGS_COMPILE = "-Wno-error"; - patches = [ ./build-shared.patch ]; + patches = [ + ./build-shared.patch + # https://github.com/nodejs/http-parser/pull/510 + (fetchpatch { + url = "https://github.com/nodejs/http-parser/commit/4f15b7d510dc7c6361a26a7c6d2f7c3a17f8d878.patch"; + sha256 = "sha256-rZZMJeow3V1fTnjadRaRa+xTq3pdhZn/eJ4xjxEDoU4="; + }) + ]; makeFlags = [ "DESTDIR=" "PREFIX=$(out)" ]; buildFlags = [ "library" ]; doCheck = true; diff --git a/pkgs/development/libraries/igraph/default.nix b/pkgs/development/libraries/igraph/default.nix index 441646c4395..8402aae9819 100644 --- a/pkgs/development/libraries/igraph/default.nix +++ b/pkgs/development/libraries/igraph/default.nix @@ -12,7 +12,9 @@ , lapack , libxml2 , libxslt +, llvmPackages , pkg-config +, plfit , python3 , sourceHighlight , suitesparse @@ -30,10 +32,6 @@ stdenv.mkDerivation rec { sha256 = "sha256-SL9PcT18vFvykCv4VRXxXtlcDAcybmwEImnnKXMciFQ="; }; - # Normally, igraph wants us to call bootstrap.sh, which will call - # tools/getversion.sh. Instead, we're going to put the version directly - # where igraph wants, and then let autoreconfHook do the rest of the - # bootstrap. ~ C. postPatch = '' echo "${version}" > IGRAPH_VERSION '' + lib.optionalString stdenv.isAarch64 '' @@ -65,7 +63,10 @@ stdenv.mkDerivation rec { gmp lapack libxml2 + plfit suitesparse + ] ++ lib.optionals stdenv.cc.isClang [ + llvmPackages.openmp ]; cmakeFlags = [ @@ -75,8 +76,10 @@ stdenv.mkDerivation rec { "-DIGRAPH_USE_INTERNAL_GLPK=OFF" "-DIGRAPH_USE_INTERNAL_CXSPARSE=OFF" "-DIGRAPH_USE_INTERNAL_GMP=OFF" + "-DIGRAPH_USE_INTERNAL_PLFIT=OFF" "-DIGRAPH_GLPK_SUPPORT=ON" "-DIGRAPH_GRAPHML_SUPPORT=ON" + "-DIGRAPH_OPENMP_SUPPORT=ON" "-DIGRAPH_ENABLE_LTO=AUTO" "-DIGRAPH_ENABLE_TLS=ON" "-DBUILD_SHARED_LIBS=ON" diff --git a/pkgs/development/libraries/ijs/default.nix b/pkgs/development/libraries/ijs/default.nix index b300731ce44..ad13daef788 100644 --- a/pkgs/development/libraries/ijs/default.nix +++ b/pkgs/development/libraries/ijs/default.nix @@ -1,9 +1,8 @@ { lib, stdenv, autoreconfHook, ghostscript }: stdenv.mkDerivation { - name = "ijs-${ghostscript.version}"; - - inherit (ghostscript) src; + pname = "ijs"; + inherit (ghostscript) version src; postPatch = "cd ijs"; diff --git a/pkgs/development/libraries/isl/generic.nix b/pkgs/development/libraries/isl/generic.nix index eb6fe5f9cd6..0a8c89d88ad 100644 --- a/pkgs/development/libraries/isl/generic.nix +++ b/pkgs/development/libraries/isl/generic.nix @@ -9,7 +9,8 @@ }: stdenv.mkDerivation { - name = "isl-${version}"; + pname = "isl"; + inherit version; src = fetchurl { inherit urls sha256; diff --git a/pkgs/development/libraries/jcal/default.nix b/pkgs/development/libraries/jcal/default.nix index 4ce62ec67bc..354a5518c43 100644 --- a/pkgs/development/libraries/jcal/default.nix +++ b/pkgs/development/libraries/jcal/default.nix @@ -3,7 +3,7 @@ }: stdenv.mkDerivation rec { - name = "jcal"; + pname = "jcal"; version = "0.4.1"; src = fetchFromGitHub { diff --git a/pkgs/development/libraries/kde-frameworks/attica.nix b/pkgs/development/libraries/kde-frameworks/attica.nix index 8c71afd5dcf..dbe4dd14b8f 100644 --- a/pkgs/development/libraries/kde-frameworks/attica.nix +++ b/pkgs/development/libraries/kde-frameworks/attica.nix @@ -1,7 +1,7 @@ { mkDerivation, extra-cmake-modules, qtbase }: mkDerivation { - name = "attica"; + pname = "attica"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qtbase ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/baloo.nix b/pkgs/development/libraries/kde-frameworks/baloo.nix index 0c8f181a188..d608785027e 100644 --- a/pkgs/development/libraries/kde-frameworks/baloo.nix +++ b/pkgs/development/libraries/kde-frameworks/baloo.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "baloo"; + pname = "baloo"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kauth kconfig kcrash kdbusaddons ki18n kio kidletime lmdb qtdeclarative diff --git a/pkgs/development/libraries/kde-frameworks/bluez-qt.nix b/pkgs/development/libraries/kde-frameworks/bluez-qt.nix index c5764b4915e..c07553f8493 100644 --- a/pkgs/development/libraries/kde-frameworks/bluez-qt.nix +++ b/pkgs/development/libraries/kde-frameworks/bluez-qt.nix @@ -4,7 +4,7 @@ }: mkDerivation { - name = "bluez-qt"; + pname = "bluez-qt"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qtdeclarative ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/breeze-icons.nix b/pkgs/development/libraries/kde-frameworks/breeze-icons.nix index 6e79a45ea92..7fd482ea0da 100644 --- a/pkgs/development/libraries/kde-frameworks/breeze-icons.nix +++ b/pkgs/development/libraries/kde-frameworks/breeze-icons.nix @@ -1,7 +1,7 @@ { mkDerivation, extra-cmake-modules, gtk3, qtsvg, hicolor-icon-theme }: mkDerivation { - name = "breeze-icons"; + pname = "breeze-icons"; nativeBuildInputs = [ extra-cmake-modules gtk3 ]; buildInputs = [ qtsvg ]; propagatedBuildInputs = [ diff --git a/pkgs/development/libraries/kde-frameworks/default.nix b/pkgs/development/libraries/kde-frameworks/default.nix index a5b0bfdae8d..2f7d0943dd4 100644 --- a/pkgs/development/libraries/kde-frameworks/default.nix +++ b/pkgs/development/libraries/kde-frameworks/default.nix @@ -70,8 +70,8 @@ let mkDerivation = args: let - inherit (args) name; - inherit (srcs.${name}) src version; + inherit (args) pname; + inherit (srcs.${pname}) src version; outputs = args.outputs or [ "bin" "dev" "out" ]; hasSeparateDev = lib.elem "dev" outputs; @@ -90,8 +90,7 @@ let }; in mkDerivation (args // { - name = "${name}-${version}"; - inherit meta outputs setupHook src version; + inherit pname meta outputs setupHook src version; }); }; diff --git a/pkgs/development/libraries/kde-frameworks/extra-cmake-modules/default.nix b/pkgs/development/libraries/kde-frameworks/extra-cmake-modules/default.nix index b74fb29e5f2..b274999010a 100644 --- a/pkgs/development/libraries/kde-frameworks/extra-cmake-modules/default.nix +++ b/pkgs/development/libraries/kde-frameworks/extra-cmake-modules/default.nix @@ -1,7 +1,7 @@ { mkDerivation, lib, cmake, pkg-config }: mkDerivation { - name = "extra-cmake-modules"; + pname = "extra-cmake-modules"; patches = [ ./nix-lib-path.patch diff --git a/pkgs/development/libraries/kde-frameworks/fetch.sh b/pkgs/development/libraries/kde-frameworks/fetch.sh index cb4e4cc2629..1e2e36d6784 100644 --- a/pkgs/development/libraries/kde-frameworks/fetch.sh +++ b/pkgs/development/libraries/kde-frameworks/fetch.sh @@ -1 +1 @@ -WGET_ARGS=( https://download.kde.org/stable/frameworks/5.91/ -A '*.tar.xz' ) +WGET_ARGS=( https://download.kde.org/stable/frameworks/5.92/ -A '*.tar.xz' ) diff --git a/pkgs/development/libraries/kde-frameworks/frameworkintegration.nix b/pkgs/development/libraries/kde-frameworks/frameworkintegration.nix index c49eab2763c..6cb700c7774 100644 --- a/pkgs/development/libraries/kde-frameworks/frameworkintegration.nix +++ b/pkgs/development/libraries/kde-frameworks/frameworkintegration.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "frameworkintegration"; + pname = "frameworkintegration"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kbookmarks kcompletion kconfig ki18n kio knewstuff knotifications kpackage diff --git a/pkgs/development/libraries/kde-frameworks/kactivities-stats.nix b/pkgs/development/libraries/kde-frameworks/kactivities-stats.nix index 88fde8c5fd6..63a5b035724 100644 --- a/pkgs/development/libraries/kde-frameworks/kactivities-stats.nix +++ b/pkgs/development/libraries/kde-frameworks/kactivities-stats.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kactivities-stats"; + pname = "kactivities-stats"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ boost kactivities kconfig ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kactivities.nix b/pkgs/development/libraries/kde-frameworks/kactivities.nix index b53de41455a..f2f5d09cc8e 100644 --- a/pkgs/development/libraries/kde-frameworks/kactivities.nix +++ b/pkgs/development/libraries/kde-frameworks/kactivities.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kactivities"; + pname = "kactivities"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ boost kconfig kcoreaddons kio kwindowsystem qtdeclarative diff --git a/pkgs/development/libraries/kde-frameworks/kapidox.nix b/pkgs/development/libraries/kde-frameworks/kapidox.nix index 381dacaf496..8d3e89935f8 100644 --- a/pkgs/development/libraries/kde-frameworks/kapidox.nix +++ b/pkgs/development/libraries/kde-frameworks/kapidox.nix @@ -1,7 +1,7 @@ { mkDerivation, lib, extra-cmake-modules, python3 }: mkDerivation { - name = "kapidox"; + pname = "kapidox"; nativeBuildInputs = [ extra-cmake-modules python3 python3.pkgs.setuptools ]; postFixup = '' moveToOutput bin $bin diff --git a/pkgs/development/libraries/kde-frameworks/karchive.nix b/pkgs/development/libraries/kde-frameworks/karchive.nix index bd010f3f11c..822b28f3dee 100644 --- a/pkgs/development/libraries/kde-frameworks/karchive.nix +++ b/pkgs/development/libraries/kde-frameworks/karchive.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "karchive"; + pname = "karchive"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ bzip2 xz zlib zstd ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kauth/default.nix b/pkgs/development/libraries/kde-frameworks/kauth/default.nix index 93c81525a14..f5ab518ce62 100644 --- a/pkgs/development/libraries/kde-frameworks/kauth/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kauth/default.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kauth"; + pname = "kauth"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = lib.optional enablePolkit polkit-qt ++ [ qttools ]; propagatedBuildInputs = [ kcoreaddons ]; diff --git a/pkgs/development/libraries/kde-frameworks/kbookmarks.nix b/pkgs/development/libraries/kde-frameworks/kbookmarks.nix index 4d68c3694bd..1c45a4acb09 100644 --- a/pkgs/development/libraries/kde-frameworks/kbookmarks.nix +++ b/pkgs/development/libraries/kde-frameworks/kbookmarks.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kbookmarks"; + pname = "kbookmarks"; nativeBuildInputs = [ extra-cmake-modules qttools ]; buildInputs = [ kcodecs kconfig kconfigwidgets kcoreaddons kiconthemes kxmlgui diff --git a/pkgs/development/libraries/kde-frameworks/kcalendarcore.nix b/pkgs/development/libraries/kde-frameworks/kcalendarcore.nix index f4f2b05ad73..3f02765af8e 100644 --- a/pkgs/development/libraries/kde-frameworks/kcalendarcore.nix +++ b/pkgs/development/libraries/kde-frameworks/kcalendarcore.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kcalendarcore"; + pname = "kcalendarcore"; nativeBuildInputs = [ extra-cmake-modules ]; propagatedBuildInputs = [ libical ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/kcmutils/default.nix b/pkgs/development/libraries/kde-frameworks/kcmutils/default.nix index 22e2929ae0c..f965256ce3d 100644 --- a/pkgs/development/libraries/kde-frameworks/kcmutils/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kcmutils/default.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kcmutils"; + pname = "kcmutils"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kcoreaddons kdeclarative ki18n kiconthemes kitemviews kpackage kxmlgui diff --git a/pkgs/development/libraries/kde-frameworks/kcodecs.nix b/pkgs/development/libraries/kde-frameworks/kcodecs.nix index a62135150a0..69a9e812494 100644 --- a/pkgs/development/libraries/kde-frameworks/kcodecs.nix +++ b/pkgs/development/libraries/kde-frameworks/kcodecs.nix @@ -1,7 +1,7 @@ { mkDerivation, extra-cmake-modules, qtbase, qttools, gperf }: mkDerivation { - name = "kcodecs"; + pname = "kcodecs"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qttools gperf ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kcompletion.nix b/pkgs/development/libraries/kde-frameworks/kcompletion.nix index ffa612ffaa1..28b4715f98f 100644 --- a/pkgs/development/libraries/kde-frameworks/kcompletion.nix +++ b/pkgs/development/libraries/kde-frameworks/kcompletion.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kcompletion"; + pname = "kcompletion"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kconfig kwidgetsaddons qttools ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kconfig.nix b/pkgs/development/libraries/kde-frameworks/kconfig.nix index ba16e97ef3a..76d9a85e649 100644 --- a/pkgs/development/libraries/kde-frameworks/kconfig.nix +++ b/pkgs/development/libraries/kde-frameworks/kconfig.nix @@ -1,7 +1,7 @@ { mkDerivation, extra-cmake-modules, qtbase, qttools }: mkDerivation { - name = "kconfig"; + pname = "kconfig"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qttools ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kconfigwidgets/default.nix b/pkgs/development/libraries/kde-frameworks/kconfigwidgets/default.nix index fc10f3070b6..e9b283ebc31 100644 --- a/pkgs/development/libraries/kde-frameworks/kconfigwidgets/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kconfigwidgets/default.nix @@ -4,7 +4,7 @@ }: mkDerivation { - name = "kconfigwidgets"; + pname = "kconfigwidgets"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ kguiaddons ki18n qtbase qttools ]; propagatedBuildInputs = [ kauth kcodecs kconfig kwidgetsaddons ]; diff --git a/pkgs/development/libraries/kde-frameworks/kcontacts.nix b/pkgs/development/libraries/kde-frameworks/kcontacts.nix index 56887b775f4..0d26d064dd2 100644 --- a/pkgs/development/libraries/kde-frameworks/kcontacts.nix +++ b/pkgs/development/libraries/kde-frameworks/kcontacts.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kcontacts"; + pname = "kcontacts"; meta = { license = [ lib.licenses.lgpl21 ]; }; diff --git a/pkgs/development/libraries/kde-frameworks/kcoreaddons.nix b/pkgs/development/libraries/kde-frameworks/kcoreaddons.nix index a2102c7d732..f790d802c0c 100644 --- a/pkgs/development/libraries/kde-frameworks/kcoreaddons.nix +++ b/pkgs/development/libraries/kde-frameworks/kcoreaddons.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kcoreaddons"; + pname = "kcoreaddons"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qttools shared-mime-info ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kcrash.nix b/pkgs/development/libraries/kde-frameworks/kcrash.nix index 27dc6d65edf..4658ab5c6da 100644 --- a/pkgs/development/libraries/kde-frameworks/kcrash.nix +++ b/pkgs/development/libraries/kde-frameworks/kcrash.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kcrash"; + pname = "kcrash"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kcoreaddons kwindowsystem qtx11extras ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kdav.nix b/pkgs/development/libraries/kde-frameworks/kdav.nix index a03cca3fdf2..92d57158e32 100644 --- a/pkgs/development/libraries/kde-frameworks/kdav.nix +++ b/pkgs/development/libraries/kde-frameworks/kdav.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kdav"; + pname = "kdav"; meta = { license = with lib.licenses; [ gpl2 lgpl21 fdl12 ]; }; diff --git a/pkgs/development/libraries/kde-frameworks/kdbusaddons.nix b/pkgs/development/libraries/kde-frameworks/kdbusaddons.nix index 5c435b44541..b123129cf8d 100644 --- a/pkgs/development/libraries/kde-frameworks/kdbusaddons.nix +++ b/pkgs/development/libraries/kde-frameworks/kdbusaddons.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kdbusaddons"; + pname = "kdbusaddons"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qttools qtx11extras ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kdeclarative.nix b/pkgs/development/libraries/kde-frameworks/kdeclarative.nix index 1389df5eb15..08f7cb5d378 100644 --- a/pkgs/development/libraries/kde-frameworks/kdeclarative.nix +++ b/pkgs/development/libraries/kde-frameworks/kdeclarative.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kdeclarative"; + pname = "kdeclarative"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ libepoxy kglobalaccel kguiaddons ki18n kiconthemes kio kwidgetsaddons diff --git a/pkgs/development/libraries/kde-frameworks/kded.nix b/pkgs/development/libraries/kde-frameworks/kded.nix index 250a999f4d6..180d508acc5 100644 --- a/pkgs/development/libraries/kde-frameworks/kded.nix +++ b/pkgs/development/libraries/kde-frameworks/kded.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kded"; + pname = "kded"; nativeBuildInputs = [ extra-cmake-modules kdoctools wrapGAppsHook ]; buildInputs = [ gsettings-desktop-schemas kconfig kcoreaddons kcrash kdbusaddons diff --git a/pkgs/development/libraries/kde-frameworks/kdelibs4support/default.nix b/pkgs/development/libraries/kde-frameworks/kdelibs4support/default.nix index 392aa9ea902..1e7b3073875 100644 --- a/pkgs/development/libraries/kde-frameworks/kdelibs4support/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kdelibs4support/default.nix @@ -9,7 +9,7 @@ }: mkDerivation { - name = "kdelibs4support"; + pname = "kdelibs4support"; patches = [ ./nix-kde-include-dir.patch ]; diff --git a/pkgs/development/libraries/kde-frameworks/kdesignerplugin.nix b/pkgs/development/libraries/kde-frameworks/kdesignerplugin.nix index f1305274070..6244b82397a 100644 --- a/pkgs/development/libraries/kde-frameworks/kdesignerplugin.nix +++ b/pkgs/development/libraries/kde-frameworks/kdesignerplugin.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kdesignerplugin"; + pname = "kdesignerplugin"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ kcompletion kconfig kconfigwidgets kcoreaddons kiconthemes kio kitemviews diff --git a/pkgs/development/libraries/kde-frameworks/kdesu/default.nix b/pkgs/development/libraries/kde-frameworks/kdesu/default.nix index 9a5f5a6942a..fe506401da4 100644 --- a/pkgs/development/libraries/kde-frameworks/kdesu/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kdesu/default.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kdesu"; + pname = "kdesu"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kcoreaddons ki18n kpty kservice qtbase ]; propagatedBuildInputs = [ kpty ]; diff --git a/pkgs/development/libraries/kde-frameworks/kdewebkit.nix b/pkgs/development/libraries/kde-frameworks/kdewebkit.nix index 9f682b44975..b6d548cabfc 100644 --- a/pkgs/development/libraries/kde-frameworks/kdewebkit.nix +++ b/pkgs/development/libraries/kde-frameworks/kdewebkit.nix @@ -3,7 +3,7 @@ }: mkDerivation { - name = "kdewebkit"; + pname = "kdewebkit"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kconfig kcoreaddons kio kparts ]; propagatedBuildInputs = [ qtwebkit ]; diff --git a/pkgs/development/libraries/kde-frameworks/kdnssd.nix b/pkgs/development/libraries/kde-frameworks/kdnssd.nix index 8bb59bb36db..545057e7ef1 100644 --- a/pkgs/development/libraries/kde-frameworks/kdnssd.nix +++ b/pkgs/development/libraries/kde-frameworks/kdnssd.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kdnssd"; + pname = "kdnssd"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ avahi qttools ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kdoctools/default.nix b/pkgs/development/libraries/kde-frameworks/kdoctools/default.nix index a87bef40b1e..83f3a04ee36 100644 --- a/pkgs/development/libraries/kde-frameworks/kdoctools/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kdoctools/default.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kdoctools"; + pname = "kdoctools"; nativeBuildInputs = [ extra-cmake-modules # The build system insists on having native Perl. diff --git a/pkgs/development/libraries/kde-frameworks/kemoticons.nix b/pkgs/development/libraries/kde-frameworks/kemoticons.nix index 66a0889b13d..67613d274a7 100644 --- a/pkgs/development/libraries/kde-frameworks/kemoticons.nix +++ b/pkgs/development/libraries/kde-frameworks/kemoticons.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kemoticons"; + pname = "kemoticons"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ karchive kcoreaddons ]; propagatedBuildInputs = [ kservice qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kfilemetadata/default.nix b/pkgs/development/libraries/kde-frameworks/kfilemetadata/default.nix index 7c16dcf4650..782b0332214 100644 --- a/pkgs/development/libraries/kde-frameworks/kfilemetadata/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kfilemetadata/default.nix @@ -15,7 +15,7 @@ }: mkDerivation { - name = "kfilemetadata"; + pname = "kfilemetadata"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ attr diff --git a/pkgs/development/libraries/kde-frameworks/kglobalaccel.nix b/pkgs/development/libraries/kde-frameworks/kglobalaccel.nix index 7001c98ee00..ab181b8d902 100644 --- a/pkgs/development/libraries/kde-frameworks/kglobalaccel.nix +++ b/pkgs/development/libraries/kde-frameworks/kglobalaccel.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kglobalaccel"; + pname = "kglobalaccel"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kconfig kcoreaddons kcrash kdbusaddons kservice kwindowsystem qttools diff --git a/pkgs/development/libraries/kde-frameworks/kguiaddons.nix b/pkgs/development/libraries/kde-frameworks/kguiaddons.nix index bcd18ab614b..d3575717592 100644 --- a/pkgs/development/libraries/kde-frameworks/kguiaddons.nix +++ b/pkgs/development/libraries/kde-frameworks/kguiaddons.nix @@ -4,7 +4,7 @@ }: mkDerivation { - name = "kguiaddons"; + pname = "kguiaddons"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qtx11extras wayland ]; diff --git a/pkgs/development/libraries/kde-frameworks/kholidays.nix b/pkgs/development/libraries/kde-frameworks/kholidays.nix index 2ede69e7495..9484dece57e 100644 --- a/pkgs/development/libraries/kde-frameworks/kholidays.nix +++ b/pkgs/development/libraries/kde-frameworks/kholidays.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kholidays"; + pname = "kholidays"; meta = { license = with lib.licenses; [ gpl2 lgpl21 fdl12 ]; maintainers = with lib.maintainers; [ bkchr ]; diff --git a/pkgs/development/libraries/kde-frameworks/khtml.nix b/pkgs/development/libraries/kde-frameworks/khtml.nix index 3ef3a043c4e..9677ffb78a5 100644 --- a/pkgs/development/libraries/kde-frameworks/khtml.nix +++ b/pkgs/development/libraries/kde-frameworks/khtml.nix @@ -7,7 +7,7 @@ }: mkDerivation { - name = "khtml"; + pname = "khtml"; nativeBuildInputs = [ extra-cmake-modules perl ]; buildInputs = [ giflib karchive kcodecs kglobalaccel ki18n kiconthemes kio knotifications diff --git a/pkgs/development/libraries/kde-frameworks/ki18n.nix b/pkgs/development/libraries/kde-frameworks/ki18n.nix index 46f502d06bb..be8016155b8 100644 --- a/pkgs/development/libraries/kde-frameworks/ki18n.nix +++ b/pkgs/development/libraries/kde-frameworks/ki18n.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "ki18n"; + pname = "ki18n"; nativeBuildInputs = [ extra-cmake-modules ]; propagatedNativeBuildInputs = [ gettext python3 ]; buildInputs = [ qtdeclarative qtscript ]; diff --git a/pkgs/development/libraries/kde-frameworks/kiconthemes/default.nix b/pkgs/development/libraries/kde-frameworks/kiconthemes/default.nix index 122f3108da4..f807193718d 100644 --- a/pkgs/development/libraries/kde-frameworks/kiconthemes/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kiconthemes/default.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kiconthemes"; + pname = "kiconthemes"; patches = [ ./default-theme-breeze.patch ]; diff --git a/pkgs/development/libraries/kde-frameworks/kidletime.nix b/pkgs/development/libraries/kde-frameworks/kidletime.nix index 2678cf0804e..6379a5e2e31 100644 --- a/pkgs/development/libraries/kde-frameworks/kidletime.nix +++ b/pkgs/development/libraries/kde-frameworks/kidletime.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kidletime"; + pname = "kidletime"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qtx11extras ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kimageformats.nix b/pkgs/development/libraries/kde-frameworks/kimageformats.nix index 97b413e805c..86026bf50f4 100644 --- a/pkgs/development/libraries/kde-frameworks/kimageformats.nix +++ b/pkgs/development/libraries/kde-frameworks/kimageformats.nix @@ -7,7 +7,7 @@ let inherit (lib) getDev; in mkDerivation { - name = "kimageformats"; + pname = "kimageformats"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ karchive openexr libavif qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kinit/default.nix b/pkgs/development/libraries/kde-frameworks/kinit/default.nix index dcd84f1f35a..9acd56f324c 100644 --- a/pkgs/development/libraries/kde-frameworks/kinit/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kinit/default.nix @@ -7,7 +7,7 @@ let inherit (lib) getLib; in mkDerivation { - name = "kinit"; + pname = "kinit"; outputs = [ "out" "dev" ]; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ diff --git a/pkgs/development/libraries/kde-frameworks/kio/default.nix b/pkgs/development/libraries/kde-frameworks/kio/default.nix index 5c05e0159b5..7b2815945c8 100644 --- a/pkgs/development/libraries/kde-frameworks/kio/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kio/default.nix @@ -9,7 +9,7 @@ }: mkDerivation { - name = "kio"; + pname = "kio"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ karchive kconfigwidgets kdbusaddons ki18n kiconthemes knotifications diff --git a/pkgs/development/libraries/kde-frameworks/kirigami2.nix b/pkgs/development/libraries/kde-frameworks/kirigami2.nix index bb5a5a3fc80..281a490bf90 100644 --- a/pkgs/development/libraries/kde-frameworks/kirigami2.nix +++ b/pkgs/development/libraries/kde-frameworks/kirigami2.nix @@ -1,7 +1,7 @@ { mkDerivation, extra-cmake-modules, qtbase, qtquickcontrols2, qttranslations, qtgraphicaleffects }: mkDerivation { - name = "kirigami2"; + pname = "kirigami2"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qtbase qtquickcontrols2 qttranslations qtgraphicaleffects ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/kitemmodels.nix b/pkgs/development/libraries/kde-frameworks/kitemmodels.nix index 0f398b0f57d..8abed8aaa09 100644 --- a/pkgs/development/libraries/kde-frameworks/kitemmodels.nix +++ b/pkgs/development/libraries/kde-frameworks/kitemmodels.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kitemmodels"; + pname = "kitemmodels"; nativeBuildInputs = [ extra-cmake-modules ]; propagatedBuildInputs = [ qtbase ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/kitemviews.nix b/pkgs/development/libraries/kde-frameworks/kitemviews.nix index 0e772978e19..ef350835f05 100644 --- a/pkgs/development/libraries/kde-frameworks/kitemviews.nix +++ b/pkgs/development/libraries/kde-frameworks/kitemviews.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kitemviews"; + pname = "kitemviews"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qttools ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kjobwidgets.nix b/pkgs/development/libraries/kde-frameworks/kjobwidgets.nix index 2e116b7bb79..a4a6d5bb102 100644 --- a/pkgs/development/libraries/kde-frameworks/kjobwidgets.nix +++ b/pkgs/development/libraries/kde-frameworks/kjobwidgets.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kjobwidgets"; + pname = "kjobwidgets"; nativeBuildInputs = [ extra-cmake-modules qttools ]; buildInputs = [ kcoreaddons kwidgetsaddons qtx11extras ]; } diff --git a/pkgs/development/libraries/kde-frameworks/kjs.nix b/pkgs/development/libraries/kde-frameworks/kjs.nix index 33aeb284e16..a0f98532374 100644 --- a/pkgs/development/libraries/kde-frameworks/kjs.nix +++ b/pkgs/development/libraries/kde-frameworks/kjs.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kjs"; + pname = "kjs"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ pcre qtbase ]; } diff --git a/pkgs/development/libraries/kde-frameworks/kjsembed.nix b/pkgs/development/libraries/kde-frameworks/kjsembed.nix index f552f963513..576727e81d2 100644 --- a/pkgs/development/libraries/kde-frameworks/kjsembed.nix +++ b/pkgs/development/libraries/kde-frameworks/kjsembed.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kjsembed"; + pname = "kjsembed"; nativeBuildInputs = [ extra-cmake-modules kdoctools qttools ]; buildInputs = [ ki18n qtsvg ]; propagatedBuildInputs = [ kjs ]; diff --git a/pkgs/development/libraries/kde-frameworks/kmediaplayer.nix b/pkgs/development/libraries/kde-frameworks/kmediaplayer.nix index 5de26e0c8dc..f92c2295651 100644 --- a/pkgs/development/libraries/kde-frameworks/kmediaplayer.nix +++ b/pkgs/development/libraries/kde-frameworks/kmediaplayer.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kmediaplayer"; + pname = "kmediaplayer"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kparts kxmlgui ]; } diff --git a/pkgs/development/libraries/kde-frameworks/knewstuff/default.nix b/pkgs/development/libraries/kde-frameworks/knewstuff/default.nix index 6d170c0bb12..6e554b5faaa 100644 --- a/pkgs/development/libraries/kde-frameworks/knewstuff/default.nix +++ b/pkgs/development/libraries/kde-frameworks/knewstuff/default.nix @@ -7,7 +7,7 @@ }: mkDerivation { - name = "knewstuff"; + pname = "knewstuff"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ karchive kcompletion kconfig kcoreaddons ki18n kiconthemes kio kitemviews diff --git a/pkgs/development/libraries/kde-frameworks/knotifications.nix b/pkgs/development/libraries/kde-frameworks/knotifications.nix index d1a809d9f51..363ca46d10a 100644 --- a/pkgs/development/libraries/kde-frameworks/knotifications.nix +++ b/pkgs/development/libraries/kde-frameworks/knotifications.nix @@ -7,7 +7,7 @@ }: mkDerivation { - name = "knotifications"; + pname = "knotifications"; nativeBuildInputs = [ extra-cmake-modules qttools ]; buildInputs = [ kcodecs kconfig kcoreaddons kwindowsystem libdbusmenu phonon qtx11extras diff --git a/pkgs/development/libraries/kde-frameworks/knotifyconfig.nix b/pkgs/development/libraries/kde-frameworks/knotifyconfig.nix index 1971e3e8039..b2415d731ff 100644 --- a/pkgs/development/libraries/kde-frameworks/knotifyconfig.nix +++ b/pkgs/development/libraries/kde-frameworks/knotifyconfig.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "knotifyconfig"; + pname = "knotifyconfig"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kcompletion kconfig ki18n kio phonon ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kpackage/default.nix b/pkgs/development/libraries/kde-frameworks/kpackage/default.nix index d4edc09b2f0..c1d9bf387fc 100644 --- a/pkgs/development/libraries/kde-frameworks/kpackage/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kpackage/default.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kpackage"; + pname = "kpackage"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ karchive kconfig kcoreaddons ki18n qtbase ]; patches = [ diff --git a/pkgs/development/libraries/kde-frameworks/kparts.nix b/pkgs/development/libraries/kde-frameworks/kparts.nix index e1d2a156160..682c2da6313 100644 --- a/pkgs/development/libraries/kde-frameworks/kparts.nix +++ b/pkgs/development/libraries/kde-frameworks/kparts.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kparts"; + pname = "kparts"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kconfig kcoreaddons ki18n kiconthemes kjobwidgets knotifications kservice diff --git a/pkgs/development/libraries/kde-frameworks/kpeople.nix b/pkgs/development/libraries/kde-frameworks/kpeople.nix index 52c16ea2b9c..433cc6b6e11 100644 --- a/pkgs/development/libraries/kde-frameworks/kpeople.nix +++ b/pkgs/development/libraries/kde-frameworks/kpeople.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kpeople"; + pname = "kpeople"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kcoreaddons ki18n kitemviews kservice kwidgetsaddons qtdeclarative diff --git a/pkgs/development/libraries/kde-frameworks/kplotting.nix b/pkgs/development/libraries/kde-frameworks/kplotting.nix index 68df24d0087..eb26b252566 100644 --- a/pkgs/development/libraries/kde-frameworks/kplotting.nix +++ b/pkgs/development/libraries/kde-frameworks/kplotting.nix @@ -3,7 +3,7 @@ }: mkDerivation { - name = "kplotting"; + pname = "kplotting"; nativeBuildInputs = [ extra-cmake-modules ]; propagatedBuildInputs = [ qtbase qttools ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/kpty.nix b/pkgs/development/libraries/kde-frameworks/kpty.nix index 2456f4e22fa..239407d6abd 100644 --- a/pkgs/development/libraries/kde-frameworks/kpty.nix +++ b/pkgs/development/libraries/kde-frameworks/kpty.nix @@ -1,7 +1,7 @@ { mkDerivation, extra-cmake-modules, kcoreaddons, ki18n, qtbase, }: mkDerivation { - name = "kpty"; + pname = "kpty"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kcoreaddons ki18n qtbase ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/kquickcharts.nix b/pkgs/development/libraries/kde-frameworks/kquickcharts.nix index 0ae30be653d..20c1b2368a7 100644 --- a/pkgs/development/libraries/kde-frameworks/kquickcharts.nix +++ b/pkgs/development/libraries/kde-frameworks/kquickcharts.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kquickcharts"; + pname = "kquickcharts"; nativeBuildInputs = [ extra-cmake-modules ]; propagatedBuildInputs = [ qtquickcontrols2 ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/kross.nix b/pkgs/development/libraries/kde-frameworks/kross.nix index 189e100aa70..7cc083e5a26 100644 --- a/pkgs/development/libraries/kde-frameworks/kross.nix +++ b/pkgs/development/libraries/kde-frameworks/kross.nix @@ -4,7 +4,7 @@ }: mkDerivation { - name = "kross"; + pname = "kross"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ kcompletion kcoreaddons kxmlgui ]; propagatedBuildInputs = [ diff --git a/pkgs/development/libraries/kde-frameworks/krunner.nix b/pkgs/development/libraries/kde-frameworks/krunner.nix index 7db7c61db46..a56e56a2fe0 100644 --- a/pkgs/development/libraries/kde-frameworks/krunner.nix +++ b/pkgs/development/libraries/kde-frameworks/krunner.nix @@ -7,7 +7,7 @@ let self = mkDerivation { - name = "krunner"; + pname = "krunner"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kconfig kcoreaddons ki18n kio kservice qtdeclarative solid diff --git a/pkgs/development/libraries/kde-frameworks/kservice/default.nix b/pkgs/development/libraries/kde-frameworks/kservice/default.nix index c1488f728dd..008c52cf078 100644 --- a/pkgs/development/libraries/kde-frameworks/kservice/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kservice/default.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kservice"; + pname = "kservice"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; propagatedNativeBuildInputs = [ bison flex ]; buildInputs = [ diff --git a/pkgs/development/libraries/kde-frameworks/ktexteditor.nix b/pkgs/development/libraries/kde-frameworks/ktexteditor.nix index 6a74dca7b4b..5788c07cb05 100644 --- a/pkgs/development/libraries/kde-frameworks/ktexteditor.nix +++ b/pkgs/development/libraries/kde-frameworks/ktexteditor.nix @@ -7,7 +7,7 @@ }: mkDerivation { - name = "ktexteditor"; + pname = "ktexteditor"; nativeBuildInputs = [ extra-cmake-modules perl ]; buildInputs = [ karchive kconfig kguiaddons ki18n kiconthemes kio libgit2 qtscript diff --git a/pkgs/development/libraries/kde-frameworks/ktextwidgets.nix b/pkgs/development/libraries/kde-frameworks/ktextwidgets.nix index 653d0ac8899..6ce7aa88c3a 100644 --- a/pkgs/development/libraries/kde-frameworks/ktextwidgets.nix +++ b/pkgs/development/libraries/kde-frameworks/ktextwidgets.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "ktextwidgets"; + pname = "ktextwidgets"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kcompletion kconfig kconfigwidgets kiconthemes kservice kwindowsystem diff --git a/pkgs/development/libraries/kde-frameworks/kunitconversion.nix b/pkgs/development/libraries/kde-frameworks/kunitconversion.nix index de0d9aab922..aa4c87a1e5f 100644 --- a/pkgs/development/libraries/kde-frameworks/kunitconversion.nix +++ b/pkgs/development/libraries/kde-frameworks/kunitconversion.nix @@ -1,7 +1,7 @@ { mkDerivation, extra-cmake-modules, ki18n, qtbase, }: mkDerivation { - name = "kunitconversion"; + pname = "kunitconversion"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ ki18n qtbase ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/kwallet.nix b/pkgs/development/libraries/kde-frameworks/kwallet.nix index f93f0437dbd..e2a54a03f6e 100644 --- a/pkgs/development/libraries/kde-frameworks/kwallet.nix +++ b/pkgs/development/libraries/kde-frameworks/kwallet.nix @@ -7,7 +7,7 @@ }: mkDerivation { - name = "kwallet"; + pname = "kwallet"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ kconfig kconfigwidgets kcoreaddons kdbusaddons ki18n kiconthemes diff --git a/pkgs/development/libraries/kde-frameworks/kwayland.nix b/pkgs/development/libraries/kde-frameworks/kwayland.nix index 749735c4ad5..6a070d22780 100644 --- a/pkgs/development/libraries/kde-frameworks/kwayland.nix +++ b/pkgs/development/libraries/kde-frameworks/kwayland.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kwayland"; + pname = "kwayland"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ plasma-wayland-protocols wayland wayland-protocols ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kwidgetsaddons.nix b/pkgs/development/libraries/kde-frameworks/kwidgetsaddons.nix index ee347df18ab..0fead3bfd6b 100644 --- a/pkgs/development/libraries/kde-frameworks/kwidgetsaddons.nix +++ b/pkgs/development/libraries/kde-frameworks/kwidgetsaddons.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "kwidgetsaddons"; + pname = "kwidgetsaddons"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qttools ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kwindowsystem/default.nix b/pkgs/development/libraries/kde-frameworks/kwindowsystem/default.nix index 7643572a7ec..ec102dbb342 100644 --- a/pkgs/development/libraries/kde-frameworks/kwindowsystem/default.nix +++ b/pkgs/development/libraries/kde-frameworks/kwindowsystem/default.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kwindowsystem"; + pname = "kwindowsystem"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ libpthreadstubs libXdmcp qttools qtx11extras ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/kxmlgui.nix b/pkgs/development/libraries/kde-frameworks/kxmlgui.nix index 0b29158e4b0..c666edbc196 100644 --- a/pkgs/development/libraries/kde-frameworks/kxmlgui.nix +++ b/pkgs/development/libraries/kde-frameworks/kxmlgui.nix @@ -6,7 +6,7 @@ }: mkDerivation { - name = "kxmlgui"; + pname = "kxmlgui"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ attica kglobalaccel ki18n kiconthemes kitemviews ktextwidgets kwindowsystem diff --git a/pkgs/development/libraries/kde-frameworks/kxmlrpcclient.nix b/pkgs/development/libraries/kde-frameworks/kxmlrpcclient.nix index aa334d69ef1..3b2d869d177 100644 --- a/pkgs/development/libraries/kde-frameworks/kxmlrpcclient.nix +++ b/pkgs/development/libraries/kde-frameworks/kxmlrpcclient.nix @@ -1,7 +1,7 @@ { mkDerivation, extra-cmake-modules, ki18n, kio }: mkDerivation { - name = "kxmlrpcclient"; + pname = "kxmlrpcclient"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ ki18n ]; propagatedBuildInputs = [ kio ]; diff --git a/pkgs/development/libraries/kde-frameworks/modemmanager-qt.nix b/pkgs/development/libraries/kde-frameworks/modemmanager-qt.nix index 5ecb5317cfc..507e24e8f61 100644 --- a/pkgs/development/libraries/kde-frameworks/modemmanager-qt.nix +++ b/pkgs/development/libraries/kde-frameworks/modemmanager-qt.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "modemmanager-qt"; + pname = "modemmanager-qt"; nativeBuildInputs = [ extra-cmake-modules ]; propagatedBuildInputs = [ modemmanager qtbase ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/networkmanager-qt.nix b/pkgs/development/libraries/kde-frameworks/networkmanager-qt.nix index 2ff4b2c2b40..b79c79b084d 100644 --- a/pkgs/development/libraries/kde-frameworks/networkmanager-qt.nix +++ b/pkgs/development/libraries/kde-frameworks/networkmanager-qt.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "networkmanager-qt"; + pname = "networkmanager-qt"; nativeBuildInputs = [ extra-cmake-modules ]; propagatedBuildInputs = [ networkmanager qtbase ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kde-frameworks/oxygen-icons5.nix b/pkgs/development/libraries/kde-frameworks/oxygen-icons5.nix index 32b219ab7e1..7121944d5d3 100644 --- a/pkgs/development/libraries/kde-frameworks/oxygen-icons5.nix +++ b/pkgs/development/libraries/kde-frameworks/oxygen-icons5.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "oxygen-icons5"; + pname = "oxygen-icons5"; meta.license = lib.licenses.lgpl3Plus; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/plasma-framework.nix b/pkgs/development/libraries/kde-frameworks/plasma-framework.nix index 12540b07007..cf118beaabc 100644 --- a/pkgs/development/libraries/kde-frameworks/plasma-framework.nix +++ b/pkgs/development/libraries/kde-frameworks/plasma-framework.nix @@ -8,7 +8,7 @@ }: mkDerivation { - name = "plasma-framework"; + pname = "plasma-framework"; nativeBuildInputs = [ extra-cmake-modules kdoctools ]; buildInputs = [ kactivities karchive kconfig kconfigwidgets kcoreaddons kdbusaddons diff --git a/pkgs/development/libraries/kde-frameworks/prison.nix b/pkgs/development/libraries/kde-frameworks/prison.nix index 670fd02d616..c2063e22bba 100644 --- a/pkgs/development/libraries/kde-frameworks/prison.nix +++ b/pkgs/development/libraries/kde-frameworks/prison.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "prison"; + pname = "prison"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ libdmtx qrencode ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/purpose.nix b/pkgs/development/libraries/kde-frameworks/purpose.nix index 0f376ce9ec3..ee4e9584641 100644 --- a/pkgs/development/libraries/kde-frameworks/purpose.nix +++ b/pkgs/development/libraries/kde-frameworks/purpose.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "purpose"; + pname = "purpose"; nativeBuildInputs = [ extra-cmake-modules intltool ]; buildInputs = [ qtbase accounts-qt qtdeclarative kaccounts-integration kconfig kcoreaddons diff --git a/pkgs/development/libraries/kde-frameworks/qqc2-desktop-style.nix b/pkgs/development/libraries/kde-frameworks/qqc2-desktop-style.nix index e400967407c..6d8635c4f28 100644 --- a/pkgs/development/libraries/kde-frameworks/qqc2-desktop-style.nix +++ b/pkgs/development/libraries/kde-frameworks/qqc2-desktop-style.nix @@ -8,7 +8,7 @@ }: mkDerivation { - name = "qqc2-desktop-style"; + pname = "qqc2-desktop-style"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ qtx11extras qtquickcontrols2 kconfig kiconthemes kirigami2 ]; } diff --git a/pkgs/development/libraries/kde-frameworks/solid.nix b/pkgs/development/libraries/kde-frameworks/solid.nix index aa1b1ebe345..69ef8c8adca 100644 --- a/pkgs/development/libraries/kde-frameworks/solid.nix +++ b/pkgs/development/libraries/kde-frameworks/solid.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "solid"; + pname = "solid"; nativeBuildInputs = [ bison extra-cmake-modules flex media-player-info ]; buildInputs = [ qtdeclarative qttools ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/sonnet.nix b/pkgs/development/libraries/kde-frameworks/sonnet.nix index 2eff7bad240..78aa189559f 100644 --- a/pkgs/development/libraries/kde-frameworks/sonnet.nix +++ b/pkgs/development/libraries/kde-frameworks/sonnet.nix @@ -4,7 +4,7 @@ }: mkDerivation { - name = "sonnet"; + pname = "sonnet"; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ aspell qttools ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/srcs.nix b/pkgs/development/libraries/kde-frameworks/srcs.nix index 2b3983a892c..1cddd857dda 100644 --- a/pkgs/development/libraries/kde-frameworks/srcs.nix +++ b/pkgs/development/libraries/kde-frameworks/srcs.nix @@ -4,667 +4,667 @@ { attica = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/attica-5.91.0.tar.xz"; - sha256 = "0svvy7qflidwxns12y2lra54gg6lhglcddzmrw7ccvbdyqcy2pn0"; - name = "attica-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/attica-5.92.0.tar.xz"; + sha256 = "0cy9dd8kazfkhas87bxjj5smmzay3gvkjwsmy6gvkfxc6rvpqr5z"; + name = "attica-5.92.0.tar.xz"; }; }; baloo = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/baloo-5.91.0.tar.xz"; - sha256 = "1cqjbaiwqba707xaz9zsrdz9cms2mdrhv6jpwsq8q7f4g4rxcx3m"; - name = "baloo-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/baloo-5.92.0.tar.xz"; + sha256 = "0xd4a0p22gjm523ymlyd5nfgp8z3ayb0nq6a04h5py507mc70d98"; + name = "baloo-5.92.0.tar.xz"; }; }; bluez-qt = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/bluez-qt-5.91.0.tar.xz"; - sha256 = "0p37jrmppwahh4vaq3wkw6xn0ms8dxcxpfd4glzjlnw426zrwnjr"; - name = "bluez-qt-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/bluez-qt-5.92.0.tar.xz"; + sha256 = "1dlasb39kqrcql6hq0sl74ax3n5bdcy3pkhvc9vwpf9dxn1j93gm"; + name = "bluez-qt-5.92.0.tar.xz"; }; }; breeze-icons = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/breeze-icons-5.91.0.tar.xz"; - sha256 = "0aj24gn48c17n9jzrj0az04ph4hpx7zf2rj4vgwl19iip69vfzf1"; - name = "breeze-icons-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/breeze-icons-5.92.0.tar.xz"; + sha256 = "0rj30r52ca6njx00gmmni4k70yn8873ihxfbc66lklwzk1irdq29"; + name = "breeze-icons-5.92.0.tar.xz"; }; }; extra-cmake-modules = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/extra-cmake-modules-5.91.0.tar.xz"; - sha256 = "0k65rvxh926ya6qahzk2ns7g1fya1429648mlx7iipxa61g8h5wp"; - name = "extra-cmake-modules-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/extra-cmake-modules-5.92.0.tar.xz"; + sha256 = "1vq3sd4qfr4hjcgqyfpykcz5wyagbfvrd4p24pdki1zjqn5j76pq"; + name = "extra-cmake-modules-5.92.0.tar.xz"; }; }; frameworkintegration = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/frameworkintegration-5.91.0.tar.xz"; - sha256 = "1176ql8f96ap4gzjaj8vm4cr6f2rsx9z93gpc4hx4jcqjhxqrg3z"; - name = "frameworkintegration-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/frameworkintegration-5.92.0.tar.xz"; + sha256 = "0pgcwfxxzvfvqyjfgqzsllzfy9il4y8xr8dzdyjmd5vccpvgd3mx"; + name = "frameworkintegration-5.92.0.tar.xz"; }; }; kactivities = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kactivities-5.91.0.tar.xz"; - sha256 = "03y4hx7jgrhac12ys8pm22h0f49kms8b71gck4xv577p3ywi3j60"; - name = "kactivities-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kactivities-5.92.0.tar.xz"; + sha256 = "1kfvg23gdl4k6azs6700j8i8ncl8c7rrc70w1i2xhphz27ybc1pw"; + name = "kactivities-5.92.0.tar.xz"; }; }; kactivities-stats = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kactivities-stats-5.91.0.tar.xz"; - sha256 = "0864qfljh20723djfzdv8h6nipw01825lhiknyqz17aj2x2ymzcq"; - name = "kactivities-stats-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kactivities-stats-5.92.0.tar.xz"; + sha256 = "0lgp7zxgjmjm02x4mydlv6ivmlxqjkklav5vfwgjgf6v1qp161i2"; + name = "kactivities-stats-5.92.0.tar.xz"; }; }; kapidox = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kapidox-5.91.0.tar.xz"; - sha256 = "1xxpl8rn49d2cr7ld94j3wsg21019l2kq14p5bvilisnj3salka3"; - name = "kapidox-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kapidox-5.92.0.tar.xz"; + sha256 = "0vd5k4wmmawbhyy3cxj0gjidf4haghwbsbly9yr3zg3qb3g02ljg"; + name = "kapidox-5.92.0.tar.xz"; }; }; karchive = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/karchive-5.91.0.tar.xz"; - sha256 = "1kjc47zzdd9jhcmynq6zw6y6zaj2c1i8pxvszx3d9x5asaz2qq53"; - name = "karchive-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/karchive-5.92.0.tar.xz"; + sha256 = "1blzm6vf8kpflam4671r1y4svrsb79bglln7aia7baqh7a6a4xjh"; + name = "karchive-5.92.0.tar.xz"; }; }; kauth = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kauth-5.91.0.tar.xz"; - sha256 = "001svdyvs8qc6h8zkb9x072npkz6xabz6j0djjb380gl9h9wnrgq"; - name = "kauth-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kauth-5.92.0.tar.xz"; + sha256 = "0a27z9xr5ccxfcxmx93vs4hgxc388nsd9ac906mdh475ivv4p0j4"; + name = "kauth-5.92.0.tar.xz"; }; }; kbookmarks = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kbookmarks-5.91.0.tar.xz"; - sha256 = "0iqfngsvpbgxk6h8l68idcp97df28sa2zwj707zs0mf2bl9k68m4"; - name = "kbookmarks-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kbookmarks-5.92.0.tar.xz"; + sha256 = "0hym3558xnp3h7q8kf1ljcy65r3g37mcmqb1ll3nxd912rv4wl4r"; + name = "kbookmarks-5.92.0.tar.xz"; }; }; kcalendarcore = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kcalendarcore-5.91.0.tar.xz"; - sha256 = "0gkn0mzk3za86pjrpi8gd9d71bfv0ihzkgn8yy1ik3dw1rf9gxip"; - name = "kcalendarcore-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kcalendarcore-5.92.0.tar.xz"; + sha256 = "0fhbas8i7i08z4x32yq49admiz8vk4h9vwgkh7qy14lbzf6ydwkg"; + name = "kcalendarcore-5.92.0.tar.xz"; }; }; kcmutils = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kcmutils-5.91.0.tar.xz"; - sha256 = "009r9r7fz1588g2cnqw585d2fz170x8j8bip1zqr7i4jl21ms68s"; - name = "kcmutils-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kcmutils-5.92.0.tar.xz"; + sha256 = "0fldpkhq4ysma4m6qylr7kqvxw0rb11x5abz5921bhl5zicfcjfx"; + name = "kcmutils-5.92.0.tar.xz"; }; }; kcodecs = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kcodecs-5.91.0.tar.xz"; - sha256 = "0qkwvbp4vp3w57f3fyjknxd66qac77hl77mf042c7jxjl5vq7h1y"; - name = "kcodecs-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kcodecs-5.92.0.tar.xz"; + sha256 = "0xfjc0diljx081as3b500awybay9l3sfl59792h5z3clafjbgrfn"; + name = "kcodecs-5.92.0.tar.xz"; }; }; kcompletion = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kcompletion-5.91.0.tar.xz"; - sha256 = "1l6z85a4rh3vrf4x5g3pqvp0q36gwmw0fbp9ny1iaqyy21dlh8i4"; - name = "kcompletion-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kcompletion-5.92.0.tar.xz"; + sha256 = "1svwvj9jxkgcddfdila10ggdmsabs22vnhf9k7isp2zfdif55w88"; + name = "kcompletion-5.92.0.tar.xz"; }; }; kconfig = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kconfig-5.91.0.tar.xz"; - sha256 = "0axdnqipa8xgx864zylxllnzchlp50q59bbfw3c98svvvkm3yg56"; - name = "kconfig-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kconfig-5.92.0.tar.xz"; + sha256 = "08q57f3wxj22d485s0ph53p44yrkjb376817470a0s43p10vc0bq"; + name = "kconfig-5.92.0.tar.xz"; }; }; kconfigwidgets = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kconfigwidgets-5.91.0.tar.xz"; - sha256 = "01mvv01hv64wadjh8xk3hhp1vbs04cvbrjpfl1g9cv2sa6hr7102"; - name = "kconfigwidgets-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kconfigwidgets-5.92.0.tar.xz"; + sha256 = "0ji799xd45lpnd70a9bizicfz2bsmlxq6r0fqgn0ghwsbp9ywna2"; + name = "kconfigwidgets-5.92.0.tar.xz"; }; }; kcontacts = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kcontacts-5.91.0.tar.xz"; - sha256 = "1c839c9rvys3jwmi3fzw06r1nhgvrb4z8sdh8gda0w03vqh7h1hv"; - name = "kcontacts-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kcontacts-5.92.0.tar.xz"; + sha256 = "1kik4pvy8snvj6rsc9pfbcpc8rrcn0k4pjj1h9m221zma1p00xhj"; + name = "kcontacts-5.92.0.tar.xz"; }; }; kcoreaddons = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kcoreaddons-5.91.0.tar.xz"; - sha256 = "16vimllvcs6rnb1ccbv9zg8hxbzacisgrlffyvwm608f4q1xmqyz"; - name = "kcoreaddons-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kcoreaddons-5.92.0.tar.xz"; + sha256 = "0rv63byrxwf9zdpx347rxybpk2j9yyjqm323j60vb8ja6a7p2pyz"; + name = "kcoreaddons-5.92.0.tar.xz"; }; }; kcrash = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kcrash-5.91.0.tar.xz"; - sha256 = "0gdknmp5a36ipvzms4jhxywyxpjh0vy26861c54jfsk13yircjal"; - name = "kcrash-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kcrash-5.92.0.tar.xz"; + sha256 = "1ir64mlv49vh3vz81r22q3sx0fichiwjr8qw5jf5vx96a1dn1icv"; + name = "kcrash-5.92.0.tar.xz"; }; }; kdav = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kdav-5.91.0.tar.xz"; - sha256 = "026w3bk2lmc7lqzra8w9jq8i2l1hvqsxz36r1jzj9p01skhdm32v"; - name = "kdav-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kdav-5.92.0.tar.xz"; + sha256 = "1i5i6bkjairz1slk3fhrxd3s8wkcdaqg55jg2bv86kqh7d3nrcgk"; + name = "kdav-5.92.0.tar.xz"; }; }; kdbusaddons = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kdbusaddons-5.91.0.tar.xz"; - sha256 = "18qhpj0s4abypkb8ix2d84wv1kqv6qxyblninn2f9hjkl2dnlwis"; - name = "kdbusaddons-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kdbusaddons-5.92.0.tar.xz"; + sha256 = "0m5fd396xi3dhc45zwxjrrxr2bhlrc8g8m7n17jq1ylzqhyg60vw"; + name = "kdbusaddons-5.92.0.tar.xz"; }; }; kdeclarative = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kdeclarative-5.91.0.tar.xz"; - sha256 = "183df5c0xyjqsip0izqvvk4wy2bjb973900s1wqsldhhvc7gpf7z"; - name = "kdeclarative-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kdeclarative-5.92.0.tar.xz"; + sha256 = "1cymh8clcajk9cl6r443cpqk6vmp4x12ngc6wgp08z53zrvlv5py"; + name = "kdeclarative-5.92.0.tar.xz"; }; }; kded = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kded-5.91.0.tar.xz"; - sha256 = "1zi0sixlzaxvw4lfil2r36i3xrav3vfwxp2r1lp4n65dpl7nv7p5"; - name = "kded-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kded-5.92.0.tar.xz"; + sha256 = "0v0fak84nw4lb4qc1irb9sn5nh5k7qrhnfav5smn3cvchldm6dc3"; + name = "kded-5.92.0.tar.xz"; }; }; kdelibs4support = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/kdelibs4support-5.91.0.tar.xz"; - sha256 = "1373fi9vi7ki8frr0lsw6yp335i95v8yq2j41s7ip003dpy4hr2g"; - name = "kdelibs4support-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/kdelibs4support-5.92.0.tar.xz"; + sha256 = "1q7d0i09klkhsiwq7i91ypxakdr5b841zdb60q7yjzcdmn25wbi9"; + name = "kdelibs4support-5.92.0.tar.xz"; }; }; kdesignerplugin = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/kdesignerplugin-5.91.0.tar.xz"; - sha256 = "07lvvryc3k418hd0j7ddlqhid26c51isa8mvk7g6gd0v2x3gp76q"; - name = "kdesignerplugin-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/kdesignerplugin-5.92.0.tar.xz"; + sha256 = "0kial8k6qr39871v103952d0qcs0hm25y6k0vdg4y8ns8nrmjs06"; + name = "kdesignerplugin-5.92.0.tar.xz"; }; }; kdesu = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kdesu-5.91.0.tar.xz"; - sha256 = "1wj099w810dabqn43pqis4sism3zwq3d1qa9mvcdyjafqbl7xnjm"; - name = "kdesu-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kdesu-5.92.0.tar.xz"; + sha256 = "1yjyz4v0gn7ys7zy4ymn47zggxxmgd37big005c6g85dm63xr1s6"; + name = "kdesu-5.92.0.tar.xz"; }; }; kdewebkit = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/kdewebkit-5.91.0.tar.xz"; - sha256 = "1mln0w1dzrbpm373vfpcyss4xxnrfgwh9nhzr8wmzs8965bn3wqq"; - name = "kdewebkit-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/kdewebkit-5.92.0.tar.xz"; + sha256 = "1dni134qbs5yff7zgk4n3sfjwblzarblg16rj35l59l6mly7f2jd"; + name = "kdewebkit-5.92.0.tar.xz"; }; }; kdnssd = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kdnssd-5.91.0.tar.xz"; - sha256 = "1smzwh7lvz8g7vydxnd2kkh0ymg7yp6akc7k2vg8q65pa6pxqn3g"; - name = "kdnssd-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kdnssd-5.92.0.tar.xz"; + sha256 = "1m24v36pphy591z1xp90i0yxv70c62iinvy4gspdi15bz94sydjz"; + name = "kdnssd-5.92.0.tar.xz"; }; }; kdoctools = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kdoctools-5.91.0.tar.xz"; - sha256 = "02lr4l4n5gnv7ffzml8lbrdwgfpq6m7ayhz3bdqqijdfvw6h283n"; - name = "kdoctools-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kdoctools-5.92.0.tar.xz"; + sha256 = "0w08fa8rl0dhp59lv6xcvypahl6pxda6cr0vv0f0xv0xp6wax8w6"; + name = "kdoctools-5.92.0.tar.xz"; }; }; kemoticons = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kemoticons-5.91.0.tar.xz"; - sha256 = "1jznkiq87rkndv10xs6974b5k0v82ly32agy5acxc2xy9wq7la0h"; - name = "kemoticons-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kemoticons-5.92.0.tar.xz"; + sha256 = "01wzy3mwfz4sqpq8i1hfbbymajp55axryiaqkfr9r2n1844y7kzx"; + name = "kemoticons-5.92.0.tar.xz"; }; }; kfilemetadata = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kfilemetadata-5.91.0.tar.xz"; - sha256 = "1z030irzcvmjq329nwfk3h8cd51dwy9mppnwbgcd0lw6y3bka0rq"; - name = "kfilemetadata-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kfilemetadata-5.92.0.tar.xz"; + sha256 = "1khmx9kd1jhd6j7rmfww3vmyjz2pg36mpsdn0bc77kwl21ax696n"; + name = "kfilemetadata-5.92.0.tar.xz"; }; }; kglobalaccel = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kglobalaccel-5.91.0.tar.xz"; - sha256 = "09wscg6f19sh314ywpxp47pdr1xf1wzpjchg9rcjg207zrfhqqf0"; - name = "kglobalaccel-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kglobalaccel-5.92.0.tar.xz"; + sha256 = "0lhlb274pvv7rpkcsccqbv81bh8iklanp29g0k28wrv3kckiwyxy"; + name = "kglobalaccel-5.92.0.tar.xz"; }; }; kguiaddons = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kguiaddons-5.91.0.tar.xz"; - sha256 = "0gn8lvpm4i11s5vavlpm162bizjkmh5cb4dhj3p34dlp4vcc4mky"; - name = "kguiaddons-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kguiaddons-5.92.0.tar.xz"; + sha256 = "0pyzgyrglvz2m11b82rycs9fbmzpfgzabnjkvsq00agjcnjparqg"; + name = "kguiaddons-5.92.0.tar.xz"; }; }; kholidays = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kholidays-5.91.0.tar.xz"; - sha256 = "165vfmi5y8l00ng494469w5s1gjnf9zkggqrzmq65dfkdis3amdm"; - name = "kholidays-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kholidays-5.92.0.tar.xz"; + sha256 = "042bdg46hkpg66vdp9gk13wck5yhks8s6i9qz9xzh2mikz285lqf"; + name = "kholidays-5.92.0.tar.xz"; }; }; khtml = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/khtml-5.91.0.tar.xz"; - sha256 = "1ldkk1f954mmgz30vqa895z1nw2jaknnb53lsd5vqxzxi3cmc054"; - name = "khtml-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/khtml-5.92.0.tar.xz"; + sha256 = "06hpjcm5yrfj1056vvv9dklccd0a1y09zm8ch4a5d8l2lfgdg8ci"; + name = "khtml-5.92.0.tar.xz"; }; }; ki18n = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/ki18n-5.91.0.tar.xz"; - sha256 = "11gdd2gvzsz3r8zvqbxxwbpwjvjwnzzhzyrd4spbpdy0w7j8n6ly"; - name = "ki18n-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/ki18n-5.92.0.tar.xz"; + sha256 = "0xsp77iaxf72i0ri3pb6x5rrdz3cv8rxcaqcrynisvsmx7l35005"; + name = "ki18n-5.92.0.tar.xz"; }; }; kiconthemes = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kiconthemes-5.91.0.tar.xz"; - sha256 = "1khh4ngivwdj9rxxcpx08ka8anskc9i1z9n2zijp4m5ix8mmj3c2"; - name = "kiconthemes-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kiconthemes-5.92.0.tar.xz"; + sha256 = "08yb6f980p620dfklfiyp83lcsqw4dds9qwzd6xpn2mzz07p2a11"; + name = "kiconthemes-5.92.0.tar.xz"; }; }; kidletime = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kidletime-5.91.0.tar.xz"; - sha256 = "12qmiwc8p3izj1y5h0rndj2s496ckm1p85dv4g51zbpg7m8a48qv"; - name = "kidletime-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kidletime-5.92.0.tar.xz"; + sha256 = "1mw0jarqv2ypxwgf4qaxqlw0sijw0is36sasrfz8grbykwi18bz1"; + name = "kidletime-5.92.0.tar.xz"; }; }; kimageformats = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kimageformats-5.91.0.tar.xz"; - sha256 = "0df8in33xwajqay487w0hjfsplz8y51w9sjb75na7yqsn75p38xb"; - name = "kimageformats-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kimageformats-5.92.0.tar.xz"; + sha256 = "0sd3xhqh3zgy4jq8fc1llqjrxizylbsz58njz2dxqjas2a4rj16f"; + name = "kimageformats-5.92.0.tar.xz"; }; }; kinit = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kinit-5.91.0.tar.xz"; - sha256 = "1y62k24mwzbg4gchvjb8wn6ygq57wc72clb3jgyipw034czdihvi"; - name = "kinit-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kinit-5.92.0.tar.xz"; + sha256 = "1kpkqnq9krxlzhripwjhw3n55p5sxqsvj6nb2pqb9m0ppw97jlfb"; + name = "kinit-5.92.0.tar.xz"; }; }; kio = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kio-5.91.0.tar.xz"; - sha256 = "14v28qilb5ayv9shw86hb88k60nr4bbd2pa4vwsqij9xkwlympgj"; - name = "kio-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kio-5.92.0.tar.xz"; + sha256 = "1cscsjb2v0zygzazfhcflc3gb5ny1a79g3i6glyzw6ppj2c3yhyl"; + name = "kio-5.92.0.tar.xz"; }; }; kirigami2 = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kirigami2-5.91.0.tar.xz"; - sha256 = "0ifljwa6hli2rndfadpzs30dpwc99nnvcm3yi9j5dim2bdf6glwc"; - name = "kirigami2-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kirigami2-5.92.0.tar.xz"; + sha256 = "0p1x40p38pr9rvzwil57asgsaa95qpjqi9npwv4pgibhxacgznha"; + name = "kirigami2-5.92.0.tar.xz"; }; }; kitemmodels = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kitemmodels-5.91.0.tar.xz"; - sha256 = "189kgrw2vjr9067mqr4f2sv06xmnjaapry0bf8s41v6r9v7py708"; - name = "kitemmodels-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kitemmodels-5.92.0.tar.xz"; + sha256 = "16z8m11cyrapf6m56gmpjmvcgan7s50si8rl1cbbid02src7yp76"; + name = "kitemmodels-5.92.0.tar.xz"; }; }; kitemviews = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kitemviews-5.91.0.tar.xz"; - sha256 = "16cm4zmv1ngrsmy6k0ybv5wxd0g8cc8zwq6ab7jvs7a04sykv238"; - name = "kitemviews-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kitemviews-5.92.0.tar.xz"; + sha256 = "1ml6i1km22xsprldkzmngfh9xs5vdhlfvc6f7aq5hx9q5114v2q5"; + name = "kitemviews-5.92.0.tar.xz"; }; }; kjobwidgets = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kjobwidgets-5.91.0.tar.xz"; - sha256 = "14pkyd6j78kignr62xfkvpyi2fwvzcvcsdnn23h8jxkhwm2ri42v"; - name = "kjobwidgets-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kjobwidgets-5.92.0.tar.xz"; + sha256 = "09l5zgr5mn29v410ng5rccdg2bki9r6cb8y2lrijzgfxfxpvj96z"; + name = "kjobwidgets-5.92.0.tar.xz"; }; }; kjs = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/kjs-5.91.0.tar.xz"; - sha256 = "0jbwlnmf8whzgjkrbnsvdsnn3kv0h44ghf63m2qcgg2l9wb0j8rj"; - name = "kjs-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/kjs-5.92.0.tar.xz"; + sha256 = "067ilsm78x03kf5fs2xmlasvy2712k0xrsa404g2zj81fm92s1q4"; + name = "kjs-5.92.0.tar.xz"; }; }; kjsembed = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/kjsembed-5.91.0.tar.xz"; - sha256 = "124y7518jhjg3y2x7bcyl6b3c0bfxfbgd2sz6dwk45y4byx7rl60"; - name = "kjsembed-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/kjsembed-5.92.0.tar.xz"; + sha256 = "0db0r8v0bhp3razwyvmvk9r4psl14vgn23c4cm2q1b5pl0w6bhnp"; + name = "kjsembed-5.92.0.tar.xz"; }; }; kmediaplayer = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/kmediaplayer-5.91.0.tar.xz"; - sha256 = "0rn9azrj8k1m67y9ni0f3nwl9ldf1ksiqv6dgnzrx6xh0rxfm2h1"; - name = "kmediaplayer-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/kmediaplayer-5.92.0.tar.xz"; + sha256 = "19lpib2wj91w8shsf9056nwi46qja8nh96hj164ydqlkslpfnf7y"; + name = "kmediaplayer-5.92.0.tar.xz"; }; }; knewstuff = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/knewstuff-5.91.0.tar.xz"; - sha256 = "0akaxi9klmpwn4pyr6ys5sxcapdspldq1f64im7vd6byzqrgpnax"; - name = "knewstuff-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/knewstuff-5.92.0.tar.xz"; + sha256 = "0gvclv1a6xyrqa24svb56kp9zf2wi98as3q30lnwf0bpbpjsw52b"; + name = "knewstuff-5.92.0.tar.xz"; }; }; knotifications = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/knotifications-5.91.0.tar.xz"; - sha256 = "1207rimq8si1zxnn827631a1hskrd3m3ilgaj3wj859qrbkqmxzm"; - name = "knotifications-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/knotifications-5.92.0.tar.xz"; + sha256 = "1dwlx8w810l0cvy72mj52saf4x7i9p3xpqpjx4chy54n7mg0jklc"; + name = "knotifications-5.92.0.tar.xz"; }; }; knotifyconfig = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/knotifyconfig-5.91.0.tar.xz"; - sha256 = "07m5mphd8mrak5sdqlldbcd51946v49xpcwi9fhn7w0kx29hknyf"; - name = "knotifyconfig-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/knotifyconfig-5.92.0.tar.xz"; + sha256 = "0fii74r0ap3n08lp9kj7pki0msqjsia2jnmavyps51kq37im5x7p"; + name = "knotifyconfig-5.92.0.tar.xz"; }; }; kpackage = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kpackage-5.91.0.tar.xz"; - sha256 = "12w8lfwifa107wlrld3zz774hczn9mkib6wqxw24yxxmzfw9lc2i"; - name = "kpackage-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kpackage-5.92.0.tar.xz"; + sha256 = "1av6v0629a8yi0wpl7xgyd0gsn5gi228abdlvbk4dzrx9vxpa7rn"; + name = "kpackage-5.92.0.tar.xz"; }; }; kparts = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kparts-5.91.0.tar.xz"; - sha256 = "10ni6b114acjnmrahvvqw75iqkc10ii97y3z7lirj2727a3qmzzj"; - name = "kparts-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kparts-5.92.0.tar.xz"; + sha256 = "061kzss4b0bw67j3mc8h36mbaji077k3alk2ghcir7qix6r1hkh9"; + name = "kparts-5.92.0.tar.xz"; }; }; kpeople = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kpeople-5.91.0.tar.xz"; - sha256 = "09l2q8cg9p8g7zkd1mjx6x08bqkr4ykxjibskc184asff7v47gvp"; - name = "kpeople-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kpeople-5.92.0.tar.xz"; + sha256 = "0wf555pqiannxb115mlbl43ds1365im95vadsbzv1gdz668p44xk"; + name = "kpeople-5.92.0.tar.xz"; }; }; kplotting = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kplotting-5.91.0.tar.xz"; - sha256 = "0rgmmliw9cfi0j2miszqz2kphqm04r5nfs8dqq6pnvclk1k9kss6"; - name = "kplotting-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kplotting-5.92.0.tar.xz"; + sha256 = "1l8y0xlwjyv1l4g0mag4bgf906jc654ygky1bribzay4wki66pf9"; + name = "kplotting-5.92.0.tar.xz"; }; }; kpty = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kpty-5.91.0.tar.xz"; - sha256 = "1yy1k96kikvvnlyd00krc08ifiqbrz0x5vwv3pgdbpnwgl8p580d"; - name = "kpty-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kpty-5.92.0.tar.xz"; + sha256 = "0lp0bqlg1i0a5vl6gvvkngbsha8ab38z6b3sjvpmk83vixgsq7fb"; + name = "kpty-5.92.0.tar.xz"; }; }; kquickcharts = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kquickcharts-5.91.0.tar.xz"; - sha256 = "1ghiymm257b8xgmkibb7s7bwb28x3zhnrgrrsya47q5njb87h0ck"; - name = "kquickcharts-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kquickcharts-5.92.0.tar.xz"; + sha256 = "0y467vqx2r6dcyqwn6p7hbg4q7n0xdh4lcqwyin4cdxi14lhwhqs"; + name = "kquickcharts-5.92.0.tar.xz"; }; }; kross = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/kross-5.91.0.tar.xz"; - sha256 = "06f8220jmvjsfbzjkr2ybwicwjffbi3yw9sr3bcyrilchrrpgqal"; - name = "kross-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/kross-5.92.0.tar.xz"; + sha256 = "1gqy1h5mqsfgbpqkdrhs7xf77kw4yy19mryda1fwjcqzxd02i7hj"; + name = "kross-5.92.0.tar.xz"; }; }; krunner = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/krunner-5.91.0.tar.xz"; - sha256 = "17iaw55rkzyfpgkbw2an6pa4wid79b0dnb3310vfaq0xkm0gjxq6"; - name = "krunner-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/krunner-5.92.0.tar.xz"; + sha256 = "1vcgqjyx9i8k9q4j6q9p4f7sp76aap8gqn2v269lb7imcrfhrj1z"; + name = "krunner-5.92.0.tar.xz"; }; }; kservice = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kservice-5.91.0.tar.xz"; - sha256 = "0m4j7djiyapi1hm23lz9nd238rrlldxlggzkqq056z486v2137bp"; - name = "kservice-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kservice-5.92.0.tar.xz"; + sha256 = "1y1fr1galhhi6yf9w9qcvkp1zb63ifvr4wb43jwpvpms9djxkqjj"; + name = "kservice-5.92.0.tar.xz"; }; }; ktexteditor = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/ktexteditor-5.91.0.tar.xz"; - sha256 = "1bkz6v1y5vyxav398a6224ldqa9pqhbad3vmhxrjb2hxcbha2cpm"; - name = "ktexteditor-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/ktexteditor-5.92.0.tar.xz"; + sha256 = "137v8g7j8kkv9yh30ysmm5n6imyyd3jmd0f6w5ni00kxl0y1rl5w"; + name = "ktexteditor-5.92.0.tar.xz"; }; }; ktextwidgets = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/ktextwidgets-5.91.0.tar.xz"; - sha256 = "0xmzrak5mwg1l4v38g14i7j1yr3j6sj13q2iqa433hs5agl6l6n4"; - name = "ktextwidgets-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/ktextwidgets-5.92.0.tar.xz"; + sha256 = "030bz67n6m3fkbldnr48mzicm9cgnr9gdpwipaghl5x5k3s7p1py"; + name = "ktextwidgets-5.92.0.tar.xz"; }; }; kunitconversion = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kunitconversion-5.91.0.tar.xz"; - sha256 = "0n2v0f08s71z2imhn41jkm2knjvk7bkwmcz70gs8h97ykrj6niap"; - name = "kunitconversion-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kunitconversion-5.92.0.tar.xz"; + sha256 = "17ph75rg3y652ii0yxm9s8xrbpjs9pdfsrsajm220mi9ng2b9qj7"; + name = "kunitconversion-5.92.0.tar.xz"; }; }; kwallet = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kwallet-5.91.0.tar.xz"; - sha256 = "1z1qb6a2b5rqj7js88ms8n67fbs885pw6djbf1l86na2zhf0adip"; - name = "kwallet-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kwallet-5.92.0.tar.xz"; + sha256 = "1ra0cxw70vb6pks8sqw5k895rnrfzwxhg6vh4yc5dgzdn1nagb3i"; + name = "kwallet-5.92.0.tar.xz"; }; }; kwayland = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kwayland-5.91.0.tar.xz"; - sha256 = "1a03ckacp39lpsqyykkm6lxajxm71s6ifpzgj8q0a37v75jzmz9y"; - name = "kwayland-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kwayland-5.92.0.tar.xz"; + sha256 = "15fizsbdl6psmi24fvpfk9dvh61q07irzavpkl961qp4zg79gq4m"; + name = "kwayland-5.92.0.tar.xz"; }; }; kwidgetsaddons = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kwidgetsaddons-5.91.0.tar.xz"; - sha256 = "03pj98sgybkcz487vr774x05w46imnipq2794nkv426nnhyxrd73"; - name = "kwidgetsaddons-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kwidgetsaddons-5.92.0.tar.xz"; + sha256 = "0b0z24j162j39zfycl5al69xcqgdsr96p7ii3prm1mbyda6mbqyh"; + name = "kwidgetsaddons-5.92.0.tar.xz"; }; }; kwindowsystem = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kwindowsystem-5.91.0.tar.xz"; - sha256 = "1yy02fvfabrsvdpmrkdnjdsdd3d2crxavsl47si6ry8fdxb90y95"; - name = "kwindowsystem-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kwindowsystem-5.92.0.tar.xz"; + sha256 = "103xvhzlggi05k16s9kssy7g5a74k9yildj1a4igqwi39wmvvnyw"; + name = "kwindowsystem-5.92.0.tar.xz"; }; }; kxmlgui = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/kxmlgui-5.91.0.tar.xz"; - sha256 = "1qww2isx99lx0mn1dv0vzrvmr2xdp8zgikyvgw1wf8hfay3v2s1g"; - name = "kxmlgui-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/kxmlgui-5.92.0.tar.xz"; + sha256 = "0hxpjyjr77q2gyi3hg13119aza3634rvmllbj66pi7y37h6lr2z0"; + name = "kxmlgui-5.92.0.tar.xz"; }; }; kxmlrpcclient = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/portingAids/kxmlrpcclient-5.91.0.tar.xz"; - sha256 = "1bnymf5wq4apjsgshvbhcggdw7jc0yxv4jag3k19ff9820lskhph"; - name = "kxmlrpcclient-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/portingAids/kxmlrpcclient-5.92.0.tar.xz"; + sha256 = "1axy34g5ahd1c3qg7ab7h786jibpaj4dvj45x50x5czq06idqchf"; + name = "kxmlrpcclient-5.92.0.tar.xz"; }; }; modemmanager-qt = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/modemmanager-qt-5.91.0.tar.xz"; - sha256 = "15l46lkh8nkal1nai494dabaysy581jzi8nwrv4kjvc6qwc3yrx2"; - name = "modemmanager-qt-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/modemmanager-qt-5.92.0.tar.xz"; + sha256 = "162qzq1aqv2l3bi0r01xrfan20r1zhaaqih4dqbaj7vqibsb9l3y"; + name = "modemmanager-qt-5.92.0.tar.xz"; }; }; networkmanager-qt = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/networkmanager-qt-5.91.0.tar.xz"; - sha256 = "0f27qin2ks3q7rin53sk9vjjnadjnax99d9k245sjr6fjpczy81f"; - name = "networkmanager-qt-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/networkmanager-qt-5.92.0.tar.xz"; + sha256 = "0r7s3fw9fk3pkrzrl1bxsmkf1qbgv3p0jrsskp28f3561vncipai"; + name = "networkmanager-qt-5.92.0.tar.xz"; }; }; oxygen-icons5 = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/oxygen-icons5-5.91.0.tar.xz"; - sha256 = "0j3j2lyxr2iz68vasvpjqkix4bnnj6wc4sr97i6x6z06zq0kawai"; - name = "oxygen-icons5-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/oxygen-icons5-5.92.0.tar.xz"; + sha256 = "1wcy8bv4d6jns7vaisbvjc8nxriw9vkiz7j4za5ry7wnvlzv126a"; + name = "oxygen-icons5-5.92.0.tar.xz"; }; }; plasma-framework = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/plasma-framework-5.91.0.tar.xz"; - sha256 = "0ydhhpnwf7lfl3kdjsw92mgsza5gy292f7v6kyby4ygjnir1hizl"; - name = "plasma-framework-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/plasma-framework-5.92.0.tar.xz"; + sha256 = "1xq66lyagjsgfashhqgqgqhda0rqfqf0l5yf1gc4ziv48mibrhn6"; + name = "plasma-framework-5.92.0.tar.xz"; }; }; prison = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/prison-5.91.0.tar.xz"; - sha256 = "0k1zp3jzh8gjsji6wh5g8k41zdl8s1vd58ipm0lxy670a71wcqcg"; - name = "prison-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/prison-5.92.0.tar.xz"; + sha256 = "07p47q8sva82hglfzp145a1sajlal8b3qshhkicc9rkbsngywvvy"; + name = "prison-5.92.0.tar.xz"; }; }; purpose = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/purpose-5.91.0.tar.xz"; - sha256 = "1z6wpz7d9byx4n5zx6chmyy9k1jkmghdgahsvkqsc33z6hnh2b4m"; - name = "purpose-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/purpose-5.92.0.tar.xz"; + sha256 = "02j09zf18dwjk17mn841m7cm0qsn7gcz5lff8dad3yah0lc3wqcl"; + name = "purpose-5.92.0.tar.xz"; }; }; qqc2-desktop-style = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/qqc2-desktop-style-5.91.0.tar.xz"; - sha256 = "0rd9rvffhif8yckwr7axjcv5iqn5b0jdviij7f9y8vjpkzyjvm8i"; - name = "qqc2-desktop-style-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/qqc2-desktop-style-5.92.0.tar.xz"; + sha256 = "1b5xr71lan7ixvd1nfxy9wj21h4wwidsaxa192sha1d8p49hhlwp"; + name = "qqc2-desktop-style-5.92.0.tar.xz"; }; }; solid = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/solid-5.91.0.tar.xz"; - sha256 = "1a4k0amyg8mvfr2ld7v8zyphhxv33yybh55vqcshwv4a0jm1wmjg"; - name = "solid-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/solid-5.92.0.tar.xz"; + sha256 = "172sid8l1znzxxz0hi5m19yy4vg7l1nbghvzjvh18ssbmxcwh9l9"; + name = "solid-5.92.0.tar.xz"; }; }; sonnet = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/sonnet-5.91.0.tar.xz"; - sha256 = "067xj5mllpzl0gnxxljhfi9y4xdgrpqbckm7pykczzqrklrrx8dx"; - name = "sonnet-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/sonnet-5.92.0.tar.xz"; + sha256 = "08jps1hy0qvk62wnzn50qi8iaay7xav3hbcj55sk70mm7pd1vz1i"; + name = "sonnet-5.92.0.tar.xz"; }; }; syndication = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/syndication-5.91.0.tar.xz"; - sha256 = "1f2kb6mh1xc1k1bn536lq9gq0j2lb65qw4vpp4ixynlfij4zq1gy"; - name = "syndication-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/syndication-5.92.0.tar.xz"; + sha256 = "0ijxpnsygwzzybic5lp8gfq57y84vrp3bq7vdbjh3h0345vvk6hw"; + name = "syndication-5.92.0.tar.xz"; }; }; syntax-highlighting = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/syntax-highlighting-5.91.0.tar.xz"; - sha256 = "0fprqi2z8issh3jkql6labszkwd3cpvd6qadsg9fi46vfjr4a2ip"; - name = "syntax-highlighting-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/syntax-highlighting-5.92.0.tar.xz"; + sha256 = "03p5qzf13nbf54gzad3q1q6i33iggz3ik0ydr9szhj92kfppwd4r"; + name = "syntax-highlighting-5.92.0.tar.xz"; }; }; threadweaver = { - version = "5.91.0"; + version = "5.92.0"; src = fetchurl { - url = "${mirror}/stable/frameworks/5.91/threadweaver-5.91.0.tar.xz"; - sha256 = "1900kqglkwzkjc24mvl0j7jf7xcx6cr6b1g78s5b5m18rw050j12"; - name = "threadweaver-5.91.0.tar.xz"; + url = "${mirror}/stable/frameworks/5.92/threadweaver-5.92.0.tar.xz"; + sha256 = "008in2wbl6zr404m9hbqdvy3d4r06mmb3jrr13myldwljqywzc28"; + name = "threadweaver-5.92.0.tar.xz"; }; }; } diff --git a/pkgs/development/libraries/kde-frameworks/syndication.nix b/pkgs/development/libraries/kde-frameworks/syndication.nix index fd5a9b9db84..1d32f9b7021 100644 --- a/pkgs/development/libraries/kde-frameworks/syndication.nix +++ b/pkgs/development/libraries/kde-frameworks/syndication.nix @@ -4,7 +4,7 @@ }: mkDerivation { - name = "syndication"; + pname = "syndication"; meta.maintainers = [ lib.maintainers.bkchr ]; nativeBuildInputs = [ extra-cmake-modules ]; buildInputs = [ kcodecs ]; diff --git a/pkgs/development/libraries/kde-frameworks/syntax-highlighting.nix b/pkgs/development/libraries/kde-frameworks/syntax-highlighting.nix index a295b23f321..fee392140f7 100644 --- a/pkgs/development/libraries/kde-frameworks/syntax-highlighting.nix +++ b/pkgs/development/libraries/kde-frameworks/syntax-highlighting.nix @@ -3,7 +3,7 @@ }: mkDerivation { - name = "syntax-highlighting"; + pname = "syntax-highlighting"; nativeBuildInputs = [ extra-cmake-modules perl ]; buildInputs = [ qttools ]; propagatedBuildInputs = [ qtbase ]; diff --git a/pkgs/development/libraries/kde-frameworks/threadweaver.nix b/pkgs/development/libraries/kde-frameworks/threadweaver.nix index bfa529c9267..fb43b9f28b0 100644 --- a/pkgs/development/libraries/kde-frameworks/threadweaver.nix +++ b/pkgs/development/libraries/kde-frameworks/threadweaver.nix @@ -5,7 +5,7 @@ }: mkDerivation { - name = "threadweaver"; + pname = "threadweaver"; nativeBuildInputs = [ extra-cmake-modules ]; propagatedBuildInputs = [ qtbase ]; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/kerberos/krb5.nix b/pkgs/development/libraries/kerberos/krb5.nix index c632c2fdac9..e1251b0e942 100644 --- a/pkgs/development/libraries/kerberos/krb5.nix +++ b/pkgs/development/libraries/kerberos/krb5.nix @@ -18,7 +18,7 @@ let in with lib; stdenv.mkDerivation rec { - name = "${type}krb5-${version}"; + pname = "${type}krb5"; version = "1.19.2"; src = fetchurl { diff --git a/pkgs/development/libraries/khronos-ocl-icd-loader/default.nix b/pkgs/development/libraries/khronos-ocl-icd-loader/default.nix index 732efda1df4..8ff7b933247 100644 --- a/pkgs/development/libraries/khronos-ocl-icd-loader/default.nix +++ b/pkgs/development/libraries/khronos-ocl-icd-loader/default.nix @@ -1,7 +1,7 @@ { lib, stdenv, fetchFromGitHub, opencl-headers, cmake, withTracing ? false }: stdenv.mkDerivation rec { - name = "khronos-ocl-icd-loader-${version}"; + pname = "khronos-ocl-icd-loader"; version = "2022.01.04"; src = fetchFromGitHub { diff --git a/pkgs/development/libraries/languagemachines/frog.nix b/pkgs/development/libraries/languagemachines/frog.nix index b21d0f1159e..50167f28a9d 100644 --- a/pkgs/development/libraries/languagemachines/frog.nix +++ b/pkgs/development/libraries/languagemachines/frog.nix @@ -9,7 +9,7 @@ let in stdenv.mkDerivation { - name = "frog-${release.version}"; + pname = "frog"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "frog-v${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/languagemachines/frogdata.nix b/pkgs/development/libraries/languagemachines/frogdata.nix index f037e7fc17a..5b1b07e7927 100644 --- a/pkgs/development/libraries/languagemachines/frogdata.nix +++ b/pkgs/development/libraries/languagemachines/frogdata.nix @@ -7,7 +7,7 @@ let in stdenv.mkDerivation { - name = "frogdata-${release.version}"; + pname = "frogdata"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "frogdata-${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/languagemachines/libfolia.nix b/pkgs/development/libraries/languagemachines/libfolia.nix index c2b4f6662bb..6cc5bcade20 100644 --- a/pkgs/development/libraries/languagemachines/libfolia.nix +++ b/pkgs/development/libraries/languagemachines/libfolia.nix @@ -8,7 +8,7 @@ let in stdenv.mkDerivation { - name = "libfolia-${release.version}"; + pname = "libfolia"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "libfolia-${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/languagemachines/mbt.nix b/pkgs/development/libraries/languagemachines/mbt.nix index af0f8724942..9556c1d5670 100644 --- a/pkgs/development/libraries/languagemachines/mbt.nix +++ b/pkgs/development/libraries/languagemachines/mbt.nix @@ -9,7 +9,7 @@ let in stdenv.mkDerivation { - name = "mbt-${release.version}"; + pname = "mbt"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "mbt-${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/languagemachines/ticcutils.nix b/pkgs/development/libraries/languagemachines/ticcutils.nix index a5b262106c0..0b5fef292fc 100644 --- a/pkgs/development/libraries/languagemachines/ticcutils.nix +++ b/pkgs/development/libraries/languagemachines/ticcutils.nix @@ -7,7 +7,7 @@ let in stdenv.mkDerivation { - name = "ticcutils-${release.version}"; + pname = "ticcutils"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "ticcutils-${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/languagemachines/timbl.nix b/pkgs/development/libraries/languagemachines/timbl.nix index 8b9e6c62aee..1585798170b 100644 --- a/pkgs/development/libraries/languagemachines/timbl.nix +++ b/pkgs/development/libraries/languagemachines/timbl.nix @@ -9,7 +9,7 @@ let in stdenv.mkDerivation { - name = "timbl-${release.version}"; + pname = "timbl"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "timbl-${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/languagemachines/timblserver.nix b/pkgs/development/libraries/languagemachines/timblserver.nix index 55e914bd5b4..ea40d017d47 100644 --- a/pkgs/development/libraries/languagemachines/timblserver.nix +++ b/pkgs/development/libraries/languagemachines/timblserver.nix @@ -9,7 +9,7 @@ let in stdenv.mkDerivation { - name = "timblserver-${release.version}"; + pname = "timblserver"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "timblserver-${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/languagemachines/ucto.nix b/pkgs/development/libraries/languagemachines/ucto.nix index 4d85bbfc212..f707d9fb8b6 100644 --- a/pkgs/development/libraries/languagemachines/ucto.nix +++ b/pkgs/development/libraries/languagemachines/ucto.nix @@ -9,7 +9,7 @@ let in stdenv.mkDerivation { - name = "ucto-${release.version}"; + pname = "ucto"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "ucto-${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/languagemachines/uctodata.nix b/pkgs/development/libraries/languagemachines/uctodata.nix index dbc15a17a14..a274b6193ed 100644 --- a/pkgs/development/libraries/languagemachines/uctodata.nix +++ b/pkgs/development/libraries/languagemachines/uctodata.nix @@ -7,7 +7,7 @@ let in stdenv.mkDerivation { - name = "uctodata-${release.version}"; + pname = "uctodata"; version = release.version; src = fetchurl { inherit (release) url sha256; name = "uctodata-${release.version}.tar.gz"; }; diff --git a/pkgs/development/libraries/leatherman/default.nix b/pkgs/development/libraries/leatherman/default.nix index 874c567ed42..05cf84144fe 100644 --- a/pkgs/development/libraries/leatherman/default.nix +++ b/pkgs/development/libraries/leatherman/default.nix @@ -11,6 +11,8 @@ stdenv.mkDerivation rec { owner = "puppetlabs"; }; + cmakeFlags = [ "-DLEATHERMAN_ENABLE_TESTING=OFF" ]; + NIX_CFLAGS_COMPILE = "-Wno-error"; nativeBuildInputs = [ cmake ]; diff --git a/pkgs/development/libraries/libappindicator/default.nix b/pkgs/development/libraries/libappindicator/default.nix index 469235e2e6a..8ca2acc11c7 100644 --- a/pkgs/development/libraries/libappindicator/default.nix +++ b/pkgs/development/libraries/libappindicator/default.nix @@ -13,8 +13,8 @@ with lib; stdenv.mkDerivation rec { - name = let postfix = if gtkVersion == "2" && monoSupport then "sharp" else "gtk${gtkVersion}"; - in "libappindicator-${postfix}-${version}"; + pname = let postfix = if gtkVersion == "2" && monoSupport then "sharp" else "gtk${gtkVersion}"; + in "libappindicator-${postfix}"; version = "12.10.1+20.10.20200706.1"; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/libraries/libcbor/default.nix b/pkgs/development/libraries/libcbor/default.nix index 349b715d852..9473c4823fc 100644 --- a/pkgs/development/libraries/libcbor/default.nix +++ b/pkgs/development/libraries/libcbor/default.nix @@ -2,13 +2,13 @@ stdenv.mkDerivation rec { pname = "libcbor"; - version = "0.8.0"; + version = "0.9.0"; src = fetchFromGitHub { owner = "PJK"; repo = pname; rev = "v${version}"; - sha256 = "01dv4vxcmbvpphqy16vqiwh25wx11x630js5wfnx7cryarsh9ld7"; + sha256 = "sha256-Wp/48yQA17mf/dTgeMcMDvPpKOPkfLhQkCnzgGLpLtk="; }; nativeBuildInputs = [ cmake ]; diff --git a/pkgs/development/libraries/libcollectdclient/default.nix b/pkgs/development/libraries/libcollectdclient/default.nix index 0bf654ee963..919ddcd3f06 100644 --- a/pkgs/development/libraries/libcollectdclient/default.nix +++ b/pkgs/development/libraries/libcollectdclient/default.nix @@ -2,7 +2,8 @@ with lib; collectd.overrideAttrs (oldAttrs: { - name = "libcollectdclient-${collectd.version}"; + pname = "libcollectdclient"; + inherit (collectd) version; buildInputs = [ ]; configureFlags = (oldAttrs.configureFlags or []) ++ [ diff --git a/pkgs/development/libraries/libfido2/default.nix b/pkgs/development/libraries/libfido2/default.nix index 13bbd246c64..e5d6d1c7c67 100644 --- a/pkgs/development/libraries/libfido2/default.nix +++ b/pkgs/development/libraries/libfido2/default.nix @@ -12,12 +12,12 @@ stdenv.mkDerivation rec { pname = "libfido2"; - version = "1.9.0"; + version = "1.10.0"; # releases on https://developers.yubico.com/libfido2/Releases/ are signed src = fetchurl { url = "https://developers.yubico.com/${pname}/Releases/${pname}-${version}.tar.gz"; - sha256 = "sha256-ujnjrzc20t/IrT0ctuO+fszAlYhhCjsHyGXQ7T5YwtI="; + sha256 = "sha256-Um79PVavcGwF0J89IfGO47CxWsDB9cXaGsvCfCcwuZs="; }; nativeBuildInputs = [ cmake pkg-config ]; diff --git a/pkgs/development/libraries/libfive/default.nix b/pkgs/development/libraries/libfive/default.nix index 8634f05ebbc..00031e66bf5 100644 --- a/pkgs/development/libraries/libfive/default.nix +++ b/pkgs/development/libraries/libfive/default.nix @@ -47,5 +47,6 @@ mkDerivation { maintainers = with maintainers; [ hodapp kovirobi ]; license = with licenses; [ mpl20 gpl2Plus ]; platforms = with platforms; linux ++ darwin; + broken = true; }; } diff --git a/pkgs/development/libraries/libinput/default.nix b/pkgs/development/libraries/libinput/default.nix index 89bdc15ff62..5c06cd282da 100644 --- a/pkgs/development/libraries/libinput/default.nix +++ b/pkgs/development/libraries/libinput/default.nix @@ -1,6 +1,7 @@ { lib , stdenv -, fetchurl +, fetchFromGitLab +, gitUpdater , pkg-config , meson , ninja @@ -44,13 +45,16 @@ in stdenv.mkDerivation rec { pname = "libinput"; - version = "1.19.3"; + version = "1.20.0"; outputs = [ "bin" "out" "dev" ]; - src = fetchurl { - url = "https://www.freedesktop.org/software/libinput/libinput-${version}.tar.xz"; - sha256 = "sha256-PK54zN4Z19Dzh+WLxzTU0Xq19kJvVKnotyjJCxe6oGg="; + src = fetchFromGitLab { + domain = "gitlab.freedesktop.org"; + owner = "libinput"; + repo = "libinput"; + rev = version; + sha256 = "Ey6ItBIrf1POACp2+6R0B4KxJq5V1HoO+y4j6hZSGAE="; }; patches = [ @@ -113,8 +117,14 @@ stdenv.mkDerivation rec { sed -i "/install_subdir('libinput', install_dir : dir_etc)/d" meson.build ''; - passthru.tests = { - libinput-module = nixosTests.libinput; + passthru = { + tests = { + libinput-module = nixosTests.libinput; + }; + updateScript = gitUpdater { + inherit pname version; + patchlevel-unstable = true; + }; }; meta = with lib; { diff --git a/pkgs/development/libraries/libjpeg-turbo/default.nix b/pkgs/development/libraries/libjpeg-turbo/default.nix index 92aaf6201b9..75ec20545ca 100644 --- a/pkgs/development/libraries/libjpeg-turbo/default.nix +++ b/pkgs/development/libraries/libjpeg-turbo/default.nix @@ -16,13 +16,13 @@ assert !(enableJpeg7 && enableJpeg8); # pick only one or none, not both stdenv.mkDerivation rec { pname = "libjpeg-turbo"; - version = "2.1.2"; + version = "2.1.3"; src = fetchFromGitHub { owner = "libjpeg-turbo"; repo = "libjpeg-turbo"; rev = version; - sha256 = "sha256-mlHueKAU/uNUdV9s4jWKAE+XVJdpEFhw2hxGvqRwAGc="; + sha256 = "sha256-GbOYoCNAsOESXrEsBb6OHVB4TKhPUEU04PBp8qXVMug="; }; # This is needed by freeimage diff --git a/pkgs/development/libraries/libnetfilter_conntrack/default.nix b/pkgs/development/libraries/libnetfilter_conntrack/default.nix index a2097bb17e2..e960c8d1bf4 100644 --- a/pkgs/development/libraries/libnetfilter_conntrack/default.nix +++ b/pkgs/development/libraries/libnetfilter_conntrack/default.nix @@ -1,14 +1,22 @@ -{ lib, stdenv, fetchurl, pkg-config, libnfnetlink, libmnl }: +{ lib, stdenv, fetchurl, fetchpatch, pkg-config, libnfnetlink, libmnl }: stdenv.mkDerivation rec { pname = "libnetfilter_conntrack"; - version = "1.0.8"; + version = "1.0.9"; src = fetchurl { url = "https://netfilter.org/projects/libnetfilter_conntrack/files/${pname}-${version}.tar.bz2"; - sha256 = "1ky1mqgnplw2h9jf0kn0a69d94jkydhbiipng9l2hdcj13h3pl8c"; + sha256 = "sha256-Z72d9J/jTouCFE9t+5OzIPOEqOpZcn6S/40YtfS1eag="; }; + patches = [ + # Fix Musl build. + (fetchpatch { + url = "https://git.netfilter.org/libnetfilter_conntrack/patch/?id=21ee35dde73aec5eba35290587d479218c6dd824"; + sha256 = "00rp82jrx5ygcw8la3c7bv7sigw9qzbn956dk71qjx981a2g2kqk"; + }) + ]; + buildInputs = [ libmnl ]; propagatedBuildInputs = [ libnfnetlink ]; nativeBuildInputs = [ pkg-config ]; diff --git a/pkgs/development/libraries/libosmscout/default.nix b/pkgs/development/libraries/libosmscout/default.nix index 2f83963d205..b11ec3eb94c 100644 --- a/pkgs/development/libraries/libosmscout/default.nix +++ b/pkgs/development/libraries/libosmscout/default.nix @@ -11,6 +11,8 @@ mkDerivation rec { sha256 = "1pa459h52kw88mvsdvkz83f4p35vvgsfy2qfjwcj61gj4y9d2rq4"; }; + cmakeFlags = [ "-DOSMSCOUT_BUILD_TESTS=OFF" ]; + nativeBuildInputs = [ cmake pkg-config ]; buildInputs = [ marisa qtlocation ]; diff --git a/pkgs/development/libraries/libowfat/default.nix b/pkgs/development/libraries/libowfat/default.nix index 9db1354677d..665121b58b5 100644 --- a/pkgs/development/libraries/libowfat/default.nix +++ b/pkgs/development/libraries/libowfat/default.nix @@ -17,5 +17,8 @@ stdenv.mkDerivation rec { homepage = "https://www.fefe.de/libowfat/"; license = licenses.gpl2; platforms = platforms.linux; + # Doesn't build with glibc 2.34: https://hydra.nixos.org/build/156248131 + # Should be fixed with the next release: https://bugs.gentoo.org/806505 + broken = true; }; } diff --git a/pkgs/development/libraries/libressl/fix-build-with-glibc.patch b/pkgs/development/libraries/libressl/fix-build-with-glibc.patch new file mode 100644 index 00000000000..db482bcb35d --- /dev/null +++ b/pkgs/development/libraries/libressl/fix-build-with-glibc.patch @@ -0,0 +1,92 @@ +diff --git a/tests/explicit_bzero.c b/tests/explicit_bzero.c +index 34c60baa8a..9c0e917829 100644 +--- a/tests/explicit_bzero.c ++++ b/tests/explicit_bzero.c +@@ -1,4 +1,4 @@ +-/* $OpenBSD: explicit_bzero.c,v 1.6 2014/07/11 01:10:35 matthew Exp $ */ ++/* $OpenBSD: explicit_bzero.c,v 1.7 2021/03/27 11:17:58 bcook Exp $ */ + /* + * Copyright (c) 2014 Google Inc. + * +@@ -18,6 +18,7 @@ + #include <assert.h> + #include <errno.h> + #include <signal.h> ++#include <stdlib.h> + #include <string.h> + #include <unistd.h> + +@@ -36,19 +37,33 @@ enum { + SECRETBYTES = SECRETCOUNT * sizeof(secret) + }; + +-static char altstack[SIGSTKSZ + SECRETBYTES]; ++/* ++ * As of glibc 2.34, when _GNU_SOURCE is defined, SIGSTKSZ is no longer ++ * constant on Linux. SIGSTKSZ is redefined to sysconf (_SC_SIGSTKSZ). ++ */ ++static char *altstack; ++#define ALTSTACK_SIZE (SIGSTKSZ + SECRETBYTES) + + static void + setup_stack(void) + { ++ altstack = calloc(1, ALTSTACK_SIZE); ++ ASSERT_NE(NULL, altstack); ++ + const stack_t sigstk = { + .ss_sp = altstack, +- .ss_size = sizeof(altstack), ++ .ss_size = ALTSTACK_SIZE + }; + + ASSERT_EQ(0, sigaltstack(&sigstk, NULL)); + } + ++static void ++cleanup_stack(void) ++{ ++ free(altstack); ++} ++ + static void + assert_on_stack(void) + { +@@ -129,7 +144,7 @@ test_without_bzero() + char buf[SECRETBYTES]; + assert_on_stack(); + populate_secret(buf, sizeof(buf)); +- char *res = memmem(altstack, sizeof(altstack), buf, sizeof(buf)); ++ char *res = memmem(altstack, ALTSTACK_SIZE, buf, sizeof(buf)); + ASSERT_NE(NULL, res); + return (res); + } +@@ -140,7 +155,7 @@ test_with_bzero() + char buf[SECRETBYTES]; + assert_on_stack(); + populate_secret(buf, sizeof(buf)); +- char *res = memmem(altstack, sizeof(altstack), buf, sizeof(buf)); ++ char *res = memmem(altstack, ALTSTACK_SIZE, buf, sizeof(buf)); + ASSERT_NE(NULL, res); + explicit_bzero(buf, sizeof(buf)); + return (res); +@@ -183,15 +198,17 @@ main() + * on the stack. This sanity checks that call_on_stack() and + * populate_secret() work as intended. + */ +- memset(altstack, 0, sizeof(altstack)); ++ memset(altstack, 0, ALTSTACK_SIZE); + call_on_stack(do_test_without_bzero); + + /* + * Now test with a call to explicit_bzero() and check that we + * *don't* find any instances of the secret data. + */ +- memset(altstack, 0, sizeof(altstack)); ++ memset(altstack, 0, ALTSTACK_SIZE); + call_on_stack(do_test_with_bzero); + ++ cleanup_stack(); ++ + return (0); + } diff --git a/pkgs/development/libraries/libsecret/default.nix b/pkgs/development/libraries/libsecret/default.nix index 9e8be02aa63..e023a524ae2 100644 --- a/pkgs/development/libraries/libsecret/default.nix +++ b/pkgs/development/libraries/libsecret/default.nix @@ -55,7 +55,7 @@ stdenv.mkDerivation rec { glib ]; - installCheckInputs = [ + checkInputs = [ python3 python3.pkgs.dbus-python python3.pkgs.pygobject3 @@ -64,18 +64,36 @@ stdenv.mkDerivation rec { gjs ]; - # needs to run after install because typelibs point to absolute paths - doInstallCheck = false; # Failed to load shared library '/force/shared/libmock_service.so.0' referenced by the typelib + doCheck = true; + postPatch = '' patchShebangs . ''; - installCheckPhase = '' - export NO_AT_BRIDGE=1 - xvfb-run -s '-screen 0 800x600x24' dbus-run-session \ + preCheck = '' + # Our gobject-introspection patches make the shared library paths absolute + # in the GIR files. When running tests, the library is not yet installed, + # though, so we need to replace the absolute path with a local one during build. + # We are using a symlink that will be overwitten during installation. + mkdir -p $out/lib $out/lib + ln -s "$PWD/libsecret/libmock-service.so" "$out/lib/libmock-service.so" + ln -s "$PWD/libsecret/libsecret-1.so.0" "$out/lib/libsecret-1.so.0" + ''; + + checkPhase = '' + runHook preCheck + + dbus-run-session \ --config-file=${dbus.daemon}/share/dbus-1/session.conf \ - make check + meson test --print-errorlogs + + runHook postCheck + ''; + + postCheck = '' + # This is test-only so it won’t be overwritten during installation. + rm "$out/lib/libmock-service.so" ''; postFixup = '' diff --git a/pkgs/development/libraries/libspf2/default.nix b/pkgs/development/libraries/libspf2/default.nix index c48c71e1448..203f2768e37 100644 --- a/pkgs/development/libraries/libspf2/default.nix +++ b/pkgs/development/libraries/libspf2/default.nix @@ -1,4 +1,4 @@ -{ lib, stdenv, fetchFromGitHub, autoreconfHook }: +{ lib, stdenv, fetchFromGitHub, autoreconfHook, fetchpatch }: with lib; @@ -13,6 +13,14 @@ stdenv.mkDerivation rec { sha256 = "03iiaafdcwh220pqignk407h6klrakwz0zkb8iwk6nkwipkwvhsx"; }; + patches = [ + # glibc-2.34 compat + (fetchpatch { + url = "https://raw.githubusercontent.com/gentoo/gentoo/dbb8a5c9f749cc11e61cfe558f164b165cbc30cb/mail-filter/libspf2/files/libspf2-1.2.11-undefined-dn_.patch"; + sha256 = "sha256-6JVVkVGCcFJsNeBdVTPcLhW4KoHLY4ai/KXDMliXgPA="; + }) + ]; + postPatch = '' # disable static bins compilation sed -i \ diff --git a/pkgs/development/libraries/libusb1/default.nix b/pkgs/development/libraries/libusb1/default.nix index 1514d270210..24b147d142d 100644 --- a/pkgs/development/libraries/libusb1/default.nix +++ b/pkgs/development/libraries/libusb1/default.nix @@ -7,33 +7,27 @@ , udev , libobjc , IOKit +, Security , withStatic ? false }: stdenv.mkDerivation rec { pname = "libusb"; - version = "1.0.24"; + version = "1.0.25"; src = fetchFromGitHub { owner = "libusb"; repo = "libusb"; rev = "v${version}"; - sha256 = "18ri8ky422hw64zry7bpbarb1m0hiljyf64a0a9y093y7aad38i7"; + sha256 = "141wygijjcgka0h31504cdlvih4l2j02j67pcbb2l527p7dbc5pn"; }; outputs = [ "out" "dev" ]; - patches = [ (fetchpatch { - # https://bugs.archlinux.org/task/69121 - url = "https://github.com/libusb/libusb/commit/f6d2cb561402c3b6d3627c0eb89e009b503d9067.patch"; - sha256 = "1dbahikcbwkjhyvks7wbp7fy2bf7nca48vg5z0zqvqzjb9y595cq"; - excludes = [ "libusb/version_nano.h" ]; - }) ]; - nativeBuildInputs = [ pkg-config autoreconfHook ]; propagatedBuildInputs = lib.optional enableUdev udev ++ - lib.optionals stdenv.isDarwin [ libobjc IOKit ]; + lib.optionals stdenv.isDarwin [ libobjc IOKit Security ]; dontDisableStatic = withStatic; diff --git a/pkgs/development/libraries/libuv/default.nix b/pkgs/development/libraries/libuv/default.nix index 1d9354d48e1..12f7f982c1d 100644 --- a/pkgs/development/libraries/libuv/default.nix +++ b/pkgs/development/libraries/libuv/default.nix @@ -1,14 +1,14 @@ { stdenv, lib, fetchFromGitHub, autoconf, automake, libtool, pkg-config, ApplicationServices, CoreServices }: stdenv.mkDerivation rec { - version = "1.43.0"; + version = "1.44.1"; pname = "libuv"; src = fetchFromGitHub { owner = pname; repo = pname; rev = "v${version}"; - sha256 = "sha256-AsXJb2AGNx+SARPmY8uRFRLfX5vqTPNjwL8njSw/e7o="; + sha256 = "sha256-12uveSEavRxQW4xVrB4Rkkj+eHZ71Qy8dRG+95ldz50="; }; postPatch = let @@ -20,6 +20,7 @@ stdenv.mkDerivation rec { "threadpool_multiple_event_loops" # times out on slow machines "get_passwd" # passed on NixOS but failed on other Linuxes "tcp_writealot" "udp_multicast_join" "udp_multicast_join6" # times out sometimes + "fs_fstat" # https://github.com/libuv/libuv/issues/2235#issuecomment-1012086927 ] ++ lib.optionals stdenv.isDarwin [ # Sometimes: timeout (no output), failed uv_listen. Someone # should report these failures to libuv team. There tests should diff --git a/pkgs/development/libraries/libva/1.0.0.nix b/pkgs/development/libraries/libva/1.0.0.nix deleted file mode 100644 index ade56ac16ee..00000000000 --- a/pkgs/development/libraries/libva/1.0.0.nix +++ /dev/null @@ -1,37 +0,0 @@ -{ stdenv, lib, fetchurl, libX11, pkg-config, libXext, libdrm, libXfixes, wayland, libffi -, libGL, mesa -, minimal ? false, libva1-minimal -}: - -stdenv.mkDerivation rec { - pname = "libva"; - version = "1.7.3"; - - src = fetchurl { - url = "https://www.freedesktop.org/software/vaapi/releases/libva/${pname}-${version}.tar.bz2"; - sha256 = "1ndrf136rlw03xag7j1xpmf9015d1h0dpnv6v587jnh6k2a17g12"; - }; - - outputs = [ "bin" "dev" "out" ]; - - nativeBuildInputs = [ pkg-config ]; - - buildInputs = [ libdrm ] - ++ lib.optionals (!minimal) [ libva1-minimal libX11 libXext libXfixes wayland libffi libGL ]; - # TODO: share libs between minimal and !minimal - perhaps just symlink them - - configureFlags = - # Add FHS paths for non-NixOS applications. - [ "--with-drivers-path=${mesa.drivers.driverLink}/lib/dri:/usr/lib/dri:/usr/lib32/dri" ] ++ - lib.optionals (!minimal) [ "--enable-glx" ]; - - installFlags = [ "dummy_drv_video_ladir=$(out)/lib/dri" ]; - - meta = with lib; { - homepage = "http://www.freedesktop.org/wiki/Software/vaapi"; - license = licenses.mit; - description = "VAAPI library: Video Acceleration API"; - platforms = platforms.unix; - maintainers = with maintainers; [ ]; - }; -} diff --git a/pkgs/development/libraries/libva/1.nix b/pkgs/development/libraries/libva/1.nix new file mode 100644 index 00000000000..5197420783a --- /dev/null +++ b/pkgs/development/libraries/libva/1.nix @@ -0,0 +1,50 @@ +{ stdenv +, lib +, fetchFromGitHub +, autoreconfHook +, libX11 +, pkg-config +, libXext +, libdrm +, libXfixes +, wayland +, libffi +, libGL +, mesa +, minimal ? false +, libva1-minimal +}: + +stdenv.mkDerivation rec { + pname = "libva" + lib.optionalString minimal "-minimal"; + version = "1.8.3"; + + src = fetchFromGitHub { + owner = "intel"; + repo = "libva"; + rev = version; + sha256 = "sha256-ur59cqdZqXIY2dDUSie9XsxyRomVBxIW2IVKAgWYC38="; + }; + + outputs = [ "dev" "out" ]; + + nativeBuildInputs = [ autoreconfHook pkg-config ]; + + buildInputs = [ libdrm ] + ++ lib.optionals (!minimal) [ libva1-minimal libX11 libXext libXfixes wayland libffi libGL ]; + # TODO: share libs between minimal and !minimal - perhaps just symlink them + + # Add FHS paths for non-NixOS applications. + configureFlags = [ "--with-drivers-path=${mesa.drivers.driverLink}/lib/dri:/usr/lib/dri:/usr/lib32/dri" ] + ++ lib.optionals (!minimal) [ "--enable-glx" ]; + + installFlags = [ "dummy_drv_video_ladir=$(out)/lib/dri" ]; + + meta = with lib; { + homepage = "https://www.freedesktop.org/wiki/Software/vaapi/"; + license = licenses.mit; + description = "VAAPI library: Video Acceleration API"; + platforms = platforms.unix; + maintainers = with maintainers; [ SuperSandro2000 ]; + }; +} diff --git a/pkgs/development/libraries/libva/default.nix b/pkgs/development/libraries/libva/default.nix index 10f90a16c92..037318353ce 100644 --- a/pkgs/development/libraries/libva/default.nix +++ b/pkgs/development/libraries/libva/default.nix @@ -6,14 +6,14 @@ }: stdenv.mkDerivation rec { - pname = "libva" + lib.optionalString minimal "minimal"; - version = "2.13.0"; + pname = "libva" + lib.optionalString minimal "-minimal"; + version = "2.14.0"; src = fetchFromGitHub { owner = "intel"; repo = "libva"; rev = version; - sha256 = "0vsvli3xc0gqqp06p7wkm973lhr7c5qgnyz5jfjmf8kv75rajazp"; + sha256 = "0q395lg6gp05mwf04zbrwgj6q9073lahh3wrcfa2i8ll60cfq9fg"; }; outputs = [ "dev" "out" ]; @@ -40,7 +40,7 @@ stdenv.mkDerivation rec { homepage = "https://01.org/linuxmedia/vaapi"; changelog = "https://raw.githubusercontent.com/intel/libva/${version}/NEWS"; license = licenses.mit; - maintainers = with maintainers; [ primeos ]; + maintainers = with maintainers; [ SuperSandro2000 ]; platforms = platforms.unix; }; } diff --git a/pkgs/development/libraries/libva/utils.nix b/pkgs/development/libraries/libva/utils.nix index 05ba3519ff4..357d2052795 100644 --- a/pkgs/development/libraries/libva/utils.nix +++ b/pkgs/development/libraries/libva/utils.nix @@ -4,13 +4,13 @@ stdenv.mkDerivation rec { pname = "libva-utils"; - version = "2.13.0"; + version = "2.14.0"; src = fetchFromGitHub { owner = "intel"; repo = "libva-utils"; rev = version; - sha256 = "0ahbwikdb0chf76whm62zz0a7zqil3gzsxmq38ccbqlmnnyjkbbb"; + sha256 = "sha256-WuNJCFBbXbLSftL+L15ruq9PxM1XhIfYpP/IccB+aBs="; }; nativeBuildInputs = [ meson ninja pkg-config ]; @@ -26,7 +26,7 @@ stdenv.mkDerivation rec { homepage = "https://github.com/intel/libva-utils"; changelog = "https://raw.githubusercontent.com/intel/libva-utils/${version}/NEWS"; license = licenses.mit; - maintainers = with maintainers; [ primeos ]; + maintainers = with maintainers; [ SuperSandro2000 ]; platforms = platforms.unix; }; } diff --git a/pkgs/development/libraries/libwacom/default.nix b/pkgs/development/libraries/libwacom/default.nix index 1517cf97078..7ccc0d2a199 100644 --- a/pkgs/development/libraries/libwacom/default.nix +++ b/pkgs/development/libraries/libwacom/default.nix @@ -12,7 +12,7 @@ stdenv.mkDerivation rec { pname = "libwacom"; - version = "2.0.0"; + version = "2.1.0"; outputs = [ "out" "dev" ]; @@ -20,7 +20,7 @@ stdenv.mkDerivation rec { owner = "linuxwacom"; repo = "libwacom"; rev = "libwacom-${version}"; - sha256 = "sha256-k8pEgEu+oWNa0rI47osVPKaZGxgwX/ENaz9jPrQXy0E="; + sha256 = "sha256-yqOhlbOgDIAsxgQWoLKj7WpwJXvxeuW8yCvuKTtE7h0="; }; nativeBuildInputs = [ diff --git a/pkgs/development/libraries/mesa/default.nix b/pkgs/development/libraries/mesa/default.nix index 23163763ed9..a48f4b42e45 100644 --- a/pkgs/development/libraries/mesa/default.nix +++ b/pkgs/development/libraries/mesa/default.nix @@ -15,6 +15,7 @@ , enableOSMesa ? stdenv.isLinux , enableOpenCL ? stdenv.isLinux && stdenv.isx86_64 , libclc +, jdupes }: /** Packaging design: @@ -33,7 +34,7 @@ with lib; let # Release calendar: https://www.mesa3d.org/release-calendar.html # Release frequency: https://www.mesa3d.org/releasing.html#schedule - version = "21.3.7"; + version = "21.3.8"; branch = versions.major version; self = stdenv.mkDerivation { @@ -47,7 +48,7 @@ self = stdenv.mkDerivation { "ftp://ftp.freedesktop.org/pub/mesa/${version}/mesa-${version}.tar.xz" "ftp://ftp.freedesktop.org/pub/mesa/older-versions/${branch}.x/${version}/mesa-${version}.tar.xz" ]; - sha256 = "0ggw3s514z6szasbiy4dv5mdi689121yy2xly2g21gv1mavrvyml"; + sha256 = "19wx5plk6z0hhi0zdzxjx8ynl3lhlc5mbd8vhwqyk92kvhxjf3g7"; }; # TODO: @@ -228,6 +229,9 @@ self = stdenv.mkDerivation { fi done + # NAR doesn't support hard links, so convert them to symlinks to save space. + ${jdupes}/bin/jdupes --hard-links --link-soft --recurse "$drivers" + # add RPATH so the drivers can find the moved libgallium and libdricore9 # moved here to avoid problems with stripping patchelfed files for lib in $drivers/lib/*.so* $drivers/lib/*/*.so*; do diff --git a/pkgs/development/libraries/mustache-hpp/default.nix b/pkgs/development/libraries/mustache-hpp/default.nix index 373f232a986..ce6dd1d21a9 100644 --- a/pkgs/development/libraries/mustache-hpp/default.nix +++ b/pkgs/development/libraries/mustache-hpp/default.nix @@ -1,4 +1,4 @@ -{ lib, stdenv, fetchFromGitHub, cmake }: +{ lib, stdenv, fetchFromGitHub }: stdenv.mkDerivation rec { pname = "mustache"; @@ -11,11 +11,11 @@ stdenv.mkDerivation rec { sha256 = "0r9rbk6v1wpld2ismfsk2lkhbyv3dkf0p03hkjivbj05qkfhvlbb"; }; - nativeBuildInputs = [ cmake ]; + dontBuild = true; installPhase = '' mkdir -p $out/include - cp ../mustache.hpp $out/include + cp mustache.hpp $out/include ''; meta = with lib; { diff --git a/pkgs/development/libraries/nghttp2/default.nix b/pkgs/development/libraries/nghttp2/default.nix index bd639ec3041..01df15c0a83 100644 --- a/pkgs/development/libraries/nghttp2/default.nix +++ b/pkgs/development/libraries/nghttp2/default.nix @@ -1,90 +1,110 @@ -{ lib, stdenv, fetchurl, pkg-config +{ lib +, stdenv +, fetchurl +, installShellFiles +, pkg-config -# Optional Dependencies -, openssl ? null, zlib ? null -, enableLibEv ? !stdenv.hostPlatform.isWindows, libev ? null -, enableCAres ? !stdenv.hostPlatform.isWindows, c-ares ? null -, enableHpack ? false, jansson ? null +# Optional dependencies +, enableApp ? with stdenv.hostPlatform; !isWindows && !isStatic +, c-ares ? null, libev ? null, openssl ? null, zlib ? null , enableAsioLib ? false, boost ? null , enableGetAssets ? false, libxml2 ? null +, enableHpack ? false, jansson ? null , enableJemalloc ? false, jemalloc ? null -, enableApp ? with stdenv.hostPlatform; !isWindows && !isStatic , enablePython ? false, python ? null, cython ? null, ncurses ? null, setuptools ? null +# Unit tests ; we have to set TZDIR, which is a GNUism. +, enableTests ? stdenv.hostPlatform.isGnu, cunit ? null, tzdata ? null + # downstream dependencies, for testing , curl , libsoup }: -# Note: this package is used for bootstrapping fetchurl, and thus -# cannot use fetchpatch! All mutable patches (generated by GitHub or -# cgit) that are needed here should be included directly in Nixpkgs as -# files. +# Note: this package is used for bootstrapping fetchurl, and thus cannot use fetchpatch! +# All mutable patches (generated by GitHub or cgit) that are needed here +# should be included directly in Nixpkgs as files. -assert enableHpack -> jansson != null; +assert enableApp -> c-ares != null && libev != null && openssl != null && zlib != null; assert enableAsioLib -> boost != null; -assert enableGetAssets -> libxml2 != null; -assert enableJemalloc -> jemalloc != null; +assert enableGetAssets -> enableApp == true && libxml2 != null; +assert enableHpack -> enableApp == true && jansson != null; +assert enableJemalloc -> enableApp == true && jemalloc != null; assert enablePython -> python != null && cython != null && ncurses != null && setuptools != null; - -let inherit (lib) optional optionals optionalString; in +assert enableTests -> cunit != null && tzdata != null; stdenv.mkDerivation rec { pname = "nghttp2"; - version = "1.43.0"; + version = "1.47.0"; src = fetchurl { url = "https://github.com/${pname}/${pname}/releases/download/v${version}/${pname}-${version}.tar.bz2"; - sha256 = "0qhgyphzdv72dgdfxin2xbk9623za3jwbcvhhaxixiwp6djj8vsm"; + sha256 = "11d6w8iqrhnxmjd9ss9fzf66f7a32d48h2ihyk1580lg8d3rkj07"; }; outputs = [ "bin" "out" "dev" "lib" ] - ++ optional enablePython "python"; - - nativeBuildInputs = [ pkg-config ]; - buildInputs = [ openssl ] - ++ optional enableLibEv libev - ++ [ zlib ] - ++ optional enableCAres c-ares - ++ optional enableHpack jansson - ++ optional enableAsioLib boost - ++ optional enableGetAssets libxml2 - ++ optional enableJemalloc jemalloc - ++ optionals enablePython [ python ncurses setuptools ]; + ++ lib.optionals (enablePython) [ "python" ]; + + nativeBuildInputs = [ pkg-config ] + ++ lib.optionals (enableApp) [ installShellFiles ] + ++ lib.optionals (enablePython) [ cython ]; + + buildInputs = lib.optionals enableApp [ c-ares libev openssl zlib ] + ++ lib.optionals (enableAsioLib) [ boost ] + ++ lib.optionals (enableGetAssets) [ libxml2 ] + ++ lib.optionals (enableHpack) [ jansson ] + ++ lib.optionals (enableJemalloc) [ jemalloc ] + ++ lib.optionals (enablePython) [ python ncurses setuptools ]; enableParallelBuilding = true; configureFlags = [ - "--with-spdylay=no" "--disable-examples" (lib.enableFeature enableApp "app") - ] ++ optional enableAsioLib "--enable-asio-lib --with-boost-libdir=${boost}/lib" - ++ (if enablePython then [ - "--with-cython=${cython}/bin/cython" - ] else [ - "--disable-python-bindings" - ]); - - preInstall = optionalString enablePython '' + ] ++ lib.optionals (enableAsioLib) [ "--enable-asio-lib" "--with-boost-libdir=${boost}/lib" ] + ++ lib.optionals (enablePython) [ "--with-cython=${cython}/bin/cython" ]; + + # Unit tests require CUnit and setting TZDIR environment variable + doCheck = enableTests; + checkInputs = lib.optionals (enableTests) [ cunit tzdata ]; + preCheck = lib.optionalString (enableTests) '' + export TZDIR=${tzdata}/share/zoneinfo + ''; + + preInstall = lib.optionalString (enablePython) '' mkdir -p $out/${python.sitePackages} # convince installer it's ok to install here export PYTHONPATH="$PYTHONPATH:$out/${python.sitePackages}" ''; - postInstall = optionalString enablePython '' + postInstall = lib.optionalString (enablePython) '' mkdir -p $python/${python.sitePackages} mv $out/${python.sitePackages}/* $python/${python.sitePackages} + rm -r $out/lib + '' + lib.optionalString (enableApp) '' + installShellCompletion --bash doc/bash_completion/{h2load,nghttp,nghttpd,nghttpx} ''; - #doCheck = true; # requires CUnit ; currently failing at test_util_localtime_date in util_test.cc - passthru.tests = { inherit curl libsoup; }; meta = with lib; { + description = "HTTP/2 C library and tools"; + longDescription = '' + nghttp2 is an implementation of the HyperText Transfer Protocol version 2 in C. + The framing layer of HTTP/2 is implemented as a reusable C library. On top of that, + we have implemented an HTTP/2 client, server and proxy. We have also developed + load test and benchmarking tools for HTTP/2. + An HPACK encoder and decoder are available as a public API. + We have Python bindings of this library, but we do not have full code coverage yet. + An experimental high level C++ library is also available. + ''; + homepage = "https://nghttp2.org/"; - description = "A C implementation of HTTP/2"; + changelog = "https://github.com/nghttp2/nghttp2/releases/tag/v${version}"; + # News articles with changes summary can be found here: https://nghttp2.org/blog/archives/ license = licenses.mit; + maintainers = with maintainers; [ c0bw3b ]; platforms = platforms.all; }; } diff --git a/pkgs/development/libraries/nlopt/default.nix b/pkgs/development/libraries/nlopt/default.nix index 279c8a0fd05..2fae17a2323 100644 --- a/pkgs/development/libraries/nlopt/default.nix +++ b/pkgs/development/libraries/nlopt/default.nix @@ -1,4 +1,4 @@ -{ lib, stdenv, fetchFromGitHub, cmake, octave ? null }: +{ lib, stdenv, fetchFromGitHub, cmake, octave ? null, libiconv }: stdenv.mkDerivation rec { pname = "nlopt"; @@ -11,7 +11,7 @@ stdenv.mkDerivation rec { sha256 = "sha256-TgieCX7yUdTAEblzXY/gCN0r6F9TVDh4RdNDjQdXZ1o="; }; - nativeBuildInputs = [ cmake ]; + nativeBuildInputs = [ cmake ] ++ lib.optionals stdenv.isDarwin [ libiconv ]; buildInputs = [ octave ]; configureFlags = [ diff --git a/pkgs/development/libraries/nss/default.nix b/pkgs/development/libraries/nss/default.nix index d17f4c4a783..454c09e1b02 100644 --- a/pkgs/development/libraries/nss/default.nix +++ b/pkgs/development/libraries/nss/default.nix @@ -27,7 +27,8 @@ let # It will rebuild itself using the version of this package (NSS) and if # an update is required do the required changes to the expression. # Example: nix-shell ./maintainers/scripts/update.nix --argstr package cacert - version = "3.75"; + version = "3.76"; + underscoreVersion = lib.replaceStrings [ "." ] [ "_" ] version; in stdenv.mkDerivation rec { @@ -35,8 +36,8 @@ stdenv.mkDerivation rec { inherit version; src = fetchurl { - url = "mirror://mozilla/security/nss/releases/NSS_${lib.replaceStrings [ "." ] [ "_" ] version}_RTM/src/${pname}-${version}.tar.gz"; - sha256 = "10l5qn68gly2l4ifv0v6by1qc8nsmhra08nm9m7n913jh83iamzx"; + url = "mirror://mozilla/security/nss/releases/NSS_${underscoreVersion}_RTM/src/${pname}-${version}.tar.gz"; + sha256 = "0c0nmajcvnm8gqz2v6wrlq04yzy3y7hcs806wjnx4r6kml8073hv"; }; depsBuildBuild = [ buildPackages.stdenv.cc ]; @@ -190,6 +191,7 @@ stdenv.mkDerivation rec { meta = with lib; { homepage = "https://developer.mozilla.org/en-US/docs/Mozilla/Projects/NSS"; description = "A set of libraries for development of security-enabled client and server applications"; + changelog = "https://github.com/nss-dev/nss/blob/master/doc/rst/releases/nss_${underscoreVersion}.rst"; maintainers = with maintainers; [ ]; license = licenses.mpl20; platforms = platforms.all; diff --git a/pkgs/development/libraries/polkit/default.nix b/pkgs/development/libraries/polkit/default.nix index 72907f7aedc..9c49f89c2ca 100644 --- a/pkgs/development/libraries/polkit/default.nix +++ b/pkgs/development/libraries/polkit/default.nix @@ -71,6 +71,12 @@ stdenv.mkDerivation rec { url = "https://src.fedoraproject.org/rpms/polkit/raw/0a203bd46a1e2ec8cc4b3626840e2ea9d0d13a9a/f/CVE-2021-4115.patch"; sha256 = "sha256-BivHVVpYB4Ies1YbBDyKwUmNlqq2D1MpMipH9/dZM54="; }) + # Fix build with meson 0.61 + # https://gitlab.freedesktop.org/polkit/polkit/-/merge_requests/99 + (fetchpatch { + url = "https://gitlab.freedesktop.org/polkit/polkit/-/commit/a96c5119f726225f8d79b222c85d71a9f0e32419.patch"; + sha256 = "sha256-/hm/m22dKA50sDmw4L1VAlgvCm8CuIyNjHxF/2YgMKo="; + }) ] ++ lib.optionals stdenv.hostPlatform.isMusl [ # Make netgroup support optional (musl does not have it) # Upstream MR: https://gitlab.freedesktop.org/polkit/polkit/merge_requests/10 diff --git a/pkgs/development/libraries/qt-5/5.12/default.nix b/pkgs/development/libraries/qt-5/5.12/default.nix index d8954726188..a3664ae9e05 100644 --- a/pkgs/development/libraries/qt-5/5.12/default.nix +++ b/pkgs/development/libraries/qt-5/5.12/default.nix @@ -84,7 +84,21 @@ let qtlocation = [ ./qtlocation-gcc-9.patch ]; qtscript = [ ./qtscript.patch ]; qtserialport = [ ./qtserialport.patch ]; + qtwayland = [ + # NixOS-specific, ensure that app_id is correctly determined for + # wrapped executables from `wrapQtAppsHook` (see comment in patch for further + # context). Beware: shared among different Qt5 versions. + ../modules/qtwayland-app_id.patch + ]; qtwebengine = [ + # glibc 2.34 compat + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/qt5-qtwebengine/raw/d122c011631137b79455850c363676c655cf9e09/f/qtwebengine-everywhere-src-5.15.5-SIGSTKSZ.patch"; + sha256 = "sha256-CJxN6sTvWdPVEwSkr0zpPrjyhUIi6tYSWb8ZyO0sY2o="; + excludes = [ + "src/3rdparty/chromium/third_party/abseil-cpp/absl/debugging/failure_signal_handler.cc" + ]; + }) ./qtwebengine-no-build-skip.patch # https://gitlab.freedesktop.org/pulseaudio/pulseaudio/issues/707 # https://bugreports.qt.io/browse/QTBUG-77037 diff --git a/pkgs/development/libraries/qt-5/5.14/default.nix b/pkgs/development/libraries/qt-5/5.14/default.nix index 65ce74dac02..15c85961adc 100644 --- a/pkgs/development/libraries/qt-5/5.14/default.nix +++ b/pkgs/development/libraries/qt-5/5.14/default.nix @@ -96,6 +96,12 @@ let stripLen = 1; extraPrefix = "src/3rdparty/"; }) + + # glibc 2.34 compat + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/qt5-qtwebengine/raw/4cef673b2dd01ce85ce7a841cf352104bbe79668/f/qtwebengine-everywhere-5.15.2-SIGSTKSZ.patch"; + sha256 = "sha256-2D0/FL4PBL4p6ccd6JoDAGqNtLs2aeE1OdM+PJItock="; + }) ] ++ lib.optional stdenv.isDarwin ./qtwebengine-darwin-no-platform-check.patch; qtwebkit = [ (fetchpatch { @@ -120,7 +126,13 @@ let ./qtwebkit-darwin-no-qos-classes.patch ]; qttools = [ ./qttools.patch ]; - qtwayland = [ ./qtwayland-libdrm-build.patch ]; + qtwayland = [ + ./qtwayland-libdrm-build.patch + # NixOS-specific, ensure that app_id is correctly determined for + # wrapped executables from `wrapQtAppsHook` (see comment in patch for further + # context). Beware: shared among different Qt5 versions. + ../modules/qtwayland-app_id.patch + ]; }; addPackages = self: with self; diff --git a/pkgs/development/libraries/qt-5/5.15/default.nix b/pkgs/development/libraries/qt-5/5.15/default.nix index 5943a80a701..946c196f4a2 100644 --- a/pkgs/development/libraries/qt-5/5.15/default.nix +++ b/pkgs/development/libraries/qt-5/5.15/default.nix @@ -60,6 +60,12 @@ let ./qtwebengine-darwin-no-platform-check.patch ./qtwebengine-mac-dont-set-dsymutil-path.patch ]; + qtwayland = [ + # NixOS-specific, ensure that app_id is correctly determined for + # wrapped executables from `wrapQtAppsHook` (see comment in patch for further + # context). Beware: shared among different Qt5 versions. + ../modules/qtwayland-app_id.patch + ]; qtwebkit = [ (fetchpatch { name = "qtwebkit-bison-3.7-build.patch"; diff --git a/pkgs/development/libraries/qt-5/modules/qtwayland-app_id.patch b/pkgs/development/libraries/qt-5/modules/qtwayland-app_id.patch new file mode 100644 index 00000000000..24d081aa602 --- /dev/null +++ b/pkgs/development/libraries/qt-5/modules/qtwayland-app_id.patch @@ -0,0 +1,36 @@ +Ensure that the correct `app_id` for Wayland is set. The upstream implementation +uses `QFileInfo::baseName()`[1] which strips everything away after the first dot. +This means that `.foo-wrapped` has an empty `app_id` because `baseName` returns +an empty string in this case. + +The patch basically checks whether the program has the form `.foo-wrapped` (i.e. got +wrapped by `makeWrapper`) and if that's the case, `foo` will be the correct `app_id`. + +[1] https://doc.qt.io/qt-5/qfileinfo.html#baseName + +diff --git a/src/client/qwaylandwindow.cpp b/src/client/qwaylandwindow.cpp +index ba881cb..b3fd031 100644 +--- a/src/client/qwaylandwindow.cpp ++++ b/src/client/qwaylandwindow.cpp +@@ -167,7 +167,20 @@ void QWaylandWindow::initWindow() + Qt::SkipEmptyParts); + + if (domainName.isEmpty()) { +- mShellSurface->setAppId(fi.baseName()); ++ auto baseName = fi.baseName(); ++ if (baseName.isEmpty()) { ++ auto fileName = fi.fileName(); ++ if (fileName.endsWith("-wrapped") && fileName.startsWith(".")) { ++ do { ++ auto len = fileName.length(); ++ fileName = fileName.right(len - 1); ++ fileName = fileName.left(len - 9); ++ } while (fileName.endsWith("-wrapped") && fileName.startsWith(".")); ++ mShellSurface->setAppId(fileName); ++ } ++ } else { ++ mShellSurface->setAppId(baseName); ++ } + } else { + QString appId; + for (int i = 0; i < domainName.count(); ++i) diff --git a/pkgs/development/libraries/recastnavigation/default.nix b/pkgs/development/libraries/recastnavigation/default.nix index d39d1a71321..6fd2056d2ea 100644 --- a/pkgs/development/libraries/recastnavigation/default.nix +++ b/pkgs/development/libraries/recastnavigation/default.nix @@ -1,4 +1,4 @@ -{ stdenv, lib, fetchFromGitHub, cmake, libGL, SDL2, libGLU }: +{ stdenv, lib, fetchFromGitHub, cmake, libGL, SDL2, libGLU, catch }: stdenv.mkDerivation rec { pname = "recastai"; @@ -13,6 +13,12 @@ stdenv.mkDerivation rec { sha256 = "sha256-QP3lMMFR6fiKQTksAkRL6X9yaoVz2xt4QSIP9g6piww="; }; + postPatch = '' + cp ${catch}/include/catch/catch.hpp Tests/catch.hpp + ''; + + doCheck = true; + nativeBuildInputs = [ cmake ]; buildInputs = [ libGL SDL2 libGLU ]; diff --git a/pkgs/development/libraries/seasocks/default.nix b/pkgs/development/libraries/seasocks/default.nix index fd53db0dcf9..044948a012e 100644 --- a/pkgs/development/libraries/seasocks/default.nix +++ b/pkgs/development/libraries/seasocks/default.nix @@ -1,4 +1,4 @@ -{ lib, stdenv, fetchFromGitHub, cmake, python3, zlib }: +{ lib, stdenv, fetchFromGitHub, cmake, python3, zlib, catch2 }: stdenv.mkDerivation rec { pname = "seasocks"; @@ -11,9 +11,15 @@ stdenv.mkDerivation rec { sha256 = "1f9a3mx3yjmr5qry4rc1c7mrx3348iifxm7d8sj8yd41kqnzmfv4"; }; + postPatch = '' + cp ${catch2}/include/catch2/catch.hpp src/test/c/catch/catch2/catch.hpp + ''; + nativeBuildInputs = [ cmake ]; buildInputs = [ zlib python3 ]; + doCheck = true; + meta = with lib; { homepage = "https://github.com/mattgodbolt/seasocks"; description = "Tiny embeddable C++ HTTP and WebSocket server"; diff --git a/pkgs/development/libraries/soci/default.nix b/pkgs/development/libraries/soci/default.nix index b17fbe16655..142081da015 100644 --- a/pkgs/development/libraries/soci/default.nix +++ b/pkgs/development/libraries/soci/default.nix @@ -27,7 +27,7 @@ stdenv.mkDerivation rec { ]; # Do not build static libraries - cmakeFlags = [ "-DSOCI_STATIC=OFF" "-DCMAKE_CXX_STANDARD=11" ]; + cmakeFlags = [ "-DSOCI_STATIC=OFF" "-DCMAKE_CXX_STANDARD=11" "-DSOCI_TESTS=off" ]; nativeBuildInputs = [ cmake ]; buildInputs = [ diff --git a/pkgs/development/libraries/spdlog/default.nix b/pkgs/development/libraries/spdlog/default.nix index d4e0888ffd2..6ef4f4af43a 100644 --- a/pkgs/development/libraries/spdlog/default.nix +++ b/pkgs/development/libraries/spdlog/default.nix @@ -1,7 +1,7 @@ -{ lib, stdenv, fetchFromGitHub, cmake, fmt_8 }: +{ lib, stdenv, fetchFromGitHub, cmake, fmt_8, fetchpatch }: let - generic = { version, sha256 }: + generic = { version, sha256, patches ? [] }: stdenv.mkDerivation { pname = "spdlog"; inherit version; @@ -13,6 +13,8 @@ let inherit sha256; }; + inherit patches; + nativeBuildInputs = [ cmake ]; # spdlog <1.3 uses a bundled version of fmt propagatedBuildInputs = lib.optional (lib.versionAtLeast version "1.3") fmt_8; @@ -51,6 +53,13 @@ in spdlog_1 = generic { version = "1.9.2"; sha256 = "sha256-GSUdHtvV/97RyDKy8i+ticnSlQCubGGWHg4Oo+YAr8Y="; + patches = [ + # glibc 2.34 compat + (fetchpatch { + url = "https://github.com/gabime/spdlog/commit/d54b8e89c058f3cab2b32b3e9a2b49fd171d5895.patch"; + sha256 = "sha256-pb7cREF90GXb5Mbs8xFLQ+eLo6Xum13/xYa8JUgJlbI="; + }) + ]; }; spdlog_0 = generic { diff --git a/pkgs/development/libraries/sqlite/default.nix b/pkgs/development/libraries/sqlite/default.nix index 5fdf6c11d77..6cb2eb4b2d1 100644 --- a/pkgs/development/libraries/sqlite/default.nix +++ b/pkgs/development/libraries/sqlite/default.nix @@ -1,6 +1,7 @@ { lib, stdenv, fetchurl, zlib, interactive ? false, readline, ncurses , python3Packages , enableDeserialize ? false +, sqldiff, sqlite-analyzer }: with lib; @@ -11,13 +12,13 @@ in stdenv.mkDerivation rec { pname = "sqlite${optionalString interactive "-interactive"}"; - version = "3.37.2"; + version = "3.38.1"; # nixpkgs-update: no auto update # NB! Make sure to update ./tools.nix src (in the same directory). src = fetchurl { url = "https://sqlite.org/2022/sqlite-autoconf-${archiveVersion version}.tar.gz"; - sha256 = "sha256-QImo2bRnU3s/JG8he4TNduALHRqXH+WsoeMOIw5Gstg="; + sha256 = "sha256-jjqM65eU2Wg5lZDS3fnVwESpfdg9OLlhM2SiReyKL8Q="; }; outputs = [ "bin" "dev" "out" ]; @@ -85,6 +86,7 @@ stdenv.mkDerivation rec { passthru.tests = { inherit (python3Packages) sqlalchemy; + inherit sqldiff sqlite-analyzer; }; meta = { diff --git a/pkgs/development/libraries/sqlite/tools.nix b/pkgs/development/libraries/sqlite/tools.nix index d8d3735fe3d..6b07c762881 100644 --- a/pkgs/development/libraries/sqlite/tools.nix +++ b/pkgs/development/libraries/sqlite/tools.nix @@ -4,12 +4,12 @@ let archiveVersion = import ./archive-version.nix lib; mkTool = { pname, makeTarget, description, homepage }: stdenv.mkDerivation rec { inherit pname; - version = "3.37.2"; + version = "3.38.1"; # nixpkgs-update: no auto update src = assert version == sqlite.version; fetchurl { url = "https://sqlite.org/2022/sqlite-src-${archiveVersion version}.zip"; - sha256 = "sha256-SGdwtNX4i1uw26VA3W7hdjBn11Od/uGKfGb+m7A9Ftk="; + sha256 = "sha256-F3rv2oF/qfUoJeF0hYf3wnqbXmtTpIHNQ0YfJ0bZMdg="; }; nativeBuildInputs = [ unzip ]; diff --git a/pkgs/development/libraries/symengine/default.nix b/pkgs/development/libraries/symengine/default.nix index cbe5e13a700..5cb2e211786 100644 --- a/pkgs/development/libraries/symengine/default.nix +++ b/pkgs/development/libraries/symengine/default.nix @@ -5,6 +5,7 @@ , flint , mpfr , libmpc +, catch }: stdenv.mkDerivation rec { @@ -18,6 +19,10 @@ stdenv.mkDerivation rec { sha256 = "sha256-5KpxBusJCuwrfFWHbrRKlH6Ic7YivYqz2m+BCbNfZp0="; }; + postPatch = '' + cp ${catch}/include/catch/catch.hpp symengine/utilities/catch/catch.hpp + ''; + nativeBuildInputs = [ cmake ]; buildInputs = [ gmp flint mpfr libmpc ]; diff --git a/pkgs/development/libraries/wxwidgets/wxGTK28.nix b/pkgs/development/libraries/wxwidgets/wxGTK28.nix index 19a57d68e15..b577e524820 100644 --- a/pkgs/development/libraries/wxwidgets/wxGTK28.nix +++ b/pkgs/development/libraries/wxwidgets/wxGTK28.nix @@ -17,8 +17,6 @@ , withMesa ? lib.elem stdenv.hostPlatform.system lib.platforms.mesaPlatforms }: -assert withMesa -> libGLU != null && libGL != null; - stdenv.mkDerivation rec { pname = "wxGTK"; version = "2.8.12.1"; diff --git a/pkgs/development/libraries/wxwidgets/wxGTK29.nix b/pkgs/development/libraries/wxwidgets/wxGTK29.nix index d5bef77202f..097cce6109c 100644 --- a/pkgs/development/libraries/wxwidgets/wxGTK29.nix +++ b/pkgs/development/libraries/wxwidgets/wxGTK29.nix @@ -22,7 +22,6 @@ , setfile }: -assert withMesa -> libGLU != null && libGL != null; stdenv.mkDerivation rec { pname = "wxGTK"; version = "2.9.5"; diff --git a/pkgs/development/libraries/wxwidgets/wxGTK30.nix b/pkgs/development/libraries/wxwidgets/wxGTK30.nix index 11545330387..6157786a5d0 100644 --- a/pkgs/development/libraries/wxwidgets/wxGTK30.nix +++ b/pkgs/development/libraries/wxwidgets/wxGTK30.nix @@ -28,7 +28,6 @@ assert withGtk2 -> (!withWebKit); let - inherit (gst_all_1) gstreamer gst-plugins-base; gtk = if withGtk2 then gtk2 else gtk3; in stdenv.mkDerivation rec { @@ -47,8 +46,8 @@ stdenv.mkDerivation rec { ]; buildInputs = [ - gstreamer - gst-plugins-base + gst_all_1.gstreamer + gst_all_1.gst-plugins-base gtk libSM libXinerama diff --git a/pkgs/development/libraries/wxwidgets/wxGTK31.nix b/pkgs/development/libraries/wxwidgets/wxGTK31.nix index 31d59e24fd8..5bce6250c74 100644 --- a/pkgs/development/libraries/wxwidgets/wxGTK31.nix +++ b/pkgs/development/libraries/wxwidgets/wxGTK31.nix @@ -35,8 +35,6 @@ assert withGtk2 -> (!withWebKit); let - inherit (gnome2) GConf; - inherit (gst_all_1) gst-plugins-base gstreamer; gtk = if withGtk2 then gtk2 else gtk3; in stdenv.mkDerivation rec { @@ -59,8 +57,8 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ pkg-config ]; buildInputs = [ - gst-plugins-base - gstreamer + gst_all_1.gst-plugins-base + gst_all_1.gstreamer ] ++ lib.optionals (!stdenv.isDarwin) [ gtk @@ -71,7 +69,7 @@ stdenv.mkDerivation rec { xorgproto ] ++ lib.optionals withGtk2 [ - GConf + gnome2.GConf ] ++ lib.optional withMesa libGLU ++ lib.optional (withWebKit && !stdenv.isDarwin) webkitgtk diff --git a/pkgs/development/libraries/wxwidgets/wxmac30.nix b/pkgs/development/libraries/wxwidgets/wxmac30.nix index e1f732929ce..73bf013452a 100644 --- a/pkgs/development/libraries/wxwidgets/wxmac30.nix +++ b/pkgs/development/libraries/wxwidgets/wxmac30.nix @@ -7,13 +7,15 @@ , libpng , libtiff , zlib -, darwin +, AGL +, Cocoa +, Kernel +, WebKit +, derez +, rez +, setfile }: -let - inherit (darwin.apple_sdk.frameworks) AGL Cocoa Kernel WebKit; - inherit (darwin.stubs) derez rez setfile; -in stdenv.mkDerivation rec { pname = "wxmac"; version = "3.0.5.1"; diff --git a/pkgs/development/libraries/zeroc-ice/3.6.nix b/pkgs/development/libraries/zeroc-ice/3.6.nix deleted file mode 100644 index e8082e50447..00000000000 --- a/pkgs/development/libraries/zeroc-ice/3.6.nix +++ /dev/null @@ -1,59 +0,0 @@ -{ stdenv, lib, fetchFromGitHub -, mcpp, bzip2, expat, openssl, db5 -, darwin, libiconv, Security -, zeroc-ice # to share meta -, cpp11 ? false -}: - -stdenv.mkDerivation rec { - pname = "zeroc-ice"; - version = "3.6.5"; - - src = fetchFromGitHub { - owner = "zeroc-ice"; - repo = "ice"; - rev = "v${version}"; - sha256 = "073h7v1f2sw77cr1a6xxa5l9j547pz24sxa9qdjc4zki0ivcnq15"; - }; - - buildInputs = [ mcpp bzip2 expat openssl db5 ] - ++ lib.optionals stdenv.isDarwin [ darwin.cctools libiconv Security ]; - - postUnpack = '' - sourceRoot=$sourceRoot/cpp - ''; - - prePatch = lib.optionalString stdenv.isDarwin '' - substituteInPlace config/Make.rules.Darwin \ - --replace xcrun "" - ''; - - patches = [ - # Fixes compilation warning about uninitialied variables (in test code) - ./uninitialized-variable-warning.patch - ]; - - preBuild = '' - makeFlagsArray+=( - "prefix=$out" - "OPTIMIZE=yes" - "USR_DIR_INSTALL=yes" - "CONFIGS=${if cpp11 then "cpp11-shared" else "shared"}" - "SKIP=slice2py" # provided by a separate package - ) - ''; - - # cannot find -lIceXML (linking bin/transformdb) - enableParallelBuilding = false; - - outputs = [ "out" "bin" "dev" ]; - - postInstall = '' - mkdir -p $bin $dev/share - mv $out/bin $bin - mv $out/share/Ice-* $dev/share/ice - rm -rf $out/share/slice - ''; - - inherit (zeroc-ice) meta; -} diff --git a/pkgs/development/libraries/zeroc-ice/default.nix b/pkgs/development/libraries/zeroc-ice/default.nix index fcd83634855..9a1861f6044 100644 --- a/pkgs/development/libraries/zeroc-ice/default.nix +++ b/pkgs/development/libraries/zeroc-ice/default.nix @@ -3,6 +3,7 @@ , darwin, libiconv, Security , python3 # for tests only , cpp11 ? false +, fetchpatch }: let @@ -32,6 +33,18 @@ in stdenv.mkDerivation rec { sha256 = "0zc8gmlzl2f38m1fj6pv2vm8ka7fkszd6hx2lb8gfv65vn3m4sk4"; }; + patches = [ + # Fixes for openssl 3.0 / glibc-2.34. + (fetchpatch { + url = "https://github.com/zeroc-ice/ice/commit/7204b31a082a10cd481c1f31dbb6184ec699160d.patch"; + sha256 = "sha256-RN8kQrvWRu1oXB7UV7DkYbZ8A0VyJYGArx6ikovwefo="; + }) + (fetchpatch { + url = "https://github.com/zeroc-ice/ice/commit/358e7fea00383d55d1c19d38a3bbb64aca803aeb.patch"; + sha256 = "sha256-ntrTO6qHB7dw398BRdAyJQUfVYW3iEfzUaBYoWWOEDs="; + }) + ]; + buildInputs = [ zeroc_mcpp bzip2 expat libedit lmdb openssl ] ++ lib.optionals stdenv.isDarwin [ darwin.cctools libiconv Security ]; diff --git a/pkgs/development/libraries/zeroc-ice/uninitialized-variable-warning.patch b/pkgs/development/libraries/zeroc-ice/uninitialized-variable-warning.patch deleted file mode 100644 index 878dee26bb8..00000000000 --- a/pkgs/development/libraries/zeroc-ice/uninitialized-variable-warning.patch +++ /dev/null @@ -1,20 +0,0 @@ -diff --git a/test/Glacier2/dynamicFiltering/TestControllerI.h b/test/Glacier2/dynamicFiltering/TestControllerI.h -index 7e21639..1279200 100644 ---- a/test/Glacier2/dynamicFiltering/TestControllerI.h -+++ b/test/Glacier2/dynamicFiltering/TestControllerI.h -@@ -21,13 +21,12 @@ struct SessionTuple - { - Glacier2::SessionPrx session; - Glacier2::SessionControlPrx sessionControl; -- bool configured; -+ bool configured = false; - - SessionTuple() {} - SessionTuple(Glacier2::SessionPrx s, Glacier2::SessionControlPrx control): - session(s), -- sessionControl(control), -- configured(false) -+ sessionControl(control) - {} - - SessionTuple& diff --git a/pkgs/development/libraries/zlib/default.nix b/pkgs/development/libraries/zlib/default.nix index 48603000c90..91cd037e0e3 100644 --- a/pkgs/development/libraries/zlib/default.nix +++ b/pkgs/development/libraries/zlib/default.nix @@ -23,18 +23,16 @@ assert splitStaticOutput -> static; stdenv.mkDerivation (rec { pname = "zlib"; - version = "1.2.11"; + version = "1.2.12"; src = fetchurl { urls = [ "https://www.zlib.net/fossils/zlib-${version}.tar.gz" # stable archive path "mirror://sourceforge/libpng/zlib/${version}/zlib-${version}.tar.gz" ]; - sha256 = "c3e5e9fdd5004dcb542feda5ee4f0ff0744628baf8ed2dd5d66f8ca1197cb1a1"; + sha256 = "91844808532e5ce316b3c010929493c0244f3d37593afd6de04f71821d5136d9"; }; - patches = lib.optional stdenv.hostPlatform.isCygwin ./disable-cygwin-widechar.patch; - postPatch = lib.optionalString stdenv.hostPlatform.isDarwin '' substituteInPlace configure \ --replace '/usr/bin/libtool' '${stdenv.cc.targetPrefix}ar' \ diff --git a/pkgs/development/libraries/zlib/disable-cygwin-widechar.patch b/pkgs/development/libraries/zlib/disable-cygwin-widechar.patch deleted file mode 100644 index 3de4978c306..00000000000 --- a/pkgs/development/libraries/zlib/disable-cygwin-widechar.patch +++ /dev/null @@ -1,13 +0,0 @@ -diff --git a/gzguts.h b/gzguts.h -index 990a4d2..6378d46 100644 ---- a/gzguts.h -+++ b/gzguts.h -@@ -39,7 +39,7 @@ - # include <io.h> - #endif - --#if defined(_WIN32) || defined(__CYGWIN__) -+#if defined(_WIN32) - # define WIDECHAR - #endif - diff --git a/pkgs/development/misc/breakpad/default.nix b/pkgs/development/misc/breakpad/default.nix index 7fb2b329667..045e2e8f9a6 100644 --- a/pkgs/development/misc/breakpad/default.nix +++ b/pkgs/development/misc/breakpad/default.nix @@ -20,6 +20,11 @@ in stdenv.mkDerivation { ln -s ${lss} $sourceRoot/src/third_party/lss ''; + postPatch = '' + substituteInPlace src/client/linux/handler/exception_handler.cc \ + --replace "max(16384" "max(static_cast<long>(16384)" + ''; + meta = with lib; { description = "An open-source multi-platform crash reporting system"; homepage = "https://chromium.googlesource.com/breakpad"; diff --git a/pkgs/development/node-packages/default.nix b/pkgs/development/node-packages/default.nix index 07ed3d19e4e..9ecb7c5f3ef 100644 --- a/pkgs/development/node-packages/default.nix +++ b/pkgs/development/node-packages/default.nix @@ -352,6 +352,9 @@ let meta.mainProgram = "postcss"; }; + # To update prisma, please first update prisma-engines to the latest + # version. Then change the correct hash to this package. The PR should hold + # two commits: one for the engines and the other one for the node package. prisma = super.prisma.override rec { nativeBuildInputs = [ pkgs.makeWrapper ]; @@ -359,7 +362,7 @@ let src = fetchurl { url = "https://registry.npmjs.org/prisma/-/prisma-${version}.tgz"; - sha512 = "sha512-8SdsLPhKR3mOfoo2o73h9mNn3v5kA/RqGA26Sv6qDS78Eh2uepPqt5e8/nwj5EOblYm5HEGuitaXQrOCLb6uTw=="; + sha512 = "sha512-ltCMZAx1i0i9xuPM692Srj8McC665h6E5RqJom999sjtVSccHSD8Z+HSdBN2183h9PJKvC5dapkn78dd0NWMBg=="; }; postInstall = with pkgs; '' wrapProgram "$out/bin/prisma" \ diff --git a/pkgs/development/ocaml-modules/eliom/default.nix b/pkgs/development/ocaml-modules/eliom/default.nix index e3af173edc9..f3c587428a4 100644 --- a/pkgs/development/ocaml-modules/eliom/default.nix +++ b/pkgs/development/ocaml-modules/eliom/default.nix @@ -16,17 +16,18 @@ , js_of_ocaml-tyxml , lwt_ppx , ocamlnet +, ocsipersist }: stdenv.mkDerivation rec { pname = "eliom"; - version = "8.9.0"; + version = "9.4.0"; src = fetchFromGitHub { owner = "ocsigen"; repo = "eliom"; rev = version; - sha256 = "sha256-VNxzpVpXEGlixyjadbW0GjL83jcKV5TWd46UReNYO6w="; + sha256 = "sha256:1yn8mqxv9yz51x81j8wv1jn7l7crm8azp1m2g4zn5nz2s4nmfv6q"; }; nativeBuildInputs = [ @@ -49,12 +50,17 @@ stdenv.mkDerivation rec { lwt_ppx lwt_react ocsigen_server + ocsipersist ppx_deriving ]; strictDeps = true; - installPhase = "opaline -prefix $out -libdir $OCAMLFIND_DESTDIR"; + installPhase = '' + runHook preInstall + opaline -prefix $out -libdir $OCAMLFIND_DESTDIR + runHook postInstall + ''; setupHook = [ ./setup-hook.sh ]; diff --git a/pkgs/development/ocaml-modules/ocsigen-server/default.nix b/pkgs/development/ocaml-modules/ocsigen-server/default.nix index 67ec458a122..daa64b7e301 100644 --- a/pkgs/development/ocaml-modules/ocsigen-server/default.nix +++ b/pkgs/development/ocaml-modules/ocsigen-server/default.nix @@ -2,7 +2,7 @@ , bigstringaf, lwt, cstruct, mirage-crypto, zarith, mirage-crypto-ec, ptime, mirage-crypto-rng, mtime, ca-certs , cohttp, cohttp-lwt-unix, hmap , lwt_log, ocaml_pcre, cryptokit, xml-light, ipaddr -, pgocaml, camlzip, ocaml_sqlite3 +, camlzip , makeWrapper }: @@ -17,7 +17,7 @@ let caml_ld_library_path = ; in buildDunePackage rec { - version = "4.0.1"; + version = "5.0.1"; pname = "ocsigenserver"; useDune2 = true; @@ -27,11 +27,11 @@ buildDunePackage rec { owner = "ocsigen"; repo = "ocsigenserver"; rev = version; - sha256 = "0pid4irkmdmx1d6n2rvcvx5mnljl3hazzdqc3bql72by35izfac6"; + sha256 = "sha256:1vzza33hd41740dqrx4854rqpyd8wv7kwpsvvmlpck841i9lh8h5"; }; nativeBuildInputs = [ makeWrapper which ]; - buildInputs = [ lwt_react pgocaml camlzip ocaml_sqlite3 ]; + buildInputs = [ lwt_react camlzip ]; propagatedBuildInputs = [ cohttp cohttp-lwt-unix cryptokit hmap ipaddr lwt_log lwt_ssl ocaml_pcre xml-light diff --git a/pkgs/development/ocaml-modules/ocsigen-start/default.nix b/pkgs/development/ocaml-modules/ocsigen-start/default.nix index 118138dc8fd..4f439733740 100644 --- a/pkgs/development/ocaml-modules/ocsigen-start/default.nix +++ b/pkgs/development/ocaml-modules/ocsigen-start/default.nix @@ -6,7 +6,7 @@ stdenv.mkDerivation rec { pname = "ocaml${ocaml.version}-ocsigen-start"; - version = "4.3.0"; + version = "4.5.0"; nativeBuildInputs = [ ocaml findlib eliom ]; propagatedBuildInputs = [ pgocaml_ppx safepass ocsigen-toolkit yojson resource-pooling cohttp-lwt-unix ocamlnet ]; @@ -19,7 +19,7 @@ stdenv.mkDerivation rec { owner = "ocsigen"; repo = "ocsigen-start"; rev = version; - sha256 = "0lkl59dwzyqq2lyr46fyjr27ms0fp9h59xfsn37faaavdd7v0h98"; + sha256 = "sha256:1n94r8rbkzxbgcz5w135n6f2cwpc91bdvf7yslcdq4cn713rncmq"; }; preInstall = '' diff --git a/pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix b/pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix index 1b2dd72a2ec..12a92c5be39 100644 --- a/pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix +++ b/pkgs/development/ocaml-modules/ocsigen-toolkit/default.nix @@ -5,7 +5,7 @@ stdenv.mkDerivation rec { pname = "ocsigen-toolkit"; name = "ocaml${ocaml.version}-${pname}-${version}"; - version = "3.0.1"; + version = "3.1.1"; propagatedBuildInputs = [ calendar js_of_ocaml-ppx_deriving_json eliom ]; nativeBuildInputs = [ ocaml findlib opaline eliom ]; @@ -25,7 +25,7 @@ stdenv.mkDerivation rec { owner = "ocsigen"; repo = pname; rev = version; - sha256 = "1yx50ja2wcs5vfy4rk9szgwccpnihkjn14i4ywchx4yr4ppr00fm"; + sha256 = "sha256:1fm0vvccmjib9yj5m2760vhzb4z3392swlprp51az53g3vk4q218"; }; meta = { diff --git a/pkgs/development/ocaml-modules/ocsipersist/default.nix b/pkgs/development/ocaml-modules/ocsipersist/default.nix new file mode 100644 index 00000000000..8006477dad9 --- /dev/null +++ b/pkgs/development/ocaml-modules/ocsipersist/default.nix @@ -0,0 +1,20 @@ +{ buildDunePackage, ocsipersist-lib +, ocsipersist-pgsql +, ocsipersist-sqlite +}: + +buildDunePackage { + pname = "ocsipersist"; + inherit (ocsipersist-lib) src version useDune2; + + buildInputs = [ + ocsipersist-pgsql + ocsipersist-sqlite + ]; + + propagatedBuildInputs = [ ocsipersist-lib ]; + + meta = ocsipersist-lib.meta // { + description = "Persistent key/value storage (for Ocsigen) using multiple backends"; + }; +} diff --git a/pkgs/development/ocaml-modules/ocsipersist/lib.nix b/pkgs/development/ocaml-modules/ocsipersist/lib.nix new file mode 100644 index 00000000000..a2abc5d9b39 --- /dev/null +++ b/pkgs/development/ocaml-modules/ocsipersist/lib.nix @@ -0,0 +1,27 @@ +{ lib, buildDunePackage, fetchFromGitHub +, lwt_ppx, lwt +}: + +buildDunePackage rec { + pname = "ocsipersist-lib"; + version = "1.1.0"; + + useDune2 = true; + + src = fetchFromGitHub { + owner = "ocsigen"; + repo = "ocsipersist"; + rev = version; + sha256 = "sha256:1d6kdcfjvrz0dl764mnyxc477aa57rvmzkg154qc915w2y1nbz9a"; + }; + + buildInputs = [ lwt_ppx ]; + propagatedBuildInputs = [ lwt ]; + + meta = { + description = "Persistent key/value storage (for Ocsigen) - support library"; + license = lib.licenses.lgpl21Only; + maintainers = [ lib.maintainers.vbgl ]; + inherit (src.meta) homepage; + }; +} diff --git a/pkgs/development/ocaml-modules/ocsipersist/pgsql.nix b/pkgs/development/ocaml-modules/ocsipersist/pgsql.nix new file mode 100644 index 00000000000..e93c8b47903 --- /dev/null +++ b/pkgs/development/ocaml-modules/ocsipersist/pgsql.nix @@ -0,0 +1,24 @@ +{ buildDunePackage, ocsipersist-lib +, lwt_log +, ocsigen_server +, pgocaml +, xml-light +}: + +buildDunePackage { + pname = "ocsipersist-pgsql"; + inherit (ocsipersist-lib) version src useDune2; + + propagatedBuildInputs = [ + lwt_log + ocsigen_server + ocsipersist-lib + pgocaml + xml-light + ]; + + meta = ocsipersist-lib.meta // { + description = "Persistent key/value storage (for Ocsigen) using PostgreSQL"; + }; +} + diff --git a/pkgs/development/ocaml-modules/ocsipersist/sqlite.nix b/pkgs/development/ocaml-modules/ocsipersist/sqlite.nix new file mode 100644 index 00000000000..2cfa30bc908 --- /dev/null +++ b/pkgs/development/ocaml-modules/ocsipersist/sqlite.nix @@ -0,0 +1,23 @@ +{ buildDunePackage, ocsipersist-lib +, lwt_log +, ocaml_sqlite3 +, ocsigen_server +, xml-light +}: + +buildDunePackage { + pname = "ocsipersist-sqlite"; + inherit (ocsipersist-lib) version src useDune2; + + propagatedBuildInputs = [ + lwt_log + ocaml_sqlite3 + ocsigen_server + ocsipersist-lib + xml-light + ]; + + meta = ocsipersist-lib.meta // { + description = "Persistent key/value storage (for Ocsigen) using SQLite"; + }; +} diff --git a/pkgs/development/python-modules/Cython/default.nix b/pkgs/development/python-modules/Cython/default.nix index e22037cbbb9..5ceabe766b8 100644 --- a/pkgs/development/python-modules/Cython/default.nix +++ b/pkgs/development/python-modules/Cython/default.nix @@ -25,11 +25,11 @@ let in buildPythonPackage rec { pname = "Cython"; - version = "0.29.24"; + version = "0.29.28"; src = fetchPypi { inherit pname version; - sha256 = "sha256-zfBNB8NgCGDowuuq1Oj1KsP+shJFPBdkpJrAjIJ+hEM="; + sha256 = "sha256-1vrCNCgCww5RQmgo/ghP9N6xszhzZ8+Yl2uy5ktvjkU="; }; nativeBuildInputs = [ @@ -44,13 +44,6 @@ in buildPythonPackage rec { LC_ALL = "en_US.UTF-8"; patches = [ - # https://github.com/cython/cython/issues/2752, needed by sage (https://trac.sagemath.org/ticket/26855) and up to be included in 0.30 - (fetchpatch { - name = "non-int-conversion-to-pyhash.patch"; - url = "https://github.com/cython/cython/commit/28251032f86c266065e4976080230481b1a1bb29.patch"; - sha256 = "19rg7xs8gr90k3ya5c634bs8gww1sxyhdavv07cyd2k71afr83gy"; - }) - # backport Cython 3.0 trashcan support (https://github.com/cython/cython/pull/2842) to 0.X series. # it does not affect Python code unless the code explicitly uses the feature. # trashcan support is needed to avoid stack overflows during object deallocation in sage (https://trac.sagemath.org/ticket/27267) diff --git a/pkgs/development/python-modules/XlsxWriter/default.nix b/pkgs/development/python-modules/XlsxWriter/default.nix index 15bd1ee35fe..5096f37e302 100644 --- a/pkgs/development/python-modules/XlsxWriter/default.nix +++ b/pkgs/development/python-modules/XlsxWriter/default.nix @@ -1,24 +1,36 @@ -{lib, buildPythonPackage, fetchFromGitHub}: +{ lib +, buildPythonPackage +, fetchFromGitHub +, pytestCheckHook +, pythonOlder +}: buildPythonPackage rec { + pname = "xlsxwriter"; + version = "3.0.2"; + format = "setuptools"; - pname = "XlsxWriter"; - version = "1.2.9"; + disabled = pythonOlder "3.7"; - # PyPI release tarball doesn't contain tests so let's use GitHub. See: - # https://github.com/jmcnamara/XlsxWriter/issues/327 - src = fetchFromGitHub{ + src = fetchFromGitHub { owner = "jmcnamara"; - repo = pname; + repo = "XlsxWriter"; rev = "RELEASE_${version}"; - sha256 = "08pdca5ssi50bx2xz52gkmjix2ybv5i4bjw7yd6yfiph0y0qsbsb"; + hash = "sha256-I87/8OhMoI9/BRXdmTZ1Ul+d+/x+Kg/9CuqMgTsP8Eo="; }; - meta = { - description = "A Python module for creating Excel XLSX files"; + checkInputs = [ + pytestCheckHook + ]; + + pythonImportsCheck = [ + "xlsxwriter" + ]; + + meta = with lib; { + description = "Module for creating Excel XLSX files"; homepage = "https://xlsxwriter.readthedocs.io/"; - maintainers = with lib.maintainers; [ jluttine ]; - license = lib.licenses.bsd2; + license = licenses.bsd2; + maintainers = with maintainers; [ jluttine ]; }; - } diff --git a/pkgs/development/python-modules/adblock/default.nix b/pkgs/development/python-modules/adblock/default.nix index 941beb54473..3655c7456e5 100644 --- a/pkgs/development/python-modules/adblock/default.nix +++ b/pkgs/development/python-modules/adblock/default.nix @@ -16,7 +16,7 @@ buildPythonPackage rec { pname = "adblock"; - version = "0.5.1"; + version = "0.5.2"; format = "pyproject"; disabled = pythonOlder "3.6"; @@ -25,14 +25,14 @@ buildPythonPackage rec { src = fetchFromGitHub { owner = "ArniDagur"; repo = "python-adblock"; - rev = version; - sha256 = "sha256-f6PmEHVahQv8t+WOkE8DO2emivHG2t14hUSIf/l8omY="; + rev = "refs/tags/${version}"; + sha256 = "sha256-6FH+AVK7+Yg1a6oKbFV80TuGGE4Y7I3mMVzwVHdHYO4="; }; cargoDeps = rustPlatform.fetchCargoTarball { inherit src; name = "${pname}-${version}"; - hash = "sha256-x0mcykHWhheD2ycELcfR1ZQ/6WfFQzY+L/LmMipP4Rc="; + hash = "sha256-JI/C+Woi/dJWUGUum8daecjFWiQgxY6BFYZ5MpTcRvU="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/afsapi/default.nix b/pkgs/development/python-modules/afsapi/default.nix index 4bc3532f5b5..864d0caba39 100644 --- a/pkgs/development/python-modules/afsapi/default.nix +++ b/pkgs/development/python-modules/afsapi/default.nix @@ -11,7 +11,7 @@ buildPythonPackage rec { pname = "afsapi"; - version = "0.2.2"; + version = "0.2.3"; format = "setuptools"; disabled = pythonOlder "3.8"; @@ -20,7 +20,7 @@ buildPythonPackage rec { owner = "wlcrs"; repo = "python-afsapi"; rev = version; - hash = "sha256-C4rxlkylWGsDsnMPuecrC2ELj1PvP6EelZ/kzTn4Brk="; + hash = "sha256-6nmj15jCGBRkT7Ip/VGHX5IrAbhu1LUlvXuvFhvXknY="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/aioftp/default.nix b/pkgs/development/python-modules/aioftp/default.nix index fab3a32a6a0..83c5e986f09 100644 --- a/pkgs/development/python-modules/aioftp/default.nix +++ b/pkgs/development/python-modules/aioftp/default.nix @@ -11,14 +11,14 @@ buildPythonPackage rec { pname = "aioftp"; - version = "0.20.0"; + version = "0.20.1"; format = "setuptools"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "sha256-N8qiKsWPaFT/t5p1eSHS0BydoXv4AL6y8gP4z4P9fsE="; + sha256 = "sha256-6p3n5tNNQrbwHqGRXYNL4+cf31Blx2e9elxX6/wxj/4="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/aiohttp/default.nix b/pkgs/development/python-modules/aiohttp/default.nix index f6d9b5d97ec..660e205fb48 100644 --- a/pkgs/development/python-modules/aiohttp/default.nix +++ b/pkgs/development/python-modules/aiohttp/default.nix @@ -75,6 +75,10 @@ buildPythonPackage rec { "test_client_session_timeout_zero" "test_mark_formdata_as_processed" "test_requote_redirect_url_default" + # Disable tests that trigger deprecation warnings in pytest + "test_async_with_session" + "test_session_close_awaitable" + "test_close_run_until_complete_not_deprecated" ] ++ lib.optionals stdenv.is32bit [ "test_cookiejar" ] ++ lib.optionals stdenv.isDarwin [ diff --git a/pkgs/development/python-modules/aionotify/default.nix b/pkgs/development/python-modules/aionotify/default.nix index e653f4cca74..13ae51d2522 100644 --- a/pkgs/development/python-modules/aionotify/default.nix +++ b/pkgs/development/python-modules/aionotify/default.nix @@ -18,6 +18,11 @@ buildPythonPackage rec { disabled = pythonOlder "3.5"; + preCheck = '' + substituteInPlace tests/test_usage.py \ + --replace "asyncio.wait_for(task, timeout, loop=self.loop)" "asyncio.wait_for(task, timeout)" + ''; + checkInputs = [ asynctest ]; diff --git a/pkgs/development/python-modules/alembic/default.nix b/pkgs/development/python-modules/alembic/default.nix index 18698a0d68f..a82cd5e258a 100644 --- a/pkgs/development/python-modules/alembic/default.nix +++ b/pkgs/development/python-modules/alembic/default.nix @@ -13,14 +13,14 @@ buildPythonPackage rec { pname = "alembic"; - version = "1.7.5"; + version = "1.7.6"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-fDKGlKLmjwPulx5jw72IWEZHA3OltTLPLJ8WAcQTsVM="; + sha256 = "sha256-bAwF6XaKiW2AQ4fiCymYgP4BvFZIQkaw3/6AddbT2Ec="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/ansi/default.nix b/pkgs/development/python-modules/ansi/default.nix index d198fde80bb..5847e3ad0f9 100644 --- a/pkgs/development/python-modules/ansi/default.nix +++ b/pkgs/development/python-modules/ansi/default.nix @@ -1,17 +1,29 @@ -{ lib, buildPythonPackage, fetchPypi }: +{ lib +, buildPythonPackage +, fetchFromGitHub +, pytestCheckHook +}: buildPythonPackage rec { pname = "ansi"; - version = "0.2.0"; + version = "0.3.6"; + format = "pyproject"; - src = fetchPypi { - inherit pname version; - sha256 = "98e9b27c4bb187867a69480cbc63b843331622fec7e7d090873d806e1b5d8a80"; + src = fetchFromGitHub { + owner = "tehmaze"; + repo = pname; + rev = "${pname}-${version}"; + hash = "sha256-2gu2Dba3LOjMhbCCZrBqzlOor5KqDYThhe8OP8J3O2M="; }; - checkPhase = '' - python -c "import ansi.color" - ''; + checkInputs = [ + pytestCheckHook + ]; + + pythonImportsCheck = [ + "ansi.colour" + "ansi.color" + ]; meta = with lib; { description = "ANSI cursor movement and graphics"; diff --git a/pkgs/development/python-modules/ansi2html/default.nix b/pkgs/development/python-modules/ansi2html/default.nix index 50188fe0e4a..1f45968974c 100644 --- a/pkgs/development/python-modules/ansi2html/default.nix +++ b/pkgs/development/python-modules/ansi2html/default.nix @@ -2,13 +2,14 @@ buildPythonPackage rec { pname = "ansi2html"; - version = "1.6.0"; + version = "1.7.0"; + format = "pyproject"; disabled = !isPy3k; src = fetchPypi { inherit pname version; - sha256 = "0f124ea7efcf3f24f1f9398e527e688c9ae6eab26b0b84e1299ef7f94d92c596"; + sha256 = "sha256-aTFr6MaKyRxVgtOXwokOacmTzHzaUgYqx+Rfy2YNjtw="; }; nativeBuildInputs = [ setuptools-scm ]; diff --git a/pkgs/development/python-modules/anyio/default.nix b/pkgs/development/python-modules/anyio/default.nix index 382e64ea0f4..a9ae447d45f 100644 --- a/pkgs/development/python-modules/anyio/default.nix +++ b/pkgs/development/python-modules/anyio/default.nix @@ -2,6 +2,7 @@ , lib , buildPythonPackage , fetchFromGitHub +, fetchpatch , pythonOlder , setuptools-scm , idna @@ -19,7 +20,7 @@ buildPythonPackage rec { pname = "anyio"; - version = "3.3.4"; + version = "3.5.0"; format = "pyproject"; disabled = pythonOlder "3.7"; @@ -27,9 +28,17 @@ buildPythonPackage rec { owner = "agronholm"; repo = pname; rev = version; - sha256 = "sha256-aMnXZ+4dlybId2QhjE/3STY+Sj/vzI6K7wmqqx+P8yE="; + sha256 = "sha256-AZ9M/NBCBlMIUpRJgKbJRL/oReZDUh2Jhwtoxoo0tMs="; }; + patches = [ + (fetchpatch { + # Pytest 7.0 compatibility + url = "https://github.com/agronholm/anyio/commit/fed7cc4f95e196f68251bcb9253da3b143ea8e7e.patch"; + sha256 = "sha256-VmZmiQEmWJ4aPz0Wx+GTMZo7jXRDScnRYf2Hu2hiRVw="; + }) + ]; + preBuild = '' export SETUPTOOLS_SCM_PRETEND_VERSION=${version} ''; diff --git a/pkgs/development/python-modules/apache-airflow/default.nix b/pkgs/development/python-modules/apache-airflow/default.nix index 4ac03a8820f..948fae7893b 100644 --- a/pkgs/development/python-modules/apache-airflow/default.nix +++ b/pkgs/development/python-modules/apache-airflow/default.nix @@ -65,13 +65,13 @@ , mkYarnPackage }: let - version = "2.2.3"; + version = "2.2.4"; airflow-src = fetchFromGitHub rec { owner = "apache"; repo = "airflow"; rev = version; - sha256 = "02y3az7yj4g4qaamq5s1bcvy3knd6xmvnhbfqs3kbm51irkba1zq"; + sha256 = "sha256-JCcEgCq1sB8lBaeJy7QQbWU00sGAh5vUmJAptF8M9qo="; }; # airflow bundles a web interface, which is built using webpack by an undocumented shell script in airflow's source tree. diff --git a/pkgs/development/python-modules/apache-beam/default.nix b/pkgs/development/python-modules/apache-beam/default.nix index 2eeebaaea7f..b8d1a94eeff 100644 --- a/pkgs/development/python-modules/apache-beam/default.nix +++ b/pkgs/development/python-modules/apache-beam/default.nix @@ -43,14 +43,14 @@ buildPythonPackage rec { pname = "apache-beam"; - version = "2.35.0"; + version = "2.36.0"; disabled = pythonAtLeast "3.10"; src = fetchFromGitHub { owner = "apache"; repo = "beam"; rev = "v${version}"; - sha256 = "0qxkas33d8i6yj133plnadbfm74ak7arn7ldpziyiwdav3hj68sy"; + sha256 = "sha256-f+ICbKSwNjkhrTCCZwxbmqZlQ1+dQSTRag1IflWsqYg="; }; patches = [ diff --git a/pkgs/development/python-modules/approvaltests/default.nix b/pkgs/development/python-modules/approvaltests/default.nix index b74533e0d44..ece87d1894e 100644 --- a/pkgs/development/python-modules/approvaltests/default.nix +++ b/pkgs/development/python-modules/approvaltests/default.nix @@ -7,7 +7,7 @@ }: buildPythonPackage rec { - version = "3.6.0"; + version = "4.0.0"; pname = "approvaltests"; # no tests included in PyPI tarball @@ -15,7 +15,7 @@ buildPythonPackage rec { owner = "approvals"; repo = "ApprovalTests.Python"; rev = "v${version}"; - sha256 = "sha256-pgGuIoYV6JRM9h7hR8IeNduqsGm+UrKq+P/T1LM30NE="; + sha256 = "sha256-4dg5xTswqLFRBaZagKrkilCvsAnky9donb03MT/PiWM="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/apsw/default.nix b/pkgs/development/python-modules/apsw/default.nix index 46ae3fc34e5..5adee7244dd 100644 --- a/pkgs/development/python-modules/apsw/default.nix +++ b/pkgs/development/python-modules/apsw/default.nix @@ -29,6 +29,14 @@ buildPythonPackage rec { pytestCheckHook ]; + # Works around the following error by dropping the call to that function + # def print_version_info(write=write): + # > write(" Python " + sys.executable + " " + str(sys.version_info) + "\n") + # E TypeError: 'module' object is not callable + preCheck = '' + sed -i '/print_version_info(write)/d' tests.py + ''; + pytestFlagsArray = [ "tests.py" ]; diff --git a/pkgs/development/python-modules/arrow/default.nix b/pkgs/development/python-modules/arrow/default.nix index fc66509a194..c09610c3be1 100644 --- a/pkgs/development/python-modules/arrow/default.nix +++ b/pkgs/development/python-modules/arrow/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "arrow"; - version = "1.2.1"; + version = "1.2.2"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "c2dde3c382d9f7e6922ce636bf0b318a7a853df40ecb383b29192e6c5cc82840"; + sha256 = "sha256-Bcrx/T2aEaETWytvCYh0IRU7lFWOXvTQkLVntHFzrCs="; }; postPatch = '' diff --git a/pkgs/development/python-modules/asdf/default.nix b/pkgs/development/python-modules/asdf/default.nix index 1a9ba2dd096..122020c271f 100644 --- a/pkgs/development/python-modules/asdf/default.nix +++ b/pkgs/development/python-modules/asdf/default.nix @@ -17,13 +17,13 @@ buildPythonPackage rec { pname = "asdf"; - version = "2.8.3"; + version = "2.10.1"; disabled = pythonOlder "3.6"; format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "de0f70ffb2e0d539461940d6f7529c3548541fa098d8edc37af256af61c09b44"; + sha256 = "sha256-9+Vp8ps3I5Oe/sgWTrLtcnS91ICwsoPXWDPw9Z0QhAk="; }; nativeBuildInputs = [ setuptools-scm ]; diff --git a/pkgs/development/python-modules/astropy/default.nix b/pkgs/development/python-modules/astropy/default.nix index 78f02e2870c..6a61dd1009c 100644 --- a/pkgs/development/python-modules/astropy/default.nix +++ b/pkgs/development/python-modules/astropy/default.nix @@ -19,7 +19,7 @@ let pname = "astropy"; - version = "5.0"; + version = "5.0.1"; in buildPythonPackage { inherit pname version; @@ -29,7 +29,7 @@ buildPythonPackage { src = fetchPypi { inherit pname version; - sha256 = "70203e151e13292586a817b4069ce1aad4643567aff38b1d191c173bc54f3927"; + sha256 = "sha256-Y4LN5qIFqgsWoNXmHAwBMevU8BdNbHPilk9L7hMqkCc="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/async-lru/default.nix b/pkgs/development/python-modules/async-lru/default.nix index 9dc412ccde8..69e6519b32c 100644 --- a/pkgs/development/python-modules/async-lru/default.nix +++ b/pkgs/development/python-modules/async-lru/default.nix @@ -28,6 +28,10 @@ buildPythonPackage rec { pytest-asyncio ]; + pytestFlagsArray = [ + "--asyncio-mode=strict" + ]; + disabledTests = [ # https://github.com/aio-libs/async-lru/issues/341 "test_alru_cache_deco" diff --git a/pkgs/development/python-modules/authcaptureproxy/default.nix b/pkgs/development/python-modules/authcaptureproxy/default.nix index 73422a0624c..11e1f444cb0 100644 --- a/pkgs/development/python-modules/authcaptureproxy/default.nix +++ b/pkgs/development/python-modules/authcaptureproxy/default.nix @@ -15,14 +15,14 @@ buildPythonPackage rec { pname = "authcaptureproxy"; - version = "1.1.1"; + version = "1.1.3"; format = "pyproject"; src = fetchFromGitHub { owner = "alandtse"; repo = "auth_capture_proxy"; rev = "v${version}"; - sha256 = "08zpaclg5f9g1pix0jaq42i2ph12xc8djjrmhxz0yygw5rsilgl4"; + sha256 = "sha256-RD/8v3IQb50iGkU6zj5QfHXakjHdcCBWWAkXhCIF6qo="; }; postPatch = '' diff --git a/pkgs/development/python-modules/autobahn/default.nix b/pkgs/development/python-modules/autobahn/default.nix index a088a012010..285630db32e 100644 --- a/pkgs/development/python-modules/autobahn/default.nix +++ b/pkgs/development/python-modules/autobahn/default.nix @@ -23,14 +23,14 @@ buildPythonPackage rec { pname = "autobahn"; - version = "21.11.1"; + version = "22.2.2"; format = "setuptools"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "sha256-vW9GMVQZygpb5BCfc3QQIIrV8ZcY9nympKZ0zGbKmxg="; + sha256 = "sha256-YOH0xgKqzQUv/j1GrkC2t1+ChrPEaSLCE7UjFi5YwX4="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/aws-adfs/default.nix b/pkgs/development/python-modules/aws-adfs/default.nix index 461ce9d90d9..673b6631cf2 100644 --- a/pkgs/development/python-modules/aws-adfs/default.nix +++ b/pkgs/development/python-modules/aws-adfs/default.nix @@ -17,12 +17,12 @@ buildPythonPackage rec { pname = "aws-adfs"; - version = "1.24.5"; + version = "2.0.1"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "6a78bd31477ea9988166215ae86abcbfe1413bee20373ecdf0dd170b7290db55"; + sha256 = "sha256-+WMv52JIbh51pqLhDnUCzrcbPD5eutzwFcPOhO+nR7s="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/azure-common/default.nix b/pkgs/development/python-modules/azure-common/default.nix index 2312df1cafa..a540ebf0bea 100644 --- a/pkgs/development/python-modules/azure-common/default.nix +++ b/pkgs/development/python-modules/azure-common/default.nix @@ -9,14 +9,14 @@ }: buildPythonPackage rec { - version = "1.1.27"; + version = "1.1.28"; pname = "azure-common"; disabled = isPyPy; src = fetchPypi { inherit pname version; extension = "zip"; - sha256 = "9f3f5d991023acbd93050cf53c4e863c6973ded7e236c69e99c8ff5c7bad41ef"; + sha256 = "sha256-SsDNMhTja2obakQmhnIqXYzESWA6qDPz8PQL2oNnBKM="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/azure-core/default.nix b/pkgs/development/python-modules/azure-core/default.nix index b7d330e6eff..fbff37fad37 100644 --- a/pkgs/development/python-modules/azure-core/default.nix +++ b/pkgs/development/python-modules/azure-core/default.nix @@ -15,14 +15,14 @@ }: buildPythonPackage rec { - version = "1.21.1"; + version = "1.22.1"; pname = "azure-core"; disabled = isPy27; src = fetchPypi { inherit pname version; extension = "zip"; - sha256 = "88d2db5cf9a135a7287dc45fdde6b96f9ca62c9567512a3bb3e20e322ce7deb2"; + sha256 = "sha256-S25AUmijO4cxB3lklc7D8vGx/+k1Ykzg+93/NtONOk0="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/azure-identity/default.nix b/pkgs/development/python-modules/azure-identity/default.nix index ea0696e294a..44660e56f42 100644 --- a/pkgs/development/python-modules/azure-identity/default.nix +++ b/pkgs/development/python-modules/azure-identity/default.nix @@ -24,6 +24,11 @@ buildPythonPackage rec { sha256 = "sha256-Ag/w5HFXhS5KrIo62waEGCcUfyepTL50qQRCXY5i2Tw="; }; + postPatch = '' + substituteInPlace setup.py \ + --replace "msal-extensions~=0.3.0" "msal-extensions" + ''; + propagatedBuildInputs = [ azure-common azure-core diff --git a/pkgs/development/python-modules/azure-mgmt-kusto/azure-mgmt-apimanagement/default.nix b/pkgs/development/python-modules/azure-mgmt-kusto/azure-mgmt-apimanagement/default.nix index 4c7233203bb..4c61b55b666 100644 --- a/pkgs/development/python-modules/azure-mgmt-kusto/azure-mgmt-apimanagement/default.nix +++ b/pkgs/development/python-modules/azure-mgmt-kusto/azure-mgmt-apimanagement/default.nix @@ -5,13 +5,13 @@ }: buildPythonPackage rec { - version = "2.1.0"; + version = "3.0.0"; pname = "azure-mgmt-apimanagement"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "58296bd45e876df33f93f3a41c866c36476f5f3bd46818e8891308794f041c94"; + sha256 = "sha256-kmL1TtOH6wg9ja5m0yqN81ZHMZuQK9SYzcN29QoS0VQ="; extension = "zip"; }; diff --git a/pkgs/development/python-modules/azure-mgmt-loganalytics/default.nix b/pkgs/development/python-modules/azure-mgmt-loganalytics/default.nix index 947bb4a28ba..9629c6e7bba 100644 --- a/pkgs/development/python-modules/azure-mgmt-loganalytics/default.nix +++ b/pkgs/development/python-modules/azure-mgmt-loganalytics/default.nix @@ -4,7 +4,6 @@ , msrest , msrestazure , azure-common -, azure-mgmt-nspkg , azure-mgmt-core }: @@ -22,7 +21,6 @@ buildPythonPackage rec { msrest msrestazure azure-common - azure-mgmt-nspkg azure-mgmt-core ]; diff --git a/pkgs/development/python-modules/azure-mgmt-trafficmanager/default.nix b/pkgs/development/python-modules/azure-mgmt-trafficmanager/default.nix index dd7ed3b19b2..68d14c49ef6 100644 --- a/pkgs/development/python-modules/azure-mgmt-trafficmanager/default.nix +++ b/pkgs/development/python-modules/azure-mgmt-trafficmanager/default.nix @@ -4,24 +4,26 @@ , msrest , msrestazure , azure-common +, azure-mgmt-core , azure-mgmt-nspkg , isPy3k }: buildPythonPackage rec { pname = "azure-mgmt-trafficmanager"; - version = "0.51.0"; + version = "1.0.0"; src = fetchPypi { inherit pname version; extension = "zip"; - sha256 = "fc8ae77022cfe52fda4379a2f31e0b857574d536e41291a7b569b5c0f4104186"; + sha256 = "sha256-R0F2HoA0bE7dTLPycTaOqYBj+ATQFeJFwv4EjtK1lqg="; }; propagatedBuildInputs = [ msrest msrestazure azure-common + azure-mgmt-core ] ++ lib.optionals (!isPy3k) [ azure-mgmt-nspkg ]; diff --git a/pkgs/development/python-modules/azure-servicebus/default.nix b/pkgs/development/python-modules/azure-servicebus/default.nix index b4e37c33fef..a0864529177 100644 --- a/pkgs/development/python-modules/azure-servicebus/default.nix +++ b/pkgs/development/python-modules/azure-servicebus/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "azure-servicebus"; - version = "7.5.0"; + version = "7.6.0"; format = "setuptools"; src = fetchPypi { inherit pname version; extension = "zip"; - sha256 = "e97a069c6a73fce3042a5ef0d438cc564152cfbcc2e7db6f7a19fbd51bb3555b"; + sha256 = "sha256-uZGxQ1Vl6wpBCMW1+80/CBuqelLV02yXf1sNlNtCpHU="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/backports-zoneinfo/default.nix b/pkgs/development/python-modules/backports-zoneinfo/default.nix index 0b4703e2651..d2b6d06c4cd 100644 --- a/pkgs/development/python-modules/backports-zoneinfo/default.nix +++ b/pkgs/development/python-modules/backports-zoneinfo/default.nix @@ -1,4 +1,5 @@ { lib, buildPythonPackage, fetchFromGitHub +, pythonAtLeast , pythonOlder , python , substituteAll @@ -12,6 +13,8 @@ buildPythonPackage rec { pname = "backports-zoneinfo"; version = "0.2.1"; + disabled = pythonAtLeast "3.9"; + src = fetchFromGitHub { owner = "pganssle"; repo = "zoneinfo"; diff --git a/pkgs/development/python-modules/basemap/default.nix b/pkgs/development/python-modules/basemap/default.nix index 30ca58fed31..6d8dd8a3943 100644 --- a/pkgs/development/python-modules/basemap/default.nix +++ b/pkgs/development/python-modules/basemap/default.nix @@ -14,13 +14,13 @@ buildPythonPackage rec { pname = "basemap"; - version = "1.3.0"; + version = "1.3.2"; src = fetchFromGitHub { owner = "matplotlib"; repo = "basemap"; rev = "v${version}"; - sha256 = "0nwpd6zx2q2fc556ppz71ra6ad9z0d5bz8hcld64i91dcy0f0zs3"; + sha256 = "sha256-onNdOQL4i6GTcuCRel5yanJ2EQ5iYClp+imuBObXF2I="; }; propagatedBuildInputs = [ numpy matplotlib pillow pyproj pyshp six ]; diff --git a/pkgs/development/python-modules/behave/default.nix b/pkgs/development/python-modules/behave/default.nix index 1198f034d00..2384a51e502 100644 --- a/pkgs/development/python-modules/behave/default.nix +++ b/pkgs/development/python-modules/behave/default.nix @@ -7,13 +7,13 @@ buildPythonApplication rec { pname = "behave"; - version = "1.2.7.dev1"; + version = "1.2.7.dev2"; src = fetchFromGitHub { owner = "behave"; repo = pname; rev = "v${version}"; - sha256 = "1ssgixmqlg8sxsyalr83a1970njc2wg3zl8idsmxnsljwacv7qwv"; + hash = "sha256-B8PUN1Q4UAsDWrHjPZDlpaPjCKjI/pAogCSI+BQnaWs="; }; checkInputs = [ pytestCheckHook mock pathpy pyhamcrest pytest-html ]; diff --git a/pkgs/development/python-modules/bip_utils/default.nix b/pkgs/development/python-modules/bip_utils/default.nix index a4430b655ce..932d887754e 100644 --- a/pkgs/development/python-modules/bip_utils/default.nix +++ b/pkgs/development/python-modules/bip_utils/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { pname = "bip_utils"; - version = "2.1.0"; + version = "2.2.1"; disabled = pythonOlder "3.6"; @@ -16,7 +16,7 @@ buildPythonPackage rec { owner = "ebellocchia"; repo = pname; rev = "v${version}"; - sha256 = "1n677z6rvcny1vyfzwnvcmzbqp9m4kfpdjfvkf1q6310zr2ybp7m"; + sha256 = "sha256-p2JOZAJxQ/nPZ7vjnB24hA3kz3Io4D3HTP/8mqS/XCc="; }; propagatedBuildInputs = [ ecdsa pysha3 ]; diff --git a/pkgs/development/python-modules/bitbox02/default.nix b/pkgs/development/python-modules/bitbox02/default.nix index d57d4a6585b..358a4d163f3 100644 --- a/pkgs/development/python-modules/bitbox02/default.nix +++ b/pkgs/development/python-modules/bitbox02/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "bitbox02"; - version = "5.3.0"; + version = "6.0.0"; src = fetchPypi { inherit pname version; - sha256 = "fe0e8aeb9b32fd7d76bb3e9838895973a74dfd532a8fb8ac174a1a60214aee26"; + sha256 = "sha256-wTateh3dJycFNozLaQbAzXF0avr2ofBdjlqqcOBLr/0="; }; propagatedBuildInputs = [ base58 ecdsa hidapi noiseprotocol protobuf semver typing-extensions ]; diff --git a/pkgs/development/python-modules/bitcoin-price-api/default.nix b/pkgs/development/python-modules/bitcoin-price-api/default.nix deleted file mode 100644 index c9d317a81c3..00000000000 --- a/pkgs/development/python-modules/bitcoin-price-api/default.nix +++ /dev/null @@ -1,24 +0,0 @@ -{ lib, buildPythonPackage, fetchPypi -, python-dateutil, requests }: - -buildPythonPackage rec { - pname = "bitcoin-price-api"; - version = "0.0.4"; - - src = fetchPypi { - inherit pname version; - sha256 = "bc68076f9632aaa9a8009d916d67a709c1e045dd904cfc7a3e8be33960d32029"; - }; - - propagatedBuildInputs = [ python-dateutil requests ]; - - # No tests in archive - doCheck = false; - - meta = { - homepage = "https://github.com/dursk/bitcoin-price-api"; - description = "Price APIs for bitcoin exchanges"; - license = with lib.licenses; [ mit ]; - maintainers = with lib.maintainers; [ bhipple ]; - }; -} diff --git a/pkgs/development/python-modules/bjoern/default.nix b/pkgs/development/python-modules/bjoern/default.nix index ef599d89be2..e8b11a6311a 100644 --- a/pkgs/development/python-modules/bjoern/default.nix +++ b/pkgs/development/python-modules/bjoern/default.nix @@ -1,12 +1,17 @@ -{ lib, buildPythonPackage, fetchPypi, libev, python }: +{ lib, buildPythonPackage, fetchFromGitHub, libev, python }: buildPythonPackage rec { pname = "bjoern"; - version = "3.1.0"; + version = "3.2.1"; + format = "setuptools"; - src = fetchPypi { - inherit pname version; - sha256 = "01f3b601cf0ab0a9c7cb9c8f944ab7c738baaa6043ca82db20e9bd7a9be5767b"; + # tests are not published to pypi anymore + src = fetchFromGitHub { + owner = "jonashaag"; + repo = pname; + rev = version; + hash = "sha256-d7u/lEh2Zr5NYWYu4Zr7kgyeOIQuHQLYrZeiZMHbpio="; + fetchSubmodules = true; # fetch http-parser and statsd-c-client submodules }; buildInputs = [ libev ]; diff --git a/pkgs/development/python-modules/blessed/default.nix b/pkgs/development/python-modules/blessed/default.nix index c2b03d35a21..592c36692d0 100644 --- a/pkgs/development/python-modules/blessed/default.nix +++ b/pkgs/development/python-modules/blessed/default.nix @@ -4,11 +4,11 @@ buildPythonPackage rec { pname = "blessed"; - version = "1.19.0"; + version = "1.19.1"; src = fetchPypi { inherit pname version; - sha256 = "4db0f94e5761aea330b528e84a250027ffe996b5a94bf03e502600c9a5ad7a61"; + sha256 = "sha256-mg0JlpW/Yh1GgN1sc/atVH9qNEL72+gMSx2qHtvEkvw="; }; checkInputs = [ pytest mock glibcLocales ]; diff --git a/pkgs/development/python-modules/boto3/default.nix b/pkgs/development/python-modules/boto3/default.nix index c6fdc8c9981..d1a104f6ae9 100644 --- a/pkgs/development/python-modules/boto3/default.nix +++ b/pkgs/development/python-modules/boto3/default.nix @@ -13,11 +13,11 @@ buildPythonPackage rec { pname = "boto3"; - version = "1.20.35"; # N.B: if you change this, change botocore and awscli to a matching version + version = "1.21.12"; # N.B: if you change this, change botocore and awscli to a matching version src = fetchPypi { inherit pname version; - sha256 = "42dd9fcb9e033ab19c9dfaeaba745ef9d2db6efe4e9f1e1f547b3e3e0b1f4a82"; + sha256 = "sha256-yS7CCmcHIbWhvAE7MFqE2yt/nHFmU7MFbOfi+9KhgO8="; }; propagatedBuildInputs = [ botocore jmespath s3transfer ] ++ lib.optionals (!isPy3k) [ futures ]; diff --git a/pkgs/development/python-modules/botocore/default.nix b/pkgs/development/python-modules/botocore/default.nix index 6d5c11665c2..0c69de1c0e0 100644 --- a/pkgs/development/python-modules/botocore/default.nix +++ b/pkgs/development/python-modules/botocore/default.nix @@ -13,11 +13,11 @@ buildPythonPackage rec { pname = "botocore"; - version = "1.23.35"; # N.B: if you change this, change boto3 and awscli to a matching version + version = "1.24.12"; # N.B: if you change this, change boto3 and awscli to a matching version src = fetchPypi { inherit pname version; - sha256 = "5be6ba6c5ea71c256da8a5023bf9c278847c4b90fdb40f2c4c3bdb21ca11ff28"; + sha256 = "sha256-AXSZmgSwouQkVxBgk6zps2+pR3KkQtm89gdQJj0dBz4="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/bottleneck/default.nix b/pkgs/development/python-modules/bottleneck/default.nix index f7e7dc7c390..7b8334ee36c 100644 --- a/pkgs/development/python-modules/bottleneck/default.nix +++ b/pkgs/development/python-modules/bottleneck/default.nix @@ -7,11 +7,11 @@ buildPythonPackage rec { pname = "Bottleneck"; - version = "1.3.2"; + version = "1.3.4"; src = fetchPypi { inherit pname version; - sha256 = "20179f0b66359792ea283b69aa16366419132f3b6cf3adadc0c48e2e8118e573"; + sha256 = "sha256-F2Sn9K1YxVhyPFQoR+s2erC7ttiApOXV7vMKDs5c7Oo="; }; propagatedBuildInputs = [ numpy ]; diff --git a/pkgs/development/python-modules/boxx/default.nix b/pkgs/development/python-modules/boxx/default.nix index a3f0db80faf..dd521523179 100644 --- a/pkgs/development/python-modules/boxx/default.nix +++ b/pkgs/development/python-modules/boxx/default.nix @@ -18,11 +18,11 @@ buildPythonPackage rec { pname = "boxx"; - version = "0.9.9"; + version = "0.9.10"; src = fetchPypi { inherit pname version; - sha256 = "sha256-Mc6R6ruUVhFs2D0CTJsAiM9aGOusS973hRS5r2kQsy4="; + sha256 = "sha256-Iw6jRhKAroqfWmbXhD7YTn4s8FrE/Iyd31EOP0tMdkQ="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/bsblan/default.nix b/pkgs/development/python-modules/bsblan/default.nix index 6db95234775..ed13a3a3a7b 100644 --- a/pkgs/development/python-modules/bsblan/default.nix +++ b/pkgs/development/python-modules/bsblan/default.nix @@ -5,6 +5,8 @@ , aresponses , coverage , mypy +, poetry-core +, pydantic , pytest-asyncio , pytest-cov , pytest-mock @@ -17,22 +19,27 @@ buildPythonPackage rec { pname = "bsblan"; - version = "0.5.0"; - format = "setuptools"; + version = "0.5.5"; + format = "pyproject"; disabled = pythonOlder "3.8"; src = fetchFromGitHub { owner = "liudger"; repo = "python-bsblan"; - rev = "v.${version}"; - sha256 = "1j41y2njnalcsp1vjqwl508yp3ki82lv8108ijz52hprhrq4fffb"; + rev = "v${version}"; + sha256 = "sha256-kq4cML7D9XC/QRPjGfaWcs0H78OOc2IXGua7qJpWYOQ="; }; + nativeBuildInputs = [ + poetry-core + ]; + propagatedBuildInputs = [ aiohttp attrs cattrs + pydantic yarl ]; diff --git a/pkgs/development/python-modules/buildbot/default.nix b/pkgs/development/python-modules/buildbot/default.nix index 2836ee24c34..5190c1fa74f 100644 --- a/pkgs/development/python-modules/buildbot/default.nix +++ b/pkgs/development/python-modules/buildbot/default.nix @@ -92,6 +92,9 @@ let preCheck = '' export LC_ALL="en_US.UTF-8" export PATH="$out/bin:$PATH" + + # remove testfile which is missing configuration file from sdist + rm buildbot/test/integration/test_graphql.py ''; disabled = !isPy3k; diff --git a/pkgs/development/python-modules/can/default.nix b/pkgs/development/python-modules/can/default.nix index a68d73e1242..18077ce78cc 100644 --- a/pkgs/development/python-modules/can/default.nix +++ b/pkgs/development/python-modules/can/default.nix @@ -15,7 +15,7 @@ buildPythonPackage rec { pname = "python-can"; - version = "unstable-2022-01-11"; + version = "4.0.0"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -23,8 +23,8 @@ buildPythonPackage rec { src = fetchFromGitHub { owner = "hardbyte"; repo = pname; - rev = "2e24af08326ecd69fba9f02fed7b9c26f233c92b"; - hash = "sha256-ZP5qtbjDtBZ2uT9DOSvSnfHyTlirr0oCEXhiLO1ydz0="; + rev = version; + hash = "sha256-/z7zBfVbO7x4UtzWOXolH2YrtYWgsvRLObWwz8sqOEc="; }; propagatedBuildInputs = [ @@ -56,6 +56,9 @@ buildPythonPackage rec { # Tests require access socket "BasicTestUdpMulticastBusIPv4" "BasicTestUdpMulticastBusIPv6" + # pytest.approx is not supported in a boolean context (since pytest7) + "test_pack_unpack" + "test_receive" ]; preCheck = '' diff --git a/pkgs/development/python-modules/cattrs/default.nix b/pkgs/development/python-modules/cattrs/default.nix index e3d694d28e3..94a357df98b 100644 --- a/pkgs/development/python-modules/cattrs/default.nix +++ b/pkgs/development/python-modules/cattrs/default.nix @@ -7,6 +7,7 @@ , motor , msgpack , poetry-core +, pytest-xdist , pytestCheckHook , pythonOlder , pyyaml @@ -44,12 +45,17 @@ buildPythonPackage rec { immutables motor msgpack + pytest-xdist pytestCheckHook pyyaml tomlkit ujson ]; + pytestFlagsArray = [ + "--numprocesses $NIX_BUILD_CORES" + ]; + postPatch = '' substituteInPlace pyproject.toml \ --replace "-l --benchmark-sort=fullname --benchmark-warmup=true --benchmark-warmup-iterations=5 --benchmark-group-by=fullname" "" \ @@ -75,6 +81,8 @@ buildPythonPackage rec { disabledTests = [ # orjson is not available as it requires Rust nightly features to compile its requirements "test_orjson" + # tomlkit is pinned to an older version and newer versions raise InvalidControlChar exception + "test_tomlkit" ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/cbor2/default.nix b/pkgs/development/python-modules/cbor2/default.nix index cf4813a9d90..5039872b336 100644 --- a/pkgs/development/python-modules/cbor2/default.nix +++ b/pkgs/development/python-modules/cbor2/default.nix @@ -9,13 +9,13 @@ buildPythonPackage rec { pname = "cbor2"; - version = "5.4.2"; + version = "5.4.2.post1"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-4oPnC1WgSf82TMXmSP3lh+TZsOh+SyZkxp5jkTXms7g="; + sha256 = "sha256-nPIdWWBLlSnXh3yOA0Ki66rhoH/o/1aD3HX+wVhHx5c="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/certbot/default.nix b/pkgs/development/python-modules/certbot/default.nix index e65e6f0d808..72a5d8db39d 100644 --- a/pkgs/development/python-modules/certbot/default.nix +++ b/pkgs/development/python-modules/certbot/default.nix @@ -9,13 +9,13 @@ buildPythonPackage rec { pname = "certbot"; - version = "1.22.0"; + version = "1.24.0"; src = fetchFromGitHub { owner = pname; repo = pname; rev = "v${version}"; - sha256 = "1wrk5rhds6a69vbs1bda0zhwpvjhd8i20did6j3kydbas3zbr516"; + sha256 = "sha256-XIKFEPQKIV5s6sZ7LRnlTvsb3cF4KIaiVZ36cAN1AwA="; }; sourceRoot = "source/${pname}"; diff --git a/pkgs/development/python-modules/chalice/default.nix b/pkgs/development/python-modules/chalice/default.nix index 762846ab34c..93499d0f563 100644 --- a/pkgs/development/python-modules/chalice/default.nix +++ b/pkgs/development/python-modules/chalice/default.nix @@ -24,13 +24,13 @@ buildPythonPackage rec { pname = "chalice"; - version = "1.26.4"; + version = "1.26.6"; src = fetchFromGitHub { owner = "aws"; repo = pname; rev = version; - sha256 = "sha256-Xn8OqeEihLxZS9QZtrhzau2zLg9SzQrrigK70PoImhU="; + sha256 = "sha256-6Y5pJg6N/F97zvkyo4r6MoThi79kI53AvlHNOmOCpFA="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/ciscoconfparse/default.nix b/pkgs/development/python-modules/ciscoconfparse/default.nix index e6db689a45c..49b36a5c658 100644 --- a/pkgs/development/python-modules/ciscoconfparse/default.nix +++ b/pkgs/development/python-modules/ciscoconfparse/default.nix @@ -33,6 +33,7 @@ buildPythonPackage rec { passlib dnspython loguru + toml ]; checkInputs = [ diff --git a/pkgs/development/python-modules/click/default.nix b/pkgs/development/python-modules/click/default.nix index 6d865307f9b..5156ad1048f 100644 --- a/pkgs/development/python-modules/click/default.nix +++ b/pkgs/development/python-modules/click/default.nix @@ -17,11 +17,11 @@ buildPythonPackage rec { pname = "click"; - version = "8.0.3"; + version = "8.0.4"; src = fetchPypi { inherit pname version; - sha256 = "sha256-QQ6TKwUPXu13PEzalN51lxyJzbMVWnKggxE5p55ey1s="; + sha256 = "sha256-hFjXsSh8X7EoyQ4jOBz5nc3nS+r2x/9jhM6E1v4JCts="; }; postPatch = '' diff --git a/pkgs/development/python-modules/clldutils/default.nix b/pkgs/development/python-modules/clldutils/default.nix index 563ad08381c..697296d9a20 100644 --- a/pkgs/development/python-modules/clldutils/default.nix +++ b/pkgs/development/python-modules/clldutils/default.nix @@ -44,9 +44,15 @@ buildPythonPackage rec { pytest-mock ]; + disabledTests = [ + # uses pytest.approx which is not supported in a boolean context in pytest7 + "test_to_dec" + "test_roundtrip" + ]; + meta = with lib; { - description = "CSV on the Web"; - homepage = "https://github.com/cldf/csvw"; + description = "Utilities for clld apps without the overhead of requiring pyramid, rdflib et al"; + homepage = "https://github.com/clld/clldutils"; license = licenses.asl20; maintainers = with maintainers; [ ]; }; diff --git a/pkgs/development/python-modules/cma/default.nix b/pkgs/development/python-modules/cma/default.nix index 473f0607698..c0480f2fa71 100644 --- a/pkgs/development/python-modules/cma/default.nix +++ b/pkgs/development/python-modules/cma/default.nix @@ -7,13 +7,13 @@ buildPythonPackage rec { pname = "cma"; - version = "3.1.0"; + version = "3.2.1"; src = fetchFromGitHub { owner = "CMA-ES"; repo = "pycma"; rev = "r${version}"; - sha256 = "1bal4kljxrdm6x5ppyi6i109714h0czdxfsna906dlfplrmq52bf"; + sha256 = "sha256-wLUD8HMJusUeCwwp37D/W7yJuJQcDfRwVGVKwBS6sR8="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/cmd2/default.nix b/pkgs/development/python-modules/cmd2/default.nix index 5f262438fe9..8a7f9a5e1c8 100644 --- a/pkgs/development/python-modules/cmd2/default.nix +++ b/pkgs/development/python-modules/cmd2/default.nix @@ -18,13 +18,13 @@ buildPythonPackage rec { pname = "cmd2"; - version = "2.3.3"; + version = "2.4.0"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "750d7eb04d55c3bc2a413e191bc177856f388102de47d11f2210a35266543640"; + sha256 = "sha256-CQkJq2yOzuQIE87HWeYd1ucMgiehqOlggvXysNOUvHc="; }; LC_ALL = "en_US.UTF-8"; diff --git a/pkgs/development/python-modules/collections-extended/default.nix b/pkgs/development/python-modules/collections-extended/default.nix index 52f73a5554a..b51a458109c 100644 --- a/pkgs/development/python-modules/collections-extended/default.nix +++ b/pkgs/development/python-modules/collections-extended/default.nix @@ -7,7 +7,7 @@ }: buildPythonPackage rec { pname = "collections-extended"; - version = "2.0.0"; + version = "2.0.2"; format = "pyproject"; disabled = pythonOlder "3.6"; @@ -16,7 +16,7 @@ buildPythonPackage rec { owner = "mlenzen"; repo = pname; rev = "v${version}"; - sha256 = "sha256:1qcr1q49a134b122rpldjiim1fsl32gxs5fpj3232nyb05r68haz"; + sha256 = "sha256-cK13+CQUELKSiLpG747+C+RB5b6luu0mWLLXTT+uGH4="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/commoncode/default.nix b/pkgs/development/python-modules/commoncode/default.nix index 7a2416728c8..ff642c8930e 100644 --- a/pkgs/development/python-modules/commoncode/default.nix +++ b/pkgs/development/python-modules/commoncode/default.nix @@ -20,7 +20,7 @@ buildPythonPackage rec { pname = "commoncode"; version = "30.0.0"; - format = "setuptools"; + format = "pyproject"; disabled = pythonOlder "3.6"; @@ -29,6 +29,11 @@ buildPythonPackage rec { sha256 = "sha256-6SeU4u6pfDuGCgCYAO5fdbWBxW9XN3WvM8j6DwUlFwM="; }; + postPatch = '' + substituteInPlace setup.cfg \ + --replace "intbitset >= 2.3.0, < 3.0" "intbitset >= 2.3.0" + ''; + dontConfigure = true; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/construct/default.nix b/pkgs/development/python-modules/construct/default.nix index 8ae44476eff..ce6e0a65b34 100644 --- a/pkgs/development/python-modules/construct/default.nix +++ b/pkgs/development/python-modules/construct/default.nix @@ -5,7 +5,7 @@ buildPythonPackage rec { pname = "construct"; - version = "2.10.67"; + version = "2.10.68"; disabled = pythonOlder "3.6"; @@ -14,7 +14,7 @@ buildPythonPackage rec { owner = pname; repo = pname; rev = "v${version}"; - sha256 = "1nciwim745qk41l1ck4chx3vxpfr6cq4k3a4i7vfnnrd3s6szzsw"; + sha256 = "sha256-bp/YyRFP0rrBHPyhiqnn6o1iC5l61oedShZ2phGeqaw="; }; # not an explicit dependency, but it's imported by an entrypoint diff --git a/pkgs/development/python-modules/convertdate/default.nix b/pkgs/development/python-modules/convertdate/default.nix index cc26142d362..b20066c51d8 100644 --- a/pkgs/development/python-modules/convertdate/default.nix +++ b/pkgs/development/python-modules/convertdate/default.nix @@ -1,23 +1,24 @@ { lib , buildPythonPackage -, isPy27 , fetchFromGitHub , pymeeus , pytz , pytestCheckHook +, pythonOlder }: buildPythonPackage rec { pname = "convertdate"; - version = "2.3.2"; - disabled = isPy27; + version = "2.4.0"; + format = "setuptools"; + + disabled = pythonOlder "3.7"; - # Tests are not available in the PyPI tarball so use GitHub instead. src = fetchFromGitHub { owner = "fitnr"; repo = pname; rev = "v${version}"; - sha256 = "0k7j59sbqwyi72vcjx5vsh3qb6hxfnkfjkd2i6f6lckdr1bkh7fz"; + hash = "sha256-iOHK3UJulXJJR50nhiVgfk3bt+CAtG3BRySJ8DkBuJE="; }; propagatedBuildInputs = [ @@ -29,11 +30,13 @@ buildPythonPackage rec { pytestCheckHook ]; - pythonImportsCheck = [ "convertdate" ]; + pythonImportsCheck = [ + "convertdate" + ]; meta = with lib; { - homepage = "https://github.com/fitnr/convertdate"; description = "Utils for converting between date formats and calculating holidays"; + homepage = "https://github.com/fitnr/convertdate"; license = licenses.mit; maintainers = with maintainers; [ jluttine ]; }; diff --git a/pkgs/development/python-modules/coverage/default.nix b/pkgs/development/python-modules/coverage/default.nix index f1930b88fb8..8019fc94966 100644 --- a/pkgs/development/python-modules/coverage/default.nix +++ b/pkgs/development/python-modules/coverage/default.nix @@ -7,13 +7,13 @@ buildPythonPackage rec { pname = "coverage"; - version = "6.2"; + version = "6.3.2"; # uses f strings disabled = pythonOlder "3.5"; src = fetchPypi { inherit pname version; - sha256 = "e2cad8093172b7d1595b4ad66f24270808658e11acf43a8f95b41276162eb5b8"; + sha256 = "sha256-A+KngmCGuR7zRf8YdC7p/Eemg5zNUXBh74+hl25lLOk="; }; # No tests in archive diff --git a/pkgs/development/python-modules/cssselect2/default.nix b/pkgs/development/python-modules/cssselect2/default.nix index 52c1bc4067f..987e84ffcee 100644 --- a/pkgs/development/python-modules/cssselect2/default.nix +++ b/pkgs/development/python-modules/cssselect2/default.nix @@ -1,5 +1,6 @@ { lib , buildPythonPackage +, flit-core , pythonOlder , fetchPypi , tinycss2 @@ -8,18 +9,23 @@ buildPythonPackage rec { pname = "cssselect2"; - version = "0.4.1"; + version = "0.5.0"; + format = "pyproject"; disabled = pythonOlder "3.5"; src = fetchPypi { inherit pname version; - sha256 = "93fbb9af860e95dd40bf18c3b2b6ed99189a07c0f29ba76f9c5be71344664ec8"; + sha256 = "sha256-2Yp7vdjrxGCTJ5GV1mmjNZvVoj+QwZ6CwZ2e7vMz5hc="; }; postPatch = '' sed -i '/^addopts/d' pyproject.toml ''; + nativeBuildInputs = [ + flit-core + ]; + propagatedBuildInputs = [ tinycss2 ]; checkInputs = [ pytestCheckHook ]; diff --git a/pkgs/development/python-modules/cx_freeze/default.nix b/pkgs/development/python-modules/cx_freeze/default.nix index 90e2608069c..fb02b0d1ef1 100644 --- a/pkgs/development/python-modules/cx_freeze/default.nix +++ b/pkgs/development/python-modules/cx_freeze/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "cx_Freeze"; - version = "6.9"; + version = "6.10"; src = fetchPypi { inherit pname version; - sha256 = "673aa3199af2ef87fc03a43a30e5d78b27ced2cedde925da89c55b5657da267b"; + sha256 = "sha256-5bcb9XuYgawUL76+riyLDTKUtW9uSKtkAyMh47Giuic="; }; disabled = pythonOlder "3.5"; diff --git a/pkgs/development/python-modules/cyclonedx-python-lib/default.nix b/pkgs/development/python-modules/cyclonedx-python-lib/default.nix index 26546c3f7cb..af638894831 100644 --- a/pkgs/development/python-modules/cyclonedx-python-lib/default.nix +++ b/pkgs/development/python-modules/cyclonedx-python-lib/default.nix @@ -17,7 +17,7 @@ buildPythonPackage rec { pname = "cyclonedx-python-lib"; - version = "1.3.0"; + version = "2.0.0"; format = "pyproject"; disabled = pythonOlder "3.6"; @@ -26,7 +26,7 @@ buildPythonPackage rec { owner = "CycloneDX"; repo = pname; rev = "v${version}"; - hash = "sha256-/1kWvhTUS0JT0RwodiivJSUiWIDwQyXxdjF/KUlCNds="; + hash = "sha256-S1bcUCHe4UYJuSHI8LMQZ/reS6YAE0hxrpw+QweFm/8="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/dask/default.nix b/pkgs/development/python-modules/dask/default.nix index 7af0eca747e..ffdca65a606 100644 --- a/pkgs/development/python-modules/dask/default.nix +++ b/pkgs/development/python-modules/dask/default.nix @@ -22,7 +22,7 @@ buildPythonPackage rec { pname = "dask"; - version = "2022.02.0"; + version = "2022.02.1"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -31,7 +31,7 @@ buildPythonPackage rec { owner = "dask"; repo = pname; rev = version; - hash = "sha256-tDqpIS8j6a16YbJak+P1GkCEZvJyheWV5vkUrkhScRY="; + hash = "sha256-A8ktvfpow/QKAEEt9SUnkTqYFJCrV1mgnuDIP3gdyrE="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/datadog/default.nix b/pkgs/development/python-modules/datadog/default.nix index c15e673fa3e..7d32650302f 100644 --- a/pkgs/development/python-modules/datadog/default.nix +++ b/pkgs/development/python-modules/datadog/default.nix @@ -2,6 +2,7 @@ , buildPythonPackage , fetchPypi , pythonOlder +, hatchling , decorator , requests , typing ? null @@ -17,17 +18,22 @@ buildPythonPackage rec { pname = "datadog"; - version = "0.43.0"; + version = "0.44.0"; + format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "1f2123083d9e1add6f238c62714b76ac2fc134d7d1c435cd82b976487b191b96"; + sha256 = "sha256-BxFw8MfvIlEdv3+b12xL5QDuLT1SBykApch7VJXSxzM="; }; postPatch = '' find . -name '*.pyc' -exec rm {} \; ''; + nativeBuildInputs = [ + hatchling + ]; + propagatedBuildInputs = [ decorator requests ] ++ lib.optional (pythonOlder "3.5") typing ++ lib.optional (pythonOlder "3.0") configparser; diff --git a/pkgs/development/python-modules/datasets/default.nix b/pkgs/development/python-modules/datasets/default.nix index ab5e929818c..baf27639fd4 100644 --- a/pkgs/development/python-modules/datasets/default.nix +++ b/pkgs/development/python-modules/datasets/default.nix @@ -16,13 +16,13 @@ buildPythonPackage rec { pname = "datasets"; - version = "1.17.0"; + version = "1.18.3"; src = fetchFromGitHub { owner = "huggingface"; repo = pname; rev = version; - sha256 = "0bsk3jldvcxak64dhlxkqax7mf83z6qpwfgfk32rni1gpnz5pqbd"; + sha256 = "sha256-2x6DpsDcVF2O5iJKeMEGw/aJwZPc7gSGaK2947c3B6s="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/datatable/default.nix b/pkgs/development/python-modules/datatable/default.nix index 9008270fc79..004e47a60b5 100644 --- a/pkgs/development/python-modules/datatable/default.nix +++ b/pkgs/development/python-modules/datatable/default.nix @@ -44,15 +44,9 @@ buildPythonPackage rec { LLVM = llvm; NIX_CFLAGS_COMPILE = lib.optionalString stdenv.isDarwin "-isystem ${lib.getDev libcxx}/include/c++/v1"; - pytestFlagsArray = let - # ini file (not included in tarball) required to change python_files setting, - pytestIni = writeText "pytest.ini" '' - [pytest] - python_files = test_*.py test-*.py - ''; - in [ - "-c ${pytestIni}" - ]; + # test suite is very cpu intensive, only run small subset to ensure package is working as expected + pytestFlagsArray = [ "tests/test-sets.py" ]; + disabledTests = [ # skip tests which are irrelevant to our installation or use way too much memory "test_xfunction_paths" diff --git a/pkgs/development/python-modules/deepdiff/default.nix b/pkgs/development/python-modules/deepdiff/default.nix index 67f5347e1e7..2601eedc2fa 100644 --- a/pkgs/development/python-modules/deepdiff/default.nix +++ b/pkgs/development/python-modules/deepdiff/default.nix @@ -12,18 +12,21 @@ buildPythonPackage rec { pname = "deepdiff"; - version = "5.6.0"; + version = "5.7.0"; format = "setuptools"; # pypi source does not contain all fixtures required for tests src = fetchFromGitHub { owner = "seperman"; repo = "deepdiff"; - rev = version; - sha256 = "sha256-ysaIeVefsTX7ZubOXaEzeS1kMyBp4/w3SHNFxsGVhzY="; + # 5.7.0 release not tagged https://github.com/seperman/deepdiff/issues/300 + rev = "f2ffdb83b2993f4f0bb7e854620f0acd0bf6339e"; + hash = "sha256-0UBx7sH2iMrLVl5FtHNTwoecLHi8GbInn75G3FSg4gk="; }; postPatch = '' + substituteInPlace requirements.txt \ + --replace "ordered-set==4.0.2" "ordered-set" substituteInPlace tests/test_command.py \ --replace '/tmp/' "$TMPDIR/" ''; diff --git a/pkgs/development/python-modules/detect-secrets/default.nix b/pkgs/development/python-modules/detect-secrets/default.nix index ef19b9a913b..e9227891e04 100644 --- a/pkgs/development/python-modules/detect-secrets/default.nix +++ b/pkgs/development/python-modules/detect-secrets/default.nix @@ -15,14 +15,14 @@ buildPythonPackage rec { pname = "detect-secrets"; - version = "1.1.0"; + version = "1.2.0"; disabled = isPy27; src = fetchFromGitHub { owner = "Yelp"; repo = pname; rev = "v${version}"; - sha256 = "sha256-dG2YaWXAMINxBGKNMlVfGTR9QHdnepiZmN+G88X4Wak="; + hash = "sha256-4VcV06iaL3NAj7qF8RyfWV1zgrt928AQfjGeuO2Pbjk="; leaveDotGit = true; }; diff --git a/pkgs/development/python-modules/devtools/default.nix b/pkgs/development/python-modules/devtools/default.nix index 5d4f0871bf7..34004769b1f 100644 --- a/pkgs/development/python-modules/devtools/default.nix +++ b/pkgs/development/python-modules/devtools/default.nix @@ -34,11 +34,18 @@ buildPythonPackage rec { pytest-mock ]; + pytestFlagsArray = [ + # pytest.PytestRemovedIn8Warning: Passing None has been deprecated. + "-W ignore::pytest.PytestRemovedIn8Warning" + ]; + disabledTests = [ # Test for Windows32 "test_print_subprocess" # sensitive to timing "test_multiple_not_verbose" + # sensitive to interpreter output + "test_simple_vars" ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/diff-cover/default.nix b/pkgs/development/python-modules/diff-cover/default.nix index cbb44fb7ca4..22435ae71ba 100644 --- a/pkgs/development/python-modules/diff-cover/default.nix +++ b/pkgs/development/python-modules/diff-cover/default.nix @@ -52,6 +52,8 @@ buildPythonPackage rec { "file_does_not_exist" # AssertionError: assert '.c { color:... "test_style_defs" + # uses pytest.approx in a boolean context, which is unsupported since pytest7 + "test_percent_covered" ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/distributed/default.nix b/pkgs/development/python-modules/distributed/default.nix index ee86418a665..2055c9de13e 100644 --- a/pkgs/development/python-modules/distributed/default.nix +++ b/pkgs/development/python-modules/distributed/default.nix @@ -19,7 +19,7 @@ buildPythonPackage rec { pname = "distributed"; - version = "2022.2.0"; + version = "2022.2.1"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -27,7 +27,7 @@ buildPythonPackage rec { # get full repository need conftest.py to run tests src = fetchPypi { inherit pname version; - hash = "sha256-Gi9u7JczpnAEg53E7N5tXBfAeWZaLBVzRU3SpbU3bZU="; + hash = "sha256-+2KnWvjvM7vhqoCmjAGjOpPBzVozLdAXq0SVW/fs9ls="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/distro/default.nix b/pkgs/development/python-modules/distro/default.nix index bf8675af941..deee452ae1b 100644 --- a/pkgs/development/python-modules/distro/default.nix +++ b/pkgs/development/python-modules/distro/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "distro"; - version = "1.6.0"; + version = "1.7.0"; src = fetchPypi { inherit pname version; - sha256 = "83f5e5a09f9c5f68f60173de572930effbcc0287bb84fdc4426cb4168c088424"; + sha256 = "sha256-FRrsz2DCFkApMrUuQO5HepOfjViJiSc3igKrvoUsHDk="; }; # tests are very targeted at individual linux distributions diff --git a/pkgs/development/python-modules/django-appconf/default.nix b/pkgs/development/python-modules/django-appconf/default.nix new file mode 100644 index 00000000000..66eef9d4728 --- /dev/null +++ b/pkgs/development/python-modules/django-appconf/default.nix @@ -0,0 +1,45 @@ +{ lib +, buildPythonPackage +, fetchFromGitHub +, pythonOlder +, django +, six +, python +}: + +buildPythonPackage rec { + pname = "django-appconf"; + version = "1.0.5"; + format = "setuptools"; + + disabled = pythonOlder "3.6"; + + src = fetchFromGitHub { + owner = "django-compressor"; + repo = "django-appconf"; + rev = "v${version}"; + hash = "sha256-nS4Hwp/NYg1XGvZO1tiE9mzJA7WFifyvgAjyp3YpqS4="; + }; + + propagatedBuildInputs = [ + django + ]; + + preCheck = '' + # prove we're running tests against installed package, not build dir + rm -r appconf + ''; + + checkPhase = '' + runHook preCheck + ${python.interpreter} -m django test --settings=tests.test_settings + runHook postCheck + ''; + + meta = with lib; { + description = "A helper class for handling configuration defaults of packaged apps gracefully"; + homepage = "https://django-appconf.readthedocs.org/"; + license = licenses.bsd2; + maintainers = with maintainers; [ desiderius ]; + }; +} diff --git a/pkgs/development/python-modules/django-raster/default.nix b/pkgs/development/python-modules/django-raster/default.nix index 713e7214cfb..f590aca527f 100644 --- a/pkgs/development/python-modules/django-raster/default.nix +++ b/pkgs/development/python-modules/django-raster/default.nix @@ -2,9 +2,7 @@ numpy, django_colorful, pillow, psycopg2, pyparsing, django, celery, boto3, importlib-metadata }: -if lib.versionOlder django.version "2.0" -then throw "django-raster requires Django >= 2.0. Consider overiding the python package set to use django_2." -else + buildPythonPackage rec { version = "0.8.1"; pname = "django-raster"; diff --git a/pkgs/development/python-modules/django-statici18n/default.nix b/pkgs/development/python-modules/django-statici18n/default.nix index 78c807903c4..db7d36c8993 100644 --- a/pkgs/development/python-modules/django-statici18n/default.nix +++ b/pkgs/development/python-modules/django-statici18n/default.nix @@ -1,4 +1,4 @@ -{ lib, buildPythonPackage, fetchPypi, django, django_appconf }: +{ lib, buildPythonPackage, fetchPypi, django, django-appconf }: buildPythonPackage rec { pname = "django-statici18n"; @@ -9,7 +9,7 @@ buildPythonPackage rec { sha256 = "dbcdac190d93e0b4eabcab8875c8eb68795eceb442f926843ec5cbe1432fe628"; }; - propagatedBuildInputs = [ django django_appconf ]; + propagatedBuildInputs = [ django django-appconf ]; # pypi package does not contains test harness # source tarball requires setting up a config diff --git a/pkgs/development/python-modules/django-widget-tweaks/default.nix b/pkgs/development/python-modules/django-widget-tweaks/default.nix index 63e575b6345..5fd29de1610 100644 --- a/pkgs/development/python-modules/django-widget-tweaks/default.nix +++ b/pkgs/development/python-modules/django-widget-tweaks/default.nix @@ -1,4 +1,16 @@ -{ buildPythonPackage, fetchFromGitHub, python, lib, django }: +{ lib +, buildPythonPackage +, fetchFromGitHub + +# native +, setuptools-scm + +# propagated +, django + +# tests +, python +}: buildPythonPackage rec { pname = "django-widget-tweaks"; @@ -11,15 +23,26 @@ buildPythonPackage rec { sha256 = "1rhn2skx287k6nnkxlwvl9snbia6w6z4c2rqg22hwzbz5w05b24h"; }; - checkPhase = "${python.interpreter} runtests.py"; - propagatedBuildInputs = [ django ]; + SETUPTOOLS_SCM_PRETEND_VERSION = version; + + nativeBuildInputs = [ + setuptools-scm + ]; + + propagatedBuildInputs = [ + django + ]; + + checkPhase = '' + ${python.interpreter} -m django test --settings=tests.settings + ''; meta = with lib; { - description = "Tweak the form field rendering in templates, not in python-level form definitions."; - homepage = "https://github.com/jazzband/django-widget-tweaks"; - license = licenses.mit; - maintainers = with maintainers; [ - maxxk - ]; + description = "Tweak the form field rendering in templates, not in python-level form definitions."; + homepage = "https://github.com/jazzband/django-widget-tweaks"; + license = licenses.mit; + maintainers = with maintainers; [ + maxxk + ]; }; } diff --git a/pkgs/development/python-modules/django/1.10-gis-libs.template.patch b/pkgs/development/python-modules/django/1.10-gis-libs.template.patch deleted file mode 100644 index da154554d1b..00000000000 --- a/pkgs/development/python-modules/django/1.10-gis-libs.template.patch +++ /dev/null @@ -1,24 +0,0 @@ -diff --git a/django/contrib/gis/gdal/libgdal.py b/django/contrib/gis/gdal/libgdal.py ---- a/django/contrib/gis/gdal/libgdal.py -+++ b/django/contrib/gis/gdal/libgdal.py -@@ -17,7 +17,7 @@ try: - lib_path = settings.GDAL_LIBRARY_PATH - except (AttributeError, EnvironmentError, - ImportError, ImproperlyConfigured): -- lib_path = None -+ lib_path = "@gdal@/lib/libgdal@extension@" - - if lib_path: - lib_names = None -diff --git a/django/contrib/gis/geos/libgeos.py b/django/contrib/gis/geos/libgeos.py ---- a/django/contrib/gis/geos/libgeos.py -+++ b/django/contrib/gis/geos/libgeos.py -@@ -26,7 +26,7 @@ try: - lib_path = settings.GEOS_LIBRARY_PATH - except (AttributeError, EnvironmentError, - ImportError, ImproperlyConfigured): -- lib_path = None -+ lib_path = "@geos@/lib/libgeos_c@extension@" - - # Setting the appropriate names for the GEOS-C library. - if lib_path: diff --git a/pkgs/development/python-modules/django/2.nix b/pkgs/development/python-modules/django/2.nix deleted file mode 100644 index 727bf304fdb..00000000000 --- a/pkgs/development/python-modules/django/2.nix +++ /dev/null @@ -1,39 +0,0 @@ -{ lib, stdenv, buildPythonPackage, fetchPypi, substituteAll, - isPy3k, - geos, gdal, pytz, sqlparse, - withGdal ? false -}: - -buildPythonPackage rec { - pname = "django"; - version = "2.2.27"; - - disabled = !isPy3k; - - src = fetchPypi { - pname = "Django"; - inherit version; - sha256 = "sha256-HuNwRrC/K2HoOzoB0GcyNRbsO28rF81JsTJt1LqdyRM="; - }; - - patches = lib.optional withGdal - (substituteAll { - src = ./1.10-gis-libs.template.patch; - geos = geos; - gdal = gdal; - extension = stdenv.hostPlatform.extensions.sharedLibrary; - }) - ; - - propagatedBuildInputs = [ pytz sqlparse ]; - - # too complicated to setup - doCheck = false; - - meta = with lib; { - description = "A high-level Python Web framework"; - homepage = "https://www.djangoproject.com/"; - license = licenses.bsd3; - maintainers = with maintainers; [ georgewhewell ]; - }; -} diff --git a/pkgs/development/python-modules/django_appconf/default.nix b/pkgs/development/python-modules/django_appconf/default.nix deleted file mode 100644 index 5da9ed0ca26..00000000000 --- a/pkgs/development/python-modules/django_appconf/default.nix +++ /dev/null @@ -1,35 +0,0 @@ -{ lib, buildPythonPackage, fetchFromGitHub, six, django, fetchpatch }: -buildPythonPackage rec { - pname = "django-appconf"; - version = "1.0.3"; - - src = fetchFromGitHub { - owner = "django-compressor"; - repo = "django-appconf"; - rev = version; - sha256 = "06hwbz7362y0la9np3df25mms235fcqgpd2vn0mnf8dri9spzy1h"; - }; - - propagatedBuildInputs = [ six django ]; - - patches = [ - (fetchpatch { - name = "backport_django_2_2.patch"; - url = "https://github.com/django-compressor/django-appconf/commit/1526a842ee084b791aa66c931b3822091a442853.patch"; - sha256 = "1vl2s6vlf15089s8p4c3g4d5iqm8jva66bdw683r8440f80ixgmw"; - }) - ]; - - checkPhase = '' - # prove we're running tests against installed package, not build dir - rm -r appconf - python -m django test --settings="tests.test_settings" - ''; - - meta = with lib; { - description = "A helper class for handling configuration defaults of packaged apps gracefully"; - homepage = "https://django-appconf.readthedocs.org/"; - license = licenses.bsd2; - maintainers = with maintainers; [ desiderius ]; - }; -} diff --git a/pkgs/development/python-modules/django_compressor/default.nix b/pkgs/development/python-modules/django_compressor/default.nix index a8204eab5fa..82684b52374 100644 --- a/pkgs/development/python-modules/django_compressor/default.nix +++ b/pkgs/development/python-modules/django_compressor/default.nix @@ -1,5 +1,5 @@ { lib, buildPythonPackage, fetchPypi, - rcssmin, rjsmin, django_appconf }: + rcssmin, rjsmin, django-appconf }: buildPythonPackage rec { pname = "django_compressor"; @@ -18,7 +18,7 @@ buildPythonPackage rec { # requires django-sekizai, which we don't have packaged yet doCheck = false; - propagatedBuildInputs = [ rcssmin rjsmin django_appconf ]; + propagatedBuildInputs = [ rcssmin rjsmin django-appconf ]; meta = with lib; { description = "Compresses linked and inline JavaScript or CSS into single cached files"; diff --git a/pkgs/development/python-modules/django_contrib_comments/default.nix b/pkgs/development/python-modules/django_contrib_comments/default.nix index 3f717b0fb5c..88bbdfdeddb 100644 --- a/pkgs/development/python-modules/django_contrib_comments/default.nix +++ b/pkgs/development/python-modules/django_contrib_comments/default.nix @@ -6,11 +6,11 @@ buildPythonPackage rec { pname = "django-contrib-comments"; - version = "2.1.0"; + version = "2.2.0"; src = fetchPypi { inherit pname version; - sha256 = "d82f1d04690550df026553053903deec0c52dc54212e1b79241b08f0355cff2c"; + sha256 = "sha256-SN4A8VZ34BaiFq7/IF1uAOQ5HJpXAhNsZBGcRytzVto="; }; propagatedBuildInputs = [ django ]; diff --git a/pkgs/development/python-modules/django_reversion/default.nix b/pkgs/development/python-modules/django_reversion/default.nix index 1bf4d6b4dab..f6bc72dc226 100644 --- a/pkgs/development/python-modules/django_reversion/default.nix +++ b/pkgs/development/python-modules/django_reversion/default.nix @@ -6,11 +6,11 @@ buildPythonPackage rec { pname = "django-reversion"; - version = "4.0.2"; + version = "5.0.0"; src = fetchPypi { inherit pname version; - sha256 = "sha256-XTO6lE2/GccDDJ5w43MSSK40Nozyr+3hDg0I+/ieb4w="; + sha256 = "sha256-C63jw5k4dFEIfwxng14NPRhtdn3mpcW6U6iOr8Pyccg="; }; # tests assume the availability of a mysql/postgresql database diff --git a/pkgs/development/python-modules/dm-haiku/default.nix b/pkgs/development/python-modules/dm-haiku/default.nix index 55a91006b06..03677faa689 100644 --- a/pkgs/development/python-modules/dm-haiku/default.nix +++ b/pkgs/development/python-modules/dm-haiku/default.nix @@ -15,13 +15,13 @@ buildPythonPackage rec { pname = "dm-haiku"; - version = "0.0.5"; + version = "0.0.6"; src = fetchFromGitHub { owner = "deepmind"; repo = pname; rev = "v${version}"; - sha256 = "1mdqjcka0m1div63ngba8w8z94id4c1h8xqmnq1xpmgkc79224wa"; + sha256 = "sha256-qvKMeGPiWXvvyV+GZdTWdsC6Wp08AmP8nDtWk7sZtqM="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/dnspython/default.nix b/pkgs/development/python-modules/dnspython/default.nix index 59730bff71e..5676d270935 100644 --- a/pkgs/development/python-modules/dnspython/default.nix +++ b/pkgs/development/python-modules/dnspython/default.nix @@ -5,6 +5,7 @@ , pythonOlder , setuptools-scm , pytestCheckHook +, cacert }: buildPythonPackage rec { @@ -20,16 +21,23 @@ buildPythonPackage rec { checkInputs = [ pytestCheckHook + ] ++ lib.optional stdenv.isDarwin [ + cacert ]; disabledTests = [ # dns.exception.SyntaxError: protocol not found "test_misc_good_WKS_text" - ] ++ lib.optionals stdenv.isDarwin [ - # unable to get local issuer certificate - "test_async" - "test_query" + # fails if IPv6 isn't available "test_resolver_override" + + # Tests that run inconsistently on darwin systems + ] ++ lib.optionals stdenv.isDarwin [ + # 9 tests fail with: BlockingIOError: [Errno 35] Resource temporarily unavailable + "testQueryUDP" + # 6 tests fail with: dns.resolver.LifetimeTimeout: The resolution lifetime expired after ... + "testResolveCacheHit" + "testResolveTCP" ]; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/doit/default.nix b/pkgs/development/python-modules/doit/default.nix index c7c66fceaa7..95b7adc474a 100644 --- a/pkgs/development/python-modules/doit/default.nix +++ b/pkgs/development/python-modules/doit/default.nix @@ -8,6 +8,7 @@ , cloudpickle , pyinotify , macfsevents +, toml }: buildPythonPackage rec { @@ -21,8 +22,10 @@ buildPythonPackage rec { sha256 = "sha256-OIER+Kals7RGIM7rKH0FhZJ8hdDW0/h5DTT7tFwM9sM="; }; - propagatedBuildInputs = [ cloudpickle ] - ++ lib.optional stdenv.isLinux pyinotify + propagatedBuildInputs = [ + cloudpickle + toml + ] ++ lib.optional stdenv.isLinux pyinotify ++ lib.optional stdenv.isDarwin macfsevents; # hangs on darwin diff --git a/pkgs/development/python-modules/dotmap/default.nix b/pkgs/development/python-modules/dotmap/default.nix index 1378569f3a9..b0627160e3e 100644 --- a/pkgs/development/python-modules/dotmap/default.nix +++ b/pkgs/development/python-modules/dotmap/default.nix @@ -7,14 +7,14 @@ buildPythonPackage rec { pname = "dotmap"; - version = "1.3.28"; + version = "1.3.29"; format = "setuptools"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-riqDYqtjstyx681zz80aZ6hBizNw4V3NOusInHGlXoI="; + hash = "sha256-5mhR+Ey8RrruucUIt5LxBNM6OBUWbLy5jNOWg6tzxRE="; }; checkInputs = [ diff --git a/pkgs/development/python-modules/dynalite-devices/default.nix b/pkgs/development/python-modules/dynalite-devices/default.nix index dafbcfc2f5c..3ee79ae4480 100644 --- a/pkgs/development/python-modules/dynalite-devices/default.nix +++ b/pkgs/development/python-modules/dynalite-devices/default.nix @@ -8,12 +8,12 @@ buildPythonPackage rec { pname = "dynalite-devices"; - version = "0.1.46"; + version = "0.46"; src = fetchFromGitHub { owner = "ziv1234"; repo = "python-dynalite-devices"; - rev = "v0.46"; # https://github.com/ziv1234/python-dynalite-devices/issues/2 + rev = "v${version}"; # https://github.com/ziv1234/python-dynalite-devices/issues/2 hash = "sha256-Fju2JpFkQBCbOln7r3L+crv82TI2SkdPJ1oaK7PEifo="; }; diff --git a/pkgs/development/python-modules/easyprocess/default.nix b/pkgs/development/python-modules/easyprocess/default.nix index c98a8b572d4..97707e0e9fd 100644 --- a/pkgs/development/python-modules/easyprocess/default.nix +++ b/pkgs/development/python-modules/easyprocess/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "EasyProcess"; - version = "0.3"; + version = "1.1"; src = fetchPypi { inherit pname version; - sha256 = "115rzzr0hx4af4m6krf7dxn8851n4l8jfxahjzjc2r0zq2m8v57v"; + sha256 = "sha256-iFiYMCpXqrlIlz6LXTKkIpOSufstmGqx1P/VkOW6kOw="; }; # No tests diff --git a/pkgs/development/python-modules/entrypoints/default.nix b/pkgs/development/python-modules/entrypoints/default.nix index a26d6ede890..1223f3f911d 100644 --- a/pkgs/development/python-modules/entrypoints/default.nix +++ b/pkgs/development/python-modules/entrypoints/default.nix @@ -1,31 +1,36 @@ { lib , buildPythonPackage +, pythonOlder , fetchPypi +, flit-core , configparser -, pytest -, isPy3k +, pytestCheckHook }: buildPythonPackage rec { pname = "entrypoints"; - version = "0.3"; + version = "0.4"; + format = "pyproject"; + + disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "c70dd71abe5a8c85e55e12c19bd91ccfeec11a6e99044204511f9ed547d48451"; + sha256 = "sha256-twbt2qkhihnrzWe1aBjwW7J1ibHKno15e3Sv+tTMrNQ="; }; - checkInputs = [ pytest ]; - - propagatedBuildInputs = lib.optional (!isPy3k) configparser; + nativeBuildInputs = [ + flit-core + ]; - checkPhase = '' - py.test tests - ''; + checkInputs = [ + pytestCheckHook + ]; - meta = { + meta = with lib; { description = "Discover and load entry points from installed packages"; homepage = "https://github.com/takluyver/entrypoints"; - license = lib.licenses.mit; + license = licenses.mit; + maintainers = with maintainers; [ ]; }; } diff --git a/pkgs/development/python-modules/faker/default.nix b/pkgs/development/python-modules/faker/default.nix index 048edf64d38..728339621f8 100644 --- a/pkgs/development/python-modules/faker/default.nix +++ b/pkgs/development/python-modules/faker/default.nix @@ -12,12 +12,12 @@ buildPythonPackage rec { pname = "faker"; - version = "11.3.0"; + version = "13.3.0"; src = fetchPypi { pname = "Faker"; inherit version; - hash = "sha256-rb5WfmTaahCX/qyraZAA4a0W4Xplkqjwrh7gt/vxmIc="; + hash = "sha256-YYsUDHdHV4bb46VAmtU1Ict2dGq3pcd7mcZj8+8bG8I="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/faraday-plugins/default.nix b/pkgs/development/python-modules/faraday-plugins/default.nix index 42f8a486050..e1c6fee726e 100644 --- a/pkgs/development/python-modules/faraday-plugins/default.nix +++ b/pkgs/development/python-modules/faraday-plugins/default.nix @@ -16,14 +16,14 @@ buildPythonPackage rec { pname = "faraday-plugins"; - version = "1.6.1"; + version = "1.6.2"; format = "setuptools"; src = fetchFromGitHub { owner = "infobyte"; repo = "faraday_plugins"; rev = "v${version}"; - sha256 = "sha256-NpPVA+fruI/xX0KMjRuRuMK8HYc/0ErbDhJOCNXKhyY="; + sha256 = "sha256-1YROdQvwfV5Wp7vsNYCy2X6yR6mplunchD0U4xGUNBc="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/fasteners/default.nix b/pkgs/development/python-modules/fasteners/default.nix index 0364022fa28..b1281c686d8 100644 --- a/pkgs/development/python-modules/fasteners/default.nix +++ b/pkgs/development/python-modules/fasteners/default.nix @@ -1,47 +1,32 @@ { lib , buildPythonPackage -, fetchPypi -, six -, monotonic +, fetchFromGitHub , diskcache -, more-itertools -, testtools -, isPy3k -, nose -, futures ? null +, pytestCheckHook }: buildPythonPackage rec { pname = "fasteners"; - version = "0.16.3"; + version = "0.17.3"; + format = "pyproject"; - src = fetchPypi { - inherit pname version; - sha256 = "b1ab4e5adfbc28681ce44b3024421c4f567e705cc3963c732bf1cba3348307de"; + src = fetchFromGitHub { + owner = "harlowja"; + repo = pname; + rev = version; + hash = "sha256-FVhHp8BZ/wQQyr5AcuDo94LlflixhjZ0SnheSdHuDVQ="; }; - propagatedBuildInputs = [ - six - monotonic - ]; - checkInputs = [ diskcache - more-itertools - testtools - nose - ] ++ lib.optionals (!isPy3k) [ - futures + pytestCheckHook ]; - checkPhase = '' - nosetests - ''; - meta = with lib; { description = "A python package that provides useful locks"; homepage = "https://github.com/harlowja/fasteners"; license = licenses.asl20; + maintainers = with maintainers; [ ]; }; } diff --git a/pkgs/development/python-modules/filelock/default.nix b/pkgs/development/python-modules/filelock/default.nix index 8eaed65ca73..16379ef85e1 100644 --- a/pkgs/development/python-modules/filelock/default.nix +++ b/pkgs/development/python-modules/filelock/default.nix @@ -8,13 +8,13 @@ buildPythonPackage rec { pname = "filelock"; - version = "3.4.2"; + version = "3.6.0"; format = "pyproject"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "38b4f4c989f9d06d44524df1b24bd19e167d851f19b50bf3e3559952dddc5b80"; + sha256 = "sha256-nNVAqTUuQyxyRqSP5OhxKxCssd8q0fMOjAcLgq4f7YU="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/findpython/default.nix b/pkgs/development/python-modules/findpython/default.nix new file mode 100644 index 00000000000..ad35f379b90 --- /dev/null +++ b/pkgs/development/python-modules/findpython/default.nix @@ -0,0 +1,53 @@ +{ lib +, buildPythonPackage +, fetchPypi +, pythonOlder + +# build time +, pdm-pep517 + +# runtime +, packaging + +# tests +, pytestCheckHook +}: + +let + pname = "findpython"; + version = "0.1.3"; +in +buildPythonPackage { + inherit pname version; + format = "pyproject"; + + disabled = pythonOlder "3.7"; + + src = fetchPypi { + inherit pname version; + hash = "sha256-tVpBa5/PLShyG/vqHOsqbLZ6APmexLlKdtoix6IAKHA="; + }; + + nativeBuildInputs = [ + pdm-pep517 + ]; + + propagatedBuildInputs = [ + packaging + ]; + + checkInputs = [ + pytestCheckHook + ]; + + pythonImportsCheck = [ + "findpython" + ]; + + meta = with lib; { + description = "A utility to find python versions on your system"; + homepage = "https://github.com/frostming/findpython"; + license = licenses.mit; + maintainers = with maintainers; [ hexa ]; + }; +} diff --git a/pkgs/development/python-modules/flask-compress/default.nix b/pkgs/development/python-modules/flask-compress/default.nix index fff330946d1..26e5feca03e 100644 --- a/pkgs/development/python-modules/flask-compress/default.nix +++ b/pkgs/development/python-modules/flask-compress/default.nix @@ -1,25 +1,43 @@ -{ lib, fetchPypi, buildPythonPackage, flask +{ lib +, fetchPypi +, buildPythonPackage +, setuptools-scm +, flask , brotli +, pytestCheckHook }: buildPythonPackage rec { - version = "1.10.1"; + version = "1.11"; pname = "Flask-Compress"; + format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "28352387efbbe772cfb307570019f81957a13ff718d994a9125fa705efb73680"; + sha256 = "sha256-9WnzLERtayXKjjR9UAOgUxgR73MmeABbADb8HJ6xwhw="; }; - postPatch = '' - sed -i -e 's/use_scm_version=.*/version="${version}",/' setup.py - ''; + nativeBuildInputs = [ + setuptools-scm + ]; - propagatedBuildInputs = [ flask brotli ]; + propagatedBuildInputs = [ + flask + brotli + ]; + + checkInputs = [ + pytestCheckHook + ]; + + pythonImportsCheck = [ + "flask_compress" + ]; meta = with lib; { description = "Compress responses in your Flask app with gzip"; - homepage = "https://libwilliam.github.io/flask-compress/"; + homepage = "https://github.com/colour-science/flask-compress"; + changelog = "https://github.com/colour-science/flask-compress/blob/v${version}/CHANGELOG.md"; license = licenses.mit; }; } diff --git a/pkgs/development/python-modules/flask-security-too/default.nix b/pkgs/development/python-modules/flask-security-too/default.nix index ddf5aa05c49..e88556c07d0 100644 --- a/pkgs/development/python-modules/flask-security-too/default.nix +++ b/pkgs/development/python-modules/flask-security-too/default.nix @@ -28,12 +28,12 @@ buildPythonPackage rec { pname = "flask-security-too"; - version = "4.1.2"; + version = "4.1.3"; src = fetchPypi { pname = "Flask-Security-Too"; inherit version; - sha256 = "16ws5n08vm7wsa2f7lrkxvc7jl3ah1xfylhhyzb4vvqmlk7x9hw8"; + sha256 = "sha256-mW2NKGeJpyR4Ri7m+KE3ElSg3E+P7qbzNTTCo3cskc8="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/flask/default.nix b/pkgs/development/python-modules/flask/default.nix index 6c05367b3d4..6b49d2d2a6e 100644 --- a/pkgs/development/python-modules/flask/default.nix +++ b/pkgs/development/python-modules/flask/default.nix @@ -12,12 +12,12 @@ }: buildPythonPackage rec { - version = "2.0.2"; + version = "2.0.3"; pname = "Flask"; src = fetchPypi { inherit pname version; - sha256 = "7b2fb8e934ddd50731893bdcdb00fc8c0315916f9fcd50d22c7cc1a95ab634e2"; + sha256 = "sha256-4RIMIoyi9VO0cN9KX6knq2YlhGdSYGmYGz6wqRkCaH0="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/fonttools/default.nix b/pkgs/development/python-modules/fonttools/default.nix index 50f5e87a29f..84f2edb7210 100644 --- a/pkgs/development/python-modules/fonttools/default.nix +++ b/pkgs/development/python-modules/fonttools/default.nix @@ -17,7 +17,7 @@ buildPythonPackage rec { pname = "fonttools"; - version = "4.29.0"; + version = "4.29.1"; # Bump to 3.7 when https://github.com/fonttools/fonttools/pull/2417 is merged disabled = pythonOlder "3.6"; @@ -26,7 +26,7 @@ buildPythonPackage rec { owner = pname; repo = pname; rev = version; - sha256 = "LnkpTEpZbbRAyqGPJXdfpHjh4t7n6LkjZGLhirVNl7E="; + sha256 = "sha256-xviNGFcb1wj5WuA6UxHpw3BkpdjSJL3fbsBytJacp8w="; }; # all dependencies are optional, but diff --git a/pkgs/development/python-modules/fs/default.nix b/pkgs/development/python-modules/fs/default.nix index 0ab3778f55c..6915ba8d050 100644 --- a/pkgs/development/python-modules/fs/default.nix +++ b/pkgs/development/python-modules/fs/default.nix @@ -20,11 +20,11 @@ buildPythonPackage rec { pname = "fs"; - version = "2.4.14"; + version = "2.4.15"; src = fetchPypi { inherit pname version; - sha256 = "9555dc2bc58c58cac03478ac7e9f622d29fe2d20a4384c24c90ab50de2c7b36c"; + sha256 = "sha256-sJ0CwxH0rdHm4rdXJMRQ6vz+7MkXV5IkyorSHazQoYI="; }; buildInputs = [ glibcLocales ]; diff --git a/pkgs/development/python-modules/ftfy/default.nix b/pkgs/development/python-modules/ftfy/default.nix index 5ea93ec179e..d214cb4f0a4 100644 --- a/pkgs/development/python-modules/ftfy/default.nix +++ b/pkgs/development/python-modules/ftfy/default.nix @@ -8,13 +8,13 @@ buildPythonPackage rec { pname = "ftfy"; - version = "6.0.3"; + version = "6.1.1"; disabled = !isPy3k; src = fetchPypi { inherit pname version; - sha256 = "ba71121a9c8d7790d3e833c6c1021143f3e5c4118293ec3afb5d43ed9ca8e72b"; + sha256 = "sha256-v8IBn4T82FFBkVIyCmN1YEoPFFnCgbWxmbLNDS5yf48="; }; propagatedBuildInputs = [ @@ -29,6 +29,12 @@ buildPythonPackage rec { export PATH=$out/bin:$PATH ''; + disabledTestPaths = [ + # Calls poetry and fails to match output exactly + "tests/test_cli.py" + ]; + + meta = with lib; { description = "Given Unicode text, make its representation consistent and possibly less broken"; homepage = "https://github.com/LuminosoInsight/python-ftfy"; diff --git a/pkgs/development/python-modules/genshi/default.nix b/pkgs/development/python-modules/genshi/default.nix index c476960bbf8..be6abbd8364 100644 --- a/pkgs/development/python-modules/genshi/default.nix +++ b/pkgs/development/python-modules/genshi/default.nix @@ -7,11 +7,11 @@ buildPythonPackage rec { pname = "Genshi"; - version = "0.7.5"; + version = "0.7.6"; src = fetchPypi { inherit pname version; - sha256 = "c12d6c2abf7df0ec661d9ff2e197522eae846e43dc58abd5a36443d05bc41135"; + sha256 = "sha256-NKLOi4DoQ/Ygxbe35ZqqNip2zpdkpvEQMig+2UWMOlk="; }; # FAIL: test_sanitize_remove_script_elem (genshi.filters.tests.html.HTMLSanitizerTestCase) diff --git a/pkgs/development/python-modules/gidgethub/default.nix b/pkgs/development/python-modules/gidgethub/default.nix index 691af2eda84..9d1fdc07d90 100644 --- a/pkgs/development/python-modules/gidgethub/default.nix +++ b/pkgs/development/python-modules/gidgethub/default.nix @@ -16,13 +16,13 @@ buildPythonPackage rec { pname = "gidgethub"; - version = "5.0.1"; + version = "5.1.0"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "3efbd6998600254ec7a2869318bd3ffde38edc3a0d37be0c14bc46b45947b682"; + sha256 = "sha256-kNGTb6mA2XBaljYvpOWaKFEks3NigsiPgmdIgSMKTiU="; }; nativeBuildInputs = [ setuptools pytest-runner ]; diff --git a/pkgs/development/python-modules/github3_py/default.nix b/pkgs/development/python-modules/github3_py/default.nix index 1f5c983e14f..67e1868fb8b 100644 --- a/pkgs/development/python-modules/github3_py/default.nix +++ b/pkgs/development/python-modules/github3_py/default.nix @@ -18,11 +18,11 @@ buildPythonPackage rec { pname = "github3.py"; - version = "3.0.0"; + version = "3.2.0"; src = fetchPypi { inherit pname version; - sha256 = "a9134cb9efd334b1644ad7c5ee3ff3ff488317c4549ffc0e8d82e4d63383a1a4"; + sha256 = "sha256-Cbcr4Ul9NGsJaM3oNgoNavedwgbQFJpjzT7IbGXDd8w="; }; checkInputs = [ betamax pytest betamax-matchers ] diff --git a/pkgs/development/python-modules/google-api-python-client/default.nix b/pkgs/development/python-modules/google-api-python-client/default.nix index 772f45411d3..493bda2f9d5 100644 --- a/pkgs/development/python-modules/google-api-python-client/default.nix +++ b/pkgs/development/python-modules/google-api-python-client/default.nix @@ -13,14 +13,14 @@ buildPythonPackage rec { pname = "google-api-python-client"; - version = "2.35.0"; + version = "2.39.0"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "038b12979ea86ef0e33962bd33f955c337bc28f0471522bd27a801d52bfb4ae2"; + sha256 = "sha256-QBFpIV7K+1r7aD0/4OQ8BZ62Jccf6hkp8WQD3acqLcE="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/graphql-relay/default.nix b/pkgs/development/python-modules/graphql-relay/default.nix index 08e27c19487..d5460461925 100644 --- a/pkgs/development/python-modules/graphql-relay/default.nix +++ b/pkgs/development/python-modules/graphql-relay/default.nix @@ -10,11 +10,11 @@ buildPythonPackage rec { pname = "graphql-relay"; - version = "3.1.0"; + version = "3.1.5"; src = fetchPypi { inherit pname version; - sha256 = "sha256-cNWn7lmV6nwqmjflEidmOxpGTx9A6Y/d6VC+VBXf4LQ="; + sha256 = "sha256-En9AkT8Ry4R0Uu95STEmGq47Ii6q+Xb3yEMCmFNOVNM="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/graphql-subscription-manager/default.nix b/pkgs/development/python-modules/graphql-subscription-manager/default.nix index 2ca6a134ee2..ab12d350088 100644 --- a/pkgs/development/python-modules/graphql-subscription-manager/default.nix +++ b/pkgs/development/python-modules/graphql-subscription-manager/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { pname = "graphql-subscription-manager"; - version = "0.5.5"; + version = "0.5.6"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -17,7 +17,7 @@ buildPythonPackage rec { owner = "Danielhiversen"; repo = "PyGraphqlWebsocketManager"; rev = version; - hash = "sha256-7MqFsttMNnWmmWKj1zaOORBTDGt6Wm8GU7w56DfPl2c="; + hash = "sha256-nieKl25yDc3FHnMqwn6FNzWKd8sas3rTlBonYbJc1tg="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/graphviz/default.nix b/pkgs/development/python-modules/graphviz/default.nix index 881dec6b932..46a541fe504 100644 --- a/pkgs/development/python-modules/graphviz/default.nix +++ b/pkgs/development/python-modules/graphviz/default.nix @@ -1,4 +1,5 @@ { lib +, stdenv , buildPythonPackage , pythonOlder , fetchFromGitHub @@ -58,6 +59,9 @@ buildPythonPackage rec { runHook postCheck ''; + # Too many failures due to attempting to connect to com.apple.fonts daemon + doCheck = !stdenv.isDarwin; + meta = with lib; { description = "Simple Python interface for Graphviz"; homepage = "https://github.com/xflr6/graphviz"; diff --git a/pkgs/development/python-modules/graspologic/default.nix b/pkgs/development/python-modules/graspologic/default.nix index 10e7190d1fd..1a246461e5f 100644 --- a/pkgs/development/python-modules/graspologic/default.nix +++ b/pkgs/development/python-modules/graspologic/default.nix @@ -15,7 +15,7 @@ buildPythonPackage rec { pname = "graspologic"; - version = "0.3.1"; + version = "1.0.0"; disabled = isPy27; @@ -23,7 +23,7 @@ buildPythonPackage rec { owner = "microsoft"; repo = "graspologic"; rev = "v${version}"; - sha256 = "07dmfb1aplha01d22b41js7634dac4v28pv1l3bzssqhi4yyds7h"; + sha256 = "sha256-mzJ3eFo77gnOh/Vs9u68yFDZW3ilXtcCCwKahKyRRmc="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/grpcio-status/default.nix b/pkgs/development/python-modules/grpcio-status/default.nix index b20426c0288..fc069dccbaf 100644 --- a/pkgs/development/python-modules/grpcio-status/default.nix +++ b/pkgs/development/python-modules/grpcio-status/default.nix @@ -9,14 +9,14 @@ buildPythonPackage rec { pname = "grpcio-status"; - version = "1.43.0"; + version = "1.44.0"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-IXWQBvNqf/v/GH1BkfQRjActiqn6aCOhGq14QqPGzNA="; + sha256 = "sha256-rGE6t6RTgMv6PlKQItCzcxfYWPFyum5lwYiqc1VTk5g="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/grpcio-tools/default.nix b/pkgs/development/python-modules/grpcio-tools/default.nix index 78d952f4cb9..c428be64307 100644 --- a/pkgs/development/python-modules/grpcio-tools/default.nix +++ b/pkgs/development/python-modules/grpcio-tools/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "grpcio-tools"; - version = "1.43.0"; + version = "1.44.0"; src = fetchPypi { inherit pname version; - sha256 = "f42f1d713096808b1b0472dd2a3749b712d13f0092dab9442d9c096446e860b2"; + sha256 = "sha256-vjf0WOpRDJqPHKq7wrJY0S5V0YmlZ/Xtys6Q8n3A778="; }; outputs = [ "out" "dev" ]; diff --git a/pkgs/development/python-modules/gssapi/default.nix b/pkgs/development/python-modules/gssapi/default.nix index d500c645321..f703820a4f5 100644 --- a/pkgs/development/python-modules/gssapi/default.nix +++ b/pkgs/development/python-modules/gssapi/default.nix @@ -17,14 +17,14 @@ buildPythonPackage rec { pname = "gssapi"; - version = "1.7.2"; + version = "1.7.3"; disabled = pythonOlder "3.6"; src = fetchFromGitHub { owner = "pythongssapi"; repo = "python-${pname}"; rev = "v${version}"; - sha256 = "1xdcnm66b07m7chf04pp58p3khvy547hns1fw1xffd4n51kl42pp"; + sha256 = "sha256-/1YOnG6sCP8G8J3K2/RycTC95rXW9M+U3Mjz4GCt13s="; }; # It's used to locate headers diff --git a/pkgs/development/python-modules/gym/default.nix b/pkgs/development/python-modules/gym/default.nix index 1616343f8b4..aff7d1a2978 100644 --- a/pkgs/development/python-modules/gym/default.nix +++ b/pkgs/development/python-modules/gym/default.nix @@ -7,13 +7,13 @@ buildPythonPackage rec { pname = "gym"; - version = "0.21.0"; + version = "0.22.0"; src = fetchFromGitHub { owner = "openai"; repo = pname; - rev = "v${version}"; - sha256 = "12b545xz0r2g4z5r7f8amxl7nm0lqymkzwcwhg1bni9h0sxwpv6c"; + rev = version; + sha256 = "sha256-JbPWLuQGo+fErUlCKKpMwWdu0KvXBDuH2MeAHdJCTgM="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/h11/default.nix b/pkgs/development/python-modules/h11/default.nix index f3d37dacfa3..be4802566f7 100644 --- a/pkgs/development/python-modules/h11/default.nix +++ b/pkgs/development/python-modules/h11/default.nix @@ -6,11 +6,11 @@ buildPythonPackage rec { pname = "h11"; - version = "0.12.0"; + version = "0.13.0"; src = fetchPypi { inherit pname version; - sha256 = "0hk0nll6qazsambp3kl8cxxsbl4gv5y9252qadyk0jky0sv2q8j7"; + sha256 = "sha256-cIE8ETUIeiSKTTjMDhoBgf+rIYgUGpPq9WeUDDlX/wY="; }; checkInputs = [ pytestCheckHook ]; diff --git a/pkgs/development/python-modules/hachoir/default.nix b/pkgs/development/python-modules/hachoir/default.nix index 2c46b14a274..c7d4178e3bf 100644 --- a/pkgs/development/python-modules/hachoir/default.nix +++ b/pkgs/development/python-modules/hachoir/default.nix @@ -3,17 +3,21 @@ , fetchFromGitHub , pytestCheckHook , urwid +, pythonOlder }: buildPythonPackage rec { pname = "hachoir"; - version = "3.1.2"; + version = "3.1.3"; + format = "setuptools"; + + disabled = pythonOlder "3.7"; src = fetchFromGitHub { owner = "vstinner"; repo = pname; rev = version; - sha256 = "06544qmmimvaznwcjs8wwfih1frdd7anwcw5z07cf69l8p146p0y"; + hash = "sha256-HlxDwkU0GccO+IUzbtVpLbsAo+Mcacm4/WrXWCsmpBg="; }; propagatedBuildInputs = [ @@ -24,7 +28,9 @@ buildPythonPackage rec { pytestCheckHook ]; - pythonImportsCheck = [ "hachoir" ]; + pythonImportsCheck = [ + "hachoir" + ]; meta = with lib; { description = "Python library to view and edit a binary stream"; diff --git a/pkgs/development/python-modules/hahomematic/default.nix b/pkgs/development/python-modules/hahomematic/default.nix index b70c8081975..512f92deb1b 100644 --- a/pkgs/development/python-modules/hahomematic/default.nix +++ b/pkgs/development/python-modules/hahomematic/default.nix @@ -14,7 +14,7 @@ buildPythonPackage rec { pname = "hahomematic"; - version = "1.0.4"; + version = "1.0.5"; format = "setuptools"; disabled = pythonOlder "3.9"; @@ -23,7 +23,7 @@ buildPythonPackage rec { owner = "danielperna84"; repo = pname; rev = version; - sha256 = "sha256-YpsZKhuK3IzUZFNmBToBOuUacaDgbMC/N7pZDjuSzbE="; + sha256 = "sha256-8iLQpNax0xgjf+vUo6OcXMF1aZuaRFZBos8EC1gJEPA="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/hass-nabucasa/default.nix b/pkgs/development/python-modules/hass-nabucasa/default.nix index e7732e1f6a4..edf19d0e190 100644 --- a/pkgs/development/python-modules/hass-nabucasa/default.nix +++ b/pkgs/development/python-modules/hass-nabucasa/default.nix @@ -28,7 +28,8 @@ buildPythonPackage rec { sed -i 's/"acme.*"/"acme"/' setup.py substituteInPlace setup.py \ --replace "cryptography>=2.8,<4.0" "cryptography" \ - --replace "snitun==" "snitun>=" + --replace "snitun==" "snitun>=" \ + --replace "pycognito==2022.01.0" "pycognito" ''; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/hatasmota/default.nix b/pkgs/development/python-modules/hatasmota/default.nix index 6a0a3793d87..b710e5fb2e2 100644 --- a/pkgs/development/python-modules/hatasmota/default.nix +++ b/pkgs/development/python-modules/hatasmota/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { pname = "hatasmota"; - version = "0.3.1"; + version = "0.4.0"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -17,7 +17,7 @@ buildPythonPackage rec { owner = "emontnemery"; repo = pname; rev = version; - sha256 = "sha256-/am6cRhAdiqMq0u7Ed4qhIA+Em2O0gIt7HfP19+2XHw="; + sha256 = "sha256-r9EBuaKxc7Vcdfk8zoDpIi2i6yIGc7soSWx+RjG+SZo="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/hatchling/default.nix b/pkgs/development/python-modules/hatchling/default.nix new file mode 100644 index 00000000000..09cbdead671 --- /dev/null +++ b/pkgs/development/python-modules/hatchling/default.nix @@ -0,0 +1,79 @@ +{ lib +, buildPythonPackage +, fetchPypi +, pythonOlder + +# runtime +, editables +, importlib-metadata # < 3.8 +, packaging +, pathspec +, pluggy +, tomli + +# tests +, build +, python +, requests +, toml +, virtualenv +}: + +let + pname = "hatchling"; + version = "0.20.1"; +in +buildPythonPackage { + inherit pname version; + format = "pyproject"; + + src = fetchPypi { + inherit pname version; + hash = "sha256-l1VRce5H3CSAwZBeuxRyy7bNpOM6zX5s2L1/DXPo/Bg="; + }; + + # listed in backend/src/hatchling/ouroboros.py + propagatedBuildInputs = [ + editables + packaging + pathspec + pluggy + tomli + ] ++ lib.optionals (pythonOlder "3.8") [ + importlib-metadata + ]; + + pythonImportsCheck = [ + "hatchling" + "hatchling.build" + ]; + + # tries to fetch packages from the internet + doCheck = false; + + # listed in /backend/tests/downstream/requirements.txt + checkInputs = [ + build + packaging + requests + toml + virtualenv + ]; + + preCheck = '' + export HOME=$TMPDIR + ''; + + checkPhase = '' + runHook preCheck + ${python.interpreter} tests/downstream/integrate.py + runHook postCheck + ''; + + meta = with lib; { + description = "Modern, extensible Python build backend"; + homepage = "https://ofek.dev/hatch/latest/"; + license = licenses.mit; + maintainers = with maintainers; [ hexa ofek ]; + }; +} diff --git a/pkgs/development/python-modules/hg-git/default.nix b/pkgs/development/python-modules/hg-git/default.nix index eccdcdaed42..be3edd37218 100644 --- a/pkgs/development/python-modules/hg-git/default.nix +++ b/pkgs/development/python-modules/hg-git/default.nix @@ -7,11 +7,11 @@ buildPythonPackage rec { pname = "hg-git"; - version = "0.10.3"; + version = "0.10.4"; src = fetchPypi { inherit pname version; - sha256 = "27e6d7686a1548d4632dcc977f2ff3ce2e42d80735339b1f3b389b7481260cc4"; + sha256 = "sha256-guJlIm9HPTgKw5cg/s7rFST/crAXfPxGYGeZxEJ+hcw="; }; propagatedBuildInputs = [ dulwich mercurial ]; diff --git a/pkgs/development/python-modules/hmmlearn/default.nix b/pkgs/development/python-modules/hmmlearn/default.nix index 17f5126367b..bdeff30b761 100644 --- a/pkgs/development/python-modules/hmmlearn/default.nix +++ b/pkgs/development/python-modules/hmmlearn/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "hmmlearn"; - version = "0.2.6"; + version = "0.2.7"; src = fetchurl { url = "mirror://pypi/h/hmmlearn/${pname}-${version}.tar.gz"; - sha256 = "2a289cf28b31be59fa8ba5d3253d4a2a992401d45a8cdc221ae484fbf390c0d7"; + sha256 = "sha256-a0snIPJ6912pNnq02Q3LAPONozFo322Rf57F3mZw9uE="; }; buildInputs = [ setuptools-scm cython ]; diff --git a/pkgs/development/python-modules/httpcore/default.nix b/pkgs/development/python-modules/httpcore/default.nix index 79d979b10a9..7f028c478fc 100644 --- a/pkgs/development/python-modules/httpcore/default.nix +++ b/pkgs/development/python-modules/httpcore/default.nix @@ -12,6 +12,7 @@ , pytest-cov , pytest-httpbin , sniffio +, socksio , trio , trustme , uvicorn @@ -19,22 +20,28 @@ buildPythonPackage rec { pname = "httpcore"; - version = "0.14.4"; + version = "0.14.7"; disabled = pythonOlder "3.6"; src = fetchFromGitHub { owner = "encode"; repo = pname; rev = version; - sha256 = "19zsg8ijw0s1722ka67mjxx5z07lx9jq36z97l1fa6z1129wq240"; + sha256 = "sha256-h+3MfP1p/ifN0mF/xxrOKPTjD4Q7WzRh94YO4DYSuXE="; }; + postPatch = '' + substituteInPlace setup.py \ + --replace "h11>=0.11,<0.13" "h11>=0.11,<0.14" + ''; + propagatedBuildInputs = [ anyio certifi h11 h2 sniffio + socksio ]; checkInputs = [ diff --git a/pkgs/development/python-modules/httplib2/default.nix b/pkgs/development/python-modules/httplib2/default.nix index cd2134418a7..9fc6b4ff144 100644 --- a/pkgs/development/python-modules/httplib2/default.nix +++ b/pkgs/development/python-modules/httplib2/default.nix @@ -52,7 +52,13 @@ buildPythonPackage rec { # ValueError: Unable to load PEM file. # https://github.com/httplib2/httplib2/issues/192#issuecomment-993165140 "test_client_cert_password_verified" - ] ++ lib.optionals (stdenv.isDarwin) [ + + # improper pytest marking + "test_head_301" + "test_303" + ] ++ lib.optionals stdenv.isDarwin [ + # fails with "ConnectionResetError: [Errno 54] Connection reset by peer" + "test_connection_close" # fails with HTTP 408 Request Timeout, instead of expected 200 OK "test_timeout_subsequent" "test_connection_close" diff --git a/pkgs/development/python-modules/httptools/default.nix b/pkgs/development/python-modules/httptools/default.nix index 0a5b510b0ad..963a9ff5ebf 100644 --- a/pkgs/development/python-modules/httptools/default.nix +++ b/pkgs/development/python-modules/httptools/default.nix @@ -6,12 +6,12 @@ buildPythonPackage rec { pname = "httptools"; - version = "0.3.0"; + version = "0.4.0"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "3f9b4856d46ba1f0c850f4e84b264a9a8b4460acb20e865ec00978ad9fbaa4cf"; + sha256 = "sha256-LJqTDDeLPRXWtpX7levP+BpzlbT5d1xPEKB2vrCywf8="; }; # tests are not included in pypi tarball diff --git a/pkgs/development/python-modules/httpx/default.nix b/pkgs/development/python-modules/httpx/default.nix index d479cc1f13c..dbf8d1745c0 100644 --- a/pkgs/development/python-modules/httpx/default.nix +++ b/pkgs/development/python-modules/httpx/default.nix @@ -20,7 +20,7 @@ buildPythonPackage rec { pname = "httpx"; - version = "0.21.3"; + version = "0.22.0"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -29,7 +29,7 @@ buildPythonPackage rec { owner = "encode"; repo = pname; rev = version; - sha256 = "01069b0kj6vnb26xazlz06rj4yncy5nkq76pajvzx0pmpjkniiz9"; + sha256 = "sha256-hQmQodGpVG23IZSsWV7rB1iB6QAudDao/8YshIgpmas="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/huggingface-hub/default.nix b/pkgs/development/python-modules/huggingface-hub/default.nix index cf0b27c6c5b..3bbc8ad2669 100644 --- a/pkgs/development/python-modules/huggingface-hub/default.nix +++ b/pkgs/development/python-modules/huggingface-hub/default.nix @@ -14,13 +14,13 @@ buildPythonPackage rec { pname = "huggingface-hub"; - version = "0.1.2"; + version = "0.4.0"; src = fetchFromGitHub { owner = "huggingface"; repo = "huggingface_hub"; rev = "v${version}"; - sha256 = "1pmi76vinwwn0bcxy5hj8pxhzqxdbzp0y3hsd631yyys01s0n6xd"; + sha256 = "sha256-rrkubNy60e/1VcGacYQang4yWxUzIBGySxZyq6G1arw="; }; nativeBuildInputs = [ packaging ]; diff --git a/pkgs/development/python-modules/humanize/default.nix b/pkgs/development/python-modules/humanize/default.nix index d0b2464608b..fa13cdab0c2 100644 --- a/pkgs/development/python-modules/humanize/default.nix +++ b/pkgs/development/python-modules/humanize/default.nix @@ -9,7 +9,7 @@ }: buildPythonPackage rec { - version = "3.13.1"; + version = "4.0.0"; pname = "humanize"; format = "pyproject"; @@ -19,7 +19,7 @@ buildPythonPackage rec { owner = "jmoiron"; repo = pname; rev = version; - sha256 = "sha256-lgGBvYb3ciqETBOR31gxQVD7YyopTtmr++nCwvm63Zs="; + sha256 = "sha256-v4OdZmUI2LCick4qCSGOHJ7jtWybwKTeTeIcly+QQQQ="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/hypothesis/default.nix b/pkgs/development/python-modules/hypothesis/default.nix index 89aac153172..c928a13950c 100644 --- a/pkgs/development/python-modules/hypothesis/default.nix +++ b/pkgs/development/python-modules/hypothesis/default.nix @@ -19,7 +19,7 @@ buildPythonPackage rec { # If you need these, you can just add them to your environment. pname = "hypothesis"; - version = "6.35.0"; + version = "6.38.0"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -28,7 +28,7 @@ buildPythonPackage rec { owner = "HypothesisWorks"; repo = "hypothesis-python"; rev = "hypothesis-python-${version}"; - sha256 = "08wph7q3c08480ma2p7m7mamy0g7g7r5jqpwdyhdga4cfg734527"; + sha256 = "sha256-JLAM9gBf/Lh+UO7audy6V2jEPg5Cn4DR7moQV7VBwGc="; }; postUnpack = "sourceRoot=$sourceRoot/hypothesis-python"; diff --git a/pkgs/development/python-modules/hypothesmith/default.nix b/pkgs/development/python-modules/hypothesmith/default.nix index ee8b897154b..33174deb657 100644 --- a/pkgs/development/python-modules/hypothesmith/default.nix +++ b/pkgs/development/python-modules/hypothesmith/default.nix @@ -17,7 +17,11 @@ buildPythonPackage rec { checkInputs = [ black parso pytestCheckHook pytest-cov pytest-xdist ]; - pytestFlagsArray = [ "-v" ]; # tests are fairly slow, prevents timeout due to no stdout printing + pytestFlagsArray = [ + "-v" + "--numprocesses $NIX_BUILD_CORES" + ]; + pythonImportsCheck = [ "hypothesmith" ]; meta = with lib; { diff --git a/pkgs/development/python-modules/hyppo/default.nix b/pkgs/development/python-modules/hyppo/default.nix index 61966bc7de7..b09d5bd565f 100644 --- a/pkgs/development/python-modules/hyppo/default.nix +++ b/pkgs/development/python-modules/hyppo/default.nix @@ -13,7 +13,7 @@ buildPythonPackage rec { pname = "hyppo"; - version = "0.2.2"; + version = "0.3.2"; disabled = pythonOlder "3.6"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "neurodata"; repo = pname; rev = "v${version}"; - sha256 = "1wrzrppyjq0pc03bn6qcslxzcnwn7fr2z5lm71gfpli5k05i26nr"; + sha256 = "sha256-DQ5DrQrFBJ3dnGAjD1c/7GCJeR3g+aL2poR4hwOvmPA="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/imageio/default.nix b/pkgs/development/python-modules/imageio/default.nix index 98495932fda..9c449c69b77 100644 --- a/pkgs/development/python-modules/imageio/default.nix +++ b/pkgs/development/python-modules/imageio/default.nix @@ -1,26 +1,36 @@ { lib +, stdenv , buildPythonPackage , isPy27 , fetchPypi -, fetchpatch +, substituteAll , imageio-ffmpeg , numpy , pillow , psutil , pytestCheckHook , tifffile +, fsspec +, libGL }: buildPythonPackage rec { pname = "imageio"; - version = "2.14.1"; + version = "2.16.1"; disabled = isPy27; src = fetchPypi { - sha256 = "sha256-cJwY+ACYHkKGq+S9hrbJtbtuKFtrkztboJYu+OeZQFg="; + sha256 = "sha256-fxI8sjp3rFq+jtTnrWpggxqC3ixdEjRj3PHUJ4xHedI="; inherit pname version; }; + patches = [ + (substituteAll { + src = ./libgl-path.patch; + libgl = "${libGL.out}/lib/libGL${stdenv.hostPlatform.extensions.sharedLibrary}"; + }) + ]; + propagatedBuildInputs = [ imageio-ffmpeg numpy @@ -28,34 +38,33 @@ buildPythonPackage rec { ]; checkInputs = [ + fsspec psutil pytestCheckHook tifffile ]; + pytestFlagsArray = [ + "-m 'not needs_internet'" + ]; + preCheck = '' export IMAGEIO_USERDIR="$TMP" - export IMAGEIO_NO_INTERNET="true" - export HOME="$(mktemp -d)" + export HOME=$TMPDIR ''; - disabledTests = [ - # tries to pull remote resources, even with IMAGEIO_NO_INTERNET - "test_png_remote" - # needs git history - "test_mvolread_out_of_bytes" - "test_imiter" - "test_memory_size" - "test_legacy_write_empty" - ]; - disabledTestPaths = [ + # tries to fetch fixtures over the network + "tests/test_freeimage.py" "tests/test_pillow.py" + "tests/test_spe.py" + "tests/test_swf.py" ]; meta = with lib; { description = "Library for reading and writing a wide range of image, video, scientific, and volumetric data formats"; homepage = "http://imageio.github.io/"; license = licenses.bsd2; + maintainers = with maintainers; [ ]; }; } diff --git a/pkgs/development/python-modules/imageio/libgl-path.patch b/pkgs/development/python-modules/imageio/libgl-path.patch new file mode 100644 index 00000000000..f2a2bbfa093 --- /dev/null +++ b/pkgs/development/python-modules/imageio/libgl-path.patch @@ -0,0 +1,13 @@ +diff --git a/tests/test_core.py b/tests/test_core.py +index 2cdbb3a..032974c 100644 +--- a/tests/test_core.py ++++ b/tests/test_core.py +@@ -129,7 +129,7 @@ def test_findlib2(): + open(os.path.join(fi_dir, "notalib.test.so"), "wb") + + # Loading libs +- gllib = ctypes.util.find_library("GL") ++ gllib = "@libgl@" + core.load_lib([gllib], []) + # Fail + raises(ValueError, core.load_lib, [], []) # Nothing given diff --git a/pkgs/development/python-modules/importlib-metadata/default.nix b/pkgs/development/python-modules/importlib-metadata/default.nix index 3917742a55a..31181d9b1af 100644 --- a/pkgs/development/python-modules/importlib-metadata/default.nix +++ b/pkgs/development/python-modules/importlib-metadata/default.nix @@ -2,6 +2,7 @@ , buildPythonPackage , fetchPypi , pythonOlder +, setuptools , setuptools-scm , typing-extensions , toml @@ -10,7 +11,7 @@ buildPythonPackage rec { pname = "importlib-metadata"; - version = "4.11.0"; + version = "4.11.2"; format = "pyproject"; disabled = pythonOlder "3.7"; @@ -18,10 +19,11 @@ buildPythonPackage rec { src = fetchPypi { pname = "importlib_metadata"; inherit version; - hash = "sha256-nl5VO7uhhDy0oAgjAUuQdha+Ru5QPSuboAHSFKjaIY8="; + hash = "sha256-s2/6kl/jE5svb/EdaSX/1Pp7xHhwFl46wmCse0+R5qw="; }; nativeBuildInputs = [ + setuptools # otherwise cross build fails setuptools-scm ]; diff --git a/pkgs/development/python-modules/intbitset/default.nix b/pkgs/development/python-modules/intbitset/default.nix index db98be8276c..798bdbbd251 100644 --- a/pkgs/development/python-modules/intbitset/default.nix +++ b/pkgs/development/python-modules/intbitset/default.nix @@ -1,36 +1,23 @@ { lib , fetchPypi , buildPythonPackage -, six -, nose +, pytestCheckHook }: + buildPythonPackage rec { pname = "intbitset"; - version = "2.4.1"; + version = "3.0.0"; + format = "setuptools"; src = fetchPypi { inherit pname version; - sha256 = "44bca80b8cc702d5a56f0686f2bb5e028ab4d0c2c1761941589d46b7fa2c701c"; + sha256 = "sha256-tDG3CAlTZvz9Pi2pLq0TEPhl3DyYuWQS1N6VNNNokEE="; }; - patches = [ - # fixes compilation on aarch64 and determinism (uses -march=core2 and - # -mtune=native) - ./remove-impure-tuning.patch - ]; - - propagatedBuildInputs = [ - six - ]; - checkInputs = [ - nose + pytestCheckHook ]; - checkPhase = '' - nosetests - ''; - pythonImportsCheck = [ "intbitset" ]; diff --git a/pkgs/development/python-modules/intbitset/remove-impure-tuning.patch b/pkgs/development/python-modules/intbitset/remove-impure-tuning.patch deleted file mode 100644 index 4747b87b806..00000000000 --- a/pkgs/development/python-modules/intbitset/remove-impure-tuning.patch +++ /dev/null @@ -1,24 +0,0 @@ -From 2ea60bdf4d7b0344fc6ff5c97c675842fedccfa8 Mon Sep 17 00:00:00 2001 -From: Cole Helbling <cole.e.helbling@outlook.com> -Date: Fri, 23 Apr 2021 09:02:22 -0700 -Subject: [PATCH] setup.py: remove impure tuning - ---- - setup.py | 1 - - 1 file changed, 1 deletion(-) - -diff --git a/setup.py b/setup.py -index 7840022..3922aa5 100644 ---- a/setup.py -+++ b/setup.py -@@ -48,7 +48,6 @@ setup( - ext_modules=[ - Extension("intbitset", - ["intbitset/intbitset.c", "intbitset/intbitset_impl.c"], -- extra_compile_args=['-O3', '-march=core2', '-mtune=native'] - # For debug -> '-ftree-vectorizer-verbose=2' - ) - ], --- -2.30.1 - diff --git a/pkgs/development/python-modules/intensity-normalization/default.nix b/pkgs/development/python-modules/intensity-normalization/default.nix index 48260398f49..5e658953fc8 100644 --- a/pkgs/development/python-modules/intensity-normalization/default.nix +++ b/pkgs/development/python-modules/intensity-normalization/default.nix @@ -15,14 +15,15 @@ buildPythonPackage rec { pname = "intensity-normalization"; - version = "2.1.4"; + version = "2.2.0"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { - inherit pname version; - sha256 = "e7b46039311bcbba40224d85eb07eefe1488bd8a6faa893a180e15e65c48b7f5"; + pname = "intensity_normalization"; + inherit version; + sha256 = "sha256-0tc21NBj3Cajklk9mWbKfBzbSwjUrBWs/SlakjEHC1U="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/ipykernel/default.nix b/pkgs/development/python-modules/ipykernel/default.nix index e888fdcd320..fe67c73cbad 100644 --- a/pkgs/development/python-modules/ipykernel/default.nix +++ b/pkgs/development/python-modules/ipykernel/default.nix @@ -12,11 +12,11 @@ buildPythonPackage rec { pname = "ipykernel"; - version = "6.7.0"; + version = "6.9.1"; src = fetchPypi { inherit pname version; - sha256 = "d82b904fdc2fd8c7b1fbe0fa481c68a11b4cd4c8ef07e6517da1f10cc3114d24"; + sha256 = "sha256-+VBwot/TFH+KsZ8Y7kZzMxCBN1hZN0XgfsGPsItAnx0="; }; # debugpy is optional, see https://github.com/ipython/ipykernel/pull/767 diff --git a/pkgs/development/python-modules/ipympl/default.nix b/pkgs/development/python-modules/ipympl/default.nix index 3644442f7ad..08b41e62978 100644 --- a/pkgs/development/python-modules/ipympl/default.nix +++ b/pkgs/development/python-modules/ipympl/default.nix @@ -7,12 +7,12 @@ buildPythonPackage rec { pname = "ipympl"; - version = "0.8.7"; + version = "0.8.8"; format = "wheel"; src = fetchPypi { inherit pname version format; - sha256 = "11c3d01f0555f855c51a960964e3ab4dff38e6ccd1a4695205fe250341a9eb99"; + sha256 = "sha256-hkaK6q6MCigAfQx/bbuF8rbLmAUWfojU2qdSlWIAkVk="; }; diff --git a/pkgs/development/python-modules/ipython/default.nix b/pkgs/development/python-modules/ipython/default.nix index c1c0b049dc8..24fd28a16f7 100644 --- a/pkgs/development/python-modules/ipython/default.nix +++ b/pkgs/development/python-modules/ipython/default.nix @@ -28,13 +28,13 @@ buildPythonPackage rec { pname = "ipython"; - version = "8.0.1"; + version = "8.1.0"; format = "pyproject"; disabled = pythonOlder "3.8"; src = fetchPypi { inherit pname version; - sha256 = "0x19sj4dlq7r4p1mqnpx9245r8dwvpjwd8n34snfm37a452lsmmb"; + sha256 = "sha256-QsI+kLLequYxJmiF3hZWpRehZz1+HbV+jrOku2zVzhs="; }; buildInputs = [ diff --git a/pkgs/development/python-modules/itsdangerous/default.nix b/pkgs/development/python-modules/itsdangerous/default.nix index 35cdf8836a8..c2050c6f79c 100644 --- a/pkgs/development/python-modules/itsdangerous/default.nix +++ b/pkgs/development/python-modules/itsdangerous/default.nix @@ -8,12 +8,12 @@ buildPythonPackage rec { pname = "itsdangerous"; - version = "2.0.1"; + version = "2.1.0"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "1w6gfb2zhbcmrfj6digwzw1z68w6zg1q87rm6la2m412zil4swly"; + sha256 = "sha256-2Ej8uLx9UHxFRrRIV06KRPxOorqE6/jXgykNU+gZkvU="; }; checkInputs = [ diff --git a/pkgs/development/python-modules/jaraco_itertools/default.nix b/pkgs/development/python-modules/jaraco_itertools/default.nix index 80b0349ed58..95d20fd7e6b 100644 --- a/pkgs/development/python-modules/jaraco_itertools/default.nix +++ b/pkgs/development/python-modules/jaraco_itertools/default.nix @@ -4,11 +4,12 @@ buildPythonPackage rec { pname = "jaraco.itertools"; - version = "6.0.3"; + version = "6.2.1"; + format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "1775bfcad5de275a540a36720c5ab34594ea1dbe7ffefa32099b0129c5604608"; + sha256 = "sha256-YJjts3xrgCPzeU1CWIoTv3WyygK0D/l5XIRry+DBtGw="; }; pythonNamespaces = [ "jaraco" ]; diff --git a/pkgs/development/python-modules/jaraco_text/default.nix b/pkgs/development/python-modules/jaraco_text/default.nix index 054f68ba2f2..e1e82df89ea 100644 --- a/pkgs/development/python-modules/jaraco_text/default.nix +++ b/pkgs/development/python-modules/jaraco_text/default.nix @@ -10,14 +10,14 @@ buildPythonPackage rec { pname = "jaraco.text"; - version = "3.6.0"; + version = "3.7.0"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "901d3468eaaa04f1d8a8f141f54b8887bfd943ccba311fc1c1de62c66604dfe0"; + sha256 = "sha256-p/nMG0Sl8wlqIWy9EwtlDHprLJ+ABbAArpfzKSOafAA="; }; pythonNamespaces = [ diff --git a/pkgs/development/python-modules/joblib/default.nix b/pkgs/development/python-modules/joblib/default.nix index 2b011f56c1e..ad7db290d67 100644 --- a/pkgs/development/python-modules/joblib/default.nix +++ b/pkgs/development/python-modules/joblib/default.nix @@ -1,4 +1,5 @@ { lib +, pythonAtLeast , pythonOlder , buildPythonPackage , fetchPypi @@ -28,6 +29,7 @@ buildPythonPackage rec { disabledTests = [ "test_disk_used" # test_disk_used is broken: https://github.com/joblib/joblib/issues/57 "test_parallel_call_cached_function_defined_in_jupyter" # jupyter not available during tests + "test_nested_parallel_warnings" # tests is flaky under load ] ++ lib.optionals stdenv.isDarwin [ "test_dispatch_multiprocessing" # test_dispatch_multiprocessing is broken only on Darwin. ]; diff --git a/pkgs/development/python-modules/jsondiff/default.nix b/pkgs/development/python-modules/jsondiff/default.nix index 0b6f0120981..fe41d0dd854 100644 --- a/pkgs/development/python-modules/jsondiff/default.nix +++ b/pkgs/development/python-modules/jsondiff/default.nix @@ -5,11 +5,11 @@ buildPythonPackage rec { pname = "jsondiff"; - version = "1.3.0"; + version = "1.3.1"; src = fetchPypi { inherit pname version; - sha256 = "5122bf4708a031b02db029366184a87c5d0ddd5a327a5884ee6cf0193e599d71"; + sha256 = "sha256-BM+uvUpeVziUirYVcQ3D7pjvvfhRJV/Tl3xMLuWecxI="; }; postPatch = '' diff --git a/pkgs/development/python-modules/jsonpickle/default.nix b/pkgs/development/python-modules/jsonpickle/default.nix index a91e6b3accd..1ffbbdd5e89 100644 --- a/pkgs/development/python-modules/jsonpickle/default.nix +++ b/pkgs/development/python-modules/jsonpickle/default.nix @@ -9,11 +9,11 @@ buildPythonPackage rec { pname = "jsonpickle"; - version = "2.0.0"; + version = "2.1.0"; src = fetchPypi { inherit pname version; - sha256 = "0be49cba80ea6f87a168aa8168d717d00c6ca07ba83df3cec32d3b30bfe6fb9a"; + sha256 = "sha256-hGhM/FM4pTQXPI3WmAnkDyhl0L4fiit6+EZeW5aNz6k="; }; checkInputs = [ pytest ]; diff --git a/pkgs/development/python-modules/jupyter-client/default.nix b/pkgs/development/python-modules/jupyter-client/default.nix index 9cb46594755..23580f42bf5 100644 --- a/pkgs/development/python-modules/jupyter-client/default.nix +++ b/pkgs/development/python-modules/jupyter-client/default.nix @@ -14,11 +14,11 @@ buildPythonPackage rec { pname = "jupyter_client"; - version = "7.1.0"; + version = "7.1.2"; src = fetchPypi { inherit pname version; - sha256 = "a5f995a73cffb314ed262713ae6dfce53c6b8216cea9f332071b8ff44a6e1654"; + sha256 = "sha256-TqYQM3Jsjlee21VibY7i5r8KgxWN3zdRuN1GssXNHpY="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/jupyter_core/default.nix b/pkgs/development/python-modules/jupyter_core/default.nix index a7dd89a1f89..b7838ff5915 100644 --- a/pkgs/development/python-modules/jupyter_core/default.nix +++ b/pkgs/development/python-modules/jupyter_core/default.nix @@ -2,33 +2,54 @@ , buildPythonPackage , fetchPypi , isPy3k +, fetchpatch +, python , ipython , traitlets , glibcLocales , mock -, pytest +, pytestCheckHook , nose }: buildPythonPackage rec { pname = "jupyter_core"; - version = "4.9.1"; + version = "4.9.2"; disabled = !isPy3k; src = fetchPypi { inherit pname version; - sha256 = "dce8a7499da5a53ae3afd5a9f4b02e5df1d57250cf48f3ad79da23b4778cd6fa"; + sha256 = "sha256-1puuuf+xKLjNJlf88nA/icdp0Wc8hRgSEZ46Kg6TrZo="; }; - checkInputs = [ pytest mock glibcLocales nose ]; + checkInputs = [ pytestCheckHook mock glibcLocales nose ]; propagatedBuildInputs = [ ipython traitlets ]; - patches = [ ./tests_respect_pythonpath.patch ]; + patches = [ + # install jupyter_core/*.py files + (fetchpatch { + url = "https://github.com/jupyter/jupyter_core/pull/253/commits/3bbeaebec0a53520523162d5e8d5c6ca02b1b782.patch"; + sha256 = "sha256-QeAfj7wLz4egVUPMAgrZ9Wn/Tv60LrIXLgHGVoH41wQ="; + }) + ./tests_respect_pythonpath.patch + ]; - checkPhase = '' - HOME=$TMPDIR LC_ALL=en_US.utf8 py.test + preCheck = '' + export HOME=$TMPDIR + export LC_ALL=en_US.utf8 ''; + disabledTests = [ + # creates a temporary script, which isn't aware of PYTHONPATH + "test_argv0" + ]; + + postCheck = '' + $out/bin/jupyter --help > /dev/null + ''; + + pythonImportsCheck = [ "jupyter_core" ]; + meta = with lib; { description = "Jupyter core package. A base package on which Jupyter projects rely"; homepage = "https://jupyter.org/"; diff --git a/pkgs/development/python-modules/jupyterlab-git/default.nix b/pkgs/development/python-modules/jupyterlab-git/default.nix index 9d2907072e6..dc909f798da 100644 --- a/pkgs/development/python-modules/jupyterlab-git/default.nix +++ b/pkgs/development/python-modules/jupyterlab-git/default.nix @@ -17,14 +17,14 @@ buildPythonPackage rec { pname = "jupyterlab-git"; - version = "0.34.1"; + version = "0.34.2"; disabled = pythonOlder "3.6"; src = fetchPypi { pname = "jupyterlab_git"; inherit version; - sha256 = "c7a03f526eb19175df73fedd5dee3cdae2d39e0474eef8f55c1c55b219ab26d9"; + sha256 = "sha256-WNBhuHF3rhAWZED4di9B9Loq+shRzpJuaAOOcND1YEE="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/keepalive/default.nix b/pkgs/development/python-modules/keepalive/default.nix index b6daec6ca20..6a4fcdb265f 100644 --- a/pkgs/development/python-modules/keepalive/default.nix +++ b/pkgs/development/python-modules/keepalive/default.nix @@ -19,6 +19,7 @@ buildPythonPackage rec { description = "An HTTP handler for `urllib2` that supports HTTP 1.1 and keepalive"; homepage = "https://github.com/wikier/keepalive"; license = licenses.asl20; + broken = true; # uses use_2to3, which is no longer supported for setuptools>=58 }; } diff --git a/pkgs/development/python-modules/keras/default.nix b/pkgs/development/python-modules/keras/default.nix index 2b9a269e280..dbdebefdb5a 100644 --- a/pkgs/development/python-modules/keras/default.nix +++ b/pkgs/development/python-modules/keras/default.nix @@ -6,12 +6,12 @@ buildPythonPackage rec { pname = "keras"; - version = "2.7.0"; + version = "2.8.0"; format = "wheel"; src = fetchPypi { inherit format pname version; - sha256 = "0c33ae1f728064ca0d35dfba999e9c316f03623bf5688c82fb83cc74a80ea248"; + sha256 = "sha256-dE053GV33NgP9KTUFUnpK3fWoX4O3VikMdMGVuKbyU4="; }; checkInputs = [ diff --git a/pkgs/development/python-modules/labelbox/default.nix b/pkgs/development/python-modules/labelbox/default.nix index c89782d4027..27f05d83aa0 100644 --- a/pkgs/development/python-modules/labelbox/default.nix +++ b/pkgs/development/python-modules/labelbox/default.nix @@ -19,14 +19,14 @@ buildPythonPackage rec { pname = "labelbox"; - version = "3.11.1"; + version = "3.15.0"; disabled = pythonOlder "3.6"; src = fetchFromGitHub { owner = "Labelbox"; repo = "labelbox-python"; - rev = "v${version}"; - sha256 = "114h9phvbdknyvqdnjba3pd7i4iznffhgx9d569lq0hfla3hl61a"; + rev = "v.${version}"; + sha256 = "sha256-pJkDC/2EDPWbIw9WqV9kdYmr4X6apXtholzd0IYjgDg="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/lektor/default.nix b/pkgs/development/python-modules/lektor/default.nix index f88e14d0a3e..918cbd2591c 100644 --- a/pkgs/development/python-modules/lektor/default.nix +++ b/pkgs/development/python-modules/lektor/default.nix @@ -2,6 +2,7 @@ , buildPythonPackage , fetchFromGitHub , click +, filetype , watchdog , exifread , requests @@ -17,6 +18,7 @@ , pytest-mock , pytest-pylint , pytest-click +, python-slugify , isPy27 , functools32 , setuptools @@ -24,18 +26,19 @@ buildPythonPackage rec { pname = "lektor"; - version = "3.3.1"; + version = "3.3.2"; + format = "pyproject"; src = fetchFromGitHub { owner = "lektor"; repo = "lektor"; - rev = version; - sha256 = "04gn3jybqf9wc6l9mi0djpki60adnk7gppmv987ik676k5x8f1kk"; + rev = "v${version}"; + sha256 = "sha256-PNHQ87aO+b1xseupIOsO7MXdr16s0gjoHGnZhPlKKRY="; }; propagatedBuildInputs = [ - click watchdog exifread requests mistune inifile Babel jinja2 - flask pyopenssl ndg-httpsclient setuptools + click filetype watchdog exifread requests mistune inifile Babel jinja2 + flask pyopenssl python-slugify ndg-httpsclient setuptools ] ++ lib.optionals isPy27 [ functools32 ]; checkInputs = [ diff --git a/pkgs/development/python-modules/levenshtein/default.nix b/pkgs/development/python-modules/levenshtein/default.nix index 64a9a3b5e99..e5f743e0fe1 100644 --- a/pkgs/development/python-modules/levenshtein/default.nix +++ b/pkgs/development/python-modules/levenshtein/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { pname = "levenshtein"; - version = "0.17.0"; + version = "0.18.1"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -17,7 +17,7 @@ buildPythonPackage rec { owner = "maxbachmann"; repo = "Levenshtein"; rev = "v${version}"; - sha256 = "1a14cw2314jb5lrm979zipzk3av4630lxdr4jzj2wl5qh3yw4w52"; + sha256 = "sha256-3p9LM4tv45bqeTsuyngivqfd5uml7uqGB2ICKqPa0qY="; }; postPatch = '' diff --git a/pkgs/development/python-modules/libcst/default.nix b/pkgs/development/python-modules/libcst/default.nix index 0c4a8985e40..86b546289bb 100644 --- a/pkgs/development/python-modules/libcst/default.nix +++ b/pkgs/development/python-modules/libcst/default.nix @@ -7,6 +7,8 @@ , python , pythonOlder , pyyaml +, rustPlatform +, setuptools-rust , setuptools-scm , typing-extensions , typing-inspect @@ -14,8 +16,8 @@ buildPythonPackage rec { pname = "libcst"; - version = "0.3.23"; - format = "setuptools"; + version = "0.4.1"; + format = "pyproject"; disabled = pythonOlder "3.6"; @@ -23,9 +25,18 @@ buildPythonPackage rec { owner = "instagram"; repo = pname; rev = "v${version}"; - sha256 = "1r4aiqpndqa75119faknsghi7zxyjrx5r6i7cb3d0liwiqrkzrvx"; + sha256 = "sha256-soAlt1KBpCn5JxM1b2LZ3vOpBn9HPGdbm+BBYbyEkfE="; }; + cargoDeps = rustPlatform.fetchCargoTarball { + inherit src; + sourceRoot = "source/${cargoRoot}"; + name = "${pname}-${version}"; + hash = "sha256:1rz1c0dv3f1h2m5hwdisl3rbqnmifbva4f0c4vygk7rh1q27l515"; + }; + + cargoRoot = "native"; + postPatch = '' # test try to format files, which isn't necessary when consuming releases sed -i libcst/codegen/generate.py \ @@ -35,8 +46,10 @@ buildPythonPackage rec { SETUPTOOLS_SCM_PRETEND_VERSION = version; nativeBuildInputs = [ + setuptools-rust setuptools-scm - ]; + rustPlatform.cargoSetupHook + ] ++ (with rustPlatform; [ rust.cargo rust.rustc ]); propagatedBuildInputs = [ hypothesis diff --git a/pkgs/development/python-modules/libevdev/default.nix b/pkgs/development/python-modules/libevdev/default.nix index 4a4ba489e0a..494e887c79b 100644 --- a/pkgs/development/python-modules/libevdev/default.nix +++ b/pkgs/development/python-modules/libevdev/default.nix @@ -9,12 +9,12 @@ buildPythonPackage rec { pname = "libevdev"; - version = "0.9"; + version = "0.10"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "17agnigmzscmdjqmrylg1lza03hwjhgxbpf4l705s6i7p7ndaqrs"; + sha256 = "sha256-9LM2Ftr6qmQYysCxso+XJSthwJdOU01J+yL8ZWbtwRM="; }; patches = [ diff --git a/pkgs/development/python-modules/limits/default.nix b/pkgs/development/python-modules/limits/default.nix index 9a19dda1578..47738b23dc4 100644 --- a/pkgs/development/python-modules/limits/default.nix +++ b/pkgs/development/python-modules/limits/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "limits"; - version = "2.2.0"; + version = "2.3.3"; src = fetchPypi { inherit pname version; - sha256 = "da6346f0dcf85f17f0f1cc709c3408a3058cf6fee68313c288127c287237b411"; + sha256 = "sha256-1CcNKVkcxezqsZvgU0VaTmGbo5UGJQK94rVoGvfcG+g="; }; propagatedBuildInputs = [ six ]; diff --git a/pkgs/development/python-modules/lxml/default.nix b/pkgs/development/python-modules/lxml/default.nix index 2c549b6830a..3ef230eb8e8 100644 --- a/pkgs/development/python-modules/lxml/default.nix +++ b/pkgs/development/python-modules/lxml/default.nix @@ -8,13 +8,13 @@ buildPythonPackage rec { pname = "lxml"; - version = "4.7.1"; + version = "4.8.0"; src = fetchFromGitHub { owner = pname; repo = pname; rev = "lxml-${version}"; - sha256 = "0xji4kcw1fl3nqg04q6zlympkx2kv2s1r1p18763dshgpisqgiq4"; + sha256 = "sha256-ppyLn8B0YFQivRCOE8TjKGdDDQHbb7UdTUkevznoVC8="; }; # setuptoolsBuildPhase needs dependencies to be passed through nativeBuildInputs diff --git a/pkgs/development/python-modules/lz4/default.nix b/pkgs/development/python-modules/lz4/default.nix index 9e2cc9b31e1..c6966e632f0 100644 --- a/pkgs/development/python-modules/lz4/default.nix +++ b/pkgs/development/python-modules/lz4/default.nix @@ -2,6 +2,7 @@ , buildPythonPackage , fetchFromGitHub , pythonOlder +, python # native inputs , pkgconfig @@ -14,7 +15,7 @@ buildPythonPackage rec { pname = "python-lz4"; - version = "3.1.12"; + version = "4.0.0"; format = "setuptools"; disabled = pythonOlder "3.5"; @@ -24,7 +25,7 @@ buildPythonPackage rec { owner = pname; repo = pname; rev = "v${version}"; - sha256 = "sha256-fqt9aJGqZpfbiYtU8cmm7UQaixZwbTKFBwRfR1B/qic="; + sha256 = "sha256-9gp67i2fotvFOpkaQZ82/YKnDEs3DnzXfuNCVRJg88I="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; @@ -50,13 +51,13 @@ buildPythonPackage rec { psutil ]; - # leave build directory, so the installed library gets imported - preCheck = '' - pushd tests - ''; + # for lz4.steam + PYLZ4_EXPERIMENTAL = true; - postCheck = '' - popd + # prevent local lz4 directory from getting imported as it lacks native extensions + preCheck = '' + rm -r lz4 + export PYTHONPATH=$out/${python.sitePackages}:$PYTHONPATH ''; meta = with lib; { diff --git a/pkgs/development/python-modules/magicgui/default.nix b/pkgs/development/python-modules/magicgui/default.nix index 03ca9d79159..28fa4c9c4e2 100644 --- a/pkgs/development/python-modules/magicgui/default.nix +++ b/pkgs/development/python-modules/magicgui/default.nix @@ -11,12 +11,12 @@ , docstring-parser }: buildPythonPackage rec { pname = "magicgui"; - version = "0.3.0"; + version = "0.3.7"; src = fetchFromGitHub { owner = "napari"; repo = "magicgui"; rev = "v${version}"; - sha256 = "sha256-DvL1szk2RoCrpisjp0BVNL6qFZtYc2oYDenX59Cxbug="; + sha256 = "sha256-LYXNNr5lS3ibQk2NIopZkB8kzC7j3yY8moGMk0Gr+hU="; }; nativeBuildInputs = [ setuptools-scm ]; propagatedBuildInputs = [ typing-extensions qtpy pyside2 psygnal docstring-parser ]; diff --git a/pkgs/development/python-modules/manticore/default.nix b/pkgs/development/python-modules/manticore/default.nix index 0c36f2cc6cc..2e1bff7e21e 100644 --- a/pkgs/development/python-modules/manticore/default.nix +++ b/pkgs/development/python-modules/manticore/default.nix @@ -23,7 +23,7 @@ buildPythonPackage rec { pname = "manticore"; - version = "0.3.6"; + version = "0.3.7"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -32,7 +32,7 @@ buildPythonPackage rec { owner = "trailofbits"; repo = "manticore"; rev = version; - sha256 = "sha256-L112YwrBcdcLBeBsPLWt3C57u2WDvGLq50EzW9ojdyg="; + sha256 = "sha256-+17VBfAtkZZIi3SF5Num1Uqg3WjIpgbz3Jx65rD5zkM="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/markupsafe/default.nix b/pkgs/development/python-modules/markupsafe/default.nix index 12845da7e37..b0f876ef3e8 100644 --- a/pkgs/development/python-modules/markupsafe/default.nix +++ b/pkgs/development/python-modules/markupsafe/default.nix @@ -7,13 +7,13 @@ buildPythonPackage rec { pname = "markupsafe"; - version = "2.0.1"; + version = "2.1.0"; disabled = pythonOlder "3.6"; src = fetchPypi { pname = "MarkupSafe"; inherit version; - sha256 = "02k2ynmqvvd0z0gakkf8s4idyb606r7zgga41jrkhqmigy06fk2r"; + sha256 = "sha256-gL6vY937xkoEUrhB2ANsoGEeBJZQ4gr8uIL108Jm1l8="; }; checkInputs = [ diff --git a/pkgs/development/python-modules/matrix-nio/default.nix b/pkgs/development/python-modules/matrix-nio/default.nix index 665167e290e..724a1459b77 100644 --- a/pkgs/development/python-modules/matrix-nio/default.nix +++ b/pkgs/development/python-modules/matrix-nio/default.nix @@ -41,6 +41,7 @@ buildPythonPackage rec { postPatch = '' substituteInPlace pyproject.toml \ --replace 'aiofiles = "^0.6.0"' 'aiofiles = "*"' \ + --replace 'h11 = "^0.12.0"' 'h11 = "*"' \ --replace 'jsonschema = "^3.2.0"' 'jsonschema = "*"' \ --replace 'cachetools = { version = "^4.2.1", optional = true }' 'cachetools = { version = "*", optional = true }' ''; diff --git a/pkgs/development/python-modules/md-toc/default.nix b/pkgs/development/python-modules/md-toc/default.nix index a37e82a62d3..5f0f9a434b4 100644 --- a/pkgs/development/python-modules/md-toc/default.nix +++ b/pkgs/development/python-modules/md-toc/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { pname = "md-toc"; - version = "8.1.1"; + version = "8.1.2"; format = "setuptools"; disabled = pythonOlder "3.5"; @@ -17,7 +17,7 @@ buildPythonPackage rec { owner = "frnmst"; repo = pname; rev = version; - sha256 = "sha256-Dlqia+B7WJZlFGlIhgUWdND1qhSS/FOPoFH+uim6i8I="; + sha256 = "sha256-EmhCZhxUCzBMqScPeawvcWmP9rrthow1vhTZachjCDI="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/meshio/default.nix b/pkgs/development/python-modules/meshio/default.nix index 54f8431ba27..1471ea5b1e5 100644 --- a/pkgs/development/python-modules/meshio/default.nix +++ b/pkgs/development/python-modules/meshio/default.nix @@ -6,22 +6,24 @@ , h5py , exdown , pytestCheckHook +, rich }: buildPythonPackage rec { pname = "meshio"; - version = "5.2.2"; + version = "5.3.2"; format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "209885ac31b00155e43c27859d1aff0ba7f97f319ee7bed453a8b9e1677a4e52"; + sha256 = "sha256-L1YNRAgoHBvf8SsM++J+k1UNciIw91W1s6IA26I/bYw="; }; propagatedBuildInputs = [ numpy netcdf4 h5py + rich ]; checkInputs = [ diff --git a/pkgs/development/python-modules/mezzanine/default.nix b/pkgs/development/python-modules/mezzanine/default.nix index 2c78575d370..83085d76a36 100644 --- a/pkgs/development/python-modules/mezzanine/default.nix +++ b/pkgs/development/python-modules/mezzanine/default.nix @@ -20,12 +20,12 @@ }: buildPythonPackage rec { - version = "5.1.0"; + version = "5.1.3"; pname = "Mezzanine"; src = fetchPypi { inherit pname version; - sha256 = "ce1117c81416d2e0a77981419312e200aec1cf3cb3ea9630083bd29e74bbb265"; + sha256 = "sha256-G/Oj5g70tFUhnbSVElVk0s9Ka+MEuPsEgj6blcFBOoY="; }; disabled = isPyPy || lib.versionOlder django.version "1.11" diff --git a/pkgs/development/python-modules/minio/default.nix b/pkgs/development/python-modules/minio/default.nix index 477ed47e9dd..5b142406fab 100644 --- a/pkgs/development/python-modules/minio/default.nix +++ b/pkgs/development/python-modules/minio/default.nix @@ -16,7 +16,7 @@ buildPythonPackage rec { pname = "minio"; - version = "7.1.2"; + version = "7.1.4"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -25,7 +25,7 @@ buildPythonPackage rec { owner = "minio"; repo = "minio-py"; rev = version; - sha256 = "sha256-KluSdmhpSSqUTLVdFpIGwre7LOu3A16rt73FvaTmuz8="; + sha256 = "sha256-IzITqo23pRf83SFpnBZdryGHIsxh+7HrLVLM9CT5nQQ="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/mongoengine/default.nix b/pkgs/development/python-modules/mongoengine/default.nix index d609f465e27..269ebf2ef3c 100644 --- a/pkgs/development/python-modules/mongoengine/default.nix +++ b/pkgs/development/python-modules/mongoengine/default.nix @@ -12,14 +12,14 @@ buildPythonPackage rec { pname = "mongoengine"; - version = "0.23.1"; + version = "0.24.0"; disabled = isPy27; src = fetchFromGitHub { owner = "MongoEngine"; repo = pname; rev = "v${version}"; - sha256 = "1lj33pgdrp4rvjzcg2glvz1f87np1pfnqhlwbdcijav9rxqc0w70"; + sha256 = "sha256-BQSB4SGlejARFreeTfqFMzCWvBc6Vvq9EOMLjhAihdI="; }; propagatedBuildInputs = [ @@ -36,12 +36,15 @@ buildPythonPackage rec { postPatch = '' substituteInPlace setup.py \ - --replace "coverage==4.2" "coverage" + --replace "coverage==4.2" "coverage" \ + --replace "pymongo>=3.4,<=4.0" "pymongo" ''; # tests require mongodb running in background doCheck = false; + pythonImportsCheck = [ "mongoengine" ]; + meta = with lib; { description = "MongoEngine is a Python Object-Document Mapper for working with MongoDB"; homepage = "http://mongoengine.org/"; diff --git a/pkgs/development/python-modules/moonraker-api/default.nix b/pkgs/development/python-modules/moonraker-api/default.nix index 9f6ca7e91a7..50ba81d6d52 100644 --- a/pkgs/development/python-modules/moonraker-api/default.nix +++ b/pkgs/development/python-modules/moonraker-api/default.nix @@ -9,7 +9,7 @@ buildPythonPackage rec { pname = "moonraker-api"; - version = "2.0.4"; + version = "2.0.5"; format = "setuptools"; disabled = pythonOlder "3.8"; @@ -18,7 +18,7 @@ buildPythonPackage rec { owner = "cmroche"; repo = pname; rev = "v${version}"; - sha256 = "1hhm3jnl9qm44y4k927fzw1n32c3551kgsk7i57qw25nca9x3k61"; + sha256 = "sha256-PgFsXmdAmHXK0wZ6xLTu94RdME1L2H1Mb6V+qFlGXSk="; }; postPatch = '' diff --git a/pkgs/development/python-modules/moto/default.nix b/pkgs/development/python-modules/moto/default.nix index 1d9d0774379..f920a06488a 100644 --- a/pkgs/development/python-modules/moto/default.nix +++ b/pkgs/development/python-modules/moto/default.nix @@ -1,269 +1,115 @@ -{ lib, buildPythonPackage, fetchPypi, isPy27, fetchpatch +{ lib +, buildPythonPackage +, fetchPypi +, pythonOlder + +# runtime , aws-xray-sdk -, backports_tempfile , boto3 , botocore , cfn-lint +, cryptography , docker , flask , flask-cors -, freezegun +, graphql-core +, idna , jinja2 , jsondiff -, mock -, pyaml +, python-dateutil , python-jose , pytz +, pyyaml , requests , responses -, six , sshpubkeys -, sure , werkzeug , xmltodict -, parameterized -, idna -, nose + +# tests +, freezegun , pytestCheckHook , pytest-xdist +, sure }: buildPythonPackage rec { pname = "moto"; - version = "3.0.2"; + version = "3.0.5"; + format = "setuptools"; + + disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-vZ1oofOYUkFETDFKwSmifvvn+bCi/6NQAxu950NYk5k="; + sha256 = "sha256-hfLs4K0DBaoTo5E5zmSKs6/hwEyzKsHbjV5ekRfU0Q4="; }; - postPatch = '' - substituteInPlace setup.py \ - --replace "ecdsa<0.15" "ecdsa" \ - --replace "idna<3,>=2.5" "idna" \ - --replace "MarkupSafe<2.0" "MarkupSafe" \ - ''; - propagatedBuildInputs = [ aws-xray-sdk boto3 botocore cfn-lint + cryptography docker - flask # required for server + flask + flask-cors + graphql-core + idna jinja2 jsondiff - mock - pyaml + python-dateutil python-jose pytz - six + pyyaml requests responses sshpubkeys werkzeug xmltodict - idna - ] ++ lib.optionals isPy27 [ backports_tempfile ]; + ]; checkInputs = [ - boto3 - flask-cors freezegun - parameterized - pytestCheckHook pytest-xdist + pytestCheckHook sure ]; - # Multiple test files still import boto, rather than boto3 like - # boto is long-deprecated and broken on python3.9 - # https://github.com/spulec/moto/blob/63ce647123755e4c4693a89f52c254596004c098/tests/test_autoscaling/test_autoscaling.py#L2 - # NOTE: This should change to use disabledTestFiles / disabledTestPaths once that - # feature stabalizes: see #113153 (mostly the discussion therein), #113167, #110700 pytestFlagsArray = [ - "-n $NIX_BUILD_CORES" - "--ignore=tests/test_awslambda/test_policy.py" - "--ignore=tests/test_autoscaling/test_autoscaling.py" - "--ignore=tests/test_autoscaling/test_cloudformation.py" - "--ignore=tests/test_autoscaling/test_elbv2.py" - "--ignore=tests/test_autoscaling/test_launch_configurations.py" - "--ignore=tests/test_autoscaling/test_policies.py" - "--ignore=tests/test_autoscaling/test_server.py" - "--ignore=tests/test_awslambda/test_lambda.py" - "--ignore=tests/test_awslambda/test_lambda_cloudformation.py" - "--ignore=tests/test_batch/test_cloudformation.py" - "--ignore=tests/test_batch/test_server.py" - "--ignore=tests/test_cloudformation/test_cloudformation_depends_on.py" - "--ignore=tests/test_cloudformation/test_cloudformation_stack_crud.py" - "--ignore=tests/test_cloudformation/test_cloudformation_stack_crud_boto3.py" - "--ignore=tests/test_cloudformation/test_cloudformation_stack_integration.py" - "--ignore=tests/test_cloudformation/test_stack_parsing.py" - "--ignore=tests/test_cloudformation/test_validate.py" - "--ignore=tests/test_cloudwatch/test_cloudwatch.py" - "--ignore=tests/test_cognitoidentity/test_server.py" - "--ignore=tests/test_config/test_config.py" - "--ignore=tests/test_core/test_auth.py" - "--ignore=tests/test_core/test_decorator_calls.py" - "--ignore=tests/test_core/test_nested.py" - "--ignore=tests/test_core/test_server.py" - "--ignore=tests/test_datapipeline/test_datapipeline.py" - "--ignore=tests/test_datapipeline/test_server.py" - "--ignore=tests/test_datasync/test_datasync.py" - "--ignore=tests/test_dynamodb/test_dynamodb.py" - "--ignore=tests/test_dynamodb/test_dynamodb_table_with_range_key.py" - "--ignore=tests/test_dynamodb/test_dynamodb_table_without_range_key.py" - "--ignore=tests/test_dynamodb/test_server.py" - "--ignore=tests/test_dynamodb2/test_dynamodb.py" - "--ignore=tests/test_dynamodb2/test_dynamodb_table_with_range_key.py" - "--ignore=tests/test_dynamodb2/test_dynamodb_table_without_range_key.py" - "--ignore=tests/test_dynamodb2/test_server.py" - "--ignore=tests/test_ec2/test_amazon_dev_pay.py" - "--ignore=tests/test_ec2/test_amis.py" - "--ignore=tests/test_ec2/test_availability_zones_and_regions.py" - "--ignore=tests/test_ec2/test_customer_gateways.py" - "--ignore=tests/test_ec2/test_dhcp_options.py" - "--ignore=tests/test_ec2/test_elastic_block_store.py" - "--ignore=tests/test_ec2/test_elastic_ip_addresses.py" - "--ignore=tests/test_ec2/test_elastic_network_interfaces.py" - "--ignore=tests/test_ec2/test_general.py" - "--ignore=tests/test_ec2/test_instances.py" - "--ignore=tests/test_ec2/test_internet_gateways.py" - "--ignore=tests/test_ec2/test_ip_addresses.py" - "--ignore=tests/test_ec2/test_key_pairs.py" - "--ignore=tests/test_ec2/test_monitoring.py" - "--ignore=tests/test_ec2/test_network_acls.py" - "--ignore=tests/test_ec2/test_placement_groups.py" - "--ignore=tests/test_ec2/test_regions.py" - "--ignore=tests/test_ec2/test_reserved_instances.py" - "--ignore=tests/test_ec2/test_route_tables.py" - "--ignore=tests/test_ec2/test_security_groups.py" - "--ignore=tests/test_ec2/test_spot_instances.py" - "--ignore=tests/test_ec2/test_subnets.py" - "--ignore=tests/test_ec2/test_tags.py" - "--ignore=tests/test_ec2/test_virtual_private_gateways.py" - "--ignore=tests/test_ec2/test_vm_export.py" - "--ignore=tests/test_ec2/test_vm_import.py" - "--ignore=tests/test_ec2/test_vpc_peering.py" - "--ignore=tests/test_ec2/test_vpcs.py" - "--ignore=tests/test_ec2/test_vpn_connections.py" - "--ignore=tests/test_ec2/test_vpn_connections.py" - "--ignore=tests/test_ec2/test_windows.py" - "--ignore=tests/test_ecs/test_ecs_boto3.py" - "--ignore=tests/test_elb/test_elb.py" - "--ignore=tests/test_elb/test_server.py" - "--ignore=tests/test_elbv2/test_elbv2.py" - "--ignore=tests/test_elbv2/test_server.py" - "--ignore=tests/test_emr/test_emr.py" - "--ignore=tests/test_emr/test_server.py" - "--ignore=tests/test_glacier/test_glacier_archives.py" - "--ignore=tests/test_glacier/test_glacier_jobs.py" - "--ignore=tests/test_glacier/test_glacier_vaults.py" - "--ignore=tests/test_iam/test_iam.py" - "--ignore=tests/test_iam/test_iam_cloudformation.py" - "--ignore=tests/test_iam/test_iam_groups.py" - "--ignore=tests/test_iam/test_server.py" - "--ignore=tests/test_iot/test_server.py" - "--ignore=tests/test_iotdata/test_server.py" - "--ignore=tests/test_kinesis/test_kinesis.py" - "--ignore=tests/test_kinesis/test_kinesis_cloudformation.py" - "--ignore=tests/test_kinesis/test_server.py" - "--ignore=tests/test_kinesisvideo/test_server.py" - "--ignore=tests/test_kinesisvideoarchivedmedia/test_server.py" - "--ignore=tests/test_kms/test_kms.py" - "--ignore=tests/test_kms/test_server.py" - "--ignore=tests/test_kms/test_utils.py" - "--ignore=tests/test_logs/test_logs.py" - "--ignore=tests/test_polly/test_server.py" - "--ignore=tests/test_rds/test_rds.py" - "--ignore=tests/test_rds/test_server.py" - "--ignore=tests/test_rds2/test_server.py" - "--ignore=tests/test_redshift/test_redshift.py" - "--ignore=tests/test_redshift/test_server.py" - "--ignore=tests/test_resourcegroupstaggingapi/test_resourcegroupstaggingapi.py" - "--ignore=tests/test_route53/test_route53.py" - "--ignore=tests/test_s3/test_s3.py" - "--ignore=tests/test_s3/test_s3_cloudformation.py" - "--ignore=tests/test_s3/test_s3_lifecycle.py" - "--ignore=tests/test_s3/test_s3_storageclass.py" - "--ignore=tests/test_s3/test_s3_utils.py" - "--ignore=tests/test_s3bucket_path/test_s3bucket_path.py" - "--ignore=tests/test_s3bucket_path/test_s3bucket_path_combo.py" - "--ignore=tests/test_secretsmanager/test_server.py" - "--ignore=tests/test_ses/test_server.py" - "--ignore=tests/test_ses/test_ses.py" - "--ignore=tests/test_ses/test_ses_boto3.py" - "--ignore=tests/test_ses/test_ses_sns_boto3.py" - "--ignore=tests/test_sns/test_application.py" - "--ignore=tests/test_sns/test_application_boto3.py" - "--ignore=tests/test_sns/test_publishing.py" - "--ignore=tests/test_sns/test_publishing_boto3.py" - "--ignore=tests/test_sns/test_server.py" - "--ignore=tests/test_sns/test_subscriptions.py" - "--ignore=tests/test_sns/test_subscriptions_boto3.py" - "--ignore=tests/test_sns/test_topics.py" - "--ignore=tests/test_sns/test_topics_boto3.py" - "--ignore=tests/test_sqs/test_server.py" - "--ignore=tests/test_sqs/test_sqs.py" - "--ignore=tests/test_ssm/test_ssm_boto3.py" - "--ignore=tests/test_ssm/test_ssm_docs.py" - "--ignore=tests/test_sts/test_server.py" - "--ignore=tests/test_sts/test_sts.py" - "--ignore=tests/test_swf/models/test_activity_task.py" - "--ignore=tests/test_swf/models/test_decision_task.py" - "--ignore=tests/test_swf/models/test_timeout.py" - "--ignore=tests/test_swf/models/test_workflow_execution.py" - "--ignore=tests/test_swf/responses/test_activity_tasks.py" - "--ignore=tests/test_swf/responses/test_activity_types.py" - "--ignore=tests/test_swf/responses/test_decision_tasks.py" - "--ignore=tests/test_swf/responses/test_domains.py" - "--ignore=tests/test_swf/responses/test_timeouts.py" - "--ignore=tests/test_swf/responses/test_workflow_executions.py" - "--ignore=tests/test_swf/responses/test_workflow_types.py" - # attempts web connections - "--ignore=tests/test_appsync/test_appsync_schema.py" - "--ignore=tests/test_awslambda/test_lambda_eventsourcemapping.py" - "--ignore=tests/test_awslambda/test_lambda_invoke.py" - "--ignore=tests/test_batch/test_batch_jobs.py" - "--ignore=tests/**/*_integration.py" + "--numprocesses $NIX_BUILD_CORES" + + # Disable tests that try to access the network + "--deselect=tests/test_cloudformation/test_cloudformation_custom_resources.py::test_create_custom_lambda_resource__verify_cfnresponse_failed" + "--deselect=tests/test_cloudformation/test_server.py::test_cloudformation_server_get" + "--deselect=tests/test_core/test_decorator_calls.py::test_context_manager" + "--deselect=tests/test_core/test_decorator_calls.py::test_decorator_start_and_stop" + "--deselect=tests/test_core/test_request_mocking.py::test_passthrough_requests" + "--deselect=tests/test_firehose/test_firehose_put.py::test_put_record_batch_http_destination" + "--deselect=tests/test_firehose/test_firehose_put.py::test_put_record_http_destination" + "--deselect=tests/test_logs/test_integration.py::test_put_subscription_filter_with_lambda" + "--deselect=tests/test_sqs/test_integration.py::test_invoke_function_from_sqs_exception" + "--deselect=tests/test_sqs/test_sqs_integration.py::test_invoke_function_from_sqs_exception" + "--deselect=tests/test_stepfunctions/test_stepfunctions.py::test_state_machine_creation_fails_with_invalid_names" + "--deselect=tests/test_stepfunctions/test_stepfunctions.py::test_state_machine_list_executions_with_pagination" + + # json.decoder.JSONDecodeError: Expecting value: line 1 column 1 (char 0) + "--deselect=tests/test_cloudformation/test_cloudformation_stack_integration.py::test_lambda_function" + ]; + + disabledTestPaths = [ + # xml.parsers.expat.ExpatError: out of memory: line 1, column 0 + "tests/test_sts/test_sts.py" + # botocore.exceptions.NoCredentialsError: Unable to locate credentials + "tests/test_redshiftdata/test_redshiftdata.py" + # Tries to access the network + "tests/test_appsync/test_appsync_schema.py" + "tests/test_awslambda/test_lambda_eventsourcemapping.py" + "tests/test_awslambda/test_lambda_invoke.py" + "tests/test_batch/test_batch_jobs.py" ]; disabledTests = [ - # these tests rely on the network - "test_server" - "test_managedblockchain_nodes" - "test_swf" - "test_simple_instance" - "test_passthrough_requests" - "test_s3_server_get" - "test_s3_server_bucket_create" - "test_s3_server_post_to_bucket" - "test_s3_server_put_ipv6" - "test_s3_server_put_ipv4" - "test_http_proxying_integration" - "test_submit_job_by_name" - "test_submit_job" - "test_list_jobs" - "test_terminate_job" - "test_idtoken_contains_kid_header" - "test_latest_meta_data" - "test_meta_data_iam" - "test_meta_data_security_credentials" - "test_meta_data_default_role" - "test_reset_api" - "test_data_api" - "test_requests_to_amazon_subdomains_dont_work" - "test_get_records_seq" - "test_stream_with_range_key" - "test_create_notebook_instance_bad_volume_size" - "http_destination" - "test_invoke_function_from_sqs_exception" - "test_state_machine_list_executions_with_pagination" - "test_put_subscription_filter_with_lambda" - "test_create_custom_lambda_resource__verify_cfnresponse_failed" - "test_state_machine_creation_fails_with_invalid_names" - # needs graphql - "test_get_schema_creation_status" # only appears in aarch64 currently, but best to be safe "test_state_machine_list_executions_with_filter" ]; diff --git a/pkgs/development/python-modules/msal-extensions/default.nix b/pkgs/development/python-modules/msal-extensions/default.nix index f81395f0245..a811018da21 100644 --- a/pkgs/development/python-modules/msal-extensions/default.nix +++ b/pkgs/development/python-modules/msal-extensions/default.nix @@ -11,11 +11,11 @@ buildPythonPackage rec { pname = "msal-extensions"; - version = "0.3.1"; + version = "1.0.0"; src = fetchPypi { inherit pname version; - sha256 = "d9029af70f2cbdc5ad7ecfed61cb432ebe900484843ccf72825445dbfe62d311"; + sha256 = "sha256-xnarpWsMzjeD3htcXs/oKNuZgWeHUSbKS0fcZDZFE1Q="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/multidict/default.nix b/pkgs/development/python-modules/multidict/default.nix index 0ea21ecbe40..6ee07173269 100644 --- a/pkgs/development/python-modules/multidict/default.nix +++ b/pkgs/development/python-modules/multidict/default.nix @@ -7,13 +7,13 @@ buildPythonPackage rec { pname = "multidict"; - version = "5.2.0"; + version = "6.0.2"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "0dd1c93edb444b33ba2274b66f63def8a327d607c6c790772f448a53b6ea59ce"; + sha256 = "sha256-X/O9dfOOTEPx9HDy33pNQwuCHEziK+OE4UWctX1rsBM="; }; postPatch = '' diff --git a/pkgs/development/python-modules/mutagen/default.nix b/pkgs/development/python-modules/mutagen/default.nix index 33fc3c02dae..6308b6fceb6 100644 --- a/pkgs/development/python-modules/mutagen/default.nix +++ b/pkgs/development/python-modules/mutagen/default.nix @@ -1,37 +1,74 @@ { lib , buildPythonPackage +, pythonOlder , fetchPypi -, isPy27 -, flake8 + +# docs +, python +, sphinx +, sphinx_rtd_theme + +# tests , hypothesis -, pycodestyle -, pyflakes -, pytest -, setuptools -, pkgs +, pytestCheckHook }: buildPythonPackage rec { pname = "mutagen"; version = "1.45.1"; - disabled = isPy27; # abandoned + format = "pyproject"; + + disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; sha256 = "6397602efb3c2d7baebd2166ed85731ae1c1d475abca22090b7141ff5034b3e1"; }; - propagatedBuildInputs = [ setuptools ]; + outputs = [ + "doc" + "out" + ]; + + nativeBuildInputs = [ + sphinx + sphinx_rtd_theme + ]; + + postInstall = '' + ${python.interpreter} setup.py build_sphinx --build-dir=$doc + ''; + checkInputs = [ - pkgs.faad2 pkgs.flac pkgs.vorbis-tools pkgs.liboggz - pkgs.glibcLocales pycodestyle pyflakes pytest hypothesis flake8 + hypothesis + pytestCheckHook + ]; + + disabledTests = [ + # Hypothesis produces unreliable results: Falsified on the first call but did not on a subsequent one + "test_test_fileobj_save" + ]; + + disabledTestPaths = [ + # we are not interested in code quality measurements + "tests/quality/test_flake8.py" ]; - LC_ALL = "en_US.UTF-8"; meta = with lib; { - description = "Python multimedia tagging library"; + description = "Python module for handling audio metadata"; + longDescription = '' + Mutagen is a Python module to handle audio metadata. It supports + ASF, FLAC, MP4, Monkey's Audio, MP3, Musepack, Ogg Opus, Ogg FLAC, + Ogg Speex, Ogg Theora, Ogg Vorbis, True Audio, WavPack, OptimFROG, + and AIFF audio files. All versions of ID3v2 are supported, and all + standard ID3v2.4 frames are parsed. It can read Xing headers to + accurately calculate the bitrate and length of MP3s. ID3 and APEv2 + tags can be edited regardless of audio format. It can also + manipulate Ogg streams on an individual packet/page level. + ''; homepage = "https://mutagen.readthedocs.io"; - license = licenses.lgpl2Plus; + changelog = "https://mutagen.readthedocs.io/en/latest/changelog.html#release-${lib.replaceStrings [ "." ] [ "-" ] version}"; + license = licenses.gpl2Plus; platforms = platforms.all; }; } diff --git a/pkgs/development/python-modules/mypy/default.nix b/pkgs/development/python-modules/mypy/default.nix index 5c5e985641f..937c9587172 100644 --- a/pkgs/development/python-modules/mypy/default.nix +++ b/pkgs/development/python-modules/mypy/default.nix @@ -14,22 +14,22 @@ buildPythonPackage rec { pname = "mypy"; - version = "0.931"; + version = "0.941"; disabled = pythonOlder "3.6"; src = fetchFromGitHub { owner = "python"; repo = "mypy"; rev = "v${version}"; - sha256 = "1v83flrdxh8grcp40qw04q4hzjflih9xwib64078vsxv2w36f817"; + hash = "sha256-H2SWJA0WWyKV7/5miFawv4JRXu/J7H6Wer1eBL+Tru0="; }; patches = [ # FIXME: Remove patch after upstream has decided the proper solution. # https://github.com/python/mypy/pull/11143 (fetchpatch { - url = "https://github.com/python/mypy/commit/f1755259d54330cd087cae763cd5bbbff26e3e8a.patch"; - sha256 = "sha256-5gPahX2X6+/qUaqDQIGJGvh9lQ2EDtks2cpQutgbOHk="; + url = "https://github.com/python/mypy/commit/e7869f05751561958b946b562093397027f6d5fa.patch"; + hash = "sha256-waIZ+m3tfvYE4HJ8kL6rN/C4fMjvLEe9UoPbt9mHWIM="; }) ]; diff --git a/pkgs/development/python-modules/napari/default.nix b/pkgs/development/python-modules/napari/default.nix index 74936da4f72..babdbc4506d 100644 --- a/pkgs/development/python-modules/napari/default.nix +++ b/pkgs/development/python-modules/napari/default.nix @@ -28,12 +28,12 @@ , wrapQtAppsHook }: mkDerivationWith buildPythonPackage rec { pname = "napari"; - version = "0.4.12"; + version = "0.4.14"; src = fetchFromGitHub { owner = "napari"; repo = pname; rev = "v${version}"; - sha256 = "sha256-0QSI0mgDjF70/X58fE7uWwlBUCGY5gsvbCm4oJkp2Yk="; + sha256 = "sha256-uDDj5dzsT4tRVV0Y+CYegiCpLM77XFaXEXEZXTnX808="; }; nativeBuildInputs = [ setuptools-scm wrapQtAppsHook ]; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/nbclient/default.nix b/pkgs/development/python-modules/nbclient/default.nix index c5e3facc062..52478ad4fd6 100644 --- a/pkgs/development/python-modules/nbclient/default.nix +++ b/pkgs/development/python-modules/nbclient/default.nix @@ -6,12 +6,12 @@ buildPythonPackage rec { pname = "nbclient"; - version = "0.5.10"; + version = "0.5.11"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "b5fdea88d6fa52ca38de6c2361401cfe7aaa7cd24c74effc5e489cec04d79088"; + sha256 = "sha256-dRUWmS80tYFyutVO7x5L9+T0Rg1Y4lXKGk5clklHYAc="; }; inherit doCheck; diff --git a/pkgs/development/python-modules/nbconvert/default.nix b/pkgs/development/python-modules/nbconvert/default.nix index ab91f22acc4..8604698cc2a 100644 --- a/pkgs/development/python-modules/nbconvert/default.nix +++ b/pkgs/development/python-modules/nbconvert/default.nix @@ -23,11 +23,11 @@ buildPythonPackage rec { pname = "nbconvert"; - version = "6.4.0"; + version = "6.4.2"; src = fetchPypi { inherit pname version; - sha256 = "5412ec774c6db4fccecb8c4ba07ec5d37d6dcf5762593cb3d6ecbbeb562ebbe5"; + sha256 = "sha256-6ygD2xj2+szmvzsBtoT+R5B5lL0VbRXqzN8BHj1/gWQ="; }; # Add $out/share/jupyter to the list of paths that are used to search for diff --git a/pkgs/development/python-modules/net2grid/default.nix b/pkgs/development/python-modules/net2grid/default.nix index 05b5321a69c..ef03d45ab6b 100644 --- a/pkgs/development/python-modules/net2grid/default.nix +++ b/pkgs/development/python-modules/net2grid/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "net2grid"; - version = "3.0.0"; + version = "4.0.0"; format = "pyproject"; disabled = pythonOlder "3.9"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "klaasnicolaas"; repo = "python-net2grid"; rev = "v${version}"; - hash = "sha256-nT9qMv4Zr7SjNwHRN3HRR11yl+Oue8VVCfJr2n1D02Q="; + hash = "sha256-Ihs8qUx50tAUcRBsVArRhzoLcQUi1vbYh8sPyK75AEk="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/networkx/default.nix b/pkgs/development/python-modules/networkx/default.nix index e8769f9efc7..c876c0d549d 100644 --- a/pkgs/development/python-modules/networkx/default.nix +++ b/pkgs/development/python-modules/networkx/default.nix @@ -10,11 +10,11 @@ buildPythonPackage rec { pname = "networkx"; # upgrade may break sage, please test the sage build or ping @timokau on upgrade - version = "2.6.3"; + version = "2.7"; src = fetchPypi { inherit pname version; - sha256 = "c0946ed31d71f1b732b5aaa6da5a0388a345019af232ce2f49c766e2d6795c51"; + sha256 = "sha256-7/t9nNXDbh4NM/QqOu9brd5QMFNYJqNn1c9gihcK9RU="; }; propagatedBuildInputs = [ decorator setuptools ]; diff --git a/pkgs/development/python-modules/nibabel/default.nix b/pkgs/development/python-modules/nibabel/default.nix index 60f5fcde63f..dc0a6d12f0c 100644 --- a/pkgs/development/python-modules/nibabel/default.nix +++ b/pkgs/development/python-modules/nibabel/default.nix @@ -3,7 +3,7 @@ , fetchPypi , isPy27 , packaging -, pytest +, pytestCheckHook , nose , numpy , h5py @@ -23,11 +23,14 @@ buildPythonPackage rec { propagatedBuildInputs = [ numpy scipy h5py packaging pydicom ]; - checkInputs = [ nose pytest ]; + checkInputs = [ + pytestCheckHook + ]; - checkPhase = '' - pytest - ''; + disabledTests = [ + # https://github.com/nipy/nibabel/issues/951 + "test_filenames" + ]; meta = with lib; { homepage = "https://nipy.org/nibabel"; diff --git a/pkgs/development/python-modules/nilearn/default.nix b/pkgs/development/python-modules/nilearn/default.nix index 60e11ef1d12..2494a446a81 100644 --- a/pkgs/development/python-modules/nilearn/default.nix +++ b/pkgs/development/python-modules/nilearn/default.nix @@ -3,11 +3,11 @@ buildPythonPackage rec { pname = "nilearn"; - version = "0.8.1"; + version = "0.9.0"; src = fetchPypi { inherit pname version; - sha256 = "a0489940855130f35bbc4cac0750479a6f82025215ea7b1d778faca064219298"; + sha256 = "sha256-+cjjCt71FImRCux3JLVpneF4Qn065jhz2tmyPdMh/nY="; }; checkInputs = [ pytestCheckHook ]; diff --git a/pkgs/development/python-modules/nose-cover3/default.nix b/pkgs/development/python-modules/nose-cover3/default.nix deleted file mode 100644 index b75dcc526c5..00000000000 --- a/pkgs/development/python-modules/nose-cover3/default.nix +++ /dev/null @@ -1,27 +0,0 @@ -{ lib -, buildPythonPackage -, fetchPypi -, nose -}: - -buildPythonPackage rec { - pname = "nose-cover3"; - version = "0.1.0"; - - src = fetchPypi { - inherit pname version; - sha256 = "1la4hhc1yszjpcchvkqk5xmzlb2g1b3fgxj9wwc58qc549whlcc1"; - }; - - propagatedBuildInputs = [ nose ]; - - # No tests included - doCheck = false; - - meta = with lib; { - description = "Coverage 3.x support for Nose"; - homepage = "https://github.com/ask/nosecover3"; - license = licenses.lgpl21; - }; - -} diff --git a/pkgs/development/python-modules/notebook/default.nix b/pkgs/development/python-modules/notebook/default.nix index 7a1902cb211..586257a4f8d 100644 --- a/pkgs/development/python-modules/notebook/default.nix +++ b/pkgs/development/python-modules/notebook/default.nix @@ -27,12 +27,12 @@ buildPythonPackage rec { pname = "notebook"; - version = "6.4.7"; + version = "6.4.8"; disabled = !isPy3k; src = fetchPypi { inherit pname version; - sha256 = "b01da66f11a203b3839d6afa4013674bcfff41c36552f9ad0fbcb2d93c92764a"; + sha256 = "sha256-Hphcncb2eL3/+53GVzBrVGm/pi1z4D906N77920oQxI="; }; LC_ALL = "en_US.utf8"; diff --git a/pkgs/development/python-modules/nplusone/default.nix b/pkgs/development/python-modules/nplusone/default.nix index d9a340d8249..898d209d913 100644 --- a/pkgs/development/python-modules/nplusone/default.nix +++ b/pkgs/development/python-modules/nplusone/default.nix @@ -8,7 +8,6 @@ , mock , peewee , pytest-django -, pytest-pythonpath , pytestCheckHook , six , sqlalchemy @@ -38,7 +37,6 @@ buildPythonPackage rec { mock peewee pytest-django - pytest-pythonpath pytestCheckHook sqlalchemy webtest @@ -54,6 +52,7 @@ buildPythonPackage rec { postPatch = '' substituteInPlace pytest.ini \ + --replace "python_paths" "pythonpath" \ --replace "--cov nplusone --cov-report term-missing" "" ''; diff --git a/pkgs/development/python-modules/numba/default.nix b/pkgs/development/python-modules/numba/default.nix index c1415a07b68..0219300f1fd 100644 --- a/pkgs/development/python-modules/numba/default.nix +++ b/pkgs/development/python-modules/numba/default.nix @@ -19,15 +19,24 @@ , cudaSupport ? false }: buildPythonPackage rec { - version = "0.55.0"; + version = "0.55.1"; pname = "numba"; disabled = pythonOlder "3.6" || pythonAtLeast "3.10"; src = fetchPypi { inherit pname version; - sha256 = "sha256-siHr2ZdmKh3Ld+TwkUDgIvv+dXetB4H8LgIUE126bL0="; + sha256 = "sha256-A+kGmiZm0chPk7ANvXFvuP7d6Lssbvr6LwSEKkZELqM="; }; + postPatch = '' + # numpy + substituteInPlace setup.py \ + --replace "1.22" "2" + + substituteInPlace numba/__init__.py \ + --replace "(1, 21)" "(2, 0)" + ''; + NIX_CFLAGS_COMPILE = lib.optionalString stdenv.isDarwin "-I${lib.getDev libcxx}/include/c++/v1"; propagatedBuildInputs = [ numpy llvmlite setuptools ] ++ lib.optionals cudaSupport [ cudatoolkit cudatoolkit.lib ]; diff --git a/pkgs/development/python-modules/numpydoc/default.nix b/pkgs/development/python-modules/numpydoc/default.nix index 0f57847b3a6..ea092d01dd4 100644 --- a/pkgs/development/python-modules/numpydoc/default.nix +++ b/pkgs/development/python-modules/numpydoc/default.nix @@ -7,13 +7,13 @@ buildPythonPackage rec { pname = "numpydoc"; - version = "1.1.0"; + version = "1.2"; disabled = isPy27; src = fetchPypi { inherit pname; inherit version; - sha256 = "c36fd6cb7ffdc9b4e165a43f67bf6271a7b024d0bb6b00ac468c9e2bfc76448e"; + sha256 = "sha256-DOwjN0DGsSWRMAXRboqZluBgUor8uLfK0/JwZinf1vc="; }; checkInputs = [ nose pytest ]; diff --git a/pkgs/development/python-modules/nunavut/default.nix b/pkgs/development/python-modules/nunavut/default.nix index f4cc9d3140e..5b974c9b6af 100644 --- a/pkgs/development/python-modules/nunavut/default.nix +++ b/pkgs/development/python-modules/nunavut/default.nix @@ -8,13 +8,13 @@ buildPythonPackage rec { pname = "nunavut"; - version = "1.6.2"; + version = "1.7.3"; disabled = pythonOlder "3.5"; src = fetchPypi { inherit pname version; - sha256 = "c6f99eaa65935b2c8a3f004025fb3c0309e11655c391d0fcd318d2a8665ca5c4"; + sha256 = "sha256-Tj3zCKDM4IBH9BKonhW9gPFD+lE3Q570Lxfm6b/d5JU="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/oauthlib/default.nix b/pkgs/development/python-modules/oauthlib/default.nix index 01e6ca29b5d..3a2f5cb1bdd 100644 --- a/pkgs/development/python-modules/oauthlib/default.nix +++ b/pkgs/development/python-modules/oauthlib/default.nix @@ -1,28 +1,26 @@ { lib -, buildPythonPackage -, fetchFromGitHub - -# propagates , blinker +, buildPythonPackage , cryptography -, pyjwt - -# test +, fetchFromGitHub , mock +, pyjwt , pytestCheckHook +, pythonOlder }: buildPythonPackage rec { pname = "oauthlib"; - version = "3.1.1"; + version = "3.2.0"; format = "setuptools"; - # master supports pyjwt==1.7.1 + disabled = pythonOlder "3.7"; + src = fetchFromGitHub { owner = pname; repo = pname; rev = "v${version}"; - hash = "sha256:1bgxpzh11i0x7h9py3a29cz5z714b3p498b62znnn5ciy0cr80sv"; + hash = "sha256-41JFURG8G8BjlAlNu2+lbj84XR/trAk1U5OPYxPq+5M="; }; propagatedBuildInputs = [ @@ -36,10 +34,14 @@ buildPythonPackage rec { pytestCheckHook ]; + pythonImportsCheck = [ + "oauthlib" + ]; + meta = with lib; { + description = "Generic, spec-compliant, thorough implementation of the OAuth request-signing logic"; homepage = "https://github.com/idan/oauthlib"; - description = "A generic, spec-compliant, thorough implementation of the OAuth request-signing logic"; - maintainers = with maintainers; [ prikhi ]; license = licenses.bsd3; + maintainers = with maintainers; [ prikhi ]; }; } diff --git a/pkgs/development/python-modules/objax/default.nix b/pkgs/development/python-modules/objax/default.nix index da0a70aafb4..84d56962cc4 100644 --- a/pkgs/development/python-modules/objax/default.nix +++ b/pkgs/development/python-modules/objax/default.nix @@ -7,7 +7,7 @@ , parameterized , pillow , scipy -, tensorflow-tensorboard +, tensorboard }: buildPythonPackage rec { @@ -33,7 +33,7 @@ buildPythonPackage rec { parameterized pillow scipy - tensorflow-tensorboard + tensorboard ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/onnx/default.nix b/pkgs/development/python-modules/onnx/default.nix index d32b82365dc..e873f325608 100644 --- a/pkgs/development/python-modules/onnx/default.nix +++ b/pkgs/development/python-modules/onnx/default.nix @@ -14,14 +14,14 @@ buildPythonPackage rec { pname = "onnx"; - version = "1.10.2"; + version = "1.11.0"; format = "setuptools"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "sha256-JNc8p9/X5sczmUT4lVS0AQcZiZM3kk/KFEfY8bXbUNY="; + sha256 = "sha256-7KIkx8LI7kByoHQ+SJioSpvfgpe15ZEKJjLkxBgv+yo="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/openai/default.nix b/pkgs/development/python-modules/openai/default.nix index 4fb744826b7..a8b65ea5894 100644 --- a/pkgs/development/python-modules/openai/default.nix +++ b/pkgs/development/python-modules/openai/default.nix @@ -9,6 +9,7 @@ , pandas-stubs , requests , tqdm +, wandb # Check dependencies , pytest-mock @@ -35,6 +36,7 @@ buildPythonPackage rec { pandas-stubs requests tqdm + wandb ]; pythonImportsCheck = [ "openai" ]; diff --git a/pkgs/development/python-modules/openapi-core/default.nix b/pkgs/development/python-modules/openapi-core/default.nix index 199ea38ae4a..32989e7f9ce 100644 --- a/pkgs/development/python-modules/openapi-core/default.nix +++ b/pkgs/development/python-modules/openapi-core/default.nix @@ -68,6 +68,8 @@ buildPythonPackage rec { disabledTestPaths = [ # AttributeError: 'str' object has no attribute '__name__' "tests/integration/validation" + # requires secrets and additional configuration + "tests/integration/contrib/test_django.py" # Unable to detect SECRET_KEY and ROOT_URLCONF "tests/integration/contrib/test_django.py" ]; diff --git a/pkgs/development/python-modules/openapi-schema-validator/default.nix b/pkgs/development/python-modules/openapi-schema-validator/default.nix index 8251c2cd017..ced5f8ed68b 100644 --- a/pkgs/development/python-modules/openapi-schema-validator/default.nix +++ b/pkgs/development/python-modules/openapi-schema-validator/default.nix @@ -14,14 +14,14 @@ buildPythonPackage rec { pname = "openapi-schema-validator"; - version = "0.2.0"; + version = "0.2.3"; format = "pyproject"; src = fetchFromGitHub { owner = "p1c2u"; repo = pname; rev = version; - sha256 = "sha256-HoXtDlXOoYqzsM4FxVfLQdIlpJXaNUcQo8//B4JqJoA="; + sha256 = "sha256-rgl2B55dnbpZszr+gWM0FgeXMKfrkDG7HeZBSw5Eles="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/openapi-spec-validator/default.nix b/pkgs/development/python-modules/openapi-spec-validator/default.nix index 4e61a86a501..7ef70ab3d3f 100644 --- a/pkgs/development/python-modules/openapi-spec-validator/default.nix +++ b/pkgs/development/python-modules/openapi-spec-validator/default.nix @@ -1,17 +1,23 @@ { lib, buildPythonPackage, isPy27, fetchPypi , jsonschema, openapi-schema-validator, pyyaml, six, pathlib -, mock, pytest, pytest-cov, pytest-flake8, tox, setuptools }: +, mock, pytest, pytest-cov, pytest-flake8, tox, setuptools +, poetry-core +, requests +}: buildPythonPackage rec { pname = "openapi-spec-validator"; - version = "0.3.1"; + version = "0.4.0"; + format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "3d70e6592754799f7e77a45b98c6a91706bdd309a425169d17d8e92173e198a2"; + sha256 = "sha256-l/JYhQr8l7BI98JlOFXg+I+masEDwr5Qd8eWCsoq1Jo="; }; - propagatedBuildInputs = [ jsonschema openapi-schema-validator pyyaml six setuptools ] + nativeBuildInputs = [ poetry-core ]; + + propagatedBuildInputs = [ jsonschema openapi-schema-validator pyyaml six setuptools requests ] ++ (lib.optionals (isPy27) [ pathlib ]); checkInputs = [ mock pytest pytest-cov pytest-flake8 tox ]; diff --git a/pkgs/development/python-modules/openshift/default.nix b/pkgs/development/python-modules/openshift/default.nix index 78e0c53c911..c233f88c73f 100644 --- a/pkgs/development/python-modules/openshift/default.nix +++ b/pkgs/development/python-modules/openshift/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "openshift"; - version = "0.12.1"; + version = "0.13.1"; src = fetchFromGitHub { owner = "openshift"; repo = "openshift-restclient-python"; rev = "v${version}"; - sha256 = "1di55xg3nl4dwrrfw314p4mfm6593kdi7ia517v1sm6x5p4hjl78"; + sha256 = "sha256-9mMHih2xuQve8hEnc5x4f9Pd4wX7IMy3vrxxGFCG+8o="; }; postPatch = '' diff --git a/pkgs/development/python-modules/ordered-set/default.nix b/pkgs/development/python-modules/ordered-set/default.nix index 7546566cb3a..8ea71fd2d90 100644 --- a/pkgs/development/python-modules/ordered-set/default.nix +++ b/pkgs/development/python-modules/ordered-set/default.nix @@ -1,24 +1,39 @@ -{ buildPythonPackage, fetchPypi, lib, isPy27, pytest }: +{ lib +, buildPythonPackage +, fetchPypi +, pythonOlder +, flit-core +, pytestCheckHook +}: buildPythonPackage rec { pname = "ordered-set"; - version = "4.0.2"; - disabled = isPy27; + version = "4.1.0"; + format = "pyproject"; - checkInputs = [ pytest ]; + disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "159syfbqnwqnivzjfn3x7ak3xwrxmnzbji7c2qhj1jjv0pgv54xs"; + sha256 = "sha256-aUqORMh2V8WSku3nKJHrkdNBMfZTFGOqswCRkcdzZKg="; }; - checkPhase = '' - py.test test.py - ''; + nativeBuildInputs = [ + flit-core + ]; - meta = { + checkInputs = [ + pytestCheckHook + ]; + + pythonImportsCheck = [ + "ordered_set" + ]; + + meta = with lib; { description = "A MutableSet that remembers its order, so that every entry has an index."; - license = lib.licenses.mit; - maintainers = [ lib.maintainers.MostAwesomeDude ]; + homepage = "https://github.com/rspeer/ordered-set"; + license = licenses.mit; + maintainers = with maintainers; [ MostAwesomeDude ]; }; } diff --git a/pkgs/development/python-modules/osc-lib/default.nix b/pkgs/development/python-modules/osc-lib/default.nix index e9a662412b7..2777fc5be75 100644 --- a/pkgs/development/python-modules/osc-lib/default.nix +++ b/pkgs/development/python-modules/osc-lib/default.nix @@ -43,7 +43,13 @@ buildPythonPackage rec { ]; checkPhase = '' - stestr run + # tests parse cli output which slightly changed + stestr run -e <(echo " + osc_lib.tests.utils.test_tags.TestTagHelps.test_add_tag_filtering_option_to_parser + osc_lib.tests.utils.test_tags.TestTagHelps.test_add_tag_option_to_parser_for_create + osc_lib.tests.utils.test_tags.TestTagHelps.test_add_tag_option_to_parser_for_set + osc_lib.tests.utils.test_tags.TestTagHelps.test_add_tag_option_to_parser_for_unset + ") ''; pythonImportsCheck = [ "osc_lib" ]; diff --git a/pkgs/development/python-modules/oslo-context/default.nix b/pkgs/development/python-modules/oslo-context/default.nix index f38b9bb09b3..7f5fa9b98ca 100644 --- a/pkgs/development/python-modules/oslo-context/default.nix +++ b/pkgs/development/python-modules/oslo-context/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "oslo.context"; - version = "3.4.0"; + version = "4.1.0"; src = fetchPypi { inherit pname version; - sha256 = "970f96361c5de9a5dc86d48a648289d77118180ca13ba5eeb307137736ffa953"; + sha256 = "sha256-damnIqVS+6ionooBAo+oKmGQqzF6lZG7gzA6IhCnkUQ="; }; postPatch = '' diff --git a/pkgs/development/python-modules/packageurl-python/default.nix b/pkgs/development/python-modules/packageurl-python/default.nix index 5236cc7bbf8..c2d74d0d3c1 100644 --- a/pkgs/development/python-modules/packageurl-python/default.nix +++ b/pkgs/development/python-modules/packageurl-python/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "packageurl-python"; - version = "0.9.8.1"; + version = "0.9.9"; src = fetchPypi { inherit pname version; - sha256 = "sha256-Z14OyAWPoIN6BAUEcXi96mp9C0aWaYP6eeHAoa+rHJ4="; + sha256 = "sha256-hyoENLmkSLP6l1cXEfad0qP7cjRa1myQsX2Cev6oLwk="; }; checkInputs = [ pytestCheckHook ]; diff --git a/pkgs/development/python-modules/pandas/default.nix b/pkgs/development/python-modules/pandas/default.nix index 536f883f29a..90309ef0b40 100644 --- a/pkgs/development/python-modules/pandas/default.nix +++ b/pkgs/development/python-modules/pandas/default.nix @@ -27,12 +27,12 @@ buildPythonPackage rec { pname = "pandas"; - version = "1.3.5"; + version = "1.4.1"; format = "setuptools"; src = fetchPypi { inherit pname version; - sha256 = "1e4285f5de1012de20ca46b188ccf33521bff61ba5c5ebd78b4fb28e5416a9f1"; + sha256 = "sha256-jbk+yYrHy1+KwUIMEPXjxDUzFT8lP+f7bYkc9aorgNI="; }; nativeBuildInputs = [ cython ]; diff --git a/pkgs/development/python-modules/parameterizedtestcase/default.nix b/pkgs/development/python-modules/parameterizedtestcase/default.nix index 20e662cd66d..9d277af8d1a 100644 --- a/pkgs/development/python-modules/parameterizedtestcase/default.nix +++ b/pkgs/development/python-modules/parameterizedtestcase/default.nix @@ -27,5 +27,6 @@ buildPythonPackage rec { homepage = "https://github.com/msabramo/python_unittest_parameterized_test_case"; license = licenses.mit; maintainers = with maintainers; [ dotlambda ]; + broken = python.isPy3k; # uses use_2to3 }; } diff --git a/pkgs/development/python-modules/parse-type/default.nix b/pkgs/development/python-modules/parse-type/default.nix index 5cfb4b610ce..3356853e8ac 100644 --- a/pkgs/development/python-modules/parse-type/default.nix +++ b/pkgs/development/python-modules/parse-type/default.nix @@ -8,13 +8,13 @@ buildPythonPackage rec { pname = "parse-type"; - version = "0.5.6"; + version = "0.6.0"; src = fetchFromGitHub { owner = "jenisys"; repo = "parse_type"; rev = "v${version}"; - sha256 = "sha256-CJroqJIi5DpmR8i1lr8OJ+234615PhpVUsqK91XOT3E="; + sha256 = "sha256-v79zzAAwXYoK2N8ZPl1L90qOwMRexAV2wCTMvo4vrSc="; }; propagatedBuildInputs = [ @@ -29,7 +29,7 @@ buildPythonPackage rec { postPatch = '' substituteInPlace pytest.ini \ --replace "--metadata PACKAGE_UNDER_TEST parse_type" "" \ - --replace "--metadata PACKAGE_VERSION 0.5.6" "" \ + --replace "--metadata PACKAGE_VERSION ${version}" "" \ --replace "--html=build/testing/report.html --self-contained-html" "" \ --replace "--junit-xml=build/testing/report.xml" "" ''; diff --git a/pkgs/development/python-modules/pathlib2/default.nix b/pkgs/development/python-modules/pathlib2/default.nix index 757ddc7d974..f0f0163652c 100644 --- a/pkgs/development/python-modules/pathlib2/default.nix +++ b/pkgs/development/python-modules/pathlib2/default.nix @@ -5,28 +5,32 @@ , pythonOlder , scandir ? null , glibcLocales -, mock ? null +, mock +, typing }: buildPythonPackage rec { pname = "pathlib2"; - version = "2.3.6"; + version = "2.3.7.post1"; src = fetchPypi { inherit pname version; - sha256 = "7d8bcb5555003cdf4a8d2872c538faa3a0f5d20630cb360e518ca3b981795e5f"; + sha256 = "sha256-n+DtrYmLg8DD4ZnIQrJ+0hZkXS4Xd1ey3Wc4TUETxkE="; }; - propagatedBuildInputs = [ six ] ++ lib.optional (pythonOlder "3.5") scandir; - checkInputs = [ glibcLocales ] ++ lib.optional (pythonOlder "3.3") mock; + propagatedBuildInputs = [ six ] + ++ lib.optionals (pythonOlder "3.5") [ scandir typing ]; + checkInputs = [ glibcLocales ] + ++ lib.optional (pythonOlder "3.3") mock; preCheck = '' export LC_ALL="en_US.UTF-8" ''; - meta = { + meta = with lib; { description = "This module offers classes representing filesystem paths with semantics appropriate for different operating systems."; - homepage = "https://pypi.python.org/pypi/pathlib2/"; - license = with lib.licenses; [ mit ]; + homepage = "https://pypi.org/project/pathlib2/"; + license = with licenses; [ mit ]; + maintainers = with maintainers; [ SuperSandro2000 ]; }; } diff --git a/pkgs/development/python-modules/pdm-pep517/default.nix b/pkgs/development/python-modules/pdm-pep517/default.nix index aa99d5f23f7..5649e092634 100644 --- a/pkgs/development/python-modules/pdm-pep517/default.nix +++ b/pkgs/development/python-modules/pdm-pep517/default.nix @@ -8,13 +8,13 @@ buildPythonPackage rec { pname = "pdm-pep517"; - version = "0.10.2"; + version = "0.11.2"; format = "pyproject"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "83bb71a7588df69ea0d77dc6524741c3a1af54ad5f421341428de648bfc03a29"; + sha256 = "sha256-4AC6tDUCwZHXGAiiYw3UTs4wGjGdJuACocrqOnMHzSA="; }; preCheck = '' diff --git a/pkgs/development/python-modules/peewee/default.nix b/pkgs/development/python-modules/peewee/default.nix index 852ba5ffbcb..85a58271b6d 100644 --- a/pkgs/development/python-modules/peewee/default.nix +++ b/pkgs/development/python-modules/peewee/default.nix @@ -14,14 +14,14 @@ buildPythonPackage rec { pname = "peewee"; - version = "3.14.8"; + version = "3.14.9"; format = "setuptools"; src = fetchFromGitHub { owner = "coleifer"; repo = pname; rev = version; - sha256 = "sha256-BJSM+7+VdW6SxN4/AXsX8NhQPdIFoYrVRVwR9OsJ3QE="; + sha256 = "sha256-8rwWKsOOYUrk2k1piCurb1LkB9zzmSITq52qWdyx4yk="; }; buildInputs = [ diff --git a/pkgs/development/python-modules/pelican/default.nix b/pkgs/development/python-modules/pelican/default.nix index 436192e18b8..723b3888edb 100644 --- a/pkgs/development/python-modules/pelican/default.nix +++ b/pkgs/development/python-modules/pelican/default.nix @@ -28,14 +28,14 @@ buildPythonPackage rec { pname = "pelican"; - version = "4.7.1"; + version = "4.7.2"; disabled = pythonOlder "3.6"; src = fetchFromGitHub { owner = "getpelican"; repo = pname; rev = version; - sha256 = "0w3r4ifbrl6mhfphabqs048qys7x6k164ds63jr10l3namljm8ad"; + hash = "sha256-ZBGzsyCtFt5uj9mpOpGdTzGJET0iwOAgDTy80P6anRU="; # Remove unicode file names which leads to different checksums on HFS+ # vs. other filesystems because of unicode normalisation. extraPostFetch = '' diff --git a/pkgs/development/python-modules/perfplot/default.nix b/pkgs/development/python-modules/perfplot/default.nix index ca8f867e6e3..a2bb6baec96 100644 --- a/pkgs/development/python-modules/perfplot/default.nix +++ b/pkgs/development/python-modules/perfplot/default.nix @@ -14,7 +14,7 @@ buildPythonPackage rec { pname = "perfplot"; - version = "0.9.13"; + version = "0.10.1"; format = "pyproject"; disabled = pythonOlder "3.7"; @@ -22,7 +22,7 @@ buildPythonPackage rec { owner = "nschloe"; repo = pname; rev = "v${version}"; - sha256 = "0ry5x38sv8gh505z6ip90jymm7kfgyf80y3vjb2i6z567bnblam6"; + sha256 = "sha256-5qZolEJWjhqk1JakcGBWZ1hxeP1cLqcB7IZ3ufjOC/o="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/pex/default.nix b/pkgs/development/python-modules/pex/default.nix index 0c22823d565..4d6085e6deb 100644 --- a/pkgs/development/python-modules/pex/default.nix +++ b/pkgs/development/python-modules/pex/default.nix @@ -7,14 +7,14 @@ buildPythonPackage rec { pname = "pex"; - version = "2.1.75"; + version = "2.1.76"; format = "flit"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - hash = "sha256-G5JE4/ZWZYo8Fpy3ZhIaWNzGfEkWb9qA9vL3UVTqf0Q="; + hash = "sha256-a/e0tz67QR7SSYQRt3tJqgCGJLn6oi0+3HMpg8NKRH8="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/pgspecial/default.nix b/pkgs/development/python-modules/pgspecial/default.nix index 308e8c9c8b6..e7b4e62ab57 100644 --- a/pkgs/development/python-modules/pgspecial/default.nix +++ b/pkgs/development/python-modules/pgspecial/default.nix @@ -10,11 +10,11 @@ buildPythonPackage rec { pname = "pgspecial"; - version = "1.13.0"; + version = "1.13.1"; src = fetchPypi { inherit pname version; - sha256 = "3847e205b19469f16ded05bda24b4758056d67ade4075a5ded4ce6628a9bad01"; + sha256 = "sha256-1dq5ZpCQgnWRbcLGIu+uIX8ULggWX6NmlJ1By8VlhwE="; }; propagatedBuildInputs = [ @@ -28,6 +28,11 @@ buildPythonPackage rec { pytestCheckHook ]; + disabledTests = [ + # requires a postgresql server + "test_slash_dp_pattern_schema" + ]; + meta = with lib; { description = "Meta-commands handler for Postgres Database"; homepage = "https://pypi.python.org/pypi/pgspecial"; diff --git a/pkgs/development/python-modules/phonenumbers/default.nix b/pkgs/development/python-modules/phonenumbers/default.nix index 9faad1e96de..92b621e49c6 100644 --- a/pkgs/development/python-modules/phonenumbers/default.nix +++ b/pkgs/development/python-modules/phonenumbers/default.nix @@ -6,12 +6,12 @@ buildPythonPackage rec { pname = "phonenumbers"; - version = "8.12.43"; + version = "8.12.44"; format = "setuptools"; src = fetchPypi { inherit pname version; - sha256 = "sha256-HIJwouJX1sZUWKQig/gtPsp/e52SVFSmlm4vBN914c8="; + sha256 = "sha256-Js/QJX0XBP4viMr/LKq7cNFqh3seZbaq5R+fu+EKqM4="; }; checkInputs = [ diff --git a/pkgs/development/python-modules/pip/default.nix b/pkgs/development/python-modules/pip/default.nix index 2ddba8f363e..a4370fbaae5 100644 --- a/pkgs/development/python-modules/pip/default.nix +++ b/pkgs/development/python-modules/pip/default.nix @@ -14,14 +14,14 @@ buildPythonPackage rec { pname = "pip"; - version = "21.3.1"; + version = "22.0.3"; format = "other"; src = fetchFromGitHub { owner = "pypa"; repo = pname; rev = version; - sha256 = "sha256-A8oePI5VOKGJTY6ZuUhcOhRkz2I2FSdfsS2xIgktCVQ="; + sha256 = "sha256-Wu2QQfb0pehPLLa+za32C4jH1arkBKKc3jlAMRkDV5Q="; name = "${pname}-${version}-source"; }; diff --git a/pkgs/development/python-modules/platformdirs/default.nix b/pkgs/development/python-modules/platformdirs/default.nix index 2be8928f630..584d9361fb7 100644 --- a/pkgs/development/python-modules/platformdirs/default.nix +++ b/pkgs/development/python-modules/platformdirs/default.nix @@ -11,7 +11,7 @@ buildPythonPackage rec { pname = "platformdirs"; - version = "2.5.0"; + version = "2.5.1"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -20,7 +20,7 @@ buildPythonPackage rec { owner = pname; repo = pname; rev = version; - sha256 = "sha256-fppwtY8VX8IQ96H930xItO7mS8LlxxHgBcKlwIL5P2E="; + sha256 = "sha256-z6WIwTWLlc/chNRxt3dqqa/IxYj1BBTcQ6OcfliHrvA="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/plotly/default.nix b/pkgs/development/python-modules/plotly/default.nix index fbe869b0703..fc24a4c2e6f 100644 --- a/pkgs/development/python-modules/plotly/default.nix +++ b/pkgs/development/python-modules/plotly/default.nix @@ -9,11 +9,11 @@ buildPythonPackage rec { pname = "plotly"; - version = "5.5.0"; + version = "5.6.0"; src = fetchPypi { inherit pname version; - sha256 = "20b8a1a0f0434f9b8d10eb7caa66e947a9a1d698e5a53d40d447bbc0d2ae41f0"; + sha256 = "sha256-2G5E69449HU9/5gqubXgPPhyqrj99TpAPpme03gVQzE="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/plumbum/default.nix b/pkgs/development/python-modules/plumbum/default.nix index ae3c4941f68..70b4421778f 100644 --- a/pkgs/development/python-modules/plumbum/default.nix +++ b/pkgs/development/python-modules/plumbum/default.nix @@ -50,6 +50,14 @@ buildPythonPackage rec { "test_change_env" "test_dictlike" "test_local" + # incompatible with pytest 7 + "test_incorrect_login" + ]; + + disabledTestPaths = [ + # incompatible with pytest7 + # https://github.com/tomerfiliba/plumbum/issues/594 + "tests/test_remote.py" ]; meta = with lib; { diff --git a/pkgs/development/python-modules/poetry-core/default.nix b/pkgs/development/python-modules/poetry-core/default.nix index e8632d0ed07..5922d67fc8b 100644 --- a/pkgs/development/python-modules/poetry-core/default.nix +++ b/pkgs/development/python-modules/poetry-core/default.nix @@ -13,14 +13,14 @@ buildPythonPackage rec { pname = "poetry-core"; - version = "1.0.7"; + version = "1.0.8"; format = "pyproject"; src = fetchFromGitHub { owner = "python-poetry"; repo = pname; rev = version; - sha256 = "0v86x8f8pcbviv2cdn7jjbgj3c994qasx0bqk1kr0mj8m6pjwy9z"; + sha256 = "sha256-cs9SMGD9RdW8Wx/IAMq6gkOUBsney5r19hyGva98grk="; }; postPatch = lib.optionalString (pythonOlder "3.8") '' diff --git a/pkgs/development/python-modules/pooch/default.nix b/pkgs/development/python-modules/pooch/default.nix index 3b7ddaf2801..238e6ad6223 100644 --- a/pkgs/development/python-modules/pooch/default.nix +++ b/pkgs/development/python-modules/pooch/default.nix @@ -11,12 +11,13 @@ buildPythonPackage rec { pname = "pooch"; - version = "1.5.2"; + version = "1.6.0"; + format = "pyproject"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "5969b2f1defbdc405df932767e05e0b536e2771c27f1f95d7f260bc99bf13581"; + sha256 = "sha256-V9IOxLEN1pTSsFu2S8axCcboWmwUBXlM6H7Ys0GrP0Q="; }; nativeBuildInputs = [ setuptools-scm ]; diff --git a/pkgs/development/python-modules/portalocker/default.nix b/pkgs/development/python-modules/portalocker/default.nix index 357ca815407..cd7d6d03bbd 100644 --- a/pkgs/development/python-modules/portalocker/default.nix +++ b/pkgs/development/python-modules/portalocker/default.nix @@ -22,6 +22,10 @@ buildPythonPackage rec { pytest-mypy ]; + disabledTests = [ + "test_combined" # no longer compatible with setuptools>=58 + ]; + meta = with lib; { description = "A library to provide an easy API to file locking"; homepage = "https://github.com/WoLpH/portalocker"; diff --git a/pkgs/development/python-modules/prettytable/default.nix b/pkgs/development/python-modules/prettytable/default.nix index f914a0f3df4..25d22c2c5a2 100644 --- a/pkgs/development/python-modules/prettytable/default.nix +++ b/pkgs/development/python-modules/prettytable/default.nix @@ -10,11 +10,11 @@ buildPythonPackage rec { pname = "prettytable"; - version = "3.0.0"; + version = "3.1.1"; src = fetchPypi { inherit pname version; - sha256 = "69fe75d78ac8651e16dd61265b9e19626df5d630ae294fc31687aa6037b97a58"; + sha256 = "sha256-Q8niMnLKJT0Diudv463eiXlOkuf8qy3fW5SzhkLvTyE="; }; nativeBuildInputs = [ setuptools-scm ]; diff --git a/pkgs/development/python-modules/prometheus-client/default.nix b/pkgs/development/python-modules/prometheus-client/default.nix index 7af4e2b02fa..9ba5068359b 100644 --- a/pkgs/development/python-modules/prometheus-client/default.nix +++ b/pkgs/development/python-modules/prometheus-client/default.nix @@ -7,7 +7,7 @@ buildPythonPackage rec { pname = "prometheus-client"; - version = "0.12.0"; + version = "0.13.1"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -16,7 +16,7 @@ buildPythonPackage rec { owner = "prometheus"; repo = "client_python"; rev = "v${version}"; - sha256 = "1a0kllal5vkkdv325k0mx1mha2l9808mcz4dqx6qrgfskz8c2xjl"; + sha256 = "sha256-1sMnlUOvvdlUuh288UalAdlf0a1mpnM+Y/upwlnL1H8="; }; checkInputs = [ diff --git a/pkgs/development/python-modules/promise/default.nix b/pkgs/development/python-modules/promise/default.nix index 403f0c09791..8833689cec1 100644 --- a/pkgs/development/python-modules/promise/default.nix +++ b/pkgs/development/python-modules/promise/default.nix @@ -18,6 +18,11 @@ buildPythonPackage rec { sha256 = "17mq1bm78xfl0x1g50ng502m5ldq6421rzz35hlqafsj0cq8dkp6"; }; + postPatch = '' + substituteInPlace tests/test_extra.py \ + --replace "assert_exc.traceback[-1].path.strpath" "str(assert_exc.traceback[-1].path)" + ''; + propagatedBuildInputs = [ six ]; diff --git a/pkgs/development/python-modules/prompt-toolkit/default.nix b/pkgs/development/python-modules/prompt-toolkit/default.nix index e38560be2eb..4ec9e381daf 100644 --- a/pkgs/development/python-modules/prompt-toolkit/default.nix +++ b/pkgs/development/python-modules/prompt-toolkit/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { pname = "prompt-toolkit"; - version = "3.0.24"; + version = "3.0.28"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -16,7 +16,7 @@ buildPythonPackage rec { src = fetchPypi { pname = "prompt_toolkit"; inherit version; - sha256 = "1bb05628c7d87b645974a1bad3f17612be0c29fa39af9f7688030163f680bad6"; + sha256 = "sha256-nxzRax6GwpaPJRnX+zHdnWaZFvUVYSwmnRTp7VK1FlA="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/proto-plus/default.nix b/pkgs/development/python-modules/proto-plus/default.nix index dd2494729ef..defc28d9429 100644 --- a/pkgs/development/python-modules/proto-plus/default.nix +++ b/pkgs/development/python-modules/proto-plus/default.nix @@ -10,12 +10,12 @@ buildPythonPackage rec { pname = "proto-plus"; - version = "1.19.8"; + version = "1.20.3"; disabled = !isPy3k; src = fetchPypi { inherit pname version; - sha256 = "bdf45f0e0be71510eb2ec9db4da78afde7b5fb8b0a507a36340a9b6ce8e48e58"; + sha256 = "sha256-8osiW8nmwU4gb7f46Zakb7LM2QJkjlEtSWq7anFqSuU="; }; propagatedBuildInputs = [ protobuf ]; diff --git a/pkgs/development/python-modules/proxy-py/default.nix b/pkgs/development/python-modules/proxy-py/default.nix index 4bf07b1375e..6527f88e489 100644 --- a/pkgs/development/python-modules/proxy-py/default.nix +++ b/pkgs/development/python-modules/proxy-py/default.nix @@ -13,7 +13,7 @@ buildPythonPackage rec { pname = "proxy-py"; - version = "2.3.1"; + version = "2.4.0"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -22,7 +22,7 @@ buildPythonPackage rec { owner = "abhinavsingh"; repo = "proxy.py"; rev = "v${version}"; - sha256 = "sha256-qqwb3t8/xicDGfO6l843qRwh0yUfthnOIhgNeKIbEO4="; + sha256 = "sha256-VagX7ATVu6AT4POWoG9btizxFeBh9MLXiLpavtfXnyM="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/pybind11/default.nix b/pkgs/development/python-modules/pybind11/default.nix index 46c1307826e..8627ca53d54 100644 --- a/pkgs/development/python-modules/pybind11/default.nix +++ b/pkgs/development/python-modules/pybind11/default.nix @@ -36,7 +36,7 @@ buildPythonPackage rec { postBuild = '' # build tests - make + make -j $NIX_BUILD_CORES -l $NIX_BUILD_CORES ''; postInstall = '' @@ -60,6 +60,8 @@ buildPythonPackage rec { "tests/test_numpy_dtypes.py" # no need to test internal packaging "tests/extra_python_package/test_files.py" + # tests that try to parse setuptools stdout + "tests/extra_setuptools/test_setuphelper.py" ]; meta = with lib; { diff --git a/pkgs/development/python-modules/pybluez/default.nix b/pkgs/development/python-modules/pybluez/default.nix index 1cd7d91ef25..ae90c21bea9 100644 --- a/pkgs/development/python-modules/pybluez/default.nix +++ b/pkgs/development/python-modules/pybluez/default.nix @@ -2,11 +2,14 @@ , buildPythonPackage , fetchFromGitHub , pkgs +, isPy3k }: buildPythonPackage rec { version = "unstable-20160819"; pname = "pybluez"; + # requires use2to3, which is no longer supported in setuptools>58 + disabled = isPy3k; propagatedBuildInputs = [ pkgs.bluez ]; diff --git a/pkgs/development/python-modules/pycognito/default.nix b/pkgs/development/python-modules/pycognito/default.nix index 375453231b9..ff050c15bfe 100644 --- a/pkgs/development/python-modules/pycognito/default.nix +++ b/pkgs/development/python-modules/pycognito/default.nix @@ -4,22 +4,25 @@ , envs , fetchFromGitHub , isPy27 +, freezegun , mock +, moto , pytestCheckHook , python-jose , requests +, requests-mock }: buildPythonPackage rec { pname = "pycognito"; - version = "2022.01.0"; + version = "2022.02.1"; disabled = isPy27; src = fetchFromGitHub { owner = "pvizeli"; repo = pname; rev = version; - sha256 = "sha256-mmlw3irMC0SFjfEinXHyoPNfTvCcO02zGyqQLj9STSY="; + sha256 = "sha256-0PqeZ8yy2MzvIi1xQNosR7V2Ma3tMT0Q/v4OIv7f1Kg="; }; propagatedBuildInputs = [ @@ -30,8 +33,11 @@ buildPythonPackage rec { ]; checkInputs = [ + freezegun mock + moto pytestCheckHook + requests-mock ]; postPatch = '' diff --git a/pkgs/development/python-modules/pydmd/default.nix b/pkgs/development/python-modules/pydmd/default.nix index f80f9003478..68a19afddba 100644 --- a/pkgs/development/python-modules/pydmd/default.nix +++ b/pkgs/development/python-modules/pydmd/default.nix @@ -35,9 +35,10 @@ buildPythonPackage rec { pytestCheckHook ]; - disabledTestPaths = [ - # Those tests take over 1.5 h on hydra. Also, an error and two failures - "tests/test_spdmd.py" + pytestFlagsArray = [ + # test suite takes over 100 vCPU hours, just run small subset of it. + # TODO: Add a passthru.tests with all tests + "tests/test_dmdbase.py" ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/pyee/default.nix b/pkgs/development/python-modules/pyee/default.nix index a252cd4505a..e47e0366c86 100644 --- a/pkgs/development/python-modules/pyee/default.nix +++ b/pkgs/development/python-modules/pyee/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "pyee"; - version = "8.2.2"; + version = "9.0.4"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-XH5g+N+VcQ2+F1UOFs4BU/g5kMAO90SEG0Pzce1T6+o="; + sha256 = "sha256-J3DEkoq8ch9GtwXmpysMWUgMSmnJqDygsAu5lPHqSzI="; }; buildInputs = [ diff --git a/pkgs/development/python-modules/pyfaidx/default.nix b/pkgs/development/python-modules/pyfaidx/default.nix index a2815c3e1e2..e356ca563b5 100644 --- a/pkgs/development/python-modules/pyfaidx/default.nix +++ b/pkgs/development/python-modules/pyfaidx/default.nix @@ -10,12 +10,12 @@ buildPythonPackage rec { pname = "pyfaidx"; - version = "0.6.3.1"; + version = "0.6.4"; format = "setuptools"; src = fetchPypi { inherit pname version; - sha256 = "93adf036a75e08dc9b1dcd59de6a4db2f65a48c603edabe2e499764b6535ed50"; + sha256 = "sha256-e6O9yx30unSfdmWzTmoFKqToQkBqDflebfRxfMEj85I="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/pyfakefs/default.nix b/pkgs/development/python-modules/pyfakefs/default.nix index 29803793fd6..63bf4483911 100644 --- a/pkgs/development/python-modules/pyfakefs/default.nix +++ b/pkgs/development/python-modules/pyfakefs/default.nix @@ -7,13 +7,13 @@ }: buildPythonPackage rec { - version = "4.5.4"; + version = "4.5.5"; pname = "pyfakefs"; disabled = pythonOlder "3.5"; src = fetchPypi { inherit pname version; - sha256 = "5b5951e873f73bf12e3a19d8e4470c4b7962c51df753cf8c4caaf64e24a0a323"; + sha256 = "sha256-iIIe2MJjJxu2alRBmoJZGqEH+yz9pC3I8hWOC+CIWQc="; }; postPatch = '' diff --git a/pkgs/development/python-modules/pygit2/default.nix b/pkgs/development/python-modules/pygit2/default.nix index b8b405a8ecf..47654ff34c6 100644 --- a/pkgs/development/python-modules/pygit2/default.nix +++ b/pkgs/development/python-modules/pygit2/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "pygit2"; - version = "1.8.0"; + version = "1.9.0"; src = fetchPypi { inherit pname version; - sha256 = "sha256-bixc/1qh5D9DEDSAdhFS9cXWvvQPXB9QyHWKbonmbLY="; + sha256 = "sha256-xehYisrV4y+gWVWCVxBZ5rkOx8SHxYtOU8KADcveRMg="; }; preConfigure = lib.optionalString stdenv.isDarwin '' diff --git a/pkgs/development/python-modules/pygls/default.nix b/pkgs/development/python-modules/pygls/default.nix index 4c557b2676c..22cea8c0709 100644 --- a/pkgs/development/python-modules/pygls/default.nix +++ b/pkgs/development/python-modules/pygls/default.nix @@ -4,6 +4,7 @@ , fetchFromGitHub , setuptools-scm , pydantic +, toml , typeguard , mock , pytest-asyncio @@ -13,6 +14,7 @@ buildPythonPackage rec { pname = "pygls"; version = "0.11.3"; + format = "setuptools"; disabled = !isPy3k; src = fetchFromGitHub { @@ -27,6 +29,7 @@ buildPythonPackage rec { propagatedBuildInputs = [ pydantic + toml typeguard ]; # We don't know why an early version of pydantic is required, see: diff --git a/pkgs/development/python-modules/pyicu/default.nix b/pkgs/development/python-modules/pyicu/default.nix index 3281a7ceb87..02226feff2c 100644 --- a/pkgs/development/python-modules/pyicu/default.nix +++ b/pkgs/development/python-modules/pyicu/default.nix @@ -8,11 +8,11 @@ buildPythonPackage rec { pname = "PyICU"; - version = "2.8"; + version = "2.8.1"; src = fetchPypi { inherit pname version; - sha256 = "3d80de47045a8163db5aebc947c42b4d429eeea4f0c32af4f40b33981fa872b9"; + sha256 = "sha256-8LlUmof4e6fEE/E2edE3Jx4LN/HzmwEJrOOCV9TRSNY="; }; nativeBuildInputs = [ icu ]; # for icu-config, but should be replaced with pkg-config diff --git a/pkgs/development/python-modules/pylama/default.nix b/pkgs/development/python-modules/pylama/default.nix index 3f93aef0a3f..5d8674aac02 100644 --- a/pkgs/development/python-modules/pylama/default.nix +++ b/pkgs/development/python-modules/pylama/default.nix @@ -10,12 +10,14 @@ , pydocstyle , pyflakes , vulture +, isort +, pylint , pytestCheckHook }: buildPythonPackage rec { pname = "pylama"; - version = "8.3.6"; + version = "8.3.7"; format = "setuptools"; @@ -24,7 +26,7 @@ buildPythonPackage rec { owner = "klen"; repo = "pylama"; rev = version; - hash = "sha256-KU/G+2Fm4G/dUuNhhk8xM0Y8+7YOUUgREONM8CQGugw="; + hash = "sha256-//mrvZb4bT4aATURqa4g1DUagYe9SoP3o3OrwmiEJnI="; }; patches = [ @@ -45,14 +47,22 @@ buildPythonPackage rec { ]; checkInputs = [ + # avoid infinite recursion pylint -> isort -> pylama + (pylint.override { + isort = isort.overridePythonAttrs (old: { + doCheck = false; + }); + }) pytestCheckHook ]; + preCheck = '' + export HOME=$TEMP + ''; + disabledTests = [ - "test_pylint" # infinite recursion "test_quotes" # FIXME package pylama-quotes "test_radon" # FIXME package radon - "test_sort" ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/pylint-django/default.nix b/pkgs/development/python-modules/pylint-django/default.nix index 291ef8fba62..61d49bd3ba0 100644 --- a/pkgs/development/python-modules/pylint-django/default.nix +++ b/pkgs/development/python-modules/pylint-django/default.nix @@ -11,14 +11,14 @@ buildPythonPackage rec { pname = "pylint-django"; - version = "2.5.0"; + version = "2.5.2"; disabled = !isPy3k; src = fetchFromGitHub { owner = "PyCQA"; repo = pname; rev = "v${version}"; - sha256 = "1r48dss9qnzlifwy5ylkffdw35aaajmil0486mav056jm1vmi2pr"; + sha256 = "sha256-VgGdV1T154LauclGo6jpLPUrYn5vTOWwvO4IXQ9se7c="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pymemcache/default.nix b/pkgs/development/python-modules/pymemcache/default.nix index f30b6ea06b4..f2055ca9a79 100644 --- a/pkgs/development/python-modules/pymemcache/default.nix +++ b/pkgs/development/python-modules/pymemcache/default.nix @@ -8,13 +8,13 @@ buildPythonPackage rec { pname = "pymemcache"; - version = "3.5.0"; + version = "3.5.1"; src = fetchFromGitHub { owner = "pinterest"; repo = pname; rev = "v${version}"; - sha256 = "sha256-O2qmcLWCUSc1f32irelIZOOuOziOUQXFGcuQJBXPvvM="; + sha256 = "sha256-DKqfv5gf9gzbnEPQSzy2mAaVYJZL9jmTKyGWVzj40T4="; }; checkInputs = [ diff --git a/pkgs/development/python-modules/pymongo/default.nix b/pkgs/development/python-modules/pymongo/default.nix index bae4f7c25fb..ba184f68b4b 100644 --- a/pkgs/development/python-modules/pymongo/default.nix +++ b/pkgs/development/python-modules/pymongo/default.nix @@ -6,12 +6,12 @@ buildPythonPackage rec { pname = "pymongo"; - version = "3.12.2"; + version = "3.12.3"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "64ea5e97fca1a37f83df9f3460bf63640bc0d725e12f3471e6acbf3a6040dd37"; + sha256 = "sha256-ConK3ABipeU2ZN3gQ/bAlxcrjBxfAJRJAJUoL/mZWl8="; }; # Tests call a running mongodb instance diff --git a/pkgs/development/python-modules/pynndescent/default.nix b/pkgs/development/python-modules/pynndescent/default.nix index f15cfef63c6..79b914f6122 100644 --- a/pkgs/development/python-modules/pynndescent/default.nix +++ b/pkgs/development/python-modules/pynndescent/default.nix @@ -34,6 +34,16 @@ buildPythonPackage rec { pytestCheckHook ]; + disabledTests = [ + # numpy.core._exceptions._UFuncNoLoopError + "test_sparse_nn_descent_query_accuracy_angular" + "test_nn_descent_query_accuracy_angular" + "test_alternative_distances" + # scipy: ValueError: Unknown Distance Metric: wminkowski + # https://github.com/scikit-learn/scikit-learn/pull/21741 + "test_weighted_minkowski" + ]; + pythonImportsCheck = [ "pynndescent" ]; diff --git a/pkgs/development/python-modules/pyomo/default.nix b/pkgs/development/python-modules/pyomo/default.nix index e8d89e9ef2d..20450cd9eff 100644 --- a/pkgs/development/python-modules/pyomo/default.nix +++ b/pkgs/development/python-modules/pyomo/default.nix @@ -12,14 +12,14 @@ buildPythonPackage rec { pname = "pyomo"; - version = "5.7.3"; + version = "6.3.0"; disabled = isPy27; # unable to import pyutilib.th src = fetchFromGitHub { repo = "pyomo"; owner = "pyomo"; rev = version; - sha256 = "sha256-p0/DdCwyXdzXElzjWewKs0Oi7BMXC+BxgYikdZL0t68="; + sha256 = "sha256-xyjiB5fDRf5y9Av5Cr+8wtU4pHzMHsM45mcmJEOaTWs="; }; checkInputs = [ nose glpk ]; diff --git a/pkgs/development/python-modules/pyopengl-accelerate/default.nix b/pkgs/development/python-modules/pyopengl-accelerate/default.nix index c6839bba989..195ec563d50 100644 --- a/pkgs/development/python-modules/pyopengl-accelerate/default.nix +++ b/pkgs/development/python-modules/pyopengl-accelerate/default.nix @@ -1,11 +1,13 @@ { lib , buildPythonPackage +, pythonAtLeast , fetchPypi }: buildPythonPackage rec { pname = "pyopengl-accelerate"; version = "3.1.5"; + disabled = pythonAtLeast "3.10"; # fails to compile src = fetchPypi { pname = "PyOpenGL-accelerate"; diff --git a/pkgs/development/python-modules/pyopengl/default.nix b/pkgs/development/python-modules/pyopengl/default.nix index 72d6ae33258..7370057ad72 100644 --- a/pkgs/development/python-modules/pyopengl/default.nix +++ b/pkgs/development/python-modules/pyopengl/default.nix @@ -7,12 +7,12 @@ buildPythonPackage rec { pname = "pyopengl"; - version = "3.1.5"; + version = "3.1.6"; src = fetchPypi { pname = "PyOpenGL"; inherit version; - sha256 = "4107ba0d0390da5766a08c242cf0cf3404c377ed293c5f6d701e457c57ba3424"; + sha256 = "sha256-jqbIdzkn7adAW//G9buTvoFWmnsFyMrFDNlOlp3OXic="; }; propagatedBuildInputs = [ pillow ]; diff --git a/pkgs/development/python-modules/pyownet/default.nix b/pkgs/development/python-modules/pyownet/default.nix index 2bdc18e1e24..9a368c26087 100644 --- a/pkgs/development/python-modules/pyownet/default.nix +++ b/pkgs/development/python-modules/pyownet/default.nix @@ -14,6 +14,10 @@ buildPythonPackage rec { sha256 = "4f2fa4471c2f806b35090bdc6c092305c6eded3ff3736f8b586d35bdb157de62"; }; + postPatch = '' + sed -i '/use_2to3/d' setup.py + ''; + # tests access network doCheck = false; diff --git a/pkgs/development/python-modules/pyparsing/default.nix b/pkgs/development/python-modules/pyparsing/default.nix index 27047cf6eab..449c5334e66 100644 --- a/pkgs/development/python-modules/pyparsing/default.nix +++ b/pkgs/development/python-modules/pyparsing/default.nix @@ -11,13 +11,13 @@ let pyparsing = buildPythonPackage rec { pname = "pyparsing"; - version = "3.0.6"; + version = "3.0.7"; src = fetchFromGitHub { owner = "pyparsing"; repo = pname; rev = "pyparsing_${version}"; - sha256 = "0n89ky7rx5yg09ssji8liahnyxip08hz7syc2k4pmlgs4978181a"; + sha256 = "sha256-RyvTTbFshAZgyZPgzqcq31E504RlnMZuf16jJYGqDDI="; }; # circular dependencies if enabled by default diff --git a/pkgs/development/python-modules/pypdf3/default.nix b/pkgs/development/python-modules/pypdf3/default.nix index 4970c0d527b..a4273497e3b 100644 --- a/pkgs/development/python-modules/pypdf3/default.nix +++ b/pkgs/development/python-modules/pypdf3/default.nix @@ -8,12 +8,12 @@ buildPythonPackage rec { pname = "pypdf3"; - version = "1.0.5"; + version = "1.0.6"; src = fetchPypi { pname = "PyPDF3"; inherit version; - sha256 = "sha256-DGKpR4p3z8tw4gKi5Hmj09svysD3Hkn4NklhgROmEAU="; + sha256 = "sha256-yUbzJzQZ43JY415yJz9JkEqxVyPYenYcERXvmXmfjF8="; }; LC_ALL = "en_US.UTF-8"; diff --git a/pkgs/development/python-modules/pyperf/default.nix b/pkgs/development/python-modules/pyperf/default.nix index 40a77fc0c7b..25cf9906cb4 100644 --- a/pkgs/development/python-modules/pyperf/default.nix +++ b/pkgs/development/python-modules/pyperf/default.nix @@ -15,11 +15,11 @@ buildPythonPackage rec { pname = "pyperf"; - version = "2.3.0"; + version = "2.3.1"; src = fetchPypi { inherit pname version; - sha256 = "8a85dd42e067131d5b26b71472336da7f7f4b87ff9c97350d89f5ff0de9adedc"; + sha256 = "sha256-SsLiz3JKubUlInw7SmnxarXHFOpbrWHJdODF1XhyOKE="; }; checkInputs = [ nose psutil ] ++ diff --git a/pkgs/development/python-modules/pyres/default.nix b/pkgs/development/python-modules/pyres/default.nix index bb15a4d927a..a5b618d5690 100644 --- a/pkgs/development/python-modules/pyres/default.nix +++ b/pkgs/development/python-modules/pyres/default.nix @@ -1,26 +1,10 @@ { lib, stdenv, fetchPypi, buildPythonPackage, fetchFromGitHub, simplejson, redis, setproctitle, nose, pkgs }: -let - - # the requirements of `pyres` support Redis 3.x (due to a missing upper-bound), - # but it doesn't support Redis 3.x. - redis' = redis.overridePythonAttrs (old: rec { - pname = "redis"; - version = "2.10.6"; - src = fetchPypi { - inherit pname version; - sha256 = "03vcgklykny0g0wpvqmy8p6azi2s078317wgb2xjv5m2rs9sjb52"; - }; - }); - -in - buildPythonPackage rec { pname = "pyres"; version = "1.5"; - # ps is used in Worker.worker_pids method - propagatedBuildInputs = [ simplejson setproctitle redis' pkgs.ps ]; + propagatedBuildInputs = [ simplejson setproctitle redis pkgs.ps ]; checkInputs = [ nose pkgs.redis ]; # PyPI tarball doesn't contain tests so let's use GitHub @@ -44,5 +28,6 @@ buildPythonPackage rec { homepage = "https://github.com/binarydud/pyres"; license = licenses.mit; maintainers = with maintainers; [ jluttine ]; + broken = true; # not compatible with latest redis }; } diff --git a/pkgs/development/python-modules/pyrsistent/default.nix b/pkgs/development/python-modules/pyrsistent/default.nix index 75cecc7d709..5a1b66bfa26 100644 --- a/pkgs/development/python-modules/pyrsistent/default.nix +++ b/pkgs/development/python-modules/pyrsistent/default.nix @@ -9,13 +9,13 @@ buildPythonPackage rec { pname = "pyrsistent"; - version = "0.18.0"; + version = "0.18.1"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "773c781216f8c2900b42a7b638d5b517bb134ae1acbebe4d1e8f1f41ea60eb4b"; + sha256 = "sha256-1NYfi5k6clW6cU3zrKUnAPgSUon4T3BM+AkWUXxG65Y="; }; propagatedBuildInputs = [ six ]; diff --git a/pkgs/development/python-modules/pyspark/default.nix b/pkgs/development/python-modules/pyspark/default.nix index 2e6f41aa233..c424e3195e7 100644 --- a/pkgs/development/python-modules/pyspark/default.nix +++ b/pkgs/development/python-modules/pyspark/default.nix @@ -6,11 +6,11 @@ buildPythonPackage rec { pname = "pyspark"; - version = "3.2.0"; + version = "3.2.1"; src = fetchPypi { inherit pname version; - sha256 = "bfea06179edbfb4bc76a0f470bd3c38e12f00e1023e3ad0373558d07cff102ab"; + sha256 = "sha256-C4E1kmLsbprHjDUzROfeAmAn0UDG3vlJ/w2Aq3D4mlQ="; }; # pypandoc is broken with pandoc2, so we just lose docs. diff --git a/pkgs/development/python-modules/pyspnego/default.nix b/pkgs/development/python-modules/pyspnego/default.nix index 561ec037c0a..563042091bf 100644 --- a/pkgs/development/python-modules/pyspnego/default.nix +++ b/pkgs/development/python-modules/pyspnego/default.nix @@ -13,7 +13,7 @@ buildPythonPackage rec { pname = "pyspnego"; - version = "0.3.1"; + version = "0.5.0"; disabled = pythonOlder "3.7"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "jborean93"; repo = pname; rev = "v${version}"; - sha256 = "sha256-f7CR7wMxHNNpxizV7MFCtWci3SSNvdx+W5i/rgOUSxY="; + sha256 = "sha256-CvPvyP7Vi2Ib+ikgUQt8JkVt5fxzapG590TgAehXqHE="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pytesseract/default.nix b/pkgs/development/python-modules/pytesseract/default.nix index 4aac6902ce3..13cfdaea214 100644 --- a/pkgs/development/python-modules/pytesseract/default.nix +++ b/pkgs/development/python-modules/pytesseract/default.nix @@ -1,8 +1,9 @@ -{ buildPythonPackage, fetchPypi, lib, pillow, tesseract, substituteAll, packaging }: +{ buildPythonPackage, fetchPypi, lib, packaging, pillow, tesseract, substituteAll }: buildPythonPackage rec { pname = "pytesseract"; version = "0.3.9"; + format = "pyproject"; src = fetchPypi { inherit pname version; @@ -16,8 +17,14 @@ buildPythonPackage rec { }) ]; - buildInputs = [ tesseract ]; - propagatedBuildInputs = [ pillow packaging ]; + buildInputs = [ + tesseract + ]; + + propagatedBuildInputs = [ + packaging + pillow + ]; # the package doesn't have any tests. doCheck = false; diff --git a/pkgs/development/python-modules/pytest-asyncio/default.nix b/pkgs/development/python-modules/pytest-asyncio/default.nix index b8d3dffa3b0..da60feb724f 100644 --- a/pkgs/development/python-modules/pytest-asyncio/default.nix +++ b/pkgs/development/python-modules/pytest-asyncio/default.nix @@ -11,7 +11,7 @@ buildPythonPackage rec { pname = "pytest-asyncio"; - version = "0.18.0"; + version = "0.18.1"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -20,7 +20,7 @@ buildPythonPackage rec { owner = "pytest-dev"; repo = pname; rev = "v${version}"; - hash = "sha256-PE66ogjfzj6cW3+UD5nZHSt6zg7b+j6Q4ACznE4j0j8="; + hash = "sha256-9KN45+Pdz40rJv1NUxuoy8xWtLGt7kz7YcqfjfZ9x4A="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/pytest-cid/default.nix b/pkgs/development/python-modules/pytest-cid/default.nix index c1c918c4d60..767d300f7dd 100644 --- a/pkgs/development/python-modules/pytest-cid/default.nix +++ b/pkgs/development/python-modules/pytest-cid/default.nix @@ -20,6 +20,11 @@ buildPythonPackage rec { sha256 = "sha256-H2RtMGYWukowTTfqZSx+hikxzkqw1v5bA4AfZfiVl8U="; }; + postPatch = '' + substituteInPlace pyproject.toml \ + --replace "pytest >= 5.0, < 7.0" "pytest >= 5.0" + ''; + propagatedBuildInputs = [ py-cid ]; diff --git a/pkgs/development/python-modules/pytest-httpx/default.nix b/pkgs/development/python-modules/pytest-httpx/default.nix index 9536325ade5..569ac8606f6 100644 --- a/pkgs/development/python-modules/pytest-httpx/default.nix +++ b/pkgs/development/python-modules/pytest-httpx/default.nix @@ -10,7 +10,7 @@ buildPythonPackage rec { pname = "pytest-httpx"; - version = "0.17.3"; + version = "0.20.0"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -19,7 +19,7 @@ buildPythonPackage rec { owner = "Colin-b"; repo = "pytest_httpx"; rev = "v${version}"; - sha256 = "sha256-cJRzjNIN9Fc8vcjmndW+akjxDSp+wFahY2MEslgXIwM="; + sha256 = "sha256-9LDbVZgTmfyYAWylUy6Q4KH2gKpAa/o4IhqQV31BVgY="; }; buildInputs = [ diff --git a/pkgs/development/python-modules/pytest-isort/default.nix b/pkgs/development/python-modules/pytest-isort/default.nix index e628e6a158c..c06959b96c4 100644 --- a/pkgs/development/python-modules/pytest-isort/default.nix +++ b/pkgs/development/python-modules/pytest-isort/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "pytest-isort"; - version = "2.0.0"; + version = "3.0.0"; src = fetchPypi { inherit pname version; - sha256 = "821a8c5c9c4f3a3c52cfa9c541fbe89ac9e28728125125af53724c4c3f129117"; + sha256 = "sha256-T+Sybq0q93ZzDsI/WHDXQh81qs4ipBxOk4WG702Hh8s="; }; propagatedBuildInputs = [ isort ]; diff --git a/pkgs/development/python-modules/pytest-mpl/default.nix b/pkgs/development/python-modules/pytest-mpl/default.nix index 747411ad745..b5a5775f56e 100644 --- a/pkgs/development/python-modules/pytest-mpl/default.nix +++ b/pkgs/development/python-modules/pytest-mpl/default.nix @@ -10,11 +10,11 @@ buildPythonPackage rec { pname = "pytest-mpl"; - version = "0.13"; + version = "0.14.0"; src = fetchPypi { inherit pname version; - sha256 = "582db6e14315f9b08cbd2df39b136dc344bfe8a27c2f05b995460fb0969ec19e"; + sha256 = "sha256-iE4HjS1TgK9WQzhOIzw1jpZZgl+y2X/9r48YXENMjYk="; }; buildInputs = [ diff --git a/pkgs/development/python-modules/pytest-mypy/default.nix b/pkgs/development/python-modules/pytest-mypy/default.nix index 8c52fa2e698..bec0ee59d0c 100644 --- a/pkgs/development/python-modules/pytest-mypy/default.nix +++ b/pkgs/development/python-modules/pytest-mypy/default.nix @@ -9,11 +9,11 @@ buildPythonPackage rec { pname = "pytest-mypy"; - version = "0.8.1"; + version = "0.9.1"; src = fetchPypi { inherit pname version; - sha256 = "1fa55723a4bf1d054fcba1c3bd694215a2a65cc95ab10164f5808afd893f3b11"; + sha256 = "sha256-n/o79AXBLFxr6ekuIr67arLJG5wy9FsPDJOvRzJpq1w="; }; nativeBuildInputs = [ setuptools-scm ]; diff --git a/pkgs/development/python-modules/pytest-pythonpath/default.nix b/pkgs/development/python-modules/pytest-pythonpath/default.nix deleted file mode 100644 index 8c3fb48b430..00000000000 --- a/pkgs/development/python-modules/pytest-pythonpath/default.nix +++ /dev/null @@ -1,26 +0,0 @@ -{ buildPythonPackage, fetchPypi, lib, pytest }: - -buildPythonPackage rec { - pname = "pytest-pythonpath"; - version = "0.7.4"; - - src = fetchPypi { - inherit pname version; - sha256 = "sha256-ZOGVsjqPjAxjH7Fogtmtb6QTftHylh3dFdUgZc1DXbY="; - }; - - buildInputs = [ pytest ]; - checkInputs = [ pytest ]; - - checkPhase = '' - pytest - ''; - - meta = with lib; { - description = - "Pytest plugin for adding to the PYTHONPATH from command line or configs"; - homepage = "https://github.com/bigsassy/pytest-pythonpath"; - maintainers = with maintainers; [ cript0nauta ]; - license = licenses.mit; - }; -} diff --git a/pkgs/development/python-modules/pytest-regressions/default.nix b/pkgs/development/python-modules/pytest-regressions/default.nix index 6866df7b712..99099d3ac92 100644 --- a/pkgs/development/python-modules/pytest-regressions/default.nix +++ b/pkgs/development/python-modules/pytest-regressions/default.nix @@ -15,14 +15,14 @@ buildPythonPackage rec { pname = "pytest-regressions"; - version = "2.3.0"; + version = "2.3.1"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-STWtZzbvhQ0NsSvl7jh0CjmYjmtRA/LTUQAAaze5Tg4="; + sha256 = "sha256-s+xM2zTo9idgYnXYuDTGXmDhowc+MmuzcnpCcnPQIh0="; }; SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/pytest-runner/default.nix b/pkgs/development/python-modules/pytest-runner/default.nix index d99f72299dd..baca23d7749 100644 --- a/pkgs/development/python-modules/pytest-runner/default.nix +++ b/pkgs/development/python-modules/pytest-runner/default.nix @@ -1,20 +1,29 @@ -{ lib, buildPythonPackage, fetchPypi, setuptools-scm, pytest }: +{ lib +, buildPythonPackage +, fetchPypi +, setuptools-scm +, pytest +}: buildPythonPackage rec { pname = "pytest-runner"; - version = "5.3.1"; + version = "6.0.0"; + format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "0fce5b8dc68760f353979d99fdd6b3ad46330b6b1837e2077a89ebcf204aac91"; + sha256 = "sha256-tNhTYu0ptMNIZ43nl99Djw8FCUl924xkcJbAKm2HtoU="; }; - nativeBuildInputs = [ setuptools-scm pytest ]; - postPatch = '' rm pytest.ini ''; + nativeBuildInputs = [ + setuptools-scm + pytest + ]; + checkPhase = '' py.test tests ''; diff --git a/pkgs/development/python-modules/pytest-socket/default.nix b/pkgs/development/python-modules/pytest-socket/default.nix index 1376d3e8412..bcd4abb4d41 100644 --- a/pkgs/development/python-modules/pytest-socket/default.nix +++ b/pkgs/development/python-modules/pytest-socket/default.nix @@ -9,7 +9,7 @@ buildPythonPackage rec { pname = "pytest-socket"; - version = "0.5.0"; + version = "0.5.1"; format = "pyproject"; disabled = pythonOlder "3.7"; @@ -18,7 +18,7 @@ buildPythonPackage rec { owner = "miketheman"; repo = pname; rev = version; - hash = "sha256-HdGkpIHFsoAG2+8UyL9jSb3Dm8bWkYzREdY3i15ls/Q="; + hash = "sha256-QKHnuq2pqWMVUhF9nnhJggEK6SSyp6zBEfQX9tGND2E="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/pytest-subtests/default.nix b/pkgs/development/python-modules/pytest-subtests/default.nix index d5e379b524d..b1df1ceaad6 100644 --- a/pkgs/development/python-modules/pytest-subtests/default.nix +++ b/pkgs/development/python-modules/pytest-subtests/default.nix @@ -8,14 +8,14 @@ buildPythonPackage rec { pname = "pytest-subtests"; - version = "0.6.0"; + version = "0.7.0"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-Pr0wao3PdRM/F0LyiMgvNkJuvPihMtTuiXgtIOhPwTo="; + sha256 = "sha256-lcRMd+P77emEi7iMqQs4SBX8uoCQ75qfVWWasWOxaBw="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/pytest-testmon/default.nix b/pkgs/development/python-modules/pytest-testmon/default.nix index 1b291778b2a..3a397001865 100644 --- a/pkgs/development/python-modules/pytest-testmon/default.nix +++ b/pkgs/development/python-modules/pytest-testmon/default.nix @@ -8,12 +8,12 @@ buildPythonPackage rec { pname = "pytest-testmon"; - version = "1.2.2"; + version = "1.3.0"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "e69d5aeac4e371986f94e8ad06e56d70633870d026f2306fca44051f02fcb688"; + sha256 = "sha256-1Qyroq6Dv11EaCGRAj19bKQBfRz26XSh5TJY7xA/vBE="; }; propagatedBuildInputs = [ coverage ]; diff --git a/pkgs/development/python-modules/pytest-timeout/default.nix b/pkgs/development/python-modules/pytest-timeout/default.nix index f99340e48b3..e380068c59d 100644 --- a/pkgs/development/python-modules/pytest-timeout/default.nix +++ b/pkgs/development/python-modules/pytest-timeout/default.nix @@ -9,12 +9,12 @@ buildPythonPackage rec { pname = "pytest-timeout"; - version = "2.0.2"; + version = "2.1.0"; format = "setuptools"; src = fetchPypi { inherit pname version; - sha256 = "e6f98b54dafde8d70e4088467ff621260b641eb64895c4195b6e5c8f45638112"; + sha256 = "sha256-wHygdATGEvirviIpSyPDaOLlEEtSHBeQGVVh834aw9k="; }; buildInputs = [ diff --git a/pkgs/development/python-modules/pytest/default.nix b/pkgs/development/python-modules/pytest/default.nix index 0b1bb2b0203..109e9182858 100644 --- a/pkgs/development/python-modules/pytest/default.nix +++ b/pkgs/development/python-modules/pytest/default.nix @@ -1,5 +1,4 @@ { lib, buildPythonPackage, pythonOlder, fetchPypi, isPy3k, isPyPy -, pythonAtLeast, fetchpatch , atomicwrites , attrs , hypothesis @@ -13,29 +12,21 @@ , setuptools , setuptools-scm , six -, toml +, tomli , wcwidth , writeText }: buildPythonPackage rec { pname = "pytest"; - version = "6.2.5"; + version = "7.0.1"; disabled = !isPy3k; src = fetchPypi { inherit pname version; - sha256 = "131b36680866a76e6781d13f101efb86cf674ebb9762eb70d3082b6f29889e89"; + sha256 = "sha256-4wkFoMEx09lLiWJKHMWv7D4LovvbFRhn2ODr1JhQ8XE="; }; - patches = lib.optionals (pythonAtLeast "3.10") [ - (fetchpatch { - # Fix test_errors_in_xfail_skip_expressions for Python 3.10.1, remove after 6.2.5 - url = "https://github.com/pytest-dev/pytest/commit/913439f5e5691f391e2969b3c8f0a49e50dce43a.patch"; - sha256 = "0hsl3lww6bx5k99cp8gj0fy9rg02kcfbwiiwjx2y8vbhwd5ns41p"; - }) - ]; - nativeBuildInputs = [ setuptools-scm ]; propagatedBuildInputs = [ @@ -48,7 +39,7 @@ buildPythonPackage rec { py setuptools six - toml + tomli wcwidth ] ++ lib.optionals (pythonOlder "3.6") [ pathlib2 ]; @@ -95,7 +86,7 @@ buildPythonPackage rec { # - files are not needed after tests are finished pytestRemoveBytecodePhase () { # suffix is defined at: - # https://github.com/pytest-dev/pytest/blob/6.2.5/src/_pytest/assertion/rewrite.py#L51-L53 + # https://github.com/pytest-dev/pytest/blob/7.0.1/src/_pytest/assertion/rewrite.py#L51-L53 find $out -name "*-pytest-*.py[co]" -delete } preDistPhases+=" pytestRemoveBytecodePhase" diff --git a/pkgs/development/python-modules/python-daemon/default.nix b/pkgs/development/python-modules/python-daemon/default.nix index 074e5699e3d..cc12b14aa15 100644 --- a/pkgs/development/python-modules/python-daemon/default.nix +++ b/pkgs/development/python-modules/python-daemon/default.nix @@ -51,6 +51,11 @@ buildPythonPackage rec { }) ]; + disabledTestPaths = [ + # requires removed distutils.command + "test_version.py" + ]; + disabledTests = [ "begin_with_TestCase" "changelog_TestCase" diff --git a/pkgs/development/python-modules/python-dbusmock/default.nix b/pkgs/development/python-modules/python-dbusmock/default.nix index 60e6f2e7455..378c58f0236 100644 --- a/pkgs/development/python-modules/python-dbusmock/default.nix +++ b/pkgs/development/python-modules/python-dbusmock/default.nix @@ -5,13 +5,13 @@ buildPythonPackage rec { pname = "python-dbusmock"; - version = "0.25.0"; + version = "0.26.1"; src = fetchFromGitHub { owner = "martinpitt"; repo = pname; rev = version; - sha256 = "0zg2aib0k6hc1vvlbdcmp003m85dvkv7pndzgkc4vv2y9qpi0jp9"; + sha256 = "sha256-kavbWMTgKU/rBIo7RMs9NkwReYQyEdeFwMBSzEM9wa0="; }; prePatch = '' diff --git a/pkgs/development/python-modules/python-glanceclient/default.nix b/pkgs/development/python-modules/python-glanceclient/default.nix index 754bac51ea6..3d290ae5eda 100644 --- a/pkgs/development/python-modules/python-glanceclient/default.nix +++ b/pkgs/development/python-modules/python-glanceclient/default.nix @@ -19,11 +19,11 @@ buildPythonApplication rec { pname = "python-glanceclient"; - version = "3.5.0"; + version = "3.6.0"; src = fetchPypi { inherit pname version; - sha256 = "417b9d814b43e62df4351f26a0d5569b801e9f99f7758bd8c82ef994c3629356"; + sha256 = "sha256-gi1IYtWJL2pltoKTRy5gsHTRwHlp0GHoBMbh1UP5g9o="; }; postPatch = '' diff --git a/pkgs/development/python-modules/python-heatclient/default.nix b/pkgs/development/python-modules/python-heatclient/default.nix index 8ba5c7dd21f..d78682a8c66 100644 --- a/pkgs/development/python-modules/python-heatclient/default.nix +++ b/pkgs/development/python-modules/python-heatclient/default.nix @@ -22,11 +22,11 @@ buildPythonApplication rec { pname = "python-heatclient"; - version = "2.5.0"; + version = "2.5.1"; src = fetchPypi { inherit pname version; - sha256 = "b610748eb3f18f6bd762e0808accdf872308289a77c3b19ed2d8b9f306393a42"; + sha256 = "sha256-3l7XyxKm18BAM1DhNsCmRwcZR224+8m/jQ1YHrwLHCs="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/python-ironicclient/default.nix b/pkgs/development/python-modules/python-ironicclient/default.nix index c193cf7cd1a..83449a9285d 100644 --- a/pkgs/development/python-modules/python-ironicclient/default.nix +++ b/pkgs/development/python-modules/python-ironicclient/default.nix @@ -20,11 +20,11 @@ buildPythonApplication rec { pname = "python-ironicclient"; - version = "4.10.0"; + version = "4.11.0"; src = fetchPypi { inherit pname version; - sha256 = "8f3ad8ae1fc4df524ea05a458ad2567b58144e881807dbbb985e282902d732fd"; + sha256 = "sha256-zGG/3Cq7mARyuGGvqa4KGWFmx/UN+W2KMuy+RNenzXM="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/python-manilaclient/default.nix b/pkgs/development/python-modules/python-manilaclient/default.nix index a2da2e4f4a7..09dc46ba955 100644 --- a/pkgs/development/python-modules/python-manilaclient/default.nix +++ b/pkgs/development/python-modules/python-manilaclient/default.nix @@ -22,11 +22,11 @@ buildPythonApplication rec { pname = "python-manilaclient"; - version = "3.2.0"; + version = "3.3.0"; src = fetchPypi { inherit pname version; - sha256 = "sha256-6iAed0mtEYHguYq4Rlh4YWT8E5hNqBYPcnG9/8RMspo="; + sha256 = "sha256-JFfkbJHmDQFbiWXw0Wp+0xSLyXowIHnsw7+5irZwhXo="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/python-slugify/default.nix b/pkgs/development/python-modules/python-slugify/default.nix index 16c4dc0f230..2f22a20afb3 100644 --- a/pkgs/development/python-modules/python-slugify/default.nix +++ b/pkgs/development/python-modules/python-slugify/default.nix @@ -9,14 +9,14 @@ buildPythonPackage rec { pname = "python-slugify"; - version = "6.1.0"; + version = "6.1.1"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - hash = "sha256-7/GQ5N+sl9L4wYkO5oJwns0jZQdCNhaH24LZXh5eJfU="; + hash = "sha256-AAAzl/TjFBTpIs5WezpNoozxQ2pT0zLJrutRx9jEaf0="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/python-snappy/default.nix b/pkgs/development/python-modules/python-snappy/default.nix index fe4d6ea7bda..397fcaa3dd0 100644 --- a/pkgs/development/python-modules/python-snappy/default.nix +++ b/pkgs/development/python-modules/python-snappy/default.nix @@ -4,35 +4,33 @@ , isPyPy , snappy , cffi -, nose +, python }: buildPythonPackage rec { pname = "python-snappy"; - version = "0.6.0"; + version = "0.6.1"; + format = "setuptools"; src = fetchPypi { inherit pname version; - sha256 = "06l9my361ig4x5ycyrmq33q83zcdib3y2zxfxv7k7dlpyp9ri2hn"; + sha256 = "sha256-tqEHqwYgasxTWdTFYyvZsi1EhwKnmzFpsMYuD7gIuyo="; }; buildInputs = [ snappy ]; propagatedBuildInputs = lib.optional isPyPy cffi; - checkInputs = [ nose ]; - checkPhase = '' - rm -r snappy # prevent local snappy from being picked up - nosetests test_snappy.py - '' + lib.optionalString isPyPy '' - nosetests test_snappy_cffi.py + runHook preCheck + ${python.interpreter} -m unittest discover + runHook postCheck ''; meta = with lib; { description = "Python library for the snappy compression library from Google"; homepage = "https://github.com/andrix/python-snappy"; license = licenses.bsd3; - maintainers = [ maintainers.costrouc ]; + maintainers = with maintainers; [ costrouc ]; }; } diff --git a/pkgs/development/python-modules/python-swiftclient/default.nix b/pkgs/development/python-modules/python-swiftclient/default.nix index cb3b5b850e3..8c1e38ed45e 100644 --- a/pkgs/development/python-modules/python-swiftclient/default.nix +++ b/pkgs/development/python-modules/python-swiftclient/default.nix @@ -10,11 +10,11 @@ buildPythonApplication rec { pname = "python-swiftclient"; - version = "3.13.0"; + version = "3.13.1"; src = fetchPypi { inherit pname version; - sha256 = "b200dcfbc6842bd4cac29efd0ea9ef34d3b8625957472ba7aa3ae0242437e2cc"; + sha256 = "sha256-LSbJC2OS9r76f7sW/Np75Eqibiropb7icF0dHIE4M/A="; }; propagatedBuildInputs = [ pbr python-keystoneclient ]; diff --git a/pkgs/development/python-modules/python3-saml/default.nix b/pkgs/development/python-modules/python3-saml/default.nix index a21ee97eca5..8bc9cf3090f 100644 --- a/pkgs/development/python-modules/python3-saml/default.nix +++ b/pkgs/development/python-modules/python3-saml/default.nix @@ -3,14 +3,14 @@ isodate, lxml, xmlsec, freezegun }: buildPythonPackage rec { pname = "python3-saml"; - version = "1.12.0"; + version = "1.14.0"; disabled = !isPy3k; src = fetchFromGitHub { owner = "onelogin"; repo = "python3-saml"; rev = "v${version}"; - sha256 = "sha256-VPUsjuo4FIes8ti0tkR0kT3J3RdUt1wtl4QEahVsc2c="; + sha256 = "sha256-TAfVXh1fSKhNn/lsi7elq4wFyKCxCtCYUTrnH3ytBTw="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pytomlpp/default.nix b/pkgs/development/python-modules/pytomlpp/default.nix index 271d193ce01..73c1987fb3c 100644 --- a/pkgs/development/python-modules/pytomlpp/default.nix +++ b/pkgs/development/python-modules/pytomlpp/default.nix @@ -38,6 +38,14 @@ buildPythonPackage rec { # pelican requires > 2.7 doCheck = !pythonOlder "3.6"; + disabledTests = [ + # incompatible with pytest7 + # https://github.com/bobfang1992/pytomlpp/issues/66 + "test_loads_valid_toml_files" + "test_round_trip_for_valid_toml_files" + "test_decode_encode_binary" + ]; + preCheck = '' cd tests ''; diff --git a/pkgs/development/python-modules/pytools/default.nix b/pkgs/development/python-modules/pytools/default.nix index 7dcd86705a3..f4710872cbe 100644 --- a/pkgs/development/python-modules/pytools/default.nix +++ b/pkgs/development/python-modules/pytools/default.nix @@ -3,34 +3,36 @@ , fetchPypi , pythonOlder , decorator -, appdirs -, six , numpy -, pytest +, platformdirs +, pytestCheckHook }: buildPythonPackage rec { pname = "pytools"; - version = "2021.2.9"; + version = "2022.1"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "db6cf83c9ba0a165d545029e2301621486d1e9ef295684072e5cd75316a13755"; + sha256 = "sha256-GXqs9uH11gxxW5JDh5Kst3Aq7Vnrv7FH+oTtp4DlT+4="; }; - checkInputs = [ pytest ]; - propagatedBuildInputs = [ decorator - appdirs - six numpy + platformdirs + ]; + + checkInputs = [ + pytestCheckHook ]; - checkPhase = '' - py.test -k 'not test_persistent_dict' - ''; + pythonImportsCheck = [ + "pytools" + "pytools.batchjob" + "pytools.lex" + ]; meta = { homepage = "https://github.com/inducer/pytools/"; diff --git a/pkgs/development/python-modules/pytorch-lightning/default.nix b/pkgs/development/python-modules/pytorch-lightning/default.nix index de75aa0ae8f..d3c9a965515 100644 --- a/pkgs/development/python-modules/pytorch-lightning/default.nix +++ b/pkgs/development/python-modules/pytorch-lightning/default.nix @@ -6,12 +6,12 @@ , pytestCheckHook , pytorch , pyyaml -, tensorflow-tensorboard +, tensorboard , tqdm }: buildPythonPackage rec { pname = "pytorch-lightning"; - version = "1.5.8"; + version = "1.5.10"; disabled = isPy27; @@ -19,14 +19,14 @@ buildPythonPackage rec { owner = "PyTorchLightning"; repo = pname; rev = version; - sha256 = "161mz66l11z4350q93fmmq3x0jzbp5761lf4fx3yvz17qzp7ygkn"; + sha256 = "sha256-GP6/VZuRv8dS5wKQW7RbtOSa2vV9Af2Jp+ioEW3bIgc="; }; propagatedBuildInputs = [ future pytorch pyyaml - tensorflow-tensorboard + tensorboard tqdm ]; diff --git a/pkgs/development/python-modules/pytorch-metric-learning/default.nix b/pkgs/development/python-modules/pytorch-metric-learning/default.nix index e9728b3d676..64dfca2e94b 100644 --- a/pkgs/development/python-modules/pytorch-metric-learning/default.nix +++ b/pkgs/development/python-modules/pytorch-metric-learning/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "pytorch-metric-learning"; - version = "1.1.0"; + version = "1.2.0"; disabled = isPy27; @@ -20,7 +20,7 @@ buildPythonPackage rec { owner = "KevinMusgrave"; repo = pname; rev = "v${version}"; - sha256 = "0qvlxgdml22fzrs47yzqpfzak8lfdrzayvapawfz93cq8903h7qp"; + sha256 = "sha256-M/iH+pIuamOmvxLtKMzWXiuMCnMXzpVFRb/HfYfCKdc="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pytorch-pfn-extras/default.nix b/pkgs/development/python-modules/pytorch-pfn-extras/default.nix index 46bd35b9cfb..3c239d97040 100644 --- a/pkgs/development/python-modules/pytorch-pfn-extras/default.nix +++ b/pkgs/development/python-modules/pytorch-pfn-extras/default.nix @@ -10,13 +10,13 @@ buildPythonPackage rec { pname = "pytorch-pfn-extras"; - version = "0.5.6"; + version = "0.5.7"; src = fetchFromGitHub { owner = "pfnet"; repo = pname; rev = "v${version}"; - sha256 = "1ch4vhz3zjanj5advqsj51yy7idrp8yvydvcg4ymwa3wsfjrx58g"; + sha256 = "sha256-gB575ZKXZRAy5K5CkBtfG6KG1yQ9WDREIobsy43CEOc="; }; propagatedBuildInputs = [ numpy pytorch typing-extensions ]; diff --git a/pkgs/development/python-modules/pytorch/breakpad-sigstksz.patch b/pkgs/development/python-modules/pytorch/breakpad-sigstksz.patch new file mode 100644 index 00000000000..33a2304cb9b --- /dev/null +++ b/pkgs/development/python-modules/pytorch/breakpad-sigstksz.patch @@ -0,0 +1,13 @@ +diff --git a/third_party/breakpad/src/client/linux/handler/exception_handler.cc b/third_party/breakpad/src/client/linux/handler/exception_handler.cc +index ca353c4099..499be0a986 100644 +--- a/third_party/breakpad/src/client/linux/handler/exception_handler.cc ++++ b/third_party/breakpad/src/client/linux/handler/exception_handler.cc +@@ -138,7 +138,7 @@ void InstallAlternateStackLocked() { + // SIGSTKSZ may be too small to prevent the signal handlers from overrunning + // the alternative stack. Ensure that the size of the alternative stack is + // large enough. +- static const unsigned kSigStackSize = std::max(16384, SIGSTKSZ); ++ const unsigned kSigStackSize = std::max<unsigned>(16384, SIGSTKSZ); + + // Only set an alternative stack if there isn't already one, or if the current + // one is too small. diff --git a/pkgs/development/python-modules/pytorch/default.nix b/pkgs/development/python-modules/pytorch/default.nix index c370eaf6a94..24ba74a1013 100644 --- a/pkgs/development/python-modules/pytorch/default.nix +++ b/pkgs/development/python-modules/pytorch/default.nix @@ -1,4 +1,4 @@ -{ stdenv, lib, fetchFromGitHub, buildPythonPackage, python, +{ stdenv, lib, fetchFromGitHub, fetchpatch, buildPythonPackage, python, cudaSupport ? false, cudatoolkit, cudnn, nccl, magma, mklDnnSupport ? true, useSystemNccl ? true, MPISupport ? false, mpi, @@ -12,7 +12,7 @@ numactl, # Propagated build inputs - dataclasses, numpy, pyyaml, cffi, click, typing-extensions, + numpy, pyyaml, cffi, click, typing-extensions, # Unit tests hypothesis, psutil, @@ -25,7 +25,7 @@ ninja, # dependencies for torch.utils.tensorboard - pillow, six, future, tensorflow-tensorboard, protobuf, + pillow, six, future, tensorboard, protobuf, isPy3k, pythonOlder }: @@ -117,9 +117,10 @@ let in buildPythonPackage rec { pname = "pytorch"; # Don't forget to update pytorch-bin to the same version. - version = "1.10.2"; + version = "1.11.0"; + format = "setuptools"; - disabled = !isPy3k; + disabled = pythonOlder "3.7.0"; outputs = [ "out" # output standard python package @@ -132,10 +133,15 @@ in buildPythonPackage rec { repo = "pytorch"; rev = "v${version}"; fetchSubmodules = true; - sha256 = "sha256-QcvoJqpZJXPSc9HLCJHetrp/hMESuC5kYl90d7Id0ZU="; + sha256 = "sha256-CEu63tdRBAF8CTchO3Qu8gUNObQylX6U08yDTI4/c/0="; }; - patches = lib.optionals stdenv.isDarwin [ + patches = [ + # Fix for a breakpad incompatibility with glibc>2.33 + # https://github.com/pytorch/pytorch/issues/70297 + # https://github.com/google/breakpad/commit/605c51ed96ad44b34c457bbca320e74e194c317e + ./breakpad-sigstksz.patch + ] ++ lib.optionals stdenv.isDarwin [ # pthreadpool added support for Grand Central Dispatch in April # 2020. However, this relies on functionality (DISPATCH_APPLY_AUTO) # that is available starting with macOS 10.13. However, our current @@ -144,13 +150,6 @@ in buildPythonPackage rec { ./pthreadpool-disable-gcd.diff ]; - # The dataclasses module is included with Python >= 3.7. This should - # be fixed with the next PyTorch release. - postPatch = '' - substituteInPlace setup.py \ - --replace "'dataclasses'" "'dataclasses; python_version < \"3.7\"'" - ''; - preConfigure = lib.optionalString cudaSupport '' export TORCH_CUDA_ARCH_LIST="${lib.strings.concatStringsSep ";" final_cudaArchList}" export CC=${cudatoolkit.cc}/bin/gcc CXX=${cudatoolkit.cc}/bin/g++ @@ -208,7 +207,7 @@ in buildPythonPackage rec { # https://github.com/pytorch/pytorch/issues/22346 # # Also of interest: pytorch ignores CXXFLAGS uses CFLAGS for both C and C++: - # https://github.com/pytorch/pytorch/blob/v1.2.0/setup.py#L17 + # https://github.com/pytorch/pytorch/blob/v1.11.0/setup.py#L17 NIX_CFLAGS_COMPILE = lib.optionals (blas.implementation == "mkl") [ "-Wno-error=array-bounds" ]; nativeBuildInputs = [ @@ -230,9 +229,8 @@ in buildPythonPackage rec { pyyaml typing-extensions # the following are required for tensorboard support - pillow six future tensorflow-tensorboard protobuf - ] ++ lib.optionals MPISupport [ mpi ] - ++ lib.optionals (pythonOlder "3.7") [ dataclasses ]; + pillow six future tensorboard protobuf + ] ++ lib.optionals MPISupport [ mpi ]; checkInputs = [ hypothesis ninja psutil ]; diff --git a/pkgs/development/python-modules/pyudev/default.nix b/pkgs/development/python-modules/pyudev/default.nix index 89cd50f085f..24784afc842 100644 --- a/pkgs/development/python-modules/pyudev/default.nix +++ b/pkgs/development/python-modules/pyudev/default.nix @@ -4,11 +4,11 @@ buildPythonPackage rec { pname = "pyudev"; - version = "0.22.0"; + version = "0.23.2"; src = fetchPypi { inherit pname version; - sha256 = "0xmj6l08iih2js9skjqpv4w7y0dhxyg91zmrs6v5aa65gbmipfv9"; + sha256 = "sha256-Mq41hbMgpRvCg+CgQAD9iiVZnttEVB4vUDT2r+5dFcw="; }; postPatch = '' diff --git a/pkgs/development/python-modules/pyuv/default.nix b/pkgs/development/python-modules/pyuv/default.nix index 2d276c6dcca..2f1870dd1c8 100644 --- a/pkgs/development/python-modules/pyuv/default.nix +++ b/pkgs/development/python-modules/pyuv/default.nix @@ -1,5 +1,6 @@ { lib , buildPythonPackage +, pythonAtLeast , fetchFromGitHub , libuv }: @@ -7,6 +8,7 @@ buildPythonPackage rec { pname = "pyuv"; version = "1.4.0"; + disabled = pythonAtLeast "3.10"; # https://github.com/saghul/pyuv/issues/273 src = fetchFromGitHub { owner = "saghul"; diff --git a/pkgs/development/python-modules/pyvcf/default.nix b/pkgs/development/python-modules/pyvcf/default.nix index 7c513617754..919477298b1 100644 --- a/pkgs/development/python-modules/pyvcf/default.nix +++ b/pkgs/development/python-modules/pyvcf/default.nix @@ -28,5 +28,6 @@ buildPythonPackage rec { vcf will attempt to parse the content of each record based on the data types specified in the meta-information lines ''; + broken = true; # uses the 2to3 feature, that got removed in setuptools 0.58 }; } diff --git a/pkgs/development/python-modules/pyverilog/default.nix b/pkgs/development/python-modules/pyverilog/default.nix index 8e41d26921f..115014a25bb 100644 --- a/pkgs/development/python-modules/pyverilog/default.nix +++ b/pkgs/development/python-modules/pyverilog/default.nix @@ -5,7 +5,6 @@ , jinja2 , ply , verilog -, pytest-pythonpath , pytestCheckHook }: @@ -32,8 +31,12 @@ buildPythonPackage rec { verilog ]; + preCheck = '' + substituteInPlace pytest.ini \ + --replace "python_paths" "pythonpath" + ''; + checkInputs = [ - pytest-pythonpath pytestCheckHook ]; diff --git a/pkgs/development/python-modules/pyvesync/default.nix b/pkgs/development/python-modules/pyvesync/default.nix index 96669c52634..c0800c3a8cc 100644 --- a/pkgs/development/python-modules/pyvesync/default.nix +++ b/pkgs/development/python-modules/pyvesync/default.nix @@ -7,14 +7,14 @@ buildPythonPackage rec { pname = "pyvesync"; - version = "2.0.0"; + version = "2.0.1"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-+054tFirjMF3sGLRpTVCZ3V2KN627b57+fFl6GBMMcU="; + sha256 = "sha256-7eGsRy8S6IZQ+UVNN8SoS7tBIYLlujSFr2qFldaxtJE="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pywbem/default.nix b/pkgs/development/python-modules/pywbem/default.nix index db7bd82b652..0547f3edd93 100644 --- a/pkgs/development/python-modules/pywbem/default.nix +++ b/pkgs/development/python-modules/pywbem/default.nix @@ -6,11 +6,11 @@ buildPythonPackage rec { pname = "pywbem"; - version = "1.4.0"; + version = "1.4.1"; src = fetchPypi { inherit pname version; - sha256 = "52f668f7ee1f03bdd80485692b648588b3e1909e2dc0754dceca497f5e9cf059"; + sha256 = "sha256-rYu75Kt+eVciwPJ/JlbJL8Zzp+BqFM0VGlDwMGRU0X4="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/pywebview/default.nix b/pkgs/development/python-modules/pywebview/default.nix index 67f11ed291f..2a369ca5704 100644 --- a/pkgs/development/python-modules/pywebview/default.nix +++ b/pkgs/development/python-modules/pywebview/default.nix @@ -12,14 +12,14 @@ buildPythonPackage rec { pname = "pywebview"; - version = "3.5"; + version = "3.6.1"; disabled = pythonOlder "3.5"; src = fetchFromGitHub { owner = "r0x0r"; repo = "pywebview"; rev = version; - sha256 = "sha256-+At/ToEylSPcLh/u2NHVTXQpMnw+2/afsevg5YAX/4c="; + sha256 = "sha256-9o9ghqvU9Hnmf2aj/BqX7WBgS9ilRSnicR+qd25OfjI="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/qiskit-machine-learning/default.nix b/pkgs/development/python-modules/qiskit-machine-learning/default.nix index 511bc0b2a0b..ad00a16a880 100644 --- a/pkgs/development/python-modules/qiskit-machine-learning/default.nix +++ b/pkgs/development/python-modules/qiskit-machine-learning/default.nix @@ -23,7 +23,7 @@ buildPythonPackage rec { pname = "qiskit-machine-learning"; - version = "0.3.0"; + version = "0.3.1"; disabled = pythonOlder "3.6"; @@ -31,7 +31,7 @@ buildPythonPackage rec { owner = "qiskit"; repo = pname; rev = version; - sha256 = "0jycs18apnwrksarpwpmp7scndyx91vnv6fchil4jyx4kym8mnf9"; + sha256 = "sha256-8tnd6+tqofKuK/sBdqmClBtywHbu3VvwLjO9k4YoChA="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/qutip/default.nix b/pkgs/development/python-modules/qutip/default.nix index 8d19e360ca4..c1f078ecc13 100644 --- a/pkgs/development/python-modules/qutip/default.nix +++ b/pkgs/development/python-modules/qutip/default.nix @@ -1,57 +1,69 @@ { lib, stdenv, fetchFromGitHub, buildPythonPackage, python, packaging, numpy -, cython, scipy, matplotlib, pytestCheckHook, pytest-rerunfailures }: +, cython, scipy, matplotlib, pytestCheckHook, pytest-rerunfailures +, doCheck ? false +}: -buildPythonPackage rec { - pname = "qutip"; - version = "4.6.3"; +let + self = buildPythonPackage rec { + pname = "qutip"; + version = "4.6.3"; - src = fetchFromGitHub { - owner = pname; - repo = pname; - rev = "v${version}"; - sha256 = "sha256-11K7Tl7PE98nM2vGsa+OKIJYu0Wmv8dT700PDt9RRVk="; - }; + src = fetchFromGitHub { + owner = pname; + repo = pname; + rev = "v${version}"; + sha256 = "sha256-11K7Tl7PE98nM2vGsa+OKIJYu0Wmv8dT700PDt9RRVk="; + }; + + # QuTiP says it needs specific (old) Numpy versions. We overwrite them here + # as the tests work perfectly fine with up-to-date packages. + postPatch = '' + substituteInPlace setup.cfg --replace "numpy>=1.16.6,<1.20" "numpy>=1.16.6" + ''; + + # Disabling OpenMP support on Darwin. + setupPyGlobalFlags = lib.optional (!stdenv.isDarwin) "--with-openmp"; + + propagatedBuildInputs = [ + packaging + numpy + cython + scipy + matplotlib + ]; + + checkInputs = [ + pytestCheckHook + pytest-rerunfailures + ]; + + # test suite is very cpu intensive + inherit doCheck; + # - QuTiP tries to access the home directory to create an rc file for us. + # This of course fails and therefore, we provide a writable temp dir as HOME. + # - We need to go to another directory to run the tests from there. + # This is due to the Cython-compiled modules not being in the correct location + # of the source tree. + # - For running tests, see: + # https://qutip.org/docs/latest/installation.html#verifying-the-installation + checkPhase = '' + export OMP_NUM_THREADS=$NIX_BUILD_CORES + export HOME=$(mktemp -d) + mkdir -p test && cd test + ${python.interpreter} -c "import qutip.testing; qutip.testing.run()" + ''; + + pythonImportsCheck = [ "qutip" ]; + + passthru.tests = { + all-tests = self.override { doCheck = true; }; + }; - # QuTiP says it needs specific (old) Numpy versions. We overwrite them here - # as the tests work perfectly fine with up-to-date packages. - postPatch = '' - substituteInPlace setup.cfg --replace "numpy>=1.16.6,<1.20" "numpy>=1.16.6" - ''; - - # Disabling OpenMP support on Darwin. - setupPyGlobalFlags = lib.optional (!stdenv.isDarwin) "--with-openmp"; - - propagatedBuildInputs = [ - packaging - numpy - cython - scipy - matplotlib - ]; - - checkInputs = [ - pytestCheckHook - pytest-rerunfailures - ]; - - # - QuTiP tries to access the home directory to create an rc file for us. - # This of course fails and therefore, we provide a writable temp dir as HOME. - # - We need to go to another directory to run the tests from there. - # This is due to the Cython-compiled modules not being in the correct location - # of the source tree. - # - For running tests, see: - # https://qutip.org/docs/latest/installation.html#verifying-the-installation - checkPhase = '' - export OMP_NUM_THREADS=$NIX_BUILD_CORES - export HOME=$(mktemp -d) - mkdir -p test && cd test - ${python.interpreter} -c "import qutip.testing; qutip.testing.run()" - ''; - - meta = with lib; { - description = "Open-source software for simulating the dynamics of closed and open quantum systems"; - homepage = "https://qutip.org/"; - license = licenses.bsd3; - maintainers = [ maintainers.fabiangd ]; + meta = with lib; { + description = "Open-source software for simulating the dynamics of closed and open quantum systems"; + homepage = "https://qutip.org/"; + license = licenses.bsd3; + maintainers = [ maintainers.fabiangd ]; + }; }; -} +in self diff --git a/pkgs/development/python-modules/rasterio/default.nix b/pkgs/development/python-modules/rasterio/default.nix index 27d6d498c34..8c73268e6b8 100644 --- a/pkgs/development/python-modules/rasterio/default.nix +++ b/pkgs/development/python-modules/rasterio/default.nix @@ -1,31 +1,86 @@ -{ buildPythonPackage, lib, fetchFromGitHub, isPy3k -, cython, setuptools -, numpy, affine, attrs, cligj, click-plugins, snuggs, gdal -, pytest, pythonOlder, packaging, hypothesis, boto3 -, certifi, shapely +{ lib +, buildPythonPackage +, fetchFromGitHub +, pythonOlder + +# build time +, cython +, gdal + +# runtime +, affine +, attrs +, boto3 +, click +, click-plugins +, cligj +, matplotlib +, numpy +, snuggs + +# tests +, hypothesis +, packaging +, pytest-randomly +, pytestCheckHook +, shapely }: buildPythonPackage rec { pname = "rasterio"; - version = "1.2.10"; + version = "1.2.10"; # not x.y[ab]z, those are alpha/beta versions + format = "pyproject"; disabled = pythonOlder "3.6"; # Pypi doesn't ship the tests, so we fetch directly from GitHub src = fetchFromGitHub { - owner = "mapbox"; + owner = "rasterio"; repo = "rasterio"; rev = version; - sha256 = "sha256-xVGwQfQvxsqYihUYXENJAz9Qp9xBkhsGc/RheRTJxgo="; + hash = "sha256-xVGwQfQvxsqYihUYXENJAz9Qp9xBkhsGc/RheRTJxgo="; }; - checkInputs = [ boto3 pytest packaging hypothesis shapely ]; - nativeBuildInputs = [ cython gdal ]; - propagatedBuildInputs = [ certifi gdal numpy attrs affine cligj click-plugins snuggs setuptools ]; + nativeBuildInputs = [ + cython + gdal + ]; + + propagatedBuildInputs = [ + affine + attrs + boto3 + click + click-plugins + cligj + matplotlib + numpy + snuggs + ]; + + preCheck = '' + rm -rf rasterio + ''; + + checkInputs = [ + pytest-randomly + pytestCheckHook + packaging + hypothesis + shapely + ]; + + pytestFlagsArray = [ + "-m 'not network'" + ]; + + pythonImportsCheck = [ + "rasterio" + ]; meta = with lib; { description = "Python package to read and write geospatial raster data"; - license = licenses.bsd3; homepage = "https://rasterio.readthedocs.io/en/latest/"; + license = licenses.bsd3; maintainers = with maintainers; [ mredaelli ]; }; } diff --git a/pkgs/development/python-modules/readme_renderer/default.nix b/pkgs/development/python-modules/readme_renderer/default.nix index 122c4fdf665..ab062615cc4 100644 --- a/pkgs/development/python-modules/readme_renderer/default.nix +++ b/pkgs/development/python-modules/readme_renderer/default.nix @@ -43,6 +43,12 @@ buildPythonPackage rec { disabledTests = [ # https://github.com/pypa/readme_renderer/issues/221 "test_GFM_" + # Relies on old distutils behaviour removed by setuptools (TypeError: dist must be a Distribution instance) + "test_valid_rst" + "test_invalid_rst" + "test_malicious_rst" + "test_invalid_missing" + "test_invalid_empty" ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/redis/default.nix b/pkgs/development/python-modules/redis/default.nix index 0731487575b..7cd59a5528a 100644 --- a/pkgs/development/python-modules/redis/default.nix +++ b/pkgs/development/python-modules/redis/default.nix @@ -14,14 +14,14 @@ buildPythonPackage rec { pname = "redis"; - version = "4.1.0"; + version = "4.1.4"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "sha256-IfCiO85weQkHbmuizgdsulm/9g0qsily4GR/32IP/kc="; + sha256 = "sha256-HZoM34n92T+EJhcz4k9Vp7vUE6myGf2vVuPnKMqaIwY="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/regex/default.nix b/pkgs/development/python-modules/regex/default.nix index 86e591eaf14..512a7162f0e 100644 --- a/pkgs/development/python-modules/regex/default.nix +++ b/pkgs/development/python-modules/regex/default.nix @@ -7,14 +7,14 @@ buildPythonPackage rec { pname = "regex"; - version = "2022.1.18"; + version = "2022.3.2"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - hash = "sha256-l/MtwDqAVKTEpatddh7Uhh6CiywgD+vU5GhXBppIORY="; + hash = "sha256-eeWvH/JYvA/gvdb2m8SuM5NaiY48vvu8zyLoiif6BTs="; }; checkPhase = '' diff --git a/pkgs/development/python-modules/reportlab/default.nix b/pkgs/development/python-modules/reportlab/default.nix index 82d84dc26a9..629f8d0ec75 100644 --- a/pkgs/development/python-modules/reportlab/default.nix +++ b/pkgs/development/python-modules/reportlab/default.nix @@ -11,11 +11,11 @@ let ft = freetype.overrideAttrs (oldArgs: { dontDisableStatic = true; }); in buildPythonPackage rec { pname = "reportlab"; - version = "3.6.5"; + version = "3.6.8"; src = fetchPypi { inherit pname version; - sha256 = "d8fe27ad312671c9347cf5997f7c1017833fac17233f33296281ba9fa0de189a"; + sha256 = "sha256-3HZX/LC8PkhcPIaaRN3bUtcRNWoBpFZmS3vvgnIiyYI="; }; checkInputs = [ glibcLocales ]; diff --git a/pkgs/development/python-modules/requests-oauthlib/default.nix b/pkgs/development/python-modules/requests-oauthlib/default.nix index aed6576c90d..d42de957791 100644 --- a/pkgs/development/python-modules/requests-oauthlib/default.nix +++ b/pkgs/development/python-modules/requests-oauthlib/default.nix @@ -10,11 +10,11 @@ buildPythonPackage rec { pname = "requests-oauthlib"; - version = "1.3.0"; + version = "1.3.1"; src = fetchPypi { inherit pname version; - sha256 = "0smaxs5ixng4z0k6dsgmm6s972ka3p6a2ykdpnl23mqzlw0ic9ml"; + sha256 = "sha256-db6sSkeIHuuU1epdatMe+IhWr/4jMrmq+1LGRSzPDXo="; }; propagatedBuildInputs = [ oauthlib requests ]; diff --git a/pkgs/development/python-modules/requests/default.nix b/pkgs/development/python-modules/requests/default.nix index f5b021801f4..86b2c2ffc39 100644 --- a/pkgs/development/python-modules/requests/default.nix +++ b/pkgs/development/python-modules/requests/default.nix @@ -13,7 +13,6 @@ , pytest-mock , pytest-xdist , pytestCheckHook -, trustme , urllib3 }: @@ -54,7 +53,6 @@ buildPythonPackage rec { pytest-mock pytest-xdist pytestCheckHook - trustme ]; # AttributeError: 'KeywordMapping' object has no attribute 'get' diff --git a/pkgs/development/python-modules/respx/default.nix b/pkgs/development/python-modules/respx/default.nix index 51d88446c0b..241f0f9e9da 100644 --- a/pkgs/development/python-modules/respx/default.nix +++ b/pkgs/development/python-modules/respx/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "respx"; - version = "0.19.1"; + version = "0.19.2"; src = fetchFromGitHub { owner = "lundberg"; repo = pname; rev = version; - sha256 = "134h9526md242p7ql0cpknqvkpd3fhxk2vridkvswg91f532w180"; + sha256 = "sha256-uNmSBJOQF4baq8AWzfwj0kinO19jr6Mp9Yblys/WmZs="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/restructuredtext_lint/default.nix b/pkgs/development/python-modules/restructuredtext_lint/default.nix index 01c7a5e78c6..0033794ef43 100644 --- a/pkgs/development/python-modules/restructuredtext_lint/default.nix +++ b/pkgs/development/python-modules/restructuredtext_lint/default.nix @@ -8,11 +8,11 @@ buildPythonPackage rec { pname = "restructuredtext_lint"; - version = "1.3.2"; + version = "1.4.0"; src = fetchPypi { inherit pname version; - sha256 = "d3b10a1fe2ecac537e51ae6d151b223b78de9fafdd50e5eb6b08c243df173c80"; + sha256 = "sha256-GyNcDJIjQatsUwOQiS656S+QubdQRgY+BHys+w8FDEU="; }; checkInputs = [ nose testtools ]; diff --git a/pkgs/development/python-modules/rich/default.nix b/pkgs/development/python-modules/rich/default.nix index f6194970adb..3e7055d274e 100644 --- a/pkgs/development/python-modules/rich/default.nix +++ b/pkgs/development/python-modules/rich/default.nix @@ -13,15 +13,15 @@ buildPythonPackage rec { pname = "rich"; - version = "11.0.0"; + version = "11.2.0"; format = "pyproject"; disabled = pythonOlder "3.6"; src = fetchFromGitHub { - owner = "willmcgugan"; + owner = "Textualize"; repo = pname; rev = "v${version}"; - sha256 = "0vkwar22rv1j6a3kqj3c016j0vnnha0kwi79fkd90ib1n501m7rn"; + sha256 = "19k8c8jnqj1v0ji8kkx3r2ny6wlpwy58ir7lyrh2qyjvzkw08i58"; }; nativeBuildInputs = [ poetry-core ]; @@ -43,7 +43,7 @@ buildPythonPackage rec { meta = with lib; { description = "Render rich text, tables, progress bars, syntax highlighting, markdown and more to the terminal"; - homepage = "https://github.com/willmcgugan/rich"; + homepage = "https://github.com/Textualize/rich"; license = licenses.mit; maintainers = with maintainers; [ ris ]; }; diff --git a/pkgs/development/python-modules/robotstatuschecker/default.nix b/pkgs/development/python-modules/robotstatuschecker/default.nix index 63e87609ac2..74810c7761f 100644 --- a/pkgs/development/python-modules/robotstatuschecker/default.nix +++ b/pkgs/development/python-modules/robotstatuschecker/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { src = fetchFromGitHub { owner = "robotframework"; repo = "statuschecker"; - rev = version; + rev = "refs/tags/v${version}"; sha256 = "0hy1390j3l4kkfna9x9xax4y5mqaa3hdndv3fiyg9wr5f7sx3wnz"; }; diff --git a/pkgs/development/python-modules/s3fs/default.nix b/pkgs/development/python-modules/s3fs/default.nix index d90d1052282..8582c0ac729 100644 --- a/pkgs/development/python-modules/s3fs/default.nix +++ b/pkgs/development/python-modules/s3fs/default.nix @@ -8,11 +8,11 @@ buildPythonPackage rec { pname = "s3fs"; - version = "2022.1.0"; + version = "2022.2.0"; src = fetchPypi { inherit pname version; - sha256 = "6bafc1f6b4e935ea59512c0f38d5cb9c299dbbfe738e40c3d1de8f67b4ee1fd4"; + sha256 = "sha256-RhHQ9+QeW8nawwCQcOCtN9qHpC9t73W0gTwG9+QEpzg="; }; buildInputs = [ diff --git a/pkgs/development/python-modules/sagemaker/default.nix b/pkgs/development/python-modules/sagemaker/default.nix index 80c4bd92a38..d18d939be60 100644 --- a/pkgs/development/python-modules/sagemaker/default.nix +++ b/pkgs/development/python-modules/sagemaker/default.nix @@ -17,14 +17,14 @@ buildPythonPackage rec { pname = "sagemaker"; - version = "2.75.1"; + version = "2.77.1"; format = "setuptools"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "sha256-MN/F7TWaKsQpKMR7Pxx0Vam1+O+PFEJ/H5jLJh3zpe4="; + sha256 = "sha256-RX3QcjGDWYaPC9lKz/nJSMTO3jeXxY7MW98fHYfcLq0="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/sanic-testing/default.nix b/pkgs/development/python-modules/sanic-testing/default.nix index 4bc446c2e14..3fb60ebaa9e 100644 --- a/pkgs/development/python-modules/sanic-testing/default.nix +++ b/pkgs/development/python-modules/sanic-testing/default.nix @@ -1,11 +1,10 @@ { lib , buildPythonPackage , fetchFromGitHub -, pytestCheckHook , httpx -, pytest-asyncio , sanic , websockets +, callPackage }: buildPythonPackage rec { @@ -19,11 +18,14 @@ buildPythonPackage rec { sha256 = "17fbb78gvic5s9nlcgwj817fq1f9j9d1d7z6n2ahhinmvyzl9gc8"; }; + outputs = [ + "out" + "testsout" + ]; + postPatch = '' - # https://github.com/sanic-org/sanic-testing/issues/19 substituteInPlace setup.py \ - --replace '"websockets==8.1",' '"websockets>=9.1",' \ - --replace "httpx==0.18.*" "httpx" + --replace "httpx>=0.18,<0.22" "httpx" ''; propagatedBuildInputs = [ @@ -32,18 +34,18 @@ buildPythonPackage rec { websockets ]; - checkInputs = [ - pytest-asyncio - pytestCheckHook - ]; + postInstall = '' + mkdir $testsout + cp -R tests $testsout/tests + ''; - # `sanic` is explicitly set to null when building `sanic` itself - # to prevent infinite recursion. In that case we skip running - # the package at all. - doCheck = sanic != null; - dontUsePythonImportsCheck = sanic == null; + # check in passthru.tests.pytest to escape infinite recursion with sanic + doCheck = false; + doInstallCheck = false; - pythonImportsCheck = [ "sanic_testing" ]; + passthru.tests = { + pytest = callPackage ./tests.nix { }; + }; meta = with lib; { description = "Core testing clients for the Sanic web framework"; diff --git a/pkgs/development/python-modules/sanic-testing/tests.nix b/pkgs/development/python-modules/sanic-testing/tests.nix new file mode 100644 index 00000000000..6a228a98231 --- /dev/null +++ b/pkgs/development/python-modules/sanic-testing/tests.nix @@ -0,0 +1,26 @@ +{ buildPythonPackage +, sanic +, sanic-testing +, pytest-asyncio +, pytestCheckHook +}: + +buildPythonPackage { + pname = "sanic-testing-tests"; + inherit (sanic-testing) version; + + src = sanic-testing.testsout; + + dontBuild = true; + dontInstall = true; + + checkInputs = [ + pytest-asyncio + pytestCheckHook + sanic + ]; + + pythonImportsCheck = [ + "sanic_testing" + ]; +} diff --git a/pkgs/development/python-modules/sanic/default.nix b/pkgs/development/python-modules/sanic/default.nix index 63c24e9936f..460927719ad 100644 --- a/pkgs/development/python-modules/sanic/default.nix +++ b/pkgs/development/python-modules/sanic/default.nix @@ -40,9 +40,12 @@ buildPythonPackage rec { postPatch = '' # Loosen dependency requirements. substituteInPlace setup.py \ - --replace '"pytest==6.2.5"' '"pytest"' \ - --replace '"gunicorn==20.0.4"' '"gunicorn"' \ - --replace '"pytest-sanic",' "" \ + --replace "pytest==6.2.5" "pytest" \ + --replace "gunicorn==20.0.4" "gunicorn" \ + --replace "multidict>=5.0,<6.0" "multidict" + + sed '/pytest-sanic/d' setup.py + # Patch a request headers test to allow brotli encoding # (we build httpx with brotli support, upstream doesn't). substituteInPlace tests/test_headers.py \ @@ -118,6 +121,8 @@ buildPythonPackage rec { "test_num_workers" "test_server_run" "test_version" + # Sensitive comparison of raw HTTP header fails + "test_raw_headers" ]; disabledTestPaths = [ diff --git a/pkgs/development/python-modules/schema-salad/default.nix b/pkgs/development/python-modules/schema-salad/default.nix index bea5b766b5c..f7be7f0107c 100644 --- a/pkgs/development/python-modules/schema-salad/default.nix +++ b/pkgs/development/python-modules/schema-salad/default.nix @@ -13,14 +13,14 @@ buildPythonPackage rec { pname = "schema-salad"; - version = "8.2.20220103095339"; + version = "8.2.20220204150214"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "051690a2f89b98e35100cd2cb489406a5169a60c2f27a716f3f287a42d45be2d"; + sha256 = "sha256-PlPb/nE3eWueUTWSDpa7JxPe2ee+KFna5VTR3IsClwQ="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/scikit-build/default.nix b/pkgs/development/python-modules/scikit-build/default.nix index bc72f76bf22..3fefba47cbd 100644 --- a/pkgs/development/python-modules/scikit-build/default.nix +++ b/pkgs/development/python-modules/scikit-build/default.nix @@ -25,11 +25,11 @@ buildPythonPackage rec { pname = "scikit-build"; - version = "0.12.0"; + version = "0.13.1"; src = fetchPypi { inherit pname version; - sha256 = "f851382c469bcd9a8c98b1878bcfdd13b68556279d2fd9a329be41956ae5a7fe"; + sha256 = "sha256-XRd0ousVmI4IHFgsJUq0qXUgluajTyNUEct5vWFmDDc="; }; propagatedBuildInputs = [ @@ -66,6 +66,8 @@ buildPythonPackage rec { "test_install_command" # tries to alter out path "test_test_command" # tries to alter out path "test_setup" # tries to install using distutils + "test_pep518" # pip exits with code 1 + "test_dual_pep518" # pip exits with code 1 ]); checkPhase = '' diff --git a/pkgs/development/python-modules/scikit-image/default.nix b/pkgs/development/python-modules/scikit-image/default.nix index b06c1cb5db4..45239f64fbe 100644 --- a/pkgs/development/python-modules/scikit-image/default.nix +++ b/pkgs/development/python-modules/scikit-image/default.nix @@ -16,89 +16,98 @@ , imageio , tifffile , pytestCheckHook +, doCheck ? false }: let installedPackageRoot = "${builtins.placeholder "out"}/${python.sitePackages}"; -in buildPythonPackage rec { - pname = "scikit-image"; - version = "0.18.3"; + self = buildPythonPackage rec { + pname = "scikit-image"; + version = "0.18.3"; - src = fetchFromGitHub { - owner = pname; - repo = pname; - rev = "v${version}"; - sha256 = "0a2h3bw5rkk23k4r04qc9maccg00nddssd7lfsps8nhp5agk1vyh"; - }; + src = fetchFromGitHub { + owner = pname; + repo = pname; + rev = "v${version}"; + sha256 = "0a2h3bw5rkk23k4r04qc9maccg00nddssd7lfsps8nhp5agk1vyh"; + }; + + patches = [ ./add-testing-data.patch ]; - patches = [ ./add-testing-data.patch ]; + nativeBuildInputs = [ cython ]; - nativeBuildInputs = [ cython ]; + propagatedBuildInputs = [ + cloudpickle + dask + imageio + matplotlib + networkx + numpy + pillow + pywavelets + scipy + six + tifffile + ]; - propagatedBuildInputs = [ - cloudpickle - dask - imageio - matplotlib - networkx - numpy - pillow - pywavelets - scipy - six - tifffile - ]; + # test suite is very cpu intensive, move to passthru.tests + inherit doCheck; + checkInputs = [ pytestCheckHook ]; - checkInputs = [ pytestCheckHook ]; + # (1) The package has cythonized modules, whose .so libs will appear only in the wheel, i.e. in nix store; + # (2) To stop Python from importing the wrong directory, i.e. the one in the build dir, not the one in nix store, `skimage` dir should be removed or renamed; + # (3) Therefore, tests should be run on the installed package in nix store. - # (1) The package has cythonized modules, whose .so libs will appear only in the wheel, i.e. in nix store; - # (2) To stop Python from importing the wrong directory, i.e. the one in the build dir, not the one in nix store, `skimage` dir should be removed or renamed; - # (3) Therefore, tests should be run on the installed package in nix store. + # See e.g. https://discourse.nixos.org/t/cant-import-cythonized-modules-at-checkphase/14207 on why the following is needed. + preCheck = '' + rm -r skimage + ''; - # See e.g. https://discourse.nixos.org/t/cant-import-cythonized-modules-at-checkphase/14207 on why the following is needed. - preCheck = '' - rm -r skimage - ''; + disabledTestPaths = [ + # Requires network access (actually some data is loaded via `skimage._shared.testing.fetch` in the global scope, which calls `pytest.skip` when a network is unaccessible, leading to a pytest collection error). + "${installedPackageRoot}/skimage/filters/rank/tests/test_rank.py" + ]; + pytestFlagsArray = [ "${installedPackageRoot}" "--pyargs" "skimage" ] ++ builtins.map (testid: "--deselect=" + testid) ([ + # These tests require network access + "skimage/data/test_data.py::test_skin" + "skimage/data/tests/test_data.py::test_skin" + "skimage/io/tests/test_io.py::test_imread_http_url" + "skimage/restoration/tests/test_rolling_ball.py::test_ndim" + ] ++ lib.optionals stdenv.isDarwin [ + # Matplotlib tests are broken inside darwin sandbox + "skimage/feature/tests/test_util.py::test_plot_matches" + "skimage/filters/tests/test_thresholding.py::TestSimpleImage::test_try_all_threshold" + "skimage/io/tests/test_mpl_imshow.py::" + ]); - disabledTestPaths = [ - # Requires network access (actually some data is loaded via `skimage._shared.testing.fetch` in the global scope, which calls `pytest.skip` when a network is unaccessible, leading to a pytest collection error). - "${installedPackageRoot}/skimage/filters/rank/tests/test_rank.py" - ]; - pytestFlagsArray = [ "${installedPackageRoot}" "--pyargs" "skimage" ] ++ builtins.map (testid: "--deselect=" + testid) ([ - # These tests require network access - "skimage/data/test_data.py::test_skin" - "skimage/data/tests/test_data.py::test_skin" - "skimage/io/tests/test_io.py::test_imread_http_url" - "skimage/restoration/tests/test_rolling_ball.py::test_ndim" - ] ++ lib.optionals stdenv.isDarwin [ - # Matplotlib tests are broken inside darwin sandbox - "skimage/feature/tests/test_util.py::test_plot_matches" - "skimage/filters/tests/test_thresholding.py::TestSimpleImage::test_try_all_threshold" - "skimage/io/tests/test_mpl_imshow.py::" - ]); + # Check cythonized modules + pythonImportsCheck = [ + "skimage" + "skimage._shared" + "skimage.draw" + "skimage.feature" + "skimage.restoration" + "skimage.filters" + "skimage.future.graph" + "skimage.graph" + "skimage.io" + "skimage.measure" + "skimage.morphology" + "skimage.transform" + "skimage.util" + "skimage.segmentation" + ]; - # Check cythonized modules - pythonImportsCheck = [ - "skimage" - "skimage._shared" - "skimage.draw" - "skimage.feature" - "skimage.restoration" - "skimage.filters" - "skimage.future.graph" - "skimage.graph" - "skimage.io" - "skimage.measure" - "skimage.morphology" - "skimage.transform" - "skimage.util" - "skimage.segmentation" - ]; + passthru.tests = { + all-tests = self.override { doCheck = true; }; + }; - meta = { - description = "Image processing routines for SciPy"; - homepage = "https://scikit-image.org"; - license = lib.licenses.bsd3; - maintainers = with lib.maintainers; [ yl3dy ]; + meta = { + description = "Image processing routines for SciPy"; + homepage = "https://scikit-image.org"; + license = lib.licenses.bsd3; + maintainers = with lib.maintainers; [ yl3dy ]; + }; }; -} +in + self diff --git a/pkgs/development/python-modules/scipy/default.nix b/pkgs/development/python-modules/scipy/default.nix index 9c3b28e0a9a..85708822cc2 100644 --- a/pkgs/development/python-modules/scipy/default.nix +++ b/pkgs/development/python-modules/scipy/default.nix @@ -15,11 +15,11 @@ buildPythonPackage rec { pname = "scipy"; - version = "1.7.3"; + version = "1.8.0"; src = fetchPypi { inherit pname version; - sha256 = "ab5875facfdef77e0a47d5fd39ea178b58e60e454a4c85aa1e52fcb80db7babf"; + sha256 = "sha256-MdTy1rckvJqY5Se1hJuKflib8epjDDOqVj7akSyf8L0="; }; nativeBuildInputs = [ cython gfortran pythran ]; diff --git a/pkgs/development/python-modules/scmrepo/default.nix b/pkgs/development/python-modules/scmrepo/default.nix index b68d15f3cac..1d07c371ca2 100644 --- a/pkgs/development/python-modules/scmrepo/default.nix +++ b/pkgs/development/python-modules/scmrepo/default.nix @@ -37,6 +37,11 @@ buildPythonPackage rec { pygtrie ]; + postPatch = '' + substituteInPlace setup.cfg \ + --replace "asyncssh>=2.7.1,<2.9" "asyncssh>=2.7.1" + ''; + # Requires a running Docker instance doCheck = false; diff --git a/pkgs/development/python-modules/sentry-sdk/default.nix b/pkgs/development/python-modules/sentry-sdk/default.nix index 51e6c76de5d..3272c4b612f 100644 --- a/pkgs/development/python-modules/sentry-sdk/default.nix +++ b/pkgs/development/python-modules/sentry-sdk/default.nix @@ -126,6 +126,8 @@ buildPythonPackage rec { "tests/integrations/chalice/" # broken since rq-1.10.1: https://github.com/getsentry/sentry-python/issues/1274 "tests/integrations/rq/" + # broken since pytest 7.0.1; AssertionError: previous item was not torn down properly + "tests/utils/test_contextvars.py" ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/setuptools/default.nix b/pkgs/development/python-modules/setuptools/default.nix index e748334b5ad..6b18422cc18 100644 --- a/pkgs/development/python-modules/setuptools/default.nix +++ b/pkgs/development/python-modules/setuptools/default.nix @@ -10,7 +10,7 @@ let pname = "setuptools"; - version = "57.2.0"; + version = "60.8.2"; # Create an sdist of setuptools sdist = stdenv.mkDerivation rec { @@ -20,12 +20,13 @@ let owner = "pypa"; repo = pname; rev = "v${version}"; - sha256 = "sha256-zFmndVoATNxfvDsacY+gj5bzIbbd/8ldbsJj4qOawTA="; + sha256 = "1mqpmbn58rx3g24dm6wnllx0xs97ampn2yga3qypqgwnh1nk477i"; name = "${pname}-${version}-source"; }; patches = [ ./tag-date.patch + ./setuptools-distutils-C++.patch ]; buildPhase = '' diff --git a/pkgs/development/python-modules/setuptools/setuptools-distutils-C++.patch b/pkgs/development/python-modules/setuptools/setuptools-distutils-C++.patch new file mode 100644 index 00000000000..a14e514fda7 --- /dev/null +++ b/pkgs/development/python-modules/setuptools/setuptools-distutils-C++.patch @@ -0,0 +1,216 @@ +Based on pkgs/development/interpreters/python/cpython/3.7/python-3.x-distutils-C++.patch, +adapted to apply to setuptools 60.x's bundled distutils. + +diff --git a/setuptools/_distutils/cygwinccompiler.py b/setuptools/_distutils/cygwinccompiler.py +index c5c86d8f..b879e447 100644 +--- a/setuptools/_distutils/cygwinccompiler.py ++++ b/setuptools/_distutils/cygwinccompiler.py +@@ -124,14 +124,19 @@ class CygwinCCompiler(UnixCCompiler): + self.cxx = os.environ.get('CXX', 'g++') + + self.linker_dll = self.cc ++ self.linker_dll_cxx = self.cxx + shared_option = "-shared" + + self.set_executables(compiler='%s -mcygwin -O -Wall' % self.cc, + compiler_so='%s -mcygwin -mdll -O -Wall' % self.cc, + compiler_cxx='%s -mcygwin -O -Wall' % self.cxx, ++ compiler_so_cxx='%s -mcygwin -mdll -O -Wall' % self.cxx, + linker_exe='%s -mcygwin' % self.cc, + linker_so=('%s -mcygwin %s' % +- (self.linker_dll, shared_option))) ++ (self.linker_dll, shared_option)), ++ linker_exe_cxx='%s -mcygwin' % self.cxx, ++ linker_so_cxx=('%s -mcygwin %s' % ++ (self.linker_dll_cxx, shared_option))) + + # Include the appropriate MSVC runtime library if Python was built + # with MSVC 7.0 or later. +@@ -162,8 +167,12 @@ class CygwinCCompiler(UnixCCompiler): + raise CompileError(msg) + else: # for other files use the C-compiler + try: +- self.spawn(self.compiler_so + cc_args + [src, '-o', obj] + +- extra_postargs) ++ if self.detect_language(src) == 'c++': ++ self.spawn(self.compiler_so_cxx + cc_args + [src, '-o', obj] + ++ extra_postargs) ++ else: ++ self.spawn(self.compiler_so + cc_args + [src, '-o', obj] + ++ extra_postargs) + except DistutilsExecError as msg: + raise CompileError(msg) + +@@ -279,9 +288,13 @@ class Mingw32CCompiler(CygwinCCompiler): + self.set_executables(compiler='%s -O -Wall' % self.cc, + compiler_so='%s -mdll -O -Wall' % self.cc, + compiler_cxx='%s -O -Wall' % self.cxx, ++ compiler_so_cxx='%s -mdll -O -Wall' % self.cxx, + linker_exe='%s' % self.cc, + linker_so='%s %s' +- % (self.linker_dll, shared_option)) ++ % (self.linker_dll, shared_option), ++ linker_exe_cxx='%s' % self.cxx, ++ linker_so_cxx='%s %s' ++ % (self.linker_dll_cxx, shared_option)) + + # Maybe we should also append -mthreads, but then the finished + # dlls need another dll (mingwm10.dll see Mingw32 docs) +diff --git a/setuptools/_distutils/sysconfig.py b/setuptools/_distutils/sysconfig.py +index 4a77a431..1ad85181 100644 +--- a/setuptools/_distutils/sysconfig.py ++++ b/setuptools/_distutils/sysconfig.py +@@ -216,9 +216,11 @@ def customize_compiler(compiler): + _osx_support.customize_compiler(_config_vars) + _config_vars['CUSTOMIZED_OSX_COMPILER'] = 'True' + +- (cc, cxx, cflags, ccshared, ldshared, shlib_suffix, ar, ar_flags) = \ +- get_config_vars('CC', 'CXX', 'CFLAGS', +- 'CCSHARED', 'LDSHARED', 'SHLIB_SUFFIX', 'AR', 'ARFLAGS') ++ (cc, cxx, cflags, ccshared, ldshared, ldcxxshared, shlib_suffix, ar, ar_flags) = \ ++ get_config_vars('CC', 'CXX', 'CFLAGS', 'CCSHARED', 'LDSHARED', 'LDCXXSHARED', ++ 'SHLIB_SUFFIX', 'AR', 'ARFLAGS') ++ ++ cxxflags = cflags + + if 'CC' in os.environ: + newcc = os.environ['CC'] +@@ -232,19 +234,27 @@ def customize_compiler(compiler): + cxx = os.environ['CXX'] + if 'LDSHARED' in os.environ: + ldshared = os.environ['LDSHARED'] ++ if 'LDCXXSHARED' in os.environ: ++ ldcxxshared = os.environ['LDCXXSHARED'] + if 'CPP' in os.environ: + cpp = os.environ['CPP'] + else: + cpp = cc + " -E" # not always + if 'LDFLAGS' in os.environ: + ldshared = ldshared + ' ' + os.environ['LDFLAGS'] ++ ldcxxshared = ldcxxshared + ' ' + os.environ['LDFLAGS'] + if 'CFLAGS' in os.environ: +- cflags = cflags + ' ' + os.environ['CFLAGS'] ++ cflags = os.environ['CFLAGS'] + ldshared = ldshared + ' ' + os.environ['CFLAGS'] ++ if 'CXXFLAGS' in os.environ: ++ cxxflags = os.environ['CXXFLAGS'] ++ ldcxxshared = ldcxxshared + ' ' + os.environ['CXXFLAGS'] + if 'CPPFLAGS' in os.environ: + cpp = cpp + ' ' + os.environ['CPPFLAGS'] + cflags = cflags + ' ' + os.environ['CPPFLAGS'] ++ cxxflags = cxxflags + ' ' + os.environ['CPPFLAGS'] + ldshared = ldshared + ' ' + os.environ['CPPFLAGS'] ++ ldcxxshared = ldcxxshared + ' ' + os.environ['CPPFLAGS'] + if 'AR' in os.environ: + ar = os.environ['AR'] + if 'ARFLAGS' in os.environ: +@@ -253,13 +263,17 @@ def customize_compiler(compiler): + archiver = ar + ' ' + ar_flags + + cc_cmd = cc + ' ' + cflags ++ cxx_cmd = cxx + ' ' + cxxflags + compiler.set_executables( + preprocessor=cpp, + compiler=cc_cmd, + compiler_so=cc_cmd + ' ' + ccshared, +- compiler_cxx=cxx, ++ compiler_cxx=cxx_cmd, ++ compiler_so_cxx=cxx_cmd + ' ' + ccshared, + linker_so=ldshared, + linker_exe=cc, ++ linker_so_cxx=ldcxxshared, ++ linker_exe_cxx=cxx, + archiver=archiver) + + if 'RANLIB' in os.environ and compiler.executables.get('ranlib', None): +diff --git a/setuptools/_distutils/unixccompiler.py b/setuptools/_distutils/unixccompiler.py +index a07e5988..576ef490 100644 +--- a/setuptools/_distutils/unixccompiler.py ++++ b/setuptools/_distutils/unixccompiler.py +@@ -52,14 +52,17 @@ class UnixCCompiler(CCompiler): + # are pretty generic; they will probably have to be set by an outsider + # (eg. using information discovered by the sysconfig about building + # Python extensions). +- executables = {'preprocessor' : None, +- 'compiler' : ["cc"], +- 'compiler_so' : ["cc"], +- 'compiler_cxx' : ["cc"], +- 'linker_so' : ["cc", "-shared"], +- 'linker_exe' : ["cc"], +- 'archiver' : ["ar", "-cr"], +- 'ranlib' : None, ++ executables = {'preprocessor' : None, ++ 'compiler' : ["cc"], ++ 'compiler_so' : ["cc"], ++ 'compiler_cxx' : ["c++"], ++ 'compiler_so_cxx' : ["c++"], ++ 'linker_so' : ["cc", "-shared"], ++ 'linker_exe' : ["cc"], ++ 'linker_so_cxx' : ["c++", "-shared"], ++ 'linker_exe_cxx' : ["c++"], ++ 'archiver' : ["ar", "-cr"], ++ 'ranlib' : None, + } + + if sys.platform[:6] == "darwin": +@@ -110,12 +113,19 @@ class UnixCCompiler(CCompiler): + + def _compile(self, obj, src, ext, cc_args, extra_postargs, pp_opts): + compiler_so = self.compiler_so ++ compiler_so_cxx = self.compiler_so_cxx + if sys.platform == 'darwin': + compiler_so = _osx_support.compiler_fixup(compiler_so, + cc_args + extra_postargs) ++ compiler_so_cxx = _osx_support.compiler_fixup(compiler_so_cxx, ++ cc_args + extra_postargs) + try: +- self.spawn(compiler_so + cc_args + [src, '-o', obj] + +- extra_postargs) ++ if self.detect_language(src) == 'c++': ++ self.spawn(compiler_so_cxx + cc_args + [src, '-o', obj] + ++ extra_postargs) ++ else: ++ self.spawn(compiler_so + cc_args + [src, '-o', obj] + ++ extra_postargs) + except DistutilsExecError as msg: + raise CompileError(msg) + +@@ -173,30 +183,16 @@ class UnixCCompiler(CCompiler): + ld_args.extend(extra_postargs) + self.mkpath(os.path.dirname(output_filename)) + try: +- if target_desc == CCompiler.EXECUTABLE: +- linker = self.linker_exe[:] ++ if target_lang == "c++": ++ if target_desc == CCompiler.EXECUTABLE: ++ linker = self.linker_exe_cxx[:] ++ else: ++ linker = self.linker_so_cxx[:] + else: +- linker = self.linker_so[:] +- if target_lang == "c++" and self.compiler_cxx: +- # skip over environment variable settings if /usr/bin/env +- # is used to set up the linker's environment. +- # This is needed on OSX. Note: this assumes that the +- # normal and C++ compiler have the same environment +- # settings. +- i = 0 +- if os.path.basename(linker[0]) == "env": +- i = 1 +- while '=' in linker[i]: +- i += 1 +- +- if os.path.basename(linker[i]) == 'ld_so_aix': +- # AIX platforms prefix the compiler with the ld_so_aix +- # script, so we need to adjust our linker index +- offset = 1 ++ if target_desc == CCompiler.EXECUTABLE: ++ linker = self.linker_exe[:] + else: +- offset = 0 +- +- linker[i+offset] = self.compiler_cxx[i] ++ linker = self.linker_so[:] + + if sys.platform == 'darwin': + linker = _osx_support.compiler_fixup(linker, ld_args) diff --git a/pkgs/development/python-modules/simple-salesforce/default.nix b/pkgs/development/python-modules/simple-salesforce/default.nix index d2b36af12a3..a9319779060 100644 --- a/pkgs/development/python-modules/simple-salesforce/default.nix +++ b/pkgs/development/python-modules/simple-salesforce/default.nix @@ -10,13 +10,13 @@ buildPythonPackage rec { pname = "simple-salesforce"; - version = "1.11.4"; + version = "1.11.6"; src = fetchFromGitHub { owner = pname; repo = pname; rev = "v${version}"; - sha256 = "17d6g7zfhlgd2n4mimjarl2x4hl7ww2lb4izidlns1hzqm8igg4y"; + sha256 = "sha256-/uaFEQnilcelHKjbmrnyLm5Mzj2V8P4oEH+cgJn+KvI="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/sip/default.nix b/pkgs/development/python-modules/sip/default.nix index 6904714a60c..d6ee1e76f54 100644 --- a/pkgs/development/python-modules/sip/default.nix +++ b/pkgs/development/python-modules/sip/default.nix @@ -2,12 +2,12 @@ buildPythonPackage rec { pname = "sip"; - version = "6.5.0"; + version = "6.5.1"; src = fetchPypi { pname = "sip"; inherit version; - sha256 = "a1cf8431a8eb9392b3ff6dc61d832d0447bfdcae5b3e4256a5fa74dbc25b0734"; + sha256 = "sha256-IE8CQNuJmadJ1jiph7NRhhhD5pI5uBHsPRiBQSw3BqY="; }; patches = [ diff --git a/pkgs/development/python-modules/smbprotocol/default.nix b/pkgs/development/python-modules/smbprotocol/default.nix index b5d826c8f8e..562346b1a47 100644 --- a/pkgs/development/python-modules/smbprotocol/default.nix +++ b/pkgs/development/python-modules/smbprotocol/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "smbprotocol"; - version = "1.8.3"; + version = "1.9.0"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "jborean93"; repo = pname; rev = "v${version}"; - sha256 = "sha256-m9C+uzwrEOcbkvBQ3Z+to2BsX2i7cLnUiV/+L7hMUdE="; + sha256 = "sha256-u3brP3WsnoqRy3R0OQQkIbq+avS7nemx9GKpvTq+vxg="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/socksio/default.nix b/pkgs/development/python-modules/socksio/default.nix new file mode 100644 index 00000000000..5d42ed6e8ec --- /dev/null +++ b/pkgs/development/python-modules/socksio/default.nix @@ -0,0 +1,41 @@ +{ lib +, buildPythonPackage +, fetchPypi +, pythonAtLeast +, flit-core +, pytestCheckHook +}: + +let + pname = "socksio"; + version = "1.0.0"; +in +buildPythonPackage { + inherit pname version; + format = "pyproject"; + + src = fetchPypi { + inherit pname version; + hash = "sha256-+IvrPaW1w4uYkEad5n0MsPnUlLeLEGyhhF+WwQuRxKw="; + }; + + nativeBuildInputs = [ + flit-core + ]; + + # remove coverage configuration + preCheck = '' + rm pytest.ini + ''; + + checkInputs = [ + pytestCheckHook + ]; + + meta = with lib; { + description = "Sans-I/O implementation of SOCKS4, SOCKS4A, and SOCKS5"; + homepage = "https://github.com/sethmlarson/socksio"; + license = licenses.mit; + maintainers = with maintainers; [ hexa ]; + }; +} diff --git a/pkgs/development/python-modules/spacy-transformers/default.nix b/pkgs/development/python-modules/spacy-transformers/default.nix index 2f70732caa3..d203f8709c3 100644 --- a/pkgs/development/python-modules/spacy-transformers/default.nix +++ b/pkgs/development/python-modules/spacy-transformers/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "spacy-transformers"; - version = "1.1.3"; + version = "1.1.4"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "f4f553d3d2a065147a8c1292b5d9adf050c0f78dd15bb05c9614341cf88c5574"; + sha256 = "sha256-G09bZiXTdEuukvKjPOYYTW/B19d406QSRDOU5ZflDDU="; }; postPatch = '' diff --git a/pkgs/development/python-modules/sphinx/default.nix b/pkgs/development/python-modules/sphinx/default.nix index 19961cc2ec1..7d79aaa457a 100644 --- a/pkgs/development/python-modules/sphinx/default.nix +++ b/pkgs/development/python-modules/sphinx/default.nix @@ -92,9 +92,11 @@ buildPythonPackage rec { # Due to lack of network sandboxing can't guarantee port 7777 isn't bound "test_inspect_main_url" "test_auth_header_uses_first_match" + "test_linkcheck_allowed_redirects" "test_linkcheck_request_headers" "test_linkcheck_request_headers_no_slash" "test_follows_redirects_on_HEAD" + "test_get_after_head_raises_connection_error" "test_invalid_ssl" "test_connect_to_selfsigned_with_tls_verify_false" "test_connect_to_selfsigned_with_tls_cacerts" diff --git a/pkgs/development/python-modules/spyder/default.nix b/pkgs/development/python-modules/spyder/default.nix index cfeaf08fb33..40e393b57d6 100644 --- a/pkgs/development/python-modules/spyder/default.nix +++ b/pkgs/development/python-modules/spyder/default.nix @@ -8,13 +8,13 @@ buildPythonPackage rec { pname = "spyder"; - version = "5.2.1"; + version = "5.2.2"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "b318a70a75acd200018a547d2ff2d2f55e7507054469d0c77ec6f967ac3c2d28"; + sha256 = "sha256-3DIikQlsc7Ptagi8ddR5ia+u24dXeBdppRkIn/xp3bg="; }; nativeBuildInputs = [ pyqtwebengine.wrapQtAppsHook ]; diff --git a/pkgs/development/python-modules/sqlalchemy/default.nix b/pkgs/development/python-modules/sqlalchemy/default.nix index 1d6406c5db1..d379fc92942 100644 --- a/pkgs/development/python-modules/sqlalchemy/default.nix +++ b/pkgs/development/python-modules/sqlalchemy/default.nix @@ -13,11 +13,11 @@ buildPythonPackage rec { pname = "SQLAlchemy"; - version = "1.4.31"; + version = "1.4.32"; src = fetchPypi { inherit pname version; - sha256 = "sha256-WCtZ0eV4CkR6raIrRh5QtASp3AV2jaHYc2itgZBGhBg="; + sha256 = "sha256-b90txZMdqrd4wrZbA99q5oN24CijCY62JNCQnZmYhbw="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/sqlmap/default.nix b/pkgs/development/python-modules/sqlmap/default.nix index a435b363a0f..6313f413c6a 100644 --- a/pkgs/development/python-modules/sqlmap/default.nix +++ b/pkgs/development/python-modules/sqlmap/default.nix @@ -7,11 +7,11 @@ buildPythonPackage rec { pname = "sqlmap"; - version = "1.6.3"; + version = "1.6.4"; src = fetchPypi { inherit pname version; - sha256 = "sha256-W/UdJPLcFOEHHz7VYeQ3CcXysNju5DuxqvYA+xMkb20="; + sha256 = "sha256-6RKJ5a8Yl+SnWgdfrTIwY0m1JyY6W9fhZk6pTZiBVx8="; }; postPatch = '' diff --git a/pkgs/development/python-modules/starlette/default.nix b/pkgs/development/python-modules/starlette/default.nix index 1084a50be77..00283cd9ec9 100644 --- a/pkgs/development/python-modules/starlette/default.nix +++ b/pkgs/development/python-modules/starlette/default.nix @@ -21,7 +21,7 @@ buildPythonPackage rec { pname = "starlette"; - version = "0.17.1"; + version = "0.18.0"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -30,7 +30,7 @@ buildPythonPackage rec { owner = "encode"; repo = pname; rev = version; - sha256 = "sha256-qT/w7r8PsrauLoBolwCGpxiwhDZo3z6hIqKVXeY5yqA="; + sha256 = "sha256-N2X9pjCiQ6TKRcm6VlyybLLyCdjQuIZHu1vK99gY8rY="; }; postPatch = '' diff --git a/pkgs/development/python-modules/stone/default.nix b/pkgs/development/python-modules/stone/default.nix index 8ea42d1f279..55f74b58fb5 100644 --- a/pkgs/development/python-modules/stone/default.nix +++ b/pkgs/development/python-modules/stone/default.nix @@ -1,34 +1,31 @@ -{ lib, buildPythonPackage, fetchPypi -, coverage +{ lib +, buildPythonPackage +, fetchFromGitHub , mock , ply -, pytest-runner , pytestCheckHook , six }: buildPythonPackage rec { pname = "stone"; - version = "3.2.1"; - - src = fetchPypi { - inherit pname version; - sha256 = "0xby5mpsms7b2rv8j6mvxzmzz5i9ii01brb9ylxz6kiv2i08piwv"; + version = "3.3.1"; + + # pypi sdist misses requirements.txt + src = fetchFromGitHub { + owner = "dropbox"; + repo = pname; + rev = "v${version}"; + hash = "sha256-0FWdYbv+paVU3Wj6g9OrSNUB0pH8fLwTkhVIBPeFB/U="; }; postPatch = '' - substituteInPlace setup.py \ - --replace "pytest-runner == 5.2.0" "pytest-runner" \ - --replace "pytest < 5" "pytest" - substituteInPlace test/requirements.txt \ - --replace "coverage==5.3" "coverage" + sed -i '/pytest-runner/d' setup.py ''; - nativeBuildInputs = [ pytest-runner ]; - propagatedBuildInputs = [ ply six ]; - checkInputs = [ pytestCheckHook coverage mock ]; + checkInputs = [ pytestCheckHook mock ]; # try to import from `test` directory, which is exported by the python interpreter # and cannot be overriden without removing some py3 to py2 support diff --git a/pkgs/development/python-modules/stumpy/default.nix b/pkgs/development/python-modules/stumpy/default.nix index 68e35a1d0ec..66a9b7e0d82 100644 --- a/pkgs/development/python-modules/stumpy/default.nix +++ b/pkgs/development/python-modules/stumpy/default.nix @@ -34,6 +34,12 @@ buildPythonPackage rec { pytestCheckHook ]; + pytestFlagsArray = [ + # whole testsuite is very CPU intensive, only run core tests + # TODO: move entire test suite to passthru.tests + "tests/test_core.py" + ]; + meta = with lib; { description = "A powerful and scalable library that can be used for a variety of time series data mining tasks"; homepage = "https://github.com/TDAmeritrade/stumpy"; diff --git a/pkgs/development/python-modules/suds-jurko/default.nix b/pkgs/development/python-modules/suds-jurko/default.nix index af307919387..f2776265b06 100644 --- a/pkgs/development/python-modules/suds-jurko/default.nix +++ b/pkgs/development/python-modules/suds-jurko/default.nix @@ -27,6 +27,7 @@ buildPythonPackage rec { description = "Lightweight SOAP client (Jurko's fork)"; homepage = "https://bitbucket.org/jurko/suds"; license = licenses.lgpl3; + broken = true; # Uses use2to3, which has been removed in setuptools>=58 }; } diff --git a/pkgs/development/python-modules/sunpy/default.nix b/pkgs/development/python-modules/sunpy/default.nix index 4e61f8665ba..9c88dc3462a 100644 --- a/pkgs/development/python-modules/sunpy/default.nix +++ b/pkgs/development/python-modules/sunpy/default.nix @@ -31,14 +31,14 @@ buildPythonPackage rec { pname = "sunpy"; - version = "3.1.3"; + version = "3.1.4"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "4acb05a05c7e6a2090cd0bb426b34c7e1620be0de2bf90a95a3f48ba15a5fce2"; + sha256 = "sha256-TDslY1KUohR9zyyJ6+B95MMMsUL1TBl49L+nSCvZ9nI="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/superqt/default.nix b/pkgs/development/python-modules/superqt/default.nix index 9890a7000a9..af600f62342 100644 --- a/pkgs/development/python-modules/superqt/default.nix +++ b/pkgs/development/python-modules/superqt/default.nix @@ -3,21 +3,25 @@ , fetchFromGitHub , setuptools-scm , pyqt5 +, qtpy , typing-extensions , pytest , pytestCheckHook -}: buildPythonPackage rec { +}: + +buildPythonPackage rec { pname = "superqt"; - version = "0.2.5-1"; + version = "0.3.1"; + src = fetchFromGitHub { owner = "napari"; repo = pname; rev = "v${version}"; - sha256 = "sha256-rkTiCJ8mIogS9SDmLPiaAyhhuBx3kk6rXjCc19zbwiM="; + sha256 = "sha256-DPjJxOgybNvZ3YvYHr48fmx59Puck61Dzm2G4M9qKo4="; }; format = "pyproject"; nativeBuildInputs = [ setuptools-scm ]; - propagatedBuildInputs = [ pyqt5 typing-extensions ]; + propagatedBuildInputs = [ pyqt5 qtpy typing-extensions ]; checkInputs = [ pytestCheckHook pytest ]; doCheck = false; # Segfaults... SETUPTOOLS_SCM_PRETEND_VERSION = version; diff --git a/pkgs/development/python-modules/teletype/default.nix b/pkgs/development/python-modules/teletype/default.nix index c3878bf3c87..47f6357a568 100644 --- a/pkgs/development/python-modules/teletype/default.nix +++ b/pkgs/development/python-modules/teletype/default.nix @@ -2,11 +2,12 @@ buildPythonPackage rec { pname = "teletype"; - version = "1.1.0"; + version = "1.3.2"; + format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "02mg0qmdf7hljq6jw1hwaid3hvkf70dfxgrxmpqybaxrph5pfg1y"; + sha256 = "sha256-9q46a4ui2kgSUL/vImR02r4T9huwLFwd70AqGBNJNzs="; }; # no tests diff --git a/pkgs/development/python-modules/tempora/default.nix b/pkgs/development/python-modules/tempora/default.nix index 79b04b7ebbb..ff837158fc2 100644 --- a/pkgs/development/python-modules/tempora/default.nix +++ b/pkgs/development/python-modules/tempora/default.nix @@ -1,30 +1,59 @@ -{ lib, buildPythonPackage, fetchPypi -, setuptools-scm, pytestCheckHook, pytest-freezegun, freezegun, backports_unittest-mock -, six, pytz, jaraco_functools, pythonOlder +{ lib +, buildPythonPackage +, fetchPypi +, pythonOlder + +# build time +, setuptools-scm + +# runtime +, pytz +, jaraco_functools + +# tests +, freezegun +, pytest-freezegun +, pytestCheckHook }: buildPythonPackage rec { pname = "tempora"; - version = "5.0.0"; + version = "5.0.1"; + format = "pyproject"; + + disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "aa21dd1956e29559ecb2f2f2e14fcdb950085222fbbf86e6c946b5e1a8c36b26"; + sha256 = "sha256-y6Dxl6ZIg78+c2V++8AyTVvxcXnndpsThbTXXSbNkSc="; }; - disabled = pythonOlder "3.2"; - - nativeBuildInputs = [ setuptools-scm ]; + nativeBuildInputs = [ + setuptools-scm + ]; - propagatedBuildInputs = [ six pytz jaraco_functools ]; + propagatedBuildInputs = [ + jaraco_functools + pytz + ]; checkInputs = [ - pytest-freezegun pytestCheckHook freezegun backports_unittest-mock + freezegun + pytest-freezegun + pytestCheckHook + ]; + + pythonImportsCheck = [ + "tempora" + "tempora.schedule" + "tempora.timing" + "tempora.utc" ]; meta = with lib; { description = "Objects and routines pertaining to date and time"; homepage = "https://github.com/jaraco/tempora"; license = licenses.mit; + maintainers = with maintainers; [ ]; }; } diff --git a/pkgs/development/python-modules/tensorflow-tensorboard/default.nix b/pkgs/development/python-modules/tensorboard/default.nix index a4a04d89856..47025bf4a28 100644 --- a/pkgs/development/python-modules/tensorflow-tensorboard/default.nix +++ b/pkgs/development/python-modules/tensorboard/default.nix @@ -22,17 +22,16 @@ # buildBazelPackage. buildPythonPackage rec { - pname = "tensorflow-tensorboard"; - version = "2.6.0"; + pname = "tensorboard"; + version = "2.8.0"; format = "wheel"; - disabled = pythonOlder "3.6" || pythonAtLeast "3.10"; + disabled = pythonOlder "3.6" || pythonAtLeast "3.11"; src = fetchPypi { - pname = "tensorboard"; - inherit version format; + inherit pname version format; dist = "py3"; python = "py3"; - sha256 = "sha256-99rEzftS0UyeP3RYXOKq+OYgNiCoZOUfr4SYiwn3u9s="; + hash = "sha256-ZaM45EJOkHnyYEkjvb4wF5KtzirOG+aNprPd8AUXDe8="; }; postPatch = '' diff --git a/pkgs/development/python-modules/tensorboardx/default.nix b/pkgs/development/python-modules/tensorboardx/default.nix index eacb5b4cdc8..7aa29f34baa 100644 --- a/pkgs/development/python-modules/tensorboardx/default.nix +++ b/pkgs/development/python-modules/tensorboardx/default.nix @@ -13,7 +13,7 @@ , pytorch , six , soundfile -, tensorflow-tensorboard +, tensorboard , torchvision }: @@ -56,7 +56,7 @@ buildPythonPackage rec { pillow pytestCheckHook pytorch - tensorflow-tensorboard + tensorboard torchvision ]; @@ -70,6 +70,8 @@ buildPythonPackage rec { disabledTestPaths = [ # we are not interested in linting errors "tests/test_lint.py" + # missing caffe2 dependency + "tests/test_caffe2.py" ]; meta = with lib; { diff --git a/pkgs/development/python-modules/tensorflow-datasets/default.nix b/pkgs/development/python-modules/tensorflow-datasets/default.nix index b97461394d1..1fc9f5ae25d 100644 --- a/pkgs/development/python-modules/tensorflow-datasets/default.nix +++ b/pkgs/development/python-modules/tensorflow-datasets/default.nix @@ -39,13 +39,13 @@ buildPythonPackage rec { pname = "tensorflow-datasets"; - version = "4.4.0"; + version = "4.5.2"; src = fetchFromGitHub { owner = "tensorflow"; repo = "datasets"; rev = "v${version}"; - sha256 = "11kbpv54nwr0xf7z5mkj2lmrfqfmcdq8qcpapnqck1kiawr3yad6"; + sha256 = "sha256-OZpaY/6BMISq5IeDXyuyu5L/yG+DwlFliw4BsipPOLg="; }; patches = [ diff --git a/pkgs/development/python-modules/tensorflow-estimator/default.nix b/pkgs/development/python-modules/tensorflow-estimator/default.nix index 5ad6d0ab6e5..7c7f155adb0 100644 --- a/pkgs/development/python-modules/tensorflow-estimator/default.nix +++ b/pkgs/development/python-modules/tensorflow-estimator/default.nix @@ -6,13 +6,13 @@ buildPythonPackage rec { pname = "tensorflow-estimator"; - version = "2.7.0"; + version = "2.8.0"; format = "wheel"; src = fetchPypi { pname = "tensorflow_estimator"; inherit version format; - hash = "sha256-MltaIkhkN5JCt7dsaYfKVEI5voJXnTPmjsfCvaV6vJ0="; + hash = "sha256-vujgUgxgrn6vbKjLRsWp9LRXJVMTgNuPvjj8tIR4trs="; }; propagatedBuildInputs = [ mock numpy absl-py ]; diff --git a/pkgs/development/python-modules/tensorflow-metadata/build.patch b/pkgs/development/python-modules/tensorflow-metadata/build.patch index ff81c5d1e86..5b570bf7206 100644 --- a/pkgs/development/python-modules/tensorflow-metadata/build.patch +++ b/pkgs/development/python-modules/tensorflow-metadata/build.patch @@ -2,15 +2,6 @@ diff --git a/setup.py b/setup.py index 7a09b2f..94c5aa6 100644 --- a/setup.py +++ b/setup.py -@@ -125,7 +125,7 @@ setup( - ], - namespace_packages=[], - install_requires=[ -- 'absl-py>=0.9,<0.13', -+ 'absl-py>=0.9', - 'googleapis-common-protos>=1.52.0,<2', - 'protobuf>=3.13,<4', - ], @@ -137,8 +137,5 @@ setup( long_description_content_type='text/markdown', keywords='tensorflow metadata tfx', diff --git a/pkgs/development/python-modules/tensorflow-metadata/default.nix b/pkgs/development/python-modules/tensorflow-metadata/default.nix index 2a80155c4cd..b39f1211d0c 100644 --- a/pkgs/development/python-modules/tensorflow-metadata/default.nix +++ b/pkgs/development/python-modules/tensorflow-metadata/default.nix @@ -2,18 +2,19 @@ , buildPythonPackage , fetchFromGitHub , googleapis-common-protos +, protobuf , lib }: buildPythonPackage rec { pname = "tensorflow-metadata"; - version = "1.5.0"; + version = "1.7.0"; src = fetchFromGitHub { owner = "tensorflow"; repo = "metadata"; rev = "v${version}"; - sha256 = "17p74k6rwswpmj7m16cw9hdam6b4m7v5bahirmc2l1kwfvrn4w33"; + sha256 = "sha256-CQlLEVNcD9u2pojz8r1eLzYzc9i2hjdZfzfYSQ/8Q4k="; }; patches = [ @@ -31,8 +32,12 @@ buildPythonPackage rec { propagatedBuildInputs = [ absl-py googleapis-common-protos + protobuf ]; + # has no tests + doCheck = false; + pythonImportsCheck = [ "tensorflow_metadata" ]; diff --git a/pkgs/development/python-modules/tensorflow-tensorboard/1/default.nix b/pkgs/development/python-modules/tensorflow-tensorboard/1/default.nix deleted file mode 100644 index f58b1a20771..00000000000 --- a/pkgs/development/python-modules/tensorflow-tensorboard/1/default.nix +++ /dev/null @@ -1,65 +0,0 @@ -{ lib, fetchPypi, buildPythonPackage, isPy3k -, numpy -, wheel -, werkzeug -, protobuf -, grpcio -, markdown -, futures -, absl-py -}: - -# tensorflow/tensorboard is built from a downloaded wheel, because -# https://github.com/tensorflow/tensorboard/issues/719 blocks -# buildBazelPackage. - -buildPythonPackage rec { - pname = "tensorflow-tensorboard"; - version = "1.15.0"; - format = "wheel"; - - src = fetchPypi ({ - pname = "tensorboard"; - inherit version format; - } // (if isPy3k then { - python = "py3"; - sha256 = "1g62i3nrgp8q9wfsyqqjkkfnsz7x2k018c26kdh527h1yrjjrbac"; - } else { - python = "py2"; - sha256 = "0l3zc8j2sh7h1z4qpy8kfvclv3kzndri55p10i42q6xahs9phav1"; - })); - - propagatedBuildInputs = [ - numpy - werkzeug - protobuf - markdown - grpcio - absl-py - # not declared in install_requires, but used at runtime - # https://github.com/NixOS/nixpkgs/issues/73840 - wheel - ] ++ lib.optional (!isPy3k) futures; - - # in the absence of a real test suite, run cli and imports - checkPhase = '' - $out/bin/tensorboard --help > /dev/null - ''; - - pythonImportsCheck = [ - "tensorboard" - "tensorboard.backend" - "tensorboard.compat" - "tensorboard.data" - "tensorboard.plugins" - "tensorboard.summary" - "tensorboard.util" - ]; - - meta = with lib; { - description = "TensorFlow's Visualization Toolkit"; - homepage = "http://tensorflow.org"; - license = licenses.asl20; - maintainers = with maintainers; [ abbradar ]; - }; -} diff --git a/pkgs/development/python-modules/tensorflow/bin.nix b/pkgs/development/python-modules/tensorflow/bin.nix index 2556a8039c1..2c47f8674e0 100644 --- a/pkgs/development/python-modules/tensorflow/bin.nix +++ b/pkgs/development/python-modules/tensorflow/bin.nix @@ -18,7 +18,7 @@ , opt-einsum , backports_weakref , tensorflow-estimator -, tensorflow-tensorboard +, tensorboard , cudaSupport ? false , cudatoolkit , cudnn @@ -74,7 +74,7 @@ in buildPythonPackage { google-pasta wrapt tensorflow-estimator - tensorflow-tensorboard + tensorboard keras-applications keras-preprocessing h5py @@ -168,7 +168,7 @@ in buildPythonPackage { ''; # Upstream has a pip hack that results in bin/tensorboard being in both tensorflow - # and the propagated input tensorflow-tensorboard, which causes environment collisions. + # and the propagated input tensorboard, which causes environment collisions. # Another possibility would be to have tensorboard only in the buildInputs # See https://github.com/NixOS/nixpkgs/pull/44381 for more information. postInstall = '' diff --git a/pkgs/development/python-modules/tensorflow/default.nix b/pkgs/development/python-modules/tensorflow/default.nix index 517faef3f8f..2d5a302521b 100644 --- a/pkgs/development/python-modules/tensorflow/default.nix +++ b/pkgs/development/python-modules/tensorflow/default.nix @@ -1,19 +1,19 @@ -{ stdenv, bazel_3, buildBazelPackage, isPy3k, lib, fetchFromGitHub, symlinkJoin +{ stdenv, bazel_4, buildBazelPackage, isPy3k, lib, fetchFromGitHub, symlinkJoin , addOpenGLRunpath, fetchpatch, patchelfUnstable # Python deps , buildPythonPackage, pythonOlder, python # Python libraries -, numpy, tensorflow-tensorboard, absl-py +, numpy, tensorboard, absl-py , setuptools, wheel, keras, keras-preprocessing, google-pasta , opt-einsum, astunparse, h5py , termcolor, grpcio, six, wrapt, protobuf-python, tensorflow-estimator -, dill, flatbuffers-python, tblib, typing-extensions +, dill, flatbuffers-python, portpicker, tblib, typing-extensions # Common deps , git, pybind11, which, binutils, glibcLocales, cython, perl # Common libraries -, jemalloc, mpi, gast, grpc, sqlite, boringssl, jsoncpp +, jemalloc, mpi, gast, grpc, sqlite, boringssl, jsoncpp, nsync , curl, snappy, flatbuffers-core, lmdb-core, icu, double-conversion, libpng, libjpeg_turbo, giflib, protobuf-core -# Upsteam by default includes cuda support since tensorflow 1.15. We could do +# Upstream by default includes cuda support since tensorflow 1.15. We could do # that in nix as well. It would make some things easier and less confusing, but # it would also make the default tensorflow package unfree. See # https://groups.google.com/a/tensorflow.org/forum/#!topic/developers/iRCt5m4qUz0 @@ -72,7 +72,7 @@ let tfFeature = x: if x then "1" else "0"; - version = "2.7.1"; + version = "2.8.0"; variant = if cudaSupport then "-gpu" else ""; pname = "tensorflow${variant}"; @@ -94,8 +94,8 @@ let setuptools six tblib + tensorboard tensorflow-estimator - tensorflow-tensorboard termcolor typing-extensions wheel @@ -179,20 +179,15 @@ let stdenv = llvmPackages_11.stdenv; })) { name = "${pname}-${version}"; - bazel = bazel_3; + bazel = bazel_4; src = fetchFromGitHub { owner = "tensorflow"; repo = "tensorflow"; rev = "v${version}"; - sha256 = "1qwzbqq899swrwrwmm6z7mq9sc55gyh0r4ca0mcnchbvn7w0qbkh"; + hash = "sha256-w78ehpsnXElIyYftgZEq3b/+TSrRN1gyWVUVlSZpGFM="; }; - patches = [ - # Patch the sources to compile with protobuf >= 3.16. - ./system-protobuf.patch - ]; - # On update, it can be useful to steal the changes from gentoo # https://gitweb.gentoo.org/repo/gentoo.git/tree/sci-libs/tensorflow @@ -207,20 +202,20 @@ let git # libs taken from system through the TF_SYS_LIBS mechanism - grpc - sqlite boringssl - jsoncpp curl - pybind11 - snappy + double-conversion flatbuffers-core + giflib + grpc icu - double-conversion - libpng + jsoncpp libjpeg_turbo - giflib + libpng lmdb-core + pybind11 + snappy + sqlite ] ++ lib.optionals cudaSupport [ cudatoolkit cudnn @@ -229,6 +224,8 @@ let ] ++ lib.optionals stdenv.isDarwin [ Foundation Security + ] ++ lib.optionals (!stdenv.isDarwin) [ + nsync ]; # arbitrarily set to the current latest bazel version, overly careful @@ -237,7 +234,7 @@ let # Take as many libraries from the system as possible. Keep in sync with # list of valid syslibs in # https://github.com/tensorflow/tensorflow/blob/master/third_party/systemlibs/syslibs_configure.bzl - TF_SYSTEM_LIBS = lib.concatStringsSep "," [ + TF_SYSTEM_LIBS = lib.concatStringsSep "," ([ "absl_py" "astor_archive" "astunparse_archive" @@ -253,7 +250,6 @@ let "cython" "dill_archive" "double_conversion" - "enum34_archive" "flatbuffers" "functools32_archive" "gast_archive" @@ -264,7 +260,6 @@ let "libjpeg_turbo" "lmdb" "nasm" - # "nsync" # not packaged in nixpkgs "opt_einsum_archive" "org_sqlite" "pasta" @@ -277,7 +272,9 @@ let "typing_extensions_archive" "wrapt" "zlib" - ]; + ] ++ lib.optionals (!stdenv.isDarwin) [ + "nsync" # fails to build on darwin + ]); INCLUDEDIR = "${includes_joined}/include"; @@ -361,12 +358,12 @@ let fetchAttrs = { # cudaSupport causes fetch of ncclArchive, resulting in different hashes sha256 = if cudaSupport then - "sha256-+szc2mRoImwijzbj3nw6HmZp3DeRjjPRU5yC+5AEbkg=" + "sha256-dQEyfueuQPcGvbhuh8Al45np3nRLDw2PCfC2lEqAH50=" else if stdenv.isDarwin then - "sha256-+bwIzp6t7gRJPcI8B5oyuf9z0AjCAyggUR7x+vv5kFs=" + "sha256-yfnZVtKWqNQGvlfq2owXhem0LmzDYriVfYgf1ZRlaDo=" else - "sha256-5yOYmeGpJq4Chi55H7iblxyRXVktgnePtpYTPvBs538="; + "sha256:12i1ix2xwq77f3h8qr4h57g0aazrdsjjqa536cpwx3n1mvl5p6qi"; }; buildAttrs = { @@ -428,18 +425,20 @@ in buildPythonPackage { # Adjust dependency requirements: # - Relax gast version requirement that doesn't match what we have packaged + # - Relax tf-estimator, that would require a nightly version # - The purpose of python3Packages.libclang is not clear at the moment and we don't have it packaged yet # - keras and tensorlow-io-gcs-filesystem will be considered as optional for now. postPatch = '' sed -i setup.py \ -e "s/'gast[^']*',/'gast',/" \ + -e "s/'tf-estimator-nightly[^']*',/'tensorflow-estimator',/" \ -e "/'libclang[^']*',/d" \ -e "/'keras[^']*',/d" \ -e "/'tensorflow-io-gcs-filesystem[^']*',/d" ''; # Upstream has a pip hack that results in bin/tensorboard being in both tensorflow - # and the propagated input tensorflow-tensorboard, which causes environment collisions. + # and the propagated input tensorboard, which causes environment collisions. # Another possibility would be to have tensorboard only in the buildInputs # https://github.com/tensorflow/tensorflow/blob/v1.7.1/tensorflow/tools/pip_package/setup.py#L79 postInstall = '' @@ -452,7 +451,6 @@ in buildPythonPackage { propagatedBuildInputs = [ absl-py astunparse - dill flatbuffers-python gast google-pasta @@ -463,13 +461,12 @@ in buildPythonPackage { opt-einsum protobuf-python six - tblib tensorflow-estimator termcolor typing-extensions wrapt ] ++ lib.optionals withTensorboard [ - tensorflow-tensorboard + tensorboard ]; # remove patchelfUnstable once patchelf 0.14 with https://github.com/NixOS/patchelf/pull/256 becomes the default @@ -486,7 +483,13 @@ in buildPythonPackage { # Actual tests are slow and impure. # TODO try to run them anyway # TODO better test (files in tensorflow/tools/ci_build/builds/*test) - checkInputs = [ keras ]; + # TEST_PACKAGES in tensorflow/tools/pip_package/setup.py + checkInputs = [ + dill + keras + portpicker + tblib + ]; checkPhase = '' ${python.interpreter} <<EOF # A simple "Hello world" diff --git a/pkgs/development/python-modules/tensorflow/system-protobuf.patch b/pkgs/development/python-modules/tensorflow/system-protobuf.patch deleted file mode 100644 index dce6df81046..00000000000 --- a/pkgs/development/python-modules/tensorflow/system-protobuf.patch +++ /dev/null @@ -1,13 +0,0 @@ -diff --git a/tensorflow/core/kernels/example_parsing_ops.cc b/tensorflow/core/kernels/example_parsing_ops.cc -index a1265cfb5c6..ada919bbd7b 100644 ---- a/tensorflow/core/kernels/example_parsing_ops.cc -+++ b/tensorflow/core/kernels/example_parsing_ops.cc -@@ -1218,7 +1218,7 @@ class DecodeJSONExampleOp : public OpKernel { - resolver_.get(), "type.googleapis.com/tensorflow.Example", &in, &out); - OP_REQUIRES(ctx, status.ok(), - errors::InvalidArgument("Error while parsing JSON: ", -- string(status.error_message()))); -+ string(status.message()))); - } - } - diff --git a/pkgs/development/python-modules/terminado/default.nix b/pkgs/development/python-modules/terminado/default.nix index 28b0eb09dbe..6a63fe53716 100644 --- a/pkgs/development/python-modules/terminado/default.nix +++ b/pkgs/development/python-modules/terminado/default.nix @@ -7,11 +7,11 @@ buildPythonPackage rec { pname = "terminado"; - version = "0.12.1"; + version = "0.13.1"; src = fetchPypi { inherit pname version; - sha256 = "b20fd93cc57c1678c799799d117874367cc07a3d2d55be95205b1a88fa08393f"; + sha256 = "sha256-W4K1xumR8HBadvlh9DJip/seVbCTwW3Kg/FjhKfzm3s="; }; propagatedBuildInputs = [ ptyprocess tornado ]; diff --git a/pkgs/development/python-modules/test-tube/default.nix b/pkgs/development/python-modules/test-tube/default.nix index 1cc20cc2cca..5eac0d60b6c 100644 --- a/pkgs/development/python-modules/test-tube/default.nix +++ b/pkgs/development/python-modules/test-tube/default.nix @@ -8,7 +8,7 @@ , numpy , pandas , pytorch -, tensorflow-tensorboard +, tensorboard }: buildPythonPackage rec { @@ -34,7 +34,7 @@ buildPythonPackage rec { numpy pandas pytorch - tensorflow-tensorboard + tensorboard ]; meta = with lib; { diff --git a/pkgs/development/python-modules/testpath/default.nix b/pkgs/development/python-modules/testpath/default.nix index e11ddeed50a..4db5aa362f4 100644 --- a/pkgs/development/python-modules/testpath/default.nix +++ b/pkgs/development/python-modules/testpath/default.nix @@ -2,18 +2,24 @@ , stdenv , buildPythonPackage , fetchPypi +, flit-core , pytestCheckHook }: buildPythonPackage rec { pname = "testpath"; - version = "0.5.0"; + version = "0.6.0"; + format = "pyproject"; src = fetchPypi { inherit pname version; - sha256 = "05z4s4d5i1ja16hiv4jhqv63fvg1a4vw77s0ay1sw11hrl5pmkqs"; + sha256 = "sha256-LxuX5kQsAmgevgG9hPUxAop8rqGvOCUAD1I0XDAoXg8="; }; + nativeBuildInputs = [ + flit-core + ]; + checkInputs = [ pytestCheckHook ]; diff --git a/pkgs/development/python-modules/tiledb/default.nix b/pkgs/development/python-modules/tiledb/default.nix index b310defa45d..eabb2aff006 100644 --- a/pkgs/development/python-modules/tiledb/default.nix +++ b/pkgs/development/python-modules/tiledb/default.nix @@ -15,14 +15,14 @@ buildPythonPackage rec { pname = "tiledb"; - version = "0.12.0"; + version = "0.13.0"; format = "setuptools"; src = fetchFromGitHub { owner = "TileDB-Inc"; repo = "TileDB-Py"; rev = version; - sha256 = "0iz16sgr5dpwc1jvb6brcmgvvg0npjdd98q4wgkqmvg7qif92zls"; + sha256 = "sha256-ku+9kMXXrlPy4teV5KpTXAwExhIoPpAsGAHIBvsl9KI="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/toggl-cli/default.nix b/pkgs/development/python-modules/toggl-cli/default.nix index 30c3f08f52e..b1c0346b964 100644 --- a/pkgs/development/python-modules/toggl-cli/default.nix +++ b/pkgs/development/python-modules/toggl-cli/default.nix @@ -20,7 +20,7 @@ buildPythonPackage rec { pname = "toggl-cli"; - version = "2.4.3"; + version = "3"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -28,7 +28,7 @@ buildPythonPackage rec { src = fetchPypi { pname = "togglCli"; inherit version; - sha256 = "sha256-ncMwiMwYivaFu5jrAsm1oCuXP/PZ2ALT+M+CmV6dtFo="; + sha256 = "sha256-SkA/u1q//AyYn0v6uAXXsjANhFppxxjKhlhWhsK649w="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/tomli/default.nix b/pkgs/development/python-modules/tomli/default.nix index 551655eebf0..c9c9cb46b2c 100644 --- a/pkgs/development/python-modules/tomli/default.nix +++ b/pkgs/development/python-modules/tomli/default.nix @@ -3,6 +3,7 @@ , callPackage , fetchFromGitHub , flit-core +, python # important downstream dependencies , flit @@ -13,40 +14,28 @@ buildPythonPackage rec { pname = "tomli"; - version = "1.2.2"; + version = "2.0.1"; format = "pyproject"; - outputs = [ - "out" - "testsout" - ]; - src = fetchFromGitHub { owner = "hukkin"; repo = pname; rev = version; - sha256 = "sha256-oDjpNzWxTaCC1+WyBKrkR6kp90ZomcZQfyW+xKddDoM="; + sha256 = "sha256-v0ZMrHIIaGeORwD4JiBeLthmnKZODK5odZVL0SY4etA="; }; - patches = [ - # required for mypy - ./fix-backwards-compatibility-load.patch - ]; - nativeBuildInputs = [ flit-core ]; - postInstall = '' - mkdir $testsout - cp -R benchmark/ pyproject.toml tests/ $testsout/ - ''; - pythonImportsCheck = [ "tomli" ]; - # check in passthru.tests.pytest to escape infinite recursion with setuptools-scm - doCheck = false; + checkPhase = '' + runHook preCheck + ${python.interpreter} -m unittest discover + runHook postCheck + ''; passthru.tests = { - pytest = callPackage ./tests.nix { }; + # test downstream dependencies inherit flit black mypy setuptools-scm; }; diff --git a/pkgs/development/python-modules/tomli/fix-backwards-compatibility-load.patch b/pkgs/development/python-modules/tomli/fix-backwards-compatibility-load.patch deleted file mode 100644 index edfc2f38349..00000000000 --- a/pkgs/development/python-modules/tomli/fix-backwards-compatibility-load.patch +++ /dev/null @@ -1,21 +0,0 @@ -diff --git a/tomli/_parser.py b/tomli/_parser.py -index 89e81c3..6fb1bfd 100644 ---- a/tomli/_parser.py -+++ b/tomli/_parser.py -@@ -1,6 +1,6 @@ - import string - from types import MappingProxyType --from typing import Any, BinaryIO, Dict, FrozenSet, Iterable, NamedTuple, Optional, Tuple -+from typing import IO, Union, Any, BinaryIO, Dict, FrozenSet, Iterable, NamedTuple, Optional, Tuple - import warnings - - from tomli._re import ( -@@ -48,7 +48,7 @@ class TOMLDecodeError(ValueError): - """An error raised if a document is not valid TOML.""" - - --def load(fp: BinaryIO, *, parse_float: ParseFloat = float) -> Dict[str, Any]: -+def load(fp: Union[IO, BinaryIO], *, parse_float: ParseFloat = float) -> Dict[str, Any]: - """Parse TOML from a binary file object.""" - s_bytes = fp.read() - try: diff --git a/pkgs/development/python-modules/tomli/tests.nix b/pkgs/development/python-modules/tomli/tests.nix deleted file mode 100644 index 5d3d67dbd12..00000000000 --- a/pkgs/development/python-modules/tomli/tests.nix +++ /dev/null @@ -1,21 +0,0 @@ -{ buildPythonPackage -, tomli -, pytestCheckHook -, python-dateutil -}: - -buildPythonPackage rec { - pname = "tomli-tests"; - inherit (tomli) version; - - src = tomli.testsout; - - dontBuild = true; - dontInstall = true; - - checkInputs = [ - pytestCheckHook - python-dateutil - tomli - ]; -} diff --git a/pkgs/development/python-modules/tomlkit/default.nix b/pkgs/development/python-modules/tomlkit/default.nix index 6c8455f060e..22f3ffab299 100644 --- a/pkgs/development/python-modules/tomlkit/default.nix +++ b/pkgs/development/python-modules/tomlkit/default.nix @@ -4,11 +4,11 @@ buildPythonPackage rec { pname = "tomlkit"; - version = "0.8.0"; + version = "0.10.0"; src = fetchPypi { inherit pname version; - sha256 = "29e84a855712dfe0e88a48f6d05c21118dbafb283bb2eed614d46f80deb8e9a1"; + sha256 = "sha256-2ZlGxq7TOHyYuJ2R+57f+PkBv5JVkBCBJmqE+1YErc0="; }; propagatedBuildInputs = diff --git a/pkgs/development/python-modules/torch-tb-profiler/default.nix b/pkgs/development/python-modules/torch-tb-profiler/default.nix index fc53c5ba823..28439106136 100644 --- a/pkgs/development/python-modules/torch-tb-profiler/default.nix +++ b/pkgs/development/python-modules/torch-tb-profiler/default.nix @@ -4,7 +4,7 @@ , pandas , pytestCheckHook , pytorch -, tensorflow-tensorboard +, tensorboard , torchvision }: @@ -25,7 +25,7 @@ buildPythonPackage rec { # See https://discourse.nixos.org/t/extracting-sub-directory-from-fetchgit-or-fetchurl-or-any-derivation/8830. src = "${repo}/tb_plugin"; - propagatedBuildInputs = [ pandas tensorflow-tensorboard ]; + propagatedBuildInputs = [ pandas tensorboard ]; checkInputs = [ pytestCheckHook pytorch torchvision ]; diff --git a/pkgs/development/python-modules/tornado/5.nix b/pkgs/development/python-modules/tornado/5.nix index 2f3ba5c1c2a..f0dc14b5fa2 100644 --- a/pkgs/development/python-modules/tornado/5.nix +++ b/pkgs/development/python-modules/tornado/5.nix @@ -3,12 +3,13 @@ , buildPythonPackage , fetchPypi , isPy27 +, pythonAtLeast }: buildPythonPackage rec { pname = "tornado"; version = "5.1.1"; - disabled = isPy27; + disabled = isPy27 || pythonAtLeast "3.10"; # We specify the name of the test files to prevent # https://github.com/NixOS/nixpkgs/issues/14634 diff --git a/pkgs/development/python-modules/towncrier/default.nix b/pkgs/development/python-modules/towncrier/default.nix index b039277f201..9953e2c17be 100644 --- a/pkgs/development/python-modules/towncrier/default.nix +++ b/pkgs/development/python-modules/towncrier/default.nix @@ -13,11 +13,11 @@ buildPythonPackage rec { pname = "towncrier"; - version = "21.3.0"; + version = "21.9.0"; src = fetchPypi { inherit pname version; - sha256 = "6eed0bc924d72c98c000cb8a64de3bd566e5cb0d11032b73fcccf8a8f956ddfe"; + sha256 = "sha256-nLb0XBbhoe7J0OdlEWXnvmDNCrgdE6XJbKl6SYrof0g="; }; propagatedBuildInputs = [ @@ -31,12 +31,18 @@ buildPythonPackage rec { # zope.interface collision doCheck = !isPy27; + + preCheck = '' + export PATH=$out/bin:$PATH + ''; + checkInputs = [ git mock twisted pytestCheckHook ]; + pythonImportsCheck = [ "towncrier" ]; meta = with lib; { diff --git a/pkgs/development/python-modules/tpm2-pytss/default.nix b/pkgs/development/python-modules/tpm2-pytss/default.nix index 544c1a3084a..5cd14c7704d 100644 --- a/pkgs/development/python-modules/tpm2-pytss/default.nix +++ b/pkgs/development/python-modules/tpm2-pytss/default.nix @@ -9,12 +9,12 @@ buildPythonPackage rec { # Last version on github is 0.2.4, but it looks # like a mistake (it's missing commits from 0.1.9) - version = "0.1.9"; + version = "1.0.0"; disabled = pythonOlder "3.5"; src = fetchPypi { inherit pname version; - sha256 = "sha256-v5Xth0A3tFnLFg54nvWYL2TD201e/GWv+2y5Qc60CmU="; + sha256 = "sha256-Gx1nIXYuhTmQva9LmtTYvd1nyRH/pBQZ5bJ8OLcc1lo="; }; postPatch = '' substituteInPlace tpm2_pytss/config.py --replace \ diff --git a/pkgs/development/python-modules/tqdm/default.nix b/pkgs/development/python-modules/tqdm/default.nix index 3973d68b6c3..2613a2b587d 100644 --- a/pkgs/development/python-modules/tqdm/default.nix +++ b/pkgs/development/python-modules/tqdm/default.nix @@ -14,11 +14,11 @@ buildPythonPackage rec { pname = "tqdm"; - version = "4.62.3"; + version = "4.63.0"; src = fetchPypi { inherit pname version; - sha256 = "d359de7217506c9851b7869f3708d8ee53ed70a1b8edbba4dbcb47442592920d"; + sha256 = "sha256-HZg17ejjlLuMncv/vKAtcXIXETrcZ5I2hz7qrFvAs80="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/trio/default.nix b/pkgs/development/python-modules/trio/default.nix index e667f146afc..f9b325ecc29 100644 --- a/pkgs/development/python-modules/trio/default.nix +++ b/pkgs/development/python-modules/trio/default.nix @@ -13,19 +13,45 @@ , jedi , astor , yapf +, coreutils }: buildPythonPackage rec { pname = "trio"; - version = "0.19.0"; + version = "0.20.0"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "895e318e5ec5e8cea9f60b473b6edb95b215e82d99556a03eb2d20c5e027efe1"; + sha256 = "sha256-ZwpS0xFdDoeeGsg4pOuZmvMvhYFj46cE/kg53ipnYHA="; }; - checkInputs = [ astor pytestCheckHook pyopenssl trustme jedi yapf ]; + propagatedBuildInputs = [ + attrs + sortedcontainers + async_generator + idna + outcome + sniffio + ] ++ lib.optionals (pythonOlder "3.7") [ contextvars ]; + + # tests are failing on Darwin + doCheck = !stdenv.isDarwin; + + checkInputs = [ + astor + jedi + pyopenssl + pytestCheckHook + trustme + yapf + ]; + + preCheck = '' + substituteInPlace trio/tests/test_subprocess.py \ + --replace "/bin/sleep" "${coreutils}/bin/sleep" + ''; + # It appears that the build sandbox doesn't include /etc/services, and these tests try to use it. disabledTests = [ "getnameinfo" @@ -41,18 +67,6 @@ buildPythonPackage rec { "-W" "ignore::DeprecationWarning" ]; - propagatedBuildInputs = [ - attrs - sortedcontainers - async_generator - idna - outcome - sniffio - ] ++ lib.optionals (pythonOlder "3.7") [ contextvars ]; - - # tests are failing on Darwin - doCheck = !stdenv.isDarwin; - meta = { description = "An async/await-native I/O library for humans and snake people"; homepage = "https://github.com/python-trio/trio"; diff --git a/pkgs/development/python-modules/trytond/default.nix b/pkgs/development/python-modules/trytond/default.nix index c332a067a76..6a52dd869e0 100644 --- a/pkgs/development/python-modules/trytond/default.nix +++ b/pkgs/development/python-modules/trytond/default.nix @@ -24,14 +24,14 @@ buildPythonApplication rec { pname = "trytond"; - version = "6.2.3"; + version = "6.2.6"; format = "setuptools"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "9be5d27aff9ae9b0ab73a8805145b2cc89900b9b513e6d5bfce89e9b7167f8f4"; + sha256 = "sha256-Sof6A9lxU70YnCbboJr56CAdTL0cRbaRNxdvG5Tnqnw="; }; # Tells the tests which database to use diff --git a/pkgs/development/python-modules/tweepy/default.nix b/pkgs/development/python-modules/tweepy/default.nix index a3526eb707b..c97fd85a8be 100644 --- a/pkgs/development/python-modules/tweepy/default.nix +++ b/pkgs/development/python-modules/tweepy/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "tweepy"; - version = "4.5.0"; + version = "4.6.0"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = pname; repo = pname; rev = "v${version}"; - sha256 = "sha256-mRpYPuj2B/kEaaeZlNYYnViGxWiK1xtWfDObHNduIK8="; + sha256 = "sha256-7ogsocRTMTO5yegyY7BADu9NrHK7zMMbihBu8oF4UlQ="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/twilio/default.nix b/pkgs/development/python-modules/twilio/default.nix index ddc94541422..4404b743bc5 100644 --- a/pkgs/development/python-modules/twilio/default.nix +++ b/pkgs/development/python-modules/twilio/default.nix @@ -1,17 +1,19 @@ { lib , buildPythonPackage , fetchFromGitHub -, mock -, nose -, pyjwt , pythonOlder + +, pyjwt , pytz , requests + +, mock +, pytestCheckHook }: buildPythonPackage rec { pname = "twilio"; - version = "7.5.0"; + version = "7.7.0"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -20,7 +22,7 @@ buildPythonPackage rec { owner = "twilio"; repo = "twilio-python"; rev = version; - sha256 = "0h6r9nz7dcvagrjhzvnirpnjazcy9r64cwlr2bnmlrbjhwdni9rq"; + sha256 = "sha256-PxLDAP/6Ddvf58eEyX3DHkdBNuLE5DlLdCEaRguqOy0="; }; propagatedBuildInputs = [ @@ -31,7 +33,7 @@ buildPythonPackage rec { checkInputs = [ mock - nose + pytestCheckHook ]; pythonImportsCheck = [ diff --git a/pkgs/development/python-modules/twine/default.nix b/pkgs/development/python-modules/twine/default.nix index 82c157722d2..d6fea594211 100644 --- a/pkgs/development/python-modules/twine/default.nix +++ b/pkgs/development/python-modules/twine/default.nix @@ -14,13 +14,13 @@ buildPythonPackage rec { pname = "twine"; - version = "3.7.1"; + version = "3.8.0"; format = "pyproject"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "28460a3db6b4532bde6a5db6755cf2dce6c5020bada8a641bb2c5c7a9b1f35b8"; + sha256 = "sha256-jvpSZY4K53BoahO2dVaTKPH7qYN+XeGGe/5fRqmu/hk="; }; nativeBuildInputs = [ setuptools-scm ]; diff --git a/pkgs/development/python-modules/txaio/default.nix b/pkgs/development/python-modules/txaio/default.nix index 074e7b8d509..23c24f3e514 100644 --- a/pkgs/development/python-modules/txaio/default.nix +++ b/pkgs/development/python-modules/txaio/default.nix @@ -12,12 +12,12 @@ buildPythonPackage rec { pname = "txaio"; - version = "21.2.1"; + version = "22.2.1"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "sha256-fW+JdFaAIz8cTbndt0jfXojSp6N5Yr4XTA/QTI26Hcg="; + sha256 = "sha256-LkWCtw8EsjRZCCVGhKmEIGwNm1DjB0okpMVauiHSTQE="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/typed-settings/default.nix b/pkgs/development/python-modules/typed-settings/default.nix index 6e903b68407..d9696122f15 100644 --- a/pkgs/development/python-modules/typed-settings/default.nix +++ b/pkgs/development/python-modules/typed-settings/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "typed-settings"; - version = "1.0.0"; + version = "1.0.1"; format = "pyproject"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "sha256-c+iOb1F8+9IoRbwpMTdyDfOPW2ZEo4xDAlbzLAxgSfk="; + sha256 = "sha256-xrIJgQiAaSXcANMnyXMnqEkLNUP+VyxjRoi9DkX+SLA="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/typeguard/default.nix b/pkgs/development/python-modules/typeguard/default.nix index 8b2ff2de512..dd3f62527aa 100644 --- a/pkgs/development/python-modules/typeguard/default.nix +++ b/pkgs/development/python-modules/typeguard/default.nix @@ -3,7 +3,7 @@ , pythonOlder , lib , setuptools-scm -, pytest +, pytestCheckHook , typing-extensions , glibcLocales }: @@ -26,12 +26,17 @@ buildPythonPackage rec { substituteInPlace setup.cfg --replace " --cov" "" ''; - checkInputs = [ pytest typing-extensions ]; + checkInputs = [ pytestCheckHook typing-extensions ]; - # mypy tests aren't passing with latest mypy - checkPhase = '' - py.test . --ignore=tests/mypy - ''; + disabledTestPaths = [ + # mypy tests aren't passing with latest mypy + "tests/mypy" + ]; + + disabledTests = [ + # not compatible with python3.10 + "test_typed_dict" + ]; disabled = pythonOlder "3.3"; diff --git a/pkgs/development/python-modules/typing-extensions/default.nix b/pkgs/development/python-modules/typing-extensions/default.nix index 1e29bc9a616..97f0d48cecc 100644 --- a/pkgs/development/python-modules/typing-extensions/default.nix +++ b/pkgs/development/python-modules/typing-extensions/default.nix @@ -8,7 +8,7 @@ buildPythonPackage rec { pname = "typing-extensions"; - version = "4.0.1"; + version = "4.1.1"; format = "pyproject"; disabled = pythonOlder "3.6"; @@ -16,7 +16,7 @@ buildPythonPackage rec { src = fetchPypi { pname = "typing_extensions"; inherit version; - hash = "sha256-TKCR3qFJ+UXsVq+0ja5xTyHoaS7yKjlSI7zTKJYbag4="; + hash = "sha256-GpRi3MM0enmx8cAnH7556ERYC7WYuvoe0gi5TaPNzUI="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/typing-inspect/default.nix b/pkgs/development/python-modules/typing-inspect/default.nix index 1e5303b7b09..d5401604936 100644 --- a/pkgs/development/python-modules/typing-inspect/default.nix +++ b/pkgs/development/python-modules/typing-inspect/default.nix @@ -3,6 +3,7 @@ , fetchPypi , typing-extensions , mypy-extensions +, pytestCheckHook }: buildPythonPackage rec { @@ -20,6 +21,19 @@ buildPythonPackage rec { mypy-extensions ]; + checkInputs = [ + pytestCheckHook + ]; + + disabledTests = [ + # https://github.com/ilevkivskyi/typing_inspect/issues/84 + "test_typed_dict_typing_extension" + ]; + + pythonImportsCheck = [ + "typing_inspect" + ]; + meta = with lib; { description = "Runtime inspection utilities for Python typing module"; homepage = "https://github.com/ilevkivskyi/typing_inspect"; diff --git a/pkgs/development/python-modules/ufo2ft/default.nix b/pkgs/development/python-modules/ufo2ft/default.nix index a3458b2f332..03ebd566b70 100644 --- a/pkgs/development/python-modules/ufo2ft/default.nix +++ b/pkgs/development/python-modules/ufo2ft/default.nix @@ -12,13 +12,13 @@ buildPythonPackage rec { pname = "ufo2ft"; - version = "2.25.2"; + version = "2.25.3"; format = "setuptools"; src = fetchPypi { inherit pname version; - sha256 = "ooWIHvyMtrht4WcGPiacY8dfjPSb5uitHnTRTKvf2AA="; + sha256 = "sha256-4OuEol+YorvOeK5bj33Po8V9KD0trcgTMXCTQ+J7q94="; }; patches = [ diff --git a/pkgs/development/python-modules/unittest-xml-reporting/default.nix b/pkgs/development/python-modules/unittest-xml-reporting/default.nix index c8d1edc4210..c4ee1f955e4 100644 --- a/pkgs/development/python-modules/unittest-xml-reporting/default.nix +++ b/pkgs/development/python-modules/unittest-xml-reporting/default.nix @@ -1,18 +1,21 @@ -{lib, fetchPypi, buildPythonPackage, isPy27, six}: +{lib, fetchPypi, buildPythonPackage, isPy27, six, lxml }: buildPythonPackage rec { pname = "unittest-xml-reporting"; - version = "3.0.4"; + version = "3.2.0"; disabled = isPy27; - propagatedBuildInputs = [six]; + propagatedBuildInputs = [ + lxml + six + ]; # The tarball from Pypi doesn't actually contain the unit tests doCheck = false; src = fetchPypi { inherit pname version; - sha256 = "984cebba69e889401bfe3adb9088ca376b3a1f923f0590d005126c1bffd1a695"; + sha256 = "sha256-7djTFwtAw6gbjPkQ9GxqMErihH7AEDbQLpwPm4V2LSg="; }; meta = with lib; { homepage = "https://github.com/xmlrunner/unittest-xml-reporting/tree/master/"; diff --git a/pkgs/development/python-modules/uproot/default.nix b/pkgs/development/python-modules/uproot/default.nix index bf523046c61..8bf8e67b8e4 100644 --- a/pkgs/development/python-modules/uproot/default.nix +++ b/pkgs/development/python-modules/uproot/default.nix @@ -12,14 +12,14 @@ buildPythonPackage rec { pname = "uproot"; - version = "4.1.9"; + version = "4.2.0"; # fetch from github for tests src = fetchFromGitHub { owner = "scikit-hep"; repo = "uproot4"; rev = version; - sha256 = "035gljxm18hvpfvc7nsd7lhawwq3np5sg1y86pzcxc680c6rj6lx"; + sha256 = "sha256-ft2VXYGb+iPqRUrtOBvl7SgTPfPR4+IOdYFVTNbQAEw="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/uvicorn/default.nix b/pkgs/development/python-modules/uvicorn/default.nix index 4ce9228efee..a3238d4c548 100644 --- a/pkgs/development/python-modules/uvicorn/default.nix +++ b/pkgs/development/python-modules/uvicorn/default.nix @@ -19,14 +19,14 @@ buildPythonPackage rec { pname = "uvicorn"; - version = "0.16.0"; + version = "0.17.5"; disabled = pythonOlder "3.6"; src = fetchFromGitHub { owner = "encode"; repo = pname; rev = version; - sha256 = "14jih6j4q2qp5c9rgl798i5p51b4y6zkkj434q2l1naw0csphk4s"; + sha256 = "sha256-66wPVnBLy2HK4p0m/b/DRxy12sk8AsVFZoFVcWRkL4s="; }; outputs = [ diff --git a/pkgs/development/python-modules/uvloop/default.nix b/pkgs/development/python-modules/uvloop/default.nix index 72ede5dc171..b4b75dbb194 100644 --- a/pkgs/development/python-modules/uvloop/default.nix +++ b/pkgs/development/python-modules/uvloop/default.nix @@ -62,8 +62,12 @@ buildPythonPackage rec { "tests/test_sourcecode.py" ]; - # force using installed/compiled uvloop vs source by moving tests to temp dir - preCheck = '' + preCheck = lib.optionalString stdenv.isDarwin '' + # Work around "OSError: AF_UNIX path too long" + # https://github.com/MagicStack/uvloop/issues/463 + export TMPDIR="/tmp" + '' + '' + # force using installed/compiled uvloop vs source by moving tests to temp dir export TEST_DIR=$(mktemp -d) cp -r tests $TEST_DIR pushd $TEST_DIR diff --git a/pkgs/development/python-modules/virtualenv/default.nix b/pkgs/development/python-modules/virtualenv/default.nix index c463c37747e..126bf4e6c6c 100644 --- a/pkgs/development/python-modules/virtualenv/default.nix +++ b/pkgs/development/python-modules/virtualenv/default.nix @@ -23,11 +23,11 @@ buildPythonPackage rec { pname = "virtualenv"; - version = "20.13.0"; + version = "20.13.2"; src = fetchPypi { inherit pname version; - sha256 = "d8458cf8d59d0ea495ad9b34c2599487f8a7772d796f9910858376d1600dd2dd"; + sha256 = "sha256-AfX4B0TSSjdDzmGFgSNIjpHLLdHTvfkq2vG7o5/97fA="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/wandb/default.nix b/pkgs/development/python-modules/wandb/default.nix index ef8e6cfd247..7f21877f1fb 100644 --- a/pkgs/development/python-modules/wandb/default.nix +++ b/pkgs/development/python-modules/wandb/default.nix @@ -114,6 +114,10 @@ buildPythonPackage rec { "tests/test_tables.py" ]; + # Disable test that fails on darwin due to issue with python3Packages.psutil: + # https://github.com/giampaolo/psutil/issues/1219 + disabledTests = lib.optional stdenv.isDarwin "test_tpu_system_stats"; + checkInputs = [ azure-core bokeh diff --git a/pkgs/development/python-modules/watchdog/default.nix b/pkgs/development/python-modules/watchdog/default.nix index 9fba5785c44..1bc471c7287 100644 --- a/pkgs/development/python-modules/watchdog/default.nix +++ b/pkgs/development/python-modules/watchdog/default.nix @@ -39,6 +39,11 @@ buildPythonPackage rec { --replace "--cov-report=term-missing" "" ''; + disabledTests = [ + # probably failing because of an encoding related issue + "test_create_wrong_encoding" + ]; + disabledTestPaths = [ # Tests are flaky "tests/test_inotify_buffer.py" diff --git a/pkgs/development/python-modules/weasyprint/default.nix b/pkgs/development/python-modules/weasyprint/default.nix index 3d752596dec..a1a7470b8b5 100644 --- a/pkgs/development/python-modules/weasyprint/default.nix +++ b/pkgs/development/python-modules/weasyprint/default.nix @@ -27,7 +27,7 @@ buildPythonPackage rec { pname = "weasyprint"; - version = "54.2"; + version = "54.3"; disabled = !isPy3k; format = "pyproject"; @@ -35,7 +35,7 @@ buildPythonPackage rec { src = fetchPypi { inherit version; pname = "weasyprint"; - sha256 = "sha256-1eiqguPiokd6RUPwZG2fsUCAybo0oIWXUesjdXzABGY="; + sha256 = "sha256-4E2gQGMFZsRMqiAgM/B/hYdl9TZwkEWoCXOfPQSOidY="; }; patches = [ diff --git a/pkgs/development/python-modules/websocket-client/default.nix b/pkgs/development/python-modules/websocket-client/default.nix index 116f45f16dd..37d926e5055 100644 --- a/pkgs/development/python-modules/websocket-client/default.nix +++ b/pkgs/development/python-modules/websocket-client/default.nix @@ -8,12 +8,12 @@ buildPythonPackage rec { pname = "websocket-client"; - version = "1.2.3"; + version = "1.3.1"; disabled = pythonOlder "3.6"; src = fetchPypi { inherit pname version; - sha256 = "1315816c0acc508997eb3ae03b9d3ff619c9d12d544c9a9b553704b1cc4f6af5"; + sha256 = "sha256-YninUGU5VBgoP4h958O+r7OqaNraXKy+SyFOjSbaSZs="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/weconnect-mqtt/default.nix b/pkgs/development/python-modules/weconnect-mqtt/default.nix index 42a3877cffc..0bb0a8f7999 100644 --- a/pkgs/development/python-modules/weconnect-mqtt/default.nix +++ b/pkgs/development/python-modules/weconnect-mqtt/default.nix @@ -10,7 +10,7 @@ buildPythonPackage rec { pname = "weconnect-mqtt"; - version = "0.30.0"; + version = "0.30.2"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -19,7 +19,7 @@ buildPythonPackage rec { owner = "tillsteinbach"; repo = "WeConnect-mqtt"; rev = "v${version}"; - sha256 = "sha256-/mlN9gEEy8DJSFef0Pp2PLjHhwStKwANKSzw4nT19eM="; + sha256 = "sha256-e8dDdtabEHQKNx3c63Ou3T3ygsj4763C9Pd8usFrSCE="; }; propagatedBuildInputs = [ diff --git a/pkgs/development/python-modules/weconnect/default.nix b/pkgs/development/python-modules/weconnect/default.nix index f5af3e5aa50..096f1b0e99b 100644 --- a/pkgs/development/python-modules/weconnect/default.nix +++ b/pkgs/development/python-modules/weconnect/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "weconnect"; - version = "0.37.0"; + version = "0.37.2"; format = "setuptools"; disabled = pythonOlder "3.7"; @@ -21,7 +21,7 @@ buildPythonPackage rec { owner = "tillsteinbach"; repo = "WeConnect-python"; rev = "v${version}"; - sha256 = "sha256-h6jKtQt9vCh5bnhIqWLniUIJ41GxCs0uSi4vBVNs8tE="; + sha256 = "sha256-54T4L1MzF2rkKM0AXz+bPBdVL7Izdho6c3AVSXBho2E="; }; propagatedBuildInputs = [ @@ -42,8 +42,8 @@ buildPythonPackage rec { substituteInPlace setup.py \ --replace "setup_requires=SETUP_REQUIRED," "setup_requires=[]," \ --replace "tests_require=TEST_REQUIRED," "tests_require=[]," - substituteInPlace requirements.txt \ - --replace "pillow~=9.0.0" "pillow" + substituteInPlace image_extra_requirements.txt \ + --replace "pillow~=9.0.1" "pillow" substituteInPlace pytest.ini \ --replace "--cov=weconnect --cov-config=.coveragerc --cov-report html" "" \ --replace "pytest-cov" "" diff --git a/pkgs/development/python-modules/werkzeug/default.nix b/pkgs/development/python-modules/werkzeug/default.nix index c75c59ac1c9..63c3ad1b420 100644 --- a/pkgs/development/python-modules/werkzeug/default.nix +++ b/pkgs/development/python-modules/werkzeug/default.nix @@ -12,7 +12,7 @@ buildPythonPackage rec { pname = "werkzeug"; - version = "2.0.2"; + version = "2.0.3"; format = "setuptools"; disabled = pythonOlder "3.6"; @@ -20,7 +20,7 @@ buildPythonPackage rec { src = fetchPypi { pname = "Werkzeug"; inherit version; - sha256 = "sha256-qiu2/I3ujWxQTArB5/X33FgQqZA+eTtvcVqfAVva25o="; + sha256 = "sha256-uGP4/wV8UiFktgZ8niiwQRYbS+W6TQ2s7qpQoWOCLTw="; }; propagatedBuildInputs = lib.optionals (!stdenv.isDarwin) [ diff --git a/pkgs/development/python-modules/wsproto/default.nix b/pkgs/development/python-modules/wsproto/default.nix index d4dd7d08999..803ddd51d9f 100644 --- a/pkgs/development/python-modules/wsproto/default.nix +++ b/pkgs/development/python-modules/wsproto/default.nix @@ -6,12 +6,12 @@ buildPythonPackage rec { pname = "wsproto"; - version = "1.0.0"; + version = "1.1.0"; disabled = pythonOlder "3.6"; # python versions <3.6 src = fetchPypi { inherit pname version; - sha256 = "868776f8456997ad0d9720f7322b746bbe9193751b5b290b7f924659377c8c38"; + sha256 = "sha256-ouVr/Vx82DwTadg7X+zNbTd5i3SHKGbmJhbg7PERvag="; }; propagatedBuildInputs = [ h11 ] ++ lib.optional isPy36 dataclasses; diff --git a/pkgs/development/python-modules/xarray/default.nix b/pkgs/development/python-modules/xarray/default.nix index 5f780a61ffc..85b8ac799c7 100644 --- a/pkgs/development/python-modules/xarray/default.nix +++ b/pkgs/development/python-modules/xarray/default.nix @@ -11,14 +11,14 @@ buildPythonPackage rec { pname = "xarray"; - version = "0.20.2"; + version = "2022.3.0"; format = "pyproject"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "sha256-wuvoDKgbEKAkH2h23MNKyWluXFzc30dY2nz0vXMsQfc="; + sha256 = "sha256-OYNEv30XBHeqzv9wIQ4R69aa9rFW/hOXgFTSXEhylEA="; }; SETUPTOOLS_SCM_PRETEND_VERSION="${version}"; diff --git a/pkgs/development/python-modules/xgboost/default.nix b/pkgs/development/python-modules/xgboost/default.nix index 3717ca2473c..f6c63db4505 100644 --- a/pkgs/development/python-modules/xgboost/default.nix +++ b/pkgs/development/python-modules/xgboost/default.nix @@ -48,7 +48,8 @@ buildPythonPackage { ln -s ${xgboost}/bin/xgboost ../xgboost ''; - pytestFlagsArray = ["../tests/python"]; + # tests are extremely cpu intensive, only run basic tests to ensure package is working + pytestFlagsArray = ["../tests/python/test_basic.py"]; disabledTestPaths = [ # Requires internet access: https://github.com/dmlc/xgboost/blob/03cd087da180b7dff21bd8ef34997bf747016025/tests/python/test_ranking.py#L81 "../tests/python/test_ranking.py" diff --git a/pkgs/development/python-modules/xmlsec/default.nix b/pkgs/development/python-modules/xmlsec/default.nix index 0a9a0af0e54..76ce32e5e8f 100644 --- a/pkgs/development/python-modules/xmlsec/default.nix +++ b/pkgs/development/python-modules/xmlsec/default.nix @@ -16,6 +16,7 @@ buildPythonPackage rec { pname = "xmlsec"; version = "1.3.12"; + format = "pyproject"; src = fetchPypi { inherit pname version; @@ -35,7 +36,14 @@ buildPythonPackage rec { # Full git clone required for test_doc_examples checkInputs = [ pytestCheckHook hypothesis ]; - disabledTestPaths = [ "tests/test_doc_examples.py" ]; + + disabledTestPaths = [ + "tests/test_doc_examples.py" + # test_reinitialize_module segfaults python + # https://github.com/mehcode/python-xmlsec/issues/203 + "tests/test_xmlsec.py" + ]; + pythonImportsCheck = [ "xmlsec" ]; diff --git a/pkgs/development/python-modules/xmltodict/default.nix b/pkgs/development/python-modules/xmltodict/default.nix index 13cc5b89c2a..5e0733b6256 100644 --- a/pkgs/development/python-modules/xmltodict/default.nix +++ b/pkgs/development/python-modules/xmltodict/default.nix @@ -1,30 +1,27 @@ { lib , buildPythonPackage , fetchPypi -, coverage , pytestCheckHook }: buildPythonPackage rec { pname = "xmltodict"; version = "0.12.0"; + format = "setuptools"; src = fetchPypi { inherit pname version; sha256 = "50d8c638ed7ecb88d90561beedbf720c9b4e851a9fa6c47ebd64e99d166d8a21"; }; - checkInputs = [ coverage pytestCheckHook ]; - - disabledTests = [ - # incompatibilities with security fixes: https://github.com/martinblech/xmltodict/issues/289 - "test_namespace_collapse" - "test_namespace_support" + checkInputs = [ + pytestCheckHook ]; - meta = { + meta = with lib; { description = "Makes working with XML feel like you are working with JSON"; homepage = "https://github.com/martinblech/xmltodict"; - license = lib.licenses.mit; + license = licenses.mit; + maintainers = with maintainers; [ ]; }; } diff --git a/pkgs/development/python-modules/xxhash/default.nix b/pkgs/development/python-modules/xxhash/default.nix index df3c0c85269..f70526da6a1 100644 --- a/pkgs/development/python-modules/xxhash/default.nix +++ b/pkgs/development/python-modules/xxhash/default.nix @@ -4,12 +4,12 @@ }: buildPythonPackage rec { - version = "2.0.2"; + version = "3.0.0"; pname = "xxhash"; src = fetchPypi { inherit pname version; - sha256 = "b7bead8cf6210eadf9cecf356e17af794f57c0939a3d420a00d87ea652f87b49"; + sha256 = "sha256-MLLZeq8R+xIgI/a0TruXxpVengDXRhqWQVygMLXOucc="; }; meta = with lib; { diff --git a/pkgs/development/python-modules/yq/default.nix b/pkgs/development/python-modules/yq/default.nix index b87982b20b6..5bcbf24dc30 100644 --- a/pkgs/development/python-modules/yq/default.nix +++ b/pkgs/development/python-modules/yq/default.nix @@ -11,11 +11,11 @@ buildPythonPackage rec { pname = "yq"; - version = "2.13.0"; + version = "2.14.0"; src = fetchPypi { inherit pname version; - sha256 = "sha256-/RMf2x9WcWrY1EzZ6q99OyLTm6iGHqZKQJzD9K4mPbg="; + sha256 = "sha256-9L8rKZ0eXH69dM+yXR9dm2QBBjusB6LQmhVhRMHWROE="; }; patches = [ diff --git a/pkgs/development/python-modules/zarr/default.nix b/pkgs/development/python-modules/zarr/default.nix index 11c6f84850b..c943f34c52e 100644 --- a/pkgs/development/python-modules/zarr/default.nix +++ b/pkgs/development/python-modules/zarr/default.nix @@ -12,12 +12,12 @@ buildPythonPackage rec { pname = "zarr"; - version = "2.10.3"; + version = "2.11.0"; disabled = isPy27; src = fetchPypi { inherit pname version; - sha256 = "76932665c2146ebdf15f6dba254f9e0030552fbfcf9322dea822bff96fbce693"; + sha256 = "sha256-sIc74nr1aQc4+hWOp6gC6uRUkEwzmVBWGFrMWnQltFE="; }; nativeBuildInputs = [ diff --git a/pkgs/development/python-modules/zeep/default.nix b/pkgs/development/python-modules/zeep/default.nix index 1b3e0c5fcdf..83ee3f37f7e 100644 --- a/pkgs/development/python-modules/zeep/default.nix +++ b/pkgs/development/python-modules/zeep/default.nix @@ -6,6 +6,7 @@ , cached-property , defusedxml , fetchFromGitHub +, fetchpatch , freezegun , httpx , isodate @@ -38,6 +39,14 @@ buildPythonPackage rec { sha256 = "sha256-fJLr2LJpbNQTl183R56G7sJILfm04R39qpJxLogQLoo="; }; + patches = [ + (fetchpatch { + # fixes pytest_httpx test case; https://github.com/mvantellingen/python-zeep/pull/1293 + url = "https://github.com/mvantellingen/python-zeep/commit/2907848185adcb4e6d8c093db6c617c64cb8c8bf.patch"; + hash = "sha256-hpksgMfrBLvYtI1QIs1aHBtFq7C1PWpnAj8BW5ak1/4="; + }) + ]; + propagatedBuildInputs = [ attrs cached-property diff --git a/pkgs/development/python-modules/zimports/default.nix b/pkgs/development/python-modules/zimports/default.nix index d350e204089..d4c6c6b7e47 100644 --- a/pkgs/development/python-modules/zimports/default.nix +++ b/pkgs/development/python-modules/zimports/default.nix @@ -10,13 +10,13 @@ buildPythonPackage rec { pname = "zimports"; - version = "0.4.1"; + version = "0.5.0"; src = fetchFromGitHub { owner = "sqlalchemyorg"; repo = "zimports"; rev = "v${version}"; - sha256 = "11mg7j7xiypv9hki4qbnp9jsgwgfdrgdzfqyrzk5x0s4hycgi4q0"; + sha256 = "sha256-O8MHUt9yswL9fK9pEddkvnNS2E4vWA/S1BTs1OD1VbU="; }; disabled = !isPy3k; diff --git a/pkgs/development/python-modules/zope_exceptions/default.nix b/pkgs/development/python-modules/zope_exceptions/default.nix index 0586227c61c..fb1eb07154a 100644 --- a/pkgs/development/python-modules/zope_exceptions/default.nix +++ b/pkgs/development/python-modules/zope_exceptions/default.nix @@ -6,11 +6,11 @@ buildPythonPackage rec { pname = "zope.exceptions"; - version = "4.4"; + version = "4.5"; src = fetchPypi { inherit pname version; - sha256 = "0d72886b1bb8af4c346a117a540f28ab122577f5e3a105a261be72cd15776fda"; + sha256 = "sha256-TjW7oEiJxdEU3KpVKXQl1fM/YYqF7323Ehs7dxEAeE4="; }; propagatedBuildInputs = [ zope_interface ]; diff --git a/pkgs/development/python-modules/zopfli/default.nix b/pkgs/development/python-modules/zopfli/default.nix index d7e9cf507f0..1bc880456b6 100644 --- a/pkgs/development/python-modules/zopfli/default.nix +++ b/pkgs/development/python-modules/zopfli/default.nix @@ -2,11 +2,11 @@ buildPythonPackage rec { pname = "zopfli"; - version = "0.1.9"; + version = "0.2.0"; src = fetchPypi { inherit pname version; - sha256 = "78de3cc08a8efaa8013d61528907d91ac4d6cc014ffd8a41cc10ee75e9e60d7b"; + sha256 = "sha256-x9PzVcSR84TkNNsuYmheq269pmuWTonhdUuxFLLTjOo="; extension = "zip"; }; diff --git a/pkgs/development/python2-modules/pycairo/default.nix b/pkgs/development/python2-modules/pycairo/default.nix index 9da4da1479c..eefc69a3323 100644 --- a/pkgs/development/python2-modules/pycairo/default.nix +++ b/pkgs/development/python2-modules/pycairo/default.nix @@ -3,7 +3,7 @@ , meson , ninja , buildPythonPackage -, pytestCheckHook +, pytest , pkg-config , cairo , python @@ -32,9 +32,11 @@ buildPythonPackage rec { cairo ]; - checkInputs = [ - pytestCheckHook - ]; + # HACK: Don't use the pytestCheckHook because PYTHONPATH + # will be added by the Python setuptook breaking meson. + checkPhase = '' + ${pytest}/bin/pytest + ''; mesonFlags = [ # This is only used for figuring out what version of Python is in diff --git a/pkgs/development/tools/analysis/checkov/default.nix b/pkgs/development/tools/analysis/checkov/default.nix index 8cda4a0b212..77bf4c5dfb1 100644 --- a/pkgs/development/tools/analysis/checkov/default.nix +++ b/pkgs/development/tools/analysis/checkov/default.nix @@ -32,13 +32,13 @@ with py.pkgs; buildPythonApplication rec { pname = "checkov"; - version = "2.0.988"; + version = "2.0.1034"; src = fetchFromGitHub { owner = "bridgecrewio"; repo = pname; rev = version; - hash = "sha256-0/SL20N5d/oqWdyvVMZ+pzpPbehrYepaPi8P8SS8DSA="; + hash = "sha256-amSgg/6yYaLKzwkO7dq06zvh4744RyTVhd/tdurHKa4="; }; nativeBuildInputs = with py.pkgs; [ @@ -94,7 +94,8 @@ buildPythonApplication rec { postPatch = '' substituteInPlace setup.py \ --replace "cyclonedx-python-lib>=0.11.0,<1.0.0" "cyclonedx-python-lib>=0.11.0" \ - --replace "prettytable>=3.0.0" "prettytable" + --replace "prettytable>=3.0.0" "prettytable" \ + --replace "pycep-parser==0.3.3" "pycep-parser" ''; preCheck = '' @@ -114,6 +115,8 @@ buildPythonApplication rec { "test_skipped_check_exists" # AssertionError: 0 not greater than 0 "test_skip_mapping_default" + # Test is failing + "test_SQLServerAuditingEnabled" ]; disabledTestPaths = [ diff --git a/pkgs/development/tools/build-managers/cmake/default.nix b/pkgs/development/tools/build-managers/cmake/default.nix index 47abc7ec767..cf2fe926ddb 100644 --- a/pkgs/development/tools/build-managers/cmake/default.nix +++ b/pkgs/development/tools/build-managers/cmake/default.nix @@ -17,11 +17,11 @@ stdenv.mkDerivation rec { + lib.optionalString isBootstrap "-boot" + lib.optionalString useNcurses "-cursesUI" + lib.optionalString withQt5 "-qt5UI"; - version = "3.22.2"; + version = "3.22.3"; src = fetchurl { url = "https://cmake.org/files/v${lib.versions.majorMinor version}/cmake-${version}.tar.gz"; - sha256 = "sha256-PBxHi5ZQsQfUUsW9VFxy4vrU43wJuJoZhLmi9G32rO0="; + sha256 = "sha256-n4RpFm+UVTtpeKFu4pIn7Emi61zrYIJ13sQNiuDRtaA="; }; patches = [ diff --git a/pkgs/development/tools/build-managers/meson/default.nix b/pkgs/development/tools/build-managers/meson/default.nix index 8744407fb96..d8c92bc82d6 100644 --- a/pkgs/development/tools/build-managers/meson/default.nix +++ b/pkgs/development/tools/build-managers/meson/default.nix @@ -10,11 +10,11 @@ python3.pkgs.buildPythonApplication rec { pname = "meson"; - version = "0.60.3"; + version = "0.61.2"; src = python3.pkgs.fetchPypi { inherit pname version; - hash = "sha256-h8pfqTWKAYZFKTkr1k4CcVjrlK/KfHdmsYZu8n7MuY4="; + hash = "sha256-AjOn+NlZB5MY9gUrCTnCf2il3oa6YB8lye5oaftfWIk="; }; patches = [ @@ -58,10 +58,6 @@ python3.pkgs.buildPythonApplication rec { # unsandboxed non-NixOS builds, see: # https://github.com/NixOS/nixpkgs/issues/86131#issuecomment-711051774 ./boost-Do-not-add-system-paths-on-nix.patch - - # Meson tries to update ld.so.cache which breaks when the target architecture - # differs from the build host's. - ./do-not-update-ldconfig-cache.patch ] ++ lib.optionals withDarwinFrameworksGtkDocPatch [ # Fix building gtkdoc for GLib # https://github.com/mesonbuild/meson/pull/10186 diff --git a/pkgs/development/tools/build-managers/meson/do-not-update-ldconfig-cache.patch b/pkgs/development/tools/build-managers/meson/do-not-update-ldconfig-cache.patch deleted file mode 100644 index 884023aaa7e..00000000000 --- a/pkgs/development/tools/build-managers/meson/do-not-update-ldconfig-cache.patch +++ /dev/null @@ -1,12 +0,0 @@ -diff --git a/mesonbuild/minstall.py b/mesonbuild/minstall.py -index cb87faf5c..878ec4cd6 100644 ---- a/mesonbuild/minstall.py -+++ b/mesonbuild/minstall.py -@@ -551,7 +551,6 @@ class Installer: - self.install_emptydir(d, dm, destdir, fullprefix) - self.install_data(d, dm, destdir, fullprefix) - self.restore_selinux_contexts(destdir) -- self.apply_ldconfig(dm, destdir) - self.run_install_script(d, destdir, fullprefix) - if not self.did_install_something: - self.log('Nothing to install.') diff --git a/pkgs/development/tools/build-managers/meson/fix-gtkdoc-when-using-multiple-apple-frameworks.patch b/pkgs/development/tools/build-managers/meson/fix-gtkdoc-when-using-multiple-apple-frameworks.patch index eb6d9718bcb..6c237e92dd1 100644 --- a/pkgs/development/tools/build-managers/meson/fix-gtkdoc-when-using-multiple-apple-frameworks.patch +++ b/pkgs/development/tools/build-managers/meson/fix-gtkdoc-when-using-multiple-apple-frameworks.patch @@ -1,4 +1,4 @@ -From 0a008a6c7ecee19f35c8b7ab17b1470d0d1a8a15 Mon Sep 17 00:00:00 2001 +From b8ba462ae72e0818898357464263ec84722f6d4c Mon Sep 17 00:00:00 2001 From: Jan Tojnar <jtojnar@gmail.com> Date: Sat, 26 Mar 2022 02:26:27 +0100 Subject: [PATCH] gnome: Fix gtkdoc when using multiple Apple frameworks @@ -11,13 +11,16 @@ Picked from https://github.com/mesonbuild/meson/pull/10186 Also pick https://github.com/mesonbuild/meson/commit/68e684d51f1e469e0d9f4b499ffda15146cad98a when resolving conflict. diff --git a/mesonbuild/modules/gnome.py b/mesonbuild/modules/gnome.py -index 7113f28d2..d3269b53f 100644 +index 214f97ac3..0521b2605 100644 --- a/mesonbuild/modules/gnome.py +++ b/mesonbuild/modules/gnome.py -@@ -384,13 +384,14 @@ class GnomeModule(ExtensionModule): - def _get_link_args(self, state, lib, depends, include_rpath=False, - use_gir_args=False): - link_command = [] +@@ -593,15 +593,16 @@ class GnomeModule(ExtensionModule): + lib: T.Union[build.SharedLibrary, build.StaticLibrary], + depends: T.List[build.BuildTarget], + include_rpath: bool = False, +- use_gir_args: bool = False) -> T.List[str]: ++ use_gir_args: bool = False) -> T.Tuple[T.List[str], T.List[T.Union[build.BuildTarget, 'build.GeneratedTypes', 'FileOrString']]]: + link_command: T.List[str] = [] + new_depends = list(depends) # Construct link args if isinstance(lib, build.SharedLibrary): @@ -30,42 +33,36 @@ index 7113f28d2..d3269b53f 100644 # Needed for the following binutils bug: # https://github.com/mesonbuild/meson/issues/1911 # However, g-ir-scanner does not understand -Wl,-rpath -@@ -404,18 +405,24 @@ class GnomeModule(ExtensionModule): +@@ -615,19 +616,19 @@ class GnomeModule(ExtensionModule): link_command.append('--extra-library=' + lib.name) else: link_command.append('-l' + lib.name) - return link_command -- -- def _get_dependencies_flags(self, deps, state, depends, include_rpath=False, -- use_gir_args=False, separate_nodedup=False): -- cflags = OrderedSet() -- internal_ldflags = OrderedSet() -- external_ldflags = OrderedSet() + return link_command, new_depends -+ + +- def _get_dependencies_flags( + def _get_dependencies_flags_raw( -+ self, deps, -+ state, -+ depends, -+ include_rpath: bool = False, -+ use_gir_args: bool = False, -+ ) -> T.Tuple[OrderedSet[str], OrderedSet[T.Union[str, T.Tuple[str, str]]], OrderedSet[T.Union[str, T.Tuple[str, str]]], OrderedSet[str], -+ T.List]: -+ cflags: OrderedSet[str] = OrderedSet() + self, deps: T.Sequence[T.Union['Dependency', build.SharedLibrary, build.StaticLibrary]], +- state: 'ModuleState', depends: T.List[build.BuildTarget], include_rpath: bool = False, +- use_gir_args: bool = False, separate_nodedup: bool = False +- ) -> T.Tuple[OrderedSet[str], OrderedSet[str], OrderedSet[str], T.Optional[T.List[str]], OrderedSet[str]]: ++ state: 'ModuleState', depends: T.List[build.BuildTarget], include_rpath: bool, ++ use_gir_args: bool ++ ) -> T.Tuple[OrderedSet[str], OrderedSet[T.Union[str, T.Tuple[str, str]]], OrderedSet[T.Union[str, T.Tuple[str, str]]], T.Optional[T.List[str]], OrderedSet[str], ++ T.List[T.Union[build.BuildTarget, 'build.GeneratedTypes', 'FileOrString']]]: + cflags: OrderedSet[str] = OrderedSet() +- internal_ldflags: OrderedSet[str] = OrderedSet() +- external_ldflags: OrderedSet[str] = OrderedSet() # External linker flags that can't be de-duped reliably because they - # require two args in order, such as -framework AVFoundation -- external_ldflags_nodedup = [] -- gi_includes = OrderedSet() +- external_ldflags_nodedup: T.List[str] = [] + # require two args in order, such as -framework AVFoundation will be stored as a tuple. + internal_ldflags: OrderedSet[T.Union[str, T.Tuple[str, str]]] = OrderedSet() + external_ldflags: OrderedSet[T.Union[str, T.Tuple[str, str]]] = OrderedSet() -+ gi_includes: OrderedSet[str] = OrderedSet() + gi_includes: OrderedSet[str] = OrderedSet() deps = mesonlib.listify(deps) -+ depends = list(depends) - for dep in deps: - if isinstance(dep, Dependency): -@@ -427,21 +434,20 @@ class GnomeModule(ExtensionModule): +@@ -642,21 +643,20 @@ class GnomeModule(ExtensionModule): cflags.update(state.get_include_args(dep.include_directories)) for lib in dep.libraries: if isinstance(lib, build.SharedLibrary): @@ -95,21 +92,21 @@ index 7113f28d2..d3269b53f 100644 for source in dep.sources: if isinstance(source, GirTarget): gi_includes.update([os.path.join(state.environment.get_build_dir(), -@@ -469,7 +475,7 @@ class GnomeModule(ExtensionModule): +@@ -684,7 +684,7 @@ class GnomeModule(ExtensionModule): # If it's a framework arg, slurp the framework name too # to preserve the order of arguments - if lib == '-framework': -- external_ldflags_nodedup += [lib, next(ldflags)] -+ external_ldflags.update([(lib, next(ldflags))]) + if flag == '-framework': +- external_ldflags_nodedup += [flag, next(ldflags)] ++ external_ldflags.update([(flag, next(ldflags))]) else: - external_ldflags.update([lib]) + external_ldflags.update([flag]) elif isinstance(dep, (build.StaticLibrary, build.SharedLibrary)): -@@ -480,21 +486,43 @@ class GnomeModule(ExtensionModule): +@@ -695,21 +695,41 @@ class GnomeModule(ExtensionModule): continue if use_gir_args and self._gir_has_option('--extra-library'): -- def fix_ldflags(ldflags): -- fixed_ldflags = OrderedSet() +- def fix_ldflags(ldflags: T.Iterable[str]) -> OrderedSet[str]: +- fixed_ldflags: OrderedSet[str] = OrderedSet() + def fix_ldflags(ldflags: T.Iterable[T.Union[str, T.Tuple[str, str]]]) -> OrderedSet[T.Union[str, T.Tuple[str, str]]]: + fixed_ldflags: OrderedSet[T.Union[str, T.Tuple[str, str]]] = OrderedSet() for ldflag in ldflags: @@ -122,19 +119,17 @@ index 7113f28d2..d3269b53f 100644 external_ldflags = fix_ldflags(external_ldflags) - if not separate_nodedup: - external_ldflags.update(external_ldflags_nodedup) -- return cflags, internal_ldflags, external_ldflags, gi_includes +- return cflags, internal_ldflags, external_ldflags, None, gi_includes - else: - return cflags, internal_ldflags, external_ldflags, external_ldflags_nodedup, gi_includes + return cflags, internal_ldflags, external_ldflags, gi_includes, depends + + def _get_dependencies_flags( -+ self, deps, -+ state, -+ depends, -+ include_rpath: bool = False, -+ use_gir_args: bool = False, ++ self, deps: T.Sequence[T.Union['Dependency', build.SharedLibrary, build.StaticLibrary]], ++ state: 'ModuleState', depends: T.List[build.BuildTarget], include_rpath: bool = False, ++ use_gir_args: bool = False + ) -> T.Tuple[OrderedSet[str], T.List[str], T.List[str], OrderedSet[str], -+ T.List]: ++ T.List[T.Union[build.BuildTarget, 'build.GeneratedTypes', 'FileOrString']]]: + + cflags, internal_ldflags_raw, external_ldflags_raw, gi_includes, depends = self._get_dependencies_flags_raw(deps, state, depends, include_rpath, use_gir_args) + internal_ldflags: T.List[str] = [] @@ -153,24 +148,15 @@ index 7113f28d2..d3269b53f 100644 + external_ldflags.extend(ldflag) + return cflags, internal_ldflags, external_ldflags, gi_includes, depends - def _unwrap_gir_target(self, girtarget, state): + def _unwrap_gir_target(self, girtarget: T.Union[build.Executable, build.StaticLibrary, build.SharedLibrary], state: 'ModuleState' + ) -> T.Union[build.Executable, build.StaticLibrary, build.SharedLibrary]: if not isinstance(girtarget, (build.Executable, build.SharedLibrary, - build.StaticLibrary)): -@@ -875,7 +903,7 @@ class GnomeModule(ExtensionModule): +@@ -1056,7 +1076,7 @@ class GnomeModule(ExtensionModule): # ldflags will be misinterpreted by gir scanner (showing # spurious dependencies) but building GStreamer fails if they # are not used here. -- dep_cflags, dep_internal_ldflags, dep_external_ldflags, gi_includes = \ +- dep_cflags, dep_internal_ldflags, dep_external_ldflags, _, gi_includes = \ + dep_cflags, dep_internal_ldflags, dep_external_ldflags, gi_includes, depends = \ self._get_dependencies_flags(deps, state, depends, use_gir_args=True) scan_cflags = [] scan_cflags += list(self._get_scanner_cflags(cflags)) -@@ -1170,7 +1198,7 @@ class GnomeModule(ExtensionModule): - deps = extract_as_list(kwargs, 'dependencies') - cflags = [] - cflags.extend(mesonlib.stringlistify(kwargs.pop('c_args', []))) -- deps_cflags, internal_ldflags, external_ldflags, gi_includes = \ -+ deps_cflags, internal_ldflags, external_ldflags, gi_includes, depends = \ - self._get_dependencies_flags(deps, state, depends, include_rpath=True) - inc_dirs = mesonlib.extract_as_list(kwargs, 'include_directories') - for incd in inc_dirs: diff --git a/pkgs/development/tools/build-managers/meson/fix-rpath.patch b/pkgs/development/tools/build-managers/meson/fix-rpath.patch index d34b6c4c434..29bec7903ca 100644 --- a/pkgs/development/tools/build-managers/meson/fix-rpath.patch +++ b/pkgs/development/tools/build-managers/meson/fix-rpath.patch @@ -1,9 +1,9 @@ --- a/mesonbuild/backend/backends.py +++ b/mesonbuild/backend/backends.py -@@ -456,6 +456,21 @@ class Backend: - args.extend(self.environment.coredata.get_external_link_args(target.for_machine, lang)) - except Exception: - pass +@@ -723,6 +723,21 @@ + @staticmethod + def get_rpath_dirs_from_link_args(args: T.List[str]) -> T.Set[str]: + dirs: T.Set[str] = set() + + nix_ldflags = os.environ.get('NIX_LDFLAGS', '').split() + next_is_path = False diff --git a/pkgs/development/tools/container-linux-config-transpiler/default.nix b/pkgs/development/tools/container-linux-config-transpiler/default.nix deleted file mode 100644 index 5b2a7fddeb4..00000000000 --- a/pkgs/development/tools/container-linux-config-transpiler/default.nix +++ /dev/null @@ -1,34 +0,0 @@ -{ lib, fetchFromGitHub, buildGoPackage }: - -with lib; - -buildGoPackage rec { - pname = "ct"; - version = "0.9.0"; - - goPackagePath = "github.com/coreos/container-linux-config-transpiler"; - - src = fetchFromGitHub { - owner = "coreos"; - repo = "container-linux-config-transpiler"; - rev = "v${version}"; - sha256="1w6nvgrl5qp3ci9igflk9dlk3020psv5m4f3p57f3qcx9vrcl4lw"; - }; - - ldflags = [ - "-X ${goPackagePath}/internal/version.Raw=v${version}" - ]; - - postInstall = '' - mv $out/bin/{internal,ct} - rm $out/bin/tools - ''; - - meta = { - description = "Convert a Container Linux Config into Ignition"; - license = licenses.asl20; - homepage = "https://github.com/coreos/container-linux-config-transpiler"; - maintainers = with maintainers; [elijahcaine]; - platforms = with platforms; unix; - }; -} diff --git a/pkgs/development/tools/continuous-integration/buildkite-agent/default.nix b/pkgs/development/tools/continuous-integration/buildkite-agent/default.nix index 32be3e43238..70e60d8418f 100644 --- a/pkgs/development/tools/continuous-integration/buildkite-agent/default.nix +++ b/pkgs/development/tools/continuous-integration/buildkite-agent/default.nix @@ -3,16 +3,16 @@ nixosTests }: buildGoModule rec { pname = "buildkite-agent"; - version = "3.34.1"; + version = "3.35.1"; src = fetchFromGitHub { owner = "buildkite"; repo = "agent"; rev = "v${version}"; - sha256 = "sha256-OxZcMPJx83hBQOe4Pc8ERhO9QOc4euVVs+OMbPjA4U0="; + sha256 = "sha256-fa32tKOlRuKTONiMboX7CUxeknePsNRC7jlBvAtXmus="; }; - vendorSha256 = "sha256-n3XRxpEKjHf7L7fcGscWTVKBtot9waZbLoS9cG0kHfI="; + vendorSha256 = "sha256-YnOOJDzdirikFbS9451A/TWOSWv04QsqO68/cSXK82k="; postPatch = '' substituteInPlace bootstrap/shell/shell.go --replace /bin/bash ${bash}/bin/bash @@ -46,7 +46,7 @@ buildGoModule rec { ''; homepage = "https://buildkite.com/docs/agent"; license = licenses.mit; - maintainers = with maintainers; [ pawelpacana zimbatm rvl ]; + maintainers = with maintainers; [ pawelpacana zimbatm rvl techknowlogick ]; platforms = with platforms; unix ++ darwin; }; } diff --git a/pkgs/development/tools/database/prisma-engines/default.nix b/pkgs/development/tools/database/prisma-engines/default.nix index 015b60d9ccf..73af1bde5ea 100644 --- a/pkgs/development/tools/database/prisma-engines/default.nix +++ b/pkgs/development/tools/database/prisma-engines/default.nix @@ -8,21 +8,24 @@ , stdenv }: +# Updating this package will force an update for nodePackages.prisma. The +# version of prisma-engines and nodePackages.prisma must be the same for them to +# function correctly. rustPlatform.buildRustPackage rec { pname = "prisma-engines"; - version = "3.11.0"; + version = "3.12.0"; src = fetchFromGitHub { owner = "prisma"; repo = "prisma-engines"; rev = version; - sha256 = "sha256-z7ebwidY+p350XaGeyohoSHWc2DhfzpRxsRDLON1BuA="; + sha256 = "sha256-lIHE63XIPutvTS2cid0+tuo+JMSKMGuSUcnFv1mCRrM="; }; # Use system openssl. OPENSSL_NO_VENDOR = 1; - cargoSha256 = "sha256-PQdLoNJL9szPzPtFRznWS0lngTvtWK+Ko2rp4JWH9dQ="; + cargoSha256 = "sha256-SkI+GLHknC+CGhGo7KiZahBxMp/JCIukTe2C0mMTdjY="; nativeBuildInputs = [ pkg-config ]; diff --git a/pkgs/development/tools/deadcode/default.nix b/pkgs/development/tools/deadcode/default.nix index 014acc89e1f..c5074cd0377 100644 --- a/pkgs/development/tools/deadcode/default.nix +++ b/pkgs/development/tools/deadcode/default.nix @@ -11,7 +11,7 @@ buildGoPackage rec { rev = "210d2dc333e90c7e3eedf4f2242507a8e83ed4ab"; goPackagePath = "github.com/tsenart/deadcode"; - excludedPackages = "\\(cmd/fillswitch/test-fixtures\\)"; + excludedPackages = "cmd/fillswitch/test-fixtures"; src = fetchFromGitHub { inherit rev; diff --git a/pkgs/development/tools/delve/default.nix b/pkgs/development/tools/delve/default.nix index 478ef3b6fc6..f42046c284e 100644 --- a/pkgs/development/tools/delve/default.nix +++ b/pkgs/development/tools/delve/default.nix @@ -5,7 +5,7 @@ buildGoPackage rec { version = "1.8.2"; goPackagePath = "github.com/go-delve/delve"; - excludedPackages = "\\(_fixtures\\|scripts\\|service/test\\)"; + excludedPackages = [ "_fixtures" "scripts" "service/test" ]; src = fetchFromGitHub { owner = "go-delve"; diff --git a/pkgs/development/tools/documentation/doxygen/default.nix b/pkgs/development/tools/documentation/doxygen/default.nix index a4a70dabd69..5a0807974ed 100644 --- a/pkgs/development/tools/documentation/doxygen/default.nix +++ b/pkgs/development/tools/documentation/doxygen/default.nix @@ -2,13 +2,13 @@ stdenv.mkDerivation rec { pname = "doxygen"; - version = "1.8.20"; + version = "1.9.3"; src = fetchFromGitHub { owner = "doxygen"; repo = "doxygen"; rev = "Release_${lib.replaceStrings [ "." ] [ "_" ] version}"; - sha256 = "17chvi3i80rj4750smpizf562xjzd2xcv5rfyh997pyvc1zbq5rh"; + sha256 = "1xfsv31ffrv03qhxlscav0r5mdi3qz4654ib9cq35rvmxfj999bw"; }; nativeBuildInputs = [ @@ -30,19 +30,20 @@ stdenv.mkDerivation rec { NIX_CFLAGS_COMPILE = lib.optionalString stdenv.isDarwin "-mmacosx-version-min=10.9"; - enableParallelBuilding = false; - meta = { license = lib.licenses.gpl2Plus; - homepage = "http://doxygen.nl/"; + homepage = "https://www.doxygen.nl/"; + changelog = "https://www.doxygen.nl/manual/changelog.html"; description = "Source code documentation generator tool"; longDescription = '' - Doxygen is a documentation system for C++, C, Java, Objective-C, - Python, IDL (CORBA and Microsoft flavors), Fortran, VHDL, PHP, - C\#, and to some extent D. It can generate an on-line - documentation browser (in HTML) and/or an off-line reference - manual (in LaTeX) from a set of documented source files. + Doxygen is the de facto standard tool for generating documentation from + annotated C++ sources, but it also supports other popular programming + languages such as C, Objective-C, C#, PHP, Java, Python, IDL (Corba, + Microsoft, and UNO/OpenOffice flavors), Fortran, VHDL and to some extent + D. It can generate an on-line documentation browser (in HTML) and/or an + off-line reference manual (in LaTeX) from a set of documented source + files. ''; platforms = if qt5 != null then lib.platforms.linux else lib.platforms.unix; diff --git a/pkgs/development/tools/gauge/default.nix b/pkgs/development/tools/gauge/default.nix index 1048ca19441..4a300df0577 100644 --- a/pkgs/development/tools/gauge/default.nix +++ b/pkgs/development/tools/gauge/default.nix @@ -4,7 +4,7 @@ buildGoModule rec { pname = "gauge"; version = "1.4.3"; - excludedPackages = ''\(build\|man\)''; + excludedPackages = [ "build" "man" ]; src = fetchFromGitHub { owner = "getgauge"; diff --git a/pkgs/development/tools/ginkgo/default.nix b/pkgs/development/tools/ginkgo/default.nix index 6719d710392..9985d43da2f 100644 --- a/pkgs/development/tools/ginkgo/default.nix +++ b/pkgs/development/tools/ginkgo/default.nix @@ -14,7 +14,7 @@ buildGoModule rec { # integration tests expect more file changes # types tests are missing CodeLocation - excludedPackages = "\\(integration\\|types\\)"; + excludedPackages = [ "integration" "types" ]; meta = with lib; { homepage = "https://onsi.github.io/ginkgo/"; diff --git a/pkgs/development/tools/go-motion/default.nix b/pkgs/development/tools/go-motion/default.nix index 9ece650f0cb..5004afc28e3 100644 --- a/pkgs/development/tools/go-motion/default.nix +++ b/pkgs/development/tools/go-motion/default.nix @@ -9,7 +9,6 @@ buildGoPackage rec { rev = "218875ebe23806e7af82f3b5b14bb3355534f679"; goPackagePath = "github.com/fatih/motion"; - excludedPackages = "testdata"; src = fetchFromGitHub { inherit rev; diff --git a/pkgs/development/tools/gocode-gomod/default.nix b/pkgs/development/tools/gocode-gomod/default.nix index fca346b78c4..c07d38b6073 100644 --- a/pkgs/development/tools/gocode-gomod/default.nix +++ b/pkgs/development/tools/gocode-gomod/default.nix @@ -9,8 +9,6 @@ buildGoModule rec { # standard packages. allowGoReference = true; - excludedPackages = "internal/suggest/testdata"; - src = fetchFromGitHub { owner = "stamblerre"; repo = "gocode"; diff --git a/pkgs/development/tools/gocode/default.nix b/pkgs/development/tools/gocode/default.nix index be9f70da934..687b69cf202 100644 --- a/pkgs/development/tools/gocode/default.nix +++ b/pkgs/development/tools/gocode/default.nix @@ -6,7 +6,6 @@ buildGoPackage rec { rev = "4acdcbdea79de6b3dee1c637eca5cbea0fdbe37c"; goPackagePath = "github.com/mdempsky/gocode"; - excludedPackages = "internal/suggest/testdata"; # we must allow references to the original `go` package, # because `gocode` needs to dig into $GOROOT to provide completions for the diff --git a/pkgs/development/tools/gogetdoc/default.nix b/pkgs/development/tools/gogetdoc/default.nix index 2a111a8d1ab..6f7c189ea9d 100644 --- a/pkgs/development/tools/gogetdoc/default.nix +++ b/pkgs/development/tools/gogetdoc/default.nix @@ -12,8 +12,6 @@ buildGoModule rec { doCheck = false; - excludedPackages = "\\(testdata\\)"; - src = fetchFromGitHub { inherit rev; diff --git a/pkgs/development/tools/golint/default.nix b/pkgs/development/tools/golint/default.nix index 3187f793127..aa6ce6c7cda 100644 --- a/pkgs/development/tools/golint/default.nix +++ b/pkgs/development/tools/golint/default.nix @@ -5,8 +5,6 @@ buildGoModule rec { version = "20201208-${lib.strings.substring 0 7 rev}"; rev = "83fdc39ff7b56453e3793356bcff3070b9b96445"; - excludedPackages = "testdata"; - # we must allow references to the original `go` package, as golint uses # compiler go/build package to load the packages it's linting. allowGoReference = true; diff --git a/pkgs/development/tools/gotools/default.nix b/pkgs/development/tools/gotools/default.nix index ea79baa96a7..9ea238233c3 100644 --- a/pkgs/development/tools/gotools/default.nix +++ b/pkgs/development/tools/gotools/default.nix @@ -38,9 +38,7 @@ buildGoModule rec { export GOTOOLDIR=$out/bin ''; - excludedPackages = "\\(" - + lib.concatStringsSep "\\|" ([ "testdata" "vet" "cover" ]) - + "\\)"; + excludedPackages = [ "vet" "cover" ]; # Set GOTOOLDIR for derivations adding this to buildInputs postInstall = '' diff --git a/pkgs/development/tools/govers/default.nix b/pkgs/development/tools/govers/default.nix index 5e2d89cfd5d..eb234c82fc0 100644 --- a/pkgs/development/tools/govers/default.nix +++ b/pkgs/development/tools/govers/default.nix @@ -1,16 +1,16 @@ -{ lib, buildGoPackage, fetchgit }: +{ lib, buildGoPackage, fetchFromGitHub }: buildGoPackage rec { pname = "govers"; - version = "20160623-${lib.strings.substring 0 7 rev}"; - rev = "77fd787551fc5e7ae30696e009e334d52d2d3a43"; + version = "unstable-2016-06-23"; goPackagePath = "github.com/rogpeppe/govers"; - src = fetchgit { - inherit rev; - url = "https://github.com/rogpeppe/govers"; - sha256 = "12w83vyi8mgn48fwdm2js693qcydimxapg8rk0yf01w0ab03r5wn"; + src = fetchFromGitHub { + owner = "rogpeppe"; + repo = "govers"; + rev = "77fd787551fc5e7ae30696e009e334d52d2d3a43"; + sha256 = "sha256-lpc8wFKAB+A8mBm9q3qNzTM8ktFS1MYdIvZVFP0eiIs="; }; dontRenameImports = true; diff --git a/pkgs/development/tools/ineffassign/default.nix b/pkgs/development/tools/ineffassign/default.nix index 21580957752..111048b562f 100644 --- a/pkgs/development/tools/ineffassign/default.nix +++ b/pkgs/development/tools/ineffassign/default.nix @@ -9,7 +9,6 @@ buildGoPackage rec { rev = "1003c8bd00dc2869cb5ca5282e6ce33834fed514"; goPackagePath = "github.com/gordonklaus/ineffassign"; - excludedPackages = "testdata"; src = fetchFromGitHub { inherit rev; diff --git a/pkgs/development/tools/interfacer/default.nix b/pkgs/development/tools/interfacer/default.nix deleted file mode 100644 index 4358ee24489..00000000000 --- a/pkgs/development/tools/interfacer/default.nix +++ /dev/null @@ -1,31 +0,0 @@ -{ buildGoPackage -, lib -, fetchFromGitHub -}: - -buildGoPackage rec { - pname = "interfacer-unstable"; - version = "2018-08-31"; - rev = "c20040233aedb03da82d460eca6130fcd91c629a"; - - goPackagePath = "mvdan.cc/interfacer"; - excludedPackages = "check/testdata"; - - src = fetchFromGitHub { - inherit rev; - - owner = "mvdan"; - repo = "interfacer"; - sha256 = "0cx4m74mvn200360pmsqxx4z0apk9fcknwwqh8r94zd3jfv4akq2"; - }; - - goDeps = ./deps.nix; - - meta = with lib; { - description = "A linter that suggests interface types"; - homepage = "https://github.com/mvdan/interfacer"; - license = licenses.bsd3; - maintainers = with maintainers; [ kalbasit ]; - platforms = platforms.linux ++ platforms.darwin; - }; -} diff --git a/pkgs/development/tools/interfacer/deps.nix b/pkgs/development/tools/interfacer/deps.nix deleted file mode 100644 index 6810950878b..00000000000 --- a/pkgs/development/tools/interfacer/deps.nix +++ /dev/null @@ -1,29 +0,0 @@ -[ - { - goPackagePath = "github.com/kisielk/gotool"; - fetch = { - type = "git"; - url = "https://github.com/kisielk/gotool"; - rev = "80517062f582ea3340cd4baf70e86d539ae7d84d"; - sha256 = "14af2pa0ssyp8bp2mvdw184s5wcysk6akil3wzxmr05wwy951iwn"; - }; - } - { - goPackagePath = "golang.org/x/tools"; - fetch = { - type = "git"; - url = "https://go.googlesource.com/tools"; - rev = "96e9e165b75e735822645eff82850b08c377be36"; - sha256 = "1zj9ck5sg9b0pphxybmvxf64hhcap7v7j37fx3v5aknf18crjjdg"; - }; - } - { - goPackagePath = "mvdan.cc/lint"; - fetch = { - type = "git"; - url = "https://github.com/mvdan/lint"; - rev = "adc824a0674b99099789b6188a058d485eaf61c0"; - sha256 = "17mi2rvkg9kzv1shxcyawzcj4jj3v738d1j82fp4yygx859yvr8r"; - }; - } -] diff --git a/pkgs/development/tools/kube-aws/default.nix b/pkgs/development/tools/kube-aws/default.nix deleted file mode 100644 index e095755df11..00000000000 --- a/pkgs/development/tools/kube-aws/default.nix +++ /dev/null @@ -1,36 +0,0 @@ -{ lib, fetchFromGitHub, buildGoPackage }: - -with lib; - -buildGoPackage rec { - pname = "kube-aws"; - version = "0.9.4"; - - goPackagePath = "github.com/coreos/kube-aws"; - - src = fetchFromGitHub { - owner = "coreos"; - repo = "kube-aws"; - rev = "v${version}"; - sha256 = "11h14fsnflbx76rmpp0fxahbxi2qgcamgyxy9s4rmw83j2m8csxp"; - }; - - preBuild = ''( - cd go/src/${goPackagePath} - go generate ./core/controlplane/config - go generate ./core/nodepool/config - go generate ./core/root/config - )''; - - ldflags = [ - "-X github.com/coreos/kube-aws/core/controlplane/cluster.VERSION=v${version}" - ]; - - meta = { - description = "Tool for deploying kubernetes on aws using coreos"; - license = licenses.asl20; - homepage = "https://github.com/coreos/coreos-kubernetes"; - maintainers = with maintainers; [offline]; - platforms = with platforms; unix; - }; -} diff --git a/pkgs/development/tools/misc/gef/default.nix b/pkgs/development/tools/misc/gef/default.nix index 0352ebc7cf3..b09cc795d8c 100644 --- a/pkgs/development/tools/misc/gef/default.nix +++ b/pkgs/development/tools/misc/gef/default.nix @@ -4,6 +4,7 @@ , makeWrapper , gdb , python3 +, bintools-unwrapped , file , ps , git @@ -39,7 +40,12 @@ in stdenv.mkDerivation rec { makeWrapper ${gdb}/bin/gdb $out/bin/gef \ --add-flags "-q -x $out/share/gef/gef.py" \ --set NIX_PYTHONPATH ${pythonPath} \ - --prefix PATH : ${lib.makeBinPath [ python3 file ps ]} + --prefix PATH : ${lib.makeBinPath [ + python3 + bintools-unwrapped # for readelf + file + ps + ]} ''; checkInputs = [ diff --git a/pkgs/development/tools/misc/grcov/default.nix b/pkgs/development/tools/misc/grcov/default.nix index 04ed4a1046b..2ca092fa659 100644 --- a/pkgs/development/tools/misc/grcov/default.nix +++ b/pkgs/development/tools/misc/grcov/default.nix @@ -2,16 +2,16 @@ rustPlatform.buildRustPackage rec { pname = "grcov"; - version = "0.8.8"; + version = "0.8.9"; src = fetchFromGitHub { owner = "mozilla"; repo = pname; rev = "v${version}"; - sha256 = "sha256-OITtZdI9d5zQVI02s5gJF9lWCjZZgE7YZRfFROU040o="; + sha256 = "sha256-VSjKZoK/o05kYX5mRCnaS6r/+4dZep9Bp9Im1Zw7piM="; }; - cargoSha256 = "sha256-AZVkS/huEsA1wdVB/xUGCCjY5AWJxaU1DD/OlEURw/c="; + cargoSha256 = "sha256-7I0BizeDbikpog0YG/X8vwoO4PGE1qYzRTWTr0RUQws="; # tests do not find grcov path correctly checkFlags = let diff --git a/pkgs/development/tools/misc/nix-bisect/default.nix b/pkgs/development/tools/misc/nix-bisect/default.nix new file mode 100644 index 00000000000..4075fe5ffbb --- /dev/null +++ b/pkgs/development/tools/misc/nix-bisect/default.nix @@ -0,0 +1,35 @@ +{ lib +, fetchFromGitHub +, python3 +}: + +let + pname = "nix-bisect"; + version = "0.4.1"; +in +python3.pkgs.buildPythonApplication { + inherit pname version; + format = "setuptools"; + + src = fetchFromGitHub { + owner = "timokau"; + repo = pname; + rev = "v${version}"; + hash = "sha256-01vj35mMakqKi5zbMIPQ+R8xdkOWbzpnigd3/SU+svw="; + }; + + propagatedBuildInputs = with python3.pkgs; [ + appdirs + numpy + pexpect + ]; + + doCheck = false; + + meta = with lib; { + description = "Bisect nix builds"; + homepage = "https://github.com/timokau/nix-bisect"; + license = licenses.mit; + maintainers = with maintainers; [ hexa ]; + }; +} diff --git a/pkgs/development/tools/misc/patchelf/default.nix b/pkgs/development/tools/misc/patchelf/default.nix index dcb4d2362c8..6919cd0f23f 100644 --- a/pkgs/development/tools/misc/patchelf/default.nix +++ b/pkgs/development/tools/misc/patchelf/default.nix @@ -7,11 +7,11 @@ stdenv.mkDerivation rec { pname = "patchelf"; - version = "0.14.3"; + version = "0.14.5"; src = fetchurl { url = "https://github.com/NixOS/${pname}/releases/download/${version}/${pname}-${version}.tar.bz2"; - sha256 = "sha256-oBfsPSFSoZ/ZacDYez+LQ+MqZuT/q9yHZ6VgYrmuwnA="; + sha256 = "sha256-uaRvKYkyLrifpPYjfiCDbFe0VapDoyVF6gk7Qx2YL1w="; }; setupHook = [ ./setup-hook.sh ]; diff --git a/pkgs/development/tools/misc/texinfo/6.8.nix b/pkgs/development/tools/misc/texinfo/6.8.nix index 11435bf329f..992f695bc92 100644 --- a/pkgs/development/tools/misc/texinfo/6.8.nix +++ b/pkgs/development/tools/misc/texinfo/6.8.nix @@ -1,4 +1,8 @@ import ./common.nix { version = "6.8"; sha256 = "1i7yb7mrp3inz25zbzv2pllr4y7d58v818f1as7iz8mw53nm7dwf"; + patches = [ + # glibc 2.34 compat + ./fix-glibc-2.34.patch + ]; } diff --git a/pkgs/development/tools/misc/texinfo/common.nix b/pkgs/development/tools/misc/texinfo/common.nix index b379df09a4b..26732657eb9 100644 --- a/pkgs/development/tools/misc/texinfo/common.nix +++ b/pkgs/development/tools/misc/texinfo/common.nix @@ -1,4 +1,4 @@ -{ version, sha256 }: +{ version, sha256, patches ? [] }: { lib, stdenv, buildPackages, fetchurl, perl, xz, gettext @@ -26,7 +26,7 @@ stdenv.mkDerivation { inherit sha256; }; - patches = optional crossBuildTools ./cross-tools-flags.patch; + patches = patches ++ optional crossBuildTools ./cross-tools-flags.patch; # ncurses is required to build `makedoc' # this feature is introduced by the ./cross-tools-flags.patch diff --git a/pkgs/development/tools/misc/texinfo/fix-glibc-2.34.patch b/pkgs/development/tools/misc/texinfo/fix-glibc-2.34.patch new file mode 100644 index 00000000000..60f2e63b7ce --- /dev/null +++ b/pkgs/development/tools/misc/texinfo/fix-glibc-2.34.patch @@ -0,0 +1,186 @@ + +Patch by Vitezslav Crhonek <vcrhonek@redhat.com> +Source: https://src.fedoraproject.org/rpms/texinfo/c/9b2cca4817fa4bd8d520fed05e9560fc7183dcdf?branch=rawhide + +diff -up texinfo-6.8/gnulib/lib/cdefs.h.orig texinfo-6.8/gnulib/lib/cdefs.h +--- texinfo-6.8/gnulib/lib/cdefs.h.orig 2021-03-11 19:57:53.000000000 +0100 ++++ texinfo-6.8/gnulib/lib/cdefs.h 2021-07-19 12:26:46.985176475 +0200 +@@ -321,15 +321,15 @@ + + /* The nonnull function attribute marks pointer parameters that + must not be NULL. */ +-#ifndef __attribute_nonnull__ ++#ifndef __nonnull + # if __GNUC_PREREQ (3,3) || __glibc_has_attribute (__nonnull__) +-# define __attribute_nonnull__(params) __attribute__ ((__nonnull__ params)) ++# define __nonnull(params) __attribute__ ((__nonnull__ params)) + # else +-# define __attribute_nonnull__(params) ++# define __nonnull(params) + # endif +-#endif +-#ifndef __nonnull +-# define __nonnull(params) __attribute_nonnull__ (params) ++#elif !defined __GLIBC__ ++# undef __nonnull ++# define __nonnull(params) _GL_ATTRIBUTE_NONNULL (params) + #endif + + /* If fortification mode, we warn about unused results of certain +diff -up texinfo-6.8/gnulib/lib/libc-config.h.orig texinfo-6.8/gnulib/lib/libc-config.h +--- texinfo-6.8/gnulib/lib/libc-config.h.orig 2021-03-11 19:57:54.000000000 +0100 ++++ texinfo-6.8/gnulib/lib/libc-config.h 2021-07-19 12:27:58.810590975 +0200 +@@ -33,9 +33,9 @@ + #include <config.h> + + /* On glibc this includes <features.h> and <sys/cdefs.h> and #defines +- _FEATURES_H, __WORDSIZE, and __set_errno. On FreeBSD 11 and +- DragonFlyBSD 5.9 it includes <sys/cdefs.h> which defines __nonnull. +- Elsewhere it is harmless. */ ++ _FEATURES_H, __WORDSIZE, and __set_errno. On FreeBSD 11 it ++ includes <sys/cdefs.h> which defines __nonnull. Elsewhere it ++ is harmless. */ + #include <errno.h> + + /* From glibc <errno.h>. */ +diff -up texinfo-6.8/gnulib/lib/malloc/dynarray-skeleton.c.orig texinfo-6.8/gnulib/lib/malloc/dynarray-skeleton.c +--- texinfo-6.8/gnulib/lib/malloc/dynarray-skeleton.c.orig 2021-03-11 19:57:54.000000000 +0100 ++++ texinfo-6.8/gnulib/lib/malloc/dynarray-skeleton.c 2021-07-19 12:24:46.878419397 +0200 +@@ -192,7 +192,7 @@ DYNARRAY_NAME (free__array__) (struct DY + + /* Initialize a dynamic array object. This must be called before any + use of the object. */ +-__attribute_nonnull__ ((1)) ++__nonnull ((1)) + static void + DYNARRAY_NAME (init) (struct DYNARRAY_STRUCT *list) + { +@@ -202,7 +202,7 @@ DYNARRAY_NAME (init) (struct DYNARRAY_ST + } + + /* Deallocate the dynamic array and its elements. */ +-__attribute_maybe_unused__ __attribute_nonnull__ ((1)) ++__attribute_maybe_unused__ __nonnull ((1)) + static void + DYNARRAY_FREE (struct DYNARRAY_STRUCT *list) + { +@@ -213,7 +213,7 @@ DYNARRAY_FREE (struct DYNARRAY_STRUCT *l + } + + /* Return true if the dynamic array is in an error state. */ +-__attribute_nonnull__ ((1)) ++__nonnull ((1)) + static inline bool + DYNARRAY_NAME (has_failed) (const struct DYNARRAY_STRUCT *list) + { +@@ -222,7 +222,7 @@ DYNARRAY_NAME (has_failed) (const struct + + /* Mark the dynamic array as failed. All elements are deallocated as + a side effect. */ +-__attribute_nonnull__ ((1)) ++__nonnull ((1)) + static void + DYNARRAY_NAME (mark_failed) (struct DYNARRAY_STRUCT *list) + { +@@ -236,7 +236,7 @@ DYNARRAY_NAME (mark_failed) (struct DYNA + + /* Return the number of elements which have been added to the dynamic + array. */ +-__attribute_nonnull__ ((1)) ++__nonnull ((1)) + static inline size_t + DYNARRAY_NAME (size) (const struct DYNARRAY_STRUCT *list) + { +@@ -245,7 +245,7 @@ DYNARRAY_NAME (size) (const struct DYNAR + + /* Return a pointer to the array element at INDEX. Terminate the + process if INDEX is out of bounds. */ +-__attribute_nonnull__ ((1)) ++__nonnull ((1)) + static inline DYNARRAY_ELEMENT * + DYNARRAY_NAME (at) (struct DYNARRAY_STRUCT *list, size_t index) + { +@@ -257,7 +257,7 @@ DYNARRAY_NAME (at) (struct DYNARRAY_STRU + /* Return a pointer to the first array element, if any. For a + zero-length array, the pointer can be NULL even though the dynamic + array has not entered the failure state. */ +-__attribute_nonnull__ ((1)) ++__nonnull ((1)) + static inline DYNARRAY_ELEMENT * + DYNARRAY_NAME (begin) (struct DYNARRAY_STRUCT *list) + { +@@ -267,7 +267,7 @@ DYNARRAY_NAME (begin) (struct DYNARRAY_S + /* Return a pointer one element past the last array element. For a + zero-length array, the pointer can be NULL even though the dynamic + array has not entered the failure state. */ +-__attribute_nonnull__ ((1)) ++__nonnull ((1)) + static inline DYNARRAY_ELEMENT * + DYNARRAY_NAME (end) (struct DYNARRAY_STRUCT *list) + { +@@ -294,7 +294,7 @@ DYNARRAY_NAME (add__) (struct DYNARRAY_S + /* Add ITEM at the end of the array, enlarging it by one element. + Mark *LIST as failed if the dynamic array allocation size cannot be + increased. */ +-__attribute_nonnull__ ((1)) ++__nonnull ((1)) + static inline void + DYNARRAY_NAME (add) (struct DYNARRAY_STRUCT *list, DYNARRAY_ELEMENT item) + { +@@ -348,8 +348,7 @@ DYNARRAY_NAME (emplace__) (struct DYNARR + /* Allocate a place for a new element in *LIST and return a pointer to + it. The pointer can be NULL if the dynamic array cannot be + enlarged due to a memory allocation failure. */ +-__attribute_maybe_unused__ __attribute_warn_unused_result__ +-__attribute_nonnull__ ((1)) ++__attribute_maybe_unused__ __attribute_warn_unused_result__ __nonnull ((1)) + static + /* Avoid inlining with the larger initialization code. */ + #if !(defined (DYNARRAY_ELEMENT_INIT) || defined (DYNARRAY_ELEMENT_FREE)) +@@ -373,7 +372,7 @@ DYNARRAY_NAME (emplace) (struct DYNARRAY + existing size, new elements are added (which can be initialized). + Otherwise, the list is truncated, and elements are freed. Return + false on memory allocation failure (and mark *LIST as failed). */ +-__attribute_maybe_unused__ __attribute_nonnull__ ((1)) ++__attribute_maybe_unused__ __nonnull ((1)) + static bool + DYNARRAY_NAME (resize) (struct DYNARRAY_STRUCT *list, size_t size) + { +@@ -418,7 +417,7 @@ DYNARRAY_NAME (resize) (struct DYNARRAY_ + } + + /* Remove the last element of LIST if it is present. */ +-__attribute_maybe_unused__ __attribute_nonnull__ ((1)) ++__attribute_maybe_unused__ __nonnull ((1)) + static void + DYNARRAY_NAME (remove_last) (struct DYNARRAY_STRUCT *list) + { +@@ -435,7 +434,7 @@ DYNARRAY_NAME (remove_last) (struct DYNA + + /* Remove all elements from the list. The elements are freed, but the + list itself is not. */ +-__attribute_maybe_unused__ __attribute_nonnull__ ((1)) ++__attribute_maybe_unused__ __nonnull ((1)) + static void + DYNARRAY_NAME (clear) (struct DYNARRAY_STRUCT *list) + { +@@ -453,8 +452,7 @@ DYNARRAY_NAME (clear) (struct DYNARRAY_S + stored in *RESULT if LIST refers to an empty list. On success, the + pointer in *RESULT is heap-allocated and must be deallocated using + free. */ +-__attribute_maybe_unused__ __attribute_warn_unused_result__ +-__attribute_nonnull__ ((1, 2)) ++__attribute_maybe_unused__ __attribute_warn_unused_result__ __nonnull ((1, 2)) + static bool + DYNARRAY_NAME (finalize) (struct DYNARRAY_STRUCT *list, + DYNARRAY_FINAL_TYPE *result) +@@ -485,8 +483,7 @@ DYNARRAY_NAME (finalize) (struct DYNARRA + have a sentinel at the end). If LENGTHP is not NULL, the array + length is written to *LENGTHP. *LIST is re-initialized and can be + reused. */ +-__attribute_maybe_unused__ __attribute_warn_unused_result__ +-__attribute_nonnull__ ((1)) ++__attribute_maybe_unused__ __attribute_warn_unused_result__ __nonnull ((1)) + static DYNARRAY_ELEMENT * + DYNARRAY_NAME (finalize) (struct DYNARRAY_STRUCT *list, size_t *lengthp) + { diff --git a/pkgs/development/tools/neil/default.nix b/pkgs/development/tools/neil/default.nix index 643ca8773cb..c0d1ec44f9e 100644 --- a/pkgs/development/tools/neil/default.nix +++ b/pkgs/development/tools/neil/default.nix @@ -7,13 +7,13 @@ stdenv.mkDerivation rec { pname = "neil"; - version = "0.0.13"; + version = "0.0.23"; src = fetchFromGitHub { owner = "babashka"; repo = "neil"; rev = "v${version}"; - sha256 = "0jiyl0d39d8kk5bpangwxiy90vqipj4lgp8x84rh4z5m53knjpkd"; + sha256 = "0fx34gkhkklzq3hzk1cj2l4rgqrq9vif5y8b0nx9gg4136yj85cg"; }; nativeBuildInputs = [ makeWrapper ]; diff --git a/pkgs/development/tools/phantomjs2/default.nix b/pkgs/development/tools/phantomjs2/default.nix index d9e4ec1fb19..5093553824d 100644 --- a/pkgs/development/tools/phantomjs2/default.nix +++ b/pkgs/development/tools/phantomjs2/default.nix @@ -25,11 +25,10 @@ in stdenv.mkDerivation rec { sha256 = "1zsbpk1sgh9a16f1a5nx3qvk77ibjn812wqkxqck8n6fia85m5iq"; }; - nativeBuildInputs = [ qmake ]; + nativeBuildInputs = [ qmake makeWrapper ]; buildInputs = [ bison flex fontconfig freetype gperf icu openssl libjpeg libpng perl python2 ruby sqlite qtwebkit qtbase - makeWrapper ] ++ lib.optionals stdenv.isDarwin (with darwin.apple_sdk.frameworks; [ AGL ApplicationServices AppKit Cocoa OpenGL darwin.libobjc fakeClang cups diff --git a/pkgs/development/tools/reftools/default.nix b/pkgs/development/tools/reftools/default.nix index a31108f3381..0e8371e4a01 100644 --- a/pkgs/development/tools/reftools/default.nix +++ b/pkgs/development/tools/reftools/default.nix @@ -12,7 +12,7 @@ buildGoModule rec { doCheck = false; - excludedPackages = "\\(cmd/fillswitch/test-fixtures\\)"; + excludedPackages = "cmd/fillswitch/test-fixtures"; src = fetchFromGitHub { inherit rev; diff --git a/pkgs/development/tools/rust/cargo-flash/default.nix b/pkgs/development/tools/rust/cargo-flash/default.nix index 0f90f480043..49e9bbaceb5 100644 --- a/pkgs/development/tools/rust/cargo-flash/default.nix +++ b/pkgs/development/tools/rust/cargo-flash/default.nix @@ -10,16 +10,16 @@ rustPlatform.buildRustPackage rec { pname = "cargo-flash"; - version = "0.12.0"; + version = "0.12.1"; src = fetchFromGitHub { owner = "probe-rs"; repo = pname; rev = "v${version}"; - sha256 = "0s49q8x0iscy9rgn9zgymyg39cqm251a99m341znjn55lap3pdl8"; + sha256 = "sha256-bd0TY8bdpLHLCdDQgJeJvqjAcSF67+LGSNx8yafYbys="; }; - cargoSha256 = "0rb4s5bwjs7hri636r2viva96a6z9qjv9if6i220j9yglrvi7c8i"; + cargoSha256 = "sha256-bx2N8zP7BmqU6oM/7Nf2i9S1uNWItReQMD59vtG1RKE="; nativeBuildInputs = [ pkg-config rustfmt ]; buildInputs = [ libusb1 ] ++ lib.optionals stdenv.isDarwin [ AppKit ]; diff --git a/pkgs/development/tools/sentry-cli/default.nix b/pkgs/development/tools/sentry-cli/default.nix index 2fb0f1ebbeb..0ba8e3b3d31 100644 --- a/pkgs/development/tools/sentry-cli/default.nix +++ b/pkgs/development/tools/sentry-cli/default.nix @@ -9,13 +9,13 @@ }: rustPlatform.buildRustPackage rec { pname = "sentry-cli"; - version = "1.74.2"; + version = "1.74.3"; src = fetchFromGitHub { owner = "getsentry"; repo = "sentry-cli"; rev = version; - sha256 = "sha256-1A/c5HiXtT6xUTxVInv9DbbCsqpu8iCJ7I0A9wFeaQ0="; + sha256 = "sha256-savbS/1j6PJqmkk6c+XMOUEkrLZNU2p0YbN8rHfz2po="; }; doCheck = false; @@ -25,7 +25,7 @@ rustPlatform.buildRustPackage rec { buildInputs = [ openssl ] ++ lib.optionals stdenv.isDarwin [ Security SystemConfiguration ]; nativeBuildInputs = [ pkg-config ]; - cargoSha256 = "sha256-z++t+Zt40az11z/xhobvvbbSNUBpnMzqlRzoOuYgY2U="; + cargoSha256 = "sha256-7B8cmrDYufhlIMv2r6TSD+C8NLE2Juewgy4XYYr+QKs="; meta = with lib; { homepage = "https://docs.sentry.io/cli/"; diff --git a/pkgs/development/tools/skaffold/default.nix b/pkgs/development/tools/skaffold/default.nix index 4f286cb22d7..0a7a1823baa 100644 --- a/pkgs/development/tools/skaffold/default.nix +++ b/pkgs/development/tools/skaffold/default.nix @@ -2,13 +2,13 @@ buildGoModule rec { pname = "skaffold"; - version = "1.37.0"; + version = "1.37.1"; src = fetchFromGitHub { owner = "GoogleContainerTools"; repo = "skaffold"; rev = "v${version}"; - sha256 = "sha256-mS+q+WOdEMMHjoqoIlDOqkoaRRLlou7FbMjC436k96A="; + sha256 = "sha256-hcP0BGzPQoYGvK+5Ro9Ts5882JhQYRT63mdTJbXhnzg="; }; vendorSha256 = "sha256-LiNnTAI7iJkWL657eBw5OsCdvgWE2ZFZ3e+8vJtMhoE="; diff --git a/pkgs/development/tools/skopeo/default.nix b/pkgs/development/tools/skopeo/default.nix index 6618c024851..c25a27e6d95 100644 --- a/pkgs/development/tools/skopeo/default.nix +++ b/pkgs/development/tools/skopeo/default.nix @@ -10,6 +10,7 @@ , installShellFiles , makeWrapper , fuse-overlayfs +, dockerTools }: buildGoModule rec { @@ -53,6 +54,10 @@ buildGoModule rec { runHook postInstall ''; + passthru.tests = { + inherit (dockerTools.examples) testNixFromDockerHub; + }; + meta = with lib; { description = "A command line utility for various operations on container images and image repositories"; homepage = "https://github.com/containers/skopeo"; diff --git a/pkgs/games/bugdom/default.nix b/pkgs/games/bugdom/default.nix new file mode 100644 index 00000000000..57a1e414090 --- /dev/null +++ b/pkgs/games/bugdom/default.nix @@ -0,0 +1,44 @@ +{ lib, stdenv, fetchFromGitHub, SDL2, cmake, makeWrapper }: + +stdenv.mkDerivation rec { + pname = "bugdom"; + version = "1.3.1"; + + src = fetchFromGitHub { + owner = "jorio"; + repo = pname; + rev = version; + sha256 = "sha256:1371inw11rzfrxmc3v4gv5axp56bxjbcr0mhqm4x839401bfq5mf"; + fetchSubmodules = true; + }; + + buildInputs = [ + SDL2 + ]; + + nativeBuildInputs = [ + cmake + makeWrapper + ]; + + installPhase = '' + runHook preInstall + + mkdir -p $out/share/bugdom + mv Data $out/share/bugdom + install -Dm755 {.,$out/bin}/Bugdom + wrapProgram $out/bin/Bugdom --run "cd $out/share/bugdom" + + runHook postInstall + ''; + + meta = with lib; { + description = "A port of Bugdom, a 1999 Macintosh game by Pangea Software, for modern operating systems"; + homepage = "https://github.com/jorio/Bugdom"; + license = with licenses; [ + cc-by-sa-40 + ]; + maintainers = with maintainers; [ lux ]; + platforms = platforms.linux; + }; +} diff --git a/pkgs/games/cataclysm-dda/common.nix b/pkgs/games/cataclysm-dda/common.nix index 1701d84e8df..af20169a6e0 100644 --- a/pkgs/games/cataclysm-dda/common.nix +++ b/pkgs/games/cataclysm-dda/common.nix @@ -49,7 +49,7 @@ stdenv.mkDerivation { ''; makeFlags = [ - "PREFIX=$(out)" "LANGUAGES=all" + "PREFIX=$(out)" "LANGUAGES=all" "RUNTESTS=0" (if useXdgDir then "USE_XDG_DIR=1" else "USE_HOME_DIR=1") ] ++ optionals (!debug) [ "RELEASE=1" diff --git a/pkgs/games/nethack/default.nix b/pkgs/games/nethack/default.nix index 2b29bddad93..f6de3d57c13 100644 --- a/pkgs/games/nethack/default.nix +++ b/pkgs/games/nethack/default.nix @@ -1,4 +1,4 @@ -{ stdenv, lib, fetchurl, coreutils, ncurses, gzip, flex, bison +{ stdenv, lib, fetchurl, coreutils, ncurses, gzip, flex, bison, fetchpatch , less , buildPackages , x11Mode ? false, qtMode ? false, libXaw, libXext, libXpm, bdftopcf, mkfontdir, pkg-config, qt5 @@ -24,6 +24,15 @@ in stdenv.mkDerivation rec { else if qtMode then "nethack-qt" else "nethack"; + patches = [ + # Don't unset `__warn_unused_result__`, breaks on glibc-2.34 + (fetchpatch { + url = "https://github.com/NetHack/NetHack/commit/81d73ce417dda6a98e2e918e06922e68b67c53f7.patch"; + sha256 = "sha256-PX9XtJTEE3K1yg/IwIzEIT+EZWi02gU+9msrsG9ZWQY="; + revert = true; + }) + ]; + src = fetchurl { url = "https://nethack.org/download/${version}/nethack-${lib.replaceStrings ["."] [""] version}-src.tgz"; sha256 = "1liyckjp34j354qnxc1zn9730lh1p2dabrg1hap24z6xnqx0rpng"; diff --git a/pkgs/games/openmw/default.nix b/pkgs/games/openmw/default.nix index edc8147a2b7..8746d3172ac 100644 --- a/pkgs/games/openmw/default.nix +++ b/pkgs/games/openmw/default.nix @@ -83,5 +83,10 @@ mkDerivation rec { license = licenses.gpl3Plus; maintainers = with maintainers; [ abbradar marius851000 ]; platforms = platforms.linux; + + # 2021-10-13, doesn't compile with glibc-2.34, maintainers prefer a fix on glibc's end. + # Can be marked as un-broken as soon as https://gitlab.com/OpenMW/openmw/-/merge_requests/1239 + # is resolved and a patch is appliable here. + broken = true; }; } diff --git a/pkgs/games/steam/fhsenv.nix b/pkgs/games/steam/fhsenv.nix index c5fba68b22a..d18accd0d54 100644 --- a/pkgs/games/steam/fhsenv.nix +++ b/pkgs/games/steam/fhsenv.nix @@ -206,12 +206,6 @@ in buildFHSUserEnv rec { ++ steamPackages.steam-runtime-wrapped.overridePkgs ++ extraLibraries pkgs; - extraBuildCommands = '' - ln -s /usr/lib/libbz2.so usr/lib/libbz2.so.1.0 - '' + lib.optionalString (steam-runtime-wrapped-i686 != null) '' - ln -s /usr/lib32/libbz2.so usr/lib32/libbz2.so.1.0 - ''; - extraInstallCommands = '' mkdir -p $out/share/applications ln -s ${steam}/share/icons $out/share @@ -269,7 +263,7 @@ in buildFHSUserEnv rec { name = "steam-run"; targetPkgs = commonTargetPkgs; - inherit multiPkgs extraBuildCommands profile extraInstallCommands; + inherit multiPkgs profile extraInstallCommands; inherit unshareIpc unsharePid; diff --git a/pkgs/misc/ghostscript/default.nix b/pkgs/misc/ghostscript/default.nix index e80ad8a839f..327cf286234 100644 --- a/pkgs/misc/ghostscript/default.nix +++ b/pkgs/misc/ghostscript/default.nix @@ -29,11 +29,11 @@ let in stdenv.mkDerivation rec { - pname = "ghostscript"; + pname = "ghostscript${lib.optionalString (x11Support) "-with-X"}"; version = "9.55.0"; src = fetchurl { - url = "https://github.com/ArtifexSoftware/ghostpdl-downloads/releases/download/gs9${lib.versions.minor version}${lib.versions.patch version}/${pname}-${version}.tar.xz"; + url = "https://github.com/ArtifexSoftware/ghostpdl-downloads/releases/download/gs9${lib.versions.minor version}${lib.versions.patch version}/ghostscript-${version}.tar.xz"; sha512 = "27g72152mlwlalg232jxdhaf3ykgmqwi2pccbkwfygql1h9iz40plfbwbs1n0fkvm4zwzg5r9cr8g7w2dxih4jldiidv7rflxdy1is2"; }; diff --git a/pkgs/os-specific/darwin/apple-sdk-11.0/frameworks.nix b/pkgs/os-specific/darwin/apple-sdk-11.0/frameworks.nix index 96c0475c087..e9121b02116 100644 --- a/pkgs/os-specific/darwin/apple-sdk-11.0/frameworks.nix +++ b/pkgs/os-specific/darwin/apple-sdk-11.0/frameworks.nix @@ -89,6 +89,8 @@ IOBluetooth = { inherit CoreBluetooth IOKit; }; IOBluetoothUI = { inherit IOBluetooth; }; IOKit = {}; + # `IOSurface` should depend on `Libsystem` (in place of `xpc`) but this currently causes build + # issues due to incompatibility issues between `Libsystem` and `libcxx`. IOSurface = { inherit IOKit xpc; }; IOUSBHost = {}; IdentityLookup = {}; diff --git a/pkgs/os-specific/linux/apfs/default.nix b/pkgs/os-specific/linux/apfs/default.nix index 98fd83ed5d5..eedaa9ef968 100644 --- a/pkgs/os-specific/linux/apfs/default.nix +++ b/pkgs/os-specific/linux/apfs/default.nix @@ -6,13 +6,13 @@ stdenv.mkDerivation { pname = "apfs"; - version = "unstable-2021-09-21-${kernel.version}"; + version = "unstable-2022-02-03-${kernel.version}"; src = fetchFromGitHub { owner = "linux-apfs"; repo = "linux-apfs-rw"; - rev = "362c4e32ab585b9234a26aa3e49f29b605612a31"; - sha256 = "sha256-Y8/PGPLirNrICF+Bum60v/DBPa1xpox5VBvt64myZzs="; + rev = "a0d6a4dca69b6eab3cabaaee4d4284807828a266"; + sha256 = "sha256-3T1BNc6g3SDTxb0VrronLUIp/CWbwnzXTsc8Qk5c4jY="; }; hardeningDisable = [ "pic" ]; diff --git a/pkgs/os-specific/linux/apparmor/default.nix b/pkgs/os-specific/linux/apparmor/default.nix index 5c1cf272e0e..a7afd838624 100644 --- a/pkgs/os-specific/linux/apparmor/default.nix +++ b/pkgs/os-specific/linux/apparmor/default.nix @@ -1,4 +1,4 @@ -{ stdenv, lib, fetchurl, fetchpatch, makeWrapper, autoreconfHook +{ stdenv, lib, fetchFromGitLab, fetchpatch, makeWrapper, autoreconfHook , pkg-config, which , flex, bison , linuxHeaders ? stdenv.cc.libc.linuxHeaders @@ -21,7 +21,7 @@ }: let - apparmor-version = "3.0.3"; + apparmor-version = "3.0.4"; apparmor-meta = component: with lib; { homepage = "https://apparmor.net/"; @@ -31,9 +31,11 @@ let platforms = platforms.linux; }; - apparmor-sources = fetchurl { - url = "https://launchpad.net/apparmor/${lib.versions.majorMinor apparmor-version}/${apparmor-version}/+download/apparmor-${apparmor-version}.tar.gz"; - sha256 = "0nasq8pdmzkrf856yg1v8z5hcs0nn6gw2qr60ab0a7j9ixfv0g8m"; + apparmor-sources = fetchFromGitLab { + owner = "apparmor"; + repo = "apparmor"; + rev = "v${apparmor-version}"; + sha256 = "1a217j28rgfq4lsmpn0wv1xgmdr9ba8iysv9i6q477kj6z77zrb9"; }; aa-teardown = writeShellScript "aa-teardown" '' @@ -48,8 +50,9 @@ let substituteInPlace ./common/Make.rules \ --replace "/usr/bin/pod2man" "${buildPackages.perl}/bin/pod2man" \ --replace "/usr/bin/pod2html" "${buildPackages.perl}/bin/pod2html" \ - --replace "/usr/include/linux/capability.h" "${linuxHeaders}/include/linux/capability.h" \ --replace "/usr/share/man" "share/man" + substituteInPlace ./utils/Makefile \ + --replace "/usr/include/linux/capability.h" "${linuxHeaders}/include/linux/capability.h" ''; patches = lib.optionals stdenv.hostPlatform.isMusl [ @@ -60,6 +63,8 @@ let }) ]; + python = python3.withPackages (ps: with ps; [ setuptools ]); + # Set to `true` after the next FIXME gets fixed or this gets some # common derivation infra. Too much copy-paste to fix one by one. doCheck = false; @@ -86,19 +91,16 @@ let ncurses which perl - ] ++ lib.optional withPython python3; + ] ++ lib.optional withPython python; buildInputs = lib.optional withPerl perl - ++ lib.optional withPython python3; + ++ lib.optional withPython python; # required to build apparmor-parser dontDisableStatic = true; prePatch = prePatchCommon + '' substituteInPlace ./libraries/libapparmor/swig/perl/Makefile.am --replace install_vendor install_site - substituteInPlace ./libraries/libapparmor/swig/perl/Makefile.in --replace install_vendor install_site - substituteInPlace ./libraries/libapparmor/src/Makefile.am --replace "/usr/include/netinet/in.h" "${lib.getDev stdenv.cc.libc}/include/netinet/in.h" - substituteInPlace ./libraries/libapparmor/src/Makefile.in --replace "/usr/include/netinet/in.h" "${lib.getDev stdenv.cc.libc}/include/netinet/in.h" ''; inherit patches; @@ -132,12 +134,12 @@ let strictDeps = true; - nativeBuildInputs = [ makeWrapper which python3 ]; + nativeBuildInputs = [ makeWrapper which python ]; buildInputs = [ bash perl - python3 + python libapparmor libapparmor.python ]; @@ -159,7 +161,7 @@ let postInstall = '' sed -i $out/bin/aa-unconfined -e "/my_env\['PATH'\]/d" for prog in aa-audit aa-autodep aa-cleanprof aa-complain aa-disable aa-enforce aa-genprof aa-logprof aa-mergeprof aa-unconfined ; do - wrapProgram $out/bin/$prog --prefix PYTHONPATH : "$out/lib/${python3.libPrefix}/site-packages:$PYTHONPATH" + wrapProgram $out/bin/$prog --prefix PYTHONPATH : "$out/lib/${python.sitePackages}:$PYTHONPATH" done substituteInPlace $out/bin/aa-notify \ diff --git a/pkgs/os-specific/linux/autofs/default.nix b/pkgs/os-specific/linux/autofs/default.nix index 7b29f5a0e5c..5e552301fe4 100644 --- a/pkgs/os-specific/linux/autofs/default.nix +++ b/pkgs/os-specific/linux/autofs/default.nix @@ -1,5 +1,7 @@ { lib, stdenv, fetchurl, flex, bison, linuxHeaders, libtirpc, mount, umount, nfs-utils, e2fsprogs -, libxml2, libkrb5, kmod, openldap, sssd, cyrus_sasl, openssl, rpcsvc-proto }: +, libxml2, libkrb5, kmod, openldap, sssd, cyrus_sasl, openssl, rpcsvc-proto +, fetchpatch +}: stdenv.mkDerivation rec { version = "5.1.6"; @@ -10,6 +12,15 @@ stdenv.mkDerivation rec { sha256 = "1vya21mb4izj3khcr3flibv7xc15vvx2v0rjfk5yd31qnzcy7pnx"; }; + patches = [ + # glibc 2.34 compat + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/autofs/raw/cc745af5e42396d540d5b3b92fae486e232bf6bd/f/autofs-5.1.7-use-default-stack-size-for-threads.patch"; + sha256 = "sha256-6ETDFbW7EhHR03xFWF+6OJBgn9NX3WW3bGhTNGodaOc="; + excludes = [ "CHANGELOG" ]; + }) + ]; + preConfigure = '' configureFlags="--enable-force-shutdown --enable-ignore-busy --with-path=$PATH" export sssldir="${sssd}/lib/sssd/modules" diff --git a/pkgs/os-specific/linux/busybox/default.nix b/pkgs/os-specific/linux/busybox/default.nix index 7aaedb5b1ac..970129f9739 100644 --- a/pkgs/os-specific/linux/busybox/default.nix +++ b/pkgs/os-specific/linux/busybox/default.nix @@ -65,6 +65,16 @@ stdenv.mkDerivation rec { patches = [ ./busybox-in-store.patch + (fetchurl { + name = "CVE-2022-28391.patch"; + url = "https://git.alpinelinux.org/aports/plain/main/busybox/0001-libbb-sockaddr2str-ensure-only-printable-characters-.patch?id=ed92963eb55bbc8d938097b9ccb3e221a94653f4"; + sha256 = "sha256-yviw1GV+t9tbHbY7YNxEqPi7xEreiXVqbeRyf8c6Awo="; + }) + (fetchurl { + name = "CVE-2022-28391.patch"; + url = "https://git.alpinelinux.org/aports/plain/main/busybox/0002-nslookup-sanitize-all-printed-strings-with-printable.patch?id=ed92963eb55bbc8d938097b9ccb3e221a94653f4"; + sha256 = "sha256-vl1wPbsHtXY9naajjnTicQ7Uj3N+EQ8pRNnrdsiow+w="; + }) ] ++ lib.optional (stdenv.hostPlatform != stdenv.buildPlatform) ./clang-cross.patch; separateDebugInfo = true; diff --git a/pkgs/os-specific/linux/conky/default.nix b/pkgs/os-specific/linux/conky/default.nix index 9bd8890e713..87f5bb052f4 100644 --- a/pkgs/os-specific/linux/conky/default.nix +++ b/pkgs/os-specific/linux/conky/default.nix @@ -1,7 +1,7 @@ { config, lib, stdenv, fetchFromGitHub, pkg-config, cmake # dependencies -, glib, libXinerama +, glib, libXinerama, catch2 # optional features without extra dependencies , mpdSupport ? true @@ -85,6 +85,8 @@ stdenv.mkDerivation rec { sed -i 's/ Example: .*$//' doc/config_settings.xml substituteInPlace cmake/Conky.cmake --replace "# set(RELEASE true)" "set(RELEASE true)" + + cp ${catch2}/include/catch2/catch.hpp tests/catch2/catch.hpp ''; NIX_LDFLAGS = "-lgcc_s"; @@ -133,6 +135,8 @@ stdenv.mkDerivation rec { # src/conky.cc:137:23: fatal error: defconfig.h: No such file or directory enableParallelBuilding = false; + doCheck = true; + meta = with lib; { homepage = "http://conky.sourceforge.net/"; description = "Advanced, highly configurable system monitor based on torsmo"; diff --git a/pkgs/os-specific/linux/cryptsetup/default.nix b/pkgs/os-specific/linux/cryptsetup/default.nix index a9bd508d16e..be819802394 100644 --- a/pkgs/os-specific/linux/cryptsetup/default.nix +++ b/pkgs/os-specific/linux/cryptsetup/default.nix @@ -5,7 +5,7 @@ stdenv.mkDerivation rec { pname = "cryptsetup"; version = "2.4.3"; - outputs = [ "out" "dev" "man" ]; + outputs = [ "bin" "out" "dev" "man" ]; separateDebugInfo = true; src = fetchurl { @@ -31,6 +31,12 @@ stdenv.mkDerivation rec { "--enable-cryptsetup-reencrypt" "--with-crypto_backend=openssl" "--disable-ssh-token" + ] ++ lib.optionals stdenv.hostPlatform.isStatic [ + "--disable-external-tokens" + # We have to override this even though we're removing token + # support, because the path still gets included in the binary even + # though it isn't used. + "--with-luks2-external-tokens-path=/" ]; nativeBuildInputs = [ pkg-config ]; diff --git a/pkgs/os-specific/linux/ell/default.nix b/pkgs/os-specific/linux/ell/default.nix index aa8e3f15aab..d79201cc4cd 100644 --- a/pkgs/os-specific/linux/ell/default.nix +++ b/pkgs/os-specific/linux/ell/default.nix @@ -7,14 +7,14 @@ stdenv.mkDerivation rec { pname = "ell"; - version = "0.46"; + version = "0.49"; outputs = [ "out" "dev" ]; src = fetchgit { url = "https://git.kernel.org/pub/scm/libs/ell/ell.git"; rev = version; - sha256 = "sha256-Am1PNFFfSzII4Iaeq0wgfuVHSeMDjiDzYkNQWlnEHJY="; + sha256 = "sha256-/5ivelqRDvJuPVJqMs27VJUIq7/Dw6ROt/cmjSo309s="; }; nativeBuildInputs = [ diff --git a/pkgs/os-specific/linux/fuse/common.nix b/pkgs/os-specific/linux/fuse/common.nix index 7b9b35614a4..ac4deb19f51 100644 --- a/pkgs/os-specific/linux/fuse/common.nix +++ b/pkgs/os-specific/linux/fuse/common.nix @@ -31,7 +31,13 @@ in stdenv.mkDerivation rec { }) ++ (if isFuse3 then [ ./fuse3-install.patch ./fuse3-Do-not-set-FUSERMOUNT_DIR.patch ] - else [ ./fuse2-Do-not-set-FUSERMOUNT_DIR.patch ]); + else [ + ./fuse2-Do-not-set-FUSERMOUNT_DIR.patch + (fetchpatch { + url = "https://gitweb.gentoo.org/repo/gentoo.git/plain/sys-fs/fuse/files/fuse-2.9.9-closefrom-glibc-2-34.patch?id=8a970396fca7aca2d5a761b8e7a8242f1eef14c9"; + sha256 = "sha256-ELYBW/wxRcSMssv7ejCObrpsJHtOPJcGq33B9yHQII4="; + }) + ]); nativeBuildInputs = if isFuse3 then [ meson ninja pkg-config ] diff --git a/pkgs/os-specific/linux/iwd/default.nix b/pkgs/os-specific/linux/iwd/default.nix index 72ecaffe5f5..19f4301ff53 100644 --- a/pkgs/os-specific/linux/iwd/default.nix +++ b/pkgs/os-specific/linux/iwd/default.nix @@ -12,12 +12,12 @@ stdenv.mkDerivation rec { pname = "iwd"; - version = "1.20"; + version = "1.25"; src = fetchgit { url = "https://git.kernel.org/pub/scm/network/wireless/iwd.git"; rev = version; - sha256 = "sha256-GcqmMqrZSgvSrsY8FJbPynNWTzSi5A6kmyq+xJ+2i3Y="; + sha256 = "sha256-3IiRuILU2FKzXAQ0Q79DX2+nlNMcHNanS8m9GqjBBnU="; }; outputs = [ "out" "man" "doc" ] @@ -59,6 +59,7 @@ stdenv.mkDerivation rec { postUnpack = '' mkdir -p iwd/ell ln -s ${ell.src}/ell/useful.h iwd/ell/useful.h + ln -s ${ell.src}/ell/asn1-private.h iwd/ell/asn1-private.h patchShebangs . ''; diff --git a/pkgs/os-specific/linux/kernel/common-config.nix b/pkgs/os-specific/linux/kernel/common-config.nix index 153b41194b8..fdf54d302bf 100644 --- a/pkgs/os-specific/linux/kernel/common-config.nix +++ b/pkgs/os-specific/linux/kernel/common-config.nix @@ -448,6 +448,9 @@ let NLS_CODEPAGE_437 = module; # VFAT default for the codepage= mount option NLS_ISO8859_1 = module; # VFAT default for the iocharset= mount option + # Needed to use the installation iso image. Not included in all defconfigs (e.g. arm64) + ISO9660_FS = module; + DEVTMPFS = yes; UNICODE = whenAtLeast "5.2" yes; # Casefolding support for filesystems @@ -906,6 +909,11 @@ let ANDROID_BINDER_IPC = { optional = true; tristate = whenAtLeast "5.0" "y";}; ANDROID_BINDERFS = { optional = true; tristate = whenAtLeast "5.0" "y";}; ANDROID_BINDER_DEVICES = { optional = true; freeform = whenAtLeast "5.0" "binder,hwbinder,vndbinder";}; + + TASKSTATS = yes; + TASK_DELAY_ACCT = yes; + TASK_XACCT = yes; + TASK_IO_ACCOUNTING = yes; } // optionalAttrs (stdenv.hostPlatform.system == "x86_64-linux" || stdenv.hostPlatform.system == "aarch64-linux") { # Enable CPU/memory hotplug support # Allows you to dynamically add & remove CPUs/memory to a VM client running NixOS without requiring a reboot diff --git a/pkgs/os-specific/linux/kernel/generate-config.pl b/pkgs/os-specific/linux/kernel/generate-config.pl index df807188f14..7e12ca5d96a 100644 --- a/pkgs/os-specific/linux/kernel/generate-config.pl +++ b/pkgs/os-specific/linux/kernel/generate-config.pl @@ -81,7 +81,7 @@ sub runConfig { my $question = $1; my $name = $2; my $alts = $3; my $answer = ""; # Build everything as a module if possible. - $answer = "m" if $autoModules && $alts =~ /\/m/ && !($preferBuiltin && $alts =~ /Y/); + $answer = "m" if $autoModules && $alts =~ qr{\A(\w/)+m/(\w/)*\?\z} && !($preferBuiltin && $alts =~ /Y/); $answer = $answers{$name} if defined $answers{$name}; print STDERR "QUESTION: $question, NAME: $name, ALTS: $alts, ANSWER: $answer\n" if $debug; print OUT "$answer\n"; diff --git a/pkgs/os-specific/linux/kmod/default.nix b/pkgs/os-specific/linux/kmod/default.nix index a1a1906ba9c..0411bae2060 100644 --- a/pkgs/os-specific/linux/kmod/default.nix +++ b/pkgs/os-specific/linux/kmod/default.nix @@ -16,6 +16,8 @@ in stdenv.mkDerivation rec { sha256 = "0am54mi5rk72g5q7k6l6f36gw3r9vwgjmyna43ywcjhqmakyx00b"; }; + outputs = [ "out" "dev" "lib" ]; + nativeBuildInputs = [ autoreconfHook pkg-config libxslt ]; buildInputs = [ xz zstd ] ++ lib.optional stdenv.isDarwin elf-header; diff --git a/pkgs/os-specific/linux/kvdo/default.nix b/pkgs/os-specific/linux/kvdo/default.nix new file mode 100644 index 00000000000..74895e11bd5 --- /dev/null +++ b/pkgs/os-specific/linux/kvdo/default.nix @@ -0,0 +1,31 @@ +{ stdenv, lib, fetchFromGitHub, vdo, kernel }: + +stdenv.mkDerivation rec { + inherit (vdo) version; + pname = "kvdo"; + + src = fetchFromGitHub { + owner = "dm-vdo"; + repo = "kvdo"; + rev = version; + sha256 = "1xl7dwcqx00w1gbpb6vlkn8nchyfj1fsc8c06vgda0sgxp7qs5gn"; + }; + + dontConfigure = true; + enableParallelBuilding = true; + + KSRC = "${kernel.dev}/lib/modules/${kernel.modDirVersion}/build"; + INSTALL_MOD_PATH = placeholder "out"; + + preBuild = '' + makeFlags="$makeFlags -C ${KSRC} M=$(pwd)" +''; + installTargets = [ "modules_install" ]; + + meta = with lib; { + inherit (vdo.meta) license maintainers; + homepage = "https://github.com/dm-vdo/kvdo"; + description = "A pair of kernel modules which provide pools of deduplicated and/or compressed block storage"; + platforms = platforms.linux; + }; +} diff --git a/pkgs/os-specific/linux/libcap/default.nix b/pkgs/os-specific/linux/libcap/default.nix index 2f12d2fea38..750e26313cf 100644 --- a/pkgs/os-specific/linux/libcap/default.nix +++ b/pkgs/os-specific/linux/libcap/default.nix @@ -1,4 +1,4 @@ -{ stdenv, lib, buildPackages, fetchurl, attr, perl, runtimeShell +{ stdenv, lib, buildPackages, fetchurl, attr, runtimeShell , usePam ? !isStatic, pam ? null , isStatic ? stdenv.hostPlatform.isStatic }: @@ -7,18 +7,17 @@ assert usePam -> pam != null; stdenv.mkDerivation rec { pname = "libcap"; - version = "2.49"; + version = "2.63"; src = fetchurl { url = "mirror://kernel/linux/libs/security/linux-privs/libcap2/${pname}-${version}.tar.xz"; - sha256 = "sha256-6YvE2TZFCC7Hh3MLD9GnErOIgkZcUFd33hfDOIMe4YE="; + sha256 = "sha256-DGN7j0T8fYYneH6c9X8VrAbB3cy1PkH+7FSWvjRm938="; }; outputs = [ "out" "dev" "lib" "man" "doc" ] ++ lib.optional usePam "pam"; depsBuildBuild = [ buildPackages.stdenv.cc ]; - nativeBuildInputs = [ perl ]; buildInputs = lib.optional usePam pam; @@ -31,7 +30,9 @@ stdenv.mkDerivation rec { "CC:=$(CC)" ] ++ lib.optional isStatic "SHARED=no"; - prePatch = '' + postPatch = '' + patchShebangs ./progs/mkcapshdoc.sh + # use full path to bash substituteInPlace progs/capsh.c --replace "/bin/bash" "${runtimeShell}" diff --git a/pkgs/os-specific/linux/lvm2/common.nix b/pkgs/os-specific/linux/lvm2/common.nix index 07e8c9cb02d..7ba08e7d903 100644 --- a/pkgs/os-specific/linux/lvm2/common.nix +++ b/pkgs/os-specific/linux/lvm2/common.nix @@ -11,6 +11,7 @@ , enableDmeventd ? false , udevSupport ? !stdenv.hostPlatform.isStatic, udev ? null , onlyLib ? stdenv.hostPlatform.isStatic +, enableVDO ? false, vdo ? null , nixosTests }: @@ -18,7 +19,7 @@ assert enableDmeventd -> enableCmdlib; stdenv.mkDerivation rec { - pname = "lvm2" + lib.optionalString enableDmeventd "-with-dmeventd"; + pname = "lvm2" + lib.optionalString enableDmeventd "-with-dmeventd" + lib.optionalString enableVDO "-with-vdo"; inherit version; src = fetchurl { @@ -33,6 +34,8 @@ stdenv.mkDerivation rec { udev ] ++ lib.optionals (!onlyLib) [ libuuid + ] ++ lib.optionals enableVDO [ + vdo ]; configureFlags = [ @@ -58,6 +61,8 @@ stdenv.mkDerivation rec { "--enable-udev_sync" ] ++ lib.optionals stdenv.hostPlatform.isStatic [ "--enable-static_link" + ] ++ lib.optionals enableVDO [ + "--enable-vdo" ]; preConfigure = '' diff --git a/pkgs/os-specific/linux/nftables/default.nix b/pkgs/os-specific/linux/nftables/default.nix index 0b6291226bc..8485a868d8a 100644 --- a/pkgs/os-specific/linux/nftables/default.nix +++ b/pkgs/os-specific/linux/nftables/default.nix @@ -1,7 +1,8 @@ { lib, stdenv, fetchurl, pkg-config, bison, file, flex , asciidoc, libxslt, findXMLCatalogs, docbook_xml_dtd_45, docbook_xsl , libmnl, libnftnl, libpcap -, gmp, jansson, readline +, gmp, jansson, libedit +, autoreconfHook, fetchpatch , withDebugSymbols ? false , withPython ? false , python3 , withXtables ? true , iptables @@ -10,22 +11,23 @@ with lib; stdenv.mkDerivation rec { - version = "1.0.1"; + version = "1.0.2"; pname = "nftables"; src = fetchurl { url = "https://netfilter.org/projects/nftables/files/${pname}-${version}.tar.bz2"; - sha256 = "08x4xw0s5sap3q7jfr91v7mrkxrydi4dvsckw85ims0qb1ibmviw"; + sha256 = "00jcjn1pl7qyqpg8pd4yhlkys7wbj4vkzgg73n27nmplzips6a0b"; }; nativeBuildInputs = [ + autoreconfHook pkg-config bison file flex asciidoc docbook_xml_dtd_45 docbook_xsl findXMLCatalogs libxslt ]; buildInputs = [ libmnl libnftnl libpcap - gmp jansson readline + gmp jansson libedit ] ++ optional withXtables iptables ++ optional withPython python3; @@ -33,9 +35,17 @@ stdenv.mkDerivation rec { substituteInPlace ./configure --replace /usr/bin/file ${file}/bin/file ''; + patches = [ + # fix build after 1.0.2 release, drop when updating to a newer release + (fetchpatch { + url = "https://git.netfilter.org/nftables/patch/?id=18a08fb7f0443f8bde83393bd6f69e23a04246b3"; + sha256 = "03dzhd7fhg0d20ly4rffk4ra7wlxp731892dhp8zw67jwhys9ywz"; + }) + ]; + configureFlags = [ "--with-json" - "--with-cli=readline" # TODO: maybe switch to editline + "--with-cli=editline" ] ++ optional (!withDebugSymbols) "--disable-debug" ++ optional (!withPython) "--disable-python" ++ optional withPython "--enable-python" diff --git a/pkgs/os-specific/linux/pam_usb/default.nix b/pkgs/os-specific/linux/pam_usb/default.nix index 0091accd57a..ebd45246ae8 100644 --- a/pkgs/os-specific/linux/pam_usb/default.nix +++ b/pkgs/os-specific/linux/pam_usb/default.nix @@ -41,8 +41,12 @@ stdenv.mkDerivation rec { sha256 = "1g1w0s9d8mfld8abrn405ll5grv3xgs0b0hsganrz6qafdq9j7q1"; }; - buildInputs = [ + nativeBuildInputs = [ makeWrapper + pkg-config + ]; + + buildInputs = [ # pam_usb dependencies dbus libxml2 pam pmount pkg-config # pam_usb's tools dependencies diff --git a/pkgs/os-specific/linux/shadow/default.nix b/pkgs/os-specific/linux/shadow/default.nix index 2e4ae1649ea..5537f9f6aac 100644 --- a/pkgs/os-specific/linux/shadow/default.nix +++ b/pkgs/os-specific/linux/shadow/default.nix @@ -19,13 +19,13 @@ in stdenv.mkDerivation rec { pname = "shadow"; - version = "4.8.1"; + version = "4.11.1"; src = fetchFromGitHub { owner = "shadow-maint"; repo = "shadow"; - rev = version; - sha256 = "13407r6qwss00504qy740jghb2dzd561la7dhp47rg8w3g8jarpn"; + rev = "v${version}"; + sha256 = "sha256-PxLX5V0t18JftT5wT41krNv18Ew7Kz3MfZkOi/80ODA="; }; buildInputs = lib.optional (pam != null && stdenv.isLinux) pam; diff --git a/pkgs/os-specific/linux/systemd/0001-Start-device-units-for-uninitialised-encrypted-devic.patch b/pkgs/os-specific/linux/systemd/0001-Start-device-units-for-uninitialised-encrypted-devic.patch index a87c59558e0..404b0d2ee6f 100644 --- a/pkgs/os-specific/linux/systemd/0001-Start-device-units-for-uninitialised-encrypted-devic.patch +++ b/pkgs/os-specific/linux/systemd/0001-Start-device-units-for-uninitialised-encrypted-devic.patch @@ -1,4 +1,4 @@ -From 93b2d29de784c68d1b4d70d7f214b19432aec6a8 Mon Sep 17 00:00:00 2001 +From 8622539fe2ce67934ed2e60626a2303ef8191e40 Mon Sep 17 00:00:00 2001 From: Eelco Dolstra <eelco.dolstra@logicblox.com> Date: Tue, 8 Jan 2013 15:46:30 +0100 Subject: [PATCH 01/19] Start device units for uninitialised encrypted devices @@ -28,5 +28,5 @@ index 25b8a590a6..d18999ea87 100644 SUBSYSTEM=="block", ENV{ID_PART_GPT_AUTO_ROOT}=="1", ENV{ID_FS_TYPE}!="crypto_LUKS", SYMLINK+="gpt-auto-root" SUBSYSTEM=="block", ENV{ID_PART_GPT_AUTO_ROOT}=="1", ENV{ID_FS_TYPE}=="crypto_LUKS", SYMLINK+="gpt-auto-root-luks" -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0002-Don-t-try-to-unmount-nix-or-nix-store.patch b/pkgs/os-specific/linux/systemd/0002-Don-t-try-to-unmount-nix-or-nix-store.patch index e9fedd239f4..d37ace3250c 100644 --- a/pkgs/os-specific/linux/systemd/0002-Don-t-try-to-unmount-nix-or-nix-store.patch +++ b/pkgs/os-specific/linux/systemd/0002-Don-t-try-to-unmount-nix-or-nix-store.patch @@ -1,4 +1,4 @@ -From 41edb381df0326e216b3c569d2cd5764591267d9 Mon Sep 17 00:00:00 2001 +From a845786195182c376b72a85433e278c35243676d Mon Sep 17 00:00:00 2001 From: Eelco Dolstra <eelco.dolstra@logicblox.com> Date: Fri, 12 Apr 2013 13:16:57 +0200 Subject: [PATCH 02/19] Don't try to unmount /nix or /nix/store @@ -25,10 +25,10 @@ index f683f05981..5a04c2c2a6 100644 "/etc")) return true; diff --git a/src/shutdown/umount.c b/src/shutdown/umount.c -index 1f945b7875..6df9d383ba 100644 +index f5a2cb20c1..51608d24c0 100644 --- a/src/shutdown/umount.c +++ b/src/shutdown/umount.c -@@ -508,6 +508,8 @@ static int delete_md(MountPoint *m) { +@@ -502,6 +502,8 @@ static int delete_md(MountPoint *m) { static bool nonunmountable_path(const char *path) { return path_equal(path, "/") @@ -38,5 +38,5 @@ index 1f945b7875..6df9d383ba 100644 || path_equal(path, "/usr") #endif -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0003-Fix-NixOS-containers.patch b/pkgs/os-specific/linux/systemd/0003-Fix-NixOS-containers.patch index 217629f7d6a..56c6238b81f 100644 --- a/pkgs/os-specific/linux/systemd/0003-Fix-NixOS-containers.patch +++ b/pkgs/os-specific/linux/systemd/0003-Fix-NixOS-containers.patch @@ -1,4 +1,4 @@ -From 43620479f6bfbbc4c3eed28947e0676c817acb7c Mon Sep 17 00:00:00 2001 +From d33f3461fa2202ef9b0d6cdf2137c510c59fb052 Mon Sep 17 00:00:00 2001 From: Eelco Dolstra <eelco.dolstra@logicblox.com> Date: Wed, 16 Apr 2014 10:59:28 +0200 Subject: [PATCH 03/19] Fix NixOS containers @@ -10,10 +10,10 @@ container, so checking early whether it exists will fail. 1 file changed, 2 insertions(+) diff --git a/src/nspawn/nspawn.c b/src/nspawn/nspawn.c -index 575b9da447..438ca294db 100644 +index 8f17ab8810..197e5aa252 100644 --- a/src/nspawn/nspawn.c +++ b/src/nspawn/nspawn.c -@@ -5590,6 +5590,7 @@ static int run(int argc, char *argv[]) { +@@ -5625,6 +5625,7 @@ static int run(int argc, char *argv[]) { goto finish; } } else { @@ -21,7 +21,7 @@ index 575b9da447..438ca294db 100644 const char *p, *q; if (arg_pivot_root_new) -@@ -5604,6 +5605,7 @@ static int run(int argc, char *argv[]) { +@@ -5639,6 +5640,7 @@ static int run(int argc, char *argv[]) { r = -EINVAL; goto finish; } @@ -30,5 +30,5 @@ index 575b9da447..438ca294db 100644 } else { -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0004-Look-for-fsck-in-the-right-place.patch b/pkgs/os-specific/linux/systemd/0004-Look-for-fsck-in-the-right-place.patch index f7b768af515..36d0ee0cde2 100644 --- a/pkgs/os-specific/linux/systemd/0004-Look-for-fsck-in-the-right-place.patch +++ b/pkgs/os-specific/linux/systemd/0004-Look-for-fsck-in-the-right-place.patch @@ -1,4 +1,4 @@ -From a08ed6697974d7f7dabe60d42bbc9e31a10f7e23 Mon Sep 17 00:00:00 2001 +From 8fd5968163f3a1cb5f196d934756ba08ccaa5b1e Mon Sep 17 00:00:00 2001 From: Eelco Dolstra <eelco.dolstra@logicblox.com> Date: Thu, 1 May 2014 14:10:10 +0200 Subject: [PATCH 04/19] Look for fsck in the right place @@ -8,7 +8,7 @@ Subject: [PATCH 04/19] Look for fsck in the right place 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/fsck/fsck.c b/src/fsck/fsck.c -index cd7adfaeb9..68cebdd158 100644 +index 745d01ff50..dd4eef45c3 100644 --- a/src/fsck/fsck.c +++ b/src/fsck/fsck.c @@ -368,7 +368,7 @@ static int run(int argc, char *argv[]) { @@ -21,5 +21,5 @@ index cd7adfaeb9..68cebdd158 100644 cmdline[i++] = "-T"; -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0005-Add-some-NixOS-specific-unit-directories.patch b/pkgs/os-specific/linux/systemd/0005-Add-some-NixOS-specific-unit-directories.patch index 7ebf07d0a82..6acac84a9d2 100644 --- a/pkgs/os-specific/linux/systemd/0005-Add-some-NixOS-specific-unit-directories.patch +++ b/pkgs/os-specific/linux/systemd/0005-Add-some-NixOS-specific-unit-directories.patch @@ -1,4 +1,4 @@ -From ddcfae6de8c460903c5db8c536ffeb5771e976f8 Mon Sep 17 00:00:00 2001 +From 90d1a90d3147e9c8db5caec8befabda270e755d4 Mon Sep 17 00:00:00 2001 From: Eelco Dolstra <eelco.dolstra@logicblox.com> Date: Fri, 19 Dec 2014 14:46:17 +0100 Subject: [PATCH 05/19] Add some NixOS-specific unit directories @@ -14,10 +14,10 @@ Also, remove /usr and /lib as these don't exist on NixOS. 2 files changed, 6 insertions(+), 19 deletions(-) diff --git a/src/basic/path-lookup.c b/src/basic/path-lookup.c -index 05eb17d66c..1cd141d012 100644 +index 6fb8c40e7a..142ecdecec 100644 --- a/src/basic/path-lookup.c +++ b/src/basic/path-lookup.c -@@ -91,11 +91,7 @@ int xdg_user_data_dir(char **ret, const char *suffix) { +@@ -92,11 +92,7 @@ int xdg_user_data_dir(char **ret, const char *suffix) { } static const char* const user_data_unit_paths[] = { @@ -29,7 +29,7 @@ index 05eb17d66c..1cd141d012 100644 NULL }; -@@ -613,15 +609,13 @@ int lookup_paths_init( +@@ -614,15 +610,13 @@ int lookup_paths_init( persistent_config, SYSTEM_CONFIG_UNIT_DIR, "/etc/systemd/system", @@ -46,7 +46,7 @@ index 05eb17d66c..1cd141d012 100644 STRV_IFNOTNULL(generator_late)); break; -@@ -637,14 +631,11 @@ int lookup_paths_init( +@@ -638,14 +632,11 @@ int lookup_paths_init( persistent_config, USER_CONFIG_UNIT_DIR, "/etc/systemd/user", @@ -62,7 +62,7 @@ index 05eb17d66c..1cd141d012 100644 STRV_IFNOTNULL(generator_late)); break; -@@ -794,7 +785,6 @@ char **generator_binary_paths(UnitFileScope scope) { +@@ -795,7 +786,6 @@ char **generator_binary_paths(UnitFileScope scope) { case UNIT_FILE_SYSTEM: add = strv_new("/run/systemd/system-generators", "/etc/systemd/system-generators", @@ -70,7 +70,7 @@ index 05eb17d66c..1cd141d012 100644 SYSTEM_GENERATOR_DIR); break; -@@ -802,7 +792,6 @@ char **generator_binary_paths(UnitFileScope scope) { +@@ -803,7 +793,6 @@ char **generator_binary_paths(UnitFileScope scope) { case UNIT_FILE_USER: add = strv_new("/run/systemd/user-generators", "/etc/systemd/user-generators", @@ -78,7 +78,7 @@ index 05eb17d66c..1cd141d012 100644 USER_GENERATOR_DIR); break; -@@ -841,12 +830,10 @@ char **env_generator_binary_paths(bool is_system) { +@@ -842,12 +831,10 @@ char **env_generator_binary_paths(bool is_system) { if (is_system) add = strv_new("/run/systemd/system-environment-generators", "/etc/systemd/system-environment-generators", @@ -122,5 +122,5 @@ index fc0f8c34fa..162432e77f 100644 systemd_sleep_dir=${root_prefix}/lib/systemd/system-sleep -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0006-Get-rid-of-a-useless-message-in-user-sessions.patch b/pkgs/os-specific/linux/systemd/0006-Get-rid-of-a-useless-message-in-user-sessions.patch index 0c09107c5ef..438d841bb1c 100644 --- a/pkgs/os-specific/linux/systemd/0006-Get-rid-of-a-useless-message-in-user-sessions.patch +++ b/pkgs/os-specific/linux/systemd/0006-Get-rid-of-a-useless-message-in-user-sessions.patch @@ -1,4 +1,4 @@ -From b39b8871bcaa07280d6b0cf2226b1a3be31232b8 Mon Sep 17 00:00:00 2001 +From 213279752124dc4a57a4189df9b5b2e96feaa0b3 Mon Sep 17 00:00:00 2001 From: Eelco Dolstra <eelco.dolstra@logicblox.com> Date: Mon, 11 May 2015 15:39:38 +0200 Subject: [PATCH 06/19] Get rid of a useless message in user sessions @@ -13,10 +13,10 @@ in containers. 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/src/core/manager.c b/src/core/manager.c -index 34891a8754..b9b4789720 100644 +index 9368a1dfa1..5b0bdb1bc7 100644 --- a/src/core/manager.c +++ b/src/core/manager.c -@@ -1375,7 +1375,8 @@ static unsigned manager_dispatch_stop_when_bound_queue(Manager *m) { +@@ -1408,7 +1408,8 @@ static unsigned manager_dispatch_stop_when_bound_queue(Manager *m) { if (!unit_is_bound_by_inactive(u, &culprit)) continue; @@ -27,5 +27,5 @@ index 34891a8754..b9b4789720 100644 /* If stopping a unit fails continuously we might enter a stop loop here, hence stop acting on the * service being unnecessary after a while. */ -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0007-hostnamed-localed-timedated-disable-methods-that-cha.patch b/pkgs/os-specific/linux/systemd/0007-hostnamed-localed-timedated-disable-methods-that-cha.patch index d7649b5e44a..a93488afbf9 100644 --- a/pkgs/os-specific/linux/systemd/0007-hostnamed-localed-timedated-disable-methods-that-cha.patch +++ b/pkgs/os-specific/linux/systemd/0007-hostnamed-localed-timedated-disable-methods-that-cha.patch @@ -1,4 +1,4 @@ -From 566208aea81057789218b959f4d0e898eec54fc9 Mon Sep 17 00:00:00 2001 +From 14474d5e116609ce4fac60d779b08fa3eab840c3 Mon Sep 17 00:00:00 2001 From: Gabriel Ebner <gebner@gebner.org> Date: Sun, 6 Dec 2015 14:26:36 +0100 Subject: [PATCH 07/19] hostnamed, localed, timedated: disable methods that @@ -11,10 +11,10 @@ Subject: [PATCH 07/19] hostnamed, localed, timedated: disable methods that 3 files changed, 25 insertions(+) diff --git a/src/hostname/hostnamed.c b/src/hostname/hostnamed.c -index 36702f2fb0..669257ea2f 100644 +index b20a93ad81..6292fca4fc 100644 --- a/src/hostname/hostnamed.c +++ b/src/hostname/hostnamed.c -@@ -797,6 +797,9 @@ static int method_set_static_hostname(sd_bus_message *m, void *userdata, sd_bus_ +@@ -813,6 +813,9 @@ static int method_set_static_hostname(sd_bus_message *m, void *userdata, sd_bus_ if (r < 0) return r; @@ -24,7 +24,7 @@ index 36702f2fb0..669257ea2f 100644 name = empty_to_null(name); context_read_etc_hostname(c); -@@ -860,6 +863,9 @@ static int set_machine_info(Context *c, sd_bus_message *m, int prop, sd_bus_mess +@@ -876,6 +879,9 @@ static int set_machine_info(Context *c, sd_bus_message *m, int prop, sd_bus_mess if (r < 0) return r; @@ -104,5 +104,5 @@ index 66b454269d..0a8fe25d0f 100644 if (r < 0) return r; -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0008-Fix-hwdb-paths.patch b/pkgs/os-specific/linux/systemd/0008-Fix-hwdb-paths.patch index f938b553c9f..e1bc44a148e 100644 --- a/pkgs/os-specific/linux/systemd/0008-Fix-hwdb-paths.patch +++ b/pkgs/os-specific/linux/systemd/0008-Fix-hwdb-paths.patch @@ -1,4 +1,4 @@ -From 3b9983969de2a86929768f6362ed41c20dd13bd3 Mon Sep 17 00:00:00 2001 +From d668df39728c992ec0c691ef6e76664e7121f5bd Mon Sep 17 00:00:00 2001 From: Nikolay Amiantov <ab@fmap.me> Date: Thu, 7 Jul 2016 02:47:13 +0300 Subject: [PATCH 08/19] Fix hwdb paths @@ -24,5 +24,5 @@ index 5ddc2211e6..ee621eec46 100644 + "/etc/udev/hwdb.bin\0" + -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0009-Change-usr-share-zoneinfo-to-etc-zoneinfo.patch b/pkgs/os-specific/linux/systemd/0009-Change-usr-share-zoneinfo-to-etc-zoneinfo.patch index 87cf1afc7d2..68d40980ab1 100644 --- a/pkgs/os-specific/linux/systemd/0009-Change-usr-share-zoneinfo-to-etc-zoneinfo.patch +++ b/pkgs/os-specific/linux/systemd/0009-Change-usr-share-zoneinfo-to-etc-zoneinfo.patch @@ -1,4 +1,4 @@ -From b5966b6abb9696798618367cab33d1fed317734f Mon Sep 17 00:00:00 2001 +From dd59ce5f1bbdafb0b92f8aeacc68b000ec347a61 Mon Sep 17 00:00:00 2001 From: Nikolay Amiantov <ab@fmap.me> Date: Tue, 11 Oct 2016 13:12:08 +0300 Subject: [PATCH 09/19] Change /usr/share/zoneinfo to /etc/zoneinfo @@ -35,10 +35,10 @@ index e486474c44..5f373d0723 100644 <literal>Etc/UTC</literal>. The resulting link should lead to the corresponding binary diff --git a/src/basic/time-util.c b/src/basic/time-util.c -index 5d162e8ffe..1bec83e555 100644 +index b659d6905d..660b1c6fed 100644 --- a/src/basic/time-util.c +++ b/src/basic/time-util.c -@@ -1269,7 +1269,7 @@ static int get_timezones_from_zone1970_tab(char ***ret) { +@@ -1267,7 +1267,7 @@ static int get_timezones_from_zone1970_tab(char ***ret) { assert(ret); @@ -47,7 +47,7 @@ index 5d162e8ffe..1bec83e555 100644 if (!f) return -errno; -@@ -1308,7 +1308,7 @@ static int get_timezones_from_tzdata_zi(char ***ret) { +@@ -1306,7 +1306,7 @@ static int get_timezones_from_tzdata_zi(char ***ret) { _cleanup_strv_free_ char **zones = NULL; int r; @@ -56,7 +56,7 @@ index 5d162e8ffe..1bec83e555 100644 if (!f) return -errno; -@@ -1421,7 +1421,7 @@ int verify_timezone(const char *name, int log_level) { +@@ -1419,7 +1419,7 @@ int verify_timezone(const char *name, int log_level) { if (p - name >= PATH_MAX) return -ENAMETOOLONG; @@ -65,7 +65,7 @@ index 5d162e8ffe..1bec83e555 100644 fd = open(t, O_RDONLY|O_CLOEXEC); if (fd < 0) -@@ -1512,7 +1512,7 @@ int get_timezone(char **ret) { +@@ -1510,7 +1510,7 @@ int get_timezone(char **ret) { if (r < 0) return r; /* returns EINVAL if not a symlink */ @@ -75,10 +75,10 @@ index 5d162e8ffe..1bec83e555 100644 return -EINVAL; diff --git a/src/firstboot/firstboot.c b/src/firstboot/firstboot.c -index 2cb4f80d5d..ebeaeac52f 100644 +index d28a416e5d..c7c215731d 100644 --- a/src/firstboot/firstboot.c +++ b/src/firstboot/firstboot.c -@@ -491,7 +491,7 @@ static int process_timezone(void) { +@@ -494,7 +494,7 @@ static int process_timezone(void) { if (isempty(arg_timezone)) return 0; @@ -88,10 +88,10 @@ index 2cb4f80d5d..ebeaeac52f 100644 (void) mkdir_parents(etc_localtime, 0755); if (symlink(e, etc_localtime) < 0) diff --git a/src/nspawn/nspawn.c b/src/nspawn/nspawn.c -index 438ca294db..98bd110d92 100644 +index 197e5aa252..c674fa61d5 100644 --- a/src/nspawn/nspawn.c +++ b/src/nspawn/nspawn.c -@@ -1887,8 +1887,8 @@ int userns_mkdir(const char *root, const char *path, mode_t mode, uid_t uid, gid +@@ -1899,8 +1899,8 @@ int userns_mkdir(const char *root, const char *path, mode_t mode, uid_t uid, gid static const char *timezone_from_path(const char *path) { return PATH_STARTSWITH_SET( path, @@ -137,5 +137,5 @@ index 0a8fe25d0f..2f02b9a520 100644 return -ENOMEM; -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0010-localectl-use-etc-X11-xkb-for-list-x11.patch b/pkgs/os-specific/linux/systemd/0010-localectl-use-etc-X11-xkb-for-list-x11.patch index 6e36bbdc340..f2514de6c66 100644 --- a/pkgs/os-specific/linux/systemd/0010-localectl-use-etc-X11-xkb-for-list-x11.patch +++ b/pkgs/os-specific/linux/systemd/0010-localectl-use-etc-X11-xkb-for-list-x11.patch @@ -1,4 +1,4 @@ -From f4e9304560ad42eeb8d42be583cc55eb2e5b4bb1 Mon Sep 17 00:00:00 2001 +From a93da270bed88972f4d60a1fa08f24e00712d7fb Mon Sep 17 00:00:00 2001 From: Imuli <i@imu.li> Date: Wed, 19 Oct 2016 08:46:47 -0400 Subject: [PATCH 10/19] localectl: use /etc/X11/xkb for list-x11-* @@ -10,10 +10,10 @@ NixOS has an option to link the xkb data files to /etc/X11, but not to 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/locale/localectl.c b/src/locale/localectl.c -index 548ac8eb2c..5e372f1566 100644 +index b5624209dc..4ab7adfdb6 100644 --- a/src/locale/localectl.c +++ b/src/locale/localectl.c -@@ -280,7 +280,7 @@ static int list_x11_keymaps(int argc, char **argv, void *userdata) { +@@ -279,7 +279,7 @@ static int list_x11_keymaps(int argc, char **argv, void *userdata) { } state = NONE, look_for; int r; @@ -23,5 +23,5 @@ index 548ac8eb2c..5e372f1566 100644 return log_error_errno(errno, "Failed to open keyboard mapping list. %m"); -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0011-build-don-t-create-statedir-and-don-t-touch-prefixdi.patch b/pkgs/os-specific/linux/systemd/0011-build-don-t-create-statedir-and-don-t-touch-prefixdi.patch index 5aa22d98895..c21a1bda412 100644 --- a/pkgs/os-specific/linux/systemd/0011-build-don-t-create-statedir-and-don-t-touch-prefixdi.patch +++ b/pkgs/os-specific/linux/systemd/0011-build-don-t-create-statedir-and-don-t-touch-prefixdi.patch @@ -1,4 +1,4 @@ -From 43a363f30b6012d600cfb62a3851c4ac7af4d1d5 Mon Sep 17 00:00:00 2001 +From 3bc3462165cd72de93a1c71f03e6c4150726b159 Mon Sep 17 00:00:00 2001 From: Franz Pletz <fpletz@fnordicwalking.de> Date: Sun, 11 Feb 2018 04:37:44 +0100 Subject: [PATCH 11/19] build: don't create statedir and don't touch prefixdir @@ -8,12 +8,12 @@ Subject: [PATCH 11/19] build: don't create statedir and don't touch prefixdir 1 file changed, 3 deletions(-) diff --git a/meson.build b/meson.build -index 5bdfd9753d..5bf6afc7b7 100644 +index c0cbadecb1..8266bf57de 100644 --- a/meson.build +++ b/meson.build -@@ -3539,9 +3539,6 @@ install_data('LICENSE.GPL2', - 'docs/GVARIANT-SERIALIZATION.md', - install_dir : docdir) +@@ -3729,9 +3729,6 @@ install_data('LICENSE.GPL2', + install_subdir('LICENSES', + install_dir : docdir) -meson.add_install_script('sh', '-c', mkdir_p.format(systemdstatedir)) -meson.add_install_script('sh', '-c', 'touch $DESTDIR@0@'.format(prefixdir)) @@ -22,5 +22,5 @@ index 5bdfd9753d..5bf6afc7b7 100644 # Ensure that changes to the docs/ directory do not break the -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0012-inherit-systemd-environment-when-calling-generators.patch b/pkgs/os-specific/linux/systemd/0012-inherit-systemd-environment-when-calling-generators.patch index a2bdfcf8ec3..5f27e417523 100644 --- a/pkgs/os-specific/linux/systemd/0012-inherit-systemd-environment-when-calling-generators.patch +++ b/pkgs/os-specific/linux/systemd/0012-inherit-systemd-environment-when-calling-generators.patch @@ -1,4 +1,4 @@ -From 7ea935a5ac4f31106ce9347227d4eb59b77b02cd Mon Sep 17 00:00:00 2001 +From 85f0ad0cb7b4f0cfd482c9611f9cbc2dacbba33a Mon Sep 17 00:00:00 2001 From: Andreas Rammhold <andreas@rammhold.de> Date: Fri, 2 Nov 2018 21:15:42 +0100 Subject: [PATCH 12/19] inherit systemd environment when calling generators. @@ -16,10 +16,10 @@ executables that are being called from managers. 1 file changed, 9 insertions(+), 4 deletions(-) diff --git a/src/core/manager.c b/src/core/manager.c -index b9b4789720..79239afe4a 100644 +index 5b0bdb1bc7..1538a5200a 100644 --- a/src/core/manager.c +++ b/src/core/manager.c -@@ -4149,10 +4149,15 @@ static int manager_run_generators(Manager *m) { +@@ -3653,10 +3653,15 @@ static int manager_run_generators(Manager *m) { argv[4] = NULL; RUN_WITH_UMASK(0022) @@ -40,5 +40,5 @@ index b9b4789720..79239afe4a 100644 finish: -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0013-add-rootprefix-to-lookup-dir-paths.patch b/pkgs/os-specific/linux/systemd/0013-add-rootprefix-to-lookup-dir-paths.patch index 20372a5dbad..d008cf2821c 100644 --- a/pkgs/os-specific/linux/systemd/0013-add-rootprefix-to-lookup-dir-paths.patch +++ b/pkgs/os-specific/linux/systemd/0013-add-rootprefix-to-lookup-dir-paths.patch @@ -1,4 +1,4 @@ -From eb93778af78a127e8e20d6ed7fd9f91fd22dc7c9 Mon Sep 17 00:00:00 2001 +From b30d2273d3ce1480b0c4c27c25211f84e04172e9 Mon Sep 17 00:00:00 2001 From: Andreas Rammhold <andreas@rammhold.de> Date: Thu, 9 May 2019 11:15:22 +0200 Subject: [PATCH 13/19] add rootprefix to lookup dir paths @@ -12,7 +12,7 @@ files that I might have missed. 1 file changed, 4 insertions(+), 2 deletions(-) diff --git a/src/basic/def.h b/src/basic/def.h -index 2e60abb4f1..732ec51d36 100644 +index eccee3d3fa..e94a2c8bd0 100644 --- a/src/basic/def.h +++ b/src/basic/def.h @@ -39,13 +39,15 @@ @@ -34,5 +34,5 @@ index 2e60abb4f1..732ec51d36 100644 #define CONF_PATHS(n) \ CONF_PATHS_USR(n) \ -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0014-systemd-shutdown-execute-scripts-in-etc-systemd-syst.patch b/pkgs/os-specific/linux/systemd/0014-systemd-shutdown-execute-scripts-in-etc-systemd-syst.patch index a22566eb4cc..49c6651c0ed 100644 --- a/pkgs/os-specific/linux/systemd/0014-systemd-shutdown-execute-scripts-in-etc-systemd-syst.patch +++ b/pkgs/os-specific/linux/systemd/0014-systemd-shutdown-execute-scripts-in-etc-systemd-syst.patch @@ -1,4 +1,4 @@ -From 1d623def80a3532ac1445499c9d4673e21ae8195 Mon Sep 17 00:00:00 2001 +From 76da27ff77e5db07e502d4d8d26286d69c3f0319 Mon Sep 17 00:00:00 2001 From: Nikolay Amiantov <ab@fmap.me> Date: Thu, 25 Jul 2019 20:45:55 +0300 Subject: [PATCH 14/19] systemd-shutdown: execute scripts in @@ -10,12 +10,12 @@ This is needed for NixOS to use such scripts as systemd directory is immutable. 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/shutdown/shutdown.c b/src/shutdown/shutdown.c -index a98cfc4d8a..b0b34edda7 100644 +index 7ad9930677..fdb03a2e1a 100644 --- a/src/shutdown/shutdown.c +++ b/src/shutdown/shutdown.c -@@ -312,7 +312,7 @@ int main(int argc, char *argv[]) { +@@ -335,7 +335,7 @@ int main(int argc, char *argv[]) { _cleanup_free_ char *cgroup = NULL; - char *arguments[3], *watchdog_device; + char *arguments[3]; int cmd, r, umount_log_level = LOG_INFO; - static const char* const dirs[] = {SYSTEM_SHUTDOWN_PATH, NULL}; + static const char* const dirs[] = {SYSTEM_SHUTDOWN_PATH, "/etc/systemd/system-shutdown", NULL}; @@ -23,5 +23,5 @@ index a98cfc4d8a..b0b34edda7 100644 /* The log target defaults to console, but the original systemd process will pass its log target in through a * command line argument, which will override this default. Also, ensure we'll never log to the journal or -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0015-systemd-sleep-execute-scripts-in-etc-systemd-system-.patch b/pkgs/os-specific/linux/systemd/0015-systemd-sleep-execute-scripts-in-etc-systemd-system-.patch index 1a21d1005ee..78d77c00582 100644 --- a/pkgs/os-specific/linux/systemd/0015-systemd-sleep-execute-scripts-in-etc-systemd-system-.patch +++ b/pkgs/os-specific/linux/systemd/0015-systemd-sleep-execute-scripts-in-etc-systemd-system-.patch @@ -1,4 +1,4 @@ -From 5a96c4a98be971d84a12ae04e42bc3cb889d5191 Mon Sep 17 00:00:00 2001 +From 47c651f97acae814d4ff679ae04d78d4532cbca6 Mon Sep 17 00:00:00 2001 From: Nikolay Amiantov <ab@fmap.me> Date: Thu, 25 Jul 2019 20:46:58 +0300 Subject: [PATCH 15/19] systemd-sleep: execute scripts in @@ -10,7 +10,7 @@ This is needed for NixOS to use such scripts as systemd directory is immutable. 1 file changed, 1 insertion(+) diff --git a/src/sleep/sleep.c b/src/sleep/sleep.c -index a3aeb24633..0ed6a34d79 100644 +index 7064f3a905..b60ced9d9b 100644 --- a/src/sleep/sleep.c +++ b/src/sleep/sleep.c @@ -182,6 +182,7 @@ static int execute( @@ -22,5 +22,5 @@ index a3aeb24633..0ed6a34d79 100644 }; -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0016-kmod-static-nodes.service-Update-ConditionFileNotEmp.patch b/pkgs/os-specific/linux/systemd/0016-kmod-static-nodes.service-Update-ConditionFileNotEmp.patch index 12624cb5548..3c1643e0f1a 100644 --- a/pkgs/os-specific/linux/systemd/0016-kmod-static-nodes.service-Update-ConditionFileNotEmp.patch +++ b/pkgs/os-specific/linux/systemd/0016-kmod-static-nodes.service-Update-ConditionFileNotEmp.patch @@ -1,32 +1,27 @@ -From 775a2a8940c07f4af33a2a11bfa17e0257b427cb Mon Sep 17 00:00:00 2001 +From df0fec7ac2f33bcca60ba9a2396af33397ba42cc Mon Sep 17 00:00:00 2001 From: Florian Klink <flokli@flokli.de> Date: Sat, 7 Mar 2020 22:40:27 +0100 Subject: [PATCH 16/19] kmod-static-nodes.service: Update ConditionFileNotEmpty -kmod loads modules from not only /lib/modules but also from -/run/booted-system/kernel-modules/lib/modules and -/run/current-system/kernel-modules/lib/module - -Co-authored-by: Arian van Putten <arian.vanputten@gmail.com> +On NixOS, kernel modules of the currently booted systems are located at +/run/booted-system/kernel-modules/lib/modules/%v/, not /lib/modules/%v/. --- - units/kmod-static-nodes.service.in | 4 +++- - 1 file changed, 3 insertions(+), 1 deletion(-) + units/kmod-static-nodes.service.in | 2 +- + 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/units/kmod-static-nodes.service.in b/units/kmod-static-nodes.service.in -index 777e82d16b..9a5e05a1cc 100644 +index 777e82d16b..b6abc2bba0 100644 --- a/units/kmod-static-nodes.service.in +++ b/units/kmod-static-nodes.service.in -@@ -12,7 +12,9 @@ Description=Create List of Static Device Nodes +@@ -12,7 +12,7 @@ Description=Create List of Static Device Nodes DefaultDependencies=no Before=sysinit.target systemd-tmpfiles-setup-dev.service ConditionCapability=CAP_SYS_MODULE -ConditionFileNotEmpty=/lib/modules/%v/modules.devname -+ConditionFileNotEmpty=|/lib/modules/%v/modules.devname -+ConditionFileNotEmpty=|/run/booted-system/kernel-modules/lib/modules/%v/modules.devname -+ConditionFileNotEmpty=|/run/current-system/kernel-modules/lib/modules/%v/modules.devname ++ConditionFileNotEmpty=/run/booted-system/kernel-modules/lib/modules/%v/modules.devname [Service] Type=oneshot -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0017-path-util.h-add-placeholder-for-DEFAULT_PATH_NORMAL.patch b/pkgs/os-specific/linux/systemd/0017-path-util.h-add-placeholder-for-DEFAULT_PATH_NORMAL.patch index 52b74284fe2..882690ad914 100644 --- a/pkgs/os-specific/linux/systemd/0017-path-util.h-add-placeholder-for-DEFAULT_PATH_NORMAL.patch +++ b/pkgs/os-specific/linux/systemd/0017-path-util.h-add-placeholder-for-DEFAULT_PATH_NORMAL.patch @@ -1,4 +1,4 @@ -From 6ddb2011b379f3232374327517af874b68c434b5 Mon Sep 17 00:00:00 2001 +From f21722ac0f51b0b59a5c030af3db5fe4e6397f7c Mon Sep 17 00:00:00 2001 From: Florian Klink <flokli@flokli.de> Date: Sun, 8 Mar 2020 01:05:54 +0100 Subject: [PATCH 17/19] path-util.h: add placeholder for DEFAULT_PATH_NORMAL @@ -10,7 +10,7 @@ systemd itself uses extensively. 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/src/basic/path-util.h b/src/basic/path-util.h -index 26e7362d1f..a8f8a863ec 100644 +index 518f3340bf..18e826ea0b 100644 --- a/src/basic/path-util.h +++ b/src/basic/path-util.h @@ -24,11 +24,11 @@ @@ -29,5 +29,5 @@ index 26e7362d1f..a8f8a863ec 100644 #if HAVE_SPLIT_USR # define DEFAULT_PATH DEFAULT_PATH_SPLIT_USR -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0018-pkg-config-derive-prefix-from-prefix.patch b/pkgs/os-specific/linux/systemd/0018-pkg-config-derive-prefix-from-prefix.patch index 58eb7f96e64..e602bef9c3d 100644 --- a/pkgs/os-specific/linux/systemd/0018-pkg-config-derive-prefix-from-prefix.patch +++ b/pkgs/os-specific/linux/systemd/0018-pkg-config-derive-prefix-from-prefix.patch @@ -1,4 +1,4 @@ -From 50f2ada6cbfafa75b628410e8834f29581854e6f Mon Sep 17 00:00:00 2001 +From 968bd0c7bc058a4b05b6457f9ff20d02b70c9852 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?J=C3=B6rg=20Thalheim?= <joerg@thalheim.io> Date: Sun, 6 Dec 2020 08:34:19 +0100 Subject: [PATCH 18/19] pkg-config: derive prefix from --prefix @@ -29,5 +29,5 @@ index 162432e77f..2fc20daf03 100644 rootprefix=${root_prefix} sysconf_dir={{SYSCONF_DIR}} -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/0019-core-handle-lookup-paths-being-symlinks.patch b/pkgs/os-specific/linux/systemd/0019-core-handle-lookup-paths-being-symlinks.patch index 54e5c32aeb4..916f95e194a 100644 --- a/pkgs/os-specific/linux/systemd/0019-core-handle-lookup-paths-being-symlinks.patch +++ b/pkgs/os-specific/linux/systemd/0019-core-handle-lookup-paths-being-symlinks.patch @@ -1,4 +1,4 @@ -From 2ab388cf0be320879e668a6206cb15d002b55f98 Mon Sep 17 00:00:00 2001 +From 169fc6f270ff3e3903a7a31550c964152f9751ec Mon Sep 17 00:00:00 2001 From: Andreas Rammhold <andreas@rammhold.de> Date: Wed, 18 Aug 2021 19:10:08 +0200 Subject: [PATCH 19/19] core: handle lookup paths being symlinks @@ -15,10 +15,10 @@ directory itself is already a symlink. 1 file changed, 31 insertions(+), 2 deletions(-) diff --git a/src/basic/unit-file.c b/src/basic/unit-file.c -index 0d58b1c4fe..7314f1245f 100644 +index 30c632dfce..6179100126 100644 --- a/src/basic/unit-file.c +++ b/src/basic/unit-file.c -@@ -254,6 +254,7 @@ int unit_file_build_name_map( +@@ -255,6 +255,7 @@ int unit_file_build_name_map( _cleanup_hashmap_free_ Hashmap *ids = NULL, *names = NULL; _cleanup_set_free_free_ Set *paths = NULL; @@ -26,7 +26,7 @@ index 0d58b1c4fe..7314f1245f 100644 uint64_t timestamp_hash; char **dir; int r; -@@ -273,6 +274,34 @@ int unit_file_build_name_map( +@@ -274,6 +275,34 @@ int unit_file_build_name_map( return log_oom(); } @@ -59,9 +59,9 @@ index 0d58b1c4fe..7314f1245f 100644 + } + STRV_FOREACH(dir, (char**) lp->search_path) { - struct dirent *de; _cleanup_closedir_ DIR *d = NULL; -@@ -351,11 +380,11 @@ int unit_file_build_name_map( + +@@ -386,11 +415,11 @@ int unit_file_build_name_map( continue; } @@ -76,5 +76,5 @@ index 0d58b1c4fe..7314f1245f 100644 log_debug("%s: linked unit file: %s → %s", __func__, filename, simplified); -- -2.33.1 +2.34.0 diff --git a/pkgs/os-specific/linux/systemd/default.nix b/pkgs/os-specific/linux/systemd/default.nix index 4cbed9b7cbf..73c27b0b61f 100644 --- a/pkgs/os-specific/linux/systemd/default.nix +++ b/pkgs/os-specific/linux/systemd/default.nix @@ -15,6 +15,8 @@ , gperf , getent , glibcLocales + + # glib is only used during tests (test-bus-gvariant, test-bus-marshal) , glib , substituteAll , gettext @@ -29,7 +31,6 @@ # Optional dependencies , pam , cryptsetup -, lvm2 , audit , acl , lz4 @@ -61,8 +62,10 @@ , kexec-tools , bashInteractive , libmicrohttpd +, libfido2 +, p11-kit - # the (optional) BPF feature requires bpftool, libbpf, clang and llmv-strip to be avilable during build time. + # the (optional) BPF feature requires bpftool, libbpf, clang and llvm-strip to be available during build time. # Only libbpf should be a runtime dependency. , bpftools , libbpf @@ -97,8 +100,8 @@ , withTimesyncd ? true , withTpm2Tss ? !stdenv.hostPlatform.isMusl , withUserDb ? !stdenv.hostPlatform.isMusl -, libfido2 -, p11-kit + # tests assume too much system access for them to be feasible for us right now +, withTests ? false # name argument , pname ? "systemd" @@ -123,7 +126,14 @@ assert withHomed -> withCryptsetup; assert withCryptsetup -> (cryptsetup != null); let wantCurl = withRemote || withImportd; - version = "249.7"; + wantGcrypt = withResolved || withImportd; + version = "250.4"; + + # Bump this variable on every (major) version change. See below (in the meson options list) for why. + # command: + # $ curl -s https://api.github.com/repos/systemd/systemd/releases/latest | \ + # jq '.created_at|strptime("%Y-%m-%dT%H:%M:%SZ")|mktime' + releaseTimestamp = "1640290180"; in stdenv.mkDerivation { inherit pname version; @@ -134,12 +144,12 @@ stdenv.mkDerivation { owner = "systemd"; repo = "systemd-stable"; rev = "v${version}"; - sha256 = "sha256-y33/BvvI+JyhsvuT1Cbm6J2Z72j71oXgLw6X9NwCMPE="; + sha256 = "sha256-AdzPh7dGVrGbbjL9+PqytQOpRzNDUUEftmKZAbFH3L4="; }; - # If these need to be regenerated, `git am path/to/00*.patch` them into a - # systemd worktree, rebase to the more recent systemd version, and export the - # patches again via `git -c format.signoff=false format-patch v${version}`. + # On major changes, or when otherwise required, you *must* reformat the patches, + # `git am path/to/00*.patch` them into a systemd worktree, rebase to the more recent + # systemd version, and export the patches again via `git -c format.signoff=false format-patch v${version}`. # Use `find . -name "*.patch" | sort` to get an up-to-date listing of all patches patches = [ ./0001-Start-device-units-for-uninitialised-encrypted-devic.patch @@ -166,42 +176,44 @@ stdenv.mkDerivation { # systemd. With the below patch we mitigate that effect by special casing # all our root unit dirs if they are symlinks. This does exactly what we # need (AFAICT). - # See https://github.com/systemd/systemd/pull/20479 for upsteam discussion. + # See https://github.com/systemd/systemd/pull/20479 for upstream discussion. ./0019-core-handle-lookup-paths-being-symlinks.patch - ] ++ lib.optional stdenv.hostPlatform.isMusl (let - oe-core = fetchzip { - url = "https://git.openembedded.org/openembedded-core/snapshot/openembedded-core-14c6e5a4b72d0e4665279158a0740dd1dc21f72f.tar.bz2"; - sha256 = "1jixya4czkr5p5rdcw3d6ips8zzr82dvnanvzvgjh67730scflya"; - }; - musl-patches = oe-core + "/meta/recipes-core/systemd/systemd"; - in [ - (musl-patches + "/0002-don-t-use-glibc-specific-qsort_r.patch") - (musl-patches + "/0003-missing_type.h-add-__compare_fn_t-and-comparison_fn_.patch") - (musl-patches + "/0004-add-fallback-parse_printf_format-implementation.patch") - (musl-patches + "/0005-src-basic-missing.h-check-for-missing-strndupa.patch") - (musl-patches + "/0006-Include-netinet-if_ether.h.patch") - (musl-patches + "/0007-don-t-fail-if-GLOB_BRACE-and-GLOB_ALTDIRFUNC-is-not-.patch") - (musl-patches + "/0008-add-missing-FTW_-macros-for-musl.patch") - (musl-patches + "/0009-fix-missing-of-__register_atfork-for-non-glibc-build.patch") - (musl-patches + "/0010-Use-uintmax_t-for-handling-rlim_t.patch") - (musl-patches + "/0011-test-sizeof.c-Disable-tests-for-missing-typedefs-in-.patch") - (musl-patches + "/0012-don-t-pass-AT_SYMLINK_NOFOLLOW-flag-to-faccessat.patch") - (musl-patches + "/0013-Define-glibc-compatible-basename-for-non-glibc-syste.patch") - (musl-patches + "/0014-Do-not-disable-buffering-when-writing-to-oom_score_a.patch") - (musl-patches + "/0015-distinguish-XSI-compliant-strerror_r-from-GNU-specif.patch") - (musl-patches + "/0016-Hide-__start_BUS_ERROR_MAP-and-__stop_BUS_ERROR_MAP.patch") - (musl-patches + "/0017-missing_type.h-add-__compar_d_fn_t-definition.patch") - (musl-patches + "/0018-avoid-redefinition-of-prctl_mm_map-structure.patch") - (musl-patches + "/0019-Handle-missing-LOCK_EX.patch") - (musl-patches + "/0021-test-json.c-define-M_PIl.patch") - (musl-patches + "/0022-do-not-disable-buffer-in-writing-files.patch") - (musl-patches + "/0025-Handle-__cpu_mask-usage.patch") - (musl-patches + "/0026-Handle-missing-gshadow.patch") - (musl-patches + "/0028-missing_syscall.h-Define-MIPS-ABI-defines-for-musl.patch") - - # Being discussed upstream: https://lists.openembedded.org/g/openembedded-core/topic/86411771#157056 - ./musl.diff - ]); + ] ++ lib.optional stdenv.hostPlatform.isMusl ( + let + oe-core = fetchzip { + url = "https://git.openembedded.org/openembedded-core/snapshot/openembedded-core-7e35a575ef09a85e625a81e0b4d80b020e3e3a92.tar.bz2"; + sha256 = "0dvz4685nk0y7nnq3sr2q8ab3wfx0bi8ilwcgn0h6kagwcnav2n8"; + }; + musl-patches = oe-core + "/meta/recipes-core/systemd/systemd"; + in + [ + (musl-patches + "/0002-don-t-use-glibc-specific-qsort_r.patch") + (musl-patches + "/0003-missing_type.h-add-__compare_fn_t-and-comparison_fn_.patch") + (musl-patches + "/0004-add-fallback-parse_printf_format-implementation.patch") + (musl-patches + "/0005-src-basic-missing.h-check-for-missing-strndupa.patch") + (musl-patches + "/0007-don-t-fail-if-GLOB_BRACE-and-GLOB_ALTDIRFUNC-is-not-.patch") + (musl-patches + "/0008-add-missing-FTW_-macros-for-musl.patch") + (musl-patches + "/0009-fix-missing-of-__register_atfork-for-non-glibc-build.patch") + (musl-patches + "/0010-Use-uintmax_t-for-handling-rlim_t.patch") + (musl-patches + "/0011-test-sizeof.c-Disable-tests-for-missing-typedefs-in-.patch") + (musl-patches + "/0012-don-t-pass-AT_SYMLINK_NOFOLLOW-flag-to-faccessat.patch") + (musl-patches + "/0013-Define-glibc-compatible-basename-for-non-glibc-syste.patch") + (musl-patches + "/0014-Do-not-disable-buffering-when-writing-to-oom_score_a.patch") + (musl-patches + "/0015-distinguish-XSI-compliant-strerror_r-from-GNU-specif.patch") + (musl-patches + "/0016-Hide-__start_BUS_ERROR_MAP-and-__stop_BUS_ERROR_MAP.patch") + (musl-patches + "/0017-missing_type.h-add-__compar_d_fn_t-definition.patch") + (musl-patches + "/0018-avoid-redefinition-of-prctl_mm_map-structure.patch") + (musl-patches + "/0019-Handle-missing-LOCK_EX.patch") + (musl-patches + "/0021-test-json.c-define-M_PIl.patch") + (musl-patches + "/0022-do-not-disable-buffer-in-writing-files.patch") + (musl-patches + "/0025-Handle-__cpu_mask-usage.patch") + (musl-patches + "/0026-Handle-missing-gshadow.patch") + (musl-patches + "/0028-missing_syscall.h-Define-MIPS-ABI-defines-for-musl.patch") + (musl-patches + "/0001-pass-correct-parameters-to-getdents64.patch") + (musl-patches + "/0002-Add-sys-stat.h-for-S_IFDIR.patch") + (musl-patches + "/0001-Adjust-for-musl-headers.patch") + ] + ); postPatch = '' substituteInPlace src/basic/path-util.h --replace "@defaultPathNormal@" "${placeholder "out"}/bin/" @@ -211,7 +223,7 @@ stdenv.mkDerivation { "find_program('${stdenv.cc.bintools.targetPrefix}objcopy'" '' + ( let - # The folllowing patches references to dynamic libraries to ensure that + # The following patches references to dynamic libraries to ensure that # all the features that are implemented via dlopen(3) are available (or # explicitly deactivated) by pointing dlopen to the absolute store path # instead of relying on the linkers runtime lookup code. @@ -267,7 +279,7 @@ stdenv.mkDerivation { { name = "libidn.so.12"; pkg = null; } { name = "libidn.so.11"; pkg = null; } - # journalctl --grep requires libpcre so lets provide it + # journalctl --grep requires libpcre so let's provide it { name = "libpcre2-8.so.0"; pkg = pcre2; } # Support for TPM2 in systemd-cryptsetup, systemd-repart and systemd-cryptenroll @@ -276,6 +288,10 @@ stdenv.mkDerivation { { name = "libtss2-mu.so.0"; pkg = opt withTpm2Tss tpm2-tss; } { name = "libtss2-tcti-"; pkg = opt withTpm2Tss tpm2-tss; } { name = "libfido2.so.1"; pkg = opt withFido2 libfido2; } + + # inspect-elf support + { name = "libelf.so.1"; pkg = opt withCoredump elfutils; } + { name = "libdw.so.1"; pkg = opt withCoredump elfutils; } ]; patchDlOpen = dl: @@ -294,7 +310,7 @@ stdenv.mkDerivation { # exceptional case, details: # https://github.com/systemd/systemd-stable/blob/v249-stable/src/shared/tpm2-util.c#L157 if ! [[ "${library}" =~ .*libtss2-tcti-$ ]]; then - echo 'The shared library `${library}` does not exist but was given as subtitute for `${dl.name}`' + echo 'The shared library `${library}` does not exist but was given as substitute for `${dl.name}`' exit 1 fi fi @@ -318,8 +334,8 @@ stdenv.mkDerivation { fi '' # Finally patch shebangs that might need patching. - # Should no longer be necessary with v250. - # https://github.com/systemd/systemd/pull/19638 + # Should no longer be necessary with v251. + # https://github.com/systemd/systemd/pull/21749 + '' patchShebangs . ''; @@ -356,16 +372,16 @@ stdenv.mkDerivation { [ acl audit - glib kmod libcap - libgcrypt libidn2 libuuid linuxHeaders pam ] + ++ lib.optional wantGcrypt libgcrypt + ++ lib.optional withTests glib ++ lib.optional withApparmor libapparmor ++ lib.optional wantCurl (lib.getDev curl) ++ lib.optionals withCompression [ bzip2 lz4 xz zstd ] @@ -389,6 +405,14 @@ stdenv.mkDerivation { mesonFlags = [ "-Dversion-tag=${version}" + # We bump this variable on every (major) version change to ensure + # that we have known-good value for a timestamp that is in the (not so distant) past. + # This serves as a lower bound for valid system timestamps during startup. Systemd will + # reset the system timestamp if this date is +- 15 years from the system time. + # See the systemd v250 release notes for further details: + # https://github.com/systemd/systemd/blob/60e930fc3e6eb8a36fbc184773119eb8d2f30364/NEWS#L258-L266 + "-Dtime-epoch=${releaseTimestamp}" + "-Ddbuspolicydir=${placeholder "out"}/share/dbus-1/system.d" "-Ddbussessionservicedir=${placeholder "out"}/share/dbus-1/services" "-Ddbussystemservicedir=${placeholder "out"}/share/dbus-1/system-services" @@ -400,11 +424,11 @@ stdenv.mkDerivation { "-Dsetfont-path=${kbd}/bin/setfont" "-Dtty-gid=3" # tty in NixOS has gid 3 "-Ddebug-shell=${bashInteractive}/bin/bash" - "-Dglib=${lib.boolToString (glib != null)}" + "-Dglib=${lib.boolToString withTests}" # while we do not run tests we should also not build them. Removes about 600 targets "-Dtests=false" "-Danalyze=${lib.boolToString withAnalyze}" - "-Dgcrypt=${lib.boolToString (libgcrypt != null)}" + "-Dgcrypt=${lib.boolToString wantGcrypt}" "-Dimportd=${lib.boolToString withImportd}" "-Dlz4=${lib.boolToString withCompression}" "-Dhomed=${lib.boolToString withHomed}" @@ -435,7 +459,11 @@ stdenv.mkDerivation { "-Dsmack=true" "-Db_pie=true" "-Dinstall-sysconfdir=false" - "-Defi-ld=${stdenv.cc.bintools.targetPrefix}ld" + "-Dsbat-distro=nixos" + "-Dsbat-distro-summary=NixOS" + "-Dsbat-distro-url=https://nixos.org/" + "-Dsbat-distro-pkgname=${pname}" + "-Dsbat-distro-version=${version}" /* As of now, systemd doesn't allow runtime configuration of these values. So the settings in /etc/login.defs have no effect on it. Many people think this @@ -448,7 +476,6 @@ stdenv.mkDerivation { */ "-Dsystem-uid-max=999" "-Dsystem-gid-max=999" - # "-Dtime-epoch=1" "-Dsysvinit-path=" "-Dsysvrcnd-path=" @@ -487,57 +514,96 @@ stdenv.mkDerivation { "-Dutmp=false" "-Didn=false" ]; + preConfigure = + let + # A list of all the runtime binaries that the systemd exectuables, tests and libraries are referencing in their source code, scripts and unit files. + # As soon as a dependency isn't required anymore we should remove it from the list. The `where` attribute for each of the replacement patterns must be exhaustive. If another (unhandled) case is found in the source code the build fails with an error message. + binaryReplacements = [ + { search = "/usr/bin/getent"; replacement = "${getent}/bin/getent"; where = [ "src/nspawn/nspawn-setuid.c" ]; } + + { + search = "/sbin/mkswap"; + replacement = "${lib.getBin util-linux}/sbin/mkswap"; + where = [ + "man/systemd-makefs@.service.xml" + ]; + } + { search = "/sbin/swapon"; replacement = "${lib.getBin util-linux}/sbin/swapon"; where = [ "src/core/swap.c" "src/basic/unit-def.h" ]; } + { search = "/sbin/swapoff"; replacement = "${lib.getBin util-linux}/sbin/swapoff"; where = [ "src/core/swap.c" ]; } + { + search = "/bin/echo"; + replacement = "${coreutils}/bin/echo"; + where = [ + "man/systemd-analyze.xml" + "man/systemd.service.xml" + "src/analyze/test-verify.c" + "src/test/test-env-file.c" + "src/test/test-fileio.c" + ]; + } + { + search = "/bin/cat"; + replacement = "${coreutils}/bin/cat"; + where = [ "test/create-busybox-container" "test/test-execute/exec-noexecpaths-simple.service" "src/journal/cat.c" ]; + } + { search = "/sbin/modprobe"; replacement = "${lib.getBin kmod}/sbin/modprobe"; where = [ "units/modprobe@.service" ]; } + { + search = "/usr/lib/systemd/systemd-fsck"; + replacement = "$out/lib/systemd/systemd-fsck"; + where = [ + "man/systemd-fsck@.service.xml" + ]; + } + ] ++ lib.optionals withImportd [ + { + search = "\"gpg\""; + replacement = "\\\"${gnupg}/bin/gpg\\\""; + where = [ "src/import/pull-common.c" ]; + } + { + search = "\"tar\""; + replacement = "\\\"${gnutar}/bin/tar\\\""; + where = [ + "src/import/export-tar.c" + "src/import/export.c" + "src/import/import-common.c" + "src/import/import-tar.c" + "src/import/import.c" + "src/import/importd.c" + "src/import/pull-tar.c" + "src/import/pull.c" + ]; + } + ]; + + # { replacement, search, where } -> List[str] + mkSubstitute = { replacement, search, where }: + map (path: "substituteInPlace ${path} --replace '${search}' \"${replacement}\"") where; + mkEnsureSubstituted = { replacement, search, where }: + '' + if [[ $(grep -r '${search}' | grep -v "${replacement}" | grep -Ev 'NEWS|^test/' | wc -l) -gt 0 ]]; then + echo "Not all references to '${search}' have been replaced. Found the following matches:" + grep '${search}' -r | grep -v "${replacement}" | grep -Ev 'NEWS|^test/' + exit 1 + fi + ''; - preConfigure = '' - mesonFlagsArray+=(-Dntp-servers="0.nixos.pool.ntp.org 1.nixos.pool.ntp.org 2.nixos.pool.ntp.org 3.nixos.pool.ntp.org") - export LC_ALL="en_US.UTF-8"; - # FIXME: patch this in systemd properly (and send upstream). - # already fixed in f00929ad622c978f8ad83590a15a765b4beecac9: (u)mount - for i in \ - src/core/mount.c \ - src/core/swap.c \ - src/cryptsetup/cryptsetup-generator.c \ - src/journal/cat.c \ - src/nspawn/nspawn.c \ - src/remount-fs/remount-fs.c \ - src/shared/generator.c \ - src/shutdown/shutdown.c \ - units/emergency.service.in \ - units/modprobe@.service \ - units/rescue.service.in \ - units/systemd-logind.service.in \ - units/systemd-nspawn@.service.in; \ - do - test -e $i - substituteInPlace $i \ - --replace /usr/bin/getent ${getent}/bin/getent \ - --replace /sbin/mkswap ${lib.getBin util-linux}/sbin/mkswap \ - --replace /sbin/swapon ${lib.getBin util-linux}/sbin/swapon \ - --replace /sbin/swapoff ${lib.getBin util-linux}/sbin/swapoff \ - --replace /bin/echo ${coreutils}/bin/echo \ - --replace /bin/cat ${coreutils}/bin/cat \ - --replace /sbin/sulogin ${lib.getBin util-linux}/sbin/sulogin \ - --replace /sbin/modprobe ${lib.getBin kmod}/sbin/modprobe \ - --replace /usr/lib/systemd/systemd-fsck $out/lib/systemd/systemd-fsck \ - --replace /bin/plymouth /run/current-system/sw/bin/plymouth # To avoid dependency - done + in + '' + mesonFlagsArray+=(-Dntp-servers="0.nixos.pool.ntp.org 1.nixos.pool.ntp.org 2.nixos.pool.ntp.org 3.nixos.pool.ntp.org") + export LC_ALL="en_US.UTF-8"; - for dir in tools src/resolve test src/test src/shared; do - patchShebangs $dir - done + ${lib.concatStringsSep "\n" (lib.flatten (map mkSubstitute binaryReplacements))} + ${lib.concatMapStringsSep "\n" mkEnsureSubstituted binaryReplacements} - # absolute paths to gpg & tar - substituteInPlace src/import/pull-common.c \ - --replace '"gpg"' '"${gnupg}/bin/gpg"' - for file in src/import/{{export,import,pull}-tar,import-common}.c; do - substituteInPlace $file \ - --replace '"tar"' '"${gnutar}/bin/tar"' - done + for dir in tools src/resolve test src/test src/shared; do + patchShebangs $dir + done - substituteInPlace src/libsystemd/sd-journal/catalog.c \ - --replace /usr/lib/systemd/catalog/ $out/lib/systemd/catalog/ - ''; + substituteInPlace src/libsystemd/sd-journal/catalog.c \ + --replace /usr/lib/systemd/catalog/ $out/lib/systemd/catalog/ + ''; # These defines are overridden by CFLAGS and would trigger annoying # warning messages @@ -545,7 +611,7 @@ stdenv.mkDerivation { substituteInPlace config.h \ --replace "POLKIT_AGENT_BINARY_PATH" "_POLKIT_AGENT_BINARY_PATH" \ --replace "SYSTEMD_BINARY_PATH" "_SYSTEMD_BINARY_PATH" \ - --replace "SYSTEMD_CGROUP_AGENT_PATH" "_SYSTEMD_CGROUP_AGENT_PATH" + --replace "SYSTEMD_CGROUP_AGENTS_PATH" "_SYSTEMD_CGROUP_AGENT_PATH" ''; NIX_CFLAGS_COMPILE = toString ([ @@ -557,8 +623,8 @@ stdenv.mkDerivation { # Set the release_agent on /sys/fs/cgroup/systemd to the # currently running systemd (/run/current-system/systemd) so # that we don't use an obsolete/garbage-collected release agent. - "-USYSTEMD_CGROUP_AGENT_PATH" - "-DSYSTEMD_CGROUP_AGENT_PATH=\"/run/current-system/systemd/lib/systemd/systemd-cgroups-agent\"" + "-USYSTEMD_CGROUP_AGENTS_PATH" + "-DSYSTEMD_CGROUP_AGENTS_PATH=\"/run/current-system/systemd/lib/systemd/systemd-cgroups-agent\"" "-USYSTEMD_BINARY_PATH" "-DSYSTEMD_BINARY_PATH=\"/run/current-system/systemd/lib/systemd/systemd\"" @@ -575,6 +641,12 @@ stdenv.mkDerivation { ''; postInstall = '' + # sysinit.target: Don't depend on + # systemd-tmpfiles-setup.service. This interferes with NixOps's + # send-keys feature (since sshd.service depends indirectly on + # sysinit.target). + mv $out/lib/systemd/system/sysinit.target.wants/systemd-tmpfiles-setup-dev.service $out/lib/systemd/system/multi-user.target.wants/ + mkdir -p $out/example/systemd mv $out/lib/{modules-load.d,binfmt.d,sysctl.d,tmpfiles.d} $out/example mv $out/lib/systemd/{system,user} $out/example/systemd diff --git a/pkgs/os-specific/linux/systemd/musl.diff b/pkgs/os-specific/linux/systemd/musl.diff deleted file mode 100644 index cab135dd8fc..00000000000 --- a/pkgs/os-specific/linux/systemd/musl.diff +++ /dev/null @@ -1,12 +0,0 @@ -diff --git a/src/shared/mount-setup.c b/src/shared/mount-setup.c -index ef3527e..cc1ba23 100644 ---- a/src/shared/mount-setup.c -+++ b/src/shared/mount-setup.c -@@ -32,6 +32,7 @@ - #include "strv.h" - #include "user-util.h" - #include "virt.h" -+#include "missing_type.h" - - typedef enum MountMode { - MNT_NONE = 0, diff --git a/pkgs/os-specific/linux/tiscamera/default.nix b/pkgs/os-specific/linux/tiscamera/default.nix index 38bc7c3eaff..1182aead36b 100644 --- a/pkgs/os-specific/linux/tiscamera/default.nix +++ b/pkgs/os-specific/linux/tiscamera/default.nix @@ -17,6 +17,7 @@ , python3Packages , libuuid , wrapGAppsHook +, catch2 }: stdenv.mkDerivation rec { @@ -30,6 +31,10 @@ stdenv.mkDerivation rec { sha256 = "0hpy9yhc4mn6w8gvzwif703smmcys0j2jqbz2xfghqxcyb0ykplj"; }; + postPatch = '' + cp ${catch2}/include/catch2/catch.hpp external/catch/catch.hpp + ''; + nativeBuildInputs = [ cmake pkg-config diff --git a/pkgs/os-specific/linux/util-linux/default.nix b/pkgs/os-specific/linux/util-linux/default.nix index bedd2417e7e..d54f577def3 100644 --- a/pkgs/os-specific/linux/util-linux/default.nix +++ b/pkgs/os-specific/linux/util-linux/default.nix @@ -4,11 +4,11 @@ }: stdenv.mkDerivation rec { - pname = "util-linux"; + pname = "util-linux" + lib.optionalString ( !nlsSupport && ncurses == null && systemd == null ) "-minimal"; version = "2.37.4"; src = fetchurl { - url = "mirror://kernel/linux/utils/util-linux/v${lib.versions.majorMinor version}/${pname}-${version}.tar.xz"; + url = "mirror://kernel/linux/utils/util-linux/v${lib.versions.majorMinor version}/util-linux-${version}.tar.xz"; sha256 = "sha256-Y05pFq2RM2bDU2tkaOeER2lUm5mnsr+AMU3nirVlW4M="; }; diff --git a/pkgs/os-specific/linux/vdo/default.nix b/pkgs/os-specific/linux/vdo/default.nix new file mode 100644 index 00000000000..1904445d4c2 --- /dev/null +++ b/pkgs/os-specific/linux/vdo/default.nix @@ -0,0 +1,64 @@ +{ lib, stdenv +, fetchFromGitHub +, installShellFiles +, libuuid +, lvm2_dmeventd # <libdevmapper-event.h> +, zlib +, python3 +}: + +stdenv.mkDerivation rec { + pname = "vdo"; + version = "8.1.1.360"; # kvdo uses this! + + src = fetchFromGitHub { + owner = "dm-vdo"; + repo = pname; + rev = version; + sha256 = "1zp8aaw0diramnlx5z96jcpbm6x0r204xf1vwq6k21rzcazczkwv"; + }; + + nativeBuildInputs = [ + installShellFiles + ]; + + buildInputs = [ + libuuid + lvm2_dmeventd + zlib + python3.pkgs.wrapPython + ]; + + propagatedBuildInputs = with python3.pkgs; [ + pyyaml + ]; + + pythonPath = propagatedBuildInputs; + + makeFlags = [ + "DESTDIR=${placeholder "out"}" + "INSTALLOWNER=" + # all of these paths are relative to DESTDIR and have defaults that don't work for us + "bindir=/bin" + "defaultdocdir=/share/doc" + "mandir=/share/man" + "python3_sitelib=${python3.sitePackages}" + ]; + + enableParallelBuilding = true; + + postInstall = '' + installShellCompletion --bash $out/bash_completion.d/* + rm -r $out/bash_completion.d + + wrapPythonPrograms + ''; + + meta = with lib; { + homepage = "https://github.com/dm-vdo/vdo"; + description = "A set of userspace tools for managing pools of deduplicated and/or compressed block storage"; + platforms = platforms.linux; + license = with licenses; [ gpl2Plus ]; + maintainers = with maintainers; [ ajs124 ]; + }; +} diff --git a/pkgs/servers/home-assistant/default.nix b/pkgs/servers/home-assistant/default.nix index ce72bb0f8ed..32273d35e7a 100644 --- a/pkgs/servers/home-assistant/default.nix +++ b/pkgs/servers/home-assistant/default.nix @@ -59,6 +59,18 @@ let }) (self: super: { + hatasmota = super.hatasmota.overridePythonAttrs (oldAttrs: { + version = "0.3.1"; + src = fetchFromGitHub { + owner = "emontnemery"; + repo = "hatasmota"; + rev = "0.3.1"; + sha256 = "sha256-/am6cRhAdiqMq0u7Ed4qhIA+Em2O0gIt7HfP19+2XHw="; + }; + }); + }) + + (self: super: { huawei-lte-api = super.huawei-lte-api.overridePythonAttrs (oldAttrs: rec { version = "1.4.18"; src = fetchFromGitHub { diff --git a/pkgs/servers/http/trafficserver/default.nix b/pkgs/servers/http/trafficserver/default.nix index 9058a4cbda7..06d640a5bc0 100644 --- a/pkgs/servers/http/trafficserver/default.nix +++ b/pkgs/servers/http/trafficserver/default.nix @@ -13,6 +13,7 @@ , python3 , xz , zlib +, catch2 # recommended dependencies , withHwloc ? true , hwloc @@ -113,6 +114,8 @@ stdenv.mkDerivation rec { tools/check-unused-dependencies substituteInPlace configure --replace '/usr/bin/file' '${file}/bin/file' + + cp ${catch2}/include/catch2/catch.hpp tests/include/catch.hpp '' + lib.optionalString stdenv.isLinux '' substituteInPlace configure \ --replace '/usr/include/linux' '${linuxHeaders}/include/linux' diff --git a/pkgs/servers/mail/postfix/default.nix b/pkgs/servers/mail/postfix/default.nix index 08c55f77172..942023b4eaf 100644 --- a/pkgs/servers/mail/postfix/default.nix +++ b/pkgs/servers/mail/postfix/default.nix @@ -1,5 +1,6 @@ { stdenv, lib, fetchurl, makeWrapper, gnused, db, openssl, cyrus_sasl, libnsl , coreutils, findutils, gnugrep, gawk, icu, pcre, m4 +, fetchpatch , buildPackages, nixosTests , withLDAP ? true, openldap , withPgSQL ? false, postgresql @@ -46,6 +47,12 @@ in stdenv.mkDerivation rec { ./postfix-3.0-no-warnings.patch ./post-install-script.patch ./relative-symlinks.patch + + # glibc 2.34 compat + (fetchpatch { + url = "https://src.fedoraproject.org/rpms/postfix/raw/2f9d42453e67ebc43f786d98262a249037f80a77/f/postfix-3.6.2-glibc-234-build-fix.patch"; + sha256 = "sha256-xRUL5gaoIt6HagGlhsGwvwrAfYvzMgydsltYMWvl9BI="; + }) ]; postPatch = lib.optionalString (stdenv.hostPlatform != stdenv.buildPlatform) '' diff --git a/pkgs/servers/misc/oven-media-engine/default.nix b/pkgs/servers/misc/oven-media-engine/default.nix index 7cd209f95e3..4760b2b7ccb 100644 --- a/pkgs/servers/misc/oven-media-engine/default.nix +++ b/pkgs/servers/misc/oven-media-engine/default.nix @@ -53,7 +53,7 @@ stdenv.mkDerivation rec { meta = with lib; { description = "Open-source streaming video service with sub-second latency"; homepage = "https://ovenmediaengine.com"; - license = licenses.gpl2Only; + license = licenses.agpl3Only; maintainers = with maintainers; [ lukegb ]; platforms = [ "x86_64-linux" ]; }; diff --git a/pkgs/servers/monitoring/grafana/default.nix b/pkgs/servers/monitoring/grafana/default.nix index e3877265ca3..c541c74d5be 100644 --- a/pkgs/servers/monitoring/grafana/default.nix +++ b/pkgs/servers/monitoring/grafana/default.nix @@ -4,7 +4,7 @@ buildGoModule rec { pname = "grafana"; version = "8.4.5"; - excludedPackages = "\\(alert_webhook_listener\\|clean-swagger\\|release_publisher\\|slow_proxy\\|slow_proxy_mac\\|macaron\\)"; + excludedPackages = [ "alert_webhook_listener" "clean-swagger" "release_publisher" "slow_proxy" "slow_proxy_mac" "macaron" ]; src = fetchFromGitHub { rev = "v${version}"; diff --git a/pkgs/servers/monitoring/heapster/default.nix b/pkgs/servers/monitoring/heapster/default.nix deleted file mode 100644 index d1205ae353b..00000000000 --- a/pkgs/servers/monitoring/heapster/default.nix +++ /dev/null @@ -1,28 +0,0 @@ -{ lib, buildGoPackage, fetchFromGitHub, docker }: - -buildGoPackage rec { - rev = "3057a2c07061c8d9ffaf77e5442ffd7512ac0133"; - pname = "heapster"; - version = lib.strings.substring 0 7 rev; - goPackagePath = "k8s.io/heapster"; - subPackages = [ "./" ]; - - src = fetchFromGitHub { - inherit rev; - owner = "kubernetes"; - repo = "heapster"; - sha256 = "1vg83207y7yigydnnhlvzs3s94vx02i56lqgs6a96c6i3mr3ydpb"; - }; - - preBuild = '' - export GOPATH=$GOPATH:$NIX_BUILD_TOP/go/src/${goPackagePath}/Godeps/_workspace - ''; - - meta = with lib; { - description = "Compute Resource Usage Analysis and Monitoring of Container Clusters"; - license = licenses.asl20; - homepage = "https://github.com/kubernetes/heapster"; - maintainers = with maintainers; [ offline ]; - platforms = docker.meta.platforms; - }; -} diff --git a/pkgs/servers/monitoring/munin/default.nix b/pkgs/servers/monitoring/munin/default.nix index 258247c34f4..e8fa4feb6af 100644 --- a/pkgs/servers/monitoring/munin/default.nix +++ b/pkgs/servers/monitoring/munin/default.nix @@ -13,8 +13,11 @@ stdenv.mkDerivation rec { sha256 = "sha256-p273O5JLFX1dA2caV3lVVL9YNTcGMSrC7DWieUfUmqI="; }; - buildInputs = [ + nativeBuildInputs = [ makeWrapper + ]; + + buildInputs = [ which coreutils rrdtool diff --git a/pkgs/servers/monitoring/prometheus/mesos-exporter.nix b/pkgs/servers/monitoring/prometheus/mesos-exporter.nix deleted file mode 100644 index 289b8f2403d..00000000000 --- a/pkgs/servers/monitoring/prometheus/mesos-exporter.nix +++ /dev/null @@ -1,23 +0,0 @@ -{ lib, buildGoPackage, fetchFromGitHub }: - -buildGoPackage rec { - pname = "mesos_exporter"; - version = "1.1.2"; - - goPackagePath = "github.com/prometheus/mesos_exporter"; - - src = fetchFromGitHub { - rev = "v${version}"; - owner = "mesos"; - repo = "mesos_exporter"; - sha256 = "0nvjlpxdhh60wcdw2fdc8h0vn6fxkz0nh7zrx43hjxymvc15ixza"; - }; - - meta = with lib; { - description = "Export Mesos metrics to Prometheus"; - homepage = "https://github.com/prometheus/mesos_exporter"; - license = licenses.asl20; - maintainers = with maintainers; [ benley ]; - platforms = platforms.unix; - }; -} diff --git a/pkgs/servers/nosql/arangodb/default.nix b/pkgs/servers/nosql/arangodb/default.nix index bf7f7b43960..d9f1892beca 100644 --- a/pkgs/servers/nosql/arangodb/default.nix +++ b/pkgs/servers/nosql/arangodb/default.nix @@ -1,4 +1,4 @@ -{ stdenv, lib, fetchFromGitHub, openssl, zlib, cmake, python2, perl, snappy, lzo, which }: +{ stdenv, lib, fetchFromGitHub, openssl, zlib, cmake, python2, perl, snappy, lzo, which, catch2, catch }: let common = { version, sha256 }: stdenv.mkDerivation { @@ -26,6 +26,14 @@ let # with nixpkgs, it has no sense to check for a version update substituteInPlace js/client/client.js --replace "require('@arangodb').checkAvailableVersions();" "" substituteInPlace js/server/server.js --replace "require('@arangodb').checkAvailableVersions();" "" + + ${if (lib.versionOlder version "3.4") then '' + cp ${catch}/include/catch/catch.hpp 3rdParty/catch/catch.hpp + '' else if (lib.versionOlder version "3.5") then '' + cp ${catch2}/include/catch2/catch.hpp 3rdParty/catch/catch.hpp + '' else '' + (cd 3rdParty/boost/1.69.0 && patch -p1 < ${../../../development/libraries/boost/pthread-stack-min-fix.patch}) + ''} ''; cmakeFlags = [ diff --git a/pkgs/servers/owncast/default.nix b/pkgs/servers/owncast/default.nix index 774f51bc0f6..313d17e8e8d 100644 --- a/pkgs/servers/owncast/default.nix +++ b/pkgs/servers/owncast/default.nix @@ -15,7 +15,7 @@ buildGoModule rec { propagatedBuildInputs = [ ffmpeg ]; - buildInputs = [ makeWrapper ]; + nativeBuildInputs = [ makeWrapper ]; preInstall = '' mkdir -p $out diff --git a/pkgs/servers/rt/default.nix b/pkgs/servers/rt/default.nix index ff0bbd6b97d..2b5188f743a 100644 --- a/pkgs/servers/rt/default.nix +++ b/pkgs/servers/rt/default.nix @@ -18,10 +18,10 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ autoreconfHook + makeWrapper ]; buildInputs = [ - makeWrapper perl (buildEnv { name = "rt-perl-deps"; diff --git a/pkgs/servers/ursadb/default.nix b/pkgs/servers/ursadb/default.nix index 836a5934d96..c9b39eccd8a 100644 --- a/pkgs/servers/ursadb/default.nix +++ b/pkgs/servers/ursadb/default.nix @@ -11,6 +11,14 @@ stdenv.mkDerivation rec { hash = "sha256-/EK1CKJ0IR7fkKSpQkONbWcz6uhUoAwK430ljNYsV5U="; }; + postPatch = '' + substituteInPlace CMakeLists.txt \ + --replace \ + "add_executable(ursadb_test Tests.cpp)" "" \ + --replace \ + "target_link_libraries(ursadb_test ursa)" "" + ''; + installPhase = '' mkdir -p $out/bin cp ursadb $out/bin/ diff --git a/pkgs/servers/xmpp/prosody/default.nix b/pkgs/servers/xmpp/prosody/default.nix index 1556250447a..6b70c4cc987 100644 --- a/pkgs/servers/xmpp/prosody/default.nix +++ b/pkgs/servers/xmpp/prosody/default.nix @@ -72,17 +72,17 @@ stdenv.mkDerivation rec { cp -r $communityModules/mod_${module} $out/lib/prosody/modules/ '') (lib.lists.unique(nixosModuleDeps ++ withCommunityModules ++ withOnlyInstalledCommunityModules))} wrapProgram $out/bin/prosody \ - --set LUA_PATH "$luaEnvPath" \ - --set LUA_CPATH "$luaEnvCPath" + --prefix LUA_PATH ';' "$luaEnvPath" \ + --prefix LUA_CPATH ';' "$luaEnvCPath" wrapProgram $out/bin/prosodyctl \ --add-flags '--config "/etc/prosody/prosody.cfg.lua"' \ - --set LUA_PATH "$luaEnvPath" \ - --set LUA_CPATH "$luaEnvCPath" + --prefix LUA_PATH ';' "$luaEnvPath" \ + --prefix LUA_CPATH ';' "$luaEnvCPath" make -C tools/migration install wrapProgram $out/bin/prosody-migrator \ - --set LUA_PATH "$luaEnvPath" \ - --set LUA_CPATH "$luaEnvCPath" + --prefix LUA_PATH ';' "$luaEnvPath" \ + --prefix LUA_CPATH ';' "$luaEnvCPath" ''; passthru = { diff --git a/pkgs/shells/zsh/oh-my-zsh/default.nix b/pkgs/shells/zsh/oh-my-zsh/default.nix index 082472b9cd3..1b777d96696 100644 --- a/pkgs/shells/zsh/oh-my-zsh/default.nix +++ b/pkgs/shells/zsh/oh-my-zsh/default.nix @@ -5,15 +5,15 @@ , git, nix, nixfmt, jq, coreutils, gnused, curl, cacert }: stdenv.mkDerivation rec { - version = "2022-03-31"; + version = "2022-04-04"; pname = "oh-my-zsh"; - rev = "53863e7b3ff0c2e2816e90dab3d870adebdf49c7"; + rev = "4d9e5ce9a7d8db3c3aadcae81580a5c3ff5a0e8b"; src = fetchFromGitHub { inherit rev; owner = "ohmyzsh"; repo = "ohmyzsh"; - sha256 = "TQOGSAzcJfcUNTzUcCI5tTlAKD1JYtH9CiPnfHZaA9E="; + sha256 = "Plg7mr6ZOSzUpq5XMFkebVpCjdtwe237+4sVdtL+kLM="; }; installPhase = '' diff --git a/pkgs/stdenv/generic/make-derivation.nix b/pkgs/stdenv/generic/make-derivation.nix index 2465449867c..8749e8b7555 100644 --- a/pkgs/stdenv/generic/make-derivation.nix +++ b/pkgs/stdenv/generic/make-derivation.nix @@ -219,9 +219,11 @@ else let # it again. staticMarker = lib.optionalString stdenv.hostPlatform.isStatic "-static"; in + lib.strings.sanitizeDerivationName ( if attrs ? name then attrs.name + hostSuffix - else "${attrs.pname}${staticMarker}${hostSuffix}-${attrs.version}"; + else "${attrs.pname}${staticMarker}${hostSuffix}-${attrs.version}" + ); }) // { builder = attrs.realBuilder or stdenv.shell; args = attrs.args or ["-e" (attrs.builder or ./default-builder.sh)]; @@ -340,8 +342,9 @@ else let # passed to the builder and is not a dependency. But since we # include it in the result, it *is* available to nix-env for queries. meta = { - # `name` above includes cross-compilation cruft (and is under assert), - # lets have a clean always accessible version here. + # `name` above includes cross-compilation cruft, + # is under assert, and is sanitized. + # Let's have a clean always accessible version here. name = attrs.name or "${attrs.pname}-${attrs.version}"; # If the packager hasn't specified `outputsToInstall`, choose a default, diff --git a/pkgs/stdenv/generic/setup.sh b/pkgs/stdenv/generic/setup.sh index 0777fa830c1..350fff48252 100644 --- a/pkgs/stdenv/generic/setup.sh +++ b/pkgs/stdenv/generic/setup.sh @@ -143,14 +143,14 @@ exitHandler() { echo "build failed with exit code $exitCode (ignored)" mkdir -p "$out/nix-support" printf "%s" "$exitCode" > "$out/nix-support/failed" - exit 0 + return 0 fi else runHook exitHook fi - exit "$exitCode" + return "$exitCode" } trap "exitHandler" EXIT diff --git a/pkgs/stdenv/linux/make-bootstrap-tools.nix b/pkgs/stdenv/linux/make-bootstrap-tools.nix index 84b63e7b8fd..1d6ebe6284f 100644 --- a/pkgs/stdenv/linux/make-bootstrap-tools.nix +++ b/pkgs/stdenv/linux/make-bootstrap-tools.nix @@ -74,6 +74,9 @@ in with pkgs; rec { cp -d ${libc.out}/lib/libresolv*.so* $out/lib cp -d ${libc.out}/lib/crt?.o $out/lib + # Hacky compat with our current unpack-bootstrap-tools.sh + ln -s librt.so "$out"/lib/librt-dummy.so + cp -rL ${libc.dev}/include $out chmod -R u+w "$out" diff --git a/pkgs/test/default.nix b/pkgs/test/default.nix index 0e1b9c2ac7a..63aaf6bb72e 100644 --- a/pkgs/test/default.nix +++ b/pkgs/test/default.nix @@ -59,6 +59,7 @@ with pkgs; trivial-builders = recurseIntoAttrs { writeStringReferencesToFile = callPackage ../build-support/trivial-builders/test/writeStringReferencesToFile.nix {}; + writeTextFile = callPackage ../build-support/trivial-builders/test/write-text-file.nix {}; references = callPackage ../build-support/trivial-builders/test/references.nix {}; overriding = callPackage ../build-support/trivial-builders/test-overriding.nix {}; concat = callPackage ../build-support/trivial-builders/test/concat-test.nix {}; diff --git a/pkgs/tools/X11/obconf/default.nix b/pkgs/tools/X11/obconf/default.nix index 8074e52c7cf..5ffef951d51 100644 --- a/pkgs/tools/X11/obconf/default.nix +++ b/pkgs/tools/X11/obconf/default.nix @@ -13,6 +13,7 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ autoreconfHook + makeWrapper pkg-config ]; @@ -22,7 +23,6 @@ stdenv.mkDerivation rec { libSM libstartup_notification libxml2 - makeWrapper openbox ]; diff --git a/pkgs/tools/X11/xnee/default.nix b/pkgs/tools/X11/xnee/default.nix index c3355b80263..00ebb1ecec2 100644 --- a/pkgs/tools/X11/xnee/default.nix +++ b/pkgs/tools/X11/xnee/default.nix @@ -15,6 +15,12 @@ stdenv.mkDerivation rec { do sed -i "$i" -e's|/bin/bash|${stdenv.shell}|g ; s|/usr/bin/env bash|${stdenv.shell}|g' done + + # Fix for glibc-2.34. For some reason, `LIBSEMA="CCC"` is added + # if `sem_init` is part of libc which causes errors like + # `gcc: error: CCC: No such file or directory` during the build. + substituteInPlace configure \ + --replace 'LIBSEMA="CCC"' 'LIBSEMA=""' ''; buildInputs = diff --git a/pkgs/tools/admin/awscli/default.nix b/pkgs/tools/admin/awscli/default.nix index 11cf6c53076..1e82459f4c6 100644 --- a/pkgs/tools/admin/awscli/default.nix +++ b/pkgs/tools/admin/awscli/default.nix @@ -35,11 +35,11 @@ let in with py.pkgs; buildPythonApplication rec { pname = "awscli"; - version = "1.22.35"; # N.B: if you change this, change botocore and boto3 to a matching version too + version = "1.22.67"; # N.B: if you change this, change botocore and boto3 to a matching version too src = fetchPypi { inherit pname version; - hash = "sha256-GsMclLh/VtPaNjD+XDKqTYeSX29R2aRS7If9G918OWY="; + hash = "sha256-ofgxL9V/jTn/itxSOLGYkAmgQXES7aVUM/vM6nWdbBc="; }; # https://github.com/aws/aws-cli/issues/4837 diff --git a/pkgs/tools/admin/awscli2/default.nix b/pkgs/tools/admin/awscli2/default.nix index 08fb92e4ea6..16c547dbeba 100644 --- a/pkgs/tools/admin/awscli2/default.nix +++ b/pkgs/tools/admin/awscli2/default.nix @@ -33,13 +33,13 @@ let in with py.pkgs; buildPythonApplication rec { pname = "awscli2"; - version = "2.4.19"; # N.B: if you change this, change botocore to a matching version too + version = "2.4.23"; # N.B: if you change this, change botocore to a matching version too src = fetchFromGitHub { owner = "aws"; repo = "aws-cli"; rev = version; - sha256 = "sha256-ZOSZBZT4d5jv5lg8KkGoOJqAvStUsGZbiXp3dpsrOpo="; + sha256 = "sha256-zpkphlIfmexqZm0lZgDP3RoQJqTpFdT+5dGtaLiRr/U="; }; propagatedBuildInputs = [ @@ -69,7 +69,6 @@ with py.pkgs; buildPythonApplication rec { postPatch = '' substituteInPlace setup.cfg \ --replace "colorama>=0.2.5,<0.4.4" "colorama" \ - --replace "cryptography>=3.3.2,<3.4.0" "cryptography" \ --replace "docutils>=0.10,<0.16" "docutils" \ --replace "ruamel.yaml>=0.15.0,<0.16.0" "ruamel.yaml" \ --replace "wcwidth<0.2.0" "wcwidth" \ diff --git a/pkgs/tools/admin/azure-cli/default.nix b/pkgs/tools/admin/azure-cli/default.nix index efd1ecfee3c..01cb5081cf4 100644 --- a/pkgs/tools/admin/azure-cli/default.nix +++ b/pkgs/tools/admin/azure-cli/default.nix @@ -1,7 +1,7 @@ { stdenv, lib, python3, fetchFromGitHub, installShellFiles }: let - version = "2.32.0"; + version = "2.34.1"; srcName = "azure-cli-${version}-src"; src = fetchFromGitHub { @@ -9,7 +9,7 @@ let owner = "Azure"; repo = "azure-cli"; rev = "azure-cli-${version}"; - sha256 = "sha256-PXY32bfuK0bQGI0N+XHs9lakF6K7+WjrHMvuNgDFSJM="; + sha256 = "sha256-BEEwxf3UTShKi3K/uBK1yMxyPCvybL/BbKsu8XAwu0M="; }; # put packages that needs to be overriden in the py package scope diff --git a/pkgs/tools/admin/azure-cli/python-packages.nix b/pkgs/tools/admin/azure-cli/python-packages.nix index d27805bb257..5b8732f5375 100644 --- a/pkgs/tools/admin/azure-cli/python-packages.nix +++ b/pkgs/tools/admin/azure-cli/python-packages.nix @@ -69,7 +69,8 @@ let postPatch = '' substituteInPlace setup.py \ --replace "requests[socks]~=2.25.1" "requests[socks]~=2.25" \ - --replace "cryptography>=3.2,<3.4" "cryptography" + --replace "cryptography>=3.2,<3.4" "cryptography" \ + --replace "msal-extensions>=0.3.1,<0.4" "msal-extensions" ''; checkInputs = with self; [ pytest ]; @@ -117,11 +118,11 @@ let ''; }; - azure-batch = overrideAzureMgmtPackage super.azure-batch "11.0.0" "zip" - "sha256-zl/bDsli7d/oXNgiBekXfLC720RSZXRuOLO7vx8W3HM="; + azure-batch = overrideAzureMgmtPackage super.azure-batch "12.0.0" "zip" + "sha256-GpseF4mEp79JWvZ7zOUfDbHkqKlXr7KeM1VKFKlnTes="; - azure-mgmt-apimanagement = overrideAzureMgmtPackage super.azure-mgmt-apimanagement "0.2.0" "zip" - "0whx3s8ri9939r3pdvjf8iqcslas1xy6cnccidmp10r5ng0023vr"; + azure-mgmt-apimanagement = overrideAzureMgmtPackage super.azure-mgmt-apimanagement "3.0.0" "zip" + "9262f54ed387eb083d8dae66d32a8df35647319b902bd498cdc376f50a12d154"; azure-mgmt-batch = overrideAzureMgmtPackage super.azure-mgmt-batch "16.0.0" "zip" "1b3cecd6f16813879c6ac1a1bb01f9a6f2752cd1f9157eb04d5e41e4a89f3c34"; @@ -156,8 +157,8 @@ let azure-mgmt-cognitiveservices = overrideAzureMgmtPackage super.azure-mgmt-cognitiveservices "13.0.0" "zip" "dc6116e8394d45312c7ad5a9098ce0dd2370bd92d43afd33d8b3bfab724fa498"; - azure-mgmt-compute = overrideAzureMgmtPackage super.azure-mgmt-compute "23.1.0" "zip" - "sha256-Sduw9RAG1VfL0LIpmcuezz6rwr5G2W78xtZRxrM3VLM="; + azure-mgmt-compute = overrideAzureMgmtPackage super.azure-mgmt-compute "25.0.0" "zip" + "sha256-Y0WNBtQ9v0yhTVFfTvfcudWHOjzGagGB+/b++3Ie5Kk="; azure-mgmt-consumption = overrideAzureMgmtPackage super.azure-mgmt-consumption "2.0.0" "zip" "12ai4qps73ivawh0yzvgb148ksx02r30pqlvfihx497j62gsi1cs"; @@ -165,8 +166,8 @@ let azure-mgmt-containerinstance = overrideAzureMgmtPackage super.azure-mgmt-containerinstance "9.1.0" "zip" "sha256-N+zUTEnOyn18lDHlkUj+vRXX/sJhZR7XLd1YdV50ULA="; - azure-mgmt-containerservice = overrideAzureMgmtPackage super.azure-mgmt-containerservice "16.1.0" "zip" - "sha256-NlTIrOK4ho0OqcTHjHT1HobiMzDH2KY20TIlN0fm8/Q="; + azure-mgmt-containerservice = overrideAzureMgmtPackage super.azure-mgmt-containerservice "17.0.0" "zip" + "sha256-oUbWdZryabCCg/gTujchT7p1nS7IDoU5W9MQ4ekJYH8="; azure-mgmt-cosmosdb = overrideAzureMgmtPackage super.azure-mgmt-cosmosdb "7.0.0b2" "zip" "sha256-hVvYW9gkfTVMwis3IdD0JXYDxdKcyyzIFx3hNk7VMLI="; @@ -183,11 +184,11 @@ let azure-mgmt-imagebuilder = overrideAzureMgmtPackage super.azure-mgmt-imagebuilder "1.0.0" "zip" "634e398de9a23e712aa27a4a59f9ea5d5091d1dfcfed5ac977230918872c4430"; - azure-mgmt-iothub = overrideAzureMgmtPackage super.azure-mgmt-iothub "2.1.0" "zip" - "2724f48cadb1be7ee96fc26c7bfa178f82cea5d325e785e91d9f26965fa8e46f"; + azure-mgmt-iothub = overrideAzureMgmtPackage super.azure-mgmt-iothub "2.2.0" "zip" + "sha256-nsAeVhs5N8bpwYenmRwJmqF/IAqz/ulSoYIeOU5l0eM="; - azure-mgmt-iothubprovisioningservices = overrideAzureMgmtPackage super.azure-mgmt-iothubprovisioningservices "1.0.0" "zip" - "e5871b03488b5ae6dfc441cdbda40cb39c000635ee57c513053792b3c15826a9"; + azure-mgmt-iothubprovisioningservices = overrideAzureMgmtPackage super.azure-mgmt-iothubprovisioningservices "1.1.0" "zip" + "sha256-04OoJuff93L62G6IozpmHpEaUbHHHD6nKlkMHVoJvJ4="; azure-mgmt-iotcentral = overrideAzureMgmtPackage super.azure-mgmt-iotcentral "9.0.0" "zip" "64df73df449a6f3717f3d0963e5869224ed3e6216c79de571493bea7c1b52cb6"; @@ -198,14 +199,14 @@ let azure-mgmt-devtestlabs = overrideAzureMgmtPackage super.azure-mgmt-devtestlabs "4.0.0" "zip" "1397ksrd61jv7400mgn8sqngp6ahir55fyq9n5k69wk88169qm2r"; - azure-mgmt-netapp = overrideAzureMgmtPackage super.azure-mgmt-netapp "5.1.0" "zip" - "sha256-MGCICI7hDobEzyTMgqnKYZ21zfwNo/ogfQDsf3fwbo4="; + azure-mgmt-netapp = overrideAzureMgmtPackage super.azure-mgmt-netapp "6.0.1" "zip" + "6ce683587be1638d8d77620b7af118060b8b7dfc4fd23d46a623a66edcb388e1"; azure-mgmt-dns = overrideAzureMgmtPackage super.azure-mgmt-dns "8.0.0" "zip" "407c2dacb33513ffbe9ca4be5addb5e9d4bae0cb7efa613c3f7d531ef7bf8de8"; - azure-mgmt-loganalytics = overrideAzureMgmtPackage super.azure-mgmt-loganalytics "12.0.0" "zip" - "da128a7e0291be7fa2063848df92a9180cf5c16d42adc09d2bc2efd711536bfb"; + azure-mgmt-loganalytics = overrideAzureMgmtPackage super.azure-mgmt-loganalytics "13.0.0b2" "zip" + "sha256-j8CyWZGF7Z/5szJ+CD96E0EbNsceJ1SScrlPqWVLjnk="; azure-mgmt-network = overrideAzureMgmtPackage super.azure-mgmt-network "19.3.0" "zip" "0b6a1ccdffd76e057ab16a6c319740a0ca68d59fedf7e9c02f2437396e72aa11"; @@ -216,8 +217,8 @@ let azure-mgmt-managedservices = overrideAzureMgmtPackage super.azure-mgmt-managedservices "1.0.0" "zip" "sha256-/tg5n8Z3Oq2jfB0ElqRvWUENd8lJTQyllnxTHDN2rRk="; - azure-mgmt-managementgroups = overrideAzureMgmtPackage super.azure-mgmt-managementgroups "0.1.0" "zip" - "sha256-/2LZgu3aY0o2Fgyx0Vo2epVypay0GeXnrTcejIO9R8c="; + azure-mgmt-managementgroups = overrideAzureMgmtPackage super.azure-mgmt-managementgroups "1.0.0" "zip" + "bab9bd532a1c34557f5b0ab9950e431e3f00bb96e8a3ce66df0f6ce2ae19cd73"; azure-mgmt-marketplaceordering = overrideAzureMgmtPackage super.azure-mgmt-marketplaceordering "1.1.0" "zip" "68b381f52a4df4435dacad5a97e1c59ac4c981f667dcca8f9d04453417d60ad8"; @@ -231,8 +232,8 @@ let azure-mgmt-privatedns = overrideAzureMgmtPackage super.azure-mgmt-privatedns "1.0.0" "zip" "b60f16e43f7b291582c5f57bae1b083096d8303e9d9958e2c29227a55cc27c45"; - azure-mgmt-web = overrideAzureMgmtPackage super.azure-mgmt-web "4.0.0" "zip" - "sha256-5XQ3qTPn3qmwYY/nkODa3GP5hXc1NhrItfXoBiucKg0="; + azure-mgmt-web = overrideAzureMgmtPackage super.azure-mgmt-web "6.1.0" "zip" + "c26635089276515b0488fcf014aab50a0446f54800c6e0e5583cc493ac8d738f"; azure-mgmt-redhatopenshift = overrideAzureMgmtPackage super.azure-mgmt-redhatopenshift "1.0.0" "zip" "94cd41f1ebd82e40620fd3e6d88f666b5c19ac7cf8b4e8edadb9721bd7c80980"; @@ -291,11 +292,11 @@ let azure-mgmt-authorization = overrideAzureMgmtPackage super.azure-mgmt-authorization "0.61.0" "zip" "0xfvx2dvfj3fbz4ngn860ipi4v6gxqajyjc8x92r8knhmniyxk7m"; - azure-mgmt-storage = overrideAzureMgmtPackage super.azure-mgmt-storage "19.0.0" "zip" - "f05963e5a8696d0fd4dcadda4feecb9b382a380d2e461b3647704ac787d79876"; + azure-mgmt-storage = overrideAzureMgmtPackage super.azure-mgmt-storage "19.1.0" "zip" + "sha256-Seoi8A4JZaNVCvNKQcGh06SBaQ9lAMeOhUCIAvVtdBY="; - azure-mgmt-servicebus = overrideAzureMgmtPackage super.azure-mgmt-servicebus "6.0.0" "zip" - "f6c64ed97d22d0c03c4ca5fc7594bd0f3d4147659c10110160009b93f541298e"; + azure-mgmt-servicebus = overrideAzureMgmtPackage super.azure-mgmt-servicebus "7.1.0" "zip" + "d8ae7905fb7d3e24822daa20aa7bc5014f41aa18b48ea2d0161e997fc11a3d36"; azure-mgmt-servicefabric = overrideAzureMgmtPackage super.azure-mgmt-servicefabric "1.0.0" "zip" "de35e117912832c1a9e93109a8d24cab94f55703a9087b2eb1c5b0655b3b1913"; @@ -413,12 +414,12 @@ let }); azure-keyvault-keys = super.azure-keyvault-keys.overridePythonAttrs(oldAttrs: rec { - version = "4.5.0b4"; + version = "4.5.0b6"; src = super.fetchPypi { inherit (oldAttrs) pname; inherit version; extension = "zip"; - sha256 = "sha256-f43ZTMFc0IVIaa69gEZFOLALREcx3RRCFoYDY2FYLrY="; + sha256 = "sha256-WFSRJaia0+WnvGxoMYZIvf81ue51VPYXzTp8huUh1fc="; }; }); @@ -481,18 +482,6 @@ let }; }); - PyGithub = super.PyGithub.overridePythonAttrs(oldAttrs: rec { - version = "1.38"; - - src = super.fetchPypi { - inherit (oldAttrs) pname; - inherit version; - sha256 = "sha256-HtCPd17FBnvIRStyveLbuVz05S/yvVDMMsackf+tknI="; - }; - - doCheck = false; - }); - knack = super.knack.overridePythonAttrs(oldAttrs: rec { version = "0.9.0"; diff --git a/pkgs/tools/admin/trivy/default.nix b/pkgs/tools/admin/trivy/default.nix index 0d88df6185a..83bdea6d49e 100644 --- a/pkgs/tools/admin/trivy/default.nix +++ b/pkgs/tools/admin/trivy/default.nix @@ -5,16 +5,16 @@ buildGoModule rec { pname = "trivy"; - version = "0.25.0"; + version = "0.25.2"; src = fetchFromGitHub { owner = "aquasecurity"; repo = pname; rev = "v${version}"; - sha256 = "sha256-jlLE8io7/Yhu0rF7brV9YhDIsZBANZtatnWbgoHMReg="; + sha256 = "sha256-yDoHDOPtPX5u8K2/fnj6dgqlI+WUCsuxbdKtb/UtIRQ="; }; - vendorSha256 = "sha256-hOurOL7xowgBs9gXa++X7+iOKJJ6WjekGGFiR9Q0OEU="; + vendorSha256 = "sha256-HZpGPCayrnayOg+3mB8Tw+5M2IfIpIvzP7qfY1OL7tk="; excludedPackages = "misc"; diff --git a/pkgs/tools/compression/bzip2/default.nix b/pkgs/tools/compression/bzip2/default.nix index da37cf9fbd8..cd262875a76 100644 --- a/pkgs/tools/compression/bzip2/default.nix +++ b/pkgs/tools/compression/bzip2/default.nix @@ -44,6 +44,10 @@ stdenv.mkDerivation rec { enableParallelBuilding = true; + postInstall = '' + ln -s $out/lib/libbz2.so.1.0.* $out/lib/libbz2.so.1.0 + ''; + meta = with lib; { description = "High-quality data compression program"; homepage = "https://www.sourceware.org/bzip2"; diff --git a/pkgs/tools/filesystems/btrfs-progs/default.nix b/pkgs/tools/filesystems/btrfs-progs/default.nix index c51cc12da36..fad1944c4a0 100644 --- a/pkgs/tools/filesystems/btrfs-progs/default.nix +++ b/pkgs/tools/filesystems/btrfs-progs/default.nix @@ -7,11 +7,11 @@ stdenv.mkDerivation rec { pname = "btrfs-progs"; - version = "5.16.1"; + version = "5.16.2"; src = fetchurl { url = "mirror://kernel/linux/kernel/people/kdave/btrfs-progs/btrfs-progs-v${version}.tar.xz"; - sha256 = "sha256-PaTaU2HPhr3dqA7bTE8w6gdstOvsKZBPoIr8kw754ag="; + sha256 = "sha256-npswOh0P2c6q8gTudMHI+h/VV5TiI9n+K8Yodey9U9I="; }; nativeBuildInputs = [ diff --git a/pkgs/tools/filesystems/buttersink/default.nix b/pkgs/tools/filesystems/buttersink/default.nix deleted file mode 100644 index aa0f317787f..00000000000 --- a/pkgs/tools/filesystems/buttersink/default.nix +++ /dev/null @@ -1,30 +0,0 @@ -{ lib, python2 }: - -python2.pkgs.buildPythonApplication rec { - pname = "buttersink"; - version = "0.6.9"; - - src = python2.pkgs.fetchPypi { - inherit pname version; - sha256 = "a797b6e92ad2acdf41e033c1368ab365aa268f4d8458b396a5770fa6c2bc3f54"; - }; - - propagatedBuildInputs = with python2.pkgs; [ boto crcmod psutil ]; - - # No tests implemented - doCheck = false; - - meta = with lib; { - description = "Synchronise btrfs snapshots"; - longDescription = '' - ButterSink is like rsync, but for btrfs subvolumes instead of files, - which makes it much more efficient for things like archiving backup - snapshots. It is built on top of btrfs send and receive capabilities. - Sources and destinations can be local btrfs file systems, remote btrfs - file systems over SSH, or S3 buckets. - ''; - homepage = "https://github.com/AmesCornish/buttersink/wiki"; - license = licenses.gpl3; - platforms = platforms.linux; - }; -} diff --git a/pkgs/tools/filesystems/djmount/default.nix b/pkgs/tools/filesystems/djmount/default.nix index f5b0a0315df..3111be5b4d1 100644 --- a/pkgs/tools/filesystems/djmount/default.nix +++ b/pkgs/tools/filesystems/djmount/default.nix @@ -8,6 +8,14 @@ stdenv.mkDerivation rec { sha256 = "0kqf0cy3h4cfiy5a2sigmisx0lvvsi1n0fbyb9ll5gacmy1b8nxa"; }; + postPatch = '' + # Taken from https://github.com/pupnp/pupnp/pull/334/files + substituteInPlace libupnp/threadutil/inc/ithread.h \ + --replace \ + "#define ithread_mutexattr_setkind_np pthread_mutexattr_setkind_np" \ + '#define ithread_mutexattr_setkind_np pthread_mutexattr_settype' + ''; + nativeBuildInputs = [ pkg-config ]; buildInputs = [ fuse]; diff --git a/pkgs/tools/filesystems/securefs/default.nix b/pkgs/tools/filesystems/securefs/default.nix index 44e547b01c2..4d56f08b442 100644 --- a/pkgs/tools/filesystems/securefs/default.nix +++ b/pkgs/tools/filesystems/securefs/default.nix @@ -20,6 +20,10 @@ stdenv.mkDerivation rec { ./add-macfuse-support.patch ]; + postPatch = '' + sed -i -e '/TEST_SOURCES/d' CMakeLists.txt + ''; + nativeBuildInputs = [ cmake ]; buildInputs = [ fuse ]; diff --git a/pkgs/tools/misc/aspcud/default.nix b/pkgs/tools/misc/aspcud/default.nix index ef1b6a5a4ca..12cc6572abc 100644 --- a/pkgs/tools/misc/aspcud/default.nix +++ b/pkgs/tools/misc/aspcud/default.nix @@ -2,6 +2,7 @@ , stdenv , fetchFromGitHub , boost +, catch2 , clasp , cmake , gringo @@ -19,6 +20,10 @@ stdenv.mkDerivation rec { hash = "sha256-d04GPMoz6PMGq6iiul0zT1C9Mljdl9uJJ2C8MIwcmaw="; }; + postPatch = '' + cp ${catch2}/include/catch2/catch.hpp libcudf/tests/catch.hpp + ''; + nativeBuildInputs = [ cmake ]; buildInputs = [ boost clasp gringo re2c ]; @@ -28,6 +33,8 @@ stdenv.mkDerivation rec { "-DASPCUD_CLASP_PATH=${clasp}/bin/clasp" ]; + doCheck = true; + meta = with lib; { description = "Solver for package problems in CUDF format using ASP"; homepage = "https://potassco.org/aspcud/"; diff --git a/pkgs/tools/misc/dsq/default.nix b/pkgs/tools/misc/dsq/default.nix index 32c5ec6566d..72a38cf1eaf 100644 --- a/pkgs/tools/misc/dsq/default.nix +++ b/pkgs/tools/misc/dsq/default.nix @@ -10,16 +10,16 @@ buildGoModule rec { pname = "dsq"; - version = "0.11.0"; + version = "0.12.0"; src = fetchFromGitHub { owner = "multiprocessio"; repo = "dsq"; rev = version; - hash = "sha256-4g9fu5taFtb7VzVa0X8s6SbEO9qTFD0ff+CVJpr376c="; + hash = "sha256-AxYqSCdCrhHrN21WGJtg0KIde8VAjj6bF7DzELZptj8="; }; - vendorSha256 = "sha256-YPH/uPPNT1byXOtCrNyU68H4mHO8arl6l5hs9WMcxVk="; + vendorSha256 = "sha256-aER7j/DG1WB5DZhvgXYrl19UwQ/lZLPRAptINVJ3rdI="; nativeBuildInputs = [ diffutils ]; diff --git a/pkgs/tools/misc/ethtool/default.nix b/pkgs/tools/misc/ethtool/default.nix index 65797f65fe6..d46815e8bf2 100644 --- a/pkgs/tools/misc/ethtool/default.nix +++ b/pkgs/tools/misc/ethtool/default.nix @@ -7,11 +7,11 @@ stdenv.mkDerivation rec { pname = "ethtool"; - version = "5.15"; + version = "5.16"; src = fetchurl { url = "mirror://kernel/software/network/${pname}/${pname}-${version}.tar.xz"; - sha256 = "sha256-aG/WEQOJ1JwqEg8Aw81d/kPeutqOAh5CcNdLvkUqEW0="; + sha256 = "sha256-qi/vGTbdShF1XfoL25Pw7FvqRSCNJ8l1S8Or4apCwcs="; }; nativeBuildInputs = [ diff --git a/pkgs/tools/misc/findutils/default.nix b/pkgs/tools/misc/findutils/default.nix index 3746c4b4657..56d710c8545 100644 --- a/pkgs/tools/misc/findutils/default.nix +++ b/pkgs/tools/misc/findutils/default.nix @@ -40,7 +40,7 @@ stdenv.mkDerivation rec { "--localstatedir=/var/cache" ]; - CFLAGS = [ + CFLAGS = lib.optionals stdenv.isDarwin [ # TODO: Revisit upstream issue https://savannah.gnu.org/bugs/?59972 # https://github.com/Homebrew/homebrew-core/pull/69761#issuecomment-770268478 "-D__nonnull\\(params\\)=" diff --git a/pkgs/tools/misc/fontforge/default.nix b/pkgs/tools/misc/fontforge/default.nix index 6bb728af99c..3de016bf6d6 100644 --- a/pkgs/tools/misc/fontforge/default.nix +++ b/pkgs/tools/misc/fontforge/default.nix @@ -1,7 +1,7 @@ { stdenv, fetchpatch, fetchFromGitHub, lib , cmake, perl, uthash, pkg-config, gettext , python, freetype, zlib, glib, giflib, libpng, libjpeg, libtiff, libxml2, cairo, pango -, readline, woff2, zeromq, libuninameslist +, readline, woff2, zeromq , withSpiro ? false, libspiro , withGTK ? false, gtk3 , withGUI ? withGTK @@ -14,13 +14,13 @@ assert withGTK -> withGUI; stdenv.mkDerivation rec { pname = "fontforge"; - version = "20201107"; + version = "20220308"; src = fetchFromGitHub { owner = pname; repo = pname; rev = version; - sha256 = "sha256-Rl/5lbXaPgIndANaD0IakaDus6T53FjiBb45FIuGrvc="; + sha256 = "sha256-q+71PDPODl5fEEy3d1icRl+rBGY7AhH+2dMUKeBWGgI="; }; patches = [ @@ -28,13 +28,11 @@ stdenv.mkDerivation rec { # Taken from https://salsa.debian.org/fonts-team/fontforge/-/blob/master/debian/patches/0001-add-extra-cmake-install-rules.patch (fetchpatch { url = "https://salsa.debian.org/fonts-team/fontforge/raw/76bffe6ccf8ab20a0c81476a80a87ad245e2fd1c/debian/patches/0001-add-extra-cmake-install-rules.patch"; - sha256 = "u3D9od2xLECNEHhZ+8dkuv9818tPkdP6y/Tvd9CADJg="; - }) - # Fix segmentation fault with some fonts. - # This is merged and should be present in the next release. - (fetchpatch { - url = "https://github.com/fontforge/fontforge/commit/69e263b2aff29ad22f97f13935cfa97a1eabf207.patch"; - sha256 = "06yyf90605aq6ppfiz83mqkdmnaq5418axp9jgsjyjq78b00xb29"; + excludes = [ + # Already handled upstream: https://github.com/fontforge/fontforge/commit/f97a2cd7b344ec8fcb9f8bfb908e1b6f36326d20 + "contrib/cidmap/CMakeLists.txt" + ]; + sha256 = "iQwaGeBHUais979hGVbU2NxKozQSQkpYXjApxPuLI/4="; }) ]; @@ -52,7 +50,7 @@ stdenv.mkDerivation rec { nativeBuildInputs = [ pkg-config cmake ]; buildInputs = [ - readline uthash woff2 zeromq libuninameslist + readline uthash woff2 zeromq python freetype zlib glib giflib libpng libjpeg libtiff libxml2 ] ++ lib.optionals withSpiro [ libspiro ] diff --git a/pkgs/tools/misc/gparted/default.nix b/pkgs/tools/misc/gparted/default.nix index a002d190984..8d6de0bbeb8 100644 --- a/pkgs/tools/misc/gparted/default.nix +++ b/pkgs/tools/misc/gparted/default.nix @@ -6,11 +6,11 @@ stdenv.mkDerivation rec { pname = "gparted"; - version = "1.3.1"; + version = "1.4.0"; src = fetchurl { url = "mirror://sourceforge/gparted/${pname}-${version}.tar.gz"; - sha256 = "sha256-Xu4ubXSxXvlrE7OiMQyGjtIpjgM0ECHn0SpamKHR4Qk="; + sha256 = "sha256-5Sk6eS5T/b66KcSoNBE82WA9DWOTMNqTGkaL82h4h74="; }; # Tries to run `pkexec --version` to get version. diff --git a/pkgs/tools/misc/kisslicer/default.nix b/pkgs/tools/misc/kisslicer/default.nix index 31bc0b2b6a1..f80e15b3b3c 100644 --- a/pkgs/tools/misc/kisslicer/default.nix +++ b/pkgs/tools/misc/kisslicer/default.nix @@ -27,8 +27,11 @@ stdenv.mkDerivation rec { stripRoot = false; }; - buildInputs = [ + nativeBuildInputs = [ makeWrapper + ]; + + buildInputs = [ libGLU libGL libX11 ]; diff --git a/pkgs/tools/misc/logstash/6.x.nix b/pkgs/tools/misc/logstash/6.x.nix index 0b3e17818dc..c1136ed8876 100644 --- a/pkgs/tools/misc/logstash/6.x.nix +++ b/pkgs/tools/misc/logstash/6.x.nix @@ -26,8 +26,12 @@ let this = stdenv.mkDerivation rec { dontStrip = true; dontPatchShebangs = true; + nativeBuildInputs = [ + makeWrapper + ]; + buildInputs = [ - makeWrapper jre + jre ]; installPhase = '' diff --git a/pkgs/tools/misc/logstash/7.x.nix b/pkgs/tools/misc/logstash/7.x.nix index 636c380817c..6cf64691efb 100644 --- a/pkgs/tools/misc/logstash/7.x.nix +++ b/pkgs/tools/misc/logstash/7.x.nix @@ -41,8 +41,11 @@ let dontStrip = true; dontPatchShebangs = true; - buildInputs = [ + nativeBuildInputs = [ makeWrapper + ]; + + buildInputs = [ jre ]; diff --git a/pkgs/tools/misc/mongodb-compass/default.nix b/pkgs/tools/misc/mongodb-compass/default.nix index 5528bb2f97c..4560e14c697 100644 --- a/pkgs/tools/misc/mongodb-compass/default.nix +++ b/pkgs/tools/misc/mongodb-compass/default.nix @@ -33,7 +33,7 @@ xorg, }: let - version = "1.30.1"; + version = "1.31.0"; rpath = lib.makeLibraryPath [ alsa-lib @@ -82,7 +82,7 @@ let if stdenv.hostPlatform.system == "x86_64-linux" then fetchurl { url = "https://downloads.mongodb.com/compass/mongodb-compass_${version}_amd64.deb"; - sha256 = "sha256-MwkYgkDZmzZsthJxSK6c+0us0D4cPuDfuV1XBbeTNXE="; + sha256 = "sha256-kzGBb8h03jPCqpwKPXeqB3yPTGgvVsl1DjIyCbNgjqM="; } else throw "MongoDB compass is not supported on ${stdenv.hostPlatform.system}"; diff --git a/pkgs/tools/misc/plfit/default.nix b/pkgs/tools/misc/plfit/default.nix new file mode 100644 index 00000000000..d1613af76e9 --- /dev/null +++ b/pkgs/tools/misc/plfit/default.nix @@ -0,0 +1,54 @@ +{ lib +, stdenv +, fetchFromGitHub +, fetchpatch +, cmake +, python ? null +, swig +, llvmPackages +}: + +stdenv.mkDerivation rec { + pname = "plfit"; + version = "0.9.3"; + + src = fetchFromGitHub { + owner = "ntamas"; + repo = "plfit"; + rev = version; + hash = "sha256-y4n6AlGtuuUuA+33oF7lGOYuKSqea4GMSJlv9PaSpQ8="; + }; + + patches = [ + # https://github.com/ntamas/plfit/pull/41 + (fetchpatch { + name = "use-cmake-install-full-dir.patch"; + url = "https://github.com/ntamas/plfit/commit/d0e77c80e6e899298240e6be465cf580603f6ee2.patch"; + hash = "sha256-wi3qCp6ZQtrKuM7XDA6xCXunCiqsyhnkxmg2eSmxjYM="; + }) + ]; + + nativeBuildInputs = [ + cmake + ] ++ lib.optionals (!isNull python) [ + python + swig + ]; + + cmakeFlags = [ + "-DPLFIT_USE_OPENMP=ON" + ] ++ lib.optionals (!isNull python) [ + "-DPLFIT_COMPILE_PYTHON_MODULE=ON" + ]; + + buildInputs = lib.optionals stdenv.cc.isClang [ + llvmPackages.openmp + ]; + + meta = with lib; { + description = "Fitting power-law distributions to empirical data"; + homepage = "https://github.com/ntamas/plfit"; + license = licenses.gpl2Plus; + maintainers = with maintainers; [ dotlambda ]; + }; +} diff --git a/pkgs/tools/misc/teleconsole/default.nix b/pkgs/tools/misc/teleconsole/default.nix deleted file mode 100644 index 3bf1f5cd34b..00000000000 --- a/pkgs/tools/misc/teleconsole/default.nix +++ /dev/null @@ -1,41 +0,0 @@ -{ lib, stdenv, buildGoPackage, fetchFromGitHub }: - -buildGoPackage rec { - pname = "teleconsole"; - version = "0.4.0"; - - goPackagePath = "github.com/gravitational/teleconsole"; - - src = fetchFromGitHub { - owner = "gravitational"; - repo = "teleconsole"; - rev = version; - sha256 = "01552422n0bj1iaaw6pvg9l1qr66r69sdsngxbcdjn1xh3mj74sm"; - }; - - srcTeleport = fetchFromGitHub { - owner = "gravitational"; - repo = "teleport"; - rev = "2cb40abd8ea8fb2915304ea4888b5b9f3e5bc223"; - sha256 = "1xw3bfnjbj88x465snwwzn4bmpmzmsrq9r0pkj388qwvfrclgnfk"; - }; - - preBuild = '' - cp -r ${srcTeleport} ./go/src/github.com/gravitational/teleport - ''; - - CGO_ENABLED = 1; - - meta = with lib; { - homepage = "https://www.teleconsole.com/"; - description = "Share your terminal session with people you trust"; - license = licenses.asl20; - # Builds for Aarch64 not possible in the current release due to - # incompatibilities further up the dependency chain. - # See: - # - https://github.com/gravitational/teleport/issues/679 - # - https://github.com/kr/pty/issues/27 - broken = stdenv.isAarch64; - maintainers = [ maintainers.kimburgess ]; - }; -} diff --git a/pkgs/tools/misc/xvfb-run/default.nix b/pkgs/tools/misc/xvfb-run/default.nix index 06e886e4d04..11875e73f93 100644 --- a/pkgs/tools/misc/xvfb-run/default.nix +++ b/pkgs/tools/misc/xvfb-run/default.nix @@ -1,18 +1,39 @@ -{ lib, stdenv, fetchurl, makeWrapper, xorgserver, getopt -, xauth, util-linux, which, fontsConf, gawk, coreutils }: -let - xvfb-run = fetchurl { - name = "xvfb-run"; - url = "https://raw.githubusercontent.com/archlinux/svntogit-packages/9cb733cefa92af3fca608fb051d5251160c9bbff/trunk/xvfb-run"; - sha256 = "1307mz4nr8ga3qz73i8hbcdphky75rq8lrvfk2zm4kmv6pkbk611"; - }; -in -stdenv.mkDerivation { +{ lib +, stdenvNoCC +, fetchFromGitHub +, makeWrapper +, xorgserver +, getopt +, xauth +, util-linux +, which +, fontsConf +, gawk +, coreutils +, installShellFiles +, xterm +}: +stdenvNoCC.mkDerivation rec { name = "xvfb-run"; - nativeBuildInputs = [ makeWrapper ]; - buildCommand = '' + version = "1+g87f6705"; + + src = fetchFromGitHub { + owner = "archlinux"; + repo = "svntogit-packages"; + rev = "87f67054c49b32511893acd22be94c47ecd44b4a"; + sha256 = "sha256-KEg92RYgJd7naHFDKbdXEy075bt6NLcmX8VhQROHVPs="; + }; + + nativeBuildInputs = [ makeWrapper installShellFiles ]; + + dontUnpack = true; + dontBuild = true; + dontConfigure = true; + + installPhase = '' mkdir -p $out/bin - cp ${xvfb-run} $out/bin/xvfb-run + cp $src/trunk/xvfb-run $out/bin/xvfb-run + installManPage $src/trunk/xvfb-run.1 chmod a+x $out/bin/xvfb-run patchShebangs $out/bin/xvfb-run @@ -21,8 +42,23 @@ stdenv.mkDerivation { --prefix PATH : ${lib.makeBinPath [ getopt xorgserver xauth which util-linux gawk coreutils ]} ''; + doInstallCheck = true; + installCheckPhase = '' + ( + unset PATH + echo "running xterm with xvfb-run" + $out/bin/xvfb-run ${lib.getBin xterm}/bin/xterm -e true + ) + ''; + + passthru = { + updateScript = ./update.sh; + }; + meta = with lib; { + description = "Convenience script to run a virtualized X-Server"; platforms = platforms.linux; license = licenses.gpl2; + maintainers = [ maintainers.artturin ]; }; } diff --git a/pkgs/tools/misc/xvfb-run/update.sh b/pkgs/tools/misc/xvfb-run/update.sh new file mode 100755 index 00000000000..e592323154e --- /dev/null +++ b/pkgs/tools/misc/xvfb-run/update.sh @@ -0,0 +1,21 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i bash -p curl gnused nix-prefetch jq common-updater-scripts +# shellcheck shell=bash + +set -e + +info=$(nix-prefetch-git --quiet --url "https://github.com/archlinux/svntogit-packages" --rev "refs/heads/packages/xorg-server") + +rev=$(jq -r '.rev' <<< "$info") +sha256=$(nix hash to-sri --type sha256 "$(jq -r '.sha256' <<< "$info")") +dir=$(jq -r '.path' <<< "$info") + +newXvfbsha=$(sha256sum "$dir/trunk/xvfb-run") +oldXvfbsha=$(sha256sum "$(nix build --quiet ".#xvfb-run.src" --json --no-link | jq -r '.[].outputs.out')/trunk/xvfb-run") + +if [[ "$newXvfbsha" != "$oldXvfbsha" ]]; then + ( + cd "$(git rev-parse --show-toplevel)" + update-source-version xvfb-run "1+g${rev:0:7}" "$sha256" --rev="$rev" + ) +fi diff --git a/pkgs/tools/networking/curl/default.nix b/pkgs/tools/networking/curl/default.nix index bfd48893165..c032ba61c12 100644 --- a/pkgs/tools/networking/curl/default.nix +++ b/pkgs/tools/networking/curl/default.nix @@ -54,14 +54,14 @@ assert zstdSupport -> zstd != null; stdenv.mkDerivation rec { pname = "curl"; - version = "7.81.0"; + version = "7.82.0"; src = fetchurl { urls = [ "https://curl.haxx.se/download/${pname}-${version}.tar.bz2" "https://github.com/curl/curl/releases/download/${lib.replaceStrings ["."] ["_"] pname}-${version}/${pname}-${version}.tar.bz2" ]; - sha256 = "sha256-Hno41wGOwGDx8W34OYVPCInpThIsTPpdOjfC3Fbx4lg="; + sha256 = "sha256-RtmgQAozQI/ZkncLBKRKdDSzA28ugImsKLV1c9WdNx8="; }; patches = [ diff --git a/pkgs/tools/networking/eternal-terminal/default.nix b/pkgs/tools/networking/eternal-terminal/default.nix index 035a99103fc..0fb559afc99 100644 --- a/pkgs/tools/networking/eternal-terminal/default.nix +++ b/pkgs/tools/networking/eternal-terminal/default.nix @@ -7,6 +7,7 @@ , openssl , protobuf , zlib +, catch2 }: stdenv.mkDerivation rec { @@ -20,6 +21,10 @@ stdenv.mkDerivation rec { hash = "sha256-cCZbG0CD5V/FTj1BuVr083EJ+BCgIcKHomNtpJb3lOo="; }; + preBuild = '' + cp ${catch2}/include/catch2/catch.hpp ../external_imported/Catch2/single_include/catch2/catch.hpp + ''; + nativeBuildInputs = [ cmake ]; @@ -42,6 +47,8 @@ stdenv.mkDerivation rec { "-std=c++17" ]; + doCheck = true; + meta = with lib; { description = "Remote shell that automatically reconnects without interrupting the session"; homepage = "https://eternalterminal.dev/"; diff --git a/pkgs/tools/networking/gost/default.nix b/pkgs/tools/networking/gost/default.nix index 13cac744461..c8f42b3ad4a 100644 --- a/pkgs/tools/networking/gost/default.nix +++ b/pkgs/tools/networking/gost/default.nix @@ -13,8 +13,33 @@ buildGoModule rec { vendorSha256 = "1cgb957ipkiix3x0x84c77a1i8l679q3kqykm1lhb4f19x61dqjh"; - # Many tests fail. - doCheck = false; + postPatch = '' + substituteInPlace http2_test.go \ + --replace "TestH2CForwardTunnel" "SkipH2CForwardTunnel" \ + --replace "TestH2ForwardTunnel" "SkipH2ForwardTunnel" + + substituteInPlace resolver_test.go \ + --replace '{NameServer{Addr: "1.1.1.1"}, "github", true},' "" \ + --replace '{NameServer{Addr: "1.1.1.1"}, "github.com", true},' "" \ + --replace '{NameServer{Addr: "1.1.1.1:53"}, "github.com", true},' "" \ + --replace '{NameServer{Addr: "1.1.1.1:53", Protocol: "tcp"}, "github.com", true},' "" \ + --replace '{NameServer{Addr: "1.1.1.1:853", Protocol: "tls"}, "github.com", true},' "" \ + --replace '{NameServer{Addr: "1.1.1.1:853", Protocol: "tls", Hostname: "cloudflare-dns.com"}, "github.com", true},' "" \ + --replace '{NameServer{Addr: "https://cloudflare-dns.com/dns-query", Protocol: "https"}, "github.com", true},' "" \ + --replace '{NameServer{Addr: "https://1.0.0.1/dns-query", Protocol: "https"}, "github.com", true},' "" + + # Skip TestShadowTCP, TestShadowUDP: #70 #71 #72 #78 #83 #85 #86 #87 #93 + substituteInPlace ss_test.go \ + --replace '{url.User("xchacha20"), url.UserPassword("xchacha20", "123456"), false},' "" \ + --replace '{url.UserPassword("xchacha20", "123456"), url.User("xchacha20"), false},' "" \ + --replace '{url.UserPassword("xchacha20", "123456"), url.UserPassword("xchacha20", "abc"), false},' "" \ + --replace '{url.UserPassword("CHACHA20-IETF-POLY1305", "123456"), url.UserPassword("CHACHA20-IETF-POLY1305", "123456"), true},' "" \ + --replace '{url.UserPassword("AES-128-GCM", "123456"), url.UserPassword("AES-128-GCM", "123456"), true},' "" \ + --replace '{url.User("AES-192-GCM"), url.UserPassword("AES-192-GCM", "123456"), false},' "" \ + --replace '{url.UserPassword("AES-192-GCM", "123456"), url.User("AES-192-GCM"), false},' "" \ + --replace '{url.UserPassword("AES-192-GCM", "123456"), url.UserPassword("AES-192-GCM", "abc"), false},' "" \ + --replace '{url.UserPassword("AES-256-GCM", "123456"), url.UserPassword("AES-256-GCM", "123456"), true},' "" + ''; meta = with lib; { description = "A simple tunnel written in golang"; diff --git a/pkgs/tools/networking/modemmanager/default.nix b/pkgs/tools/networking/modemmanager/default.nix index 126b3b513a8..c9d56044b0d 100644 --- a/pkgs/tools/networking/modemmanager/default.nix +++ b/pkgs/tools/networking/modemmanager/default.nix @@ -5,11 +5,11 @@ stdenv.mkDerivation rec { pname = "modemmanager"; - version = "1.18.4"; + version = "1.18.6"; src = fetchurl { url = "https://www.freedesktop.org/software/ModemManager/ModemManager-${version}.tar.xz"; - sha256 = "sha256-EfuXD2Pi2ojfS22HWeTuZJlExRUkS5eb9Qp6bfHX8Zk="; + sha256 = "sha256-1PgEsxz1BCOcXx1Jc8YglcAMuh7pq7UDcY2sbRRqRwo="; }; nativeBuildInputs = [ vala gobject-introspection gettext pkg-config ]; diff --git a/pkgs/tools/networking/mosh/default.nix b/pkgs/tools/networking/mosh/default.nix index 7823b7eb909..8331e3686dc 100644 --- a/pkgs/tools/networking/mosh/default.nix +++ b/pkgs/tools/networking/mosh/default.nix @@ -11,8 +11,8 @@ stdenv.mkDerivation rec { sha256 = "05hjhlp6lk8yjcy59zywpf0r6s0h0b9zxq0lw66dh9x8vxrhaq6s"; }; - nativeBuildInputs = [ autoreconfHook pkg-config makeWrapper protobuf ]; - buildInputs = [ protobuf ncurses zlib openssl bash-completion perlPackages.perl ] + nativeBuildInputs = [ autoreconfHook pkg-config makeWrapper protobuf perlPackages.perl ]; + buildInputs = [ protobuf ncurses zlib openssl bash-completion ] ++ lib.optional withUtempter libutempter; strictDeps = true; diff --git a/pkgs/tools/networking/ntp/default.nix b/pkgs/tools/networking/ntp/default.nix index 91e1767b75c..f272470a98f 100644 --- a/pkgs/tools/networking/ntp/default.nix +++ b/pkgs/tools/networking/ntp/default.nix @@ -9,6 +9,11 @@ stdenv.mkDerivation rec { sha256 = "06cwhimm71safmwvp6nhxp6hvxsg62whnbgbgiflsqb8mgg40n7n"; }; + patches = [ + # From https://patchwork.openembedded.org/patch/180019/ + ./glibc-2.34-fix.patch + ]; + configureFlags = [ "--sysconfdir=/etc" "--localstatedir=/var" diff --git a/pkgs/tools/networking/ntp/glibc-2.34-fix.patch b/pkgs/tools/networking/ntp/glibc-2.34-fix.patch new file mode 100644 index 00000000000..256f125a77b --- /dev/null +++ b/pkgs/tools/networking/ntp/glibc-2.34-fix.patch @@ -0,0 +1,28 @@ +From 082a504cfcc046c3d8adaae1164268bc94e5108a Mon Sep 17 00:00:00 2001 +From: Khem Raj <raj.khem@gmail.com> +Date: Sat, 31 Jul 2021 10:51:41 -0700 +Subject: [PATCH] libntp: Do not use PTHREAD_STACK_MIN on glibc +In glibc 2.34+ PTHREAD_STACK_MIN is not a compile-time constant which +could mean different stack sizes at runtime on different architectures +and it also causes compile failure. Default glibc thread stack size +or 64Kb set by ntp should be good in glibc these days. +Upstream-Status: Pending +Signed-off-by: Khem Raj <raj.khem@gmail.com> +--- + libntp/work_thread.c | 2 +- + 1 file changed, 1 insertion(+), 1 deletion(-) +diff --git a/libntp/work_thread.c b/libntp/work_thread.c +index 03a5647..3ddd751 100644 +--- a/libntp/work_thread.c ++++ b/libntp/work_thread.c +@@ -41,7 +41,7 @@ + #ifndef THREAD_MINSTACKSIZE + # define THREAD_MINSTACKSIZE (64U * 1024) + #endif +-#ifndef __sun ++#if !defined(__sun) && !defined(__GLIBC__) + #if defined(PTHREAD_STACK_MIN) && THREAD_MINSTACKSIZE < PTHREAD_STACK_MIN + # undef THREAD_MINSTACKSIZE + # define THREAD_MINSTACKSIZE PTHREAD_STACK_MIN +-- +2.32.0 diff --git a/pkgs/tools/networking/openconnect/default.nix b/pkgs/tools/networking/openconnect/default.nix index 0e1da29320f..5dea456d00b 100644 --- a/pkgs/tools/networking/openconnect/default.nix +++ b/pkgs/tools/networking/openconnect/default.nix @@ -4,6 +4,7 @@ , pkg-config , openssl ? null , gnutls ? null +, p11-kit , gmp , libxml2 , stoken @@ -42,7 +43,8 @@ stdenv.mkDerivation rec { ]; buildInputs = [ openssl gnutls gmp libxml2 stoken zlib ] - ++ lib.optional stdenv.isDarwin PCSC; + ++ lib.optional stdenv.isDarwin PCSC + ++ lib.optional stdenv.isLinux p11-kit; nativeBuildInputs = [ pkg-config ] ++ lib.optional head autoreconfHook; diff --git a/pkgs/tools/networking/openssh/default.nix b/pkgs/tools/networking/openssh/default.nix index 36125a5893b..77277f20950 100644 --- a/pkgs/tools/networking/openssh/default.nix +++ b/pkgs/tools/networking/openssh/default.nix @@ -6,11 +6,11 @@ in openssh = common rec { pname = "openssh"; - version = "8.8p1"; + version = "8.9p1"; src = fetchurl { url = "mirror://openbsd/OpenSSH/portable/openssh-${version}.tar.gz"; - sha256 = "1s8z6f7mi1pwsl79cqai8cr350m5lf2ifcxff57wx6mvm478k425"; + sha256 = "sha256:1ry5prcax0134v6srkgznpl9ch5snkgq7yvjqvd8c5mbnxa7cjgx"; }; extraPatches = [ ./ssh-keysign-8.5.patch ]; diff --git a/pkgs/tools/networking/smartdns/default.nix b/pkgs/tools/networking/smartdns/default.nix index 8ac1e137ca4..fd4cdbaf977 100644 --- a/pkgs/tools/networking/smartdns/default.nix +++ b/pkgs/tools/networking/smartdns/default.nix @@ -1,34 +1,32 @@ -{ lib, stdenv, fetchFromGitHub, openssl }: +{ lib, stdenv, fetchFromGitHub, openssl, testVersion, smartdns }: stdenv.mkDerivation rec { pname = "smartdns"; - version = "35"; + version = "36"; src = fetchFromGitHub { owner = "pymumu"; repo = pname; rev = "Release${version}"; - sha256 = "sha256-5822qe3mdn4wPO8fHW5AsgMA7xbJnMjZn9DbiMU3GX0="; + sha256 = "sha256-sjrRPmTJRCUnMrA08M/VdYhL7/OfQY30/t1loLPSrlQ="; }; buildInputs = [ openssl ]; - # Force the systemd service file to be regenerated from it's template. This - # file is erroneously added in version 35 and it has already been deleted from - # upstream's git repository. So this "postPatch" phase can be deleted in next - # release. - postPatch = '' - rm -f systemd/smartdns.service - ''; - makeFlags = [ "PREFIX=${placeholder "out"}" "SYSTEMDSYSTEMUNITDIR=${placeholder "out"}/lib/systemd/system" "RUNSTATEDIR=/run" + # by default it is the build time... weird... https://github.com/pymumu/smartdns/search?q=ver + "VER=${version}" ]; installFlags = [ "SYSCONFDIR=${placeholder "out"}/etc" ]; + passthru.tests = { + version = testVersion { package = smartdns; }; + }; + meta = with lib; { description = "A local DNS server to obtain the fastest website IP for the best Internet experience"; diff --git a/pkgs/tools/networking/unbound/default.nix b/pkgs/tools/networking/unbound/default.nix index b2d577dab33..b92fb23d64e 100644 --- a/pkgs/tools/networking/unbound/default.nix +++ b/pkgs/tools/networking/unbound/default.nix @@ -8,6 +8,8 @@ , libsodium , protobufc , hiredis +, python ? null +, swig , dns-root-data , pkg-config , makeWrapper @@ -35,6 +37,7 @@ # Avoid .lib depending on lib.getLib openssl # The build gets a little hacky, so in some cases we disable this approach. , withSlimLib ? stdenv.isLinux && !stdenv.hostPlatform.isMusl && !withDNSTAP +, withPythonModule ? false , libnghttp2 }: @@ -49,11 +52,13 @@ stdenv.mkDerivation rec { outputs = [ "out" "lib" "man" ]; # "dev" would only split ~20 kB - nativeBuildInputs = [ makeWrapper ]; + nativeBuildInputs = [ makeWrapper ] + ++ lib.optionals withPythonModule [ swig ]; buildInputs = [ openssl nettle expat libevent ] ++ lib.optionals withSystemd [ pkg-config systemd ] - ++ lib.optionals withDoH [ libnghttp2 ]; + ++ lib.optionals withDoH [ libnghttp2 ] + ++ lib.optionals withPythonModule [ python ]; configureFlags = [ "--with-ssl=${openssl.dev}" @@ -69,6 +74,8 @@ stdenv.mkDerivation rec { "--disable-flto" ] ++ lib.optionals withSystemd [ "--enable-systemd" + ] ++ lib.optionals withPythonModule [ + "--with-pythonmodule" ] ++ lib.optionals withDoH [ "--with-libnghttp2=${libnghttp2.dev}" ] ++ lib.optionals withECS [ @@ -100,12 +107,21 @@ stdenv.mkDerivation rec { doCheck = true; + postPatch = lib.optionalString withPythonModule '' + substituteInPlace Makefile.in \ + --replace "\$(DESTDIR)\$(PYTHON_SITE_PKG)" "$out/${python.sitePackages}" + ''; + installFlags = [ "configfile=\${out}/etc/unbound/unbound.conf" ]; postInstall = '' make unbound-event-install wrapProgram $out/bin/unbound-control-setup \ --prefix PATH : ${lib.makeBinPath [ openssl ]} + '' + lib.optionalString withPythonModule '' + wrapProgram $out/bin/unbound \ + --prefix PYTHONPATH : "$out/${python.sitePackages}" \ + --argv0 $out/bin/unbound ''; preFixup = lib.optionalString withSlimLib diff --git a/pkgs/tools/package-management/nix/default.nix b/pkgs/tools/package-management/nix/default.nix index 4510948b436..4ad17072dc8 100644 --- a/pkgs/tools/package-management/nix/default.nix +++ b/pkgs/tools/package-management/nix/default.nix @@ -68,6 +68,17 @@ in lib.makeExtensible (self: { nix_2_7 = common { version = "2.7.0"; sha256 = "sha256-m8tqCS6uHveDon5GSro5yZor9H+sHeh+v/veF1IGw24="; + patches = [ + # remove when there's a 2.7.1 release + # https://github.com/NixOS/nix/pull/6297 + # https://github.com/NixOS/nix/issues/6243 + # https://github.com/NixOS/nixpkgs/issues/163374 + (fetchpatch { + url = "https://github.com/NixOS/nix/commit/c9afca59e87afe7d716101e6a75565b4f4b631f7.patch"; + sha256 = "sha256-xz7QnWVCI12lX1+K/Zr9UpB93b10t1HS9y/5n5FYf8Q="; + }) + ]; + }; stable = self.nix_2_7; diff --git a/pkgs/tools/package-management/pdm/default.nix b/pkgs/tools/package-management/pdm/default.nix index 4e59333ed79..cae4431ea65 100644 --- a/pkgs/tools/package-management/pdm/default.nix +++ b/pkgs/tools/package-management/pdm/default.nix @@ -24,13 +24,13 @@ in with python.pkgs; buildPythonApplication rec { pname = "pdm"; - version = "1.12.6"; + version = "1.13.3"; format = "pyproject"; disabled = pythonOlder "3.7"; src = fetchPypi { inherit pname version; - sha256 = "sha256-MXKER2ijU+2yPnsBFH0cu/hjHI4uNt++AqggH5rhnaU="; + sha256 = "sha256-5+bjjljmk3AHaDVjYzNuC7lkkvlpLa9/grKgdmERC7k="; }; # this patch allows us to run additional tests that invoke pdm, which checks @@ -41,19 +41,12 @@ buildPythonApplication rec { # doesn't appear to respect the settings in `$HOME`; possibly a bug upstream patches = [ ./check-update.patch - (fetchurl { - # Mark test that require network access - url = "https://github.com/pdm-project/pdm/files/7911962/mark-network-tests.patch.txt"; - hash = "sha256:1dizf9j3z7zk4lxvnszwx63xzd9r68f2iva5sszzf8s8na831dvd"; - }) ]; - postPatch = '' - substituteInPlace pyproject.toml --replace "pdm-pep517>=0.9,<0.10" "pdm-pep517" - ''; propagatedBuildInputs = [ blinker click + findpython installer packaging pdm-pep517 @@ -82,22 +75,19 @@ buildPythonApplication rec { "-m 'not network'" ]; - preCheck = "HOME=$TMPDIR"; + preCheck = '' + export HOME=$TMPDIR + ''; disabledTests = [ # sys.executable and expected executable are different "test_set_non_exist_python_path" # pythonfinder isn't aware of nix's python infrastructure "test_auto_isolate_site_packages" - "test_use_invalid_wrapper_python" "test_use_wrapper_python" - # tries to read/write files without proper permissions - "test_completion_command" - "test_plugin_add" - "test_plugin_list" - "test_plugin_remove" - # tries to treat a gzip file as a zipfile and fails - "test_resolve_local_artifacts" + "test_find_python_in_path" + # calls pip install and exits != 0 + "test_pre_and_post_hooks" ]; meta = with lib; { diff --git a/pkgs/tools/security/aeskeyfind/default.nix b/pkgs/tools/security/aeskeyfind/default.nix new file mode 100644 index 00000000000..08b2481ff00 --- /dev/null +++ b/pkgs/tools/security/aeskeyfind/default.nix @@ -0,0 +1,30 @@ +{ lib +, stdenv +, fetchurl +}: + +stdenv.mkDerivation rec { + pname = "aeskeyfind"; + version = "1.0"; + + src = fetchurl { + url = "https://citpsite.s3.amazonaws.com/memory-content/src/aeskeyfind-${version}.tar.gz"; + sha256 = "sha256-FBflwbYehruVJ9sfW+4ZlaDuqCR12zy8iA4Ev3Bgg+Q="; + }; + + installPhase = '' + runHook preInstall + mkdir -p $out/bin + cp aeskeyfind $out/bin + runHook postInstall + ''; + + meta = with lib; { + description = "Locates 128-bit and 256-bit AES keys in a captured memory image"; + homepage = "https://citp.princeton.edu/our-work/memory/"; + license = licenses.bsd3; + maintainers = with maintainers; [ fedx-sudo ]; + }; + +} + diff --git a/pkgs/tools/security/aws-okta/default.nix b/pkgs/tools/security/aws-okta/default.nix deleted file mode 100644 index 88002fc1ce4..00000000000 --- a/pkgs/tools/security/aws-okta/default.nix +++ /dev/null @@ -1,30 +0,0 @@ -{ buildGoPackage, fetchFromGitHub, libusb1, pkg-config, lib, libiconv }: - -buildGoPackage rec { - pname = "aws-okta"; - version = "1.0.11"; - - goPackagePath = "github.com/segmentio/aws-okta"; - - src = fetchFromGitHub { - owner = "segmentio"; - repo = "aws-okta"; - rev = "v${version}"; - sha256 = "sha256-1cprKpIFgM3+lUEHNvda34nJTH4Ch3LtTRq/Dp6QBQ8="; - }; - - tags = [ "release" ]; - - ldflags = [ "-X main.Version=${version}" ]; - - nativeBuildInputs = [ pkg-config ]; - buildInputs = [ libusb1 libiconv ]; - - meta = with lib; { - description = "aws-vault like tool for Okta authentication"; - license = licenses.mit; - maintainers = with maintainers; [imalsogreg Chili-Man]; - homepage = "https://github.com/segmentio/aws-okta"; - downloadPage = "https://github.com/segmentio/aws-okta"; - }; -} diff --git a/pkgs/tools/security/vaultwarden/vault.nix b/pkgs/tools/security/vaultwarden/vault.nix index 5ec014de959..f37fbe12f1c 100644 --- a/pkgs/tools/security/vaultwarden/vault.nix +++ b/pkgs/tools/security/vaultwarden/vault.nix @@ -2,11 +2,11 @@ stdenv.mkDerivation rec { pname = "vaultwarden-vault"; - version = "2.25.0"; + version = "2.27.0"; src = fetchurl { url = "https://github.com/dani-garcia/bw_web_builds/releases/download/v${version}/bw_web_v${version}.tar.gz"; - sha256 = "sha256-0uxkHz/oHWl4MdzV7zRVKgkEqOkrl7Fd405TOf472gw="; + sha256 = "sha256-r4z45gjVB+RMZM0IE/ec0yf+rt4YDz5IpZEz5FlQSds="; }; buildCommand = '' diff --git a/pkgs/tools/system/s-tui/default.nix b/pkgs/tools/system/s-tui/default.nix index 3943a8f4eef..1152e66bd88 100644 --- a/pkgs/tools/system/s-tui/default.nix +++ b/pkgs/tools/system/s-tui/default.nix @@ -1,12 +1,18 @@ -{ lib, python3Packages }: +{ lib +, stdenv +, python3Packages +, nix-update-script +, s-tui +, testVersion +}: python3Packages.buildPythonPackage rec { pname = "s-tui"; - version = "1.0.1"; + version = "1.1.3"; src = python3Packages.fetchPypi { inherit pname version; - sha256 = "1gqrb2xxii43j7kszy7kvv4f6hr8ac4p0m9q8i1xs5fhsqcx186i"; + sha256 = "sha256-t3h8d0yc7i3UvO8CVfBd3/3h3RfGN6yE6hutymOZUdA="; }; propagatedBuildInputs = with python3Packages; [ @@ -14,12 +20,16 @@ python3Packages.buildPythonPackage rec { psutil ]; - LC_ALL = "en_US.UTF-8"; + passthru = { + updateScript = nix-update-script { attrPath = pname; }; + tests = testVersion { package = s-tui; }; + }; meta = with lib; { homepage = "https://amanusk.github.io/s-tui/"; description = "Stress-Terminal UI monitoring tool"; license = licenses.gpl2; maintainers = with maintainers; [ infinisil ]; + broken = stdenv.isDarwin; # https://github.com/amanusk/s-tui/issues/49 }; } diff --git a/pkgs/tools/text/jumanpp/0001-Exclude-all-tests-from-the-build.patch b/pkgs/tools/text/jumanpp/0001-Exclude-all-tests-from-the-build.patch new file mode 100644 index 00000000000..d41bada82de --- /dev/null +++ b/pkgs/tools/text/jumanpp/0001-Exclude-all-tests-from-the-build.patch @@ -0,0 +1,177 @@ +From c52a5046e19718a43d48c9b3cfdc121d964e8c3b Mon Sep 17 00:00:00 2001 +From: Maximilian Bosch <maximilian@mbosch.me> +Date: Fri, 28 Jan 2022 17:43:35 +0100 +Subject: [PATCH] Exclude all tests from the build + +For some reason it isn't sufficient to set `-DJPP_ENABLE_TESTS=OFF`. +Doing that because the tests on 2.0.0-rc3 don't seem to be working and +the vendored catch2 doesn't build with glibc 2.34. +--- + src/CMakeLists.txt | 3 +-- + src/core/CMakeLists.txt | 11 +---------- + src/core/analysis/CMakeLists.txt | 2 -- + src/core/codegen/CMakeLists.txt | 3 --- + src/core/spec/CMakeLists.txt | 2 -- + src/core/training/CMakeLists.txt | 2 -- + src/jumandic/CMakeLists.txt | 8 +------- + src/rnn/CMakeLists.txt | 5 +---- + src/util/CMakeLists.txt | 2 -- + 9 files changed, 4 insertions(+), 34 deletions(-) + +diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt +index 169dff5..64b6a07 100644 +--- a/src/CMakeLists.txt ++++ b/src/CMakeLists.txt +@@ -67,7 +67,6 @@ function(jpp_feature_codegen) + endfunction(jpp_feature_codegen) + + add_subdirectory(util) +-add_subdirectory(testing) + add_subdirectory(core) + add_subdirectory(jumandic) +-add_subdirectory(rnn) +\ No newline at end of file ++add_subdirectory(rnn) +diff --git a/src/core/CMakeLists.txt b/src/core/CMakeLists.txt +index c63d134..01c825e 100644 +--- a/src/core/CMakeLists.txt ++++ b/src/core/CMakeLists.txt +@@ -55,20 +55,11 @@ set(core_hdrs + ${core_hdrs} + ) + +-set(core_test_srcs +- ${core_test_srcs} +- ${core_tsrcs} +- test/test_analyzer_env.h +- ../testing/test_analyzer.h +- ) +- + add_library(jpp_core ${core_srcs} ${core_hdrs} ${libs3p_pegtl_headers}) +-jpp_test_executable(jpp_core_tests ${core_test_srcs}) + + target_include_directories(jpp_core PUBLIC ${jpp_core_cfg_dir}) + + target_link_libraries(jpp_core PUBLIC jpp_util jpp_rnn PRIVATE pathie) +-target_link_libraries(jpp_core_tests jpp_core jpp_core_train) + + if (${JPP_USE_PROTOBUF}) + target_include_directories(jpp_core PUBLIC ${Protobuf_INCLUDE_DIR} ${CMAKE_CURRENT_BINARY_DIR}) +@@ -78,4 +69,4 @@ endif() + add_subdirectory(benchmarks) + if (${JPP_ENABLE_DEV_TOOLS}) + add_subdirectory(devtools) +-endif () +\ No newline at end of file ++endif () +diff --git a/src/core/analysis/CMakeLists.txt b/src/core/analysis/CMakeLists.txt +index 526263e..1b32f8d 100644 +--- a/src/core/analysis/CMakeLists.txt ++++ b/src/core/analysis/CMakeLists.txt +@@ -79,5 +79,3 @@ jpp_core_files(core_hdrs + ) + + +-jpp_test_executable(jpp_core_analysis_tests ${core_analysis_tsrc}) +-target_link_libraries(jpp_core_analysis_tests jpp_core) +diff --git a/src/core/codegen/CMakeLists.txt b/src/core/codegen/CMakeLists.txt +index a905cee..fa759c7 100644 +--- a/src/core/codegen/CMakeLists.txt ++++ b/src/core/codegen/CMakeLists.txt +@@ -30,7 +30,4 @@ set(jpp_codegen_tsrcs + + add_library(jpp_core_codegen ${jpp_codegen_srcs} ${jpp_codegen_hdrs}) + +-jpp_test_executable(jpp_codegen_tests ${jpp_codegen_tsrcs}) +-target_include_directories(jpp_codegen_tests PRIVATE ${cgtest02_INCLUDE}) + target_link_libraries(jpp_core_codegen jpp_core) +-target_link_libraries(jpp_codegen_tests jpp_core_codegen) +\ No newline at end of file +diff --git a/src/core/spec/CMakeLists.txt b/src/core/spec/CMakeLists.txt +index f495d67..da827b9 100644 +--- a/src/core/spec/CMakeLists.txt ++++ b/src/core/spec/CMakeLists.txt +@@ -33,5 +33,3 @@ jpp_core_files(core_hdrs + + ) + +-jpp_test_executable(jpp_core_spec_tests ${core_spec_tsrc} ${libs3p_pegtl_headers}) +-target_link_libraries(jpp_core_spec_tests jpp_core) +\ No newline at end of file +diff --git a/src/core/training/CMakeLists.txt b/src/core/training/CMakeLists.txt +index 960437e..4ede9e1 100644 +--- a/src/core/training/CMakeLists.txt ++++ b/src/core/training/CMakeLists.txt +@@ -39,7 +39,5 @@ set(core_train_hdrs + + + add_library(jpp_core_train ${core_train_src} ${core_train_hdrs}) +-jpp_test_executable(jpp_core_train_tests ${core_train_tsrc}) + + target_link_libraries(jpp_core_train jpp_core) +-target_link_libraries(jpp_core_train_tests jpp_core_train) +\ No newline at end of file +diff --git a/src/jumandic/CMakeLists.txt b/src/jumandic/CMakeLists.txt +index bef3149..85a8b5d 100644 +--- a/src/jumandic/CMakeLists.txt ++++ b/src/jumandic/CMakeLists.txt +@@ -53,10 +53,6 @@ if (${JPP_USE_PROTOBUF}) + endif () + + +-jpp_test_executable(jpp_jumandic_tests ${jumandic_tests}) +-jpp_test_executable(jpp_bug_tests ${bug_test_sources}) +-target_include_directories(jpp_jumandic_tests PRIVATE ${jpp_jumandic_cg_INCLUDE}) +- + add_executable(jpp_jumandic_bootstrap main/bootstrap.cc) + add_executable(jumanpp_v2 main/jumanpp.cc) + add_executable(jumanpp_v2_train main/jumanpp_train.cc main/jumanpp_train.h) +@@ -64,11 +60,9 @@ add_executable(jpp_jumandic_pathdiff main/path_diff.cc) + target_include_directories(jpp_jumandic_pathdiff PRIVATE ${jpp_jumandic_cg_INCLUDE}) + + target_link_libraries(jpp_jumandic jpp_jumandic_spec) +-target_link_libraries(jpp_jumandic_tests jpp_jumandic jpp_core_train) +-target_link_libraries(jpp_bug_tests jpp_jumandic jpp_core_train) + target_link_libraries(jpp_jumandic_bootstrap jpp_jumandic) + target_link_libraries(jumanpp_v2 jpp_jumandic) + target_link_libraries(jumanpp_v2_train jpp_jumandic jpp_core_train) + target_link_libraries(jpp_jumandic_pathdiff jpp_jumandic) + +-install(PROGRAMS ${CMAKE_CURRENT_BINARY_DIR}/jumanpp_v2 RENAME jumanpp DESTINATION bin) +\ No newline at end of file ++install(PROGRAMS ${CMAKE_CURRENT_BINARY_DIR}/jumanpp_v2 RENAME jumanpp DESTINATION bin) +diff --git a/src/rnn/CMakeLists.txt b/src/rnn/CMakeLists.txt +index 448ba51..ca09a00 100644 +--- a/src/rnn/CMakeLists.txt ++++ b/src/rnn/CMakeLists.txt +@@ -1,12 +1,9 @@ + set(jpp_rnn_sources mikolov_rnn.cc) + set(jpp_rnn_includes mikolov_rnn.h simple_rnn_impl.h mikolov_rnn_impl.h rnn_arg_parse.h) +-set(jpp_rnn_tests mikolov_rnn_test.cc) + + add_library(jpp_rnn ${jpp_rnn_sources} ${jpp_rnn_includes} ) + add_library(jumanpp_rnn_legacy legacy/rnnlmlib.h legacy/rnnlmlib_static.h legacy/rnnlmlib_static.cpp) + +-jpp_test_executable(jpp_rnn_tests ${jpp_rnn_tests}) + target_link_libraries(jpp_rnn jpp_util) +-target_link_libraries(jpp_rnn_tests jpp_rnn jumanpp_rnn_legacy) + +-target_link_libraries(jumanpp_rnn_legacy jpp_util) +\ No newline at end of file ++target_link_libraries(jumanpp_rnn_legacy jpp_util) +diff --git a/src/util/CMakeLists.txt b/src/util/CMakeLists.txt +index 53b6c57..c4599d5 100644 +--- a/src/util/CMakeLists.txt ++++ b/src/util/CMakeLists.txt +@@ -25,8 +25,6 @@ endif() + + + add_library(jpp_util ${jpp_util_sources} ${jpp_util_headers} ${BACKWARD_headers}) +-jpp_test_executable(jpp_util_test ${jpp_util_test_srcs} ${jpp_util_headers}) +-target_link_libraries(jpp_util_test jpp_util) + target_link_libraries(jpp_util ${CMAKE_THREAD_LIBS_INIT}) + target_include_directories(jpp_util PUBLIC ${JPP_LIBS_DIR} ${JPP_SRC_DIR}) + target_compile_features(jpp_util PUBLIC +-- +2.33.1 + diff --git a/pkgs/tools/text/jumanpp/default.nix b/pkgs/tools/text/jumanpp/default.nix index 5fb5ec88d67..5bea259bcca 100644 --- a/pkgs/tools/text/jumanpp/default.nix +++ b/pkgs/tools/text/jumanpp/default.nix @@ -9,6 +9,9 @@ stdenv.mkDerivation rec { sha256 = "sha256-ASdr6qbkSe71M7QmuuwidCa4xQhDVoXBJ2XqvSY53pQ="; }; + patches = [ ./0001-Exclude-all-tests-from-the-build.patch ]; + cmakeFlags = [ "-DJPP_ENABLE_TESTS=OFF" ]; + nativeBuildInputs = [ cmake ]; buildInputs = [ protobuf ] ++ lib.optional stdenv.isDarwin libiconv; diff --git a/pkgs/top-level/aliases.nix b/pkgs/top-level/aliases.nix index d12c09c93e9..18e92057304 100644 --- a/pkgs/top-level/aliases.nix +++ b/pkgs/top-level/aliases.nix @@ -87,6 +87,7 @@ mapAliases ({ aucdtect = throw "aucdtect: Upstream no longer provides download urls"; # Added 2020-12-26 avldrums-lv2 = x42-avldrums; # Added 2020-03-29 avxsynth = throw "avxsynth was removed because it was broken"; # Added 2021-05-18 + aws-okta = throw "aws-okta is on indefinite hiatus. See https://github.com/segmentio/aws-okta/issues/278"; # Added 2022-04-05; azureus = throw "azureus is now known as vuze and the version in nixpkgs was really outdated"; # Added 2021-08-02 ### B ### @@ -102,6 +103,8 @@ mapAliases ({ bcat = throw "bcat has been removed because upstream is dead"; # Added 2021-08-22 beret = throw "beret has been removed"; # Added 2021-11-16 bin_replace_string = throw "bin_replace_string has been removed: deleted by upstream"; # Added 2022-01-07 + bird2 = bird; # Added 2022-02-21 + bird6 = throw "bird6 was dropped. Use bird instead, which has support for both ipv4/ipv6"; # Added 2022-02-21 bitbucket-cli = throw "bitbucket-cli has been removed: abandoned by upstream"; # Added 2022-03-21 bitsnbots = throw "bitsnbots has been removed because it was broken and upstream missing"; # Added 2021-08-22 blastem = throw "blastem has been removed from nixpkgs as it would still require python2"; # Added 2022-01-01 @@ -112,10 +115,9 @@ mapAliases ({ brackets = throw "brackets has been removed, it was unmaintained and had open vulnerabilities"; # Added 2021-01-24 bridge_utils = throw "'bridge_utils' has been renamed to/replaced by 'bridge-utils'"; # Converted to throw 2022-02-22 bro = zeek; # Added 2019-09-29 - bird2 = bird; # Added 2022-02-21 - bird6 = throw "bird6 was dropped. Use bird instead, which has support for both ipv4/ipv6"; # Added 2022-02-21 btrfsProgs = throw "'btrfsProgs' has been renamed to/replaced by 'btrfs-progs'"; # Converted to throw 2022-02-22 bud = throw "bud has been removed: abandoned by upstream"; # Added 2022-03-14 + buttersink = throw "buttersink has been removed: abandoned by upstream"; # Added 2022-04-05 # bitwarden_rs renamed to vaultwarden with release 1.21.0 (2021-04-30) bitwarden_rs = vaultwarden; @@ -179,6 +181,7 @@ mapAliases ({ compton-git = throw "'compton-git' has been renamed to/replaced by 'compton'"; # Converted to throw 2022-02-22 concurrencykit = libck; # Added 2021-03 conntrack_tools = throw "'conntrack_tools' has been renamed to/replaced by 'conntrack-tools'"; # Converted to throw 2022-02-22 + container-linux-config-transpiler = throw "container-linux-config-transpiler is deprecated and archived by upstream"; # Added 2022-04-05 cool-old-term = throw "'cool-old-term' has been renamed to/replaced by 'cool-retro-term'"; # Converted to throw 2022-02-22 corsmisc = throw "corsmisc has been removed (upstream is gone)"; # Added 2022-01-24 couchdb = throw "couchdb was removed from nixpkgs, use couchdb3 instead"; # Added 2021-03-03 @@ -474,6 +477,7 @@ mapAliases ({ hal-flash = throw "hal-flash has been removed as Adobe Flash Player is now deprecated"; # Added 2021-02-07 hawkthorne = throw "hawkthorne has been removed because it depended on a broken version of love"; # Added 2022-01-15 + heapster = throw "Heapster is now retired. See https://github.com/kubernetes-retired/heapster/blob/master/docs/deprecation.md"; # Added 2022-04-05 heimdalFull = throw "'heimdalFull' has been renamed to/replaced by 'heimdal'"; # Converted to throw 2022-02-22 heme = throw "heme has been removed: upstream is gone"; # added 2022-02-06 hepmc = hepmc2; # Added 2019-08-05 @@ -504,6 +508,7 @@ mapAliases ({ intecture-agent = throw "intecture-agent has been removed, because it was no longer maintained upstream"; # added 2021-12-15 intecture-auth = throw "intecture-auth has been removed, because it was no longer maintained upstream"; # added 2021-12-15 intecture-cli = throw "intecture-cli has been removed, because it was no longer maintained upstream"; # added 2021-12-15 + interfacer = throw "interfacer is deprecated and archived by upstream"; # Added 2022-04-05 inter-ui = inter; # Added 2021-03-27 iops = throw "iops was removed: upstream is gone"; # Added 2022-02-06 iproute = iproute2; # moved from top-level 2021-03-14 @@ -562,6 +567,8 @@ mapAliases ({ kramdown-rfc2629 = rubyPackages.kramdown-rfc2629; # Added 2021-03-23 krename-qt5 = throw "'krename-qt5' has been renamed to/replaced by 'krename'"; # Converted to throw 2022-02-22 krita-beta = krita; # moved from top-level 2021-12-23 + kube-aws = throw "kube-aws is deprecated and archived by upstream"; # Added 2022-04-05 + kubeless = throw "kubeless is deprecated and archived by upstream"; # Added 2022-04-05 kvm = throw "'kvm' has been renamed to/replaced by 'qemu_kvm'"; # Converted to throw 2022-02-22 ### L ### @@ -971,6 +978,7 @@ mapAliases ({ proglodyte-wasm = throw "proglodyte-wasm has been removed from nixpkgs, because it is unmaintained since 5 years with zero github stars"; # Added 2021-06-30 proj_5 = throw "Proj-5 has been removed from nixpkgs, use proj instead"; # Added 2021-04-12 prometheus-cups-exporter = throw "outdated and broken by design; removed by developer"; # Added 2021-03-16 + prometheus-mesos-exporter = throw "prometheus-mesos-exporter is deprecated and archived by upstream"; # Added 2022-04-05 proxytunnel = throw "proxytunnel has been removed from nixpkgs, because it has not been update upstream since it was added to nixpkgs in 2008 and has therefore bitrotted."; # added 2021-12-15 pulseaudioLight = throw "'pulseaudioLight' has been renamed to/replaced by 'pulseaudio'"; # Converted to throw 2022-02-22 pulseeffects = throw "Use pulseeffects-legacy if you use PulseAudio and easyeffects if you use PipeWire"; # Added 2021-02-13 @@ -1157,6 +1165,7 @@ mapAliases ({ tahoelafs = throw "'tahoelafs' has been renamed to/replaced by 'tahoe-lafs'"; # Converted to throw 2022-02-22 tangogps = foxtrotgps; # Added 2020-01-26 tdm = throw "tdm has been removed because nobody can figure out how to fix OpenAL integration. Use precompiled binary and `steam-run` instead"; + teleconsole = throw "teleconsole is archived by upstream"; # Added 2022-04-05 telepathy-qt = throw "telepathy-qt no longer supports Qt 4. Please use libsForQt5.telepathy instead"; # Added 2020-07-02 telepathy_farstream = throw "'telepathy_farstream' has been renamed to/replaced by 'telepathy-farstream'"; # Converted to throw 2022-02-22 telepathy_gabble = throw "'telepathy_gabble' has been renamed to/replaced by 'telepathy-gabble'"; # Converted to throw 2022-02-22 @@ -1401,6 +1410,9 @@ mapAliases ({ targetLlvmLibraries = targetPackages.llvmPackages_git.libraries; }); + # Added 2022-01-28 + zeroc-ice-36 = throw "Unmaintained, doesn't build w/glibc-2.34"; + /* If these are in the scope of all-packages.nix, they cause collisions between mixed versions of qt. See: https://github.com/NixOS/nixpkgs/pull/101369 */ diff --git a/pkgs/top-level/all-packages.nix b/pkgs/top-level/all-packages.nix index 4558c4612c5..52a898518b1 100644 --- a/pkgs/top-level/all-packages.nix +++ b/pkgs/top-level/all-packages.nix @@ -201,6 +201,8 @@ with pkgs; aesfix = callPackage ../tools/security/aesfix { }; + aeskeyfind = callPackage ../tools/security/aeskeyfind { }; + astrolog = callPackage ../applications/science/astronomy/astrolog { }; atkinson-hyperlegible = callPackage ../data/fonts/atkinson-hyperlegible { }; @@ -670,9 +672,9 @@ with pkgs; }; nghttp2 = buildPackages.nghttp2.override { fetchurl = stdenv.fetchurlBoot; - inherit zlib pkg-config openssl; - c-ares = buildPackages.c-ares.override { fetchurl = stdenv.fetchurlBoot; }; - libev = buildPackages.libev.override { fetchurl = stdenv.fetchurlBoot; }; + inherit pkg-config; + enableApp = false; # curl just needs libnghttp2 + enableTests = false; # avoids bringing `cunit` and `tzdata` into scope }; }); }; @@ -1541,8 +1543,6 @@ with pkgs; aws-nuke = callPackage ../tools/admin/aws-nuke { }; - aws-okta = callPackage ../tools/security/aws-okta { }; - aws-rotate-key = callPackage ../tools/admin/aws-rotate-key { }; aws-sam-cli = callPackage ../development/tools/aws-sam-cli { }; @@ -1723,8 +1723,6 @@ with pkgs; codeql = callPackage ../development/tools/analysis/codeql { }; - container-linux-config-transpiler = callPackage ../development/tools/container-linux-config-transpiler { }; - fedora-backgrounds = callPackage ../data/misc/fedora-backgrounds { }; ccextractor = callPackage ../applications/video/ccextractor { }; @@ -2482,8 +2480,6 @@ with pkgs; bustle = haskellPackages.bustle; - buttersink = callPackage ../tools/filesystems/buttersink { }; - bwm_ng = callPackage ../tools/networking/bwm-ng { }; bwbasic = callPackage ../development/interpreters/bwbasic { }; @@ -9077,6 +9073,10 @@ with pkgs; pleroma = callPackage ../servers/pleroma { }; + plfit = callPackage ../tools/misc/plfit { + python = null; + }; + ploticus = callPackage ../tools/graphics/ploticus { libpng = libpng12; }; @@ -10425,8 +10425,6 @@ with pkgs; teamviewer = libsForQt515.callPackage ../applications/networking/remote/teamviewer { }; - teleconsole = callPackage ../tools/misc/teleconsole { }; - telegraf = callPackage ../servers/monitoring/telegraf { }; teleport = callPackage ../servers/teleport {}; @@ -11211,7 +11209,9 @@ with pkgs; }; unbound-full = unbound.override { + python = python3; withSystemd = true; + withPythonModule = true; withDoH = true; withECS = true; withDNSCrypt = true; @@ -13287,18 +13287,18 @@ with pkgs; inherit (darwin) apple_sdk; }; - rust_1_58 = callPackage ../development/compilers/rust/1_58.nix { + rust_1_59 = callPackage ../development/compilers/rust/1_59.nix { inherit (darwin.apple_sdk.frameworks) CoreFoundation Security SystemConfiguration; llvm_13 = llvmPackages_13.libllvm; }; - rust = rust_1_58; + rust = rust_1_59; mrustc = callPackage ../development/compilers/mrustc { }; mrustc-minicargo = callPackage ../development/compilers/mrustc/minicargo.nix { }; mrustc-bootstrap = callPackage ../development/compilers/mrustc/bootstrap.nix { }; - rustPackages_1_58 = rust_1_58.packages.stable; - rustPackages = rustPackages_1_58; + rustPackages_1_59 = rust_1_59.packages.stable; + rustPackages = rustPackages_1_59; inherit (rustPackages) cargo clippy rustc rustPlatform; @@ -15362,8 +15362,6 @@ with pkgs; krew = callPackage ../development/tools/krew { }; - kube-aws = callPackage ../development/tools/kube-aws { }; - kube-hunter = callPackage ../tools/security/kube-hunter { }; kubeaudit = callPackage ../tools/security/kubeaudit { }; @@ -15520,6 +15518,8 @@ with pkgs; pythonPackages = python3Packages; }; + nix-bisect = callPackage ../development/tools/misc/nix-bisect { }; + nix-build-uncached = callPackage ../development/tools/misc/nix-build-uncached { }; nexus = callPackage ../development/tools/repository-managers/nexus { @@ -17132,7 +17132,7 @@ with pkgs; gmp5 = callPackage ../development/libraries/gmp/5.1.x.nix { }; gmp6 = callPackage ../development/libraries/gmp/6.x.nix { }; gmp = gmp6; - gmpxx = appendToName "with-cxx" (gmp.override { cxx = true; }); + gmpxx = gmp.override { cxx = true; }; #GMP ex-satellite, so better keep it near gmp mpfr = callPackage ../development/libraries/mpfr { }; @@ -18919,7 +18919,7 @@ with pkgs; libusb1 = callPackage ../development/libraries/libusb1 { inherit (darwin) libobjc; - inherit (darwin.apple_sdk.frameworks) IOKit; + inherit (darwin.apple_sdk.frameworks) IOKit Security; # TODO: remove once `udev` is `systemdMinimal` everywhere. udev = systemdMinimal; }; @@ -18951,7 +18951,7 @@ with pkgs; libva-minimal = libva.override { minimal = true; }; libva-utils = callPackage ../development/libraries/libva/utils.nix { }; - libva1 = callPackage ../development/libraries/libva/1.0.0.nix { }; + libva1 = callPackage ../development/libraries/libva/1.nix { }; libva1-minimal = libva1.override { minimal = true; }; libvarlink = callPackage ../development/libraries/libvarlink { }; @@ -20724,7 +20724,10 @@ with pkgs; wxGTK30-gtk2 = wxGTK30.override { withGtk2 = true; }; wxGTK30-gtk3 = wxGTK30.override { withGtk2 = false; }; - wxmac = callPackage ../development/libraries/wxwidgets/wxmac30.nix { }; + wxmac = callPackage ../development/libraries/wxwidgets/wxmac30.nix { + inherit (darwin.stubs) derez rez setfile; + inherit (darwin.apple_sdk.frameworks) AGL Cocoa Kernel WebKit; + }; wxGTK31 = callPackage ../development/libraries/wxwidgets/wxGTK31.nix { inherit (darwin.stubs) setfile; @@ -21395,8 +21398,6 @@ with pkgs; hasura-cli = callPackage ../servers/hasura/cli.nix { }; - heapster = callPackage ../servers/monitoring/heapster { }; - hbase = callPackage ../servers/hbase {}; headphones = callPackage ../servers/headphones {}; @@ -21999,7 +22000,6 @@ with pkgs; prometheus-knot-exporter = callPackage ../servers/monitoring/prometheus/knot-exporter.nix { }; prometheus-lnd-exporter = callPackage ../servers/monitoring/prometheus/lnd-exporter.nix { }; prometheus-mail-exporter = callPackage ../servers/monitoring/prometheus/mail-exporter.nix { }; - prometheus-mesos-exporter = callPackage ../servers/monitoring/prometheus/mesos-exporter.nix { }; prometheus-mikrotik-exporter = callPackage ../servers/monitoring/prometheus/mikrotik-exporter.nix { }; prometheus-minio-exporter = callPackage ../servers/monitoring/prometheus/minio-exporter { }; prometheus-modemmanager-exporter = callPackage ../servers/monitoring/prometheus/modemmanager-exporter.nix { }; @@ -22934,6 +22934,9 @@ with pkgs; enableDmeventd = true; enableCmdlib = true; }; + lvm2_vdo = lvm2_dmeventd.override { + enableVDO = true; + }; maddy = callPackage ../servers/maddy { }; @@ -23366,18 +23369,12 @@ with pkgs; withTimesyncd = false; withTpm2Tss = false; withUserDb = false; - glib = null; - libgcrypt = null; - lvm2 = null; - libfido2 = null; - p11-kit = null; }; systemdStage1 = systemdMinimal.override { pname = "systemd-stage-1"; withCryptsetup = true; withFido2 = true; withTpm2Tss = true; - inherit lvm2 libfido2 p11-kit; }; systemdStage1Network = systemdStage1.override { pname = "systemd-stage-1-network"; @@ -23509,11 +23506,11 @@ with pkgs; util-linuxCurses = util-linux; - util-linuxMinimal = if stdenv.isLinux then appendToName "minimal" (util-linux.override { + util-linuxMinimal = if stdenv.isLinux then util-linux.override { nlsSupport = false; ncurses = null; systemd = null; - }) else util-linux; + } else util-linux; v4l-utils = qt5.callPackage ../os-specific/linux/v4l-utils { }; @@ -23521,6 +23518,8 @@ with pkgs; vndr = callPackage ../development/tools/vndr { }; + vdo = callPackage ../os-specific/linux/vdo { }; + windows = callPackages ../os-specific/windows {}; wirelesstools = callPackage ../os-specific/linux/wireless-tools { }; @@ -24380,8 +24379,6 @@ with pkgs; hasklig = callPackage ../data/fonts/hasklig {}; - interfacer = callPackage ../development/tools/interfacer { }; - maligned = callPackage ../development/tools/maligned { }; inter = callPackage ../data/fonts/inter { }; @@ -26193,9 +26190,7 @@ with pkgs; }; # Git with SVN support, but without GUI. - gitSVN = lowPrio (appendToName "with-svn" (git.override { - svnSupport = true; - })); + gitSVN = lowPrio (git.override { svnSupport = true; }); git-doc = lib.addMetaAttrs { description = "Additional documentation for Git"; @@ -26205,11 +26200,11 @@ with pkgs; ''; } gitFull.doc; - gitMinimal = appendToName "minimal" (git.override { + gitMinimal = git.override { withManual = false; pythonSupport = false; withpcre2 = false; - }); + }; gitRepo = callPackage ../applications/version-management/git-repo { }; @@ -27147,8 +27142,6 @@ with pkgs; kubectl-tree = callPackage ../applications/networking/cluster/kubectl-tree { }; - kubeless = callPackage ../applications/networking/cluster/kubeless { }; - kubelogin = callPackage ../applications/networking/cluster/kubelogin { }; kubelogin-oidc = callPackage ../applications/networking/cluster/kubelogin-oidc { }; @@ -30476,10 +30469,6 @@ with pkgs; zeroc-ice-cpp11 = zeroc-ice.override { cpp11 = true; }; - zeroc-ice-36 = callPackage ../development/libraries/zeroc-ice/3.6.nix { - inherit (darwin.apple_sdk.frameworks) Security; - }; - zeronet = callPackage ../applications/networking/p2p/zeronet { }; zexy = callPackage ../applications/audio/pd-plugins/zexy { @@ -31014,6 +31003,8 @@ with pkgs; btanks = callPackage ../games/btanks { }; + bugdom = callPackage ../games/bugdom { }; + bzflag = callPackage ../games/bzflag { inherit (darwin.apple_sdk.frameworks) Carbon CoreServices; }; @@ -33414,10 +33405,10 @@ with pkgs; ghostscript = callPackage ../misc/ghostscript { }; - ghostscriptX = appendToName "with-X" (ghostscript.override { + ghostscriptX = ghostscript.override { cupsSupport = true; x11Support = true; - }); + }; glava = callPackage ../applications/misc/glava {}; diff --git a/pkgs/top-level/linux-kernels.nix b/pkgs/top-level/linux-kernels.nix index 26e4b3229a2..ca80ea02ffc 100644 --- a/pkgs/top-level/linux-kernels.nix +++ b/pkgs/top-level/linux-kernels.nix @@ -317,6 +317,8 @@ in { ena = callPackage ../os-specific/linux/ena {}; + kvdo = callPackage ../os-specific/linux/kvdo {}; + liquidtux = callPackage ../os-specific/linux/liquidtux {}; v4l2loopback = callPackage ../os-specific/linux/v4l2loopback { }; diff --git a/pkgs/top-level/ocaml-packages.nix b/pkgs/top-level/ocaml-packages.nix index 255ba4eb478..62394a00c6d 100644 --- a/pkgs/top-level/ocaml-packages.nix +++ b/pkgs/top-level/ocaml-packages.nix @@ -982,6 +982,14 @@ let ocsigen-toolkit = callPackage ../development/ocaml-modules/ocsigen-toolkit { }; + ocsipersist = callPackage ../development/ocaml-modules/ocsipersist {}; + + ocsipersist-lib = callPackage ../development/ocaml-modules/ocsipersist/lib.nix { }; + + ocsipersist-pgsql = callPackage ../development/ocaml-modules/ocsipersist/pgsql.nix { }; + + ocsipersist-sqlite = callPackage ../development/ocaml-modules/ocsipersist/sqlite.nix { }; + octavius = callPackage ../development/ocaml-modules/octavius { }; odate = callPackage ../development/ocaml-modules/odate { }; diff --git a/pkgs/top-level/python-aliases.nix b/pkgs/top-level/python-aliases.nix index 0abf2b58986..db0b456d905 100644 --- a/pkgs/top-level/python-aliases.nix +++ b/pkgs/top-level/python-aliases.nix @@ -35,6 +35,7 @@ in mapAliases ({ anyjson = throw "anyjson has been removed, it was using setuptools 2to3 translation feature, which has been removed in setuptools 58"; # added 2022-01-18 asyncio-nats-client = nats-py; # added 2022-02-08 + bitcoin-price-api = throw "bitcoin-price-api has been removed, it was using setuptools 2to3 translation feautre, which has been removed in setuptools 58"; # added 2022-02-15 blockdiagcontrib-cisco = throw "blockdiagcontrib-cisco is not compatible with blockdiag 2.0.0 and has been removed."; # added 2020-11-29 bt_proximity = bt-proximity; # added 2021-07-02 carrot = throw "carrot has been removed, as its development was discontinued in 2012"; # added 2022-01-18 @@ -48,6 +49,8 @@ mapAliases ({ diff_cover = diff-cover; # added 2021-07-02 discogs_client = discogs-client; # added 2021-07-02 djangorestframework-jwt = drf-jwt; # added 2021-07-20 + django_2 = throw "Django 2 has reached it's projected EOL in 2022/04 and has therefore been removed."; # added 2022-03-05 + django_appconf = django-appconf; # added 2022-03-03 django_environ = django-environ; # added 2021-12-25 django_extensions = django-extensions; # added 2022-01-09 django_redis = django-redis; # added 2021-10-11 @@ -72,6 +75,7 @@ mapAliases ({ lammps-cython = throw "lammps-cython no longer builds and is unmaintained"; # added 2021-07-04 Markups = markups; # added 2022-02-14 MechanicalSoup = mechanicalsoup; # added 2021-06-01 + nose-cover3 = throw "nose-cover3 has been removed, it was using setuptools 2to3 translation feature, which has been removed in setuptools 58"; # added 2022-02-16 pam = python-pam; # added 2020-09-07. PasteDeploy = pastedeploy; # added 2021-10-07 powerlineMemSegment = powerline-mem-segment; # added 2021-10-08 @@ -87,6 +91,7 @@ mapAliases ({ pytest_6 = pytest; # added 2022-02-10 pytestcov = pytest-cov; # added 2021-01-04 pytest-pep8 = pytestpep8; # added 2021-01-04 + pytest-pythonpath = throw "pytest-pythonpath is obsolete as of pytest 7.0.0 and has been removed"; # added 2022-03-09 pytestpep8 = throw "pytestpep8 was removed because it is abandoned and no longer compatible with pytest v6.0"; # added 2020-12-10 pytestquickcheck = pytest-quickcheck; # added 2021-07-20 pytestrunner = pytest-runner; # added 2021-01-04 @@ -118,6 +123,7 @@ mapAliases ({ tensorflow-bin_2 = tensorflow-bin; # added 2021-11-25 tensorflow-build_2 = tensorflow-build; # added 2021-11-25 tensorflow-estimator_2 = tensorflow-estimator; # added 2021-11-25 + tensorflow-tensorboard = tensorboard; # added 2022-03-06 tensorflow-tensorboard_2 = tensorflow-tensorboard; # added 2021-11-25 tvnamer = throw "tvnamer was moved to pkgs.tvnamer"; # added 2021-07-05 WazeRouteCalculator = wazeroutecalculator; # added 2021-09-29 diff --git a/pkgs/top-level/python-packages.nix b/pkgs/top-level/python-packages.nix index 01fd6c39c4c..5b9d8033232 100644 --- a/pkgs/top-level/python-packages.nix +++ b/pkgs/top-level/python-packages.nix @@ -1238,8 +1238,6 @@ in { bitcoinlib = callPackage ../development/python-modules/bitcoinlib { }; - bitcoin-price-api = callPackage ../development/python-modules/bitcoin-price-api { }; - bitcoin-utils-fork-minimal = callPackage ../development/python-modules/bitcoin-utils-fork-minimal { }; bitcoinrpc = callPackage ../development/python-modules/bitcoinrpc { }; @@ -2236,7 +2234,6 @@ in { django = self.django_3; # Current LTS - django_2 = callPackage ../development/python-modules/django/2.nix { }; django_3 = callPackage ../development/python-modules/django/3.nix { }; # Current latest @@ -2246,7 +2243,7 @@ in { django-anymail = callPackage ../development/python-modules/django-anymail { }; - django_appconf = callPackage ../development/python-modules/django_appconf { }; + django-appconf = callPackage ../development/python-modules/django-appconf { }; django-auth-ldap = callPackage ../development/python-modules/django-auth-ldap { }; @@ -2898,6 +2895,8 @@ in { findimports = callPackage ../development/python-modules/findimports { }; + findpython = callPackage ../development/python-modules/findpython { }; + fingerprints = callPackage ../development/python-modules/fingerprints { }; finitude = callPackage ../development/python-modules/finitude { }; @@ -3727,6 +3726,8 @@ in { hatasmota = callPackage ../development/python-modules/hatasmota { }; + hatchling = callPackage ../development/python-modules/hatchling { }; + haversine = callPackage ../development/python-modules/haversine { }; hawkauthlib = callPackage ../development/python-modules/hawkauthlib { }; @@ -5535,7 +5536,8 @@ in { nghttp2 = (toPythonModule (pkgs.nghttp2.override { inherit (self) python cython setuptools; inherit (pkgs) ncurses; - enablePython = true; + enableApp = false; # build only libnghttp2 ... + enablePython = true; # ... and its Python bindings })).python; nibabel = callPackage ../development/python-modules/nibabel { }; @@ -5610,8 +5612,6 @@ in { nose-cov = callPackage ../development/python-modules/nose-cov { }; - nose-cover3 = callPackage ../development/python-modules/nose-cover3 { }; - nose-cprof = callPackage ../development/python-modules/nose-cprof { }; nose-exclude = callPackage ../development/python-modules/nose-exclude { }; @@ -6384,6 +6384,10 @@ in { plexwebsocket = callPackage ../development/python-modules/plexwebsocket { }; + plfit = toPythonModule (pkgs.plfit.override { + inherit (self) python; + }); + plone-testing = callPackage ../development/python-modules/plone-testing { }; plotly = callPackage ../development/python-modules/plotly { }; @@ -7061,9 +7065,7 @@ in { pygetwindow = callPackage ../development/python-modules/pygetwindow { }; - pygit2 = callPackage ../development/python-modules/pygit2 { - libgit2 = pkgs.libgit2_1_3_0; - }; + pygit2 = callPackage ../development/python-modules/pygit2 { }; PyGithub = callPackage ../development/python-modules/pyGithub { }; @@ -7982,8 +7984,6 @@ in { pytest-pylint = callPackage ../development/python-modules/pytest-pylint { }; - pytest-pythonpath = callPackage ../development/python-modules/pytest-pythonpath { }; - pytest-qt = callPackage ../development/python-modules/pytest-qt { }; pytest-quickcheck = callPackage ../development/python-modules/pytest-quickcheck { }; @@ -9433,6 +9433,8 @@ in { sockjs-tornado = callPackage ../development/python-modules/sockjs-tornado { }; + socksio = callPackage ../development/python-modules/socksio { }; + socksipy-branch = callPackage ../development/python-modules/socksipy-branch { }; soco = callPackage ../development/python-modules/soco { }; @@ -9897,6 +9899,8 @@ in { tensorboard-plugin-wit = callPackage ../development/python-modules/tensorboard-plugin-wit { }; + tensorboard = callPackage ../development/python-modules/tensorboard { }; + tensorboardx = callPackage ../development/python-modules/tensorboardx { }; tensorflow-bin = callPackage ../development/python-modules/tensorflow/bin.nix { @@ -9929,8 +9933,6 @@ in { tensorflow = self.tensorflow-build; - tensorflow-tensorboard = callPackage ../development/python-modules/tensorflow-tensorboard { }; - tensorflowWithCuda = self.tensorflow.override { cudaSupport = true; }; @@ -10202,7 +10204,9 @@ in { trimesh = callPackage ../development/python-modules/trimesh { }; - trio = callPackage ../development/python-modules/trio { }; + trio = callPackage ../development/python-modules/trio { + inherit (pkgs) coreutils; + }; trio-asyncio = callPackage ../development/python-modules/trio-asyncio { }; diff --git a/pkgs/top-level/release-python.nix b/pkgs/top-level/release-python.nix index d90be7f3bb4..f3418572220 100644 --- a/pkgs/top-level/release-python.nix +++ b/pkgs/top-level/release-python.nix @@ -35,11 +35,12 @@ let name = "python-tested"; meta.description = "Release-critical packages from the python package sets"; constituents = [ - jobs.remarshal.x86_64-linux # Used in pkgs.formats helper - jobs.python39Packages.colorama.x86_64-linux # Used in nixos test-driver - jobs.python39Packages.ptpython.x86_64-linux # Used in nixos test-driver - jobs.python39Packages.requests.x86_64-linux # Almost ubiquous package - jobs.python39Packages.sphinx.x86_64-linux # Document creation for many packages + jobs.remarshal.x86_64-linux # Used in pkgs.formats helper + jobs.python39Packages.buildcatrust.x86_64-linux # Used in pkgs.cacert + jobs.python39Packages.colorama.x86_64-linux # Used in nixos test-driver + jobs.python39Packages.ptpython.x86_64-linux # Used in nixos test-driver + jobs.python39Packages.requests.x86_64-linux # Almost ubiquous package + jobs.python39Packages.sphinx.x86_64-linux # Document creation for many packages ]; }; |