diff options
author | Alyssa Ross <hi@alyssa.is> | 2022-05-31 09:59:33 +0000 |
---|---|---|
committer | Alyssa Ross <hi@alyssa.is> | 2022-05-31 09:59:57 +0000 |
commit | 9ff36293d1e428cd7bf03e8d4b03611b6d361c28 (patch) | |
tree | 1ab51a42b868c55b83f6ccdb80371b9888739dd9 /maintainers | |
parent | 1c4fcd0d4b0541e674ee56ace1053e23e562cc80 (diff) | |
parent | ddc3c396a51918043bb0faa6f676abd9562be62c (diff) | |
download | nixpkgs-9ff36293d1e428cd7bf03e8d4b03611b6d361c28.tar nixpkgs-9ff36293d1e428cd7bf03e8d4b03611b6d361c28.tar.gz nixpkgs-9ff36293d1e428cd7bf03e8d4b03611b6d361c28.tar.bz2 nixpkgs-9ff36293d1e428cd7bf03e8d4b03611b6d361c28.tar.lz nixpkgs-9ff36293d1e428cd7bf03e8d4b03611b6d361c28.tar.xz nixpkgs-9ff36293d1e428cd7bf03e8d4b03611b6d361c28.tar.zst nixpkgs-9ff36293d1e428cd7bf03e8d4b03611b6d361c28.zip |
Last good Nixpkgs for Weston+nouveau? archive
I came this commit hash to terwiz[m] on IRC, who is trying to figure out what the last version of Spectrum that worked on their NUC with Nvidia graphics is.
Diffstat (limited to 'maintainers')
54 files changed, 19639 insertions, 0 deletions
diff --git a/maintainers/maintainer-list.nix b/maintainers/maintainer-list.nix new file mode 100644 index 00000000000..fea30c74954 --- /dev/null +++ b/maintainers/maintainer-list.nix @@ -0,0 +1,14174 @@ +/* List of NixOS maintainers. + ```nix + handle = { + # Required + name = "Your name"; + email = "address@example.org"; + + # Optional + matrix = "@user:example.org"; + github = "GithubUsername"; + githubId = your-github-id; + keys = [{ + longkeyid = "rsa2048/0x0123456789ABCDEF"; + fingerprint = "AAAA BBBB CCCC DDDD EEEE FFFF 0000 1111 2222 3333"; + }]; + }; + ``` + + where + + - `handle` is the handle you are going to use in nixpkgs expressions, + - `name` is your, preferably real, name, + - `email` is your maintainer email address, + - `matrix` is your Matrix user ID, + - `github` is your GitHub handle (as it appears in the URL of your profile page, `https://github.com/<userhandle>`), + - `githubId` is your GitHub user ID, which can be found at `https://api.github.com/users/<userhandle>`, + - `keys` is a list of your PGP/GPG key IDs and fingerprints. + + `handle == github` is strongly preferred whenever `github` is an acceptable attribute name and is short and convenient. + + If `github` begins with a numeral, `handle` should be prefixed with an underscore. + ```nix + _1example = { + github = "1example"; + }; + ``` + + Add PGP/GPG keys only if you actually use them to sign commits and/or mail. + + To get the required PGP/GPG values for a key run + ```shell + gpg --keyid-format 0xlong --fingerprint <email> | head -n 2 + ``` + + !!! Note that PGP/GPG values stored here are for informational purposes only, don't use this file as a source of truth. + + More fields may be added in the future, however, in order to comply with GDPR this file should stay as minimal as possible. + + Please keep the list alphabetically sorted. + See `./scripts/check-maintainer-github-handles.sh` for an example on how to work with this data. +*/ +{ + _0qq = { + email = "0qqw0qqw@gmail.com"; + github = "0qq"; + githubId = 64707304; + name = "Dmitry Kulikov"; + }; + _0x4A6F = { + email = "mail-maintainer@0x4A6F.dev"; + matrix = "@0x4a6f:matrix.org"; + name = "Joachim Ernst"; + github = "0x4A6F"; + githubId = 9675338; + keys = [{ + longkeyid = "rsa8192/0x87027528B006D66D"; + fingerprint = "F466 A548 AD3F C1F1 8C88 4576 8702 7528 B006 D66D"; + }]; + }; + _0xbe7a = { + email = "nix@be7a.de"; + name = "Bela Stoyan"; + github = "0xbe7a"; + githubId = 6232980; + keys = [{ + longkeyid = "rsa4096/0x6510870A77F49A99"; + fingerprint = "2536 9E86 1AA5 9EB7 4C47 B138 6510 870A 77F4 9A99"; + }]; + }; + _1000101 = { + email = "b1000101@pm.me"; + github = "1000101"; + githubId = 791309; + name = "Jan Hrnko"; + }; + _1000teslas = { + name = "Kevin Tran"; + email = "47207223+1000teslas@users.noreply.github.com"; + github = "1000teslas"; + githubId = 47207223; + }; + _3699n = { + email = "nicholas@nvk.pm"; + github = "3699n"; + githubId = 7414843; + name = "Nicholas von Klitzing"; + }; + _13r0ck = { + name = "Brock Szuszczewicz"; + email = "bnr@tuta.io"; + github = "13r0ck"; + githubId = 58987761; + }; + _3noch = { + email = "eacameron@gmail.com"; + github = "3noch"; + githubId = 882455; + name = "Elliot Cameron"; + }; + _414owen = { + email = "owen@owen.cafe"; + github = "414owen"; + githubId = 1714287; + name = "Owen Shepherd"; + }; + _6AA4FD = { + email = "f6442954@gmail.com"; + github = "6AA4FD"; + githubId = 12578560; + name = "Quinn Bohner"; + }; + a1russell = { + email = "adamlr6+pub@gmail.com"; + github = "a1russell"; + githubId = 241628; + name = "Adam Russell"; + }; + aadibajpai = { + email = "hello@aadibajpai.com"; + github = "aadibajpai"; + githubId = 27063113; + name = "Aadi Bajpai"; + }; + aanderse = { + email = "aaron@fosslib.net"; + matrix = "@aanderse:nixos.dev"; + github = "aanderse"; + githubId = 7755101; + name = "Aaron Andersen"; + }; + aaronjanse = { + email = "aaron@ajanse.me"; + matrix = "@aaronjanse:matrix.org"; + github = "aaronjanse"; + githubId = 16829510; + name = "Aaron Janse"; + }; + aaronjheng = { + email = "wentworth@outlook.com"; + github = "aaronjheng"; + githubId = 806876; + name = "Aaron Jheng"; + }; + aaronschif = { + email = "aaronschif@gmail.com"; + github = "aaronschif"; + githubId = 2258953; + name = "Aaron Schif"; + }; + aaschmid = { + email = "service@aaschmid.de"; + github = "aaschmid"; + githubId = 567653; + name = "Andreas Schmid"; + }; + abaldeau = { + email = "andreas@baldeau.net"; + github = "baldo"; + githubId = 178750; + name = "Andreas Baldeau"; + }; + abathur = { + email = "travis.a.everett+nixpkgs@gmail.com"; + github = "abathur"; + githubId = 2548365; + name = "Travis A. Everett"; + }; + abbe = { + email = "ashish.is@lostca.se"; + matrix = "@abbe:badti.me"; + github = "wahjava"; + githubId = 2255192; + name = "Ashish SHUKLA"; + keys = [{ + longkeyid = "rsa4096/0xC746CFA9E74FA4B0"; + fingerprint = "F682 CDCC 39DC 0FEA E116 20B6 C746 CFA9 E74F A4B0"; + }]; + }; + abbradar = { + email = "ab@fmap.me"; + github = "abbradar"; + githubId = 1174810; + name = "Nikolay Amiantov"; + }; + abhi18av = { + email = "abhi18av@gmail.com"; + github = "abhi18av"; + githubId = 12799326; + name = "Abhinav Sharma"; + }; + abigailbuccaneer = { + email = "abigailbuccaneer@gmail.com"; + github = "abigailbuccaneer"; + githubId = 908758; + name = "Abigail Bunyan"; + }; + aborsu = { + email = "a.borsu@gmail.com"; + github = "aborsu"; + githubId = 5033617; + name = "Augustin Borsu"; + }; + aboseley = { + email = "adam.boseley@gmail.com"; + github = "aboseley"; + githubId = 13504599; + name = "Adam Boseley"; + }; + abuibrahim = { + email = "ruslan@babayev.com"; + github = "abuibrahim"; + githubId = 2321000; + name = "Ruslan Babayev"; + }; + acairncross = { + email = "acairncross@gmail.com"; + github = "acairncross"; + githubId = 1517066; + name = "Aiken Cairncross"; + }; + aciceri = { + name = "Andrea Ciceri"; + email = "andrea.ciceri@autistici.org"; + github = "aciceri"; + githubId = 2318843; + }; + acowley = { + email = "acowley@gmail.com"; + github = "acowley"; + githubId = 124545; + name = "Anthony Cowley"; + }; + adamlwgriffiths = { + email = "adam.lw.griffiths@gmail.com"; + github = "adamlwgriffiths"; + githubId = 1239156; + name = "Adam Griffiths"; + }; + adamt = { + email = "mail@adamtulinius.dk"; + github = "adamtulinius"; + githubId = 749381; + name = "Adam Tulinius"; + }; + adelbertc = { + email = "adelbertc@gmail.com"; + github = "adelbertc"; + githubId = 1332980; + name = "Adelbert Chang"; + }; + adev = { + email = "adev@adev.name"; + github = "adevress"; + githubId = 1773511; + name = "Adrien Devresse"; + }; + addict3d = { + email = "nickbathum@gmail.com"; + matrix = "@nbathum:matrix.org"; + github = "addict3d"; + githubId = 49227; + name = "Nick Bathum"; + }; + adisbladis = { + email = "adisbladis@gmail.com"; + matrix = "@adis:blad.is"; + github = "adisbladis"; + githubId = 63286; + name = "Adam Hose"; + }; + Adjective-Object = { + email = "mhuan13@gmail.com"; + github = "Adjective-Object"; + githubId = 1174858; + name = "Maxwell Huang-Hobbs"; + }; + adnelson = { + email = "ithinkican@gmail.com"; + github = "adnelson"; + githubId = 5091511; + name = "Allen Nelson"; + }; + adolfogc = { + email = "adolfo.garcia.cr@gmail.com"; + github = "adolfogc"; + githubId = 1250775; + name = "Adolfo E. García Castro"; + }; + AdsonCicilioti = { + name = "Adson Cicilioti"; + email = "adson.cicilioti@live.com"; + github = "AdsonCicilioti"; + githubId = 6278398; + }; + adsr = { + email = "as@php.net"; + github = "adsr"; + githubId = 315003; + name = "Adam Saponara"; + }; + aerialx = { + email = "aaron+nixos@aaronlindsay.com"; + github = "AerialX"; + githubId = 117295; + name = "Aaron Lindsay"; + }; + aespinosa = { + email = "allan.espinosa@outlook.com"; + github = "aespinosa"; + githubId = 58771; + name = "Allan Espinosa"; + }; + aethelz = { + email = "aethelz@protonmail.com"; + github = "aethelz"; + githubId = 10677343; + name = "Eugene"; + }; + aflatter = { + email = "flatter@fastmail.fm"; + github = "aflatter"; + githubId = 168; + name = "Alexander Flatter"; + }; + afldcr = { + email = "alex@fldcr.com"; + github = "afldcr"; + githubId = 335271; + name = "James Alexander Feldman-Crough"; + }; + afontain = { + email = "antoine.fontaine@epfl.ch"; + github = "necessarily-equal"; + githubId = 59283660; + name = "Antoine Fontaine"; + }; + aforemny = { + email = "aforemny@posteo.de"; + github = "aforemny"; + githubId = 610962; + name = "Alexander Foremny"; + }; + afranchuk = { + email = "alex.franchuk@gmail.com"; + github = "afranchuk"; + githubId = 4296804; + name = "Alex Franchuk"; + }; + agbrooks = { + email = "andrewgrantbrooks@gmail.com"; + github = "agbrooks"; + githubId = 19290901; + name = "Andrew Brooks"; + }; + aherrmann = { + email = "andreash87@gmx.ch"; + github = "aherrmann"; + githubId = 732652; + name = "Andreas Herrmann"; + }; + ahrzb = { + email = "ahrzb5@gmail.com"; + github = "ahrzb"; + githubId = 5220438; + name = "AmirHossein Roozbahani"; + }; + ahuzik = { + email = "ah1990au@gmail.com"; + github = "alesya-h"; + githubId = 209175; + name = "Alesya Huzik"; + }; + aij = { + email = "aij+git@mrph.org"; + github = "aij"; + githubId = 4732885; + name = "Ivan Jager"; + }; + airwoodix = { + email = "airwoodix@posteo.me"; + github = "airwoodix"; + githubId = 44871469; + name = "Etienne Wodey"; + }; + ajs124 = { + email = "nix@ajs124.de"; + matrix = "@andreas.schraegle:helsinki-systems.de"; + github = "ajs124"; + githubId = 1229027; + name = "Andreas Schrägle"; + }; + ajgrf = { + email = "a@ajgrf.com"; + github = "ajgrf"; + githubId = 10733175; + name = "Alex Griffin"; + }; + ak = { + email = "ak@formalprivacy.com"; + github = "alexanderkjeldaas"; + githubId = 339369; + name = "Alexander Kjeldaas"; + }; + akavel = { + email = "czapkofan@gmail.com"; + github = "akavel"; + githubId = 273837; + name = "Mateusz Czapliński"; + }; + akamaus = { + email = "dmitryvyal@gmail.com"; + github = "akamaus"; + githubId = 58955; + name = "Dmitry Vyal"; + }; + akaWolf = { + email = "akawolf0@gmail.com"; + github = "akaWolf"; + githubId = 5836586; + name = "Artjom Vejsel"; + }; + akc = { + email = "akc@akc.is"; + github = "akc"; + githubId = 1318982; + name = "Anders Claesson"; + }; + akho = { + name = "Alexander Khodyrev"; + email = "a@akho.name"; + github = "akho"; + githubId = 104951; + }; + akru = { + email = "mail@akru.me"; + github = "akru"; + githubId = 786394; + name = "Alexander Krupenkin "; + }; + akshgpt7 = { + email = "akshgpt7@gmail.com"; + github = "akshgpt7"; + githubId = 20405311; + name = "Aksh Gupta"; + }; + albakham = { + email = "dev@geber.ga"; + github = "albakham"; + githubId = 43479487; + name = "Titouan Biteau"; + }; + alerque = { + email = "caleb@alerque.com"; + github = "alerque"; + githubId = 173595; + name = "Caleb Maclennan"; + }; + ALEX11BR = { + email = "alexioanpopa11@gmail.com"; + github = "ALEX11BR"; + githubId = 49609151; + name = "Popa Ioan Alexandru"; + }; + alexarice = { + email = "alexrice999@hotmail.co.uk"; + github = "alexarice"; + githubId = 17208985; + name = "Alex Rice"; + }; + alexbakker = { + email = "ab@alexbakker.me"; + github = "alexbakker"; + githubId = 2387841; + name = "Alexander Bakker"; + }; + alexbiehl = { + email = "alexbiehl@gmail.com"; + github = "alexbiehl"; + githubId = 1876617; + name = "Alex Biehl"; + }; + alexchapman = { + email = "alex@farfromthere.net"; + github = "AJChapman"; + githubId = 8316672; + name = "Alex Chapman"; + }; + alexfmpe = { + email = "alexandre.fmp.esteves@gmail.com"; + github = "alexfmpe"; + githubId = 2335822; + name = "Alexandre Esteves"; + }; + alexnortung = { + name = "alexnortung"; + email = "alex_nortung@live.dk"; + github = "alexnortung"; + githubId = 1552267; + }; + alexvorobiev = { + email = "alexander.vorobiev@gmail.com"; + github = "alexvorobiev"; + githubId = 782180; + name = "Alex Vorobiev"; + }; + alex-eyre = { + email = "A.Eyre@sms.ed.ac.uk"; + github = "alex-eyre"; + githubId = 38869148; + name = "Alex Eyre"; + }; + alibabzo = { + email = "alistair.bill@gmail.com"; + github = "alibabzo"; + githubId = 2822871; + name = "Alistair Bill"; + }; + alirezameskin = { + email = "alireza.meskin@gmail.com"; + github = "alirezameskin"; + githubId = 36147; + name = "Alireza Meskin"; + }; + alkeryn = { + email = "plbraundev@gmail.com"; + github = "Alkeryn"; + githubId = 11599075; + name = "Pierre-Louis Braun"; + }; + all = { + email = "nix-commits@lists.science.uu.nl"; + name = "Nix Committers"; + }; + allonsy = { + email = "linuxbash8@gmail.com"; + github = "allonsy"; + githubId = 5892756; + name = "Alec Snyder"; + }; + AluisioASG = { + name = "Aluísio Augusto Silva Gonçalves"; + email = "aluisio@aasg.name"; + github = "AluisioASG"; + githubId = 1904165; + keys = [{ + longkeyid = "rsa4096/0x9FAA63E097506D9D"; + fingerprint = "7FDB 17B3 C29B 5BA6 E5A9 8BB2 9FAA 63E0 9750 6D9D"; + }]; + }; + almac = { + email = "alma.cemerlic@gmail.com"; + github = "a1mac"; + githubId = 60479013; + name = "Alma Cemerlic"; + }; + alunduil = { + email = "alunduil@gmail.com"; + github = "alunduil"; + githubId = 169249; + name = "Alex Brandt"; + }; + alva = { + email = "alva@skogen.is"; + github = "fjallarefur"; + githubId = 42881386; + name = "Alva"; + keys = [{ + longkeyid = "ed25519/0xF53E323342F7A6D3"; + fingerprint = "B422 CFB1 C9EF 73F7 E1E2 698D F53E 3233 42F7 A6D3A"; + }]; + }; + alyaeanyx = { + email = "alexandra.hollmeier@mailbox.org"; + github = "alyaeanyx"; + githubId = 74795488; + name = "Alexandra Hollmeier"; + keys = [{ + longkeyid = "rsa3072/0x87D1AADCD25B8DEE"; + fingerprint = "1F73 8879 5E5A 3DFC E2B3 FA32 87D1 AADC D25B 8DEE"; + }]; + }; + amanjeev = { + email = "aj@amanjeev.com"; + github = "amanjeev"; + githubId = 160476; + name = "Amanjeev Sethi"; + }; + amar1729 = { + email = "amar.paul16@gmail.com"; + github = "amar1729"; + githubId = 15623522; + name = "Amar Paul"; + }; + amarshall = { + email = "andrew@johnandrewmarshall.com"; + github = "amarshall"; + githubId = 153175; + name = "Andrew Marshall"; + }; + ambroisie = { + email = "bruno.nixpkgs@belanyi.fr"; + github = "ambroisie"; + githubId = 12465195; + name = "Bruno BELANYI"; + }; + ambrop72 = { + email = "ambrop7@gmail.com"; + github = "ambrop72"; + githubId = 2626481; + name = "Ambroz Bizjak"; + }; + ametrine = { + name = "Matilde Ametrine"; + email = "matilde@diffyq.xyz"; + github = "matilde-ametrine"; + githubId = 90799677; + keys = [{ + longkeyid = "rsa3072/0x07EE1FFCA58A11C5"; + fingerprint = "7931 EB4E 4712 D7BE 04F8 6D34 07EE 1FFC A58A 11C5"; + }]; + }; + amfl = { + email = "amfl@none.none"; + github = "amfl"; + githubId = 382798; + name = "amfl"; + }; + amiddelk = { + email = "amiddelk@gmail.com"; + github = "amiddelk"; + githubId = 1358320; + name = "Arie Middelkoop"; + }; + amiloradovsky = { + email = "miloradovsky@gmail.com"; + github = "amiloradovsky"; + githubId = 20530052; + name = "Andrew Miloradovsky"; + }; + notbandali = { + name = "Amin Bandali"; + email = "bandali@gnu.org"; + github = "notbandali"; + githubId = 1254858; + keys = [{ + longkeyid = "rsa4096/0xA21A020248816103"; + fingerprint = "BE62 7373 8E61 6D6D 1B3A 08E8 A21A 0202 4881 6103"; + }]; + }; + aminechikhaoui = { + email = "amine.chikhaoui91@gmail.com"; + github = "AmineChikhaoui"; + githubId = 5149377; + name = "Amine Chikhaoui"; + }; + amorsillo = { + email = "andrew.morsillo@gmail.com"; + github = "AndrewMorsillo"; + githubId = 858965; + name = "Andrew Morsillo"; + }; + andehen = { + email = "git@andehen.net"; + github = "andehen"; + githubId = 754494; + name = "Anders Asheim Hennum"; + }; + andersk = { + email = "andersk@mit.edu"; + github = "andersk"; + githubId = 26471; + name = "Anders Kaseorg"; + }; + anderslundstedt = { + email = "git@anderslundstedt.se"; + github = "anderslundstedt"; + githubId = 4514101; + name = "Anders Lundstedt"; + }; + AndersonTorres = { + email = "torres.anderson.85@protonmail.com"; + github = "AndersonTorres"; + githubId = 5954806; + name = "Anderson Torres"; + }; + anderspapitto = { + email = "anderspapitto@gmail.com"; + github = "anderspapitto"; + githubId = 1388690; + name = "Anders Papitto"; + }; + andir = { + email = "andreas@rammhold.de"; + github = "andir"; + githubId = 638836; + name = "Andreas Rammhold"; + }; + andreasfelix = { + email = "fandreas@physik.hu-berlin.de"; + github = "andreasfelix"; + githubId = 24651767; + name = "Felix Andreas"; + }; + andres = { + email = "ksnixos@andres-loeh.de"; + github = "kosmikus"; + githubId = 293191; + name = "Andres Loeh"; + }; + andresilva = { + email = "andre.beat@gmail.com"; + github = "andresilva"; + githubId = 123550; + name = "André Silva"; + }; + andrestylianos = { + email = "andre.stylianos@gmail.com"; + github = "andrestylianos"; + githubId = 7112447; + name = "Andre S. Ramos"; + }; + andrew-d = { + email = "andrew@du.nham.ca"; + github = "andrew-d"; + githubId = 1079173; + name = "Andrew Dunham"; + }; + andrewchambers = { + email = "ac@acha.ninja"; + github = "andrewchambers"; + githubId = 962885; + name = "Andrew Chambers"; + }; + andrewrk = { + email = "superjoe30@gmail.com"; + github = "andrewrk"; + githubId = 106511; + name = "Andrew Kelley"; + }; + andsild = { + email = "andsild@gmail.com"; + github = "andsild"; + githubId = 3808928; + name = "Anders Sildnes"; + }; + andys8 = { + email = "andys8@users.noreply.github.com"; + github = "andys8"; + githubId = 13085980; + name = "Andy"; + }; + aneeshusa = { + email = "aneeshusa@gmail.com"; + github = "aneeshusa"; + githubId = 2085567; + name = "Aneesh Agrawal"; + }; + angristan = { + email = "angristan@pm.me"; + github = "angristan"; + githubId = 11699655; + name = "Stanislas Lange"; + }; + anhdle14 = { + name = "Le Anh Duc"; + email = "anhdle14@icloud.com"; + github = "anhdle14"; + githubId = 9645992; + keys = [{ + longkeyid = "rsa4096/0x0299AFF9ECBB5169"; + fingerprint = "AA4B 8EC3 F971 D350 482E 4E20 0299 AFF9 ECBB 5169"; + }]; + }; + anhduy = { + email = "vo@anhduy.io"; + github = "voanhduy1512"; + githubId = 1771266; + name = "Vo Anh Duy"; + }; + anirrudh = { + email = "anik597@gmail.com"; + github = "anirrudh"; + githubId = 6091755; + name = "Anirrudh Krishnan"; + }; + ankhers = { + email = "me@ankhers.dev"; + github = "ankhers"; + githubId = 750786; + name = "Justin Wood"; + }; + anna328p = { + email = "anna328p@gmail.com"; + github = "anna328p"; + githubId = 9790772; + name = "Anna"; + }; + anmonteiro = { + email = "anmonteiro@gmail.com"; + github = "anmonteiro"; + githubId = 661909; + name = "Antonio Nuno Monteiro"; + }; + anpryl = { + email = "anpryl@gmail.com"; + github = "anpryl"; + githubId = 5327697; + name = "Anatolii Prylutskyi"; + }; + antoinerg = { + email = "roygobeil.antoine@gmail.com"; + github = "antoinerg"; + githubId = 301546; + name = "Antoine Roy-Gobeil"; + }; + anton-dessiatov = { + email = "anton.dessiatov@gmail.com"; + github = "anton-dessiatov"; + githubId = 2873280; + name = "Anton Desyatov"; + }; + Anton-Latukha = { + email = "anton.latuka+nixpkgs@gmail.com"; + github = "Anton-Latukha"; + githubId = 20933385; + name = "Anton Latukha"; + }; + antono = { + email = "self@antono.info"; + github = "antono"; + githubId = 7622; + name = "Antono Vasiljev"; + }; + antonxy = { + email = "anton.schirg@posteo.de"; + github = "antonxy"; + githubId = 4194320; + name = "Anton Schirg"; + }; + apeschar = { + email = "albert@peschar.net"; + github = "apeschar"; + githubId = 122977; + name = "Albert Peschar"; + }; + apeyroux = { + email = "alex@px.io"; + github = "apeyroux"; + githubId = 1078530; + name = "Alexandre Peyroux"; + }; + applePrincess = { + email = "appleprincess@appleprincess.io"; + github = "applePrincess"; + githubId = 17154507; + name = "Lein Matsumaru"; + keys = [{ + longkeyid = "rsa4096/0xAAA50652F0479205"; + fingerprint = "BF8B F725 DA30 E53E 7F11 4ED8 AAA5 0652 F047 9205"; + }]; + }; + ar1a = { + email = "aria@ar1as.space"; + github = "ar1a"; + githubId = 8436007; + name = "Aria Edmonds"; + }; + arcadio = { + email = "arc@well.ox.ac.uk"; + github = "arcadio"; + githubId = 56009; + name = "Arcadio Rubio García"; + }; + archseer = { + email = "blaz@mxxn.io"; + github = "archseer"; + githubId = 1372918; + name = "Blaž Hrastnik"; + }; + arcnmx = { + email = "arcnmx@users.noreply.github.com"; + github = "arcnmx"; + githubId = 13426784; + name = "arcnmx"; + }; + arcticlimer = { + email = "vinigm.nho@gmail.com"; + github = "arcticlimer"; + githubId = 59743220; + name = "Vinícius Müller"; + }; + ardumont = { + email = "eniotna.t@gmail.com"; + github = "ardumont"; + githubId = 718812; + name = "Antoine R. Dumont"; + }; + arezvov = { + email = "alex@rezvov.ru"; + github = "arezvov"; + githubId = 58516559; + name = "Alexander Rezvov"; + }; + arianvp = { + email = "arian.vanputten@gmail.com"; + github = "arianvp"; + githubId = 628387; + name = "Arian van Putten"; + }; + aristid = { + email = "aristidb@gmail.com"; + github = "aristidb"; + githubId = 30712; + name = "Aristid Breitkreuz"; + }; + ariutta = { + email = "anders.riutta@gmail.com"; + github = "ariutta"; + githubId = 1296771; + name = "Anders Riutta"; + }; + arkivm = { + email = "vikram186@gmail.com"; + github = "arkivm"; + githubId = 1118815; + name = "Vikram Narayanan"; + }; + armijnhemel = { + email = "armijn@tjaldur.nl"; + github = "armijnhemel"; + githubId = 10587952; + name = "Armijn Hemel"; + }; + arnarg = { + email = "arnarg@fastmail.com"; + github = "arnarg"; + githubId = 1291396; + name = "Arnar Ingason"; + }; + arnoldfarkas = { + email = "arnold.farkas@gmail.com"; + github = "arnoldfarkas"; + githubId = 59696216; + name = "Arnold Farkas"; + }; + arnoutkroeze = { + email = "nixpkgs@arnoutkroeze.nl"; + github = "arnoutkroeze"; + githubId = 37151054; + name = "Arnout Kroeze"; + }; + arobyn = { + email = "shados@shados.net"; + github = "shados"; + githubId = 338268; + name = "Alexei Robyn"; + }; + artemist = { + email = "me@artem.ist"; + github = "artemist"; + githubId = 1226638; + name = "Artemis Tosini"; + keys = [{ + longkeyid = "rsa4096/0x4FDC96F161E7BA8A"; + fingerprint = "3D2B B230 F9FA F0C5 1832 46DD 4FDC 96F1 61E7 BA8A"; + }]; + }; + arthur = { + email = "me@arthur.li"; + github = "arthurl"; + githubId = 3965744; + name = "Arthur Lee"; + }; + arthurteisseire = { + email = "arthurteisseire33@gmail.com"; + github = "arthurteisseire"; + githubId = 37193992; + name = "Arthur Teisseire"; + }; + arturcygan = { + email = "arczicygan@gmail.com"; + github = "arcz"; + githubId = 4679721; + name = "Artur Cygan"; + }; + artuuge = { + email = "artuuge@gmail.com"; + github = "artuuge"; + githubId = 10285250; + name = "Artur E. Ruuge"; + }; + asbachb = { + email = "asbachb-nixpkgs-5c2a@impl.it"; + matrix = "@asbachb:matrix.org"; + github = "asbachb"; + githubId = 1482768; + name = "Benjamin Asbach"; + }; + ashalkhakov = { + email = "artyom.shalkhakov@gmail.com"; + github = "ashalkhakov"; + githubId = 1270502; + name = "Artyom Shalkhakov"; + }; + ashgillman = { + email = "gillmanash@gmail.com"; + github = "ashgillman"; + githubId = 816777; + name = "Ashley Gillman"; + }; + ashkitten = { + email = "ashlea@protonmail.com"; + github = "ashkitten"; + githubId = 9281956; + name = "ash lea"; + }; + aske = { + email = "aske@fmap.me"; + github = "aske"; + githubId = 869771; + name = "Kirill Boltaev"; + }; + ashley = { + email = "personavinny@protonmail.com"; + github = "paranoidcat"; + githubId = 84152630; + name = "Ashley Chiara"; + }; + asppsa = { + email = "asppsa@gmail.com"; + github = "asppsa"; + githubId = 453170; + name = "Alastair Pharo"; + }; + astro = { + email = "astro@spaceboyz.net"; + github = "astro"; + githubId = 12923; + name = "Astro"; + }; + astsmtl = { + email = "astsmtl@yandex.ru"; + github = "astsmtl"; + githubId = 2093941; + name = "Alexander Tsamutali"; + }; + asymmetric = { + email = "lorenzo@mailbox.org"; + github = "asymmetric"; + githubId = 101816; + name = "Lorenzo Manacorda"; + }; + aszlig = { + email = "aszlig@nix.build"; + github = "aszlig"; + githubId = 192147; + name = "aszlig"; + keys = [{ + longkeyid = "ed25519/0x684089CE67EBB691"; + fingerprint = "DD52 6BC7 767D BA28 16C0 95E5 6840 89CE 67EB B691"; + }]; + }; + atemu = { + name = "Atemu"; + email = "atemu.main+nixpkgs@gmail.com"; + github = "Atemu"; + githubId = 18599032; + }; + athas = { + email = "athas@sigkill.dk"; + github = "athas"; + githubId = 55833; + name = "Troels Henriksen"; + }; + atila = { + name = "Átila Saraiva"; + email = "atilasaraiva@gmail.com"; + github = "AtilaSaraiva"; + githubId = 29521461; + }; + atkinschang = { + email = "atkinschang+nixpkgs@gmail.com"; + github = "AtkinsChang"; + githubId = 5193600; + name = "Atkins Chang"; + }; + atnnn = { + email = "etienne@atnnn.com"; + github = "atnnn"; + githubId = 706854; + name = "Etienne Laurin"; + }; + attila-lendvai = { + name = "Attila Lendvai"; + email = "attila@lendvai.name"; + github = "attila-lendvai"; + githubId = 840345; + }; + auntie = { + email = "auntieNeo@gmail.com"; + github = "auntieNeo"; + githubId = 574938; + name = "Jonathan Glines"; + }; + austinbutler = { + email = "austinabutler@gmail.com"; + github = "austinbutler"; + githubId = 354741; + name = "Austin Butler"; + }; + autophagy = { + email = "mail@autophagy.io"; + github = "autophagy"; + githubId = 12958979; + name = "Mika Naylor"; + }; + avaq = { + email = "nixpkgs@account.avaq.it"; + github = "avaq"; + githubId = 1217745; + name = "Aldwin Vlasblom"; + }; + avery = { + email = "averyl+nixos@protonmail.com"; + github = "AveryLychee"; + githubId = 9147625; + name = "Avery Lychee"; + }; + averelld = { + email = "averell+nixos@rxd4.com"; + github = "averelld"; + githubId = 687218; + name = "averelld"; + }; + avh4 = { + email = "gruen0aermel@gmail.com"; + github = "avh4"; + githubId = 1222; + name = "Aaron VonderHaar"; + }; + avitex = { + email = "theavitex@gmail.com"; + github = "avitex"; + githubId = 5110816; + name = "avitex"; + keys = [{ + longkeyid = "rsa4096/0x8B366C443CABE942"; + fingerprint = "271E 136C 178E 06FA EA4E B854 8B36 6C44 3CAB E942"; + }]; + }; + avnik = { + email = "avn@avnik.info"; + github = "avnik"; + githubId = 153538; + name = "Alexander V. Nikolaev"; + }; + aw = { + email = "aw-nixos@meterriblecrew.net"; + github = "herrwiese"; + githubId = 206242; + name = "Andreas Wiese"; + }; + aycanirican = { + email = "iricanaycan@gmail.com"; + github = "aycanirican"; + githubId = 135230; + name = "Aycan iRiCAN"; + }; + arjix = { + email = "arjix@protonmail.com"; + github = "arjix"; + githubId = 62168569; + name = "arjix"; + }; + artturin = { + email = "artturin@artturin.com"; + matrix = "@artturin:matrix.org"; + github = "artturin"; + githubId = 56650223; + name = "Artturi N"; + }; + azahi = { + name = "Azat Bahawi"; + email = "azat@bahawi.net"; + matrix = "@azahi:azahi.cc"; + github = "azahi"; + githubId = 22211000; + keys = [{ + longkeyid = "rsa4096/0xC8C6BDDB3847F72B"; + fingerprint = "2688 0377 C31D 9E81 9BDF 83A8 C8C6 BDDB 3847 F72B"; + }]; + }; + ayazhafiz = { + email = "ayaz.hafiz.1@gmail.com"; + github = "ayazhafiz"; + githubId = 262763; + name = "Ayaz Hafiz"; + }; + azuwis = { + email = "azuwis@gmail.com"; + github = "azuwis"; + githubId = 9315; + name = "Zhong Jianxin"; + }; + b4dm4n = { + email = "fabianm88@gmail.com"; + github = "B4dM4n"; + githubId = 448169; + name = "Fabian Möller"; + keys = [{ + longkeyid = "rsa4096/0x754B5C0963C42C5"; + fingerprint = "6309 E212 29D4 DA30 AF24 BDED 754B 5C09 63C4 2C50"; + }]; + }; + babariviere = { + email = "babathriviere@gmail.com"; + github = "babariviere"; + githubId = 12128029; + name = "Bastien Rivière"; + keys = [{ + longkeyid = "rsa4096/0xF202AD3B6EDF4BD1"; + fingerprint = "2F85 B362 B274 0012 37E2 81EE F202 AD3B 6EDF 4BD1"; + }]; + }; + babbaj = { + name = "babbaj"; + email = "babbaj45@gmail.com"; + github = "babbaj"; + githubId = 12820770; + keys = [{ + longkeyid = "rsa4096/0xF044309848A07CAC"; + fingerprint = "6FBC A462 4EAF C69C A7C4 98C1 F044 3098 48A0 7CAC"; + }]; + }; + bachp = { + email = "pascal.bach@nextrem.ch"; + matrix = "@bachp:matrix.org"; + github = "bachp"; + githubId = 333807; + name = "Pascal Bach"; + }; + backuitist = { + email = "biethb@gmail.com"; + github = "backuitist"; + githubId = 1017537; + name = "Bruno Bieth"; + }; + badmutex = { + email = "github@badi.sh"; + github = "badmutex"; + githubId = 35324; + name = "Badi' Abdul-Wahid"; + }; + balajisivaraman = { + email = "sivaraman.balaji@gmail.com"; + name = "Balaji Sivaraman"; + }; + balodja = { + email = "balodja@gmail.com"; + github = "balodja"; + githubId = 294444; + name = "Vladimir Korolev"; + }; + baloo = { + email = "nixpkgs@superbaloo.net"; + github = "baloo"; + githubId = 59060; + name = "Arthur Gautier"; + }; + balsoft = { + email = "balsoft75@gmail.com"; + github = "balsoft"; + githubId = 18467667; + name = "Alexander Bantyev"; + }; + bandresen = { + email = "bandresen@gmail.com"; + github = "bandresen"; + githubId = 80325; + name = "Benjamin Andresen"; + }; + baracoder = { + email = "baracoder@googlemail.com"; + github = "baracoder"; + githubId = 127523; + name = "Herman Fries"; + }; + barrucadu = { + email = "mike@barrucadu.co.uk"; + github = "barrucadu"; + githubId = 75235; + name = "Michael Walker"; + }; + bartsch = { + email = "consume.noise@gmail.com"; + github = "bartsch"; + githubId = 3390885; + name = "Daniel Martin"; + }; + bartuka = { + email = "wand@hey.com"; + github = "wandersoncferreira"; + githubId = 17708295; + name = "Wanderson Ferreira"; + keys = [{ + longkeyid = "rsa4096/0x56840A614DBE37AE"; + fingerprint = "A3E1 C409 B705 50B3 BF41 492B 5684 0A61 4DBE 37AE"; + }]; + }; + basvandijk = { + email = "v.dijk.bas@gmail.com"; + github = "basvandijk"; + githubId = 576355; + name = "Bas van Dijk"; + }; + Baughn = { + email = "sveina@gmail.com"; + github = "Baughn"; + githubId = 45811; + name = "Svein Ove Aas"; + }; + bb010g = { + email = "me@bb010g.com"; + matrix = "@bb010g:matrix.org"; + github = "bb010g"; + githubId = 340132; + name = "Brayden Banks"; + }; + bbarker = { + email = "brandon.barker@gmail.com"; + github = "bbarker"; + githubId = 916366; + name = "Brandon Elam Barker"; + }; + bbigras = { + email = "bigras.bruno@gmail.com"; + github = "bbigras"; + githubId = 24027; + name = "Bruno Bigras"; + }; + bcarrell = { + email = "brandoncarrell@gmail.com"; + github = "bcarrell"; + githubId = 1015044; + name = "Brandon Carrell"; + }; + bcc32 = { + email = "me@bcc32.com"; + github = "bcc32"; + githubId = 1239097; + name = "Aaron Zeng"; + }; + bcdarwin = { + email = "bcdarwin@gmail.com"; + github = "bcdarwin"; + githubId = 164148; + name = "Ben Darwin"; + }; + bdesham = { + email = "benjamin@esham.io"; + github = "bdesham"; + githubId = 354230; + name = "Benjamin Esham"; + }; + bdimcheff = { + email = "brandon@dimcheff.com"; + github = "bdimcheff"; + githubId = 14111; + name = "Brandon Dimcheff"; + }; + beardhatcode = { + name = "Robbert Gurdeep Singh"; + email = "nixpkgs@beardhatcode.be"; + github = "beardhatcode"; + githubId = 662538; + }; + beezow = { + name = "beezow"; + email = "zbeezow@gmail.com"; + github = "beezow"; + githubId = 42082156; + }; + bendlas = { + email = "herwig@bendlas.net"; + matrix = "@bendlas:matrix.org"; + github = "bendlas"; + githubId = 214787; + name = "Herwig Hochleitner"; + }; + benley = { + email = "benley@gmail.com"; + github = "benley"; + githubId = 1432730; + name = "Benjamin Staffin"; + }; + benneti = { + name = "Benedikt Tissot"; + email = "benedikt.tissot@googlemail.com"; + github = "benneti"; + githubId = 11725645; + }; + bertof = { + name = "Filippo Berto"; + email = "berto.f@protonmail.com"; + github = "bertof"; + githubId = 9915675; + keys = [{ + longkeyid = "rsa4096/0xFE98AE5EC52B1056"; + fingerprint = "17C5 1EF9 C0FE 2EB2 FE56 BB53 FE98 AE5E C52B 1056"; + }]; + }; + bennofs = { + email = "benno.fuenfstueck@gmail.com"; + github = "bennofs"; + githubId = 3192959; + name = "Benno Fünfstück"; + }; + benpye = { + email = "ben@curlybracket.co.uk"; + github = "benpye"; + githubId = 442623; + name = "Ben Pye"; + }; + benwbooth = { + email = "benwbooth@gmail.com"; + github = "benwbooth"; + githubId = 75972; + name = "Ben Booth"; + }; + berberman = { + email = "berberman@yandex.com"; + matrix = "@berberman:mozilla.org"; + github = "berberman"; + githubId = 26041945; + name = "Potato Hatsue"; + }; + berce = { + email = "bert.moens@gmail.com"; + github = "berce"; + githubId = 10439709; + name = "Bert Moens"; + }; + berdario = { + email = "berdario@gmail.com"; + github = "berdario"; + githubId = 752835; + name = "Dario Bertini"; + }; + bergey = { + email = "bergey@teallabs.org"; + github = "bergey"; + githubId = 251106; + name = "Daniel Bergey"; + }; + bergkvist = { + email = "tobias@bergkv.ist"; + github = "bergkvist"; + githubId = 410028; + name = "Tobias Bergkvist"; + }; + betaboon = { + email = "betaboon@0x80.ninja"; + github = "betaboon"; + githubId = 7346933; + name = "betaboon"; + }; + bew = { + email = "benoit.dechezelles@gmail.com"; + github = "bew"; + githubId = 9730330; + name = "Benoit de Chezelles"; + }; + bfortz = { + email = "bernard.fortz@gmail.com"; + github = "bfortz"; + githubId = 16426882; + name = "Bernard Fortz"; + }; + bgamari = { + email = "ben@smart-cactus.org"; + github = "bgamari"; + githubId = 1010174; + name = "Ben Gamari"; + }; + bhall = { + email = "brendan.j.hall@bath.edu"; + github = "brendan-hall"; + githubId = 34919100; + name = "Brendan Hall"; + }; + bhipple = { + email = "bhipple@protonmail.com"; + github = "bhipple"; + githubId = 2071583; + name = "Benjamin Hipple"; + }; + bhougland = { + email = "benjamin.hougland@gmail.com"; + github = "bhougland18"; + githubId = 28444296; + name = "Benjamin Hougland"; + }; + billewanick = { + email = "bill@ewanick.com"; + github = "billewanick"; + githubId = 13324165; + name = "Bill Ewanick"; + }; + binarin = { + email = "binarin@binarin.ru"; + github = "binarin"; + githubId = 185443; + name = "Alexey Lebedeff"; + }; + bjg = { + email = "bjg@gnu.org"; + name = "Brian Gough"; + }; + bjornfor = { + email = "bjorn.forsman@gmail.com"; + github = "bjornfor"; + githubId = 133602; + name = "Bjørn Forsman"; + }; + bkchr = { + email = "nixos@kchr.de"; + github = "bkchr"; + githubId = 5718007; + name = "Bastian Köcher"; + }; + blaggacao = { + name = "David Arnold"; + email = "dar@xoe.solutions"; + github = "blaggacao"; + githubId = 7548295; + }; + blanky0230 = { + email = "blanky0230@gmail.com"; + github = "blanky0230"; + githubId = 5700358; + name = "Thomas Blank"; + }; + blitz = { + email = "js@alien8.de"; + matrix = "@js:ukvly.org"; + github = "blitz"; + githubId = 37907; + name = "Julian Stecklina"; + }; + bloomvdomino = { + name = "Laura Fäßler"; + email = "0x@ytex.de"; + github = "bloomvdomino"; + githubId = 33204710; + }; + bluescreen303 = { + email = "mathijs@bluescreen303.nl"; + github = "bluescreen303"; + githubId = 16330; + name = "Mathijs Kwik"; + }; + bmilanov = { + name = "Biser Milanov"; + email = "bmilanov11+nixpkgs@gmail.com"; + github = "bmilanov"; + githubId = 30090366; + }; + bmwalters = { + name = "Bradley Walters"; + email = "oss@walters.app"; + github = "bmwalters"; + githubId = 4380777; + }; + bobakker = { + email = "bobakk3r@gmail.com"; + github = "bobakker"; + githubId = 10221570; + name = "Bo Bakker"; + }; + bobby285271 = { + name = "Bobby Rong"; + email = "rjl931189261@126.com"; + matrix = "@bobby285271:matrix.org"; + github = "bobby285271"; + githubId = 20080233; + }; + bobvanderlinden = { + email = "bobvanderlinden@gmail.com"; + github = "bobvanderlinden"; + githubId = 6375609; + name = "Bob van der Linden"; + }; + bodil = { + email = "nix@bodil.org"; + github = "bodil"; + githubId = 17880; + name = "Bodil Stokke"; + }; + boj = { + email = "brian@uncannyworks.com"; + github = "boj"; + githubId = 50839; + name = "Brian Jones"; + }; + bootstrap-prime = { + email = "bootstrap.prime@gmail.com"; + github = "bootstrap-prime"; + githubId = 68566724; + name = "bootstrap-prime"; + }; + commandodev = { + email = "ben@perurbis.com"; + github = "commandodev"; + githubId = 87764; + name = "Ben Ford"; + }; + boppyt = { + email = "boppy@nwcpz.com"; + github = "boppyt"; + githubId = 71049646; + name = "Zack A"; + keys = [{ + longkeyid = "rsa4096/0x6310C97DE31D1545"; + fingerprint = "E8D7 5C19 9F65 269B 439D F77B 6310 C97D E31D 1545"; + }]; + }; + borisbabic = { + email = "boris.ivan.babic@gmail.com"; + github = "borisbabic"; + githubId = 1743184; + name = "Boris Babić"; + }; + bosu = { + email = "boriss@gmail.com"; + github = "bosu"; + githubId = 3465841; + name = "Boris Sukholitko"; + }; + bouk = { + name = "Bouke van der Bijl"; + email = "i@bou.ke"; + github = "bouk"; + githubId = 97820; + }; + bradediger = { + email = "brad@bradediger.com"; + github = "bradediger"; + githubId = 4621; + name = "Brad Ediger"; + }; + brainrape = { + email = "martonboros@gmail.com"; + github = "brainrape"; + githubId = 302429; + name = "Marton Boros"; + }; + bramd = { + email = "bram@bramd.nl"; + github = "bramd"; + githubId = 86652; + name = "Bram Duvigneau"; + }; + braydenjw = { + email = "nixpkgs@willenborg.ca"; + github = "braydenjw"; + githubId = 2506621; + name = "Brayden Willenborg"; + }; + brian-dawn = { + email = "brian.t.dawn@gmail.com"; + github = "brian-dawn"; + githubId = 1274409; + name = "Brian Dawn"; + }; + brianhicks = { + email = "brian@brianthicks.com"; + github = "BrianHicks"; + githubId = 355401; + name = "Brian Hicks"; + }; + brianmcgee = { + name = "Brian McGee"; + email = "brian@41north.dev"; + github = "brianmcgee"; + githubId = 1173648; + }; + Br1ght0ne = { + email = "brightone@protonmail.com"; + github = "Br1ght0ne"; + githubId = 12615679; + name = "Oleksii Filonenko"; + keys = [{ + longkeyid = "rsa3072/0xA1BC8428323ECFE8"; + fingerprint = "F549 3B7F 9372 5578 FDD3 D0B8 A1BC 8428 323E CFE8"; + }]; + }; + bsima = { + email = "ben@bsima.me"; + github = "bsima"; + githubId = 200617; + name = "Ben Sima"; + }; + bstrik = { + email = "dutchman55@gmx.com"; + github = "bstrik"; + githubId = 7716744; + name = "Berno Strik"; + }; + breakds = { + email = "breakds@gmail.com"; + github = "breakds"; + githubId = 1111035; + name = "Break Yang"; + }; + brecht = { + email = "brecht.savelkoul@alumni.lse.ac.uk"; + github = "brechtcs"; + githubId = 6107054; + name = "Brecht Savelkoul"; + }; + brettlyons = { + email = "blyons@fastmail.com"; + github = "brettlyons"; + githubId = 3043718; + name = "Brett Lyons"; + }; + brodes = { + email = "me@brod.es"; + github = "brhoades"; + githubId = 4763746; + name = "Billy Rhoades"; + keys = [{ + longkeyid = "rsa4096/0x8AE74787A4B7C07E"; + fingerprint = "BF4FCB85C69989B4ED95BF938AE74787A4B7C07E"; + }]; + }; + broke = { + email = "broke@in-fucking.space"; + github = "broke"; + githubId = 1071610; + name = "Gunnar Nitsche"; + }; + bryanasdev000 = { + email = "bryanasdev000@gmail.com"; + matrix = "@bryanasdev000:matrix.org"; + github = "bryanasdev000"; + githubId = 53131727; + name = "Bryan Albuquerque"; + }; + btlvr = { + email = "btlvr@protonmail.com"; + github = "btlvr"; + githubId = 32319131; + name = "Brett L"; + }; + buckley310 = { + email = "sean.bck@gmail.com"; + matrix = "@buckley310:matrix.org"; + github = "buckley310"; + githubId = 2379774; + name = "Sean Buckley"; + }; + buffet = { + email = "niclas@countingsort.com"; + github = "buffet"; + githubId = 33751841; + name = "Niclas Meyer"; + }; + bugworm = { + email = "bugworm@zoho.com"; + github = "bugworm"; + githubId = 7214361; + name = "Roman Gerasimenko"; + }; + bburdette = { + email = "bburdette@protonmail.com"; + github = "bburdette"; + githubId = 157330; + name = "Ben Burdette"; + }; + bzizou = { + email = "Bruno@bzizou.net"; + github = "bzizou"; + githubId = 2647566; + name = "Bruno Bzeznik"; + }; + c0bw3b = { + email = "c0bw3b@gmail.com"; + github = "c0bw3b"; + githubId = 24417923; + name = "Renaud"; + }; + c00w = { + email = "nix@daedrum.net"; + github = "c00w"; + githubId = 486199; + name = "Colin"; + }; + c0deaddict = { + email = "josvanbakel@protonmail.com"; + github = "c0deaddict"; + githubId = 510553; + name = "Jos van Bakel"; + }; + c4605 = { + email = "bolasblack@gmail.com"; + github = "bolasblack"; + githubId = 382011; + name = "c4605"; + }; + caadar = { + email = "v88m@posteo.net"; + github = "caadar"; + githubId = 15320726; + name = "Car Cdr"; + }; + cab404 = { + email = "cab404@mailbox.org"; + github = "cab404"; + githubId = 6453661; + name = "Vladimir Serov"; + keys = [ + # compare with https://keybase.io/cab404 + { + fingerprint = "1BB96810926F4E715DEF567E6BA7C26C3FDF7BB3"; + longkeyid = "rsa3072/0xCBDECF658C38079E"; + } + { + fingerprint = "1EBC648C64D6045463013B3EB7EFFC271D55DB8A"; + longkeyid = "ed25519/0xB7EFFC271D55DB8A"; + } + ]; + }; + calbrecht = { + email = "christian.albrecht@mayflower.de"; + github = "calbrecht"; + githubId = 1516457; + name = "Christian Albrecht"; + }; + callahad = { + email = "dan.callahan@gmail.com"; + github = "callahad"; + githubId = 24193; + name = "Dan Callahan"; + }; + calvertvl = { + email = "calvertvl@gmail.com"; + github = "calvertvl"; + githubId = 7435854; + name = "Victor Calvert"; + }; + cameronnemo = { + email = "cnemo@tutanota.com"; + github = "cameronnemo"; + githubId = 3212452; + name = "Cameron Nemo"; + }; + campadrenalin = { + email = "campadrenalin@gmail.com"; + github = "campadrenalin"; + githubId = 289492; + name = "Philip Horger"; + }; + candeira = { + email = "javier@candeira.com"; + github = "candeira"; + githubId = 91694; + name = "Javier Candeira"; + }; + canndrew = { + email = "shum@canndrew.org"; + github = "canndrew"; + githubId = 5555066; + name = "Andrew Cann"; + }; + cap = { + name = "cap"; + email = "nixos_xasenw9@digitalpostkasten.de"; + github = "scaredmushroom"; + githubId = 45340040; + }; + carlosdagos = { + email = "m@cdagostino.io"; + github = "carlosdagos"; + githubId = 686190; + name = "Carlos D'Agostino"; + }; + carlsverre = { + email = "accounts@carlsverre.com"; + github = "carlsverre"; + githubId = 82591; + name = "Carl Sverre"; + }; + carpinchomug = { + email = "aki.suda@protonmail.com"; + github = "carpinchomug"; + githubId = 101536256; + name = "Akiyoshi Suda"; + }; + cartr = { + email = "carter.sande@duodecima.technology"; + github = "cartr"; + githubId = 5241813; + name = "Carter Sande"; + }; + casey = { + email = "casey@rodarmor.net"; + github = "casey"; + githubId = 1945; + name = "Casey Rodarmor"; + }; + catern = { + email = "sbaugh@catern.com"; + github = "catern"; + githubId = 5394722; + name = "Spencer Baugh"; + }; + caugner = { + email = "nixos@caugner.de"; + github = "caugner"; + githubId = 495429; + name = "Claas Augner"; + }; + cawilliamson = { + email = "home@chrisaw.com"; + github = "cawilliamson"; + githubId = 1141769; + matrix = "@cawilliamson:nixos.dev"; + name = "Christopher A. Williamson"; + }; + cbley = { + email = "claudio.bley@gmail.com"; + github = "avdv"; + githubId = 3471749; + name = "Claudio Bley"; + }; + cburstedde = { + email = "burstedde@ins.uni-bonn.de"; + github = "cburstedde"; + githubId = 109908; + name = "Carsten Burstedde"; + keys = [{ + longkeyid = "rsa2048/0x0704CD9E550A6BCD"; + fingerprint = "1127 A432 6524 BF02 737B 544E 0704 CD9E 550A 6BCD"; + }]; + }; + cdepillabout = { + email = "cdep.illabout@gmail.com"; + matrix = "@cdepillabout:matrix.org"; + github = "cdepillabout"; + githubId = 64804; + name = "Dennis Gosnell"; + }; + ccellado = { + email = "annplague@gmail.com"; + github = "ccellado"; + githubId = 44584960; + name = "Denis Khalmatov"; + }; + ceedubs = { + email = "ceedubs@gmail.com"; + github = "ceedubs"; + githubId = 977929; + name = "Cody Allen"; + }; + centromere = { + email = "nix@centromere.net"; + github = "centromere"; + githubId = 543423; + name = "Alex Wied"; + }; + cfhammill = { + email = "cfhammill@gmail.com"; + github = "cfhammill"; + githubId = 7467038; + name = "Chris Hammill"; + }; + cfouche = { + email = "chaddai.fouche@gmail.com"; + github = "Chaddai"; + githubId = 5771456; + name = "Chaddaï Fouché"; + }; + cfsmp3 = { + email = "carlos@sanz.dev"; + github = "cfsmp3"; + githubId = 5949913; + name = "Carlos Fernandez Sanz"; + }; + cge = { + email = "cevans@evanslabs.org"; + github = "cgevans"; + githubId = 2054509; + name = "Constantine Evans"; + keys = [ + { + longkeyid = "rsa4096/0xB67DB1D20A93A9F9"; + fingerprint = "32B1 6EE7 DBA5 16DE 526E 4C5A B67D B1D2 0A93 A9F9"; + } + { + longkeyid = "rsa4096/0x1A1D58B86AE2AABD"; + fingerprint = "669C 1D24 5A87 DB34 6BE4 3216 1A1D 58B8 6AE2 AABD"; + } + ]; + }; + chaduffy = { + email = "charles@dyfis.net"; + github = "charles-dyfis-net"; + githubId = 22370; + name = "Charles Duffy"; + }; + changlinli = { + email = "mail@changlinli.com"; + github = "changlinli"; + githubId = 1762540; + name = "Changlin Li"; + }; + chanley = { + email = "charlieshanley@gmail.com"; + github = "charlieshanley"; + githubId = 8228888; + name = "Charlie Hanley"; + }; + CharlesHD = { + email = "charleshdespointes@gmail.com"; + github = "CharlesHD"; + githubId = 6608071; + name = "Charles Huyghues-Despointes"; + }; + chaoflow = { + email = "flo@chaoflow.net"; + github = "chaoflow"; + githubId = 89596; + name = "Florian Friesdorf"; + }; + chattered = { + email = "me@philscotted.com"; + name = "Phil Scott"; + }; + chekoopa = { + email = "chekoopa@mail.ru"; + github = "chekoopa"; + githubId = 1689801; + name = "Mikhail Chekan"; + }; + ChengCat = { + email = "yu@cheng.cat"; + github = "ChengCat"; + githubId = 33503784; + name = "Yucheng Zhang"; + }; + cheriimoya = { + email = "github@hausch.xyz"; + github = "cheriimoya"; + githubId = 28303440; + name = "Max Hausch"; + }; + chessai = { + email = "chessai1996@gmail.com"; + github = "chessai"; + githubId = 18648043; + name = "Daniel Cartwright"; + }; + chiiruno = { + email = "okinan@protonmail.com"; + github = "chiiruno"; + githubId = 30435868; + name = "Okina Matara"; + }; + Chili-Man = { + email = "dr.elhombrechile@gmail.com"; + name = "Diego Rodriguez"; + github = "Chili-Man"; + githubId = 631802; + keys = [{ + longkeyid = "rsa4096/0xE0EBAD78F0190BD9"; + fingerprint = "099E 3F97 FA08 3D47 8C75 EBEC E0EB AD78 F019 0BD9"; + }]; + }; + chiroptical = { + email = "chiroptical@gmail.com"; + github = "chiroptical"; + githubId = 3086255; + name = "Barry Moore II"; + }; + chisui = { + email = "chisui.pd@gmail.com"; + github = "chisui"; + githubId = 4526429; + name = "Philipp Dargel"; + }; + chivay = { + email = "hubert.jasudowicz@gmail.com"; + github = "chivay"; + githubId = 14790226; + name = "Hubert Jasudowicz"; + }; + chkno = { + email = "chuck@intelligence.org"; + github = "chkno"; + githubId = 1118859; + name = "Scott Worley"; + }; + choochootrain = { + email = "hurshal@imap.cc"; + github = "choochootrain"; + githubId = 803961; + name = "Hurshal Patel"; + }; + chpatrick = { + email = "chpatrick@gmail.com"; + github = "chpatrick"; + githubId = 832719; + name = "Patrick Chilton"; + }; + chreekat = { + email = "b@chreekat.net"; + github = "chreekat"; + githubId = 538538; + name = "Bryan Richter"; + }; + chris-martin = { + email = "ch.martin@gmail.com"; + github = "chris-martin"; + githubId = 399718; + name = "Chris Martin"; + }; + chrisjefferson = { + email = "chris@bubblescope.net"; + github = "chrisjefferson"; + githubId = 811527; + name = "Christopher Jefferson"; + }; + chrispickard = { + email = "chrispickard9@gmail.com"; + github = "chrispickard"; + githubId = 1438690; + name = "Chris Pickard"; + }; + chrisrosset = { + email = "chris@rosset.org.uk"; + github = "chrisrosset"; + githubId = 1103294; + name = "Christopher Rosset"; + }; + christianharke = { + email = "christian@harke.ch"; + github = "christianharke"; + githubId = 13007345; + name = "Christian Harke"; + keys = [{ + longkeyid = "rsa4096/0x830A9728630966F4"; + fingerprint = "4EBB 30F1 E89A 541A A7F2 52BE 830A 9728 6309 66F4"; + }]; + }; + christopherpoole = { + email = "mail@christopherpoole.net"; + github = "christopherpoole"; + githubId = 2245737; + name = "Christopher Mark Poole"; + }; + chuahou = { + email = "human+github@chuahou.dev"; + github = "chuahou"; + githubId = 12386805; + name = "Chua Hou"; + }; + chuangzhu = { + name = "Chuang Zhu"; + email = "chuang@melty.land"; + matrix = "@chuangzhu:matrix.org"; + github = "chuangzhu"; + githubId = 31200881; + keys = [{ + longkeyid = "rsa4096/E838CED81CFFD3F9"; + fingerprint = "5D03 A5E6 0754 A3E3 CA57 5037 E838 CED8 1CFF D3F9"; + }]; + }; + chvp = { + email = "nixpkgs@cvpetegem.be"; + matrix = "@charlotte:vanpetegem.me"; + github = "chvp"; + githubId = 42220376; + name = "Charlotte Van Petegem"; + }; + cigrainger = { + name = "Christopher Grainger"; + email = "chris@amplified.ai"; + github = "cigrainger"; + githubId = 3984794; + }; + ciil = { + email = "simon@lackerbauer.com"; + github = "ciil"; + githubId = 3956062; + name = "Simon Lackerbauer"; + }; + cirno-999 = { + email = "reverene@protonmail.com"; + github = "cirno-999"; + githubId = 73712874; + name = "cirno-999"; + }; + citadelcore = { + email = "alex@arctarus.co.uk"; + github = "citadelcore"; + githubId = 5567402; + name = "Alex Zero"; + keys = [{ + longkeyid = "rsa4096/0xA51550EDB450302C"; + fingerprint = "A0AA 4646 B8F6 9D45 4553 5A88 A515 50ED B450 302C"; + }]; + }; + cizra = { + email = "todurov+nix@gmail.com"; + github = "cizra"; + githubId = 2131991; + name = "Elmo Todurov"; + }; + cjab = { + email = "chad+nixpkgs@jablonski.xyz"; + github = "cjab"; + githubId = 136485; + name = "Chad Jablonski"; + }; + ck3d = { + email = "ck3d@gmx.de"; + github = "ck3d"; + githubId = 25088352; + name = "Christian Kögler"; + }; + ckie = { + email = "nixpkgs-0efe364@ckie.dev"; + github = "ckiee"; + githubId = 25263210; + keys = [{ + longkeyid = "rsa4096/0x13E79449C0525215"; + fingerprint = "539F 0655 4D35 38A5 429A E253 13E7 9449 C052 5215"; + }]; + name = "ckie"; + }; + clkamp = { + email = "c@lkamp.de"; + github = "clkamp"; + githubId = 46303707; + name = "Christian Lütke-Stetzkamp"; + }; + ckauhaus = { + email = "kc@flyingcircus.io"; + github = "ckauhaus"; + githubId = 1448923; + name = "Christian Kauhaus"; + }; + cko = { + email = "christine.koppelt@gmail.com"; + github = "cko"; + githubId = 68239; + name = "Christine Koppelt"; + }; + clacke = { + email = "claes.wallin@greatsinodevelopment.com"; + github = "clacke"; + githubId = 199180; + name = "Claes Wallin"; + }; + cleeyv = { + email = "cleeyv@riseup.net"; + github = "cleeyv"; + githubId = 71959829; + name = "Cleeyv"; + }; + cleverca22 = { + email = "cleverca22@gmail.com"; + matrix = "@cleverca22:matrix.org"; + github = "cleverca22"; + githubId = 848609; + name = "Michael Bishop"; + }; + cmacrae = { + email = "hi@cmacr.ae"; + github = "cmacrae"; + githubId = 3392199; + name = "Calum MacRae"; + }; + cmars = { + email = "nix@cmars.tech"; + github = "cmars"; + githubId = 23741; + name = "Casey Marshall"; + keys = [{ + longkeyid = "rsa3072/0x6DEC2758ACD5A973"; + fingerprint = "6B78 7E5F B493 FA4F D009 5D10 6DEC 2758 ACD5 A973"; + }]; + }; + cmcdragonkai = { + email = "roger.qiu@matrix.ai"; + github = "cmcdragonkai"; + githubId = 640797; + name = "Roger Qiu"; + }; + cmfwyp = { + email = "cmfwyp@riseup.net"; + github = "cmfwyp"; + githubId = 20808761; + name = "cmfwyp"; + }; + cobbal = { + email = "andrew.cobb@gmail.com"; + github = "cobbal"; + githubId = 180339; + name = "Andrew Cobb"; + }; + coconnor = { + email = "coreyoconnor@gmail.com"; + github = "coreyoconnor"; + githubId = 34317; + name = "Corey O'Connor"; + }; + CodeLongAndProsper90 = { + github = "CodeLongAndProsper90"; + githubId = 50145141; + email = "jupiter@m.rdis.dev"; + name = "Scott Little"; + }; + codsl = { + email = "codsl@riseup.net"; + github = "codsl"; + githubId = 6402559; + name = "codsl"; + }; + codyopel = { + email = "codyopel@gmail.com"; + github = "codyopel"; + githubId = 5561189; + name = "Cody Opel"; + }; + Cogitri = { + email = "oss@cogitri.dev"; + github = "Cogitri"; + githubId = 8766773; + matrix = "@cogitri:cogitri.dev"; + name = "Rasmus Thomsen"; + }; + cohei = { + email = "a.d.xvii.kal.mai@gmail.com"; + github = "cohei"; + githubId = 3477497; + name = "TANIGUCHI Kohei"; + }; + cohencyril = { + email = "cyril.cohen@inria.fr"; + github = "CohenCyril"; + githubId = 298705; + name = "Cyril Cohen"; + }; + colemickens = { + email = "cole.mickens@gmail.com"; + matrix = "@colemickens:matrix.org"; + github = "colemickens"; + githubId = 327028; + name = "Cole Mickens"; + }; + colescott = { + email = "colescottsf@gmail.com"; + github = "colescott"; + githubId = 5684605; + name = "Cole Scott"; + }; + cole-h = { + name = "Cole Helbling"; + email = "cole.e.helbling@outlook.com"; + matrix = "@cole-h:matrix.org"; + github = "cole-h"; + githubId = 28582702; + keys = [{ + longkeyid = "rsa4096/0xB37E0F2371016A4C"; + fingerprint = "68B8 0D57 B2E5 4AC3 EC1F 49B0 B37E 0F23 7101 6A4C"; + }]; + }; + collares = { + email = "mauricio@collares.org"; + github = "collares"; + githubId = 244239; + name = "Mauricio Collares"; + }; + copumpkin = { + email = "pumpkingod@gmail.com"; + github = "copumpkin"; + githubId = 2623; + name = "Dan Peebles"; + }; + corngood = { + email = "corngood@gmail.com"; + github = "corngood"; + githubId = 3077118; + name = "David McFarland"; + }; + coroa = { + email = "jonas@chaoflow.net"; + github = "coroa"; + githubId = 2552981; + name = "Jonas Hörsch"; + }; + costrouc = { + email = "chris.ostrouchov@gmail.com"; + github = "costrouc"; + githubId = 1740337; + name = "Chris Ostrouchov"; + }; + confus = { + email = "con-f-use@gmx.net"; + github = "con-f-use"; + githubId = 11145016; + name = "J.C."; + }; + congee = { + email = "changshengwu@pm.me"; + matrix = "@congeec:matrix.org"; + github = "congee"; + name = "Changsheng Wu"; + githubId = 2083950; + }; + contrun = { + email = "uuuuuu@protonmail.com"; + github = "contrun"; + githubId = 32609395; + name = "B YI"; + }; + conradmearns = { + email = "conradmearns+github@pm.me"; + github = "ConradMearns"; + githubId = 5510514; + name = "Conrad Mearns"; + }; + corbanr = { + email = "corban@raunco.co"; + github = "CorbanR"; + githubId = 1918683; + matrix = "@corbansolo:matrix.org"; + name = "Corban Raun"; + keys = [ + { + longkeyid = "rsa4096/0xA697A56F1F151189"; + fingerprint = "6607 0B24 8CE5 64ED 22CE 0950 A697 A56F 1F15 1189"; + } + { + longkeyid = "ed25519/0x230F4AC153F90F29"; + fingerprint = "D8CB 816A B678 A4E6 1EC7 5325 230F 4AC1 53F9 0F29"; + } + ]; + }; + couchemar = { + email = "couchemar@yandex.ru"; + github = "couchemar"; + githubId = 1573344; + name = "Andrey Pavlov"; + }; + cpages = { + email = "page@ruiec.cat"; + github = "cpages"; + githubId = 411324; + name = "Carles Pagès"; + }; + cpu = { + email = "daniel@binaryparadox.net"; + github = "cpu"; + githubId = 292650; + name = "Daniel McCarney"; + keys = [{ + longkeyid = "rsa2048/0x08FB2BFC470E75B4"; + fingerprint = "8026 D24A A966 BF9C D3CD CB3C 08FB 2BFC 470E 75B4"; + }]; + }; + craigem = { + email = "craige@mcwhirter.io"; + github = "craigem"; + githubId = 6470493; + name = "Craige McWhirter"; + }; + cransom = { + email = "cransom@hubns.net"; + github = "cransom"; + githubId = 1957293; + name = "Casey Ransom"; + }; + CrazedProgrammer = { + email = "crazedprogrammer@gmail.com"; + github = "CrazedProgrammer"; + githubId = 12202789; + name = "CrazedProgrammer"; + }; + creator54 = { + email = "hi.creator54@gmail.com"; + github = "creator54"; + githubId = 34543609; + name = "creator54"; + }; + cript0nauta = { + email = "shareman1204@gmail.com"; + github = "cript0nauta"; + githubId = 1222362; + name = "Matías Lang"; + }; + CRTified = { + email = "carl.schneider+nixos@rub.de"; + matrix = "@schnecfk:ruhr-uni-bochum.de"; + github = "CRTified"; + githubId = 2440581; + name = "Carl Richard Theodor Schneider"; + keys = [{ + longkeyid = "rsa4096/0x45BCC1E2709B1788"; + fingerprint = "2017 E152 BB81 5C16 955C E612 45BC C1E2 709B 1788"; + }]; + }; + cryptix = { + email = "cryptix@riseup.net"; + github = "cryptix"; + githubId = 111202; + name = "Henry Bubert"; + }; + CrystalGamma = { + email = "nixos@crystalgamma.de"; + github = "CrystalGamma"; + githubId = 6297001; + name = "Jona Stubbe"; + }; + csingley = { + email = "csingley@gmail.com"; + github = "csingley"; + githubId = 398996; + name = "Christopher Singley"; + }; + cstrahan = { + email = "charles@cstrahan.com"; + github = "cstrahan"; + githubId = 143982; + name = "Charles Strahan"; + }; + cswank = { + email = "craigswank@gmail.com"; + github = "cswank"; + githubId = 490965; + name = "Craig Swank"; + }; + cust0dian = { + email = "serg@effectful.software"; + github = "cust0dian"; + githubId = 389387; + name = "Serg Nesterov"; + keys = [{ + longkeyid = "rsa4096/0x1512F6EB84AECC8C"; + fingerprint = "6E7D BA30 DB5D BA60 693C 3BE3 1512 F6EB 84AE CC8C"; + }]; + }; + cwoac = { + email = "oliver@codersoffortune.net"; + github = "cwoac"; + githubId = 1382175; + name = "Oliver Matthews"; + }; + cyounkins = { + name = "Craig Younkins"; + email = "cyounkins@gmail.com"; + github = "cyounkins"; + githubId = 346185; + }; + cypherpunk2140 = { + email = "stefan.mihaila@pm.me"; + github = "stefan-mihaila"; + githubId = 2217136; + name = "Ștefan D. Mihăilă"; + keys = [ + { + longkeyid = "rsa4096/6E68A39BF16A3ECB"; + fingerprint = "CBC9 C7CC 51F0 4A61 3901 C723 6E68 A39B F16A 3ECB"; + } + { + longkeyid = "rsa4096/6220AD7846220A52"; + fingerprint = "7EAB 1447 5BBA 7DDE 7092 7276 6220 AD78 4622 0A52"; + } + ]; + }; + cyplo = { + email = "nixos@cyplo.dev"; + matrix = "@cyplo:cyplo.dev"; + github = "cyplo"; + githubId = 217899; + name = "Cyryl Płotnicki"; + }; + d-goldin = { + email = "dgoldin+github@protonmail.ch"; + github = "d-goldin"; + githubId = 43349662; + name = "Dima"; + keys = [{ + longkeyid = "rsa4096/BAB1D15FB7B4D4CE"; + fingerprint = "1C4E F4FE 7F8E D8B7 1E88 CCDF BAB1 D15F B7B4 D4CE"; + }]; + }; + d-xo = { + email = "hi@d-xo.org"; + github = "d-xo"; + githubId = 6689924; + name = "David Terry"; + }; + dadada = { + name = "dadada"; + email = "dadada@dadada.li"; + github = "dadada"; + githubId = 7216772; + keys = [{ + longkeyid = "ed25519/0xEEB8D1CE62C4DFEA"; + fingerprint = "D68C 8469 5C08 7E0F 733A 28D0 EEB8 D1CE 62C4 DFEA"; + }]; + }; + dalance = { + email = "dalance@gmail.com"; + github = "dalance"; + githubId = 4331004; + name = "Naoya Hatta"; + }; + dalpd = { + email = "denizalpd@ogr.iu.edu.tr"; + github = "dalpd"; + githubId = 16895361; + name = "Deniz Alp Durmaz"; + }; + DamienCassou = { + email = "damien@cassou.me"; + github = "DamienCassou"; + githubId = 217543; + name = "Damien Cassou"; + }; + danbst = { + email = "abcz2.uprola@gmail.com"; + github = "danbst"; + githubId = 743057; + name = "Danylo Hlynskyi"; + }; + dancek = { + email = "hannu.hartikainen@gmail.com"; + github = "dancek"; + githubId = 245394; + name = "Hannu Hartikainen"; + }; + danderson = { + email = "dave@natulte.net"; + github = "danderson"; + githubId = 1918; + name = "David Anderson"; + }; + dandellion = { + email = "daniel@dodsorf.as"; + matrix = "@dandellion:dodsorf.as"; + github = "dali99"; + githubId = 990767; + name = "Daniel Olsen"; + }; + daneads = { + email = "me@daneads.com"; + github = "daneads"; + githubId = 24708079; + name = "Dan Eads"; + }; + danharaj = { + email = "dan@obsidian.systems"; + github = "danharaj"; + githubId = 23366017; + name = "Dan Haraj"; + }; + danielbarter = { + email = "danielbarter@gmail.com"; + github = "danielbarter"; + githubId = 8081722; + name = "Daniel Barter"; + }; + danieldk = { + email = "me@danieldk.eu"; + github = "danieldk"; + githubId = 49398; + name = "Daniël de Kok"; + }; + danielfullmer = { + email = "danielrf12@gmail.com"; + github = "danielfullmer"; + githubId = 1298344; + name = "Daniel Fullmer"; + }; + danth = { + name = "Daniel Thwaites"; + email = "danthwaites30@btinternet.com"; + matrix = "@danth:matrix.org"; + github = "danth"; + githubId = 28959268; + keys = [{ + longkeyid = "rsa3072/0xD8AFC4BF05670F9D"; + fingerprint = "4779 D1D5 3C97 2EAE 34A5 ED3D D8AF C4BF 0567 0F9D"; + }]; + }; + dan4ik605743 = { + email = "6057430gu@gmail.com"; + github = "dan4ik605743"; + githubId = 86075850; + name = "Danil Danevich"; + }; + darkonion0 = { + name = "Alexandre Peruggia"; + email = "darkgenius1@protonmail.com"; + matrix = "@alexoo:matrix.org"; + github = "DarkOnion0"; + githubId = 68606322; + }; + das-g = { + email = "nixpkgs@raphael.dasgupta.ch"; + github = "das-g"; + githubId = 97746; + name = "Raphael Das Gupta"; + }; + das_j = { + email = "janne@hess.ooo"; + matrix = "@janne.hess:helsinki-systems.de"; + github = "dasJ"; + githubId = 4971975; + name = "Janne Heß"; + }; + dasisdormax = { + email = "dasisdormax@mailbox.org"; + github = "dasisdormax"; + githubId = 3714905; + keys = [{ + longkeyid = "rsa4096/0x02BA0D4480CA6C44"; + fingerprint = "E59B A198 61B0 A9ED C1FA 3FB2 02BA 0D44 80CA 6C44"; + }]; + name = "Maximilian Wende"; + }; + dasj19 = { + email = "daniel@serbanescu.dk"; + github = "dasj19"; + githubId = 7589338; + name = "Daniel Șerbănescu"; + }; + dasuxullebt = { + email = "christoph.senjak@googlemail.com"; + name = "Christoph-Simon Senjak"; + }; + datafoo = { + email = "34766150+datafoo@users.noreply.github.com"; + github = "datafoo"; + githubId = 34766150; + name = "datafoo"; + }; + davhau = { + email = "d.hauer.it@gmail.com"; + name = "David Hauer"; + github = "DavHau"; + githubId = 42246742; + }; + david-sawatzke = { + email = "d-nix@sawatzke.dev"; + github = "david-sawatzke"; + githubId = 11035569; + name = "David Sawatzke"; + }; + david50407 = { + email = "me@davy.tw"; + github = "david50407"; + githubId = 841969; + name = "David Kuo"; + }; + davidak = { + email = "post@davidak.de"; + matrix = "@davidak:matrix.org"; + github = "davidak"; + githubId = 91113; + name = "David Kleuker"; + }; + davidarmstronglewis = { + email = "davidlewis@mac.com"; + github = "davidarmstronglewis"; + githubId = 6754950; + name = "David Armstrong Lewis"; + }; + davidrusu = { + email = "davidrusu.me@gmail.com"; + github = "davidrusu"; + githubId = 1832378; + name = "David Rusu"; + }; + davidtwco = { + email = "nix@david.davidtw.co"; + github = "davidtwco"; + githubId = 1295100; + name = "David Wood"; + keys = [{ + longkeyid = "rsa4096/0x01760B4F9F53F154"; + fingerprint = "5B08 313C 6853 E5BF FA91 A817 0176 0B4F 9F53 F154"; + }]; + }; + davorb = { + email = "davor@davor.se"; + github = "davorb"; + githubId = 798427; + name = "Davor Babic"; + }; + dawidsowa = { + email = "dawid_sowa@posteo.net"; + github = "dawidsowa"; + githubId = 49904992; + name = "Dawid Sowa"; + }; + dbirks = { + email = "david@birks.dev"; + github = "dbirks"; + githubId = 7545665; + name = "David Birks"; + keys = [{ + longkeyid = "ed25519/0xBB999F83D9A19A36"; + fingerprint = "B26F 9AD8 DA20 3392 EF87 C61A BB99 9F83 D9A1 9A36"; + }]; + }; + dbohdan = { + email = "dbohdan@dbohdan.com"; + github = "dbohdan"; + githubId = 3179832; + name = "D. Bohdan"; + }; + dbrock = { + email = "daniel@brockman.se"; + github = "dbrock"; + githubId = 14032; + name = "Daniel Brockman"; + }; + ddelabru = { + email = "ddelabru@redhat.com"; + github = "ddelabru"; + githubId = 39909293; + name = "Dominic Delabruere"; + }; + dduan = { + email = "daniel@duan.ca"; + github = "dduan"; + githubId = 75067; + name = "Daniel Duan"; + }; + dearrude = { + name = "Ebrahim Nejati"; + email = "dearrude@tfwno.gf"; + github = "dearrude"; + githubId = 30749142; + keys = [{ + longkeyid = "rsa4096/19151E03BF2CF012"; + fingerprint = "4E35 F2E5 2132 D654 E815 A672 DB2C BC24 2868 6000"; + }]; + }; + deepfire = { + email = "_deepfire@feelingofgreen.ru"; + github = "deepfire"; + githubId = 452652; + name = "Kosyrev Serge"; + }; + DeeUnderscore = { + email = "d.anzorge@gmail.com"; + github = "DeeUnderscore"; + githubId = 156239; + name = "D Anzorge"; + }; + delan = { + name = "Delan Azabani"; + email = "delan@azabani.com"; + github = "delan"; + githubId = 465303; + }; + deliciouslytyped = { + email = "47436522+deliciouslytyped@users.noreply.github.com"; + github = "deliciouslytyped"; + githubId = 47436522; + name = "deliciouslytyped"; + }; + delroth = { + email = "delroth@gmail.com"; + github = "delroth"; + githubId = 202798; + name = "Pierre Bourdon"; + }; + delta = { + email = "d4delta@outlook.fr"; + name = "Delta"; + }; + deltadelta = { + email = "contact@libellules.eu"; + name = "Dara Ly"; + github = "tournemire"; + githubId = 20159432; + }; + deltaevo = { + email = "deltaduartedavid@gmail.com"; + github = "DeltaEvo"; + githubId = 8864716; + name = "Duarte David"; + }; + demin-dmitriy = { + email = "demindf@gmail.com"; + github = "demin-dmitriy"; + githubId = 5503422; + name = "Dmitriy Demin"; + }; + demize = { + email = "johannes@kyriasis.com"; + github = "kyrias"; + githubId = 2285387; + name = "Johannes Löthberg"; + }; + demyanrogozhin = { + email = "demyan.rogozhin@gmail.com"; + github = "demyanrogozhin"; + githubId = 62989; + name = "Demyan Rogozhin"; + }; + derchris = { + email = "derchris@me.com"; + github = "derchrisuk"; + githubId = 706758; + name = "Christian Gerbrandt"; + }; + derekcollison = { + email = "derek@nats.io"; + github = "derekcollison"; + githubId = 90097; + name = "Derek Collison"; + }; + DerGuteMoritz = { + email = "moritz@twoticketsplease.de"; + github = "DerGuteMoritz"; + githubId = 19733; + name = "Moritz Heidkamp"; + }; + DerickEddington = { + email = "derick.eddington@pm.me"; + github = "DerickEddington"; + githubId = 4731128; + name = "Derick Eddington"; + }; + dermetfan = { + email = "serverkorken@gmail.com"; + github = "dermetfan"; + githubId = 4956158; + name = "Robin Stumm"; + }; + DerTim1 = { + email = "tim.digel@active-group.de"; + github = "DerTim1"; + githubId = 21953890; + name = "Tim Digel"; + }; + desiderius = { + email = "didier@devroye.name"; + github = "desiderius"; + githubId = 1311761; + name = "Didier J. Devroye"; + }; + devhell = { + email = ''"^"@regexmail.net''; + github = "devhell"; + githubId = 896182; + name = "devhell"; + }; + devins2518 = { + email = "drsingh2518@icloud.com"; + github = "devins2518"; + githubId = 17111639; + name = "Devin Singh"; + }; + dezgeg = { + email = "tuomas.tynkkynen@iki.fi"; + github = "dezgeg"; + githubId = 579369; + name = "Tuomas Tynkkynen"; + }; + dfordivam = { + email = "dfordivam+nixpkgs@gmail.com"; + github = "dfordivam"; + githubId = 681060; + name = "Divam"; + }; + dfoxfranke = { + email = "dfoxfranke@gmail.com"; + github = "dfoxfranke"; + githubId = 4708206; + name = "Daniel Fox Franke"; + }; + dgliwka = { + email = "dawid.gliwka@gmail.com"; + github = "dgliwka"; + githubId = 33262214; + name = "Dawid Gliwka"; + }; + dgonyeo = { + email = "derek@gonyeo.com"; + github = "dgonyeo"; + githubId = 2439413; + name = "Derek Gonyeo"; + }; + dguenther = { + email = "dguenther9@gmail.com"; + github = "dguenther"; + githubId = 767083; + name = "Derek Guenther"; + }; + dhkl = { + email = "david@davidslab.com"; + github = "dhl"; + githubId = 265220; + name = "David Leung"; + }; + DianaOlympos = { + email = "DianaOlympos@noreply.github.com"; + github = "DianaOlympos"; + githubId = 15774340; + name = "Thomas Depierre"; + }; + diegolelis = { + email = "diego.o.lelis@gmail.com"; + github = "diegolelis"; + githubId = 8404455; + name = "Diego Lelis"; + }; + DieracDelta = { + email = "justin@restivo.me"; + github = "DieracDelta"; + githubId = 13730968; + name = "Justin Restivo"; + }; + diffumist = { + email = "git@diffumist.me"; + github = "diffumist"; + githubId = 32810399; + name = "Diffumist"; + }; + diogox = { + name = "Diogo Xavier"; + email = "13244408+diogox@users.noreply.github.com"; + github = "diogox"; + githubId = 13244408; + }; + dipinhora = { + email = "dipinhora+github@gmail.com"; + github = "dipinhora"; + githubId = 11946442; + name = "Dipin Hora"; + }; + dirkx = { + email = "dirkx@webweaving.org"; + github = "dirkx"; + githubId = 392583; + name = "Dirk-Willem van Gulik"; + }; + disassembler = { + email = "disasm@gmail.com"; + github = "disassembler"; + githubId = 651205; + name = "Samuel Leathers"; + }; + disserman = { + email = "disserman@gmail.com"; + github = "divi255"; + githubId = 40633781; + name = "Sergei S."; + }; + dit7ya = { + email = "7rat13@gmail.com"; + github = "dit7ya"; + githubId = 14034137; + name = "Mostly Void"; + }; + dizfer = { + email = "david@izquierdofernandez.com"; + github = "dizfer"; + githubId = 8852888; + name = "David Izquierdo"; + }; + djanatyn = { + email = "djanatyn@gmail.com"; + github = "djanatyn"; + githubId = 523628; + name = "Jonathan Strickland"; + }; + Dje4321 = { + email = "dje4321@gmail.com"; + github = "dje4321"; + githubId = 10913120; + name = "Dje4321"; + }; + djwf = { + email = "dave@weller-fahy.com"; + github = "djwf"; + githubId = 73162; + name = "David J. Weller-Fahy"; + }; + dkabot = { + email = "dkabot@dkabot.com"; + github = "dkabot"; + githubId = 1316469; + name = "Naomi Morse"; + }; + dlesl = { + email = "dlesl@dlesl.com"; + github = "dlesl"; + githubId = 28980797; + name = "David Leslie"; + }; + dlip = { + email = "dane@lipscombe.com.au"; + github = "dlip"; + githubId = 283316; + name = "Dane Lipscombe"; + }; + dmalikov = { + email = "malikov.d.y@gmail.com"; + github = "dmalikov"; + githubId = 997543; + name = "Dmitry Malikov"; + }; + DmitryTsygankov = { + email = "dmitry.tsygankov@gmail.com"; + github = "DmitryTsygankov"; + githubId = 425354; + name = "Dmitry Tsygankov"; + }; + dmjio = { + email = "djohnson.m@gmail.com"; + github = "dmjio"; + githubId = 875324; + name = "David Johnson"; + }; + dmrauh = { + email = "dmrauh@posteo.de"; + github = "dmrauh"; + githubId = 37698547; + name = "Dominik Michael Rauh"; + }; + dmvianna = { + email = "dmlvianna@gmail.com"; + github = "dmvianna"; + githubId = 1708810; + name = "Daniel Vianna"; + }; + dnr = { + email = "dnr@dnr.im"; + github = "dnr"; + githubId = 466723; + name = "David Reiss"; + }; + dochang = { + email = "dochang@gmail.com"; + github = "dochang"; + githubId = 129093; + name = "Desmond O. Chang"; + }; + domenkozar = { + email = "domen@dev.si"; + github = "domenkozar"; + githubId = 126339; + name = "Domen Kozar"; + }; + dominikh = { + email = "dominik@honnef.co"; + github = "dominikh"; + githubId = 39825; + name = "Dominik Honnef"; + }; + doronbehar = { + email = "me@doronbehar.com"; + github = "doronbehar"; + githubId = 10998835; + name = "Doron Behar"; + }; + dotlambda = { + email = "rschuetz17@gmail.com"; + matrix = "@robert:funklause.de"; + github = "dotlambda"; + githubId = 6806011; + name = "Robert Schütz"; + }; + dottedmag = { + email = "dottedmag@dottedmag.net"; + github = "dottedmag"; + githubId = 16120; + name = "Misha Gusarov"; + keys = [{ + longkeyid = "rsa4096/0x9D20F6503E338888"; + fingerprint = "A8DF 1326 9E5D 9A38 E57C FAC2 9D20 F650 3E33 8888"; + }]; + }; + doublec = { + email = "chris.double@double.co.nz"; + github = "doublec"; + githubId = 16599; + name = "Chris Double"; + }; + dpaetzel = { + email = "david.paetzel@posteo.de"; + github = "dpaetzel"; + githubId = 974130; + name = "David Pätzel"; + }; + dpausp = { + email = "dpausp@posteo.de"; + github = "dpausp"; + githubId = 1965950; + name = "Tobias Stenzel"; + keys = [{ + longkeyid = "rsa2048/0x78C7DD40DF23FB16"; + fingerprint = "4749 0887 CF3B 85A1 6355 C671 78C7 DD40 DF23 FB16"; + }]; + }; + dpercy = { + email = "dpercy@dpercy.dev"; + github = "dpercy"; + githubId = 349909; + name = "David Percy"; + }; + dpflug = { + email = "david@pflug.email"; + github = "dpflug"; + githubId = 108501; + name = "David Pflug"; + }; + dramaturg = { + email = "seb@ds.ag"; + github = "dramaturg"; + githubId = 472846; + name = "Sebastian Krohn"; + }; + drets = { + email = "dmitryrets@gmail.com"; + github = "drets"; + githubId = 6199462; + name = "Dmytro Rets"; + }; + drewkett = { + email = "burkett.andrew@gmail.com"; + name = "Andrew Burkett"; + }; + drewrisinger = { + email = "drisinger+nixpkgs@gmail.com"; + github = "drewrisinger"; + githubId = 10198051; + name = "Drew Risinger"; + }; + drperceptron = { + email = "92106371+drperceptron@users.noreply.github.com"; + github = "drperceptron"; + githubId = 92106371; + name = "Dr Perceptron"; + keys = [{ + longkeyid = "rsa4096/0x95EB6DFF26D1CEB0"; + fingerprint = "7E38 89D9 B1A8 B381 C8DE A15F 95EB 6DFF 26D1 CEB0"; + }]; + }; + drupol = { + name = "Pol Dellaiera"; + email = "pol.dellaiera@protonmail.com"; + matrix = "@drupol:matrix.org"; + github = "drupol"; + githubId = 252042; + keys = [{ + longkeyid = "ed25519/0x0AAF2901E8040715"; + fingerprint = "85F3 72DF 4AF3 EF13 ED34 72A3 0AAF 2901 E804 0715"; + }]; + }; + drzoidberg = { + email = "jakob@mast3rsoft.com"; + github = "jakobneufeld"; + githubId = 24791219; + name = "Jakob Neufeld"; + }; + dsalaza4 = { + email = "podany270895@gmail.com"; + github = "dsalaza4"; + githubId = 11205987; + name = "Daniel Salazar"; + }; + dschrempf = { + name = "Dominik Schrempf"; + email = "dominik.schrempf@gmail.com"; + github = "dschrempf"; + githubId = 5596239; + keys = [{ + longkeyid = "rsa2048/0x875F2BCF163F1B29"; + fingerprint = "62BC E2BD 49DF ECC7 35C7 E153 875F 2BCF 163F 1B29"; + }]; + }; + dsferruzza = { + email = "david.sferruzza@gmail.com"; + github = "dsferruzza"; + githubId = 1931963; + name = "David Sferruzza"; + }; + dtzWill = { + email = "w@wdtz.org"; + github = "dtzWill"; + githubId = 817330; + name = "Will Dietz"; + keys = [{ + longkeyid = "rsa4096/0xFD42C7D0D41494C8"; + fingerprint = "389A 78CB CD88 5E0C 4701 DEB9 FD42 C7D0 D414 94C8"; + }]; + }; + dump_stack = { + email = "root@dumpstack.io"; + github = "jollheef"; + githubId = 1749762; + name = "Mikhail Klementev"; + keys = [{ + longkeyid = "rsa4096/0x1525585D1B43C62A"; + fingerprint = "5DD7 C6F6 0630 F08E DAE7 4711 1525 585D 1B43 C62A"; + }]; + }; + dwarfmaster = { + email = "nixpkgs@dwarfmaster.net"; + github = "dwarfmaster"; + githubId = 2025623; + name = "Luc Chabassier"; + }; + dxf = { + email = "dingxiangfei2009@gmail.com"; + github = "dingxiangfei2009"; + githubId = 6884440; + name = "Ding Xiang Fei"; + }; + dysinger = { + email = "tim@dysinger.net"; + github = "dysinger"; + githubId = 447; + name = "Tim Dysinger"; + }; + dywedir = { + email = "dywedir@gra.red"; + matrix = "@dywedir:matrix.org"; + github = "dywedir"; + githubId = 399312; + name = "Vladyslav M."; + }; + dzabraev = { + email = "dzabraew@gmail.com"; + github = "dzabraev"; + githubId = 15128988; + name = "Maksim Dzabraev"; + }; + e-user = { + email = "nixos@sodosopa.io"; + github = "e-user"; + githubId = 93086; + name = "Alexander Kahl"; + }; + eadwu = { + email = "edmund.wu@protonmail.com"; + github = "eadwu"; + githubId = 22758444; + name = "Edmund Wu"; + }; + ealasu = { + email = "emanuel.alasu@gmail.com"; + github = "ealasu"; + githubId = 1362096; + name = "Emanuel Alasu"; + }; + eamsden = { + email = "edward@blackriversoft.com"; + github = "eamsden"; + githubId = 54573; + name = "Edward Amsden"; + }; + earldouglas = { + email = "james@earldouglas.com"; + github = "earldouglas"; + githubId = 424946; + name = "James Earl Douglas"; + }; + earvstedt = { + email = "erik.arvstedt@gmail.com"; + matrix = "@erikarvstedt:matrix.org"; + github = "erikarvstedt"; + githubId = 36110478; + name = "Erik Arvstedt"; + }; + ebbertd = { + email = "daniel@ebbert.nrw"; + github = "ebbertd"; + githubId = 20522234; + name = "Daniel Ebbert"; + keys = [{ + longkeyid = "rsa2048/0x47BC155927CBB9C7"; + fingerprint = "E765 FCA3 D9BF 7FDB 856E AD73 47BC 1559 27CB B9C7"; + }]; + }; + ebzzry = { + email = "ebzzry@ebzzry.io"; + github = "ebzzry"; + githubId = 7875; + name = "Rommel Martinez"; + }; + edanaher = { + email = "nixos@edanaher.net"; + github = "edanaher"; + githubId = 984691; + name = "Evan Danaher"; + }; + edbentley = { + email = "hello@edbentley.dev"; + github = "edbentley"; + githubId = 15923595; + name = "Ed Bentley"; + }; + edcragg = { + email = "ed.cragg@eipi.xyz"; + github = "nuxeh"; + githubId = 1516017; + name = "Ed Cragg"; + }; + edef = { + email = "edef@edef.eu"; + github = "edef1c"; + githubId = 50854; + name = "edef"; + }; + edlimerkaj = { + name = "Edli Merkaj"; + email = "edli.merkaj@identinet.io"; + github = "edlimerkaj"; + githubId = 71988351; + }; + emantor = { + email = "rouven+nixos@czerwinskis.de"; + github = "emantor"; + githubId = 934284; + name = "Rouven Czerwinski"; + }; + embr = { + email = "hi@liclac.eu"; + github = "liclac"; + githubId = 428026; + name = "embr"; + }; + emily = { + email = "nixpkgs@emily.moe"; + github = "emilazy"; + githubId = 18535642; + name = "Emily"; + }; + emilytrau = { + name = "Emily Trau"; + email = "nix@angus.ws"; + github = "emilytrau"; + githubId = 13267947; + }; + enderger = { + email = "endergeryt@gmail.com"; + github = "enderger"; + githubId = 36283171; + name = "Daniel"; + }; + endocrimes = { + email = "dani@builds.terrible.systems"; + github = "endocrimes"; + githubId = 1330683; + name = "Danielle Lancashire"; + }; + ederoyd46 = { + email = "matt@ederoyd.co.uk"; + github = "ederoyd46"; + githubId = 119483; + name = "Matthew Brown"; + }; + eduarrrd = { + email = "e.bachmakov@gmail.com"; + github = "eduarrrd"; + githubId = 1181393; + name = "Eduard Bachmakov"; + }; + edude03 = { + email = "michael@melenion.com"; + github = "edude03"; + githubId = 494483; + name = "Michael Francis"; + }; + edwtjo = { + email = "ed@cflags.cc"; + github = "edwtjo"; + githubId = 54799; + name = "Edward Tjörnhammar"; + }; + eelco = { + email = "edolstra+nixpkgs@gmail.com"; + github = "edolstra"; + githubId = 1148549; + name = "Eelco Dolstra"; + }; + ehegnes = { + email = "eric.hegnes@gmail.com"; + github = "ehegnes"; + githubId = 884970; + name = "Eric Hegnes"; + }; + ehmry = { + email = "ehmry@posteo.net"; + github = "ehmry"; + githubId = 537775; + name = "Emery Hemingway"; + }; + eikek = { + email = "eike.kettner@posteo.de"; + github = "eikek"; + githubId = 701128; + name = "Eike Kettner"; + }; + ekleog = { + email = "leo@gaspard.io"; + matrix = "@leo:gaspard.ninja"; + github = "ekleog"; + githubId = 411447; + name = "Leo Gaspard"; + }; + elasticdog = { + email = "aaron@elasticdog.com"; + github = "elasticdog"; + githubId = 4742; + name = "Aaron Bull Schaefer"; + }; + elatov = { + email = "elatov@gmail.com"; + github = "elatov"; + githubId = 7494394; + name = "Karim Elatov"; + }; + eleanor = { + email = "dejan@proteansec.com"; + github = "proteansec"; + githubId = 1753498; + name = "Dejan Lukan"; + }; + electrified = { + email = "ed@maidavale.org"; + github = "electrified"; + githubId = 103082; + name = "Ed Brindley"; + }; + elliot = { + email = "hack00mind@gmail.com"; + github = "Eliot00"; + githubId = 18375468; + name = "Elliot Xu"; + }; + elliottvillars = { + email = "elliottvillars@gmail.com"; + github = "elliottvillars"; + githubId = 48104179; + name = "Elliott Villars"; + }; + eliasp = { + email = "mail@eliasprobst.eu"; + matrix = "@eliasp:kde.org"; + github = "eliasp"; + githubId = 48491; + name = "Elias Probst"; + }; + elijahcaine = { + email = "elijahcainemv@gmail.com"; + github = "pop"; + githubId = 1897147; + name = "Elijah Caine"; + }; + elitak = { + email = "elitak@gmail.com"; + github = "elitak"; + githubId = 769073; + name = "Eric Litak"; + }; + ellis = { + email = "nixos@ellisw.net"; + github = "ellis"; + githubId = 97852; + name = "Ellis Whitehead"; + }; + elkowar = { + email = "thereal.elkowar@gmail.com"; + github = "elkowar"; + githubId = 5300871; + name = "Leon Kowarschick"; + }; + elohmeier = { + email = "elo-nixos@nerdworks.de"; + github = "elohmeier"; + githubId = 2536303; + name = "Enno Lohmeier"; + }; + elseym = { + email = "elseym@me.com"; + github = "elseym"; + githubId = 907478; + name = "Simon Waibl"; + }; + elvishjerricco = { + email = "elvishjerricco@gmail.com"; + github = "ElvishJerricco"; + githubId = 1365692; + name = "Will Fancher"; + }; + elyhaka = { + email = "elyhaka@protonmail.com"; + github = "Elyhaka"; + githubId = 57923898; + name = "Elyhaka"; + }; + em0lar = { + email = "nix@em0lar.dev"; + github = "em0lar"; + githubId = 11006031; + name = "Leo Maroni"; + }; + emmanuelrosa = { + email = "emmanuelrosa@protonmail.com"; + matrix = "@emmanuelrosa:matrix.org"; + github = "emmanuelrosa"; + githubId = 13485450; + name = "Emmanuel Rosa"; + }; + emptyflask = { + email = "jon@emptyflask.dev"; + github = "emptyflask"; + githubId = 28287; + name = "Jon Roberts"; + }; + endgame = { + email = "jack@jackkelly.name"; + github = "endgame"; + githubId = 231483; + name = "Jack Kelly"; + }; + enorris = { + name = "Eric Norris"; + email = "erictnorris@gmail.com"; + github = "ericnorris"; + githubId = 1906605; + }; + Enteee = { + email = "nix@duckpond.ch"; + github = "Enteee"; + githubId = 5493775; + name = "Ente"; + }; + Enzime = { + email = "enzime@users.noreply.github.com"; + github = "Enzime"; + githubId = 10492681; + name = "Michael Hoang"; + }; + eonpatapon = { + email = "eon@patapon.info"; + github = "eonpatapon"; + githubId = 418227; + name = "Jean-Philippe Braun"; + }; + eperuffo = { + email = "info@emanueleperuffo.com"; + github = "emanueleperuffo"; + githubId = 5085029; + name = "Emanuele Peruffo"; + }; + epitrochoid = { + email = "mpcervin@uncg.edu"; + name = "Mabry Cervin"; + }; + equirosa = { + email = "eduardo@eduardoquiros.com"; + github = "equirosa"; + githubId = 39096810; + name = "Eduardo Quiros"; + }; + eqyiel = { + email = "ruben@maher.fyi"; + github = "eqyiel"; + githubId = 3422442; + name = "Ruben Maher"; + }; + eraserhd = { + email = "jason.m.felice@gmail.com"; + github = "eraserhd"; + githubId = 147284; + name = "Jason Felice"; + }; + erdnaxe = { + email = "erdnaxe@crans.org"; + github = "erdnaxe"; + githubId = 2663216; + name = "Alexandre Iooss"; + keys = [{ + longkeyid = "rsa4096/0x6C79278F3FCDCC02"; + fingerprint = "2D37 1AD2 7E2B BC77 97E1 B759 6C79 278F 3FCD CC02"; + }]; + }; + ereslibre = { + email = "ereslibre@ereslibre.es"; + matrix = "@ereslibre:matrix.org"; + github = "ereslibre"; + githubId = 8706; + name = "Rafael Fernández López"; + }; + ericbmerritt = { + email = "eric@afiniate.com"; + github = "ericbmerritt"; + githubId = 4828; + name = "Eric Merritt"; + }; + ericdallo = { + email = "ercdll1337@gmail.com"; + github = "ericdallo"; + githubId = 7820865; + name = "Eric Dallo"; + }; + ericsagnes = { + email = "eric.sagnes@gmail.com"; + github = "ericsagnes"; + githubId = 367880; + name = "Eric Sagnes"; + }; + ericson2314 = { + email = "John.Ericson@Obsidian.Systems"; + matrix = "@ericson2314:matrix.org"; + github = "ericson2314"; + githubId = 1055245; + name = "John Ericson"; + }; + erictapen = { + email = "kerstin@erictapen.name"; + github = "erictapen"; + githubId = 11532355; + name = "Kerstin Humm"; + keys = [{ + longkeyid = "rsa4096/0x40293358C7B9326B"; + fingerprint = "F178 B4B4 6165 6D1B 7C15 B55D 4029 3358 C7B9 326B"; + }]; + }; + erikbackman = { + email = "contact@ebackman.net"; + github = "erikbackman"; + githubId = 46724898; + name = "Erik Backman"; + }; + erikryb = { + email = "erik.rybakken@math.ntnu.no"; + github = "erikryb"; + githubId = 3787281; + name = "Erik Rybakken"; + }; + erin = { + name = "Erin van der Veen"; + email = "erin@erinvanderveen.nl"; + github = "ErinvanderVeen"; + githubId = 10973664; + }; + erosennin = { + email = "ag@sologoc.com"; + github = "erosennin"; + githubId = 1583484; + name = "Andrey Golovizin"; + }; + ersin = { + email = "me@ersinakinci.com"; + github = "earksiinni"; + githubId = 5427394; + name = "Ersin Akinci"; + }; + ertes = { + email = "esz@posteo.de"; + github = "ertes"; + githubId = 1855930; + name = "Ertugrul Söylemez"; + }; + esclear = { + email = "esclear@users.noreply.github.com"; + github = "esclear"; + githubId = 7432848; + name = "Daniel Albert"; + }; + eskytthe = { + email = "eskytthe@gmail.com"; + github = "eskytthe"; + githubId = 2544204; + name = "Erik Skytthe"; + }; + Esteth = { + email = "adam.copp@gmail.com"; + name = "Adam Copp"; + }; + ethancedwards8 = { + email = "ethan@ethancedwards.com"; + github = "ethancedwards8"; + githubId = 60861925; + name = "Ethan Carter Edwards"; + keys = [{ + longkeyid = "rsa4096/0xF93DDAFA26EF2458"; + fingerprint = "0E69 0F46 3457 D812 3387 C978 F93D DAFA 26EF 2458"; + }]; + }; + ethercrow = { + email = "ethercrow@gmail.com"; + github = "ethercrow"; + githubId = 222467; + name = "Dmitry Ivanov"; + }; + Etjean = { + email = "et.jean@outlook.fr"; + github = "Etjean"; + githubId = 32169529; + name = "Etienne Jean"; + }; + etu = { + email = "elis@hirwing.se"; + matrix = "@etu:semi.social"; + github = "etu"; + githubId = 461970; + name = "Elis Hirwing"; + keys = [{ + longkeyid = "rsa4096/0xD57EFA625C9A925F"; + fingerprint = "67FE 98F2 8C44 CF22 1828 E12F D57E FA62 5C9A 925F"; + }]; + }; + euank = { + email = "euank-nixpkg@euank.com"; + github = "euank"; + githubId = 2147649; + name = "Euan Kemp"; + }; + evalexpr = { + name = "Jonathan Wilkins"; + email = "nixos@wilkins.tech"; + matrix = "@evalexpr:matrix.org"; + github = "evalexpr"; + githubId = 23485511; + keys = [{ + longkeyid = "rsa4096/0x2D1D402E17763DD6"; + fingerprint = "8129 5B85 9C5A F703 C2F4 1E29 2D1D 402E 1776 3DD6"; + }]; + }; + evanjs = { + email = "evanjsx@gmail.com"; + github = "evanjs"; + githubId = 1847524; + name = "Evan Stoll"; + }; + evax = { + email = "nixos@evax.fr"; + github = "evax"; + githubId = 599997; + name = "evax"; + }; + evck = { + email = "eric@evenchick.com"; + github = "ericevenchick"; + githubId = 195032; + name = "Eric Evenchick"; + }; + evenbrenden = { + email = "evenbrenden@gmail.com"; + github = "evenbrenden"; + githubId = 2512008; + name = "Even Brenden"; + }; + evils = { + email = "evils.devils@protonmail.com"; + matrix = "@evils:nixos.dev"; + github = "evils"; + githubId = 30512529; + name = "Evils"; + }; + ewok = { + email = "ewok@ewok.ru"; + github = "ewok"; + githubId = 454695; + name = "Artur Taranchiev"; + }; + exarkun = { + email = "exarkun@twistedmatrix.com"; + github = "exarkun"; + githubId = 254565; + name = "Jean-Paul Calderone"; + }; + exfalso = { + email = "0slemi0@gmail.com"; + github = "exfalso"; + githubId = 1042674; + name = "Andras Slemmer"; + }; + exi = { + email = "nixos@reckling.org"; + github = "exi"; + githubId = 449463; + name = "Reno Reckling"; + }; + exlevan = { + email = "exlevan@gmail.com"; + github = "exlevan"; + githubId = 873530; + name = "Alexey Levan"; + }; + expipiplus1 = { + email = "nix@monoid.al"; + matrix = "@ellie:monoid.al"; + github = "expipiplus1"; + githubId = 857308; + name = "Ellie Hermaszewska"; + keys = [{ + longkeyid = "rsa4096/0xC8116E3A0C1CA76A"; + fingerprint = "FC1D 3E4F CBCA 80DF E870 6397 C811 6E3A 0C1C A76A"; + }]; + }; + extends = { + email = "sharosari@gmail.com"; + github = "ImExtends"; + githubId = 55919390; + name = "Vincent VILLIAUMEY"; + }; + eyjhb = { + email = "eyjhbb@gmail.com"; + matrix = "@eyjhb:eyjhb.dk"; + github = "eyJhb"; + githubId = 25955146; + name = "eyJhb"; + }; + f--t = { + email = "git@f-t.me"; + github = "f--t"; + githubId = 2817965; + name = "f--t"; + }; + f4814n = { + email = "me@f4814n.de"; + github = "f4814"; + githubId = 11909469; + name = "Fabian Geiselhart"; + }; + fab = { + email = "mail@fabian-affolter.ch"; + matrix = "@fabaff:matrix.org"; + name = "Fabian Affolter"; + github = "fabaff"; + githubId = 116184; + keys = [{ + longkeyid = "dsa1024/0xE23CD2DD36A4397F"; + fingerprint = "2F6C 930F D3C4 7E38 6AFA 4EB4 E23C D2DD 36A4 397F"; + }]; + }; + fabiangd = { + email = "fabian.g.droege@gmail.com"; + name = "Fabian G. Dröge"; + github = "FabianGD"; + githubId = 40316600; + }; + fabianhauser = { + email = "fabian.nixos@fh2.ch"; + github = "fabianhauser"; + githubId = 368799; + name = "Fabian Hauser"; + keys = [{ + longkeyid = "rsa4096/0x8A52A140BEBF7D2C"; + fingerprint = "50B7 11F4 3DFD 2018 DCE6 E8D0 8A52 A140 BEBF 7D2C"; + }]; + }; + fabianhjr = { + email = "fabianhjr@protonmail.com"; + github = "fabianhjr"; + githubId = 303897; + name = "Fabián Heredia Montiel"; + }; + fadenb = { + email = "tristan.helmich+nixos@gmail.com"; + github = "fadenb"; + githubId = 878822; + name = "Tristan Helmich"; + }; + falsifian = { + email = "james.cook@utoronto.ca"; + github = "falsifian"; + githubId = 225893; + name = "James Cook"; + }; + fare = { + email = "fahree@gmail.com"; + github = "fare"; + githubId = 8073; + name = "Francois-Rene Rideau"; + }; + farlion = { + email = "florian.peter@gmx.at"; + github = "workflow"; + githubId = 1276854; + name = "Florian Peter"; + }; + fbeffa = { + email = "beffa@fbengineering.ch"; + github = "fedeinthemix"; + githubId = 7670450; + name = "Federico Beffa"; + }; + fbrs = { + email = "yuuki@protonmail.com"; + github = "cideM"; + githubId = 4246921; + name = "Florian Beeres"; + }; + fdns = { + email = "fdns02@gmail.com"; + github = "fdns"; + githubId = 541748; + name = "Felipe Espinoza"; + }; + fedx-sudo = { + email = "fedx-sudo@pm.me"; + github = "Fedx-sudo"; + githubId = 66258975; + name = "Fedx sudo"; + matrix = "fedx:matrix.org"; + }; + fehnomenal = { + email = "fehnomenal@fehn.systems"; + github = "fehnomenal"; + githubId = 9959940; + name = "Andreas Fehn"; + }; + felixscheinost = { + name = "Felix Scheinost"; + email = "felix.scheinost@posteo.de"; + github = "felixscheinost"; + githubId = 31761492; + }; + felixsinger = { + email = "felixsinger@posteo.net"; + github = "felixsinger"; + githubId = 628359; + name = "Felix Singer"; + }; + felschr = { + email = "dev@felschr.com"; + matrix = "@felschr:matrix.org"; + github = "felschr"; + githubId = 3314323; + name = "Felix Tenley"; + keys = [{ + longkeyid = "ed25519/0x910ACB9F6BD26F58"; + fingerprint = "6AB3 7A28 5420 9A41 82D9 0068 910A CB9F 6BD2 6F58"; + }]; + }; + ffinkdevs = { + email = "fink@h0st.space"; + github = "ffinkdevs"; + githubId = 45924649; + name = "Fabian Fink"; + }; + fgaz = { + email = "fgaz@fgaz.me"; + matrix = "@fgaz:matrix.org"; + github = "fgaz"; + githubId = 8182846; + name = "Francesco Gazzetta"; + }; + figsoda = { + email = "figsoda@pm.me"; + matrix = "@figsoda:matrix.org"; + github = "figsoda"; + githubId = 40620903; + name = "figsoda"; + }; + fionera = { + email = "nix@fionera.de"; + github = "fionera"; + githubId = 5741401; + name = "Tim Windelschmidt"; + }; + FireyFly = { + email = "nix@firefly.nu"; + github = "FireyFly"; + githubId = 415760; + name = "Jonas Höglund"; + }; + fishi0x01 = { + email = "fishi0x01@gmail.com"; + github = "fishi0x01"; + githubId = 10799507; + name = "Karl Fischer"; + }; + fitzgibbon = { + name = "Niall FitzGibbon"; + email = "fitzgibbon.niall@gmail.com"; + github = "fitzgibbon"; + githubId = 617048; + }; + fkautz = { + name = "Frederick F. Kautz IV"; + email = "fkautz@alumni.cmu.edu"; + github = "fkautz"; + githubId = 135706; + }; + Flakebi = { + email = "flakebi@t-online.de"; + github = "Flakebi"; + githubId = 6499211; + name = "Sebastian Neubauer"; + keys = [{ + longkeyid = "rsa4096/0xECC755EE583C1672"; + fingerprint = "2F93 661D AC17 EA98 A104 F780 ECC7 55EE 583C 1672"; + }]; + }; + flexagoon = { + email = "flexagoon@pm.me"; + github = "flexagoon"; + githubId = 66178592; + name = "Pavel Zolotarevskiy"; + }; + flexw = { + email = "felix.weilbach@t-online.de"; + github = "FlexW"; + githubId = 19961516; + name = "Felix Weilbach"; + }; + fliegendewurst = { + email = "arne.keller@posteo.de"; + github = "FliegendeWurst"; + githubId = 12560461; + name = "Arne Keller"; + }; + flokli = { + email = "flokli@flokli.de"; + github = "flokli"; + githubId = 183879; + name = "Florian Klink"; + }; + florentc = { + email = "florentc@users.noreply.github.com"; + github = "florentc"; + githubId = 1149048; + name = "Florent Ch."; + }; + FlorianFranzen = { + email = "Florian.Franzen@gmail.com"; + github = "FlorianFranzen"; + githubId = 781077; + name = "Florian Franzen"; + }; + florianjacob = { + email = "projects+nixos@florianjacob.de"; + github = "florianjacob"; + githubId = 1109959; + name = "Florian Jacob"; + }; + flosse = { + email = "mail@markus-kohlhase.de"; + github = "flosse"; + githubId = 276043; + name = "Markus Kohlhase"; + }; + fluffynukeit = { + email = "dan@fluffynukeit.com"; + github = "fluffynukeit"; + githubId = 844574; + name = "Daniel Austin"; + }; + flyfloh = { + email = "nix@halbmastwurf.de"; + github = "flyfloh"; + githubId = 74379; + name = "Florian Pester"; + }; + fmthoma = { + email = "f.m.thoma@googlemail.com"; + github = "fmthoma"; + githubId = 5918766; + name = "Franz Thoma"; + }; + fooker = { + email = "fooker@lab.sh"; + github = "fooker"; + githubId = 405105; + name = "Dustin Frisch"; + }; + forkk = { + email = "forkk@forkk.net"; + github = "forkk"; + githubId = 1300078; + name = "Andrew Okin"; + }; + fornever = { + email = "friedrich@fornever.me"; + github = "fornever"; + githubId = 92793; + name = "Friedrich von Never"; + }; + fortuneteller2k = { + email = "lythe1107@gmail.com"; + matrix = "@fortuneteller2k:matrix.org"; + github = "fortuneteller2k"; + githubId = 20619776; + name = "fortuneteller2k"; + }; + fpletz = { + email = "fpletz@fnordicwalking.de"; + github = "fpletz"; + githubId = 114159; + name = "Franz Pletz"; + keys = [{ + longkeyid = "rsa4096/0x846FDED7792617B4"; + fingerprint = "8A39 615D CE78 AF08 2E23 F303 846F DED7 7926 17B4"; + }]; + }; + fps = { + email = "mista.tapas@gmx.net"; + github = "fps"; + githubId = 84968; + name = "Florian Paul Schmidt"; + }; + + fragamus = { + email = "innovative.engineer@gmail.com"; + github = "fragamus"; + githubId = 119691; + name = "Michael Gough"; + }; + + fredeb = { + email = "im@fredeb.dev"; + github = "fredeeb"; + githubId = 7551358; + name = "Frede Emil"; + }; + freezeboy = { + email = "freezeboy@users.noreply.github.com"; + github = "freezeboy"; + githubId = 13279982; + name = "freezeboy"; + }; + Fresheyeball = { + email = "fresheyeball@gmail.com"; + github = "Fresheyeball"; + githubId = 609279; + name = "Isaac Shapira"; + }; + fridh = { + email = "fridh@fridh.nl"; + github = "fridh"; + githubId = 2129135; + name = "Frederik Rietdijk"; + }; + friedelino = { + email = "friede.mann@posteo.de"; + github = "friedelino"; + githubId = 46672819; + name = "Frido Friedemann"; + }; + frlan = { + email = "frank@frank.uvena.de"; + github = "frlan"; + githubId = 1010248; + name = "Frank Lanitz"; + }; + fro_ozen = { + email = "fro_ozen@gmx.de"; + github = "froozen"; + githubId = 1943632; + name = "fro_ozen"; + }; + frogamic = { + email = "frogamic@protonmail.com"; + github = "frogamic"; + githubId = 10263813; + name = "Dominic Shelton"; + }; + Frostman = { + email = "me@slukjanov.name"; + github = "Frostman"; + githubId = 134872; + name = "Sergei Lukianov"; + }; + frontsideair = { + email = "photonia@gmail.com"; + github = "frontsideair"; + githubId = 868283; + name = "Fatih Altinok"; + }; + ftrvxmtrx = { + email = "ftrvxmtrx@gmail.com"; + github = "ftrvxmtrx"; + githubId = 248148; + name = "Sigrid Solveig Haflínudóttir"; + }; + fuerbringer = { + email = "severin@fuerbringer.info"; + github = "fuerbringer"; + githubId = 10528737; + name = "Severin Fürbringer"; + }; + fufexan = { + email = "fufexan@protonmail.com"; + github = "fufexan"; + githubId = 36706276; + name = "Fufezan Mihai"; + }; + funfunctor = { + email = "eocallaghan@alterapraxis.com"; + name = "Edward O'Callaghan"; + }; + fusion809 = { + email = "brentonhorne77@gmail.com"; + github = "fusion809"; + githubId = 4717341; + name = "Brenton Horne"; + }; + fuuzetsu = { + email = "fuuzetsu@fuuzetsu.co.uk"; + github = "fuuzetsu"; + githubId = 893115; + name = "Mateusz Kowalczyk"; + }; + fuwa = { + email = "echowss@gmail.com"; + github = "fuwa0529"; + githubId = 40521440; + name = "Haruka Akiyama"; + }; + fuzen = { + email = "me@fuzen.cafe"; + github = "fuzen-py"; + githubId = 17859309; + name = "Fuzen"; + }; + fuzzy-id = { + email = "hacking+nixos@babibo.de"; + name = "Thomas Bach"; + }; + fxfactorial = { + email = "edgar.factorial@gmail.com"; + github = "fxfactorial"; + githubId = 3036816; + name = "Edgar Aroutiounian"; + }; + gabesoft = { + email = "gabesoft@gmail.com"; + github = "gabesoft"; + githubId = 606000; + name = "Gabriel Adomnicai"; + }; + Gabriel439 = { + email = "Gabriel439@gmail.com"; + github = "Gabriel439"; + githubId = 1313787; + name = "Gabriel Gonzalez"; + }; + gador = { + email = "florian.brandes@posteo.de"; + github = "gador"; + githubId = 1883533; + name = "Florian Brandes"; + keys = [{ + longkeyid = "rsa4096/0xBBB3E40E53797FD9"; + fingerprint = "0200 3EF8 8D2B CF2D 8F00 FFDC BBB3 E40E 5379 7FD9"; + }]; + }; + gal_bolle = { + email = "florent.becker@ens-lyon.org"; + github = "FlorentBecker"; + githubId = 7047019; + name = "Florent Becker"; + }; + galagora = { + email = "lightningstrikeiv@gmail.com"; + github = "galagora"; + githubId = 45048741; + name = "Alwanga Oyango"; + }; + gamb = { + email = "adam.gamble@pm.me"; + github = "gamb"; + githubId = 293586; + name = "Adam Gamble"; + }; + garbas = { + email = "rok@garbas.si"; + github = "garbas"; + githubId = 20208; + name = "Rok Garbas"; + }; + gardspirito = { + name = "gardspirito"; + email = "nyxoroso@gmail.com"; + github = "gardspirito"; + githubId = 29687558; + }; + garrison = { + email = "jim@garrison.cc"; + github = "garrison"; + githubId = 91987; + name = "Jim Garrison"; + }; + gavin = { + email = "gavin.rogers@holo.host"; + github = "gavinrogers"; + githubId = 2430469; + name = "Gavin Rogers"; + }; + gazally = { + email = "gazally@runbox.com"; + github = "gazally"; + githubId = 16470252; + name = "Gemini Lasswell"; + }; + gbtb = { + email = "goodbetterthebeast3@gmail.com"; + github = "gbtb"; + githubId = 37017396; + name = "gbtb"; + }; + gebner = { + email = "gebner@gebner.org"; + github = "gebner"; + githubId = 313929; + name = "Gabriel Ebner"; + }; + genofire = { + name = "genofire"; + email = "geno+dev@fireorbit.de"; + github = "genofire"; + githubId = 6905586; + keys = [{ + longkeyid = "rsa4096/0xFC83907C125BC2BC"; + fingerprint = "386E D1BF 848A BB4A 6B4A 3C45 FC83 907C 125B C2BC"; + }]; + }; + georgewhewell = { + email = "georgerw@gmail.com"; + github = "georgewhewell"; + githubId = 1176131; + name = "George Whewell"; + }; + georgyo = { + email = "george@shamm.as"; + github = "georgyo"; + githubId = 19374; + name = "George Shammas"; + keys = [{ + longkeyid = "rsa4096/0x82BB70D541AE2DB4"; + fingerprint = "D0CF 440A A703 E0F9 73CB A078 82BB 70D5 41AE 2DB4"; + }]; + }; + gerschtli = { + email = "tobias.happ@gmx.de"; + github = "Gerschtli"; + githubId = 10353047; + name = "Tobias Happ"; + }; + gfrascadorio = { + email = "gfrascadorio@tutanota.com"; + github = "gfrascadorio"; + githubId = 37602871; + name = "Galois"; + }; + ggpeti = { + email = "ggpeti@gmail.com"; + matrix = "@ggpeti:ggpeti.com"; + github = "ggpeti"; + githubId = 3217744; + name = "Peter Ferenczy"; + }; + ghuntley = { + email = "ghuntley@ghuntley.com"; + github = "ghuntley"; + githubId = 127353; + name = "Geoffrey Huntley"; + }; + gila = { + email = "jeffry.molanus@gmail.com"; + github = "gila"; + githubId = 15957973; + name = "Jeffry Molanus"; + }; + gilligan = { + email = "tobias.pflug@gmail.com"; + github = "gilligan"; + githubId = 27668; + name = "Tobias Pflug"; + }; + gin66 = { + email = "jochen@kiemes.de"; + github = "gin66"; + githubId = 5549373; + name = "Jochen Kiemes"; + }; + giogadi = { + email = "lgtorres42@gmail.com"; + github = "giogadi"; + githubId = 1713676; + name = "Luis G. Torres"; + }; + GKasparov = { + email = "mizozahr@gmail.com"; + github = "GKasparov"; + githubId = 60962839; + name = "Mazen Zahr"; + }; + gleber = { + email = "gleber.p@gmail.com"; + github = "gleber"; + githubId = 33185; + name = "Gleb Peregud"; + }; + glenns = { + email = "glenn.searby@gmail.com"; + github = "glenns"; + githubId = 615606; + name = "Glenn Searby"; + }; + glittershark = { + name = "Griffin Smith"; + email = "root@gws.fyi"; + github = "glittershark"; + githubId = 1481027; + keys = [{ + longkeyid = "rsa2048/0x44EF5B5E861C09A7"; + fingerprint = "0F11 A989 879E 8BBB FDC1 E236 44EF 5B5E 861C 09A7"; + }]; + }; + gloaming = { + email = "ch9871@gmail.com"; + github = "gloaming"; + githubId = 10156748; + name = "Craig Hall"; + }; + globin = { + email = "mail@glob.in"; + github = "globin"; + githubId = 1447245; + name = "Robin Gloster"; + }; + gnxlxnxx = { + email = "gnxlxnxx@web.de"; + github = "gnxlxnxx"; + githubId = 25820499; + name = "Roman Kretschmer"; + }; + goertzenator = { + email = "daniel.goertzen@gmail.com"; + github = "goertzenator"; + githubId = 605072; + name = "Daniel Goertzen"; + }; + goibhniu = { + email = "cillian.deroiste@gmail.com"; + github = "cillianderoiste"; + githubId = 643494; + name = "Cillian de Róiste"; + }; + Gonzih = { + email = "gonzih@gmail.com"; + github = "Gonzih"; + githubId = 266275; + name = "Max Gonzih"; + }; + goodrone = { + email = "goodrone@gmail.com"; + github = "goodrone"; + githubId = 1621335; + name = "Andrew Trachenko"; + }; + gordias = { + name = "Gordias"; + email = "gordias@disroot.org"; + github = "gordiasdot"; + githubId = 94724133; + keys = [{ + longkeyid = "ed25519/0x5D47284830FAA4FA"; + fingerprint = "C006 B8A0 0618 F3B6 E0E4 2ECD 5D47 2848 30FA A4FA"; + }]; + }; + govanify = { + name = "Gauvain 'GovanifY' Roussel-Tarbouriech"; + email = "gauvain@govanify.com"; + github = "govanify"; + githubId = 6375438; + keys = [{ + longkeyid = "rsa4096/0xDE62E1E2A6145556"; + fingerprint = "5214 2D39 A7CE F8FA 872B CA7F DE62 E1E2 A614 5556"; + }]; + }; + gpanders = { + name = "Gregory Anders"; + email = "greg@gpanders.com"; + github = "gpanders"; + githubId = 8965202; + keys = [{ + longkeyid = "rsa2048/0x56E93C2FB6B08BDB"; + fingerprint = "B9D5 0EDF E95E ECD0 C135 00A9 56E9 3C2F B6B0 8BDB"; + }]; + }; + gpyh = { + email = "yacine.hmito@gmail.com"; + github = "yacinehmito"; + githubId = 6893840; + name = "Yacine Hmito"; + }; + graham33 = { + email = "graham@grahambennett.org"; + github = "graham33"; + githubId = 10908649; + name = "Graham Bennett"; + }; + grahamc = { + email = "graham@grahamc.com"; + github = "grahamc"; + githubId = 76716; + name = "Graham Christensen"; + }; + gravndal = { + email = "gaute.ravndal+nixos@gmail.com"; + github = "gravndal"; + githubId = 4656860; + name = "Gaute Ravndal"; + }; + grburst = { + email = "GRBurst@protonmail.com"; + github = "GRBurst"; + githubId = 4647221; + name = "GRBurst"; + keys = [{ + longkeyid = "rsa4096/0x797F623868CD00C2"; + fingerprint = "7FC7 98AB 390E 1646 ED4D 8F1F 797F 6238 68CD 00C2"; + }]; + }; + greizgh = { + email = "greizgh@ephax.org"; + github = "greizgh"; + githubId = 1313624; + name = "greizgh"; + }; + greydot = { + email = "lanablack@amok.cc"; + github = "greydot"; + githubId = 7385287; + name = "Lana Black"; + }; + gridaphobe = { + email = "eric@seidel.io"; + github = "gridaphobe"; + githubId = 201997; + name = "Eric Seidel"; + }; + gspia = { + email = "iahogsp@gmail.com"; + github = "gspia"; + githubId = 3320792; + name = "gspia"; + }; + guibert = { + email = "david.guibert@gmail.com"; + github = "dguibert"; + githubId = 1178864; + name = "David Guibert"; + }; + groodt = { + email = "groodt@gmail.com"; + github = "groodt"; + githubId = 343415; + name = "Greg Roodt"; + }; + gruve-p = { + email = "groestlcoin@gmail.com"; + github = "gruve-p"; + githubId = 11212268; + name = "gruve-p"; + }; + gschwartz = { + email = "gsch@pennmedicine.upenn.edu"; + github = "GregorySchwartz"; + githubId = 2490088; + name = "Gregory Schwartz"; + }; + gtrunsec = { + email = "gtrunsec@hardenedlinux.org"; + github = "GTrunSec"; + githubId = 21156405; + name = "GuangTao Zhang"; + }; + guibou = { + email = "guillaum.bouchard@gmail.com"; + github = "guibou"; + githubId = 9705357; + name = "Guillaume Bouchard"; + }; + GuillaumeDesforges = { + email = "aceus02@gmail.com"; + github = "GuillaumeDesforges"; + githubId = 1882000; + name = "Guillaume Desforges"; + }; + guillaumekoenig = { + email = "guillaume.edward.koenig@gmail.com"; + github = "guillaumekoenig"; + githubId = 10654650; + name = "Guillaume Koenig"; + }; + guserav = { + email = "guserav@users.noreply.github.com"; + github = "guserav"; + githubId = 28863828; + name = "guserav"; + }; + guyonvarch = { + email = "joris@guyonvarch.me"; + github = "guyonvarch"; + githubId = 6768842; + name = "Joris Guyonvarch"; + }; + gvolpe = { + email = "volpegabriel@gmail.com"; + github = "gvolpe"; + githubId = 443978; + name = "Gabriel Volpe"; + }; + gytis-ivaskevicius = { + name = "Gytis Ivaskevicius"; + email = "me@gytis.io"; + matrix = "@gytis-ivaskevicius:matrix.org"; + github = "gytis-ivaskevicius"; + githubId = 23264966; + }; + hagl = { + email = "harald@glie.be"; + github = "hagl"; + githubId = 1162118; + name = "Harald Gliebe"; + }; + hakuch = { + email = "hakuch@gmail.com"; + github = "hakuch"; + githubId = 1498782; + name = "Jesse Haber-Kucharsky"; + }; + hamhut1066 = { + email = "github@hamhut1066.com"; + github = "moredhel"; + githubId = 1742172; + name = "Hamish Hutchings"; + }; + hanemile = { + email = "mail@emile.space"; + github = "hanemile"; + githubId = 22756350; + name = "Emile Hansmaennel"; + }; + hansjoergschurr = { + email = "commits@schurr.at"; + github = "hansjoergschurr"; + githubId = 9850776; + name = "Hans-Jörg Schurr"; + }; + HaoZeke = { + email = "r95g10@gmail.com"; + github = "haozeke"; + githubId = 4336207; + name = "Rohit Goswami"; + keys = [{ + longkeyid = "rsa4096/0x9CCCE36402CB49A6"; + fingerprint = "74B1 F67D 8E43 A94A 7554 0768 9CCC E364 02CB 49A6"; + }]; + }; + happysalada = { + email = "raphael@megzari.com"; + matrix = "@happysalada:matrix.org"; + github = "happysalada"; + githubId = 5317234; + name = "Raphael Megzari"; + }; + happy-river = { + email = "happyriver93@runbox.com"; + github = "happy-river"; + githubId = 54728477; + name = "Happy River"; + }; + hardselius = { + email = "martin@hardselius.dev"; + github = "hardselius"; + githubId = 1422583; + name = "Martin Hardselius"; + keys = [{ + longkeyid = "rsa4096/0x03A6E6F786936619"; + fingerprint = "3F35 E4CA CBF4 2DE1 2E90 53E5 03A6 E6F7 8693 6619"; + }]; + }; + haslersn = { + email = "haslersn@fius.informatik.uni-stuttgart.de"; + github = "haslersn"; + githubId = 33969028; + name = "Sebastian Hasler"; + }; + havvy = { + email = "ryan.havvy@gmail.com"; + github = "havvy"; + githubId = 731722; + name = "Ryan Scheel"; + }; + hawkw = { + email = "eliza@elizas.website"; + github = "hawkw"; + githubId = 2796466; + name = "Eliza Weisman"; + }; + hax404 = { + email = "hax404foogit@hax404.de"; + matrix = "@hax404:hax404.de"; + github = "hax404"; + githubId = 1379411; + name = "Georg Haas"; + }; + hbunke = { + email = "bunke.hendrik@gmail.com"; + github = "hbunke"; + githubId = 1768793; + name = "Hendrik Bunke"; + }; + hce = { + email = "hc@hcesperer.org"; + github = "hce"; + githubId = 147689; + name = "Hans-Christian Esperer"; + }; + hdhog = { + name = "Serg Larchenko"; + email = "hdhog@hdhog.ru"; + github = "hdhog"; + githubId = 386666; + keys = [{ + longkeyid = "rsa496/952EACB76703BA63"; + fingerprint = "A25F 6321 AAB4 4151 4085 9924 952E ACB7 6703 BA63"; + }]; + }; + hectorj = { + email = "hector.jusforgues+nixos@gmail.com"; + github = "hectorj"; + githubId = 2427959; + name = "Hector Jusforgues"; + }; + hedning = { + email = "torhedinbronner@gmail.com"; + github = "hedning"; + githubId = 71978; + name = "Tor Hedin Brønner"; + }; + heel = { + email = "parizhskiy@gmail.com"; + github = "heel"; + githubId = 287769; + name = "Sergii Paryzhskyi"; + }; + helkafen = { + email = "arnaudpourseb@gmail.com"; + github = "Helkafen"; + githubId = 2405974; + name = "Sébastian Méric de Bellefon"; + }; + henkkalkwater = { + email = "chris+nixpkgs@netsoj.nl"; + github = "HenkKalkwater"; + githubId = 4262067; + matrix = "@chris:netsoj.nl"; + name = "Chris Josten"; + }; + henrikolsson = { + email = "henrik@fixme.se"; + github = "henrikolsson"; + githubId = 982322; + name = "Henrik Olsson"; + }; + henrytill = { + email = "henrytill@gmail.com"; + github = "henrytill"; + githubId = 6430643; + name = "Henry Till"; + }; + heph2 = { + email = "srht@mrkeebs.eu"; + github = "heph2"; + githubId = 87579883; + name = "Marco"; + }; + herberteuler = { + email = "herberteuler@gmail.com"; + github = "herberteuler"; + githubId = 1401179; + name = "Guanpeng Xu"; + }; + hexa = { + email = "hexa@darmstadt.ccc.de"; + matrix = "@hexa:lossy.network"; + github = "mweinelt"; + githubId = 131599; + name = "Martin Weinelt"; + }; + hexagonal-sun = { + email = "dev@mattleach.net"; + github = "hexagonal-sun"; + githubId = 222664; + name = "Matthew Leach"; + }; + hh = { + email = "hh@m-labs.hk"; + github = "HarryMakes"; + githubId = 66358631; + name = "Harry Ho"; + }; + hhm = { + email = "heehooman+nixpkgs@gmail.com"; + github = "hhm0"; + githubId = 3656888; + name = "hhm"; + }; + higebu = { + name = "Yuya Kusakabe"; + email = "yuya.kusakabe@gmail.com"; + github = "higebu"; + githubId = 733288; + }; + hiljusti = { + name = "J.R. Hill"; + email = "hiljusti@so.dang.cool"; + github = "hiljusti"; + githubId = 17605298; + }; + hinton = { + email = "t@larkery.com"; + name = "Tom Hinton"; + }; + hirenashah = { + email = "hiren@hiren.io"; + github = "hirenashah"; + githubId = 19825977; + name = "Hiren Shah"; + }; + hiro98 = { + email = "hiro@protagon.space"; + github = "vale981"; + githubId = 4025991; + name = "Valentin Boettcher"; + keys = [{ + longkeyid = "rsa2048/0xC22D4DE4D7B32D19"; + fingerprint = "45A9 9917 578C D629 9F5F B5B4 C22D 4DE4 D7B3 2D19"; + }]; + }; + hjones2199 = { + email = "hjones2199@gmail.com"; + github = "hjones2199"; + githubId = 5525217; + name = "Hunter Jones"; + }; + hkjn = { + email = "me@hkjn.me"; + name = "Henrik Jonsson"; + github = "hkjn"; + githubId = 287215; + keys = [{ + longkeyid = "rsa4096/0x03EFBF839A5FDC15"; + fingerprint = "D618 7A03 A40A 3D56 62F5 4B46 03EF BF83 9A5F DC15"; + }]; + }; + hleboulanger = { + email = "hleboulanger@protonmail.com"; + name = "Harold Leboulanger"; + github = "thbkrhsw"; + githubId = 33122; + }; + hlolli = { + email = "hlolli@gmail.com"; + github = "hlolli"; + githubId = 6074754; + name = "Hlodver Sigurdsson"; + }; + hugoreeves = { + email = "hugo@hugoreeves.com"; + github = "hugoreeves"; + githubId = 20039091; + name = "Hugo Reeves"; + keys = [{ + longkeyid = "rsa4096/0x49FA39F8A7F735F9"; + fingerprint = "78C2 E81C 828A 420B 269A EBC1 49FA 39F8 A7F7 35F9"; + }]; + }; + humancalico = { + email = "humancalico@disroot.org"; + github = "humancalico"; + githubId = 51334444; + name = "Akshat Agarwal"; + }; + hodapp = { + email = "hodapp87@gmail.com"; + github = "Hodapp87"; + githubId = 896431; + name = "Chris Hodapp"; + }; + hollowman6 = { + email = "hollowman@hollowman.ml"; + github = "HollowMan6"; + githubId = 43995067; + name = "Songlin Jiang"; + }; + holymonson = { + email = "holymonson@gmail.com"; + github = "holymonson"; + githubId = 902012; + name = "Monson Shao"; + }; + hongchangwu = { + email = "wuhc85@gmail.com"; + github = "hongchangwu"; + githubId = 362833; + name = "Hongchang Wu"; + }; + hoppla20 = { + email = "privat@vincentcui.de"; + github = "hoppla20"; + githubId = 25618740; + name = "Vincent Cui"; + }; + hoverbear = { + email = "operator+nix@hoverbear.org"; + matrix = "@hoverbear:matrix.org"; + github = "hoverbear"; + githubId = 130903; + name = "Ana Hobden"; + }; + holgerpeters = { + name = "Holger Peters"; + email = "holger.peters@posteo.de"; + github = "HolgerPeters"; + githubId = 4097049; + }; + hqurve = { + email = "hqurve@outlook.com"; + github = "hqurve"; + githubId = 53281855; + name = "hqurve"; + }; + hrdinka = { + email = "c.nix@hrdinka.at"; + github = "hrdinka"; + githubId = 1436960; + name = "Christoph Hrdinka"; + }; + hrhino = { + email = "hora.rhino@gmail.com"; + github = "hrhino"; + githubId = 28076058; + name = "Harrison Houghton"; + }; + hschaeidt = { + email = "he.schaeidt@gmail.com"; + github = "hschaeidt"; + githubId = 1614615; + name = "Hendrik Schaeidt"; + }; + htr = { + email = "hugo@linux.com"; + github = "htr"; + githubId = 39689; + name = "Hugo Tavares Reis"; + }; + hugolgst = { + email = "hugo.lageneste@pm.me"; + github = "hugolgst"; + githubId = 15371828; + name = "Hugo Lageneste"; + }; + hypersw = { + email = "baltic@hypersw.net"; + github = "hypersw"; + githubId = 2332070; + name = "Serge Baltic"; + }; + hyphon81 = { + email = "zero812n@gmail.com"; + github = "hyphon81"; + githubId = 12491746; + name = "Masato Yonekawa"; + }; + hyshka = { + name = "Bryan Hyshka"; + email = "bryan@hyshka.com"; + github = "hyshka"; + githubId = 2090758; + keys = [{ + longkeyid = "rsa2048/0xDB2D93D1BFAAA6EA"; + fingerprint = "24F4 1925 28C4 8797 E539 F247 DB2D 93D1 BFAA A6EA"; + }]; + }; + hyzual = { + email = "hyzual@gmail.com"; + github = "Hyzual"; + githubId = 2051507; + name = "Joris Masson"; + }; + hzeller = { + email = "h.zeller@acm.org"; + github = "hzeller"; + githubId = 140937; + name = "Henner Zeller"; + }; + i077 = { + email = "nixpkgs@imranhossa.in"; + github = "i077"; + githubId = 2789926; + name = "Imran Hossain"; + }; + iagoq = { + email = "18238046+iagocq@users.noreply.github.com"; + github = "iagocq"; + githubId = 18238046; + name = "Iago Manoel Brito"; + keys = [{ + longkeyid = "rsa4096/0x35D39F9A9A1BC8DA"; + fingerprint = "DF90 9D58 BEE4 E73A 1B8C 5AF3 35D3 9F9A 9A1B C8DA"; + }]; + }; + iammrinal0 = { + email = "nixpkgs@mrinalpurohit.in"; + matrix = "@iammrinal0:nixos.dev"; + github = "iammrinal0"; + githubId = 890062; + name = "Mrinal"; + }; + iand675 = { + email = "ian@iankduncan.com"; + github = "iand675"; + githubId = 69209; + name = "Ian Duncan"; + }; + ianmjones = { + email = "ian@ianmjones.com"; + github = "ianmjones"; + githubId = 4710; + name = "Ian M. Jones"; + }; + ianwookim = { + email = "ianwookim@gmail.com"; + github = "wavewave"; + githubId = 1031119; + name = "Ian-Woo Kim"; + }; + iblech = { + email = "iblech@speicherleck.de"; + github = "iblech"; + githubId = 3661115; + name = "Ingo Blechschmidt"; + }; + icy-thought = { + name = "Icy-Thought"; + email = "gilganyx@pm.me"; + matrix = "@gilganix:matrix.org"; + github = "Icy-Thought"; + githubId = 53710398; + }; + idontgetoutmuch = { + email = "dominic@steinitz.org"; + github = "idontgetoutmuch"; + githubId = 1550265; + name = "Dominic Steinitz"; + }; + igsha = { + email = "igor.sharonov@gmail.com"; + github = "igsha"; + githubId = 5345170; + name = "Igor Sharonov"; + }; + iimog = { + email = "iimog@iimog.org"; + github = "iimog"; + githubId = 7403236; + name = "Markus J. Ankenbrand"; + }; + ikervagyok = { + email = "ikervagyok@gmail.com"; + github = "ikervagyok"; + githubId = 7481521; + name = "Balázs Lengyel"; + }; + ilian = { + email = "ilian@tuta.io"; + github = "ilian"; + githubId = 25505957; + name = "Ilian"; + }; + ilikeavocadoes = { + email = "ilikeavocadoes@hush.com"; + github = "ilikeavocadoes"; + githubId = 36193715; + name = "Lassi Haasio"; + }; + ilkecan = { + email = "ilkecan@protonmail.com"; + matrix = "@ilkecan:matrix.org"; + github = "ilkecan"; + githubId = 40234257; + name = "ilkecan bozdogan"; + }; + illegalprime = { + email = "themichaeleden@gmail.com"; + github = "illegalprime"; + githubId = 4401220; + name = "Michael Eden"; + }; + illiusdope = { + email = "mat@marini.ca"; + github = "illiusdope"; + githubId = 61913481; + name = "Mat Marini"; + }; + illustris = { + email = "me@illustris.tech"; + github = "illustris"; + githubId = 3948275; + name = "Harikrishnan R"; + }; + ilya-fedin = { + email = "fedin-ilja2010@ya.ru"; + github = "ilya-fedin"; + githubId = 17829319; + name = "Ilya Fedin"; + }; + ilya-kolpakov = { + email = "ilya.kolpakov@gmail.com"; + github = "ilya-kolpakov"; + githubId = 592849; + name = "Ilya Kolpakov"; + }; + ilyakooo0 = { + name = "Ilya Kostyuchenko"; + email = "ilyakooo0@gmail.com"; + github = "ilyakooo0"; + githubId = 6209627; + }; + imalison = { + email = "IvanMalison@gmail.com"; + github = "IvanMalison"; + githubId = 1246619; + name = "Ivan Malison"; + }; + imalsogreg = { + email = "imalsogreg@gmail.com"; + github = "imalsogreg"; + githubId = 993484; + name = "Greg Hale"; + }; + imgabe = { + email = "gabrielpmonte@hotmail.com"; + github = "imgabe"; + githubId = 24387926; + name = "Gabriel Pereira"; + }; + imlonghao = { + email = "nixos@esd.cc"; + github = "imlonghao"; + githubId = 4951333; + name = "Hao Long"; + }; + immae = { + email = "ismael@bouya.org"; + matrix = "@immae:immae.eu"; + github = "immae"; + githubId = 510202; + name = "Ismaël Bouya"; + }; + imuli = { + email = "i@imu.li"; + github = "imuli"; + githubId = 4085046; + name = "Imuli"; + }; + ineol = { + email = "leo.stefanesco@gmail.com"; + github = "ineol"; + githubId = 37965; + name = "Léo Stefanesco"; + }; + infinisil = { + email = "contact@infinisil.com"; + matrix = "@infinisil:matrix.org"; + github = "infinisil"; + githubId = 20525370; + name = "Silvan Mosberger"; + keys = [{ + longkeyid = "rsa4096/0x422E9EDAE0157170"; + fingerprint = "6C2B 55D4 4E04 8266 6B7D DA1A 422E 9EDA E015 7170"; + }]; + }; + ingenieroariel = { + email = "ariel@nunez.co"; + github = "ingenieroariel"; + githubId = 54999; + name = "Ariel Nunez"; + }; + irenes = { + name = "Irene Knapp"; + email = "ireneista@gmail.com"; + matrix = "@irenes:matrix.org"; + github = "IreneKnapp"; + githubId = 157678; + keys = [{ + longkeyid = "rsa4096/0xDBF252AFFB2619FD"; + fingerprint = "E864 BDFA AB55 36FD C905 5195 DBF2 52AF FB26 19FD"; + }]; + }; + ironpinguin = { + email = "michele@catalano.de"; + github = "ironpinguin"; + githubId = 137306; + name = "Michele Catalano"; + }; + isgy = { + name = "isgy"; + email = "isgy@teiyg.com"; + github = "isgy"; + githubId = 13622947; + keys = [{ + longkeyid = "rsa4096/0xD3E1B013B4631293"; + fingerprint = "1412 816B A9FA F62F D051 1975 D3E1 B013 B463 1293"; + }]; + }; + ius = { + email = "j.de.gram@gmail.com"; + name = "Joerie de Gram"; + matrix = "@ius:nltrix.net"; + github = "ius"; + githubId = 529626; + }; + ivan = { + email = "ivan@ludios.org"; + github = "ivan"; + githubId = 4458; + name = "Ivan Kozik"; + }; + ivan-babrou = { + email = "nixpkgs@ivan.computer"; + name = "Ivan Babrou"; + github = "bobrik"; + githubId = 89186; + }; + ivan-timokhin = { + email = "nixpkgs@ivan.timokhin.name"; + name = "Ivan Timokhin"; + github = "ivan-timokhin"; + githubId = 9802104; + }; + ivan-tkatchev = { + email = "tkatchev@gmail.com"; + name = "Ivan Tkatchev"; + }; + ivanbrennan = { + email = "ivan.brennan@gmail.com"; + github = "ivanbrennan"; + githubId = 1672874; + name = "Ivan Brennan"; + keys = [{ + longkeyid = "rsa4096/0x79C3C47DC652EA54"; + fingerprint = "7311 2700 AB4F 4CDF C68C F6A5 79C3 C47D C652 EA54"; + }]; + }; + ivankovnatsky = { + email = "75213+ivankovnatsky@users.noreply.github.com"; + github = "ivankovnatsky"; + githubId = 75213; + name = "Ivan Kovnatsky"; + keys = [{ + longkeyid = "rsa4096/0x3A33FA4C82ED674F"; + fingerprint = "6BD3 7248 30BD 941E 9180 C1A3 3A33 FA4C 82ED 674F"; + }]; + }; + ivar = { + email = "ivar.scholten@protonmail.com"; + github = "IvarWithoutBones"; + githubId = 41924494; + name = "Ivar"; + }; + ixmatus = { + email = "parnell@digitalmentat.com"; + github = "ixmatus"; + githubId = 30714; + name = "Parnell Springmeyer"; + }; + ixxie = { + email = "matan@fluxcraft.net"; + github = "ixxie"; + githubId = 20320695; + name = "Matan Bendix Shenhav"; + }; + izorkin = { + email = "Izorkin@gmail.com"; + github = "izorkin"; + githubId = 26877687; + name = "Yurii Izorkin"; + }; + j0xaf = { + email = "j0xaf@j0xaf.de"; + name = "Jörn Gersdorf"; + github = "j0xaf"; + githubId = 932697; + }; + j0hax = { + name = "Johannes Arnold"; + email = "johannes.arnold@stud.uni-hannover.de"; + github = "j0hax"; + githubId = 3802620; + }; + j4m3s = { + name = "James Landrein"; + email = "github@j4m3s.eu"; + github = "j4m3s-s"; + githubId = 9413812; + }; + jacg = { + name = "Jacek Generowicz"; + email = "jacg@my-post-office.net"; + github = "jacg"; + githubId = 2570854; + }; + jasoncarr = { + email = "jcarr250@gmail.com"; + github = "jasoncarr0"; + githubId = 6874204; + name = "Jason Carr"; + }; + j-brn = { + email = "me@bricker.io"; + github = "j-brn"; + githubId = 40566146; + name = "Jonas Braun"; + }; + j-hui = { + email = "j-hui@cs.columbia.edu"; + github = "j-hui"; + githubId = 11800204; + name = "John Hui"; + }; + j-keck = { + email = "jhyphenkeck@gmail.com"; + github = "j-keck"; + githubId = 3081095; + name = "Jürgen Keck"; + }; + j03 = { + email = "github@johannesloetzsch.de"; + github = "johannesloetzsch"; + githubId = 175537; + name = "Johannes Lötzsch"; + }; + jackgerrits = { + email = "jack@jackgerrits.com"; + github = "jackgerrits"; + githubId = 7558482; + name = "Jack Gerrits"; + }; + jagajaga = { + email = "ars.seroka@gmail.com"; + github = "jagajaga"; + githubId = 2179419; + name = "Arseniy Seroka"; + }; + jakeisnt = { + name = "Jacob Chvatal"; + email = "jake@isnt.online"; + github = "jakeisnt"; + githubId = 29869612; + }; + jakelogemann = { + email = "jake.logemann@gmail.com"; + github = "jakelogemann"; + githubId = 820715; + name = "Jake Logemann"; + }; + jakestanger = { + email = "mail@jstanger.dev"; + github = "JakeStanger"; + githubId = 5057870; + name = "Jake Stanger"; + }; + jakewaksbaum = { + email = "jake.waksbaum@gmail.com"; + github = "jbaum98"; + githubId = 5283991; + name = "Jake Waksbaum"; + }; + jakubgs = { + email = "jakub@gsokolowski.pl"; + github = "jakubgs"; + githubId = 2212681; + name = "Jakub Grzgorz Sokołowski"; + }; + jamiemagee = { + email = "jamie.magee@gmail.com"; + github = "JamieMagee"; + githubId = 1358764; + name = "Jamie Magee"; + }; + jammerful = { + email = "jammerful@gmail.com"; + github = "jammerful"; + githubId = 20176306; + name = "jammerful"; + }; + jansol = { + email = "jan.solanti@paivola.fi"; + github = "jansol"; + githubId = 2588851; + name = "Jan Solanti"; + }; + jappie = { + email = "jappieklooster@hotmail.com"; + github = "jappeace"; + githubId = 3874017; + name = "Jappie Klooster"; + }; + javaguirre = { + email = "contacto@javaguirre.net"; + github = "javaguirre"; + githubId = 488556; + name = "Javier Aguirre"; + }; + jb55 = { + email = "jb55@jb55.com"; + github = "jb55"; + githubId = 45598; + name = "William Casarin"; + }; + jbcrail = { + name = "Joseph Crail"; + email = "jbcrail@gmail.com"; + github = "jbcrail"; + githubId = 6038; + }; + jbedo = { + email = "cu@cua0.org"; + matrix = "@jb:vk3.wtf"; + github = "jbedo"; + githubId = 372912; + name = "Justin Bedő"; + }; + jbgi = { + email = "jb@giraudeau.info"; + github = "jbgi"; + githubId = 221929; + name = "Jean-Baptiste Giraudeau"; + }; + jc = { + name = "Josh Cooper"; + email = "josh@cooper.is"; + github = "joshua-cooper"; + githubId = 35612334; + }; + jceb = { + name = "jceb"; + email = "jceb@e-jc.de"; + github = "jceb"; + githubId = 101593; + }; + jchw = { + email = "johnwchadwick@gmail.com"; + github = "jchv"; + githubId = 938744; + name = "John Chadwick"; + }; + jcouyang = { + email = "oyanglulu@gmail.com"; + github = "jcouyang"; + githubId = 1235045; + name = "Jichao Ouyang"; + keys = [{ + longkeyid = "rsa2048/0xDA8B833B52604E63"; + fingerprint = "A506 C38D 5CC8 47D0 DF01 134A DA8B 833B 5260 4E63"; + }]; + }; + jcumming = { + email = "jack@mudshark.org"; + github = "jcumming"; + githubId = 1982341; + name = "Jack Cummings"; + }; + jdagilliland = { + email = "jdagilliland@gmail.com"; + github = "jdagilliland"; + githubId = 1383440; + name = "Jason Gilliland"; + }; + jdahm = { + email = "johann.dahm@gmail.com"; + github = "jdahm"; + githubId = 68032; + name = "Johann Dahm"; + }; + jdanek = { + email = "jdanek@redhat.com"; + github = "jdanekrh"; + githubId = 17877663; + keys = [{ + longkeyid = "ed25519/0x69275CADF15D872E"; + fingerprint = "D4A6 F051 AD58 2E7C BCED 5439 6927 5CAD F15D 872E"; + }]; + name = "Jiri Daněk"; + }; + jdbaldry = { + email = "jack.baldry@grafana.com"; + github = "jdbaldry"; + githubId = 4599384; + name = "Jack Baldry"; + }; + jdehaas = { + email = "qqlq@nullptr.club"; + github = "jeroendehaas"; + githubId = 117874; + name = "Jeroen de Haas"; + }; + jdreaver = { + email = "johndreaver@gmail.com"; + github = "jdreaver"; + githubId = 1253071; + name = "David Reaver"; + }; + jduan = { + name = "Jingjing Duan"; + email = "duanjingjing@gmail.com"; + github = "jduan"; + githubId = 452450; + }; + jdupak = { + name = "Jakub Dupak"; + email = "dev@jakubdupak.com"; + github = "jdupak"; + githubId = 22683640; + }; + jecaro = { + email = "jeancharles.quillet@gmail.com"; + github = "jecaro"; + githubId = 17029738; + name = "Jean-Charles Quillet"; + }; + jefdaj = { + email = "jefdaj@gmail.com"; + github = "jefdaj"; + githubId = 1198065; + name = "Jeffrey David Johnson"; + }; + jefflabonte = { + email = "grimsleepless@protonmail.com"; + github = "jefflabonte"; + githubId = 9425955; + name = "Jean-François Labonté"; + }; + jensbin = { + email = "jensbin+git@pm.me"; + github = "jensbin"; + githubId = 1608697; + name = "Jens Binkert"; + }; + jeremyschlatter = { + email = "github@jeremyschlatter.com"; + github = "jeremyschlatter"; + githubId = 5741620; + name = "Jeremy Schlatter"; + }; + jerith666 = { + email = "github@matt.mchenryfamily.org"; + github = "jerith666"; + githubId = 854319; + name = "Matt McHenry"; + }; + jeschli = { + email = "jeschli@gmail.com"; + github = "Jeschli"; + githubId = 10786794; + name = "Markus Hihn"; + }; + jethro = { + email = "jethrokuan95@gmail.com"; + github = "jethrokuan"; + githubId = 1667473; + name = "Jethro Kuan"; + }; + jfb = { + email = "james@yamtime.com"; + github = "tftio"; + githubId = 143075; + name = "James Felix Black"; + }; + jfchevrette = { + email = "jfchevrette@gmail.com"; + github = "jfchevrette"; + githubId = 3001; + name = "Jean-Francois Chevrette"; + keys = [{ + longkeyid = "rsa4096/0x67A0585801290DC6"; + fingerprint = "B612 96A9 498E EECD D5E9 C0F0 67A0 5858 0129 0DC6"; + }]; + }; + jflanglois = { + email = "yourstruly@julienlanglois.me"; + github = "jflanglois"; + githubId = 18501; + name = "Julien Langlois"; + }; + jfrankenau = { + email = "johannes@frankenau.net"; + github = "jfrankenau"; + githubId = 2736480; + name = "Johannes Frankenau"; + }; + jfroche = { + name = "Jean-François Roche"; + email = "jfroche@pyxel.be"; + matrix = "@jfroche:matrix.pyxel.cloud"; + github = "jfroche"; + githubId = 207369; + keys = [{ + longkeyid = "dsa1024/0xD1D09DE169EA19A0"; + fingerprint = "7EB1 C02A B62B B464 6D7C E4AE D1D0 9DE1 69EA 19A0"; + }]; + }; + jgart = { + email = "jgart@dismail.de"; + github = "jgarte"; + githubId = 47760695; + name = "Jorge Gomez"; + }; + jgeerds = { + email = "jascha@geerds.org"; + github = "jgeerds"; + githubId = 1473909; + name = "Jascha Geerds"; + }; + jgertm = { + email = "jger.tm@gmail.com"; + github = "jgertm"; + githubId = 6616642; + name = "Tim Jaeger"; + }; + jgillich = { + email = "jakob@gillich.me"; + github = "jgillich"; + githubId = 347965; + name = "Jakob Gillich"; + }; + jglukasik = { + email = "joseph@jgl.me"; + github = "jglukasik"; + githubId = 6445082; + name = "Joseph Lukasik"; + }; + jhhuh = { + email = "jhhuh.note@gmail.com"; + github = "jhhuh"; + githubId = 5843245; + name = "Ji-Haeng Huh"; + }; + jhillyerd = { + email = "james+nixos@hillyerd.com"; + github = "jhillyerd"; + githubId = 2502736; + name = "James Hillyerd"; + }; + jiehong = { + email = "nixos@majiehong.com"; + github = "Jiehong"; + githubId = 1061229; + name = "Jiehong Ma"; + }; + jirkamarsik = { + email = "jiri.marsik89@gmail.com"; + github = "jirkamarsik"; + githubId = 184898; + name = "Jirka Marsik"; + }; + jitwit = { + email = "jrn@bluefarm.ca"; + github = "jitwit"; + githubId = 51518420; + name = "jitwit"; + }; + jjjollyjim = { + email = "jamie@kwiius.com"; + github = "JJJollyjim"; + githubId = 691552; + name = "Jamie McClymont"; + }; + jk = { + email = "hello+nixpkgs@j-k.io"; + matrix = "@j-k:matrix.org"; + github = "06kellyjac"; + githubId = 9866621; + name = "Jack"; + }; + jkarlson = { + email = "jekarlson@gmail.com"; + github = "jkarlson"; + githubId = 1204734; + name = "Emil Karlson"; + }; + jlesquembre = { + email = "jl@lafuente.me"; + github = "jlesquembre"; + githubId = 1058504; + name = "José Luis Lafuente"; + }; + jloyet = { + email = "ml@fatbsd.com"; + github = "fatpat"; + githubId = 822436; + name = "Jérôme Loyet"; + }; + jluttine = { + email = "jaakko.luttinen@iki.fi"; + github = "jluttine"; + githubId = 2195834; + name = "Jaakko Luttinen"; + }; + jm2dev = { + email = "jomarcar@gmail.com"; + github = "jm2dev"; + githubId = 474643; + name = "José Miguel Martínez Carrasco"; + }; + jmagnusj = { + email = "jmagnusj@gmail.com"; + github = "magnusjonsson"; + githubId = 8900; + name = "Johan Magnus Jonsson"; + }; + jmc-figueira = { + email = "business+nixos@jmc-figueira.dev"; + github = "jmc-figueira"; + githubId = 6634716; + name = "João Figueira"; + keys = [ + # GitHub signing key + { + longkeyid = "rsa4096/0xDC7AE56AE98E02D7"; + fingerprint = "EC08 7AA3 DEAD A972 F015 6371 DC7A E56A E98E 02D7"; + } + # Email encryption + { + longkeyid = "ed25519/0x197F9A632D139E30"; + fingerprint = "816D 23F5 E672 EC58 7674 4A73 197F 9A63 2D13 9E30"; + } + ]; + }; + jmettes = { + email = "jonathan@jmettes.com"; + github = "jmettes"; + githubId = 587870; + name = "Jonathan Mettes"; + }; + jo1gi = { + email = "joakimholm@protonmail.com"; + github = "jo1gi"; + githubId = 26695750; + name = "Joakim Holm"; + }; + joachifm = { + email = "joachifm@fastmail.fm"; + github = "joachifm"; + githubId = 41977; + name = "Joachim Fasting"; + }; + joachimschmidt557 = { + email = "joachim.schmidt557@outlook.com"; + github = "joachimschmidt557"; + githubId = 28556218; + name = "Joachim Schmidt"; + }; + joamaki = { + email = "joamaki@gmail.com"; + github = "joamaki"; + githubId = 1102396; + name = "Jussi Maki"; + }; + jobojeha = { + email = "jobojeha@jeppener.de"; + github = "jobojeha"; + githubId = 60272884; + name = "Jonathan Jeppener-Haltenhoff"; + }; + joelancaster = { + email = "joe.a.lancas@gmail.com"; + github = "joelancaster"; + githubId = 16760945; + name = "Joe Lancaster"; + }; + joelburget = { + email = "joelburget@gmail.com"; + github = "joelburget"; + githubId = 310981; + name = "Joel Burget"; + }; + joelmo = { + email = "joel.moberg@gmail.com"; + github = "joelmo"; + githubId = 336631; + name = "Joel Moberg"; + }; + joelteon = { + email = "me@joelt.io"; + name = "Joel Taylor"; + }; + joepie91 = { + email = "admin@cryto.net"; + matrix = "@joepie91:pixie.town"; + name = "Sven Slootweg"; + github = "joepie91"; + githubId = 1663259; + }; + joesalisbury = { + email = "salisbury.joseph@gmail.com"; + github = "JosephSalisbury"; + githubId = 297653; + name = "Joe Salisbury"; + }; + johanot = { + email = "write@ownrisk.dk"; + github = "johanot"; + githubId = 998763; + name = "Johan Thomsen"; + }; + johbo = { + email = "johannes@bornhold.name"; + github = "johbo"; + githubId = 117805; + name = "Johannes Bornhold"; + }; + johnazoidberg = { + email = "git@danielschaefer.me"; + github = "johnazoidberg"; + githubId = 5307138; + name = "Daniel Schäfer"; + }; + johnchildren = { + email = "john.a.children@gmail.com"; + github = "johnchildren"; + githubId = 32305209; + name = "John Children"; + }; + johnmh = { + email = "johnmh@openblox.org"; + github = "johnmh"; + githubId = 2576152; + name = "John M. Harris, Jr."; + }; + johnramsden = { + email = "johnramsden@riseup.net"; + github = "johnramsden"; + githubId = 8735102; + name = "John Ramsden"; + }; + johnrichardrinehart = { + email = "johnrichardrinehart@gmail.com"; + github = "johnrichardrinehart"; + githubId = 6321578; + name = "John Rinehart"; + }; + johntitor = { + email = "huyuumi.dev@gmail.com"; + github = "JohnTitor"; + githubId = 25030997; + name = "Yuki Okushi"; + }; + jojosch = { + name = "Johannes Schleifenbaum"; + email = "johannes@js-webcoding.de"; + matrix = "@jojosch:jswc.de"; + github = "jojosch"; + githubId = 327488; + keys = [{ + longkeyid = "ed25519/059093B1A278BCD0"; + fingerprint = "7249 70E6 A661 D84E 8B47 678A 0590 93B1 A278 BCD0"; + }]; + }; + joko = { + email = "ioannis.koutras@gmail.com"; + github = "jokogr"; + githubId = 1252547; + keys = [{ + # compare with https://keybase.io/joko + longkeyid = "rsa2048/0x85EAE7D9DF56C5CA"; + fingerprint = "B154 A8F9 0610 DB45 0CA8 CF39 85EA E7D9 DF56 C5CA"; + }]; + name = "Ioannis Koutras"; + }; + jonafato = { + email = "jon@jonafato.com"; + github = "jonafato"; + githubId = 392720; + name = "Jon Banafato"; + }; + jonathanmarler = { + email = "johnnymarler@gmail.com"; + github = "marler8997"; + githubId = 304904; + name = "Jonathan Marler"; + }; + jonathanreeve = { + email = "jon.reeve@gmail.com"; + github = "JonathanReeve"; + githubId = 1843676; + name = "Jonathan Reeve"; + }; + jonringer = { + email = "jonringer117@gmail.com"; + matrix = "@jonringer:matrix.org"; + github = "jonringer"; + githubId = 7673602; + name = "Jonathan Ringer"; + }; + jorise = { + email = "info@jorisengbers.nl"; + github = "JorisE"; + githubId = 1767283; + name = "Joris Engbers"; + }; + jorsn = { + name = "Johannes Rosenberger"; + email = "johannes@jorsn.eu"; + github = "jorsn"; + githubId = 4646725; + }; + joshuafern = { + name = "Joshua Fern"; + email = "joshuafern@protonmail.com"; + github = "JoshuaFern"; + githubId = 4300747; + }; + jpas = { + name = "Jarrod Pas"; + email = "jarrod@jarrodpas.com"; + github = "jpas"; + githubId = 5689724; + }; + jpdoyle = { + email = "joethedoyle@gmail.com"; + github = "jpdoyle"; + githubId = 1918771; + name = "Joe Doyle"; + }; + jperras = { + email = "joel@nerderati.com"; + github = "jperras"; + githubId = 20675; + name = "Joël Perras"; + }; + jpetrucciani = { + email = "j@cobi.dev"; + github = "jpetrucciani"; + githubId = 8117202; + name = "Jacobi Petrucciani"; + }; + jpierre03 = { + email = "nix@prunetwork.fr"; + github = "jpierre03"; + githubId = 954536; + name = "Jean-Pierre PRUNARET"; + }; + jpotier = { + email = "jpo.contributes.to.nixos@marvid.fr"; + github = "jpotier"; + githubId = 752510; + name = "Martin Potier"; + }; + jqueiroz = { + email = "nixos@johnjq.com"; + github = "jqueiroz"; + githubId = 4968215; + name = "Jonathan Queiroz"; + }; + jraygauthier = { + email = "jraygauthier@gmail.com"; + github = "jraygauthier"; + githubId = 4611077; + name = "Raymond Gauthier"; + }; + jrpotter = { + email = "jrpotter2112@gmail.com"; + github = "jrpotter"; + githubId = 3267697; + name = "Joshua Potter"; + }; + jschievink = { + email = "jonasschievink@gmail.com"; + matrix = "@jschievink:matrix.org"; + github = "jonas-schievink"; + githubId = 1786438; + name = "Jonas Schievink"; + }; + jshcmpbll = { + email = "me@joshuadcampbell.com"; + github = "jshcmpbll"; + githubId = 16374374; + name = "Joshua Campbell"; + }; + jshholland = { + email = "josh@inv.alid.pw"; + github = "jshholland"; + githubId = 107689; + name = "Josh Holland"; + }; + jsierles = { + email = "joshua@hey.com"; + matrix = "@jsierles:matrix.org"; + name = "Joshua Sierles"; + github = "jsierles"; + githubId = 82; + }; + jtcoolen = { + email = "jtcoolen@pm.me"; + name = "Julien Coolen"; + github = "jtcoolen"; + githubId = 54635632; + keys = [{ + longkeyid = "rsa4096/0x19642151C218F6F5"; + fingerprint = "4C68 56EE DFDA 20FB 77E8 9169 1964 2151 C218 F6F5"; + }]; + }; + jtobin = { + email = "jared@jtobin.io"; + github = "jtobin"; + githubId = 1414434; + name = "Jared Tobin"; + }; + jtojnar = { + email = "jtojnar@gmail.com"; + matrix = "@jtojnar:matrix.org"; + github = "jtojnar"; + githubId = 705123; + name = "Jan Tojnar"; + }; + juaningan = { + email = "juaningan@gmail.com"; + github = "uningan"; + githubId = 810075; + name = "Juan Rodal"; + }; + juboba = { + email = "juboba@gmail.com"; + github = "juboba"; + githubId = 1189739; + name = "Julio Borja Barra"; + }; + juliendehos = { + email = "dehos@lisic.univ-littoral.fr"; + github = "juliendehos"; + githubId = 11947756; + name = "Julien Dehos"; + }; + julienmalka = { + email = "julien.malka@me.com"; + github = "JulienMalka"; + githubId = 1792886; + name = "Julien Malka"; + }; + julm = { + email = "julm+nixpkgs@sourcephile.fr"; + github = "ju1m"; + githubId = 21160136; + name = "Julien Moutinho"; + }; + jumper149 = { + email = "felixspringer149@gmail.com"; + github = "jumper149"; + githubId = 39434424; + name = "Felix Springer"; + }; + junjihashimoto = { + email = "junji.hashimoto@gmail.com"; + github = "junjihashimoto"; + githubId = 2469618; + name = "Junji Hashimoto"; + }; + justinas = { + email = "justinas@justinas.org"; + github = "justinas"; + githubId = 662666; + name = "Justinas Stankevičius"; + }; + justinlovinger = { + email = "git@justinlovinger.com"; + github = "JustinLovinger"; + githubId = 7183441; + name = "Justin Lovinger"; + }; + justinwoo = { + email = "moomoowoo@gmail.com"; + github = "justinwoo"; + githubId = 2396926; + name = "Justin Woo"; + }; + jvanbruegge = { + email = "supermanitu@gmail.com"; + github = "jvanbruegge"; + githubId = 1529052; + name = "Jan van Brügge"; + keys = [{ + longkeyid = "rsa4096/0x366572BE7D6C78A2"; + fingerprint = "3513 5CE5 77AD 711F 3825 9A99 3665 72BE 7D6C 78A2"; + }]; + }; + jwatt = { + email = "jwatt@broken.watch"; + github = "jjwatt"; + githubId = 2397327; + name = "Jesse Wattenbarger"; + }; + jwiegley = { + email = "johnw@newartisans.com"; + github = "jwiegley"; + githubId = 8460; + name = "John Wiegley"; + }; + jwijenbergh = { + email = "jeroenwijenbergh@protonmail.com"; + github = "jwijenbergh"; + githubId = 46386452; + name = "Jeroen Wijenbergh"; + }; + jwilberding = { + email = "jwilberding@afiniate.com"; + name = "Jordan Wilberding"; + }; + jwoudenberg = { + email = "nixpkgs@jasperwoudenberg.com"; + github = "jwoudenberg"; + githubId = 1525551; + name = "Jasper Woudenberg"; + }; + jwygoda = { + email = "jaroslaw@wygoda.me"; + github = "jwygoda"; + githubId = 20658981; + name = "Jarosław Wygoda"; + }; + jyooru = { + email = "joel@joel.tokyo"; + github = "jyooru"; + githubId = 63786778; + name = "Joel"; + keys = [{ + longkeyid = "rsa4096/18550BD205E9EF64"; + fingerprint = "9148 DC9E F4D5 3EB6 A30E 8EF0 1855 0BD2 05E9 EF64"; + }]; + }; + jyp = { + email = "jeanphilippe.bernardy@gmail.com"; + github = "jyp"; + githubId = 27747; + name = "Jean-Philippe Bernardy"; + }; + jzellner = { + email = "jeffz@eml.cc"; + github = "sofuture"; + githubId = 66669; + name = "Jeff Zellner"; + }; + k4leg = { + name = "k4leg"; + email = "python.bogdan@gmail.com"; + github = "k4leg"; + githubId = 39882583; + }; + k900 = { + name = "Ilya K."; + email = "me@0upti.me"; + github = "K900"; + githubId = 386765; + matrix = "@k900:0upti.me"; + }; + kaction = { + name = "Dmitry Bogatov"; + email = "KAction@disroot.org"; + github = "kaction"; + githubId = 44864956; + keys = [{ + longkeyid = "ed25519/0x749FD4DFA2E94236"; + fingerprint = "3F87 0A7C A7B4 3731 2F13 6083 749F D4DF A2E9 4236"; + }]; + }; + kaiha = { + email = "kai.harries@gmail.com"; + github = "kaiha"; + githubId = 6544084; + name = "Kai Harries"; + }; + kalbasit = { + email = "wael.nasreddine@gmail.com"; + matrix = "@kalbasit:matrix.org"; + github = "kalbasit"; + githubId = 87115; + name = "Wael Nasreddine"; + }; + kalekseev = { + email = "mail@kalekseev.com"; + github = "kalekseev"; + githubId = 367259; + name = "Konstantin Alekseev"; + }; + kamadorueda = { + name = "Kevin Amado"; + email = "kamadorueda@gmail.com"; + github = "kamadorueda"; + githubId = 47480384; + keys = [{ + longkeyid = "rsa4096/0x04D0CEAF916A9A40"; + fingerprint = "2BE3 BAFD 793E A349 ED1F F00F 04D0 CEAF 916A 9A40"; + }]; + }; + kamilchm = { + email = "kamil.chm@gmail.com"; + github = "kamilchm"; + githubId = 1621930; + name = "Kamil Chmielewski"; + }; + kampfschlaefer = { + email = "arnold@arnoldarts.de"; + github = "kampfschlaefer"; + githubId = 3831860; + name = "Arnold Krille"; + }; + kanashimia = { + email = "chad@redpilled.dev"; + github = "kanashimia"; + githubId = 56224949; + name = "Mia Kanashi"; + }; + karantan = { + name = "Gasper Vozel"; + email = "karantan@gmail.com"; + github = "karantan"; + githubId = 7062631; + }; + KarlJoad = { + email = "karl@hallsby.com"; + github = "KarlJoad"; + githubId = 34152449; + name = "Karl Hallsby"; + }; + karolchmist = { + email = "info+nix@chmist.com"; + name = "karolchmist"; + }; + kayhide = { + email = "kayhide@gmail.com"; + github = "kayhide"; + githubId = 1730718; + name = "Hideaki Kawai"; + }; + kazcw = { + email = "kaz@lambdaverse.org"; + github = "kazcw"; + githubId = 1047859; + name = "Kaz Wesley"; + }; + kcalvinalvin = { + email = "calvin@kcalvinalvin.info"; + github = "kcalvinalvin"; + githubId = 37185887; + name = "Calvin Kim"; + }; + keldu = { + email = "mail@keldu.de"; + github = "keldu"; + githubId = 15373888; + name = "Claudius Holeksa"; + }; + kennyballou = { + email = "kb@devnulllabs.io"; + github = "kennyballou"; + githubId = 2186188; + name = "Kenny Ballou"; + keys = [{ + longkeyid = "rsa4096/0xB0CAA28A02958308"; + fingerprint = "932F 3E8E 1C0F 4A98 95D7 B8B8 B0CA A28A 0295 8308"; + }]; + }; + kentjames = { + email = "jameschristopherkent@gmail.com"; + github = "kentjames"; + githubId = 2029444; + name = "James Kent"; + }; + ketzacoatl = { + email = "ketzacoatl@protonmail.com"; + github = "ketzacoatl"; + githubId = 10122937; + name = "ketzacoatl"; + }; + kevincox = { + email = "kevincox@kevincox.ca"; + matrix = "@kevincox:matrix.org"; + github = "kevincox"; + githubId = 494012; + name = "Kevin Cox"; + }; + kevingriffin = { + email = "me@kevin.jp"; + github = "kevingriffin"; + githubId = 209729; + name = "Kevin Griffin"; + }; + kevink = { + email = "kevin@kevink.dev"; + github = "Unkn0wnCat"; + githubId = 8211181; + name = "Kevin Kandlbinder"; + }; + kfollesdal = { + email = "kfollesdal@gmail.com"; + github = "kfollesdal"; + githubId = 546087; + name = "Kristoffer K. Føllesdal"; + }; + kho-dialga = { + email = "ivandashenyou@gmail.com"; + github = "kho-dialga"; + githubId = 55767703; + name = "Iván Brito"; + }; + khumba = { + email = "bog@khumba.net"; + github = "khumba"; + githubId = 788813; + name = "Bryan Gardiner"; + }; + khushraj = { + email = "khushraj.rathod@gmail.com"; + github = "KhushrajRathod"; + githubId = 44947946; + name = "Khushraj Rathod"; + keys = [{ + longkeyid = "rsa2048/0xB77B2A40E7702F19"; + fingerprint = "1988 3FD8 EA2E B4EC 0A93 1E22 B77B 2A40 E770 2F19"; + }]; + }; + KibaFox = { + email = "kiba.fox@foxypossibilities.com"; + github = "KibaFox"; + githubId = 16481032; + name = "Kiba Fox"; + }; + kidd = { + email = "raimonster@gmail.com"; + github = "kidd"; + githubId = 25607; + name = "Raimon Grau"; + }; + kidonng = { + email = "hi@xuann.wang"; + github = "kidonng"; + githubId = 44045911; + name = "Kid"; + }; + kierdavis = { + email = "kierdavis@gmail.com"; + github = "kierdavis"; + githubId = 845652; + name = "Kier Davis"; + }; + killercup = { + email = "killercup@gmail.com"; + github = "killercup"; + githubId = 20063; + name = "Pascal Hertleif"; + }; + kiloreux = { + email = "kiloreux@gmail.com"; + github = "kiloreux"; + githubId = 6282557; + name = "Kiloreux Emperex"; + }; + kim0 = { + email = "email.ahmedkamal@googlemail.com"; + github = "kim0"; + githubId = 59667; + name = "Ahmed Kamal"; + }; + kimat = { + email = "mail@kimat.org"; + github = "kimat"; + githubId = 3081769; + name = "Kimat Boven"; + }; + kimburgess = { + email = "kim@acaprojects.com"; + github = "kimburgess"; + githubId = 843652; + name = "Kim Burgess"; + }; + kini = { + email = "keshav.kini@gmail.com"; + github = "kini"; + githubId = 691290; + name = "Keshav Kini"; + }; + kirelagin = { + email = "kirelagin@gmail.com"; + matrix = "@kirelagin:matrix.org"; + github = "kirelagin"; + githubId = 451835; + name = "Kirill Elagin"; + }; + kirikaza = { + email = "k@kirikaza.ru"; + github = "kirikaza"; + githubId = 804677; + name = "Kirill Kazakov"; + }; + kisonecat = { + email = "kisonecat@gmail.com"; + github = "kisonecat"; + githubId = 148352; + name = "Jim Fowler"; + }; + kittywitch = { + email = "kat@kittywit.ch"; + github = "kittywitch"; + githubId = 67870215; + name = "kat witch"; + keys = [{ + longkeyid = "rsa4096/0x7248991EFA8EFBEE"; + fingerprint = "01F5 0A29 D4AA 9117 5A11 BDB1 7248 991E FA8E FBEE"; + }]; + }; + kiwi = { + email = "envy1988@gmail.com"; + github = "Kiwi"; + githubId = 35715; + name = "Robert Djubek"; + keys = [{ + longkeyid = "rsa4096/0x156C88A5B0A04B2A"; + fingerprint = "8992 44FC D291 5CA2 0A97 802C 156C 88A5 B0A0 4B2A"; + }]; + }; + kiyengar = { + email = "hello@kiyengar.net"; + github = "karthikiyengar"; + githubId = 8260207; + name = "Karthik Iyengar"; + }; + kjeremy = { + email = "kjeremy@gmail.com"; + name = "Jeremy Kolb"; + github = "kjeremy"; + githubId = 4325700; + }; + kkallio = { + email = "tierpluspluslists@gmail.com"; + name = "Karn Kallio"; + }; + klden = { + name = "Kenzyme Le"; + email = "kl@kenzymele.com"; + github = "klDen"; + githubId = 5478260; + }; + klntsky = { + email = "klntsky@gmail.com"; + name = "Vladimir Kalnitsky"; + github = "klntsky"; + githubId = 18447310; + }; + kloenk = { + email = "me@kloenk.dev"; + matrix = "@kloenk:petabyte.dev"; + name = "Finn Behrens"; + github = "kloenk"; + githubId = 12898828; + keys = [{ + longkeyid = "ed25519/0xB92445CFC9546F9D"; + fingerprint = "6881 5A95 D715 D429 659B 48A4 B924 45CF C954 6F9D"; + }]; + }; + kmcopper = { + email = "kmcopper@danwin1210.me"; + name = "Kyle Copperfield"; + github = "kmcopper"; + githubId = 57132115; + }; + kmeakin = { + email = "karlwfmeakin@gmail.com"; + name = "Karl Meakin"; + github = "Kmeakin"; + githubId = 19665139; + }; + + kmein = { + email = "kmein@posteo.de"; + name = "Kierán Meinhardt"; + github = "kmein"; + githubId = 10352507; + }; + kmicklas = { + email = "maintainer@kmicklas.com"; + name = "Ken Micklas"; + github = "kmicklas"; + githubId = 929096; + }; + knairda = { + email = "adrian@kummerlaender.eu"; + name = "Adrian Kummerlaender"; + github = "KnairdA"; + githubId = 498373; + }; + knedlsepp = { + email = "josef.kemetmueller@gmail.com"; + github = "knedlsepp"; + githubId = 3287933; + name = "Josef Kemetmüller"; + }; + knl = { + email = "nikola@knezevic.co"; + github = "knl"; + githubId = 361496; + name = "Nikola Knežević"; + }; + kolaente = { + email = "k@knt.li"; + github = "kolaente"; + githubId = 13721712; + name = "Konrad Langenberg"; + }; + kolbycrouch = { + email = "kjc.devel@gmail.com"; + github = "kolbycrouch"; + githubId = 6346418; + name = "Kolby Crouch"; + }; + kolloch = { + email = "info@eigenvalue.net"; + github = "kolloch"; + githubId = 339354; + name = "Peter Kolloch"; + }; + konimex = { + email = "herdiansyah@netc.eu"; + github = "konimex"; + githubId = 15692230; + name = "Muhammad Herdiansyah"; + }; + koozz = { + email = "koozz@linux.com"; + github = "koozz"; + githubId = 264372; + name = "Jan van den Berg"; + }; + koral = { + email = "koral@mailoo.org"; + github = "k0ral"; + githubId = 524268; + name = "Koral"; + }; + koslambrou = { + email = "koslambrou@gmail.com"; + github = "koslambrou"; + githubId = 2037002; + name = "Konstantinos"; + }; + kovirobi = { + email = "kovirobi@gmail.com"; + github = "kovirobi"; + githubId = 1903418; + name = "Kovacsics Robert"; + }; + kquick = { + email = "quick@sparq.org"; + github = "kquick"; + githubId = 787421; + name = "Kevin Quick"; + }; + kradalby = { + name = "Kristoffer Dalby"; + email = "kristoffer@dalby.cc"; + github = "kradalby"; + githubId = 98431; + }; + kraem = { + email = "me@kraem.xyz"; + github = "kraem"; + githubId = 26622971; + name = "Ronnie Ebrin"; + }; + kragniz = { + email = "louis@kragniz.eu"; + github = "kragniz"; + githubId = 735008; + name = "Louis Taylor"; + }; + kranzes = { + email = "personal@ilanjoselevich.com"; + github = "Kranzes"; + githubId = 56614642; + name = "Ilan Joselevich"; + }; + krav = { + email = "kristoffer@microdisko.no"; + github = "krav"; + githubId = 4032; + name = "Kristoffer Thømt Ravneberg"; + }; + kritnich = { + email = "kritnich@kritni.ch"; + github = "Kritnich"; + githubId = 22116767; + name = "Kritnich"; + }; + kroell = { + email = "nixosmainter@makroell.de"; + github = "rokk4"; + githubId = 17659803; + name = "Matthias Axel Kröll"; + }; + kristian-brucaj = { + email = "kbrucaj@gmail.com"; + github = "kristian-brucaj"; + githubId = 8893110; + name = "Kristian Brucaj"; + }; + kristoff3r = { + email = "k.soeholm@gmail.com"; + github = "kristoff3r"; + githubId = 160317; + name = "Kristoffer Søholm"; + }; + ktf = { + email = "giulio.eulisse@cern.ch"; + github = "ktf"; + githubId = 10544; + name = "Giuluo Eulisse"; + }; + kthielen = { + email = "kthielen@gmail.com"; + github = "kthielen"; + githubId = 1409287; + name = "Kalani Thielen"; + }; + ktor = { + email = "kruszewsky@gmail.com"; + github = "ktor"; + githubId = 99639; + name = "Pawel Kruszewski"; + }; + ktosiek = { + email = "tomasz.kontusz@gmail.com"; + github = "ktosiek"; + githubId = 278013; + name = "Tomasz Kontusz"; + }; + kubukoz = { + email = "kubukoz@gmail.com"; + github = "kubukoz"; + githubId = 894884; + name = "Jakub Kozłowski"; + }; + kurnevsky = { + email = "kurnevsky@gmail.com"; + github = "kurnevsky"; + githubId = 2943605; + name = "Evgeny Kurnevsky"; + }; + kuznero = { + email = "roman@kuznero.com"; + github = "kuznero"; + githubId = 449813; + name = "Roman Kuznetsov"; + }; + kvark = { + name = "Dzmitry Malyshau"; + email = "kvark@fastmail.com"; + matrix = "@kvark:matrix.org"; + github = "kvark"; + githubId = 107301; + }; + kwohlfahrt = { + email = "kai.wohlfahrt@gmail.com"; + github = "kwohlfahrt"; + githubId = 2422454; + name = "Kai Wohlfahrt"; + }; + kyleondy = { + email = "kyle@ondy.org"; + github = "kyleondy"; + githubId = 1640900; + name = "Kyle Ondy"; + keys = [{ + longkeyid = "rsa4096/0xDB0E3C33491F91C9"; + fingerprint = "3C79 9D26 057B 64E6 D907 B0AC DB0E 3C33 491F 91C9"; + }]; + }; + kylesferrazza = { + name = "Kyle Sferrazza"; + email = "nixpkgs@kylesferrazza.com"; + + github = "kylesferrazza"; + githubId = 6677292; + + keys = [{ + longkeyid = "rsa4096/81A1540948162372"; + fingerprint = "5A9A 1C9B 2369 8049 3B48 CF5B 81A1 5409 4816 2372"; + }]; + }; + l-as = { + email = "las@protonmail.ch"; + matrix = "@Las:matrix.org"; + github = "L-as"; + githubId = 22075344; + keys = [{ + longkeyid = "rsa2048/0xAC458A7D1087D025"; + fingerprint = "A093 EA17 F450 D4D1 60A0 1194 AC45 8A7D 1087 D025"; + }]; + name = "Las Safin"; + }; + l3af = { + email = "L3afMeAlon3@gmail.com"; + matrix = "@L3afMe:matrix.org"; + github = "L3afMe"; + githubId = 72546287; + name = "L3af"; + }; + lach = { + email = "iam@lach.pw"; + github = "CertainLach"; + githubId = 6235312; + keys = [{ + longkeyid = "rsa3072/40B5D6948143175F"; + fingerprint = "323C 95B5 DBF7 2D74 8570 C0B7 40B5 D694 8143 175F"; + }]; + name = "Yaroslav Bolyukin"; + }; + laikq = { + email = "gwen@quasebarth.de"; + github = "laikq"; + githubId = 55911173; + name = "Gwendolyn Quasebarth"; + }; + lammermann = { + email = "k.o.b.e.r@web.de"; + github = "lammermann"; + githubId = 695526; + name = "Benjamin Kober"; + }; + larsr = { + email = "Lars.Rasmusson@gmail.com"; + github = "larsr"; + githubId = 182024; + name = "Lars Rasmusson"; + }; + lasandell = { + email = "lasandell@gmail.com"; + github = "lasandell"; + githubId = 2034420; + name = "Luke Sandell"; + }; + lambda-11235 = { + email = "taranlynn0@gmail.com"; + github = "lambda-11235"; + githubId = 16354815; + name = "Taran Lynn"; + }; + lassulus = { + email = "lassulus@gmail.com"; + matrix = "@lassulus:nixos.dev"; + github = "Lassulus"; + githubId = 621759; + name = "Lassulus"; + }; + lattfein = { + email = "lattfein@gmail.com"; + # Their GitHub account was deleted. + # + # See: https://github.com/NixOS/nixpkgs/pull/69007 where this + # was added but is now owned by a ghost. + # + # Possibly the username lattfein (currently github ID 56827487) is + # owned by the same person, but we should confirm before adding + # the GitHub name or ID back. + # github = "lattfein"; + name = "Koki Yasuno"; + }; + layus = { + email = "layus.on@gmail.com"; + github = "layus"; + githubId = 632767; + name = "Guillaume Maudoux"; + }; + lblasc = { + email = "lblasc@znode.net"; + github = "lblasc"; + githubId = 32152; + name = "Luka Blaskovic"; + }; + lbpdt = { + email = "nix@pdtpartners.com"; + github = "lbpdt"; + githubId = 45168934; + name = "Louis Blin"; + }; + lucc = { + email = "lucc+nix@posteo.de"; + github = "lucc"; + githubId = 1104419; + name = "Lucas Hoffmann"; + }; + lucasew = { + email = "lucas59356@gmail.com"; + github = "lucasew"; + githubId = 15693688; + name = "Lucas Eduardo Wendt"; + }; + lde = { + email = "lilian.deloche@puck.fr"; + github = "lde"; + githubId = 1447020; + name = "Lilian Deloche"; + }; + ldelelis = { + email = "ldelelis@est.frba.utn.edu.ar"; + github = "ldelelis"; + githubId = 20250323; + name = "Lucio Delelis"; + }; + ldenefle = { + email = "ldenefle@gmail.com"; + github = "ldenefle"; + githubId = 20558127; + name = "Lucas Denefle"; + }; + ldesgoui = { + email = "ldesgoui@gmail.com"; + matrix = "@ldesgoui:matrix.org"; + github = "ldesgoui"; + githubId = 2472678; + name = "Lucas Desgouilles"; + }; + league = { + email = "league@contrapunctus.net"; + github = "league"; + githubId = 50286; + name = "Christopher League"; + }; + leahneukirchen = { + email = "leah@vuxu.org"; + github = "leahneukirchen"; + githubId = 139; + name = "Leah Neukirchen"; + }; + lebastr = { + email = "lebastr@gmail.com"; + github = "lebastr"; + githubId = 887072; + name = "Alexander Lebedev"; + }; + ledif = { + email = "refuse@gmail.com"; + github = "ledif"; + githubId = 307744; + name = "Adam Fidel"; + }; + leemachin = { + email = "me@mrl.ee"; + github = "leemachin"; + githubId = 736291; + name = "Lee Machin"; + }; + leenaars = { + email = "ml.software@leenaa.rs"; + github = "leenaars"; + githubId = 4158274; + name = "Michiel Leenaars"; + }; + lom = { + email = "legendofmiracles@protonmail.com"; + matrix = "@legendofmiracles:matrix.org"; + github = "legendofmiracles"; + githubId = 30902201; + name = "legendofmiracles"; + keys = [{ + longkeyid = "rsa4096/0x19B082B3DEFE5451"; + fingerprint = "CC50 F82C 985D 2679 0703 AF15 19B0 82B3 DEFE 5451"; + }]; + }; + leixb = { + email = "abone9999+nixpkgs@gmail.com"; + matrix = "@leix_b:matrix.org"; + github = "LeixB"; + githubId = 17183803; + name = "Aleix Boné"; + keys = [{ + longkeyid = "rsa4096/0xFC035BB2BB28E15D"; + fingerprint = "63D3 F436 EDE8 7E1F 1292 24AF FC03 5BB2 BB28 E15D"; + }]; + }; + lejonet = { + email = "daniel@kuehn.se"; + github = "lejonet"; + githubId = 567634; + name = "Daniel Kuehn"; + }; + leo60228 = { + email = "iakornfeld@gmail.com"; + github = "leo60228"; + githubId = 8355305; + name = "leo60228"; + }; + leonardoce = { + email = "leonardo.cecchi@gmail.com"; + github = "leonardoce"; + githubId = 1572058; + name = "Leonardo Cecchi"; + }; + leshainc = { + email = "leshainc@fomalhaut.me"; + github = "LeshaInc"; + githubId = 42153076; + name = "Alexey Nikashkin"; + }; + lesuisse = { + email = "thomas@gerbet.me"; + github = "LeSuisse"; + githubId = 737767; + name = "Thomas Gerbet"; + }; + lethalman = { + email = "lucabru@src.gnome.org"; + github = "lethalman"; + githubId = 480920; + name = "Luca Bruno"; + }; + leungbk = { + email = "leungbk@mailfence.com"; + github = "leungbk"; + githubId = 29217594; + name = "Brian Leung"; + }; + lewo = { + email = "lewo@abesis.fr"; + matrix = "@lewo:matrix.org"; + github = "nlewo"; + githubId = 3425311; + name = "Antoine Eiche"; + }; + lexuge = { + name = "Harry Ying"; + email = "lexugeyky@outlook.com"; + github = "LEXUGE"; + githubId = 13804737; + keys = [{ + longkeyid = "rsa4096/0xAE53B4C2E58EDD45"; + fingerprint = "7FE2 113A A08B 695A C8B8 DDE6 AE53 B4C2 E58E DD45"; + }]; + }; + lf- = { + email = "nix-maint@lfcode.ca"; + github = "lf-"; + githubId = 6652840; + name = "Jade"; + }; + lgcl = { + email = "dev@lgcl.de"; + name = "Leon Vack"; + github = "LogicalOverflow"; + githubId = 5919957; + }; + lheckemann = { + email = "git@sphalerite.org"; + github = "lheckemann"; + githubId = 341954; + name = "Linus Heckemann"; + }; + lhvwb = { + email = "nathaniel.baxter@gmail.com"; + github = "nathanielbaxter"; + githubId = 307589; + name = "Nathaniel Baxter"; + }; + liamdiprose = { + email = "liam@liamdiprose.com"; + github = "liamdiprose"; + githubId = 1769386; + name = "Liam Diprose"; + }; + liff = { + email = "liff@iki.fi"; + github = "liff"; + githubId = 124475; + name = "Olli Helenius"; + }; + lightbulbjim = { + email = "chris@killred.net"; + github = "lightbulbjim"; + githubId = 4312404; + name = "Chris Rendle-Short"; + }; + lightdiscord = { + email = "root@arnaud.sh"; + github = "lightdiscord"; + githubId = 24509182; + name = "Arnaud Pascal"; + }; + lihop = { + email = "nixos@leroy.geek.nz"; + github = "lihop"; + githubId = 3696783; + name = "Leroy Hopson"; + }; + lilyball = { + email = "lily@sb.org"; + github = "lilyball"; + githubId = 714; + name = "Lily Ballard"; + }; + limeytexan = { + email = "limeytexan@gmail.com"; + github = "limeytexan"; + githubId = 36448130; + name = "Michael Brantley"; + }; + linc01n = { + email = "git@lincoln.hk"; + github = "linc01n"; + githubId = 667272; + name = "Lincoln Lee"; + }; + linquize = { + email = "linquize@yahoo.com.hk"; + github = "linquize"; + githubId = 791115; + name = "Linquize"; + }; + linsui = { + email = "linsui555@gmail.com"; + github = "linsui"; + githubId = 36977733; + name = "linsui"; + }; + linus = { + email = "linusarver@gmail.com"; + github = "listx"; + githubId = 725613; + name = "Linus Arver"; + }; + livnev = { + email = "lev@liv.nev.org.uk"; + github = "livnev"; + githubId = 3964494; + name = "Lev Livnev"; + keys = [{ + longkeyid = "rsa2048/0x68FF81E6A7850F49"; + fingerprint = "74F5 E5CC 19D3 B5CB 608F 6124 68FF 81E6 A785 0F49"; + }]; + }; + lourkeur = { + name = "Louis Bettens"; + email = "louis@bettens.info"; + github = "lourkeur"; + githubId = 15657735; + keys = [{ + longkeyid = "ed25519/0xDFE1D4A017337E2A"; + fingerprint = "5B93 9CFA E8FC 4D8F E07A 3AEA DFE1 D4A0 1733 7E2A"; + }]; + }; + lorenzleutgeb = { + email = "lorenz@leutgeb.xyz"; + github = "lorenzleutgeb"; + githubId = 542154; + name = "Lorenz Leutgeb"; + }; + luis = { + email = "luis.nixos@gmail.com"; + github = "Luis-Hebendanz"; + githubId = 22085373; + name = "Luis Hebendanz"; + }; + lunarequest = { + email = "nullarequest@vivlaid.net"; + github = "Lunarequest"; + githubId = 30698906; + name = "Luna D Dragon"; + }; + LunNova = { + email = "nixpkgs-maintainer@lunnova.dev"; + github = "LunNova"; + githubId = 782440; + name = "Luna Nova"; + }; + lionello = { + email = "lio@lunesu.com"; + github = "lionello"; + githubId = 591860; + name = "Lionello Lunesu"; + }; + lluchs = { + email = "lukas.werling@gmail.com"; + github = "lluchs"; + githubId = 516527; + name = "Lukas Werling"; + }; + lnl7 = { + email = "daiderd@gmail.com"; + github = "lnl7"; + githubId = 689294; + name = "Daiderd Jordan"; + }; + lo1tuma = { + email = "schreck.mathias@gmail.com"; + github = "lo1tuma"; + githubId = 169170; + name = "Mathias Schreck"; + }; + loewenheim = { + email = "loewenheim@mailbox.org"; + github = "loewenheim"; + githubId = 7622248; + name = "Sebastian Zivota"; + }; + locallycompact = { + email = "dan.firth@homotopic.tech"; + github = "locallycompact"; + githubId = 1267527; + name = "Daniel Firth"; + }; + lodi = { + email = "anthony.lodi@gmail.com"; + github = "lodi"; + githubId = 918448; + name = "Anthony Lodi"; + }; + loicreynier = { + email = "loic@loireynier.fr"; + github = "loicreynier"; + githubId = 88983487; + name = "Loïc Reynier"; + }; + lopsided98 = { + email = "benwolsieffer@gmail.com"; + github = "lopsided98"; + githubId = 5624721; + name = "Ben Wolsieffer"; + }; + loskutov = { + email = "ignat.loskutov@gmail.com"; + github = "loskutov"; + githubId = 1202012; + name = "Ignat Loskutov"; + }; + lostnet = { + email = "lost.networking@gmail.com"; + github = "lostnet"; + githubId = 1422781; + name = "Will Young"; + }; + louisdk1 = { + email = "louis@louis.dk"; + github = "louisdk1"; + githubId = 4969294; + name = "Louis Tim Larsen"; + }; + lovek323 = { + email = "jason@oconal.id.au"; + github = "lovek323"; + githubId = 265084; + name = "Jason O'Conal"; + }; + lovesegfault = { + email = "meurerbernardo@gmail.com"; + matrix = "@lovesegfault:matrix.org"; + github = "lovesegfault"; + githubId = 7243783; + name = "Bernardo Meurer"; + keys = [{ + longkeyid = "rsa4096/0xF4C0D53B8D14C246"; + fingerprint = "F193 7596 57D5 6DA4 CCD4 786B F4C0 D53B 8D14 C246"; + }]; + }; + lowfatcomputing = { + email = "andreas.wagner@lowfatcomputing.org"; + github = "lowfatcomputing"; + githubId = 10626; + name = "Andreas Wagner"; + }; + lrewega = { + email = "lrewega@c32.ca"; + github = "lrewega"; + githubId = 639066; + name = "Luke Rewega"; + }; + lromor = { + email = "leonardo.romor@gmail.com"; + github = "lromor"; + githubId = 1597330; + name = "Leonardo Romor"; + }; + lrworth = { + email = "luke@worth.id.au"; + name = "Luke Worth"; + }; + lschuermann = { + email = "leon.git@is.currently.online"; + matrix = "@leons:is.currently.online"; + github = "lschuermann"; + githubId = 5341193; + name = "Leon Schuermann"; + }; + lsix = { + email = "lsix@lancelotsix.com"; + github = "lsix"; + githubId = 724339; + name = "Lancelot SIX"; + }; + ltavard = { + email = "laure.tavard@univ-grenoble-alpes.fr"; + github = "ltavard"; + githubId = 8555953; + name = "Laure Tavard"; + }; + luc65r = { + email = "lucas@ransan.tk"; + github = "luc65r"; + githubId = 59375051; + name = "Lucas Ransan"; + }; + lucperkins = { + email = "lucperkins@gmail.com"; + github = "lucperkins"; + githubId = 1523104; + name = "Luc Perkins"; + }; + lucus16 = { + email = "lars.jellema@gmail.com"; + github = "Lucus16"; + githubId = 2487922; + name = "Lars Jellema"; + }; + ludo = { + email = "ludo@gnu.org"; + github = "civodul"; + githubId = 1168435; + name = "Ludovic Courtès"; + }; + lufia = { + email = "lufia@lufia.org"; + github = "lufia"; + githubId = 1784379; + name = "Kyohei Kadota"; + }; + Luflosi = { + name = "Luflosi"; + email = "luflosi@luflosi.de"; + github = "Luflosi"; + githubId = 15217907; + keys = [{ + longkeyid = "rsa4096/0x6F987CCF224D20B9"; + fingerprint = "66D1 3048 2B5F 2069 81A6 6B83 6F98 7CCF 224D 20B9"; + }]; + }; + luispedro = { + email = "luis@luispedro.org"; + github = "luispedro"; + githubId = 79334; + name = "Luis Pedro Coelho"; + }; + lukeadams = { + email = "luke.adams@belljar.io"; + github = "lukeadams"; + githubId = 3508077; + name = "Luke Adams"; + }; + lukebfox = { + email = "lbentley-fox1@sheffield.ac.uk"; + github = "lukebfox"; + githubId = 34683288; + name = "Luke Bentley-Fox"; + }; + lukegb = { + email = "nix@lukegb.com"; + matrix = "@lukegb:zxcvbnm.ninja"; + github = "lukegb"; + githubId = 246745; + name = "Luke Granger-Brown"; + }; + lukego = { + email = "luke@snabb.co"; + github = "lukego"; + githubId = 13791; + name = "Luke Gorrie"; + }; + luker = { + email = "luker@fenrirproject.org"; + github = "LucaFulchir"; + githubId = 2486026; + name = "Luca Fulchir"; + }; + lumi = { + email = "lumi@pew.im"; + github = "lumi-me-not"; + githubId = 26020062; + name = "lumi"; + }; + lunik1 = { + email = "ch.nixpkgs@themaw.xyz"; + matrix = "@lunik1:lunik.one"; + github = "lunik1"; + githubId = 13547699; + name = "Corin Hoad"; + keys = [{ + longkeyid = "rsa2048/0x6A37DF9483188492"; + fingerprint = "BA3A 5886 AE6D 526E 20B4 57D6 6A37 DF94 8318 8492"; + }]; + }; + lux = { + email = "lux@lux.name"; + githubId = 1208273; + matrix = "@lux:ontheblueplanet.com"; + name = "Lux"; + }; + luz = { + email = "luz666@daum.net"; + github = "Luz"; + githubId = 208297; + name = "Luz"; + }; + lw = { + email = "lw@fmap.me"; + github = "lolwat97"; + githubId = 2057309; + name = "Sergey Sofeychuk"; + }; + lxea = { + email = "nix@amk.ie"; + github = "lxea"; + githubId = 7910815; + name = "Alex McGrath"; + }; + lynty = { + email = "ltdong93+nix@gmail.com"; + github = "lynty"; + githubId = 39707188; + name = "Lynn Dong"; + }; + lyt = { + email = "wheatdoge@gmail.com"; + name = "Tim Liou"; + }; + m00wl = { + name = "Moritz Lumme"; + email = "moritz.lumme@gmail.com"; + github = "m00wl"; + githubId = 46034439; + }; + m1cr0man = { + email = "lucas+nix@m1cr0man.com"; + github = "m1cr0man"; + githubId = 3044438; + name = "Lucas Savva"; + }; + m3tti = { + email = "mathaeus.peter.sander@gmail.com"; + name = "Mathaeus Sander"; + }; + ma27 = { + email = "maximilian@mbosch.me"; + matrix = "@ma27:nicht-so.sexy"; + github = "ma27"; + githubId = 6025220; + name = "Maximilian Bosch"; + }; + ma9e = { + email = "sean@lfo.team"; + github = "furrycatherder"; + githubId = 36235154; + name = "Sean Haugh"; + }; + maaslalani = { + email = "maaslalani0@gmail.com"; + github = "maaslalani"; + githubId = 42545625; + name = "Maas Lalani"; + }; + madjar = { + email = "georges.dubus@compiletoi.net"; + github = "madjar"; + githubId = 109141; + name = "Georges Dubus"; + }; + Madouura = { + email = "madouura@gmail.com"; + github = "Madouura"; + githubId = 93990818; + name = "Madoura"; + }; + mafo = { + email = "Marc.Fontaine@gmx.de"; + github = "MarcFontaine"; + githubId = 1433367; + name = "Marc Fontaine"; + }; + magenbluten = { + email = "magenbluten@codemonkey.cc"; + github = "magenbluten"; + githubId = 1140462; + name = "magenbluten"; + }; + magnetophon = { + email = "bart@magnetophon.nl"; + github = "magnetophon"; + githubId = 7645711; + name = "Bart Brouns"; + }; + mahe = { + email = "matthias.mh.herrmann@gmail.com"; + github = "2chilled"; + githubId = 1238350; + name = "Matthias Herrmann"; + }; + majesticmullet = { + email = "hoccthomas@gmail.com.au"; + github = "MajesticMullet"; + githubId = 31056089; + name = "Tom Ho"; + }; + makefu = { + email = "makefu@syntax-fehler.de"; + github = "makefu"; + githubId = 115218; + name = "Felix Richter"; + }; + malo = { + email = "mbourgon@gmail.com"; + github = "malob"; + githubId = 2914269; + name = "Malo Bourgon"; + }; + malvo = { + email = "malte@malvo.org"; + github = "malte-v"; + githubId = 34393802; + name = "Malte Voos"; + }; + malbarbo = { + email = "malbarbo@gmail.com"; + github = "malbarbo"; + githubId = 1678126; + name = "Marco A L Barbosa"; + }; + malyn = { + email = "malyn@strangeGizmo.com"; + github = "malyn"; + githubId = 346094; + name = "Michael Alyn Miller"; + }; + manojkarthick = { + email = "smanojkarthick@gmail.com"; + github = "manojkarthick"; + githubId = 7802795; + name = "Manoj Karthick"; + }; + manveru = { + email = "m.fellinger@gmail.com"; + matrix = "@manveru:matrix.org"; + github = "manveru"; + githubId = 3507; + name = "Michael Fellinger"; + }; + maralorn = { + email = "malte.brandy@maralorn.de"; + matrix = "@maralorn:maralorn.de"; + github = "maralorn"; + githubId = 1651325; + name = "Malte Brandy"; + }; + marcweber = { + email = "marco-oweber@gmx.de"; + github = "marcweber"; + githubId = 34086; + name = "Marc Weber"; + }; + marcus7070 = { + email = "marcus@geosol.com.au"; + github = "marcus7070"; + githubId = 50230945; + name = "Marcus Boyd"; + }; + marenz = { + email = "marenz@arkom.men"; + github = "marenz2569"; + githubId = 12773269; + name = "Markus Schmidl"; + }; + markus1189 = { + email = "markus1189@gmail.com"; + github = "markus1189"; + githubId = 591567; + name = "Markus Hauck"; + }; + markuskowa = { + email = "markus.kowalewski@gmail.com"; + github = "markuskowa"; + githubId = 26470037; + name = "Markus Kowalewski"; + }; + markWot = { + email = "markus@wotringer.de"; + name = "Markus Wotringer"; + }; + marijanp = { + name = "Marijan Petričević"; + email = "marijan.petricevic94@gmail.com"; + github = "marijanp"; + githubId = 13599169; + }; + marius851000 = { + email = "mariusdavid@laposte.net"; + name = "Marius David"; + github = "marius851000"; + githubId = 22586596; + }; + marsam = { + email = "marsam@users.noreply.github.com"; + github = "marsam"; + githubId = 65531; + name = "Mario Rodas"; + }; + martijnvermaat = { + email = "martijn@vermaat.name"; + github = "martijnvermaat"; + githubId = 623509; + name = "Martijn Vermaat"; + }; + martinetd = { + email = "f.ktfhrvnznqxacf@noclue.notk.org"; + github = "martinetd"; + githubId = 1729331; + name = "Dominique Martinet"; + }; + martingms = { + email = "martin@mg.am"; + github = "martingms"; + githubId = 458783; + name = "Martin Gammelsæter"; + }; + martfont = { + name = "Martino Fontana"; + email = "tinozzo123@tutanota.com"; + github = "SuperSamus"; + githubId = 40663462; + }; + marzipankaiser = { + email = "nixos@gaisseml.de"; + github = "marzipankaiser"; + githubId = 2551444; + name = "Marcial Gaißert"; + keys = [{ + longkeyid = "rsa2048/0xB629036BE399EEE9"; + fingerprint = "B573 5118 0375 A872 FBBF 7770 B629 036B E399 EEE9"; + }]; + }; + masipcat = { + email = "jordi@masip.cat"; + github = "masipcat"; + githubId = 775189; + name = "Jordi Masip"; + }; + MaskedBelgian = { + email = "michael.colicchia@imio.be"; + github = "MaskedBelgian"; + githubId = 29855073; + name = "Michael Colicchia"; + }; + matejc = { + email = "cotman.matej@gmail.com"; + github = "matejc"; + githubId = 854770; + name = "Matej Cotman"; + }; + mathnerd314 = { + email = "mathnerd314.gph+hs@gmail.com"; + github = "mathnerd314"; + githubId = 322214; + name = "Mathnerd314"; + }; + matklad = { + email = "aleksey.kladov@gmail.com"; + github = "matklad"; + githubId = 1711539; + name = "matklad"; + }; + matt-snider = { + email = "matt.snider@protonmail.com"; + github = "matt-snider"; + githubId = 11810057; + name = "Matt Snider"; + }; + mattchrist = { + email = "nixpkgs-matt@christ.systems"; + github = "mattchrist"; + githubId = 952712; + name = "Matt Christ"; + }; + matthewbauer = { + email = "mjbauer95@gmail.com"; + github = "matthewbauer"; + githubId = 19036; + name = "Matthew Bauer"; + }; + matthiasbeyer = { + email = "mail@beyermatthias.de"; + matrix = "@musicmatze:beyermatthi.as"; + github = "matthiasbeyer"; + githubId = 427866; + name = "Matthias Beyer"; + }; + matthuszagh = { + email = "huszaghmatt@gmail.com"; + github = "matthuszagh"; + githubId = 7377393; + name = "Matt Huszagh"; + }; + matti-kariluoma = { + email = "matti@kariluo.ma"; + github = "matti-kariluoma"; + githubId = 279868; + name = "Matti Kariluoma"; + }; + matthewpi = { + email = "me+nix@matthewp.io"; + github = "matthewpi"; + githubId = 26559841; + name = "Matthew Penner"; + keys = [{ + longkeyid = "ed25519/0x31311906AD4CF6D6"; + fingerprint = "5118 F1CC B7B0 6C17 4DD1 5267 3131 1906 AD4C F6D6"; + }]; + }; + maurer = { + email = "matthew.r.maurer+nix@gmail.com"; + github = "maurer"; + githubId = 136037; + name = "Matthew Maurer"; + }; + mausch = { + email = "mauricioscheffer@gmail.com"; + github = "mausch"; + githubId = 95194; + name = "Mauricio Scheffer"; + }; + max-niederman = { + email = "max@maxniederman.com"; + github = "max-niederman"; + githubId = 19580458; + name = "Max Niederman"; + keys = [{ + longkeyid = "rsa3072/0x9AED881481D8444E"; + fingerprint = "1DE4 424D BF77 1192 5DC4 CF5E 9AED 8814 81D8 444E"; + }]; + }; + maxdamantus = { + email = "maxdamantus@gmail.com"; + github = "Maxdamantus"; + githubId = 502805; + name = "Max Zerzouri"; + }; + maxeaubrey = { + email = "maxeaubrey@gmail.com"; + github = "maxeaubrey"; + githubId = 35892750; + name = "Maxine Aubrey"; + }; + maxhille = { + email = "mh@lambdasoup.com"; + github = "maxhille"; + githubId = 693447; + name = "Max Hille"; + }; + maxhbr = { + email = "nixos@maxhbr.dev"; + github = "maxhbr"; + githubId = 1187050; + name = "Maximilian Huber"; + }; + maximsmol = { + email = "maximsmol@gmail.com"; + github = "maximsmol"; + githubId = 1472826; + name = "Max Smolin"; + }; + maxxk = { + email = "maxim.krivchikov@gmail.com"; + github = "maxxk"; + githubId = 1191859; + name = "Maxim Krivchikov"; + }; + MayNiklas = { + email = "info@niklas-steffen.de"; + github = "MayNiklas"; + githubId = 44636701; + name = "Niklas Steffen"; + }; + mazurel = { + email = "mateusz.mazur@yahoo.com"; + github = "Mazurel"; + githubId = 22836301; + name = "Mateusz Mazur"; + }; + mbaeten = { + email = "mbaeten@users.noreply.github.com"; + github = "mbaeten"; + githubId = 2649304; + name = "M. Baeten"; + }; + mbaillie = { + email = "martin@baillie.id"; + github = "martinbaillie"; + githubId = 613740; + name = "Martin Baillie"; + }; + mbbx6spp = { + email = "me@susanpotter.net"; + github = "mbbx6spp"; + githubId = 564; + name = "Susan Potter"; + }; + mbe = { + email = "brandonedens@gmail.com"; + github = "brandonedens"; + githubId = 396449; + name = "Brandon Edens"; + }; + mbode = { + email = "maxbode@gmail.com"; + github = "mbode"; + githubId = 9051309; + name = "Maximilian Bode"; + }; + mboes = { + email = "mboes@tweag.net"; + github = "mboes"; + githubId = 51356; + name = "Mathieu Boespflug"; + }; + mbprtpmnr = { + name = "mbprtpmnr"; + email = "mbprtpmnr@pm.me"; + github = "mbprtpmnr"; + githubId = 88109321; + }; + mbrgm = { + email = "marius@yeai.de"; + github = "mbrgm"; + githubId = 2971615; + name = "Marius Bergmann"; + }; + mcaju = { + email = "cajum.bugs@yandex.com"; + github = "CajuM"; + githubId = 10420834; + name = "Mihai-Drosi Caju"; + }; + mcbeth = { + email = "mcbeth@broggs.org"; + github = "mcbeth"; + githubId = 683809; + name = "Jeffrey Brent McBeth"; + }; + mcmtroffaes = { + email = "matthias.troffaes@gmail.com"; + github = "mcmtroffaes"; + githubId = 158568; + name = "Matthias C. M. Troffaes"; + }; + McSinyx = { + email = "mcsinyx@disroot.org"; + github = "McSinyx"; + githubId = 13689192; + name = "Nguyễn Gia Phong"; + keys = [{ + longkeyid = "rsa3072/0x27148B2C06A2224B"; + fingerprint = "E90E 11B8 0493 343B 6132 E394 2714 8B2C 06A2 224B"; + }]; + }; + mcwitt = { + email = "mcwitt@gmail.com"; + github = "mcwitt"; + githubId = 319411; + name = "Matt Wittmann"; + }; + mdaiter = { + email = "mdaiter8121@gmail.com"; + github = "mdaiter"; + githubId = 1377571; + name = "Matthew S. Daiter"; + }; + mdevlamynck = { + email = "matthias.devlamynck@mailoo.org"; + github = "mdevlamynck"; + githubId = 4378377; + name = "Matthias Devlamynck"; + }; + mdlayher = { + email = "mdlayher@gmail.com"; + github = "mdlayher"; + githubId = 1926905; + name = "Matt Layher"; + keys = [{ + longkeyid = "rsa2048/0x77BFE531397EDE94"; + fingerprint = "D709 03C8 0BE9 ACDC 14F0 3BFB 77BF E531 397E DE94"; + }]; + }; + meatcar = { + email = "nixpkgs@denys.me"; + github = "meatcar"; + githubId = 191622; + name = "Denys Pavlov"; + }; + meditans = { + email = "meditans@gmail.com"; + github = "meditans"; + githubId = 4641445; + name = "Carlo Nucera"; + }; + megheaiulian = { + email = "iulian.meghea@gmail.com"; + github = "megheaiulian"; + githubId = 1788114; + name = "Meghea Iulian"; + }; + mehandes = { + email = "niewskici@gmail.com"; + github = "mehandes"; + githubId = 32581276; + name = "Matt Deming"; + }; + meisternu = { + email = "meister@krutt.org"; + github = "meisternu"; + githubId = 8263431; + name = "Matt Miemiec"; + }; + melchips = { + email = "truphemus.francois@gmail.com"; + github = "melchips"; + githubId = 365721; + name = "Francois Truphemus"; + }; + melsigl = { + email = "melanie.bianca.sigl@gmail.com"; + github = "melsigl"; + githubId = 15093162; + name = "Melanie B. Sigl"; + }; + melkor333 = { + email = "samuel@ton-kunst.ch"; + github = "melkor333"; + githubId = 6412377; + name = "Samuel Ruprecht"; + }; + metabar = { + email = "softs@metabarcoding.org"; + name = "Celine Mercier"; + }; + kira-bruneau = { + email = "kira.bruneau@pm.me"; + name = "Kira Bruneau"; + github = "kira-bruneau"; + githubId = 382041; + }; + mephistophiles = { + email = "mussitantesmortem@gmail.com"; + name = "Maxim Zhukov"; + github = "Mephistophiles"; + githubId = 4850908; + }; + mfossen = { + email = "msfossen@gmail.com"; + github = "mfossen"; + githubId = 3300322; + name = "Mitchell Fossen"; + }; + mgdelacroix = { + email = "mgdelacroix@gmail.com"; + github = "mgdelacroix"; + githubId = 223323; + name = "Miguel de la Cruz"; + }; + mgdm = { + email = "michael@mgdm.net"; + github = "mgdm"; + githubId = 71893; + name = "Michael Maclean"; + }; + mgregoire = { + email = "gregoire@martinache.net"; + github = "M-Gregoire"; + githubId = 9469313; + name = "Gregoire Martinache"; + }; + mgttlinger = { + email = "megoettlinger@gmail.com"; + github = "mgttlinger"; + githubId = 5120487; + name = "Merlin Göttlinger"; + }; + mguentner = { + email = "code@klandest.in"; + github = "mguentner"; + githubId = 668926; + name = "Maximilian Güntner"; + }; + mh = { + email = "68288772+markus-heinrich@users.noreply.github.com"; + github = "markus-heinrich"; + githubId = 68288772; + name = "Markus Heinrich"; + }; + mhaselsteiner = { + email = "magdalena.haselsteiner@gmx.at"; + github = "mhaselsteiner"; + githubId = 20536514; + name = "Magdalena Haselsteiner"; + }; + mic92 = { + email = "joerg@thalheim.io"; + matrix = "@mic92:nixos.dev"; + github = "mic92"; + githubId = 96200; + name = "Jörg Thalheim"; + keys = [{ + # compare with https://keybase.io/Mic92 + longkeyid = "rsa4096/0x003F2096411B5F92"; + fingerprint = "3DEE 1C55 6E1C 3DC5 54F5 875A 003F 2096 411B 5F92"; + }]; + }; + michaeladler = { + email = "therisen06@gmail.com"; + github = "michaeladler"; + githubId = 1575834; + name = "Michael Adler"; + }; + michaelpj = { + email = "michaelpj@gmail.com"; + github = "michaelpj"; + githubId = 1699466; + name = "Michael Peyton Jones"; + }; + michalrus = { + email = "m@michalrus.com"; + github = "michalrus"; + githubId = 4366292; + name = "Michal Rus"; + }; + michelk = { + email = "michel@kuhlmanns.info"; + github = "michelk"; + githubId = 1404919; + name = "Michel Kuhlmann"; + }; + michojel = { + email = "mic.liamg@gmail.com"; + github = "michojel"; + githubId = 21156022; + name = "Michal Minář"; + }; + michzappa = { + email = "me@michzappa.com"; + github = "michzappa"; + githubId = 59343378; + name = "Michael Zappa"; + }; + mickours = { + email = "mickours@gmail.com<"; + github = "mickours"; + githubId = 837312; + name = "Michael Mercier"; + }; + midchildan = { + email = "git@midchildan.org"; + matrix = "@midchildan:matrix.org"; + github = "midchildan"; + githubId = 7343721; + name = "midchildan"; + keys = [{ + longkeyid = "rsa4096/0x186A1EDAC5C63F83"; + fingerprint = "FEF0 AE2D 5449 3482 5F06 40AA 186A 1EDA C5C6 3F83"; + }]; + }; + mihnea-s = { + email = "mihn.stn@gmail.com"; + github = "mihnea-s"; + githubId = 43088426; + name = "Mihnea Stoian"; + }; + mikefaille = { + email = "michael@faille.io"; + github = "mikefaille"; + githubId = 978196; + name = "Michaël Faille"; + }; + mikoim = { + email = "ek@esh.ink"; + github = "mikoim"; + githubId = 3958340; + name = "Eshin Kunishima"; + }; + mikesperber = { + email = "sperber@deinprogramm.de"; + github = "mikesperber"; + githubId = 1387206; + name = "Mike Sperber"; + }; + mikroskeem = { + email = "mikroskeem@mikroskeem.eu"; + github = "mikroskeem"; + githubId = 3490861; + name = "Mark Vainomaa"; + keys = [{ + longkeyid = "rsa4096/0xDA015B05B5A11B22"; + fingerprint = "DB43 2895 CF68 F0CE D4B7 EF60 DA01 5B05 B5A1 1B22"; + }]; + }; + milahu = { + email = "milahu@gmail.com"; + github = "milahu"; + githubId = 12958815; + name = "Milan Hauth"; + }; + milesbreslin = { + email = "milesbreslin@gmail.com"; + github = "milesbreslin"; + githubId = 38543128; + name = "Miles Breslin"; + }; + milibopp = { + email = "contact@ebopp.de"; + github = "milibopp"; + githubId = 3098430; + name = "Emilia Bopp"; + }; + millerjason = { + email = "mailings-github@millerjason.com"; + github = "millerjason"; + githubId = 7610974; + name = "Jason Miller"; + }; + milogert = { + email = "milo@milogert.com"; + github = "milogert"; + githubId = 5378535; + name = "Milo Gertjejansen"; + }; + miltador = { + email = "miltador@yandex.ua"; + name = "Vasiliy Solovey"; + }; + mimame = { + email = "miguel.madrid.mencia@gmail.com"; + github = "mimame"; + githubId = 3269878; + name = "Miguel Madrid Mencía"; + }; + mindavi = { + email = "rol3517@gmail.com"; + github = "Mindavi"; + githubId = 9799623; + name = "Rick van Schijndel"; + }; + minijackson = { + email = "minijackson@riseup.net"; + github = "minijackson"; + githubId = 1200507; + name = "Rémi Nicole"; + keys = [{ + longkeyid = "rsa2048/0xFEA888C9F5D64F62"; + fingerprint = "3196 83D3 9A1B 4DE1 3DC2 51FD FEA8 88C9 F5D6 4F62"; + }]; + }; + mir06 = { + email = "armin.leuprecht@uni-graz.at"; + github = "mir06"; + githubId = 8479244; + name = "Armin Leuprecht"; + }; + mirdhyn = { + email = "mirdhyn@gmail.com"; + github = "mirdhyn"; + githubId = 149558; + name = "Merlin Gaillard"; + }; + mirrexagon = { + email = "mirrexagon@mirrexagon.com"; + github = "mirrexagon"; + githubId = 1776903; + name = "Andrew Abbott"; + }; + mitchmindtree = { + email = "mail@mitchellnordine.com"; + github = "mitchmindtree"; + githubId = 4587373; + name = "Mitchell Nordine"; + }; + mjanczyk = { + email = "m@dragonvr.pl"; + github = "mjanczyk"; + githubId = 1001112; + name = "Marcin Janczyk"; + }; + mjp = { + email = "mike@mythik.co.uk"; + github = "MikePlayle"; + githubId = 16974598; + name = "Mike Playle"; + }; + mkaito = { + email = "chris@mkaito.net"; + github = "mkaito"; + githubId = 20434; + name = "Christian Höppner"; + }; + mkazulak = { + email = "kazulakm@gmail.com"; + github = "mulderr"; + githubId = 5698461; + name = "Maciej Kazulak"; + }; + mkf = { + email = "m@mikf.pl"; + github = "mkf"; + githubId = 7753506; + name = "Michał Krzysztof Feiler"; + keys = [{ + longkeyid = "rsa4096/0xE35C2D7C2C6AC724"; + fingerprint = "1E36 9940 CC7E 01C4 CFE8 F20A E35C 2D7C 2C6A C724"; + }]; + }; + mkg = { + email = "mkg@vt.edu"; + github = "mkgvt"; + githubId = 22477669; + name = "Mark K Gardner"; + }; + mkg20001 = { + email = "mkg20001+nix@gmail.com"; + matrix = "@mkg20001:matrix.org"; + github = "mkg20001"; + githubId = 7735145; + name = "Maciej Krüger"; + keys = [{ + longkeyid = "rsa4096/0x0D948CE19CF49C5F"; + fingerprint = "E90C BA34 55B3 6236 740C 038F 0D94 8CE1 9CF4 9C5F"; + }]; + }; + mlieberman85 = { + email = "mlieberman85@gmail.com"; + github = "mlieberman85"; + githubId = 622577; + name = "Michael Lieberman"; + }; + mlvzk = { + name = "mlvzk"; + email = "mlvzk@users.noreply.github.com"; + github = "mlvzk"; + githubId = 44906333; + }; + mmahut = { + email = "marek.mahut@gmail.com"; + github = "mmahut"; + githubId = 104795; + name = "Marek Mahut"; + }; + mmai = { + email = "henri.bourcereau@gmail.com"; + github = "mmai"; + githubId = 117842; + name = "Henri Bourcereau"; + }; + mmesch = { + email = "mmesch@noreply.github.com"; + github = "mmesch"; + githubId = 2597803; + name = "Matthias Meschede"; + }; + mmilata = { + email = "martin@martinmilata.cz"; + github = "mmilata"; + githubId = 85857; + name = "Martin Milata"; + }; + mmlb = { + email = "manny@peekaboo.mmlb.icu"; + github = "mmlb"; + githubId = 708570; + name = "Manuel Mendez"; + }; + mnacamura = { + email = "m.nacamura@gmail.com"; + github = "mnacamura"; + githubId = 45770; + name = "Mitsuhiro Nakamura"; + }; + moaxcp = { + email = "moaxcp@gmail.com"; + github = "moaxcp"; + githubId = 7831184; + name = "John Mercier"; + }; + modulistic = { + email = "modulistic@gmail.com"; + github = "modulistic"; + githubId = 1902456; + name = "Pablo Costa"; + }; + mog = { + email = "mog-lists@rldn.net"; + github = "mogorman"; + githubId = 64710; + name = "Matthew O'Gorman"; + }; + Mogria = { + email = "m0gr14@gmail.com"; + github = "mogria"; + githubId = 754512; + name = "Mogria"; + }; + mohe2015 = { + name = "Moritz Hedtke"; + email = "Moritz.Hedtke@t-online.de"; + matrix = "@moritz.hedtke:matrix.org"; + github = "mohe2015"; + githubId = 13287984; + keys = [{ + longkeyid = "rsa4096/0x6794D45A488C2EDE"; + fingerprint = "1248 D3E1 1D11 4A85 75C9 8934 6794 D45A 488C 2EDE"; + }]; + }; + monsieurp = { + email = "monsieurp@gentoo.org"; + github = "monsieurp"; + githubId = 350116; + name = "Patrice Clement"; + }; + montag451 = { + email = "montag451@laposte.net"; + github = "montag451"; + githubId = 249317; + name = "montag451"; + }; + moosingin3space = { + email = "moosingin3space@gmail.com"; + github = "moosingin3space"; + githubId = 830082; + name = "Nathan Moos"; + }; + moredread = { + email = "code@apb.name"; + github = "moredread"; + githubId = 100848; + name = "André-Patrick Bubel"; + keys = [{ + longkeyid = "rsa8192/0x118CE7C424B45728"; + fingerprint = "4412 38AD CAD3 228D 876C 5455 118C E7C4 24B4 5728"; + }]; + }; + moretea = { + email = "maarten@moretea.nl"; + github = "moretea"; + githubId = 99988; + name = "Maarten Hoogendoorn"; + }; + MoritzBoehme = { + email = "mail@moritzboeh.me"; + github = "MoritzBoehme"; + githubId = 42215704; + name = "Moritz Böhme"; + }; + MostAwesomeDude = { + email = "cds@corbinsimpson.com"; + github = "MostAwesomeDude"; + githubId = 118035; + name = "Corbin Simpson"; + }; + mothsart = { + email = "jerem.ferry@gmail.com"; + github = "mothsart"; + githubId = 10601196; + name = "Jérémie Ferry"; + }; + mounium = { + email = "muoniurn@gmail.com"; + github = "mounium"; + githubId = 20026143; + name = "Katona László"; + }; + MP2E = { + email = "MP2E@archlinux.us"; + github = "MP2E"; + githubId = 167708; + name = "Cray Elliott"; + }; + mpcsh = { + email = "m@mpc.sh"; + github = "mpcsh"; + githubId = 2894019; + name = "Mark Cohen"; + }; + mpickering = { + email = "matthewtpickering@gmail.com"; + github = "mpickering"; + githubId = 1216657; + name = "Matthew Pickering"; + }; + mpoquet = { + email = "millian.poquet@gmail.com"; + github = "mpoquet"; + githubId = 3502831; + name = "Millian Poquet"; + }; + mpscholten = { + email = "marc@mpscholten.de"; + github = "mpscholten"; + githubId = 2072185; + name = "Marc Scholten"; + }; + mpsyco = { + email = "fr.st-amour@gmail.com"; + github = "fstamour"; + githubId = 2881922; + name = "Francis St-Amour"; + }; + mtrsk = { + email = "marcos.schonfinkel@protonmail.com"; + github = "mtrsk"; + githubId = 16356569; + name = "Marcos Benevides"; + }; + mredaelli = { + email = "massimo@typish.io"; + github = "mredaelli"; + githubId = 3073833; + name = "Massimo Redaelli"; + }; + mrhedgehog = { + name = "Mr Hedgehog"; + email = "hedgehog@mrhedgehog.xyz"; + matrix = "@mrhedgehog:jupiterbroadcasting.com"; + github = "ModdedGamers"; + githubId = 35778371; + keys = [{ + longkeyid = "rsa4096/0x7D5107866B1C6752"; + fingerprint = "38A0 29B0 4A7E 4C13 A4BB 86C8 7D51 0786 6B1C 6752"; + }]; + }; + mrkkrp = { + email = "markkarpov92@gmail.com"; + github = "mrkkrp"; + githubId = 8165792; + name = "Mark Karpov"; + }; + mrmebelman = { + email = "burzakovskij@protonmail.com"; + github = "MrMebelMan"; + githubId = 15896005; + name = "Vladyslav Burzakovskyy"; + }; + mrVanDalo = { + email = "contact@ingolf-wagner.de"; + github = "mrVanDalo"; + githubId = 839693; + name = "Ingolf Wanger"; + }; + msackman = { + email = "matthew@wellquite.org"; + name = "Matthew Sackman"; + }; + mschneider = { + email = "markus.schneider.sic+nix@gmail.com"; + name = "Markus Schneider"; + }; + mschristiansen = { + email = "mikkel@rheosystems.com"; + github = "mschristiansen"; + githubId = 437005; + name = "Mikkel Christiansen"; + }; + mschuwalow = { + github = "mschuwalow"; + githubId = 16665913; + name = "Maxim Schuwalow"; + email = "maxim.schuwalow@gmail.com"; + }; + msfjarvis = { + github = "msfjarvis"; + githubId = 3348378; + name = "Harsh Shandilya"; + email = "nixos@msfjarvis.dev"; + keys = [{ + longkeyid = "rsa4096/0xB7843F823355E9B9"; + fingerprint = "8F87 050B 0F9C B841 1515 7399 B784 3F82 3355 E9B9"; + }]; + }; + msiedlarek = { + email = "mikolaj@siedlarek.pl"; + github = "msiedlarek"; + githubId = 133448; + name = "Mikołaj Siedlarek"; + }; + msm = { + email = "msm@tailcall.net"; + github = "msm-code"; + githubId = 7026881; + name = "Jarosław Jedynak"; + }; + mstarzyk = { + email = "mstarzyk@gmail.com"; + github = "mstarzyk"; + githubId = 111304; + name = "Maciek Starzyk"; + }; + msteen = { + email = "emailmatthijs@gmail.com"; + github = "msteen"; + githubId = 788953; + name = "Matthijs Steen"; + }; + mstrangfeld = { + email = "marvin@strangfeld.io"; + github = "mstrangfeld"; + githubId = 36842980; + name = "Marvin Strangfeld"; + }; + mt-caret = { + email = "mtakeda.enigsol@gmail.com"; + github = "mt-caret"; + githubId = 4996739; + name = "Masayuki Takeda"; + }; + mtesseract = { + email = "moritz@stackrox.com"; + github = "mtesseract"; + githubId = 11706080; + name = "Moritz Clasmeier"; + }; + MtP = { + email = "marko.nixos@poikonen.de"; + github = "MtP76"; + githubId = 2176611; + name = "Marko Poikonen"; + }; + mtreca = { + email = "maxime.treca@gmail.com"; + github = "mtreca"; + githubId = 16440823; + name = "Maxime Tréca"; + }; + mtreskin = { + email = "zerthurd@gmail.com"; + github = "Zert"; + githubId = 39034; + name = "Max Treskin"; + }; + mudri = { + email = "lamudri@gmail.com"; + github = "laMudri"; + githubId = 5139265; + name = "James Wood"; + }; + mudrii = { + email = "mudreac@gmail.com"; + github = "mudrii"; + githubId = 220262; + name = "Ion Mudreac"; + }; + muflax = { + email = "mail@muflax.com"; + github = "muflax"; + githubId = 69918; + name = "Stefan Dorn"; + }; + multun = { + email = "victor.collod@epita.fr"; + github = "multun"; + githubId = 5047140; + name = "Victor Collod"; + }; + musfay = { + email = "musfay@protonmail.com"; + github = "musfay"; + githubId = 33374965; + name = "Mustafa Çalışkan"; + }; + mupdt = { + email = "nix@pdtpartners.com"; + github = "mupdt"; + githubId = 25388474; + name = "Matej Urbas"; + }; + mvisonneau = { + name = "Maxime VISONNEAU"; + email = "maxime@visonneau.fr"; + matrix = "@maxime:visonneau.fr"; + github = "mvisonneau"; + githubId = 1761583; + keys = [{ + longkeyid = "rsa4096/0x150D6F0AE9198D24"; + fingerprint = "EC63 0CEA E8BC 5EE5 5C58 F2E3 150D 6F0A E919 8D24"; + }]; + }; + mvnetbiz = { + email = "mvnetbiz@gmail.com"; + matrix = "@mvtva:matrix.org"; + github = "mvnetbiz"; + githubId = 6455574; + name = "Matt Votava"; + }; + mvs = { + email = "mvs@nya.yt"; + github = "illdefined"; + githubId = 772914; + name = "Mikael Voss"; + }; + maxwilson = { + email = "nixpkgs@maxwilson.dev"; + github = "mwilsoncoding"; + githubId = 43796009; + name = "Max Wilson"; + }; + myrl = { + email = "myrl.0xf@gmail.com"; + github = "myrl"; + githubId = 9636071; + name = "Myrl Hex"; + }; + n0emis = { + email = "nixpkgs@n0emis.network"; + github = "n0emis"; + githubId = 22817873; + name = "Ember Keske"; + }; + nadrieril = { + email = "nadrieril@gmail.com"; + github = "nadrieril"; + githubId = 6783654; + name = "Nadrieril Feneanar"; + }; + nalbyuites = { + email = "ashijit007@gmail.com"; + github = "nalbyuites"; + githubId = 1009523; + name = "Ashijit Pramanik"; + }; + namore = { + email = "namor@hemio.de"; + github = "namore"; + githubId = 1222539; + name = "Roman Naumann"; + }; + nasirhm = { + email = "nasirhussainm14@gmail.com"; + github = "nasirhm"; + githubId = 35005234; + name = "Nasir Hussain"; + keys = [{ + longkeyid = "rsa4096/0xD8126E559CE7C35D"; + fingerprint = "7A10 AB8E 0BEC 566B 090C 9BE3 D812 6E55 9CE7 C35D"; + }]; + }; + Nate-Devv = { + email = "natedevv@gmail.com"; + name = "Nathan Moore"; + }; + nathanruiz = { + email = "nathanruiz@protonmail.com"; + github = "nathanruiz"; + githubId = 18604892; + name = "Nathan Ruiz"; + }; + nathan-gs = { + email = "nathan@nathan.gs"; + github = "nathan-gs"; + githubId = 330943; + name = "Nathan Bijnens"; + }; + nathyong = { + email = "nathyong@noreply.github.com"; + github = "nathyong"; + githubId = 818502; + name = "Nathan Yong"; + }; + natto1784 = { + email = "natto@weirdnatto.in"; + github = "natto1784"; + githubId = 56316606; + name = "Amneesh Singh"; + }; + nazarewk = { + name = "Krzysztof Nazarewski"; + email = "3494992+nazarewk@users.noreply.github.com"; + matrix = "@nazarewk:matrix.org"; + github = "nazarewk"; + githubId = 3494992; + keys = [{ + longkeyid = "rsa4096/0x916D8B67241892AE"; + fingerprint = "4BFF 0614 03A2 47F0 AA0B 4BC4 916D 8B67 2418 92AE"; + }]; + }; + nbr = { + email = "nbr@users.noreply.github.com"; + github = "nbr"; + githubId = 3819225; + name = "Nick Braga"; + }; + nbren12 = { + email = "nbren12@gmail.com"; + github = "nbren12"; + githubId = 1386642; + name = "Noah Brenowitz"; + }; + ncfavier = { + email = "n@monade.li"; + matrix = "@ncfavier:matrix.org"; + github = "ncfavier"; + githubId = 4323933; + name = "Naïm Favier"; + keys = [{ + longkeyid = "rsa2048/0x49B07322580B7EE2"; + fingerprint = "51A0 705E 7DD2 3CBC 5EAA B43E 49B0 7322 580B 7EE2"; + }]; + }; + nckx = { + email = "github@tobias.gr"; + github = "nckx"; + githubId = 364510; + name = "Tobias Geerinckx-Rice"; + }; + ndl = { + email = "ndl@endl.ch"; + github = "ndl"; + githubId = 137805; + name = "Alexander Tsvyashchenko"; + }; + neeasade = { + email = "nathanisom27@gmail.com"; + github = "neeasade"; + githubId = 3747396; + name = "Nathan Isom"; + }; + nelsonjeppesen = { + email = "nix@jeppesen.io"; + github = "NelsonJeppesen"; + githubId = 50854675; + name = "Nelson Jeppesen"; + }; + neonfuz = { + email = "neonfuz@gmail.com"; + github = "neonfuz"; + githubId = 2590830; + name = "Sage Raflik"; + }; + neosimsim = { + email = "me@abn.sh"; + github = "neosimsim"; + githubId = 1771772; + name = "Alexander Ben Nasrallah"; + }; + nequissimus = { + email = "tim@nequissimus.com"; + github = "nequissimus"; + githubId = 628342; + name = "Tim Steinbach"; + }; + nerdypepper = { + email = "nerdy@peppe.rs"; + github = "nerdypepper"; + githubId = 23743547; + name = "Akshay Oppiliappan"; + }; + nessdoor = { + name = "Tomas Antonio Lopez"; + email = "entropy.overseer@protonmail.com"; + githubId = 25993494; + }; + netcrns = { + email = "jason.wing@gmx.de"; + github = "netcrns"; + githubId = 34162313; + name = "Jason Wing"; + }; + netixx = { + email = "dev.espinetfrancois@gmail.com"; + github = "netixx"; + githubId = 1488603; + name = "François Espinet"; + }; + neverbehave = { + email = "i@never.pet"; + github = "NeverBehave"; + githubId = 17120571; + name = "Xinhao Luo"; + }; + newam = { + email = "alex@thinglab.org"; + github = "newAM"; + githubId = 7845120; + name = "Alex Martens"; + }; + nialov = { + email = "nikolasovaskainen@gmail.com"; + github = "nialov"; + githubId = 47318483; + name = "Nikolas Ovaskainen"; + }; + nikitavoloboev = { + email = "nikita.voloboev@gmail.com"; + github = "nikitavoloboev"; + githubId = 6391776; + name = "Nikita Voloboev"; + }; + nfjinjing = { + email = "nfjinjing@gmail.com"; + name = "Jinjing Wang"; + }; + nh2 = { + email = "mail@nh2.me"; + matrix = "@nh2:matrix.org"; + github = "nh2"; + githubId = 399535; + name = "Niklas Hambüchen"; + }; + nhooyr = { + email = "anmol@aubble.com"; + github = "nhooyr"; + githubId = 10180857; + name = "Anmol Sethi"; + }; + nicbk = { + email = "nicolas@nicbk.com"; + github = "nicbk"; + githubId = 77309427; + name = "Nicolás Kennedy"; + keys = [{ + longkeyid = "rsa4096/0xC061089EFEBF7A35"; + fingerprint = "7BC1 77D9 C222 B1DC FB2F 0484 C061 089E FEBF 7A35"; + }]; + }; + nichtsfrei = { + email = "philipp.eder@posteo.net"; + github = "nichtsfrei"; + githubId = 1665818; + name = "Philipp Eder"; + }; + nickcao = { + name = "Nick Cao"; + email = "nickcao@nichi.co"; + github = "NickCao"; + githubId = 15247171; + }; + nickhu = { + email = "me@nickhu.co.uk"; + github = "nickhu"; + githubId = 450276; + name = "Nick Hu"; + }; + nicknovitski = { + email = "nixpkgs@nicknovitski.com"; + github = "nicknovitski"; + githubId = 151337; + name = "Nick Novitski"; + }; + nico202 = { + email = "anothersms@gmail.com"; + github = "nico202"; + githubId = 8214542; + name = "Nicolò Balzarotti"; + }; + nidabdella = { + name = "Mohamed Nidabdella"; + email = "nidabdella.mohamed@gmail.com"; + github = "nidabdella"; + githubId = 8083813; + }; + NieDzejkob = { + email = "kuba@kadziolka.net"; + github = "NieDzejkob"; + githubId = 23580910; + name = "Jakub Kądziołka"; + keys = [{ + longkeyid = "rsa4096/0xE315A75846131564"; + fingerprint = "E576 BFB2 CF6E B13D F571 33B9 E315 A758 4613 1564"; + }]; + }; + NikolaMandic = { + email = "nikola@mandic.email"; + github = "NikolaMandic"; + githubId = 4368690; + name = "Ratko Mladic"; + }; + nilp0inter = { + email = "robertomartinezp@gmail.com"; + github = "nilp0inter"; + githubId = 1224006; + name = "Roberto Abdelkader Martínez Pérez"; + }; + nilsirl = { + email = "nils@nilsand.re"; + github = "NilsIrl"; + githubId = 26231126; + name = "Nils ANDRÉ-CHANG"; + }; + nils-degroot = { + email = "nils@peeko.nl"; + github = "nils-degroot"; + githubId = 53556985; + name = "Nils de Groot"; + }; + ninjatrappeur = { + email = "felix@alternativebit.fr"; + matrix = "@ninjatrappeur:matrix.org"; + github = "ninjatrappeur"; + githubId = 1219785; + name = "Félix Baylac-Jacqué"; + }; + ninjin = { + email = "pontus@stenetorp.se"; + github = "ninjin"; + githubId = 354934; + name = "Pontus Stenetorp"; + keys = [{ + longkeyid = "rsa4096/0xD430287500E6483C"; + fingerprint = "0966 2F9F 3FDA C22B C22E 4CE1 D430 2875 00E6 483C"; + }]; + }; + nioncode = { + email = "nioncode+github@gmail.com"; + github = "nioncode"; + githubId = 3159451; + name = "Nicolas Schneider"; + }; + nkje = { + name = "Niels Kristian Lyshøj Jensen"; + email = "n@nk.je"; + github = "NKJe"; + githubId = 1102306; + keys = [{ + longkeyid = "nistp256/0xDE3BADFECD31A89D"; + fingerprint = "B956 C6A4 22AF 86A0 8F77 A8CA DE3B ADFE CD31 A89D"; + }]; + }; + nitsky = { + name = "nitsky"; + email = "492793+nitsky@users.noreply.github.com"; + github = "nitsky"; + githubId = 492793; + }; + nkpvk = { + email = "niko.pavlinek@gmail.com"; + github = "nkpvk"; + githubId = 16385648; + name = "Niko Pavlinek"; + }; + nixbitcoin = { + email = "nixbitcoin@i2pmail.org"; + github = "nixbitcoin"; + githubId = 45737139; + name = "nixbitcoindev"; + keys = [{ + longkeyid = "rsa4096/0xDD11F9AD5308B3BA"; + fingerprint = "577A 3452 7F3E 2A85 E80F E164 DD11 F9AD 5308 B3BA"; + }]; + }; + nixinator = { + email = "33lockdown33@protonmail.com"; + matrix = "@nixinator:nixos.dev"; + github = "nixinator"; + githubId = 66913205; + name = "Rick Sanchez"; + }; + nixy = { + email = "nixy@nixy.moe"; + github = "nixy"; + githubId = 7588406; + name = "Andrew R. M."; + }; + nkalupahana = { + email = "hello@nisa.la"; + github = "nkalupahana"; + githubId = 7347290; + name = "Nisala Kalupahana"; + }; + nloomans = { + email = "noah@nixos.noahloomans.com"; + github = "nloomans"; + githubId = 7829481; + name = "Noah Loomans"; + }; + nmattia = { + email = "nicolas@nmattia.com"; + github = "nmattia"; + githubId = 6930756; + name = "Nicolas Mattia"; + }; + nobbz = { + name = "Norbert Melzer"; + email = "timmelzer+nixpkgs@gmail.com"; + github = "NobbZ"; + githubId = 58951; + }; + nocoolnametom = { + email = "nocoolnametom@gmail.com"; + github = "nocoolnametom"; + githubId = 810877; + name = "Tom Doggett"; + }; + noisersup = { + email = "patryk@kwiatek.xyz"; + github = "noisersup"; + githubId = 42322511; + name = "Patryk Kwiatek"; + }; + nomeata = { + email = "mail@joachim-breitner.de"; + github = "nomeata"; + githubId = 148037; + name = "Joachim Breitner"; + }; + nomisiv = { + email = "simon@nomisiv.com"; + github = "NomisIV"; + githubId = 47303199; + name = "Simon Gutgesell"; + }; + noneucat = { + email = "andy@lolc.at"; + matrix = "@noneucat:lolc.at"; + github = "noneucat"; + githubId = 40049608; + name = "Andy Chun"; + }; + noreferences = { + email = "norkus@norkus.net"; + github = "jozuas"; + githubId = 13085275; + name = "Juozas Norkus"; + }; + norfair = { + email = "syd@cs-syd.eu"; + github = "NorfairKing"; + githubId = 3521180; + name = "Tom Sydney Kerckhove"; + }; + notthemessiah = { + email = "brian.cohen.88@gmail.com"; + github = "notthemessiah"; + githubId = 2946283; + name = "Brian Cohen"; + }; + novoxd = { + email = "radnovox@gmail.com"; + github = "novoxd"; + githubId = 6052922; + name = "Kirill Struokov"; + }; + np = { + email = "np.nix@nicolaspouillard.fr"; + github = "np"; + githubId = 5548; + name = "Nicolas Pouillard"; + }; + nphilou = { + email = "nphilou@gmail.com"; + github = "nphilou"; + githubId = 9939720; + name = "Philippe Nguyen"; + }; + nrdxp = { + email = "tim.deh@pm.me"; + matrix = "@timdeh:matrix.org"; + github = "nrdxp"; + githubId = 34083928; + name = "Tim DeHerrera"; + }; + nshalman = { + email = "nahamu@gmail.com"; + github = "nshalman"; + githubId = 20391; + name = "Nahum Shalman"; + }; + nslqqq = { + email = "nslqqq@gmail.com"; + name = "Nikita Mikhailov"; + }; + nthorne = { + email = "notrupertthorne@gmail.com"; + github = "nthorne"; + githubId = 1839979; + name = "Niklas Thörne"; + }; + nukaduka = { + email = "ksgokte@gmail.com"; + github = "NukaDuka"; + githubId = 22592293; + name = "Kartik Gokte"; + }; + nullx76 = { + email = "nix@xirion.net"; + github = "NULLx76"; + githubId = 1809198; + name = "Victor Roest"; + }; + numinit = { + email = "me@numin.it"; + github = "numinit"; + githubId = 369111; + name = "Morgan Jones"; + }; + numkem = { + name = "Sebastien Bariteau"; + email = "numkem@numkem.org"; + matrix = "@numkem:matrix.org"; + github = "numkem"; + githubId = 332423; + }; + nyanloutre = { + email = "paul@nyanlout.re"; + github = "nyanloutre"; + githubId = 7677321; + name = "Paul Trehiou"; + }; + nyanotech = { + name = "nyanotech"; + email = "nyanotechnology@gmail.com"; + github = "nyanotech"; + githubId = 33802077; + }; + nyarly = { + email = "nyarly@gmail.com"; + github = "nyarly"; + githubId = 127548; + name = "Judson Lester"; + }; + nzbr = { + email = "nixos@nzbr.de"; + github = "nzbr"; + githubId = 7851175; + name = "nzbr"; + matrix = "@nzbr:nzbr.de"; + keys = [{ + longkeyid = "rsa2048/0x6C78B50B97A42F8A"; + fingerprint = "BF3A 3EE6 3144 2C5F C9FB 39A7 6C78 B50B 97A4 2F8A"; + }]; + }; + nzhang-zh = { + email = "n.zhang.hp.au@gmail.com"; + github = "nzhang-zh"; + githubId = 30825096; + name = "Ning Zhang"; + }; + obadz = { + email = "obadz-nixos@obadz.com"; + github = "obadz"; + githubId = 3359345; + name = "obadz"; + }; + obsidian-systems-maintenance = { + name = "Obsidian Systems Maintenance"; + email = "maintainer@obsidian.systems"; + github = "obsidian-systems-maintenance"; + githubId = 80847921; + }; + obfusk = { + email = "flx@obfusk.net"; + matrix = "@obfusk:matrix.org"; + github = "obfusk"; + githubId = 1260687; + name = "Felix C. Stegerman"; + keys = [{ + longkeyid = "rsa4096/0x2F9607F09B360F2D"; + fingerprint = "D5E4 A51D F8D2 55B9 FAC6 A9BB 2F96 07F0 9B36 0F2D"; + }]; + }; + odi = { + email = "oliver.dunkl@gmail.com"; + github = "odi"; + githubId = 158758; + name = "Oliver Dunkl"; + }; + ofek = { + email = "oss@ofek.dev"; + github = "ofek"; + githubId = 9677399; + name = "Ofek Lev"; + }; + offline = { + email = "jaka@x-truder.net"; + github = "offlinehacker"; + githubId = 585547; + name = "Jaka Hudoklin"; + }; + oida = { + email = "oida@posteo.de"; + github = "oida"; + githubId = 7249506; + name = "oida"; + }; + okasu = { + email = "oka.sux@gmail.com"; + name = "Okasu"; + }; + olcai = { + email = "dev@timan.info"; + github = "olcai"; + githubId = 20923; + name = "Erik Timan"; + }; + olebedev = { + email = "ole6edev@gmail.com"; + github = "olebedev"; + githubId = 848535; + name = "Oleg Lebedev"; + }; + olejorgenb = { + email = "olejorgenb@yahoo.no"; + github = "olejorgenb"; + githubId = 72201; + name = "Ole Jørgen Brønner"; + }; + ollieB = { + email = "1237862+oliverbunting@users.noreply.github.com"; + github = "oliverbunting"; + githubId = 1237862; + name = "Ollie Bunting"; + }; + olynch = { + email = "owen@olynch.me"; + github = "olynch"; + githubId = 4728903; + name = "Owen Lynch"; + }; + omasanori = { + email = "167209+omasanori@users.noreply.github.com"; + github = "omasanori"; + githubId = 167209; + name = "Masanori Ogino"; + }; + omgbebebe = { + email = "omgbebebe@gmail.com"; + github = "omgbebebe"; + githubId = 588167; + name = "Sergey Bubnov"; + }; + omnipotententity = { + email = "omnipotententity@gmail.com"; + github = "omnipotententity"; + githubId = 1538622; + name = "Michael Reilly"; + }; + onixie = { + email = "onixie@gmail.com"; + github = "onixie"; + githubId = 817073; + name = "Yc. Shen"; + }; + onsails = { + email = "andrey@onsails.com"; + github = "onsails"; + githubId = 107261; + name = "Andrey Kuznetsov"; + }; + onny = { + email = "onny@project-insanity.org"; + github = "onny"; + githubId = 757752; + name = "Jonas Heinrich"; + }; + ony = { + name = "Mykola Orliuk"; + email = "virkony@gmail.com"; + github = "ony"; + githubId = 11265; + }; + OPNA2608 = { + email = "christoph.neidahl@gmail.com"; + github = "OPNA2608"; + githubId = 23431373; + name = "Christoph Neidahl"; + }; + opeik = { + email = "sandro@stikic.com"; + github = "opeik"; + githubId = 11566773; + name = "Sandro Stikić"; + }; + orbekk = { + email = "kjetil.orbekk@gmail.com"; + github = "orbekk"; + githubId = 19862; + name = "KJ Ørbekk"; + }; + orbitz = { + email = "mmatalka@gmail.com"; + github = "orbitz"; + githubId = 75299; + name = "Malcolm Matalka"; + }; + orivej = { + email = "orivej@gmx.fr"; + github = "orivej"; + githubId = 101514; + name = "Orivej Desh"; + }; + ornxka = { + email = "ornxka@littledevil.sh"; + github = "ornxka"; + githubId = 52086525; + name = "ornxka"; + }; + oro = { + email = "marco@orovecchia.at"; + github = "oro"; + githubId = 357005; + name = "Marco Orovecchia"; + }; + osener = { + email = "ozan@ozansener.com"; + github = "osener"; + githubId = 111265; + name = "Ozan Sener"; + }; + otavio = { + email = "otavio.salvador@ossystems.com.br"; + github = "otavio"; + githubId = 25278; + name = "Otavio Salvador"; + }; + otwieracz = { + email = "slawek@otwiera.cz"; + github = "otwieracz"; + githubId = 108072; + name = "Slawomir Gonet"; + }; + oxalica = { + email = "oxalicc@pm.me"; + github = "oxalica"; + githubId = 14816024; + name = "oxalica"; + keys = [{ + longkeyid = "rsa4096/0xCED392DE0C483D00"; + fingerprint = "5CB0 E9E5 D5D5 71F5 7F54 0FEA CED3 92DE 0C48 3D00"; + }]; + }; + oxij = { + email = "oxij@oxij.org"; + github = "oxij"; + githubId = 391919; + name = "Jan Malakhovski"; + keys = [{ + longkeyid = "rsa2048/0x0E6CA66E5C557AA8"; + fingerprint = "514B B966 B46E 3565 0508 86E8 0E6C A66E 5C55 7AA8"; + }]; + }; + oxzi = { + email = "post@0x21.biz"; + github = "oxzi"; + githubId = 8402811; + name = "Alvar Penning"; + keys = [{ + longkeyid = "rsa4096/0xF32A45637FA25E31"; + fingerprint = "EB14 4E67 E57D 27E2 B5A4 CD8C F32A 4563 7FA2 5E31"; + }]; + }; + oyren = { + email = "m.scheuren@oyra.eu"; + github = "oyren"; + githubId = 15930073; + name = "Moritz Scheuren"; + }; + ozkutuk = { + email = "ozkutuk@protonmail.com"; + github = "ozkutuk"; + githubId = 5948762; + name = "Berk Özkütük"; + }; + pablovsky = { + email = "dealberapablo07@gmail.com"; + github = "pablo1107"; + githubId = 17091659; + name = "Pablo Andres Dealbera"; + }; + pacien = { + email = "b4gx3q.nixpkgs@pacien.net"; + github = "pacien"; + githubId = 1449319; + name = "Pacien Tran-Girard"; + }; + pacman99 = { + email = "pachum99@gmail.com"; + matrix = "@pachumicchu:myrdd.info"; + github = "Pacman99"; + githubId = 16345849; + name = "Parthiv Seetharaman"; + }; + paddygord = { + email = "pgpatrickgordon@gmail.com"; + github = "paddygord"; + githubId = 10776658; + name = "Patrick Gordon"; + }; + paholg = { + email = "paho@paholg.com"; + github = "paholg"; + githubId = 4908217; + name = "Paho Lurie-Gregg"; + }; + pakhfn = { + email = "pakhfn@gmail.com"; + github = "pakhfn"; + githubId = 11016164; + name = "Fedor Pakhomov"; + }; + paluh = { + email = "paluho@gmail.com"; + github = "paluh"; + githubId = 190249; + name = "Tomasz Rybarczyk"; + }; + pamplemousse = { + email = "xav.maso@gmail.com"; + matrix = "@pamplemouss_:matrix.org"; + github = "Pamplemousse"; + githubId = 2647236; + name = "Xavier Maso"; + }; + panaeon = { + email = "vitalii.voloshyn@gmail.com"; + github = "panaeon"; + githubId = 686076; + name = "Vitalii Voloshyn"; + }; + pandaman = { + email = "kointosudesuyo@infoseek.jp"; + github = "pandaman64"; + githubId = 1788628; + name = "pandaman"; + }; + paperdigits = { + email = "mica@silentumbrella.com"; + github = "paperdigits"; + githubId = 71795; + name = "Mica Semrick"; + }; + papojari = { + email = "papojari-git.ovoid@aleeas.com"; + matrix = "@papojari:artemislena.eu"; + github = "papojari"; + githubId = 81317317; + name = "papojari"; + }; + paraseba = { + email = "paraseba@gmail.com"; + github = "paraseba"; + githubId = 20792; + name = "Sebastian Galkin"; + }; + parasrah = { + email = "nixos@parasrah.com"; + github = "parasrah"; + githubId = 14935550; + name = "Brad Pfannmuller"; + }; + pashashocky = { + email = "pashashocky@gmail.com"; + github = "pashashocky"; + githubId = 673857; + name = "Pash Shocky"; + }; + pashev = { + email = "pashev.igor@gmail.com"; + github = "ip1981"; + githubId = 131844; + name = "Igor Pashev"; + }; + pasqui23 = { + email = "p3dimaria@hotmail.it"; + github = "pasqui23"; + githubId = 6931743; + name = "pasqui23"; + }; + patryk27 = { + email = "pwychowaniec@pm.me"; + github = "Patryk27"; + githubId = 3395477; + name = "Patryk Wychowaniec"; + keys = [{ + longkeyid = "rsa4096/0xF62547D075E09767"; + fingerprint = "196A BFEC 6A1D D1EC 7594 F8D1 F625 47D0 75E0 9767"; + }]; + }; + patternspandemic = { + email = "patternspandemic@live.com"; + github = "patternspandemic"; + githubId = 15645854; + name = "Brad Christensen"; + }; + payas = { + email = "relekarpayas@gmail.com"; + github = "payasrelekar"; + githubId = 24254289; + name = "Payas Relekar"; + }; + pawelpacana = { + email = "pawel.pacana@gmail.com"; + github = "pawelpacana"; + githubId = 116740; + name = "Paweł Pacana"; + }; + pb- = { + email = "pbaecher@gmail.com"; + github = "pb-"; + githubId = 84886; + name = "Paul Baecher"; + }; + pbogdan = { + email = "ppbogdan@gmail.com"; + github = "pbogdan"; + githubId = 157610; + name = "Piotr Bogdan"; + }; + pborzenkov = { + email = "pavel@borzenkov.net"; + github = "pborzenkov"; + githubId = 434254; + name = "Pavel Borzenkov"; + }; + pblkt = { + email = "pebblekite@gmail.com"; + github = "pblkt"; + githubId = 6498458; + name = "pebble kite"; + }; + pcarrier = { + email = "pc@rrier.ca"; + github = "pcarrier"; + githubId = 8641; + name = "Pierre Carrier"; + }; + penguwin = { + email = "penguwin@penguwin.eu"; + github = "penguwin"; + githubId = 13225611; + name = "Nicolas Martin"; + }; + pennae = { + name = "pennae"; + email = "github@quasiparticle.net"; + github = "pennae"; + githubId = 82953136; + }; + p3psi = { + name = "Elliot Boo"; + email = "p3psi.boo@gmail.com"; + github = "p3psi-boo"; + githubId = 43925055; + }; + periklis = { + email = "theopompos@gmail.com"; + github = "periklis"; + githubId = 152312; + name = "Periklis Tsirakidis"; + }; + petabyteboy = { + email = "milan@petabyte.dev"; + matrix = "@milan:petabyte.dev"; + github = "petabyteboy"; + githubId = 3250809; + name = "Milan Pässler"; + }; + petercommand = { + email = "petercommand@gmail.com"; + github = "petercommand"; + githubId = 1260660; + name = "petercommand"; + }; + peterhoeg = { + email = "peter@hoeg.com"; + matrix = "@peter:hoeg.com"; + github = "peterhoeg"; + githubId = 722550; + name = "Peter Hoeg"; + }; + peterromfeldhk = { + email = "peter.romfeld.hk@gmail.com"; + github = "peterromfeldhk"; + githubId = 5515707; + name = "Peter Romfeld"; + }; + petersjt014 = { + email = "petersjt014@gmail.com"; + github = "petersjt014"; + githubId = 29493551; + name = "Josh Peters"; + }; + peti = { + email = "simons@cryp.to"; + github = "peti"; + githubId = 28323; + name = "Peter Simons"; + }; + petrosagg = { + email = "petrosagg@gmail.com"; + github = "petrosagg"; + githubId = 939420; + name = "Petros Angelatos"; + }; + petterstorvik = { + email = "petterstorvik@gmail.com"; + github = "storvik"; + githubId = 3438604; + name = "Petter Storvik"; + }; + p-h = { + email = "p@hurlimann.org"; + github = "p-h"; + githubId = 645664; + name = "Philippe Hürlimann"; + }; + philandstuff = { + email = "philip.g.potter@gmail.com"; + github = "philandstuff"; + githubId = 581269; + name = "Philip Potter"; + }; + phile314 = { + email = "nix@314.ch"; + github = "phile314"; + githubId = 1640697; + name = "Philipp Hausmann"; + }; + Philipp-M = { + email = "philipp@mildenberger.me"; + github = "Philipp-M"; + githubId = 9267430; + name = "Philipp Mildenberger"; + }; + Phlogistique = { + email = "noe.rubinstein@gmail.com"; + github = "Phlogistique"; + githubId = 421510; + name = "Noé Rubinstein"; + }; + photex = { + email = "photex@gmail.com"; + github = "photex"; + githubId = 301903; + name = "Chip Collier"; + }; + phryneas = { + email = "mail@lenzw.de"; + github = "phryneas"; + githubId = 4282439; + name = "Lenz Weber"; + }; + phunehehe = { + email = "phunehehe@gmail.com"; + github = "phunehehe"; + githubId = 627831; + name = "Hoang Xuan Phu"; + }; + piegames = { + name = "piegames"; + email = "nix@piegames.de"; + matrix = "@piegames:matrix.org"; + github = "piegamesde"; + githubId = 14054505; + }; + pierrechevalier83 = { + email = "pierrechevalier83@gmail.com"; + github = "pierrechevalier83"; + githubId = 5790907; + name = "Pierre Chevalier"; + }; + pierreis = { + email = "pierre@pierre.is"; + github = "pierreis"; + githubId = 203973; + name = "Pierre Matri"; + }; + pierrer = { + email = "pierrer@pi3r.be"; + github = "pierrer"; + githubId = 93115; + name = "Pierre Radermecker"; + }; + pierron = { + email = "nixos@nbp.name"; + github = "nbp"; + githubId = 1179566; + name = "Nicolas B. Pierron"; + }; + pimeys = { + email = "julius@nauk.io"; + github = "pimeys"; + githubId = 34967; + name = "Julius de Bruijn"; + }; + pingiun = { + email = "nixos@pingiun.com"; + github = "pingiun"; + githubId = 1576660; + name = "Jelle Besseling"; + keys = [{ + longkeyid = "rsa4096/0x9712452E8BE3372E"; + fingerprint = "A3A3 65AE 16ED A7A0 C29C 88F1 9712 452E 8BE3 372E"; + }]; + }; + pinpox = { + email = "mail@pablo.tools"; + github = "pinpox"; + githubId = 1719781; + name = "Pablo Ovelleiro Corral"; + keys = [{ + longkeyid = "rsa4096/0x823A6154426408D3"; + fingerprint = "D03B 218C AE77 1F77 D7F9 20D9 823A 6154 4264 08D3"; + }]; + }; + piotr = { + email = "ppietrasa@gmail.com"; + name = "Piotr Pietraszkiewicz"; + }; + pjbarnoy = { + email = "pjbarnoy@gmail.com"; + github = "pjbarnoy"; + githubId = 119460; + name = "Perry Barnoy"; + }; + pjjw = { + email = "peter@shortbus.org"; + github = "pjjw"; + githubId = 638; + name = "Peter Woodman"; + }; + pjones = { + email = "pjones@devalot.com"; + github = "pjones"; + githubId = 3737; + name = "Peter Jones"; + }; + pkmx = { + email = "pkmx.tw@gmail.com"; + github = "pkmx"; + githubId = 610615; + name = "Chih-Mao Chen"; + }; + plabadens = { + name = "Pierre Labadens"; + email = "labadens.pierre+nixpkgs@gmail.com"; + github = "plabadens"; + githubId = 4303706; + keys = [{ + longkeyid = "rsa2048/0xF55814E4D6874375"; + fingerprint = "B00F E582 FD3F 0732 EA48 3937 F558 14E4 D687 4375"; + }]; + }; + plchldr = { + email = "mail@oddco.de"; + github = "plchldr"; + githubId = 11639001; + name = "Jonas Beyer"; + }; + plcplc = { + email = "plcplc@gmail.com"; + github = "plcplc"; + githubId = 358550; + name = "Philip Lykke Carlsen"; + }; + plumps = { + email = "maks.bronsky@web.de"; + github = "plumps"; + githubId = 13000278; + name = "Maksim Bronsky"; + }; + PlushBeaver = { + name = "Dmitry Kozlyuk"; + email = "dmitry.kozliuk+nixpkgs@gmail.com"; + github = "PlushBeaver"; + githubId = 8988269; + }; + pmahoney = { + email = "pat@polycrystal.org"; + github = "pmahoney"; + githubId = 103822; + name = "Patrick Mahoney"; + }; + pmenke = { + email = "nixos@pmenke.de"; + github = "pmenke-de"; + githubId = 898922; + name = "Philipp Menke"; + keys = [{ + longkeyid = "rsa4096/0xEB7F2D4CCBE23B69"; + fingerprint = "ED54 5EFD 64B6 B5AA EC61 8C16 EB7F 2D4C CBE2 3B69"; + }]; + }; + pmeunier = { + email = "pierre-etienne.meunier@inria.fr"; + github = "P-E-Meunier"; + githubId = 17021304; + name = "Pierre-Étienne Meunier"; + }; + pmiddend = { + email = "pmidden@secure.mailbox.org"; + github = "pmiddend"; + githubId = 178496; + name = "Philipp Middendorf"; + }; + pmy = { + email = "pmy@xqzp.net"; + github = "pmeiyu"; + githubId = 8529551; + name = "Peng Mei Yu"; + }; + pmyjavec = { + email = "pauly@myjavec.com"; + github = "pmyjavec"; + githubId = 315096; + name = "Pauly Myjavec"; + }; + pnelson = { + email = "me@pnelson.ca"; + github = "pnelson"; + githubId = 579773; + name = "Philip Nelson"; + }; + pneumaticat = { + email = "kevin@potatofrom.space"; + github = "pneumaticat"; + githubId = 11365056; + name = "Kevin Liu"; + }; + pnmadelaine = { + name = "Paul-Nicolas Madelaine"; + email = "pnm@pnm.tf"; + github = "pnmadelaine"; + githubId = 21977014; + }; + pnotequalnp = { + email = "kevin@pnotequalnp.com"; + github = "pnotequalnp"; + githubId = 46154511; + name = "Kevin Mullins"; + keys = [{ + longkeyid = "rsa4096/361820A45DB41E9A"; + fingerprint = "2CD2 B030 BD22 32EF DF5A 008A 3618 20A4 5DB4 1E9A"; + }]; + }; + polendri = { + email = "paul@ijj.li"; + github = "polendri"; + githubId = 1829032; + name = "Paul Hendry"; + }; + polygon = { + email = "polygon@wh2.tu-dresden.de"; + name = "Polygon"; + github = "polygon"; + githubId = 51489; + }; + polykernel = { + email = "81340136+polykernel@users.noreply.github.com"; + github = "polykernel"; + githubId = 81340136; + name = "polykernel"; + }; + polyrod = { + email = "dc1mdp@gmail.com"; + github = "polyrod"; + githubId = 24878306; + name = "Maurizio Di Pietro"; + }; + pombeirp = { + email = "nix@endgr.33mail.com"; + github = "PombeirP"; + githubId = 138074; + name = "Pedro Pombeiro"; + }; + poscat = { + email = "poscat@mail.poscat.moe"; + github = "poscat0x04"; + githubId = 53291983; + name = "Poscat Tarski"; + keys = [{ + longkeyid = "rsa4096/2D2595A00D08ACE0"; + fingerprint = "48AD DE10 F27B AFB4 7BB0 CCAF 2D25 95A0 0D08 ACE0"; + }]; + }; + ppom = { + name = "Paco Pompeani"; + email = "paco@ecomail.io"; + github = "aopom"; + githubId = 38916722; + }; + pradeepchhetri = { + email = "pradeep.chhetri89@gmail.com"; + github = "pradeepchhetri"; + githubId = 2232667; + name = "Pradeep Chhetri"; + }; + pradyuman = { + email = "me@pradyuman.co"; + github = "pradyuman"; + githubId = 9904569; + name = "Pradyuman Vig"; + keys = [{ + longkeyid = "rsa4096/4F74D5361C4CA31E"; + fingerprint = "240B 57DE 4271 2480 7CE3 EAC8 4F74 D536 1C4C A31E"; + }]; + }; + preisschild = { + email = "florian@florianstroeger.com"; + github = "Preisschild"; + githubId = 11898437; + name = "Florian Ströger"; + }; + priegger = { + email = "philipp@riegger.name"; + github = "priegger"; + githubId = 228931; + name = "Philipp Riegger"; + }; + prikhi = { + email = "pavan.rikhi@gmail.com"; + github = "prikhi"; + githubId = 1304102; + name = "Pavan Rikhi"; + }; + primeos = { + email = "dev.primeos@gmail.com"; + matrix = "@primeos:matrix.org"; + github = "primeos"; + githubId = 7537109; + name = "Michael Weiss"; + keys = [ + { + longkeyid = "ed25519/0x130826A6C2A389FD"; # Git only + fingerprint = "86A7 4A55 07D0 58D1 322E 37FD 1308 26A6 C2A3 89FD"; + } + { + longkeyid = "rsa3072/0xBCA9943DD1DF4C04"; # Email, etc. + fingerprint = "AF85 991C C950 49A2 4205 1933 BCA9 943D D1DF 4C04"; + } + ]; + }; + Profpatsch = { + email = "mail@profpatsch.de"; + github = "Profpatsch"; + githubId = 3153638; + name = "Profpatsch"; + }; + proglodyte = { + email = "proglodyte23@gmail.com"; + github = "proglodyte"; + githubId = 18549627; + name = "Proglodyte"; + }; + progval = { + email = "progval+nix@progval.net"; + github = "ProgVal"; + githubId = 406946; + name = "Valentin Lorentz"; + }; + proofofkeags = { + email = "keagan.mcclelland@gmail.com"; + github = "ProofOfKeags"; + githubId = 4033651; + name = "Keagan McClelland"; + }; + protoben = { + email = "protob3n@gmail.com"; + github = "protoben"; + githubId = 4633847; + name = "Ben Hamlin"; + }; + prusnak = { + email = "pavol@rusnak.io"; + github = "prusnak"; + githubId = 42201; + name = "Pavol Rusnak"; + keys = [{ + longkeyid = "rsa4096/0x91F3B339B9A02A3D"; + fingerprint = "86E6 792F C27B FD47 8860 C110 91F3 B339 B9A0 2A3D"; + }]; + }; + psanford = { + email = "psanford@sanford.io"; + github = "psanford"; + githubId = 33375; + name = "Peter Sanford"; + }; + pshirshov = { + email = "pshirshov@eml.cc"; + github = "pshirshov"; + githubId = 295225; + name = "Pavel Shirshov"; + }; + psibi = { + email = "sibi@psibi.in"; + matrix = "@psibi:matrix.org"; + github = "psibi"; + githubId = 737477; + name = "Sibi Prabakaran"; + }; + pstn = { + email = "philipp@xndr.de"; + github = "pstn"; + githubId = 1329940; + name = "Philipp Steinpaß"; + }; + pSub = { + email = "mail@pascal-wittmann.de"; + github = "pSub"; + githubId = 83842; + name = "Pascal Wittmann"; + }; + psyanticy = { + email = "iuns@outlook.fr"; + github = "PsyanticY"; + githubId = 20524473; + name = "Psyanticy"; + }; + psydvl = { + email = "psydvl@fea.st"; + github = "psydvl"; + githubId = 43755002; + name = "Dmitriy P"; + }; + ptival = { + email = "valentin.robert.42@gmail.com"; + github = "Ptival"; + githubId = 478606; + name = "Valentin Robert"; + }; + ptrhlm = { + email = "ptrhlm0@gmail.com"; + github = "ptrhlm"; + githubId = 9568176; + name = "Piotr Halama"; + }; + puckipedia = { + email = "puck@puckipedia.com"; + github = "puckipedia"; + githubId = 488734; + name = "Puck Meerburg"; + }; + puffnfresh = { + email = "brian@brianmckenna.org"; + github = "puffnfresh"; + githubId = 37715; + name = "Brian McKenna"; + }; + purcell = { + email = "steve@sanityinc.com"; + github = "purcell"; + githubId = 5636; + name = "Steve Purcell"; + }; + putchar = { + email = "slim.cadoux@gmail.com"; + matrix = "@putch4r:matrix.org"; + github = "putchar"; + githubId = 8208767; + name = "Slim Cadoux"; + }; + puzzlewolf = { + email = "nixos@nora.pink"; + github = "puzzlewolf"; + githubId = 23097564; + name = "Nora Widdecke"; + }; + pyrolagus = { + email = "pyrolagus@gmail.com"; + github = "PyroLagus"; + githubId = 4579165; + name = "Danny Bautista"; + }; + peelz = { + email = "peelz.dev+nixpkgs@gmail.com"; + github = "louistakepillz"; + githubId = 920910; + name = "peelz"; + }; + q3k = { + email = "q3k@q3k.org"; + github = "q3k"; + githubId = 315234; + name = "Serge Bazanski"; + }; + qknight = { + email = "js@lastlog.de"; + github = "qknight"; + githubId = 137406; + name = "Joachim Schiele"; + }; + qoelet = { + email = "kenny@machinesung.com"; + github = "qoelet"; + githubId = 115877; + name = "Kenny Shen"; + }; + queezle = { + email = "git@queezle.net"; + github = "qzle"; + githubId = 1024891; + name = "Jens Nolte"; + }; + quentini = { + email = "quentini@airmail.cc"; + github = "QuentinI"; + githubId = 18196237; + name = "Quentin Inkling"; + }; + qyliss = { + email = "hi@alyssa.is"; + github = "alyssais"; + githubId = 2768870; + name = "Alyssa Ross"; + keys = [{ + longkeyid = "rsa4096/736CCDF9EF51BD97"; + fingerprint = "7573 56D7 79BB B888 773E 415E 736C CDF9 EF51 BD97"; + }]; + }; + r-burns = { + email = "rtburns@protonmail.com"; + github = "r-burns"; + githubId = 52847440; + name = "Ryan Burns"; + }; + r3dl3g = { + email = "redleg@rothfuss-web.de"; + github = "r3dl3g"; + githubId = 35229674; + name = "Armin Rothfuss"; + }; + raboof = { + email = "arnout@bzzt.net"; + matrix = "@raboof:matrix.org"; + github = "raboof"; + githubId = 131856; + name = "Arnout Engelen"; + }; + RaghavSood = { + email = "r@raghavsood.com"; + github = "RaghavSood"; + githubId = 903072; + name = "Raghav Sood"; + }; + rafaelgg = { + email = "rafael.garcia.gallego@gmail.com"; + github = "rafaelgg"; + githubId = 1016742; + name = "Rafael García"; + }; + raitobezarius = { + email = "ryan@lahfa.xyz"; + matrix = "@raitobezarius:matrix.org"; + github = "RaitoBezarius"; + githubId = 314564; + name = "Ryan Lahfa"; + }; + raquelgb = { + email = "raquel.garcia.bautista@gmail.com"; + github = "raquelgb"; + githubId = 1246959; + name = "Raquel García"; + }; + ragge = { + email = "r.dahlen@gmail.com"; + github = "ragnard"; + githubId = 882; + name = "Ragnar Dahlen"; + }; + ralith = { + email = "ben.e.saunders@gmail.com"; + matrix = "@ralith:ralith.com"; + github = "ralith"; + githubId = 104558; + name = "Benjamin Saunders"; + }; + ramkromberg = { + email = "ramkromberg@mail.com"; + github = "ramkromberg"; + githubId = 14829269; + name = "Ram Kromberg"; + }; + ranfdev = { + email = "ranfdev@gmail.com"; + name = "Lorenzo Miglietta"; + github = "ranfdev"; + githubId = 23294184; + }; + rardiol = { + email = "ricardo.ardissone@gmail.com"; + github = "rardiol"; + githubId = 11351304; + name = "Ricardo Ardissone"; + }; + rasendubi = { + email = "rasen.dubi@gmail.com"; + github = "rasendubi"; + githubId = 1366419; + name = "Alexey Shmalko"; + }; + raskin = { + email = "7c6f434c@mail.ru"; + github = "7c6f434c"; + githubId = 1891350; + name = "Michael Raskin"; + }; + ratsclub = { + email = "victor@freire.dev.br"; + github = "ratsclub"; + githubId = 25647735; + name = "Victor Freire"; + }; + ravloony = { + email = "ravloony@gmail.com"; + name = "Tom Macdonald"; + }; + rawkode = { + email = "david.andrew.mckay@gmail.com"; + github = "rawkode"; + githubId = 145816; + name = "David McKay"; + }; + razvan = { + email = "razvan.panda@gmail.com"; + github = "razvan-panda"; + githubId = 1758708; + name = "Răzvan Flavius Panda"; + }; + rb2k = { + email = "nix@marc-seeger.com"; + github = "rb2k"; + githubId = 9519; + name = "Marc Seeger"; + }; + rbasso = { + email = "rbasso@sharpgeeks.net"; + github = "rbasso"; + githubId = 16487165; + name = "Rafael Basso"; + }; + rbrewer = { + email = "rwb123@gmail.com"; + github = "rbrewer123"; + githubId = 743058; + name = "Rob Brewer"; + }; + rdnetto = { + email = "rdnetto@gmail.com"; + github = "rdnetto"; + githubId = 1973389; + name = "Reuben D'Netto"; + }; + redbaron = { + email = "ivanov.maxim@gmail.com"; + github = "redbaron"; + githubId = 16624; + name = "Maxim Ivanov"; + }; + reckenrode = { + name = "Randy Eckenrode"; + email = "randy@largeandhighquality.com"; + matrix = "@reckenrode:matrix.org"; + github = "reckenrode"; + githubId = 7413633; + keys = [ + # compare with https://keybase.io/reckenrode + { + longkeyid = "ed25519/0xFBF19A982CCE0048"; + fingerprint = "01D7 5486 3A6D 64EA AC77 0D26 FBF1 9A98 2CCE 0048"; + } + ]; + }; + redfish64 = { + email = "engler@gmail.com"; + github = "redfish64"; + githubId = 1922770; + name = "Tim Engler"; + }; + redvers = { + email = "red@infect.me"; + github = "redvers"; + githubId = 816465; + name = "Redvers Davies"; + }; + reedrw = { + email = "reedrw5601@gmail.com"; + github = "reedrw"; + githubId = 21069876; + name = "Reed Williams"; + }; + refnil = { + email = "broemartino@gmail.com"; + github = "refnil"; + githubId = 1142322; + name = "Martin Lavoie"; + }; + regnat = { + email = "regnat@regnat.ovh"; + github = "regnat"; + githubId = 7226587; + name = "Théophane Hufschmitt"; + }; + relrod = { + email = "ricky@elrod.me"; + github = "relrod"; + githubId = 43930; + name = "Ricky Elrod"; + }; + rembo10 = { + email = "rembo10@users.noreply.github.com"; + github = "rembo10"; + githubId = 801525; + name = "rembo10"; + }; + renatoGarcia = { + email = "fgarcia.renato@gmail.com"; + github = "renatoGarcia"; + githubId = 220211; + name = "Renato Garcia"; + }; + rencire = { + email = "546296+rencire@users.noreply.github.com"; + github = "rencire"; + githubId = 546296; + name = "Eric Ren"; + }; + renesat = { + name = "Ivan Smolyakov"; + email = "smol.ivan97@gmail.com"; + github = "renesat"; + githubId = 11363539; + }; + renzo = { + email = "renzocarbonara@gmail.com"; + github = "k0001"; + githubId = 3302; + name = "Renzo Carbonara"; + }; + retrry = { + email = "retrry@gmail.com"; + github = "retrry"; + githubId = 500703; + name = "Tadas Barzdžius"; + }; + revol-xut = { + email = "revol-xut@protonmail.com"; + name = "Tassilo Tanneberger"; + github = "revol-xut"; + githubId = 32239737; + keys = [{ + longkeyid = "rsa4096/B966009D57E69CC6"; + fingerprint = "91EB E870 1639 1323 642A 6803 B966 009D 57E6 9CC6"; + }]; + }; + rexim = { + email = "reximkut@gmail.com"; + github = "rexim"; + githubId = 165283; + name = "Alexey Kutepov"; + }; + rewine = { + email = "lhongxu@outlook.com"; + github = "wineee"; + githubId = 22803888; + name = "Lu Hongxu"; + }; + rgnns = { + email = "jglievano@gmail.com"; + github = "rgnns"; + githubId = 811827; + name = "Gabriel Lievano"; + }; + rgrunbla = { + email = "remy@grunblatt.org"; + github = "rgrunbla"; + githubId = 42433779; + name = "Rémy Grünblatt"; + }; + rguevara84 = { + email = "fuzztkd@gmail.com"; + github = "rguevara84"; + githubId = 12279531; + name = "Ricardo Guevara"; + }; + rht = { + email = "rhtbot@protonmail.com"; + github = "rht"; + githubId = 395821; + name = "rht"; + }; + rhoriguchi = { + email = "ryan.horiguchi@gmail.com"; + github = "rhoriguchi "; + githubId = 6047658; + name = "Ryan Horiguchi"; + }; + rhysmdnz = { + email = "rhys@memes.nz"; + matrix = "@rhys:memes.nz"; + github = "rhysmdnz"; + githubId = 2162021; + name = "Rhys Davies"; + }; + ribose-jeffreylau = { + name = "Jeffrey Lau"; + email = "jeffrey.lau@ribose.com"; + github = "ribose-jeffreylau"; + githubId = 2649467; + }; + richardipsum = { + email = "richardipsum@fastmail.co.uk"; + github = "richardipsum"; + githubId = 10631029; + name = "Richard Ipsum"; + }; + rick68 = { + email = "rick68@gmail.com"; + github = "rick68"; + githubId = 42619; + name = "Wei-Ming Yang"; + }; + rickynils = { + email = "rickynils@gmail.com"; + github = "rickynils"; + githubId = 16779; + name = "Rickard Nilsson"; + }; + ricochet = { + email = "behayes2@gmail.com"; + github = "ricochet"; + githubId = 974323; + matrix = "@ricochetcode:matrix.org"; + name = "Bailey Hayes"; + }; + riey = { + email = "creeper844@gmail.com"; + github = "Riey"; + githubId = 14910534; + name = "Riey"; + }; + rika = { + email = "rika@paymentswit.ch"; + github = "NekomimiScience"; + githubId = 1810487; + name = "Rika"; + }; + rileyinman = { + email = "rileyminman@gmail.com"; + github = "rileyinman"; + githubId = 37246692; + name = "Riley Inman"; + }; + riotbib = { + email = "github-nix@lnrt.de"; + github = "riotbib"; + githubId = 43172581; + name = "Lennart Mühlenmeier"; + }; + ris = { + email = "code@humanleg.org.uk"; + github = "risicle"; + githubId = 807447; + name = "Robert Scott"; + }; + risson = { + name = "Marc Schmitt"; + email = "marc.schmitt@risson.space"; + matrix = "@risson:lama-corp.space"; + github = "rissson"; + githubId = 18313093; + keys = [ + { + longkeyid = "rsa4096/0xF6FD87B15C263EC9"; + fingerprint = "8A0E 6A7C 08AB B9DE 67DE 2A13 F6FD 87B1 5C26 3EC9"; + } + { + longkeyid = "ed25519/0xBBB7A6801DF1E03F"; + fingerprint = "C0A7 A9BB 115B C857 4D75 EA99 BBB7 A680 1DF1 E03F"; + } + ]; + }; + rixed = { + email = "rixed-github@happyleptic.org"; + github = "rixed"; + githubId = 449990; + name = "Cedric Cellier"; + }; + rkitover = { + email = "rkitover@gmail.com"; + github = "rkitover"; + githubId = 77611; + name = "Rafael Kitover"; + }; + rkoe = { + email = "rk@simple-is-better.org"; + github = "rkoe"; + githubId = 2507744; + name = "Roland Koebler"; + }; + rizary = { + email = "andika@numtide.com"; + github = "Rizary"; + githubId = 7221768; + name = "Andika Demas Riyandi"; + }; + rkrzr = { + email = "ops+nixpkgs@channable.com"; + github = "rkrzr"; + githubId = 82817; + name = "Robert Kreuzer"; + }; + rlupton20 = { + email = "richard.lupton@gmail.com"; + github = "rlupton20"; + githubId = 13752145; + name = "Richard Lupton"; + }; + rmcgibbo = { + email = "rmcgibbo@gmail.com"; + matrix = "@rmcgibbo:matrix.org"; + github = "rmcgibbo"; + githubId = 641278; + name = "Robert T. McGibbon"; + }; + rnhmjoj = { + email = "rnhmjoj@inventati.org"; + matrix = "@rnhmjoj:maxwell.ydns.eu"; + github = "rnhmjoj"; + githubId = 2817565; + name = "Michele Guerini Rocco"; + keys = [{ + longkeyid = "ed25519/0xBFBAF4C975F76450"; + fingerprint = "92B2 904F D293 C94D C4C9 3E6B BFBA F4C9 75F7 6450"; + }]; + }; + roastiek = { + email = "r.dee.b.b@gmail.com"; + github = "roastiek"; + githubId = 422802; + name = "Rostislav Beneš"; + }; + rob = { + email = "rob.vermaas@gmail.com"; + github = "rbvermaa"; + githubId = 353885; + name = "Rob Vermaas"; + }; + robaca = { + email = "carsten@r0hrbach.de"; + github = "robaca"; + githubId = 580474; + name = "Carsten Rohrbach"; + }; + robberer = { + email = "robberer@freakmail.de"; + github = "robberer"; + githubId = 6204883; + name = "Longrin Wischnewski"; + }; + robbinch = { + email = "robbinch33@gmail.com"; + github = "robbinch"; + githubId = 12312980; + name = "Robbin C."; + }; + roberth = { + email = "nixpkgs@roberthensing.nl"; + matrix = "@roberthensing:matrix.org"; + github = "roberth"; + githubId = 496447; + name = "Robert Hensing"; + }; + robertodr = { + email = "roberto.diremigio@gmail.com"; + github = "robertodr"; + githubId = 3708689; + name = "Roberto Di Remigio"; + }; + robertoszek = { + email = "robertoszek@robertoszek.xyz"; + github = "robertoszek"; + githubId = 1080963; + name = "Roberto"; + }; + robgssp = { + email = "robgssp@gmail.com"; + github = "robgssp"; + githubId = 521306; + name = "Rob Glossop"; + }; + roblabla = { + email = "robinlambertz+dev@gmail.com"; + github = "roblabla"; + githubId = 1069318; + name = "Robin Lambertz"; + }; + roconnor = { + email = "roconnor@theorem.ca"; + github = "roconnor"; + githubId = 852967; + name = "Russell O'Connor"; + }; + roelvandijk = { + email = "roel@lambdacube.nl"; + github = "roelvandijk"; + githubId = 710906; + name = "Roel van Dijk"; + }; + romildo = { + email = "malaquias@gmail.com"; + github = "romildo"; + githubId = 1217934; + name = "José Romildo Malaquias"; + }; + ronanmacf = { + email = "macfhlar@tcd.ie"; + github = "ronanmacf"; + githubId = 25930627; + name = "Ronan Mac Fhlannchadha"; + }; + rongcuid = { + email = "rongcuid@outlook.com"; + github = "rongcuid"; + githubId = 1312525; + name = "Rongcui Dong"; + }; + roosemberth = { + email = "roosembert.palacios+nixpkgs@posteo.ch"; + matrix = "@roosemberth:orbstheorem.ch"; + github = "roosemberth"; + githubId = 3621083; + name = "Roosembert (Roosemberth) Palacios"; + keys = [{ + longkeyid = "rsa2048/0xCAAAECE5C2242BB7"; + fingerprint = "78D9 1871 D059 663B 6117 7532 CAAA ECE5 C224 2BB7"; + }]; + }; + rople380 = { + name = "rople380"; + email = "55679162+rople380@users.noreply.github.com"; + github = "rople380"; + githubId = 55679162; + keys = [{ + longkeyid = "rsa2048/0x8526B7574A536236"; + fingerprint = "1401 1B63 393D 16C1 AA9C C521 8526 B757 4A53 6236"; + }]; + }; + rowanG077 = { + email = "goemansrowan@gmail.com"; + github = "rowanG077"; + githubId = 7439756; + name = "Rowan Goemans"; + }; + royneary = { + email = "christian@ulrich.earth"; + github = "royneary"; + githubId = 1942810; + name = "Christian Ulrich"; + }; + rpearce = { + email = "me@robertwpearce.com"; + github = "rpearce"; + githubId = 592876; + name = "Robert W. Pearce"; + }; + rprecenth = { + email = "rasmus@precenth.eu"; + github = "Prillan"; + githubId = 1675190; + name = "Rasmus Précenth"; + }; + rprospero = { + email = "rprospero+nix@gmail.com"; + github = "rprospero"; + githubId = 1728853; + name = "Adam Washington"; + }; + rps = { + email = "robbpseaton@gmail.com"; + github = "robertseaton"; + githubId = 221121; + name = "Robert P. Seaton"; + }; + rraval = { + email = "ronuk.raval@gmail.com"; + github = "rraval"; + githubId = 373566; + name = "Ronuk Raval"; + }; + rski = { + name = "rski"; + email = "rom.skiad+nix@gmail.com"; + github = "rski"; + githubId = 2960312; + }; + rszibele = { + email = "richard@szibele.com"; + github = "rszibele"; + githubId = 1387224; + name = "Richard Szibele"; + }; + rsynnest = { + email = "contact@rsynnest.com"; + github = "rsynnest"; + githubId = 4392850; + name = "Roland Synnestvedt"; + }; + rtburns-jpl = { + email = "rtburns@jpl.nasa.gov"; + github = "rtburns-jpl"; + githubId = 47790121; + name = "Ryan Burns"; + }; + rtreffer = { + email = "treffer+nixos@measite.de"; + github = "rtreffer"; + githubId = 61306; + name = "Rene Treffer"; + }; + rushmorem = { + email = "rushmore@webenchanter.com"; + github = "rushmorem"; + githubId = 4958190; + name = "Rushmore Mushambi"; + }; + russell = { + email = "russell.sim@gmail.com"; + github = "russell"; + githubId = 2660; + name = "Russell Sim"; + }; + ruuda = { + email = "dev+nix@veniogames.com"; + github = "ruuda"; + githubId = 506953; + name = "Ruud van Asseldonk"; + }; + rvarago = { + email = "rafael.varago@gmail.com"; + github = "rvarago"; + githubId = 7365864; + name = "Rafael Varago"; + }; + rvl = { + email = "dev+nix@rodney.id.au"; + github = "rvl"; + githubId = 1019641; + name = "Rodney Lorrimar"; + }; + rvlander = { + email = "rvlander@gaetanandre.eu"; + github = "rvlander"; + githubId = 5236428; + name = "Gaëtan André"; + }; + rvolosatovs = { + email = "rvolosatovs@riseup.net"; + github = "rvolosatovs"; + githubId = 12877905; + name = "Roman Volosatovs"; + }; + ryanartecona = { + email = "ryanartecona@gmail.com"; + github = "ryanartecona"; + githubId = 889991; + name = "Ryan Artecona"; + }; + ryanorendorff = { + email = "12442942+ryanorendorff@users.noreply.github.com"; + github = "ryanorendorff"; + githubId = 12442942; + name = "Ryan Orendorff"; + }; + ryansydnor = { + email = "ryan.t.sydnor@gmail.com"; + github = "ryansydnor"; + githubId = 1832096; + name = "Ryan Sydnor"; + }; + ryantm = { + email = "ryan@ryantm.com"; + matrix = "@ryantm:matrix.org"; + github = "ryantm"; + githubId = 4804; + name = "Ryan Mulligan"; + }; + ryantrinkle = { + email = "ryan.trinkle@gmail.com"; + github = "ryantrinkle"; + githubId = 1156448; + name = "Ryan Trinkle"; + }; + rybern = { + email = "ryan.bernstein@columbia.edu"; + github = "rybern"; + githubId = 4982341; + name = "Ryan Bernstein"; + }; + rycee = { + email = "robert@rycee.net"; + github = "rycee"; + githubId = 798147; + name = "Robert Helgesson"; + keys = [{ + longkeyid = "rsa4096/0x3573356C25C424D4"; + fingerprint = "36CA CF52 D098 CC0E 78FB 0CB1 3573 356C 25C4 24D4"; + }]; + }; + ryneeverett = { + email = "ryneeverett@gmail.com"; + github = "ryneeverett"; + githubId = 3280280; + name = "Ryne Everett"; + }; + rytone = { + email = "max@ryt.one"; + github = "rytone"; + githubId = 8082305; + name = "Maxwell Beck"; + keys = [{ + longkeyid = "rsa2048/0xBB3EFA303760A0DB"; + fingerprint = "D260 79E3 C2BC 2E43 905B D057 BB3E FA30 3760 A0DB"; + }]; + }; + rzetterberg = { + email = "richard.zetterberg@gmail.com"; + github = "rzetterberg"; + githubId = 766350; + name = "Richard Zetterberg"; + }; + s1341 = { + email = "s1341@shmarya.net"; + matrix = "@s1341:matrix.org"; + name = "Shmarya Rubenstein"; + github = "s1341"; + githubId = 5682183; + }; + sagikazarmark = { + name = "Mark Sagi-Kazar"; + email = "mark.sagikazar@gmail.com"; + matrix = "@mark.sagikazar:matrix.org"; + github = "sagikazarmark"; + githubId = 1226384; + keys = [{ + longkeyid = "rsa4096/0xF251ADDC9D041C7E"; + fingerprint = "E628 C811 6FB8 1657 F706 4EA4 F251 ADDC 9D04 1C7E"; + }]; + }; + samalws = { + email = "sam@samalws.com"; + name = "Sam Alws"; + github = "samalws"; + githubId = 20981725; + }; + samb96 = { + email = "samb96@gmail.com"; + github = "samb96"; + githubId = 819426; + name = "Sam Bickley"; + }; + samdoshi = { + email = "sam@metal-fish.co.uk"; + github = "samdoshi"; + githubId = 112490; + name = "Sam Doshi"; + }; + samdroid-apps = { + email = "sam@sam.today"; + github = "samdroid-apps"; + githubId = 6022042; + name = "Sam Parkinson"; + }; + samlich = { + email = "nixos@samli.ch"; + github = "samlich"; + githubId = 1349989; + name = "samlich"; + keys = [{ + longkeyid = "rsa4096/B1568953B1939F1C"; + fingerprint = "AE8C 0836 FDF6 3FFC 9580 C588 B156 8953 B193 9F1C"; + }]; + }; + samrose = { + email = "samuel.rose@gmail.com"; + github = "samrose"; + githubId = 115821; + name = "Sam Rose"; + }; + samuela = { + email = "skainsworth@gmail.com"; + github = "samuela"; + githubId = 226872; + name = "Samuel Ainsworth"; + }; + samueldr = { + email = "samuel@dionne-riel.com"; + matrix = "@samueldr:matrix.org"; + github = "samueldr"; + githubId = 132835; + name = "Samuel Dionne-Riel"; + }; + samuelgrf = { + email = "s@muel.gr"; + github = "samuelgrf"; + githubId = 67663538; + name = "Samuel Gräfenstein"; + keys = [ + { + longkeyid = "rsa4096/0xDE75F92E318123F0"; + fingerprint = "6F2E 2A90 423C 8111 BFF2 895E DE75 F92E 3181 23F0"; + } + { + longkeyid = "rsa4096/0xEF76A063F15C63C8"; + fingerprint = "FF24 5832 8FAF 4660 18C6 186E EF76 A063 F15C 63C8"; + } + ]; + }; + samuelrivas = { + email = "samuelrivas@gmail.com"; + github = "samuelrivas"; + githubId = 107703; + name = "Samuel Rivas"; + }; + sander = { + email = "s.vanderburg@tudelft.nl"; + github = "svanderburg"; + githubId = 1153271; + name = "Sander van der Burg"; + }; + sarcasticadmin = { + email = "rob@sarcasticadmin.com"; + github = "sarcasticadmin"; + githubId = 30531572; + name = "Robert James Hernandez"; + }; + sargon = { + email = "danielehlers@mindeye.net"; + github = "sargon"; + githubId = 178904; + name = "Daniel Ehlers"; + }; + saschagrunert = { + email = "mail@saschagrunert.de"; + github = "saschagrunert"; + githubId = 695473; + name = "Sascha Grunert"; + }; + sauyon = { + email = "s@uyon.co"; + github = "sauyon"; + githubId = 2347889; + name = "Sauyon Lee"; + }; + savannidgerinel = { + email = "savanni@luminescent-dreams.com"; + github = "savannidgerinel"; + githubId = 8534888; + name = "Savanni D'Gerinel"; + }; + sayanarijit = { + email = "sayanarijit@gmail.com"; + github = "sayanarijit"; + githubId = 11632726; + name = "Arijit Basu"; + }; + sb0 = { + email = "sb@m-labs.hk"; + github = "sbourdeauducq"; + githubId = 720864; + name = "Sébastien Bourdeauducq"; + }; + sbellem = { + email = "sbellem@gmail.com"; + github = "sbellem"; + githubId = 125458; + name = "Sylvain Bellemare"; + }; + sbond75 = { + name = "sbond75"; + email = "43617712+sbond75@users.noreply.github.com"; + github = "sbond75"; + githubId = 43617712; + }; + sboosali = { + email = "SamBoosalis@gmail.com"; + github = "sboosali"; + githubId = 2320433; + name = "Sam Boosalis"; + }; + sbruder = { + email = "nixos@sbruder.de"; + github = "sbruder"; + githubId = 15986681; + name = "Simon Bruder"; + }; + scalavision = { + email = "scalavision@gmail.com"; + github = "scalavision"; + githubId = 3958212; + name = "Tom Sorlie"; + }; + schmitthenner = { + email = "development@schmitthenner.eu"; + github = "fkz"; + githubId = 354463; + name = "Fabian Schmitthenner"; + }; + schmittlauch = { + name = "Trolli Schmittlauch"; + email = "t.schmittlauch+nixos@orlives.de"; + github = "schmittlauch"; + githubId = 1479555; + }; + schneefux = { + email = "schneefux+nixos_pkg@schneefux.xyz"; + github = "schneefux"; + githubId = 15379000; + name = "schneefux"; + }; + schnusch = { + email = "schnusch@users.noreply.github.com"; + github = "schnusch"; + githubId = 5104601; + name = "schnusch"; + }; + schristo = { + email = "schristopher@konputa.com"; + name = "Scott Christopher"; + }; + scode = { + email = "peter.schuller@infidyne.com"; + github = "scode"; + githubId = 59476; + name = "Peter Schuller"; + }; + scolobb = { + email = "sivanov@colimite.fr"; + github = "scolobb"; + githubId = 11320; + name = "Sergiu Ivanov"; + }; + screendriver = { + email = "nix@echooff.de"; + github = "screendriver"; + githubId = 149248; + name = "Christian Rackerseder"; + }; + Scriptkiddi = { + email = "nixos@scriptkiddi.de"; + matrix = "@fritz.otlinghaus:helsinki-systems.de"; + github = "scriptkiddi"; + githubId = 3598650; + name = "Fritz Otlinghaus"; + }; + scubed2 = { + email = "scubed2@gmail.com"; + github = "scubed2"; + githubId = 7401858; + name = "Sterling Stein"; + }; + sdier = { + email = "scott@dier.name"; + matrix = "@sdier:matrix.org"; + github = "sdier"; + githubId = 11613056; + name = "Scott Dier"; + }; + SeanZicari = { + email = "sean.zicari@gmail.com"; + github = "SeanZicari"; + githubId = 2343853; + name = "Sean Zicari"; + }; + seb314 = { + email = "sebastian@seb314.com"; + github = "seb314"; + githubId = 19472270; + name = "Sebastian"; + }; + sebastianblunt = { + name = "Sebastian Blunt"; + email = "nix@sebastianblunt.com"; + github = "sebastianblunt"; + githubId = 47431204; + }; + sebbadk = { + email = "sebastian@sebba.dk"; + github = "SEbbaDK"; + githubId = 1567527; + name = "Sebastian Hyberts"; + }; + sebbel = { + email = "hej@sebastian-ball.de"; + github = "sebbel"; + githubId = 1940568; + name = "Sebastian Ball"; + }; + sebtm = { + email = "mail@sebastian-sellmeier.de"; + github = "sebtm"; + githubId = 17243347; + name = "Sebastian Sellmeier"; + }; + sellout = { + email = "greg@technomadic.org"; + github = "sellout"; + githubId = 33031; + name = "Greg Pfeil"; + }; + sengaya = { + email = "tlo@sengaya.de"; + github = "sengaya"; + githubId = 1286668; + name = "Thilo Uttendorfer"; + }; + sephalon = { + email = "me@sephalon.net"; + github = "sephalon"; + githubId = 893474; + name = "Stefan Wiehler"; + }; + sepi = { + email = "raffael@mancini.lu"; + github = "sepi"; + githubId = 529649; + name = "Raffael Mancini"; + }; + seppeljordan = { + email = "sebastian.jordan.mail@googlemail.com"; + github = "seppeljordan"; + githubId = 4805746; + name = "Sebastian Jordan"; + }; + seqizz = { + email = "seqizz@gmail.com"; + github = "seqizz"; + githubId = 307899; + name = "Gurkan Gur"; + }; + sersorrel = { + email = "ash@sorrel.sh"; + github = "sersorrel"; + githubId = 9433472; + name = "ash"; + }; + servalcatty = { + email = "servalcat@pm.me"; + github = "servalcatty"; + githubId = 51969817; + name = "Serval"; + keys = [{ + longkeyid = "rsa4096/0x4A2AAAA382F8294C"; + fingerprint = "A317 37B3 693C 921B 480C C629 4A2A AAA3 82F8 294C"; + }]; + }; + seylerius = { + name = "Sable Seyler"; + email = "sable@seyleri.us"; + github = "seylerius"; + githubId = 1145981; + keys = [{ + longkeyid = "rsa4096/0xDC26B921A9E9DBDE"; + fingerprint = "7246 B6E1 ABB9 9A48 4395 FD11 DC26 B921 A9E9 DBDE"; + }]; + }; + sfrijters = { + email = "sfrijters@gmail.com"; + github = "sfrijters"; + githubId = 918365; + name = "Stefan Frijters"; + }; + sgo = { + email = "stig@stig.io"; + github = "stigtsp"; + githubId = 75371; + name = "Stig Palmquist"; + }; + sgraf = { + email = "sgraf1337@gmail.com"; + github = "sgraf812"; + githubId = 1151264; + name = "Sebastian Graf"; + }; + shahrukh330 = { + email = "shahrukh330@gmail.com"; + github = "shahrukh330"; + githubId = 1588288; + name = "Shahrukh Khan"; + }; + shamilton = { + email = "sgn.hamilton@protonmail.com"; + github = "SCOTT-HAMILTON"; + githubId = 24496705; + name = "Scott Hamilton"; + }; + ShamrockLee = { + name = "Shamrock Lee"; + email = "44064051+ShamrockLee@users.noreply.github.com"; + github = "ShamrockLee"; + githubId = 44064051; + }; + shanemikel = { + email = "shanepearlman@pm.me"; + github = "shanemikel"; + githubId = 6720672; + name = "Shane Pearlman"; + }; + shanesveller = { + email = "shane@sveller.dev"; + github = "shanesveller"; + githubId = 831; + keys = [{ + longkeyid = "rsa4096/0x9210C218023C15CD"; + fingerprint = "F83C 407C ADC4 5A0F 1F2F 44E8 9210 C218 023C 15CD"; + }]; + name = "Shane Sveller"; + }; + shawndellysse = { + email = "sdellysse@gmail.com"; + github = "shawndellysse"; + githubId = 293035; + name = "Shawn Dellysse"; + }; + shazow = { + email = "andrey.petrov@shazow.net"; + github = "shazow"; + githubId = 6292; + name = "Andrey Petrov"; + }; + sheenobu = { + email = "sheena.artrip@gmail.com"; + github = "sheenobu"; + githubId = 1443459; + name = "Sheena Artrip"; + }; + sheepforce = { + email = "phillip.seeber@googlemail.com"; + github = "sheepforce"; + githubId = 16844216; + name = "Phillip Seeber"; + }; + sheganinans = { + email = "sheganinans@gmail.com"; + github = "sheganinans"; + githubId = 2146203; + name = "Aistis Raulinaitis"; + }; + shell = { + email = "cam.turn@gmail.com"; + github = "VShell"; + githubId = 251028; + name = "Shell Turner"; + }; + shikanime = { + name = "William Phetsinorath"; + email = "deva.shikanime@protonmail.com"; + github = "shikanime"; + githubId = 22115108; + }; + shiryel = { + email = "contact@shiryel.com"; + name = "Shiryel"; + github = "shiryel"; + githubId = 35617139; + keys = [{ + longkeyid = "ed25519/0xC4041EA6B32633DE"; + fingerprint = "AB63 4CD9 3322 BD42 6231 F764 C404 1EA6 B326 33DE"; + }]; + }; + shlevy = { + email = "shea@shealevy.com"; + github = "shlevy"; + githubId = 487050; + name = "Shea Levy"; + }; + shmish111 = { + email = "shmish111@gmail.com"; + github = "shmish111"; + githubId = 934267; + name = "David Smith"; + }; + shnarazk = { + email = "shujinarazaki@protonmail.com"; + github = "shnarazk"; + githubId = 997855; + name = "Narazaki Shuji"; + }; + shofius = { + name = "Sam Hofius"; + email = "sam@samhofi.us"; + github = "kf5grd"; + githubId = 18297490; + }; + shou = { + email = "x+g@shou.io"; + github = "Shou"; + githubId = 819413; + name = "Benedict Aas"; + }; + shreerammodi = { + name = "Shreeram Modi"; + email = "shreerammodi10@gmail.com"; + github = "Shrimpram"; + githubId = 67710369; + keys = [{ + longkeyid = "rsa4096/0x163B16EE76ED24CE"; + fingerprint = "EA88 EA07 26E9 6CBF 6365 3966 163B 16EE 76ED 24CE"; + }]; + }; + shyim = { + email = "s.sayakci@gmail.com"; + github = "shyim"; + githubId = 6224096; + name = "Soner Sayakci"; + }; + siddharthist = { + email = "langston.barrett@gmail.com"; + github = "langston-barrett"; + githubId = 4294323; + name = "Langston Barrett"; + }; + siers = { + email = "veinbahs+nixpkgs@gmail.com"; + github = "siers"; + githubId = 235147; + name = "Raitis Veinbahs"; + }; + sifmelcara = { + email = "ming@culpring.com"; + github = "sifmelcara"; + githubId = 10496191; + name = "Ming Chuan"; + }; + sigma = { + email = "yann.hodique@gmail.com"; + github = "sigma"; + githubId = 16090; + name = "Yann Hodique"; + }; + sikmir = { + email = "sikmir@disroot.org"; + github = "sikmir"; + githubId = 688044; + name = "Nikolay Korotkiy"; + keys = [{ + longkeyid = "rsa2048/0xD1DE6D7F693663A5"; + fingerprint = "ADF4 C13D 0E36 1240 BD01 9B51 D1DE 6D7F 6936 63A5"; + }]; + }; + simarra = { + name = "simarra"; + email = "loic.martel@protonmail.com"; + github = "simarra"; + githubId = 14372987; + }; + simonchatts = { + email = "code@chatts.net"; + github = "simonchatts"; + githubId = 11135311; + name = "Simon Chatterjee"; + }; + simonkampe = { + email = "simon.kampe+nix@gmail.com"; + github = "simonkampe"; + githubId = 254799; + name = "Simon Kämpe"; + }; + simonvandel = { + email = "simon.vandel@gmail.com"; + github = "simonvandel"; + githubId = 2770647; + name = "Simon Vandel Sillesen"; + }; + siraben = { + email = "bensiraphob@gmail.com"; + matrix = "@siraben:matrix.org"; + github = "siraben"; + githubId = 8219659; + name = "Siraphob Phipathananunth"; + }; + siriobalmelli = { + email = "sirio@b-ad.ch"; + github = "siriobalmelli"; + githubId = 23038812; + name = "Sirio Balmelli"; + keys = [{ + longkeyid = "ed25519/0xF72C4A887F9A24CA"; + fingerprint = "B234 EFD4 2B42 FE81 EE4D 7627 F72C 4A88 7F9A 24CA"; + }]; + }; + sirseruju = { + email = "sir.seruju@yandex.ru"; + github = "sirseruju"; + githubId = 74881555; + name = "Fofanov Sergey"; + }; + sivteck = { + email = "sivaram1992@gmail.com"; + github = "sivteck"; + githubId = 8017899; + name = "Sivaram Balakrishnan"; + }; + sjagoe = { + email = "simon@simonjagoe.com"; + github = "sjagoe"; + githubId = 80012; + name = "Simon Jagoe"; + }; + sjau = { + email = "nixos@sjau.ch"; + github = "sjau"; + githubId = 848812; + name = "Stephan Jau"; + }; + sjfloat = { + email = "steve+nixpkgs@jonescape.com"; + github = "sjfloat"; + githubId = 216167; + name = "Steve Jones"; + }; + sjmackenzie = { + email = "setori88@gmail.com"; + github = "sjmackenzie"; + githubId = 158321; + name = "Stewart Mackenzie"; + }; + sjourdois = { + email = "sjourdois@gmail.com"; + name = "Stéphane ‘kwisatz’ Jourdois"; + }; + skeidel = { + email = "svenkeidel@gmail.com"; + github = "svenkeidel"; + githubId = 266500; + name = "Sven Keidel"; + }; + skrzyp = { + email = "jot.skrzyp@gmail.com"; + name = "Jakub Skrzypnik"; + }; + skykanin = { + email = "skykanin@users.noreply.github.com"; + github = "skykanin"; + githubId = 3789764; + name = "skykanin"; + }; + sleexyz = { + email = "freshdried@gmail.com"; + github = "sleexyz"; + githubId = 1505617; + name = "Sean Lee"; + }; + SlothOfAnarchy = { + email = "slothofanarchy1@gmail.com"; + matrix = "@michel.weitbrecht:helsinki-systems.de"; + github = "SlothOfAnarchy"; + githubId = 12828415; + name = "Michel Weitbrecht"; + }; + smakarov = { + email = "setser200018@gmail.com"; + github = "setser"; + githubId = 12733495; + name = "Sergey Makarov"; + keys = [{ + longkeyid = "rsa2048/6AA23A1193B7064B"; + fingerprint = "6F8A 18AE 4101 103F 3C54 24B9 6AA2 3A11 93B7 064B"; + }]; + }; + smancill = { + email = "smancill@smancill.dev"; + github = "smancill"; + githubId = 238528; + name = "Sebastián Mancilla"; + }; + smaret = { + email = "sebastien.maret@icloud.com"; + github = "smaret"; + githubId = 95471; + name = "Sébastien Maret"; + keys = [{ + longkeyid = "rsa4096/0x86E30E5A0F5FC59C"; + fingerprint = "4242 834C D401 86EF 8281 4093 86E3 0E5A 0F5F C59C"; + }]; + }; + smasher164 = { + email = "aindurti@gmail.com"; + github = "smasher164"; + githubId = 12636891; + name = "Akhil Indurti"; + }; + smironov = { + email = "grrwlf@gmail.com"; + github = "grwlf"; + githubId = 4477729; + name = "Sergey Mironov"; + }; + smitop = { + name = "Smitty van Bodegom"; + email = "me@smitop.com"; + matrix = "@smitop:kde.org"; + github = "Smittyvb"; + githubId = 10530973; + }; + sna = { + email = "abouzahra.9@wright.edu"; + github = "s-na"; + githubId = 20214715; + name = "S. Nordin Abouzahra"; + }; + snaar = { + email = "snaar@snaar.net"; + github = "snaar"; + githubId = 602439; + name = "Serguei Narojnyi"; + }; + snicket2100 = { + email = "57048005+snicket2100@users.noreply.github.com"; + github = "snicket2100"; + githubId = 57048005; + name = "snicket2100"; + }; + snyh = { + email = "snyh@snyh.org"; + github = "snyh"; + githubId = 1437166; + name = "Xia Bin"; + }; + softinio = { + email = "code@softinio.com"; + github = "softinio"; + githubId = 3371635; + name = "Salar Rahmanian"; + }; + sohalt = { + email = "nixos@sohalt.net"; + github = "sohalt"; + githubId = 2157287; + name = "sohalt"; + }; + solson = { + email = "scott@solson.me"; + matrix = "@solson:matrix.org"; + github = "solson"; + githubId = 26806; + name = "Scott Olson"; + }; + SomeoneSerge = { + email = "sergei.kozlukov@aalto.fi"; + matrix = "@ss:someonex.net"; + github = "SomeoneSerge"; + githubId = 9720532; + name = "Sergei K"; + }; + sondr3 = { + email = "nilsen.sondre@gmail.com"; + github = "sondr3"; + githubId = 2280539; + name = "Sondre Nilsen"; + keys = [{ + longkeyid = "ed25519/0x25676BCBFFAD76B1"; + fingerprint = "0EC3 FA89 EFBA B421 F82E 40B0 2567 6BCB FFAD 76B1"; + }]; + }; + sophrosyne = { + email = "joshuaortiz@tutanota.com"; + github = "sophrosyne97"; + githubId = 53029739; + name = "Joshua Ortiz"; + }; + sorki = { + email = "srk@48.io"; + github = "sorki"; + githubId = 115308; + name = "Richard Marko"; + }; + sorpaas = { + email = "hi@that.world"; + github = "sorpaas"; + githubId = 6277322; + name = "Wei Tang"; + }; + spacefrogg = { + email = "spacefrogg-nixos@meterriblecrew.net"; + github = "spacefrogg"; + githubId = 167881; + name = "Michael Raitza"; + }; + spacekookie = { + email = "kookie@spacekookie.de"; + github = "spacekookie"; + githubId = 7669898; + name = "Katharina Fey"; + }; + spease = { + email = "peasteven@gmail.com"; + github = "spease"; + githubId = 2825204; + name = "Steven Pease"; + }; + spencerjanssen = { + email = "spencerjanssen@gmail.com"; + matrix = "@sjanssen:matrix.org"; + github = "spencerjanssen"; + githubId = 2600039; + name = "Spencer Janssen"; + }; + spinus = { + email = "tomasz.czyz@gmail.com"; + github = "spinus"; + githubId = 950799; + name = "Tomasz Czyż"; + }; + sprock = { + email = "rmason@mun.ca"; + github = "sprock"; + githubId = 6391601; + name = "Roger Mason"; + }; + spwhitt = { + email = "sw@swhitt.me"; + github = "spwhitt"; + githubId = 1414088; + name = "Spencer Whitt"; + }; + squalus = { + email = "squalus@tuta.io"; + github = "squalus"; + githubId = 36899624; + name = "squalus"; + }; + srapenne = { + email = "solene@perso.pw"; + github = "rapenne-s"; + githubId = 248016; + name = "Solène Rapenne"; + }; + srghma = { + email = "srghma@gmail.com"; + github = "srghma"; + githubId = 7573215; + name = "Sergei Khoma"; + }; + srgom = { + email = "srgom@users.noreply.github.com"; + github = "srgom"; + githubId = 8103619; + name = "SRGOM"; + }; + srhb = { + email = "sbrofeldt@gmail.com"; + matrix = "@srhb:matrix.org"; + github = "srhb"; + githubId = 219362; + name = "Sarah Brofeldt"; + }; + SShrike = { + email = "severen@shrike.me"; + github = "severen"; + githubId = 4061736; + name = "Severen Redwood"; + }; + sstef = { + email = "stephane@nix.frozenid.net"; + github = "fkstef"; + githubId = 8668915; + name = "Stephane Schitter"; + }; + staccato = { + name = "staccato"; + email = "moveq@riseup.net"; + github = "staccato"; + githubId = 86573128; + }; + stackshadow = { + email = "stackshadow@evilbrain.de"; + github = "stackshadow"; + githubId = 7512804; + name = "Martin Langlotz"; + }; + steamwalker = { + email = "steamwalker@xs4all.nl"; + github = "steamwalker"; + githubId = 94006354; + name = "steamwalker"; + }; + steell = { + email = "steve@steellworks.com"; + github = "Steell"; + githubId = 1699155; + name = "Steve Elliott"; + }; + stehessel = { + email = "stephan@stehessel.de"; + github = "stehessel"; + githubId = 55607356; + name = "Stephan Heßelmann"; + }; + steinybot = { + name = "Jason Pickens"; + email = "jasonpickensnz@gmail.com"; + matrix = "@steinybot:matrix.org"; + github = "steinybot"; + githubId = 4659562; + keys = [{ + longkeyid = "ed25519/0x21DE1CAE59762A0F"; + fingerprint = "2709 1DEC CC42 4635 4299 569C 21DE 1CAE 5976 2A0F"; + }]; + }; + stelcodes = { + email = "stel@stel.codes"; + github = "stelcodes"; + githubId = 22163194; + name = "Stel Abrego"; + }; + stephank = { + email = "nix@stephank.nl"; + matrix = "@skochen:matrix.org"; + github = "stephank"; + githubId = 89950; + name = "Stéphan Kochen"; + }; + stephenmw = { + email = "stephen@q5comm.com"; + github = "stephenmw"; + githubId = 231788; + name = "Stephen Weinberg"; + }; + stephenwithph = { + name = "StephenWithPH"; + email = "StephenWithPH@users.noreply.github.com"; + github = "StephenWithPH"; + githubId = 2990492; + }; + sterfield = { + email = "sterfield@gmail.com"; + github = "sterfield"; + githubId = 5747061; + name = "Guillaume Loetscher"; + }; + sternenseemann = { + email = "sternenseemann@systemli.org"; + github = "sternenseemann"; + githubId = 3154475; + name = "Lukas Epple"; + }; + steshaw = { + name = "Steven Shaw"; + email = "steven@steshaw.org"; + github = "steshaw"; + githubId = 45735; + keys = [{ + longkeyid = "rsa4096/0x1D9A17DFD23DCB91"; + fingerprint = "0AFE 77F7 474D 1596 EE55 7A29 1D9A 17DF D23D CB91"; + }]; + }; + stesie = { + email = "stesie@brokenpipe.de"; + github = "stesie"; + githubId = 113068; + name = "Stefan Siegl"; + }; + steve-chavez = { + email = "stevechavezast@gmail.com"; + github = "steve-chavez"; + githubId = 1829294; + name = "Steve Chávez"; + }; + stevebob = { + email = "stephen@sherra.tt"; + github = "stevebob"; + githubId = 417118; + name = "Stephen Sherratt"; + }; + steveej = { + email = "mail@stefanjunker.de"; + github = "steveej"; + githubId = 1181362; + name = "Stefan Junker"; + }; + stevenroose = { + email = "github@stevenroose.org"; + github = "stevenroose"; + githubId = 853468; + name = "Steven Roose"; + }; + stianlagstad = { + email = "stianlagstad@gmail.com"; + github = "stianlagstad"; + githubId = 4340859; + name = "Stian Lågstad"; + }; + StijnDW = { + email = "nixdev@rinsa.eu"; + github = "Stekke"; + githubId = 1751956; + name = "Stijn DW"; + }; + StillerHarpo = { + email = "florianengel39@gmail.com"; + github = "StillerHarpo"; + githubId = 25526706; + name = "Florian Engel"; + }; + stites = { + email = "sam@stites.io"; + github = "stites"; + githubId = 1694705; + name = "Sam Stites"; + }; + stumoss = { + email = "samoss@gmail.com"; + github = "stumoss"; + githubId = 638763; + name = "Stuart Moss"; + }; + stunkymonkey = { + email = "account@buehler.rocks"; + github = "Stunkymonkey"; + githubId = 1315818; + name = "Felix Bühler"; + }; + stupremee = { + email = "jutus.k@protonmail.com"; + github = "Stupremee"; + githubId = 39732259; + name = "Justus K"; + }; + SubhrajyotiSen = { + email = "subhrajyoti12@gmail.com"; + github = "SubhrajyotiSen"; + githubId = 12984845; + name = "Subhrajyoti Sen"; + }; + suhr = { + email = "suhr@i2pmail.org"; + github = "suhr"; + githubId = 65870; + name = "Сухарик"; + }; + sumnerevans = { + email = "me@sumnerevans.com"; + github = "sumnerevans"; + githubId = 16734772; + name = "Sumner Evans"; + }; + superbo = { + email = "supernbo@gmail.com"; + github = "SuperBo"; + githubId = 2666479; + name = "Y Nguyen"; + }; + superherointj = { + name = "Sérgio G."; + email = "5861043+superherointj@users.noreply.github.com"; + matrix = "@superherointj:matrix.org"; + github = "superherointj"; + githubId = 5861043; + }; + SuperSandro2000 = { + email = "sandro.jaeckel@gmail.com"; + matrix = "@sandro:supersandro.de"; + github = "SuperSandro2000"; + githubId = 7258858; + name = "Sandro Jäckel"; + }; + SuprDewd = { + email = "suprdewd@gmail.com"; + github = "SuprDewd"; + githubId = 187109; + name = "Bjarki Ágúst Guðmundsson"; + }; + suryasr007 = { + email = "94suryateja@gmail.com"; + github = "suryasr007"; + githubId = 10533926; + name = "Surya Teja V"; + }; + suvash = { + email = "suvash+nixpkgs@gmail.com"; + github = "suvash"; + githubId = 144952; + name = "Suvash Thapaliya"; + }; + sveitser = { + email = "sveitser@gmail.com"; + github = "sveitser"; + githubId = 1040871; + name = "Mathis Antony"; + }; + svend = { + email = "svend@svends.net"; + github = "svend"; + githubId = 306190; + name = "Svend Sorensen"; + }; + svrana = { + email = "shaw@vranix.com"; + github = "svrana"; + githubId = 850665; + name = "Shaw Vrana"; + }; + svsdep = { + email = "svsdep@gmail.com"; + github = "svsdep"; + githubId = 36695359; + name = "Vasyl Solovei"; + }; + swarren83 = { + email = "shawn.w.warren@gmail.com"; + github = "swarren83"; + githubId = 4572854; + name = "Shawn Warren"; + }; + swdunlop = { + email = "swdunlop@gmail.com"; + github = "swdunlop"; + githubId = 120188; + name = "Scott W. Dunlop"; + }; + sweber = { + email = "sweber2342+nixpkgs@gmail.com"; + github = "sweber83"; + githubId = 19905904; + name = "Simon Weber"; + }; + swflint = { + email = "swflint@flintfam.org"; + github = "swflint"; + githubId = 1771109; + name = "Samuel W. Flint"; + }; + swistak35 = { + email = "me@swistak35.com"; + github = "swistak35"; + githubId = 332289; + name = "Rafał Łasocha"; + }; + syberant = { + email = "sybrand@neuralcoding.com"; + github = "syberant"; + githubId = 20063502; + name = "Sybrand Aarnoutse"; + }; + symphorien = { + email = "symphorien_nixpkgs@xlumurb.eu"; + matrix = "@symphorien:xlumurb.eu"; + github = "symphorien"; + githubId = 12595971; + name = "Guillaume Girol"; + }; + synthetica = { + email = "nix@hilhorst.be"; + github = "Synthetica9"; + githubId = 7075751; + name = "Patrick Hilhorst"; + }; + szczyp = { + email = "qb@szczyp.com"; + github = "szczyp"; + githubId = 203195; + name = "Szczyp"; + }; + szlend = { + email = "pub.nix@zlender.si"; + github = "szlend"; + githubId = 7301807; + name = "Simon Žlender"; + }; + sztupi = { + email = "attila.sztupak@gmail.com"; + github = "sztupi"; + githubId = 143103; + name = "Attila Sztupak"; + }; + t184256 = { + email = "monk@unboiled.info"; + github = "t184256"; + githubId = 5991987; + name = "Alexander Sosedkin"; + }; + tadeokondrak = { + email = "me@tadeo.ca"; + github = "tadeokondrak"; + githubId = 4098453; + name = "Tadeo Kondrak"; + keys = [{ + longkeyid = "ed25519/0xFBE607FCC49516D3"; + fingerprint = "0F2B C0C7 E77C 5B42 AC5B 4C18 FBE6 07FC C495 16D3"; + }]; + }; + tadfisher = { + email = "tadfisher@gmail.com"; + github = "tadfisher"; + githubId = 129148; + name = "Tad Fisher"; + }; + taeer = { + email = "taeer@necsi.edu"; + github = "Radvendii"; + githubId = 1239929; + name = "Taeer Bar-Yam"; + }; + taha = { + email = "xrcrod@gmail.com"; + github = "tgharib"; + githubId = 6457015; + name = "Taha Gharib"; + }; + tailhook = { + email = "paul@colomiets.name"; + github = "tailhook"; + githubId = 321799; + name = "Paul Colomiets"; + }; + taikx4 = { + email = "taikx4@taikx4szlaj2rsdupcwabg35inbny4jk322ngeb7qwbbhd5i55nf5yyd.onion"; + github = "taikx4"; + githubId = 94917129; + name = "taikx4"; + keys = [{ + longkeyid = "ed25519/0xCCD52C7B37BB837E"; + fingerprint = "6B02 8103 C4E5 F68C D77C 9E54 CCD5 2C7B 37BB 837E"; + }]; + }; + takagiy = { + email = "takagiy.4dev@gmail.com"; + github = "takagiy"; + githubId = 18656090; + name = "Yuki Takagi"; + }; + taketwo = { + email = "alexandrov88@gmail.com"; + github = "taketwo"; + githubId = 1241736; + name = "Sergey Alexandrov"; + }; + takikawa = { + email = "asumu@igalia.com"; + github = "takikawa"; + githubId = 64192; + name = "Asumu Takikawa"; + }; + taktoa = { + email = "taktoa@gmail.com"; + matrix = "@taktoa:matrix.org"; + github = "taktoa"; + githubId = 553443; + name = "Remy Goldschmidt"; + }; + taku0 = { + email = "mxxouy6x3m_github@tatapa.org"; + github = "taku0"; + githubId = 870673; + name = "Takuo Yonezawa"; + }; + talkara = { + email = "taito.horiuchi@relexsolutions.com"; + github = "talkara"; + githubId = 51232929; + name = "Taito Horiuchi"; + }; + talyz = { + email = "kim.lindberger@gmail.com"; + matrix = "@talyz:matrix.org"; + github = "talyz"; + githubId = 63433; + name = "Kim Lindberger"; + }; + taneb = { + email = "nvd1234@gmail.com"; + github = "Taneb"; + githubId = 1901799; + name = "Nathan van Doorn"; + }; + tari = { + email = "peter@taricorp.net"; + github = "tari"; + githubId = 506181; + name = "Peter Marheine"; + }; + tasmo = { + email = "tasmo@tasmo.de"; + github = "tasmo"; + githubId = 102685; + name = "Thomas Friese"; + }; + tazjin = { + email = "mail@tazj.in"; + github = "tazjin"; + githubId = 1552853; + name = "Vincent Ambo"; + }; + tbenst = { + email = "nix@tylerbenster.com"; + github = "tbenst"; + githubId = 863327; + name = "Tyler Benster"; + }; + tboerger = { + email = "thomas@webhippie.de"; + matrix = "@tboerger:matrix.org"; + github = "tboerger"; + githubId = 156964; + name = "Thomas Boerger"; + }; + tcbravo = { + email = "tomas.bravo@protonmail.ch"; + github = "tcbravo"; + githubId = 66133083; + name = "Tomas Bravo"; + }; + tckmn = { + email = "andy@tck.mn"; + github = "tckmn"; + githubId = 2389333; + name = "Andy Tockman"; + }; + techknowlogick = { + email = "techknowlogick@gitea.io"; + github = "techknowlogick"; + githubId = 164197; + name = "techknowlogick"; + }; + Technical27 = { + email = "38222826+Technical27@users.noreply.github.com"; + github = "Technical27"; + githubId = 38222826; + name = "Aamaruvi Yogamani"; + }; + teh = { + email = "tehunger@gmail.com"; + github = "teh"; + githubId = 139251; + name = "Tom Hunger"; + }; + telotortium = { + email = "rirelan@gmail.com"; + github = "telotortium"; + githubId = 1755789; + name = "Robert Irelan"; + }; + teozkr = { + email = "teo@nullable.se"; + github = "teozkr"; + githubId = 649832; + name = "Teo Klestrup Röijezon"; + }; + terin = { + email = "terinjokes@gmail.com"; + github = "terinjokes"; + githubId = 273509; + name = "Terin Stock"; + }; + terlar = { + email = "terlar@gmail.com"; + github = "terlar"; + githubId = 280235; + name = "Terje Larsen"; + }; + terrorjack = { + email = "astrohavoc@gmail.com"; + github = "TerrorJack"; + githubId = 3889585; + name = "Cheng Shao"; + }; + tesq0 = { + email = "mikolaj.galkowski@gmail.com"; + github = "tesq0"; + githubId = 26417242; + name = "Mikolaj Galkowski"; + }; + TethysSvensson = { + email = "freaken@freaken.dk"; + github = "TethysSvensson"; + githubId = 4294434; + name = "Tethys Svensson"; + }; + teto = { + email = "mcoudron@hotmail.com"; + github = "teto"; + githubId = 886074; + name = "Matthieu Coudron"; + }; + tex = { + email = "milan.svoboda@centrum.cz"; + github = "tex"; + githubId = 27386; + name = "Milan Svoboda"; + }; + tfc = { + email = "jacek@galowicz.de"; + matrix = "@jonge:ukvly.org"; + github = "tfc"; + githubId = 29044; + name = "Jacek Galowicz"; + }; + tg-x = { + email = "*@tg-x.net"; + github = "tg-x"; + githubId = 378734; + name = "TG ⊗ Θ"; + }; + tgunnoe = { + email = "t@gvno.net"; + github = "tgunnoe"; + githubId = 7254833; + name = "Taylor Gunnoe"; + }; + th0rgal = { + email = "thomas.marchand@tuta.io"; + github = "Th0rgal"; + githubId = 41830259; + name = "Thomas Marchand"; + }; + thall = { + email = "niclas.thall@gmail.com"; + github = "thall"; + githubId = 102452; + name = "Niclas Thall"; + }; + thammers = { + email = "jawr@gmx.de"; + github = "tobias-hammerschmidt"; + githubId = 2543259; + name = "Tobias Hammerschmidt"; + }; + thanegill = { + email = "me@thanegill.com"; + github = "thanegill"; + githubId = 1141680; + name = "Thane Gill"; + }; + thblt = { + name = "Thibault Polge"; + email = "thibault@thb.lt"; + matrix = "@thbltp:matrix.org"; + github = "thblt"; + githubId = 2453136; + keys = [{ + longkeyid = "rsa4096/0x63A44817A52EAB7B"; + fingerprint = "D2A2 F0A1 E7A8 5E6F B711 DEE5 63A4 4817 A52E AB7B"; + }]; + }; + TheBrainScrambler = { + email = "esthromeris@riseup.net"; + github = "TheBrainScrambler"; + githubId = 34945377; + name = "John Smith"; + }; + thedavidmeister = { + email = "thedavidmeister@gmail.com"; + github = "thedavidmeister"; + githubId = 629710; + name = "David Meister"; + }; + thefloweringash = { + email = "lorne@cons.org.nz"; + github = "thefloweringash"; + githubId = 42933; + name = "Andrew Childs"; + }; + thefenriswolf = { + email = "stefan.rohrbacher97@gmail.com"; + github = "thefenriswolf"; + githubId = 8547242; + name = "Stefan Rohrbacher"; + }; + thelegy = { + email = "mail+nixos@0jb.de"; + github = "thelegy"; + githubId = 3105057; + name = "Jan Beinke"; + }; + therealansh = { + email = "tyagiansh23@gmail.com"; + github = "therealansh"; + githubId = 57180880; + name = "Ansh Tyagi"; + }; + thesola10 = { + email = "me@thesola.io"; + github = "thesola10"; + githubId = 7287268; + keys = [{ + longkeyid = "rsa4096/0x89245619BEBB95BA"; + fingerprint = "1D05 13A6 1AC4 0D8D C6D6 5F2C 8924 5619 BEBB 95BA"; + }]; + name = "Karim Vergnes"; + }; + theuni = { + email = "ct@flyingcircus.io"; + github = "ctheune"; + githubId = 1220572; + name = "Christian Theune"; + }; + thiagokokada = { + email = "thiagokokada@gmail.com"; + github = "thiagokokada"; + githubId = 844343; + name = "Thiago K. Okada"; + }; + thibautmarty = { + email = "github@thibautmarty.fr"; + matrix = "@thibaut:thibautmarty.fr"; + github = "ThibautMarty"; + githubId = 3268082; + name = "Thibaut Marty"; + }; + thmzlt = { + email = "git@thomazleite.com"; + github = "thmzlt"; + githubId = 7709; + name = "Thomaz Leite"; + }; + thomasdesr = { + email = "git@hive.pw"; + github = "thomasdesr"; + githubId = 681004; + name = "Thomas Desrosiers"; + }; + ThomasMader = { + email = "thomas.mader@gmail.com"; + github = "ThomasMader"; + githubId = 678511; + name = "Thomas Mader"; + }; + thomasjm = { + email = "tom@codedown.io"; + github = "thomasjm"; + githubId = 1634990; + name = "Tom McLaughlin"; + }; + thoughtpolice = { + email = "aseipp@pobox.com"; + github = "thoughtpolice"; + githubId = 3416; + name = "Austin Seipp"; + }; + thpham = { + email = "thomas.pham@ithings.ch"; + github = "thpham"; + githubId = 224674; + name = "Thomas Pham"; + }; + Thra11 = { + email = "tahall256@protonmail.ch"; + github = "Thra11"; + githubId = 1391883; + name = "Tom Hall"; + }; + Thunderbottom = { + email = "chinmaydpai@gmail.com"; + github = "Thunderbottom"; + githubId = 11243138; + name = "Chinmay D. Pai"; + keys = [{ + longkeyid = "rsa4096/0x75507BE256F40CED"; + fingerprint = "7F3E EEAA EE66 93CC 8782 042A 7550 7BE2 56F4 0CED"; + }]; + }; + tiagolobocastro = { + email = "tiagolobocastro@gmail.com"; + github = "tiagolobocastro"; + githubId = 1618946; + name = "Tiago Castro"; + }; + tilcreator = { + name = "TilCreator"; + email = "contact.nixos@tc-j.de"; + matrix = "@tilcreator:matrix.org"; + github = "TilCreator"; + githubId = 18621411; + }; + tilpner = { + email = "till@hoeppner.ws"; + github = "tilpner"; + githubId = 4322055; + name = "Till Höppner"; + }; + timbertson = { + email = "tim@gfxmonk.net"; + github = "timbertson"; + githubId = 14172; + name = "Tim Cuthbertson"; + }; + timma = { + email = "kunduru.it.iitb@gmail.com"; + github = "ktrsoft"; + githubId = 12712927; + name = "Timma"; + }; + timokau = { + email = "timokau@zoho.com"; + github = "timokau"; + githubId = 3799330; + name = "Timo Kaufmann"; + }; + timor = { + email = "timor.dd@googlemail.com"; + github = "timor"; + githubId = 174156; + name = "timor"; + }; + timput = { + email = "tim@timput.com"; + github = "TimPut"; + githubId = 2845239; + name = "Tim Put"; + }; + timstott = { + email = "stott.timothy@gmail.com"; + github = "timstott"; + githubId = 1334474; + name = "Timothy Stott"; + }; + tiramiseb = { + email = "sebastien@maccagnoni.eu"; + github = "tiramiseb"; + githubId = 1292007; + name = "Sébastien Maccagnoni"; + }; + titanous = { + email = "jonathan@titanous.com"; + github = "titanous"; + githubId = 13026; + name = "Jonathan Rudenberg"; + }; + tkerber = { + email = "tk@drwx.org"; + github = "tkerber"; + githubId = 5722198; + name = "Thomas Kerber"; + keys = [{ + longkeyid = "rsa4096/0x8489B911F9ED617B"; + fingerprint = "556A 403F B0A2 D423 F656 3424 8489 B911 F9ED 617B"; + }]; + }; + tmarkovski = { + email = "tmarkovski@gmail.com"; + github = "tmarkovski"; + githubId = 1280118; + name = "Tomislav Markovski"; + }; + tmountain = { + email = "tinymountain@gmail.com"; + github = "tmountain"; + githubId = 135297; + name = "Travis Whitton"; + }; + tmplt = { + email = "tmplt@dragons.rocks"; + github = "tmplt"; + githubId = 6118602; + name = "Viktor"; + }; + tnias = { + email = "phil@grmr.de"; + matrix = "@tnias:stratum0.org"; + github = "tnias"; + githubId = 9853194; + name = "Philipp Bartsch"; + }; + toastal = { + email = "toastal+nix@posteo.net"; + matrix = "@toastal:matrix.org"; + github = "toastal"; + githubId = 561087; + name = "toastal"; + keys = [{ + longkeyid = "ed25519/5CCE6F1466D47C9E"; + fingerprint = "7944 74B7 D236 DAB9 C9EF E7F9 5CCE 6F14 66D4 7C9E"; + }]; + }; + tobim = { + email = "nix@tobim.fastmail.fm"; + github = "tobim"; + githubId = 858790; + name = "Tobias Mayer"; + }; + tobiasBora = { + email = "tobias.bora.list@gmail.com"; + github = "tobiasBora"; + githubId = 2164118; + name = "Tobias Bora"; + }; + tohl = { + email = "tom@logand.com"; + github = "tohl"; + githubId = 12159013; + name = "Tomas Hlavaty"; + }; + tokudan = { + email = "git@danielfrank.net"; + github = "tokudan"; + githubId = 692610; + name = "Daniel Frank"; + }; + tomahna = { + email = "kevin.rauscher@tomahna.fr"; + github = "Tomahna"; + githubId = 8577941; + name = "Kevin Rauscher"; + }; + tomberek = { + email = "tomberek@gmail.com"; + matrix = "@tomberek:matrix.org"; + github = "tomberek"; + githubId = 178444; + name = "Thomas Bereknyei"; + }; + tomfitzhenry = { + email = "tom@tom-fitzhenry.me.uk"; + github = "tomfitzhenry"; + githubId = 61303; + name = "Tom Fitzhenry"; + }; + tomsmeets = { + email = "tom.tsmeets@gmail.com"; + github = "tomsmeets"; + githubId = 6740669; + name = "Tom Smeets"; + }; + toonn = { + email = "nixpkgs@toonn.io"; + matrix = "@toonn:matrix.org"; + github = "toonn"; + githubId = 1486805; + name = "Toon Nolten"; + }; + toschmidt = { + email = "tobias.schmidt@in.tum.de"; + github = "toschmidt"; + githubId = 27586264; + name = "Tobias Schmidt"; + }; + totoroot = { + name = "Matthias Thym"; + email = "git@thym.at"; + github = "totoroot"; + githubId = 39650930; + }; + ToxicFrog = { + email = "toxicfrog@ancilla.ca"; + github = "ToxicFrog"; + githubId = 90456; + name = "Rebecca (Bex) Kelly"; + }; + travisbhartwell = { + email = "nafai@travishartwell.net"; + github = "travisbhartwell"; + githubId = 10110; + name = "Travis B. Hartwell"; + }; + travisdavis-ops = { + email = "travisdavismedia@gmail.com"; + github = "travisdavis-ops"; + githubId = 52011418; + name = "Travis Davis"; + }; + TredwellGit = { + email = "tredwell@tutanota.com"; + github = "TredwellGit"; + githubId = 61860346; + name = "Tredwell"; + }; + treemo = { + email = "matthieu.chevrier@treemo.fr"; + github = "treemo"; + githubId = 207457; + name = "Matthieu Chevrier"; + }; + trepetti = { + email = "trepetti@cs.columbia.edu"; + github = "trepetti"; + githubId = 25440339; + name = "Tom Repetti"; + }; + trevorj = { + email = "nix@trevor.joynson.io"; + github = "akatrevorjay"; + githubId = 1312290; + name = "Trevor Joynson"; + }; + tricktron = { + email = "tgagnaux@gmail.com"; + github = "tricktron"; + githubId = 16036882; + name = "Thibault Gagnaux"; + }; + trino = { + email = "muehlhans.hubert@ekodia.de"; + github = "hmuehlhans"; + githubId = 9870613; + name = "Hubert Mühlhans"; + }; + troydm = { + email = "d.geurkov@gmail.com"; + github = "troydm"; + githubId = 483735; + name = "Dmitry Geurkov"; + }; + truh = { + email = "jakob-nixos@truh.in"; + github = "truh"; + githubId = 1183303; + name = "Jakob Klepp"; + }; + trundle = { + name = "Andreas Stührk"; + email = "andy@hammerhartes.de"; + github = "Trundle"; + githubId = 332418; + }; + tscholak = { + email = "torsten.scholak@googlemail.com"; + github = "tscholak"; + githubId = 1568873; + name = "Torsten Scholak"; + }; + tshaynik = { + email = "tshaynik@protonmail.com"; + github = "tshaynik"; + githubId = 15064765; + name = "tshaynik"; + }; + tstrobel = { + email = "4ZKTUB6TEP74PYJOPWIR013S2AV29YUBW5F9ZH2F4D5UMJUJ6S@hash.domains"; + name = "Thomas Strobel"; + }; + ttuegel = { + email = "ttuegel@mailbox.org"; + github = "ttuegel"; + githubId = 563054; + name = "Thomas Tuegel"; + }; + turion = { + email = "programming@manuelbaerenz.de"; + github = "turion"; + githubId = 303489; + name = "Manuel Bärenz"; + }; + tu-maurice = { + email = "valentin.gehrke+nixpkgs@zom.bi"; + github = "tu-maurice"; + githubId = 16151097; + name = "Valentin Gehrke"; + }; + tuxinaut = { + email = "trash4you@tuxinaut.de"; + github = "tuxinaut"; + githubId = 722482; + name = "Denny Schäfer"; + keys = [{ + longkeyid = "rsa4096/0xB057455D1E567270"; + fingerprint = "C752 0E49 4D92 1740 D263 C467 B057 455D 1E56 7270"; + }]; + }; + tv = { + email = "tv@krebsco.de"; + github = "4z3"; + githubId = 427872; + name = "Tomislav Viljetić"; + }; + tvestelind = { + email = "tomas.vestelind@fripost.org"; + github = "tvestelind"; + githubId = 699403; + name = "Tomas Vestelind"; + }; + tviti = { + email = "tviti@hawaii.edu"; + github = "tviti"; + githubId = 2251912; + name = "Taylor Viti"; + }; + tvorog = { + email = "marszaripov@gmail.com"; + github = "tvorog"; + githubId = 1325161; + name = "Marsel Zaripov"; + }; + tweber = { + email = "tw+nixpkgs@360vier.de"; + github = "thorstenweber83"; + githubId = 9413924; + name = "Thorsten Weber"; + }; + twey = { + email = "twey@twey.co.uk"; + github = "Twey"; + githubId = 101639; + name = "James ‘Twey’ Kay"; + }; + twhitehead = { + name = "Tyson Whitehead"; + email = "twhitehead@gmail.com"; + github = "twhitehead"; + githubId = 787843; + keys = [{ + longkeyid = "rsa2048/0x594258F0389D2802"; + fingerprint = "E631 8869 586F 99B4 F6E6 D785 5942 58F0 389D 2802"; + }]; + }; + twitchyliquid64 = { + name = "Tom"; + email = "twitchyliquid64@ciphersink.net"; + github = "twitchyliquid64"; + githubId = 6328589; + }; + typetetris = { + email = "ericwolf42@mail.com"; + github = "typetetris"; + githubId = 1983821; + name = "Eric Wolf"; + }; + udono = { + email = "udono@virtual-things.biz"; + github = "udono"; + githubId = 347983; + name = "Udo Spallek"; + }; + ulrikstrid = { + email = "ulrik.strid@outlook.com"; + github = "ulrikstrid"; + githubId = 1607770; + name = "Ulrik Strid"; + }; + unclechu = { + name = "Viacheslav Lotsmanov"; + email = "lotsmanov89@gmail.com"; + github = "unclechu"; + githubId = 799353; + keys = [{ + longkeyid = "rsa4096/0xD276FF7467007335"; + fingerprint = "EE59 5E29 BB5B F2B3 5ED2 3F1C D276 FF74 6700 7335"; + }]; + }; + uniquepointer = { + email = "uniquepointer@mailbox.org"; + matrix = "@uniquepointer:matrix.org"; + github = "uniquepointer"; + githubId = 71751817; + name = "uniquepointer"; + }; + unode = { + email = "alves.rjc@gmail.com"; + matrix = "@renato_alves:matrix.org"; + github = "unode"; + githubId = 122319; + name = "Renato Alves"; + }; + unrooted = { + name = "Konrad Klawikowski"; + email = "konrad.root.klawikowski@gmail.com"; + github = "unrooted"; + githubId = 30440603; + }; + uralbash = { + email = "root@uralbash.ru"; + github = "uralbash"; + githubId = 619015; + name = "Svintsov Dmitry"; + }; + urbas = { + email = "matej.urbas@gmail.com"; + github = "urbas"; + githubId = 771193; + name = "Matej Urbas"; + }; + uri-canva = { + email = "uri@canva.com"; + github = "uri-canva"; + githubId = 33242106; + name = "Uri Baghin"; + }; + urlordjames = { + email = "urlordjames@gmail.com"; + github = "urlordjames"; + githubId = 32751441; + name = "urlordjames"; + }; + uskudnik = { + email = "urban.skudnik@gmail.com"; + github = "uskudnik"; + githubId = 120451; + name = "Urban Skudnik"; + }; + utdemir = { + email = "me@utdemir.com"; + github = "utdemir"; + githubId = 928084; + name = "Utku Demir"; + }; + uvnikita = { + email = "uv.nikita@gmail.com"; + github = "uvNikita"; + githubId = 1084748; + name = "Nikita Uvarov"; + }; + uwap = { + email = "me@uwap.name"; + github = "uwap"; + githubId = 2212422; + name = "uwap"; + }; + V = { + name = "V"; + email = "v@anomalous.eu"; + github = "deviant"; + githubId = 68829907; + }; + vaibhavsagar = { + email = "vaibhavsagar@gmail.com"; + matrix = "@vaibhavsagar:matrix.org"; + github = "vaibhavsagar"; + githubId = 1525767; + name = "Vaibhav Sagar"; + }; + valebes = { + email = "valebes@gmail.com"; + github = "valebes"; + githubId = 10956211; + name = "Valerio Besozzi"; + }; + valeriangalliat = { + email = "val@codejam.info"; + github = "valeriangalliat"; + githubId = 3929133; + name = "Valérian Galliat"; + }; + valodim = { + email = "look@my.amazin.horse"; + matrix = "@Valodim:stratum0.org"; + github = "valodim"; + githubId = 27813; + name = "Vincent Breitmoser"; + }; + vandenoever = { + email = "jos@vandenoever.info"; + github = "vandenoever"; + githubId = 608417; + name = "Jos van den Oever"; + }; + vanilla = { + email = "osu_vanilla@126.com"; + github = "VergeDX"; + githubId = 25173827; + name = "Vanilla"; + keys = [{ + longkeyid = "rsa4096/0x3750028ED04FA42E"; + fingerprint = "2649 340C C909 F821 D251 6714 3750 028E D04F A42E"; + }]; + }; + vanschelven = { + email = "klaas@vanschelven.com"; + github = "vanschelven"; + githubId = 223833; + name = "Klaas van Schelven"; + }; + vanzef = { + email = "vanzef@gmail.com"; + github = "vanzef"; + githubId = 12428837; + name = "Ivan Solyankin"; + }; + varunpatro = { + email = "varun.kumar.patro@gmail.com"; + github = "varunpatro"; + githubId = 6943308; + name = "Varun Patro"; + }; + vbgl = { + email = "Vincent.Laporte@gmail.com"; + github = "vbgl"; + githubId = 2612464; + name = "Vincent Laporte"; + }; + vbmithr = { + email = "vb@luminar.eu.org"; + github = "vbmithr"; + githubId = 797581; + name = "Vincent Bernardoff"; + }; + vcanadi = { + email = "vito.canadi@gmail.com"; + github = "vcanadi"; + githubId = 8889722; + name = "Vitomir Čanadi"; + }; + vcunat = { + name = "Vladimír Čunát"; + # vcunat@gmail.com predominated in commits before 2019/03 + email = "v@cunat.cz"; + matrix = "@vcunat:matrix.org"; + github = "vcunat"; + githubId = 1785925; + keys = [{ + longkeyid = "rsa4096/0xE747DF1F9575A3AA"; + fingerprint = "B600 6460 B60A 80E7 8206 2449 E747 DF1F 9575 A3AA"; + }]; + }; + vdemeester = { + email = "vincent@sbr.pm"; + github = "vdemeester"; + githubId = 6508; + name = "Vincent Demeester"; + }; + veehaitch = { + name = "Vincent Haupert"; + email = "mail@vincent-haupert.de"; + github = "veehaitch"; + githubId = 15069839; + keys = [{ + longkeyid = "rsa4096/0x874BD6F916FAA742"; + fingerprint = "4D23 ECDF 880D CADF 5ECA 4458 874B D6F9 16FA A742"; + }]; + }; + vel = { + email = "llathasa@outlook.com"; + github = "q60"; + githubId = 61933599; + name = "vel"; + }; + velovix = { + email = "xaviosx@gmail.com"; + github = "velovix"; + githubId = 2856634; + name = "Tyler Compton"; + }; + veprbl = { + email = "veprbl@gmail.com"; + github = "veprbl"; + githubId = 245573; + name = "Dmitry Kalinkin"; + }; + vidbina = { + email = "vid@bina.me"; + github = "vidbina"; + githubId = 335406; + name = "David Asabina"; + }; + vidister = { + email = "v@vidister.de"; + github = "vidister"; + githubId = 11413574; + name = "Fiona Weber"; + }; + vifino = { + email = "vifino@tty.sh"; + github = "vifino"; + githubId = 5837359; + name = "Adrian Pistol"; + }; + vikanezrimaya = { + email = "vika@fireburn.ru"; + github = "vikanezrimaya"; + githubId = 7953163; + name = "Vika Shleina"; + keys = [{ + longkeyid = "rsa2048/0x4F62CD07CE64796A"; + fingerprint = "B3C0 DA1A C18B 82E8 CA8B B1D1 4F62 CD07 CE64 796A"; + }]; + }; + vincentbernat = { + email = "vincent@bernat.ch"; + github = "vincentbernat"; + githubId = 631446; + name = "Vincent Bernat"; + keys = [{ + longkeyid = "rsa4096/0x95A42FE8353525F9"; + fingerprint = "AEF2 3487 66F3 71C6 89A7 3600 95A4 2FE8 3535 25F9"; + }]; + }; + vinymeuh = { + email = "vinymeuh@gmail.com"; + github = "vinymeuh"; + githubId = 118959; + name = "VinyMeuh"; + }; + viraptor = { + email = "nix@viraptor.info"; + github = "viraptor"; + githubId = 188063; + name = "Stanisław Pitucha"; + }; + viric = { + email = "viric@viric.name"; + github = "viric"; + githubId = 66664; + name = "Lluís Batlle i Rossell"; + }; + virusdave = { + email = "dave.nicponski@gmail.com"; + github = "virusdave"; + githubId = 6148271; + name = "Dave Nicponski"; + }; + vizanto = { + email = "danny@prime.vc"; + github = "vizanto"; + githubId = 326263; + name = "Danny Wilson"; + }; + vklquevs = { + email = "vklquevs@gmail.com"; + github = "vklquevs"; + githubId = 1771234; + name = "vklquevs"; + }; + vlaci = { + email = "laszlo.vasko@outlook.com"; + github = "vlaci"; + githubId = 1771332; + name = "László Vaskó"; + }; + vlstill = { + email = "xstill@fi.muni.cz"; + github = "vlstill"; + githubId = 4070422; + name = "Vladimír Štill"; + }; + vmandela = { + email = "venkat.mandela@gmail.com"; + github = "vmandela"; + githubId = 849772; + name = "Venkateswara Rao Mandela"; + }; + vmchale = { + email = "tmchale@wisc.edu"; + github = "vmchale"; + githubId = 13259982; + name = "Vanessa McHale"; + }; + + voidless = { + email = "julius.schmitt@yahoo.de"; + github = "voidIess"; + githubId = 45292658; + name = "Julius Schmitt"; + }; + vojta001 = { + email = "vojtech.kane@gmail.com"; + github = "vojta001"; + githubId = 7038383; + name = "Vojta Káně"; + }; + volhovm = { + email = "volhovm.cs@gmail.com"; + github = "volhovm"; + githubId = 5604643; + name = "Mikhail Volkhov"; + }; + volth = { + email = "jaroslavas@volth.com"; + github = "volth"; + githubId = 508305; + name = "Jaroslavas Pocepko"; + }; + vonfry = { + email = "nixos@vonfry.name"; + github = "Vonfry"; + githubId = 3413119; + name = "Vonfry"; + }; + vq = { + email = "vq@erq.se"; + name = "Daniel Nilsson"; + }; + vrinek = { + email = "vrinek@hey.com"; + github = "vrinek"; + name = "Kostas Karachalios"; + githubId = 81346; + }; + vrthra = { + email = "rahul@gopinath.org"; + github = "vrthra"; + githubId = 70410; + name = "Rahul Gopinath"; + }; + vskilet = { + email = "victor@sene.ovh"; + github = "vskilet"; + githubId = 7677567; + name = "Victor SENE"; + }; + vtuan10 = { + email = "mail@tuan-vo.de"; + github = "vtuan10"; + githubId = 16415673; + name = "Van Tuan Vo"; + }; + vyorkin = { + email = "vasiliy.yorkin@gmail.com"; + github = "vyorkin"; + githubId = 988849; + name = "Vasiliy Yorkin"; + }; + vyp = { + email = "elisp.vim@gmail.com"; + github = "vyp"; + githubId = 3889405; + name = "vyp"; + }; + wackbyte = { + name = "wackbyte"; + email = "wackbyte@pm.me"; + github = "wackbyte"; + githubId = 29505620; + keys = [{ + longkeyid = "rsa4096/0x937F2AE5CCEFBF59"; + fingerprint = "E595 7FE4 FEF6 714B 1AD3 1483 937F 2AE5 CCEF BF59"; + }]; + }; + wakira = { + name = "Sheng Wang"; + email = "sheng@a64.work"; + github = "wakira"; + githubId = 2338339; + keys = [{ + longkeyid = "rsa4096/0x8C9B0A8FC0C0D862"; + fingerprint = "47F7 009E 3AE3 1DA7 988E 12E1 8C9B 0A8F C0C0 D862"; + }]; + }; + wamserma = { + name = "Markus S. Wamser"; + email = "github-dev@mail2013.wamser.eu"; + github = "wamserma"; + githubId = 60148; + }; + waynr = { + name = "Wayne Warren"; + email = "wayne.warren.s@gmail.com"; + github = "waynr"; + githubId = 1441126; + }; + wchresta = { + email = "wchresta.nix@chrummibei.ch"; + github = "wchresta"; + githubId = 34962284; + name = "wchresta"; + }; + wedens = { + email = "kirill.wedens@gmail.com"; + name = "wedens"; + }; + wegank = { + name = "Weijia Wang"; + email = "contact@weijia.wang"; + github = "wegank"; + githubId = 9713184; + }; + weihua = { + email = "luwh364@gmail.com"; + github = "weihua-lu"; + githubId = 9002575; + name = "Weihua Lu"; + }; + welteki = { + email = "welteki@pm.me"; + github = "welteki"; + githubId = 16267532; + name = "Han Verstraete"; + keys = [{ + longkeyid = "rsa4096/0x11F7BAEA856743FF"; + fingerprint = "2145 955E 3F5E 0C95 3458 41B5 11F7 BAEA 8567 43FF"; + }]; + }; + wentasah = { + name = "Michal Sojka"; + email = "wsh@2x.cz"; + github = "wentasah"; + githubId = 140542; + }; + wheelsandmetal = { + email = "jakob@schmutz.co.uk"; + github = "wheelsandmetal"; + githubId = 13031455; + name = "Jakob Schmutz"; + }; + WhittlesJr = { + email = "alex.joseph.whitt@gmail.com"; + github = "WhittlesJr"; + githubId = 19174984; + name = "Alex Whitt"; + }; + whonore = { + email = "wolfhonore@gmail.com"; + github = "whonore"; + githubId = 7121530; + name = "Wolf Honoré"; + }; + wildsebastian = { + name = "Sebastian Wild"; + email = "sebastian@wild-siena.com"; + github = "wildsebastian"; + githubId = 1215623; + keys = [{ + longkeyid = "rsa4096/0x366A2940479A06FC"; + fingerprint = "DA03 D6C6 3F58 E796 AD26 E99B 366A 2940 479A 06FC"; + }]; + }; + willibutz = { + email = "willibutz@posteo.de"; + github = "willibutz"; + githubId = 20464732; + name = "Willi Butz"; + }; + willtim = { + email = "tim.williams.public@gmail.com"; + name = "Tim Philip Williams"; + }; + willcohen = { + email = "willcohen@users.noreply.github.com"; + github = "willcohen"; + githubId = 5185341; + name = "Will Cohen"; + }; + winden = { + email = "windenntw@gmail.com"; + name = "Antonio Vargas Gonzalez"; + }; + winpat = { + email = "patrickwinter@posteo.ch"; + github = "winpat"; + githubId = 6016963; + name = "Patrick Winter"; + }; + winter = { + email = "nixos@winter.cafe"; + github = "winterqt"; + githubId = 78392041; + name = "Winter"; + }; + wintrmvte = { + name = "Jakub Lutczyn"; + email = "kubalutczyn@gmail.com"; + github = "wintrmvte"; + githubId = 41823252; + }; + wirew0rm = { + email = "alex@wirew0rm.de"; + github = "wirew0rm"; + githubId = 1202371; + name = "Alexander Krimm"; + }; + wishfort36 = { + email = "42300264+wishfort36@users.noreply.github.com"; + github = "wishfort36"; + githubId = 42300264; + name = "wishfort36"; + }; + wizeman = { + email = "rcorreia@wizy.org"; + github = "wizeman"; + githubId = 168610; + name = "Ricardo M. Correia"; + }; + wjlroe = { + email = "willroe@gmail.com"; + github = "wjlroe"; + githubId = 43315; + name = "William Roe"; + }; + wldhx = { + email = "wldhx+nixpkgs@wldhx.me"; + github = "wldhx"; + githubId = 15619766; + name = "wldhx"; + }; + wmertens = { + email = "Wout.Mertens@gmail.com"; + github = "wmertens"; + githubId = 54934; + name = "Wout Mertens"; + }; + wnklmnn = { + email = "pascal@wnklmnn.de"; + github = "wnklmnn"; + githubId = 9423014; + name = "Pascal Winkelmann"; + }; + woffs = { + email = "github@woffs.de"; + github = "woffs"; + githubId = 895853; + name = "Frank Doepper"; + }; + wohanley = { + email = "me@wohanley.com"; + github = "wohanley"; + githubId = 1322287; + name = "William O'Hanley"; + }; + woky = { + email = "pampu.andrei@pm.me"; + github = "andreisergiu98"; + githubId = 11740700; + name = "Andrei Pampu"; + }; + wolfangaukang = { + email = "liquid.query960@4wrd.cc"; + github = "wolfangaukang"; + githubId = 8378365; + name = "P. R. d. O."; + }; + womfoo = { + email = "kranium@gikos.net"; + github = "womfoo"; + githubId = 1595132; + name = "Kranium Gikos Mendoza"; + }; + worldofpeace = { + email = "worldofpeace@protonmail.ch"; + github = "worldofpeace"; + githubId = 28888242; + name = "WORLDofPEACE"; + }; + wr0belj = { + name = "Jakub Wróbel"; + email = "wrobel.jakub@protonmail.com"; + github = "wr0belj"; + githubId = 40501814; + }; + wscott = { + email = "wsc9tt@gmail.com"; + github = "wscott"; + githubId = 31487; + name = "Wayne Scott"; + }; + wucke13 = { + email = "wucke13@gmail.com"; + github = "wucke13"; + githubId = 20400405; + name = "Wucke"; + }; + wykurz = { + email = "wykurz@gmail.com"; + github = "wykurz"; + githubId = 483465; + name = "Mateusz Wykurz"; + }; + wulfsta = { + email = "wulfstawulfsta@gmail.com"; + github = "Wulfsta"; + githubId = 13378502; + name = "Wulfsta"; + }; + wunderbrick = { + name = "Andrew Phipps"; + email = "lambdafuzz@tutanota.com"; + github = "wunderbrick"; + githubId = 52174714; + }; + wyvie = { + email = "elijahrum@gmail.com"; + github = "wyvie"; + githubId = 3992240; + name = "Elijah Rum"; + }; + x3ro = { + name = "^x3ro"; + email = "nix@x3ro.dev"; + github = "x3rAx"; + githubId = 2268851; + }; + xaverdh = { + email = "hoe.dom@gmx.de"; + github = "xaverdh"; + githubId = 11050617; + name = "Dominik Xaver Hörl"; + }; + xbreak = { + email = "xbreak@alphaware.se"; + github = "xbreak"; + githubId = 13489144; + name = "Calle Rosenquist"; + }; + xdhampus = { + name = "Hampus"; + email = "16954508+xdHampus@users.noreply.github.com"; + github = "xdHampus"; + githubId = 16954508; + }; + xe = { + email = "me@christine.website"; + matrix = "@withoutwithin:matrix.org"; + github = "Xe"; + githubId = 529003; + name = "Christine Dodrill"; + }; + xeji = { + email = "xeji@cat3.de"; + github = "xeji"; + githubId = 36407913; + name = "Uli Baum"; + }; + xfnw = { + email = "xfnw+nixos@riseup.net"; + github = "xfnw"; + githubId = 66233223; + name = "Owen"; + }; + xfix = { + email = "konrad@borowski.pw"; + matrix = "@xfix:matrix.org"; + github = "xfix"; + githubId = 1297598; + name = "Konrad Borowski"; + }; + xgroleau = { + email = "xgroleau@gmail.com"; + github = "xgroleau"; + githubId = 31734358; + name = "Xavier Groleau"; + }; + xiorcale = { + email = "quentin.vaucher@pm.me"; + github = "xiorcale"; + githubId = 17534323; + name = "Quentin Vaucher"; + }; + xnaveira = { + email = "xnaveira@gmail.com"; + github = "xnaveira"; + githubId = 2534411; + name = "Xavier Naveira"; + }; + xnwdd = { + email = "nwdd+nixos@no.team"; + github = "xnwdd"; + githubId = 3028542; + name = "Guillermo NWDD"; + }; + xrelkd = { + email = "46590321+xrelkd@users.noreply.github.com"; + github = "xrelkd"; + githubId = 46590321; + name = "xrelkd"; + }; + xurei = { + email = "olivier.bourdoux@gmail.com"; + github = "xurei"; + githubId = 621695; + name = "Olivier Bourdoux"; + }; + xvapx = { + email = "marti.serra.coscollano@gmail.com"; + github = "xvapx"; + githubId = 11824817; + name = "Marti Serra"; + }; + xworld21 = { + email = "1962985+xworld21@users.noreply.github.com"; + github = "xworld21"; + githubId = 1962985; + name = "Vincenzo Mantova"; + }; + xzfc = { + email = "xzfcpw@gmail.com"; + github = "xzfc"; + githubId = 5121426; + name = "Albert Safin"; + }; + y0no = { + email = "y0no@y0no.fr"; + github = "y0no"; + githubId = 2242427; + name = "Yoann Ono"; + }; + yana = { + email = "yana@riseup.net"; + github = "sowelisuwi"; + githubId = 1643293; + name = "Yana Timoshenko"; + }; + yarny = { + email = "41838844+Yarny0@users.noreply.github.com"; + github = "Yarny0"; + githubId = 41838844; + name = "Yarny"; + }; + yarr = { + email = "savraz@gmail.com"; + github = "Eternity-Yarr"; + githubId = 3705333; + name = "Dmitry V."; + }; + yayayayaka = { + email = "nixpkgs@uwu.is"; + matrix = "@lara:uwu.is"; + github = "yayayayaka"; + githubId = 73759599; + name = "Lara A."; + }; + yesbox = { + email = "jesper.geertsen.jonsson@gmail.com"; + github = "yesbox"; + githubId = 4113027; + name = "Jesper Geertsen Jonsson"; + }; + yinfeng = { + email = "lin.yinfeng@outlook.com"; + github = "linyinfeng"; + githubId = 11229748; + name = "Lin Yinfeng"; + }; + ylecornec = { + email = "yves.stan.lecornec@tweag.io"; + github = "ylecornec"; + githubId = 5978566; + name = "Yves-Stan Le Cornec"; + }; + ylwghst = { + email = "ylwghst@onionmail.info"; + github = "ylwghst"; + githubId = 26011724; + name = "Burim Augustin Berisa"; + }; + yl3dy = { + email = "aleksandr.kiselyov@gmail.com"; + github = "yl3dy"; + githubId = 1311192; + name = "Alexander Kiselyov"; + }; + yochai = { + email = "yochai@titat.info"; + github = "yochai"; + githubId = 1322201; + name = "Yochai"; + }; + yoctocell = { + email = "public@yoctocell.xyz"; + github = "yoctocell"; + githubId = 40352765; + name = "Yoctocell"; + }; + yorickvp = { + email = "yorickvanpelt@gmail.com"; + matrix = "@yorickvp:matrix.org"; + github = "yorickvp"; + githubId = 647076; + name = "Yorick van Pelt"; + }; + yrashk = { + email = "yrashk@gmail.com"; + github = "yrashk"; + githubId = 452; + name = "Yurii Rashkovskii"; + }; + yrd = { + name = "Yannik Rödel"; + email = "nix@yannik.info"; + github = "yrd"; + githubId = 1820447; + }; + ysndr = { + email = "me@ysndr.de"; + github = "ysndr"; + githubId = 7040031; + name = "Yannik Sander"; + }; + yuriaisaka = { + email = "yuri.aisaka+nix@gmail.com"; + github = "yuriaisaka"; + githubId = 687198; + name = "Yuri Aisaka"; + }; + yurrriq = { + email = "eric@ericb.me"; + github = "yurrriq"; + githubId = 1866448; + name = "Eric Bailey"; + }; + Yumasi = { + email = "gpagnoux@gmail.com"; + github = "Yumasi"; + githubId = 24368641; + name = "Guillaume Pagnoux"; + keys = [{ + longkeyid = "rsa4096/0xEC5065899AEAAF4C"; + fingerprint = "85F8 E850 F8F2 F823 F934 535B EC50 6589 9AEA AF4C"; + }]; + }; + yuka = { + email = "yuka@yuka.dev"; + matrix = "@yuka:yuka.dev"; + github = "yu-re-ka"; + githubId = 86169957; + name = "Yureka"; + }; + yusdacra = { + email = "y.bera003.06@protonmail.com"; + matrix = "@yusdacra:nixos.dev"; + github = "yusdacra"; + githubId = 19897088; + name = "Yusuf Bera Ertan"; + keys = [{ + longkeyid = "rsa2048/0x61807181F60EFCB2"; + fingerprint = "9270 66BD 8125 A45B 4AC4 0326 6180 7181 F60E FCB2"; + }]; + }; + yuu = { + email = "yuuyin@protonmail.com"; + github = "yuuyins"; + githubId = 86538850; + name = "Yuu Yin"; + keys = [{ + longkeyid = "rsa4096/0x416F303B43C20AC3"; + fingerprint = "9F19 3AE8 AA25 647F FC31 46B5 416F 303B 43C2 0AC3"; + }]; + }; + yvesf = { + email = "yvesf+nix@xapek.org"; + github = "yvesf"; + githubId = 179548; + name = "Yves Fischer"; + }; + yvt = { + email = "i@yvt.jp"; + github = "yvt"; + githubId = 5253988; + name = "yvt"; + }; + maggesi = { + email = "marco.maggesi@gmail.com"; + github = "maggesi"; + githubId = 1809783; + name = "Marco Maggesi"; + }; + zachcoyle = { + email = "zach.coyle@gmail.com"; + github = "zachcoyle"; + githubId = 908716; + name = "Zach Coyle"; + }; + zagy = { + email = "cz@flyingcircus.io"; + github = "zagy"; + githubId = 568532; + name = "Christian Zagrodnick"; + }; + zakame = { + email = "zakame@zakame.net"; + github = "zakame"; + githubId = 110625; + name = "Zak B. Elep"; + }; + zalakain = { + email = "ping@umazalakain.info"; + github = "umazalakain"; + githubId = 1319905; + name = "Uma Zalakain"; + }; + zaninime = { + email = "francesco@zanini.me"; + github = "zaninime"; + githubId = 450885; + name = "Francesco Zanini"; + }; + zarelit = { + email = "david@zarel.net"; + github = "zarelit"; + githubId = 3449926; + name = "David Costa"; + }; + zauberpony = { + email = "elmar@athmer.org"; + github = "zauberpony"; + githubId = 250877; + name = "Elmar Athmer"; + }; + zakkor = { + email = "edward.dalbon@gmail.com"; + github = "zakkor"; + githubId = 6191421; + name = "Edward d'Albon"; + }; + zef = { + email = "zef@zef.me"; + name = "Zef Hemel"; + }; + zeratax = { + email = "mail@zera.tax"; + github = "ZerataX"; + githubId = 5024958; + name = "Jona Abdinghoff"; + keys = [{ + longkeyid = "rsa4096/0x8333735E784DF9D4"; + fingerprint = "44F7 B797 9D3A 27B1 89E0 841E 8333 735E 784D F9D4"; + }]; + }; + zfnmxt = { + name = "zfnmxt"; + email = "zfnmxt@zfnmxt.com"; + github = "zfnmxt"; + githubId = 37446532; + }; + zgrannan = { + email = "zgrannan@gmail.com"; + github = "zgrannan"; + githubId = 1141948; + name = "Zack Grannan"; + }; + zhaofengli = { + email = "hello@zhaofeng.li"; + matrix = "@zhaofeng:zhaofeng.li"; + github = "zhaofengli"; + githubId = 2189609; + name = "Zhaofeng Li"; + }; + zimbatm = { + email = "zimbatm@zimbatm.com"; + github = "zimbatm"; + githubId = 3248; + name = "zimbatm"; + }; + Zimmi48 = { + email = "theo.zimmermann@univ-paris-diderot.fr"; + github = "Zimmi48"; + githubId = 1108325; + name = "Théo Zimmermann"; + }; + zohl = { + email = "zohl@fmap.me"; + github = "zohl"; + githubId = 6067895; + name = "Al Zohali"; + }; + zookatron = { + email = "tim@zookatron.com"; + github = "zookatron"; + githubId = 1772064; + name = "Tim Zook"; + }; + zopieux = { + email = "zopieux@gmail.com"; + github = "zopieux"; + githubId = 81353; + name = "Alexandre Macabies"; + }; + zowoq = { + email = "59103226+zowoq@users.noreply.github.com"; + github = "zowoq"; + githubId = 59103226; + name = "zowoq"; + }; + zraexy = { + email = "zraexy@gmail.com"; + github = "zraexy"; + githubId = 8100652; + name = "David Mell"; + }; + ztzg = { + email = "dd@crosstwine.com"; + github = "ztzg"; + githubId = 393108; + name = "Damien Diederen"; + }; + zx2c4 = { + email = "Jason@zx2c4.com"; + github = "zx2c4"; + githubId = 10643; + name = "Jason A. Donenfeld"; + }; + zyansheep = { + email = "zyansheep@protonmail.com"; + github = "zyansheep"; + githubId = 20029431; + name = "Zyansheep"; + }; + zzamboni = { + email = "diego@zzamboni.org"; + github = "zzamboni"; + githubId = 32876; + name = "Diego Zamboni"; + }; + turbomack = { + email = "marek.faj@gmail.com"; + github = "turboMaCk"; + githubId = 2130305; + name = "Marek Fajkus"; + }; + melling = { + email = "mattmelling@fastmail.com"; + github = "mattmelling"; + githubId = 1215331; + name = "Matt Melling"; + }; + wd15 = { + email = "daniel.wheeler2@gmail.com"; + github = "wd15"; + githubId = 1986844; + name = "Daniel Wheeler"; + }; + misuzu = { + email = "bakalolka@gmail.com"; + github = "misuzu"; + githubId = 248143; + name = "misuzu"; + }; + zokrezyl = { + email = "zokrezyl@gmail.com"; + github = "zokrezyl"; + githubId = 51886259; + name = "Zokre Zyl"; + }; + rakesh4g = { + email = "rakeshgupta4u@gmail.com"; + github = "rakesh4g"; + githubId = 50867187; + name = "Rakesh Gupta"; + }; + mlatus = { + email = "wqseleven@gmail.com"; + github = "Ninlives"; + githubId = 17873203; + name = "mlatus"; + }; + waiting-for-dev = { + email = "marc@lamarciana.com"; + github = "waiting-for-dev"; + githubId = 52650; + name = "Marc Busqué"; + }; + snglth = { + email = "illia@ishestakov.com"; + github = "snglth"; + githubId = 8686360; + name = "Illia Shestakov"; + }; + masaeedu = { + email = "masaeedu@gmail.com"; + github = "masaeedu"; + githubId = 3674056; + name = "Asad Saeeduddin"; + }; + matthewcroughan = { + email = "matt@croughan.sh"; + github = "matthewcroughan"; + githubId = 26458780; + name = "Matthew Croughan"; + }; + ngerstle = { + name = "Nicholas Gerstle"; + email = "ngerstle@gmail.com"; + github = "ngerstle"; + githubId = 1023752; + }; + shardy = { + email = "shardul@baral.ca"; + github = "shardulbee"; + githubId = 16765155; + name = "Shardul Baral"; + }; + xavierzwirtz = { + email = "me@xavierzwirtz.com"; + github = "xavierzwirtz"; + githubId = 474343; + name = "Xavier Zwirtz"; + }; + ymarkus = { + name = "Yannick Markus"; + email = "nixpkgs@ymarkus.dev"; + github = "ymarkus"; + githubId = 62380378; + }; + ymatsiuk = { + name = "Yurii Matsiuk"; + email = "ymatsiuk@users.noreply.github.com"; + github = "ymatsiuk"; + githubId = 24990891; + keys = [{ + longkeyid = "rsa4096/0x61302290298601AA"; + fingerprint = "7BB8 84B5 74DA FDB1 E194 ED21 6130 2290 2986 01AA"; + }]; + }; + ymeister = { + name = "Yuri Meister"; + email = "47071325+ymeister@users.noreply.github.com"; + github = "ymeister"; + githubId = 47071325; + }; + cpcloud = { + name = "Phillip Cloud"; + email = "417981+cpcloud@users.noreply.github.com"; + github = "cpcloud"; + githubId = 417981; + }; + davegallant = { + name = "Dave Gallant"; + email = "davegallant@gmail.com"; + github = "davegallant"; + githubId = 4519234; + }; + saulecabrera = { + name = "Saúl Cabrera"; + email = "saulecabrera@gmail.com"; + github = "saulecabrera"; + githubId = 1423601; + }; + tfmoraes = { + name = "Thiago Franco de Moraes"; + email = "351108+tfmoraes@users.noreply.github.com"; + github = "tfmoraes"; + githubId = 351108; + }; + deifactor = { + name = "Ash Zahlen"; + email = "ext0l@riseup.net"; + github = "deifactor"; + githubId = 30192992; + }; + fzakaria = { + name = "Farid Zakaria"; + email = "farid.m.zakaria@gmail.com"; + matrix = "@fzakaria:matrix.org"; + github = "fzakaria"; + githubId = 605070; + }; + nagisa = { + name = "Simonas Kazlauskas"; + email = "nixpkgs@kazlauskas.me"; + github = "nagisa"; + githubId = 679122; + }; + yshym = { + name = "Yevhen Shymotiuk"; + email = "yshym@pm.me"; + github = "yshym"; + githubId = 44244245; + }; + hmenke = { + name = "Henri Menke"; + email = "henri@henrimenke.de"; + matrix = "@hmenke:matrix.org"; + github = "hmenke"; + githubId = 1903556; + keys = [{ + longkeyid = "rsa4096/0xD65C9AFB4C224DA3"; + fingerprint = "F1C5 760E 45B9 9A44 72E9 6BFB D65C 9AFB 4C22 4DA3"; + }]; + }; + berbiche = { + name = "Nicolas Berbiche"; + email = "nicolas@normie.dev"; + github = "berbiche"; + githubId = 20448408; + keys = [{ + longkeyid = "rsa4096/0xB461292445C6E696"; + fingerprint = "D446 E58D 87A0 31C7 EC15 88D7 B461 2924 45C6 E696"; + }]; + }; + wenngle = { + name = "Zeke Stephens"; + email = "zekestephens@gmail.com"; + github = "wenngle"; + githubId = 63376671; + }; + yanganto = { + name = "Antonio Yang"; + email = "yanganto@gmail.com"; + github = "yanganto"; + githubId = 10803111; + }; + starcraft66 = { + name = "Tristan Gosselin-Hane"; + email = "starcraft66@gmail.com"; + github = "starcraft66"; + githubId = 1858154; + keys = [{ + longkeyid = "rsa4096/0x9D98CDACFF04FD78"; + fingerprint = "8597 4506 EC69 5392 0443 0805 9D98 CDAC FF04 FD78"; + }]; + }; + hloeffler = { + name = "Hauke Löffler"; + email = "nix@hauke-loeffler.de"; + github = "hloeffler"; + githubId = 6627191; + }; + wilsonehusin = { + name = "Wilson E. Husin"; + email = "wilsonehusin@gmail.com"; + github = "wilsonehusin"; + githubId = 14004487; + }; + bb2020 = { + email = "bb2020@users.noreply.github.com"; + github = "bb2020"; + githubId = 19290397; + name = "Tunc Uzlu"; + }; + pulsation = { + name = "Philippe Sam-Long"; + email = "1838397+pulsation@users.noreply.github.com"; + github = "pulsation"; + githubId = 1838397; + }; + princemachiavelli = { + name = "Josh Hoffer"; + email = "jhoffer@sansorgan.es"; + matrix = "@princemachiavelli:matrix.org"; + github = "princemachiavelli"; + githubId = 2730968; + keys = [{ + longkeyid = "ed25519/0x83124F97A318EA18"; + fingerprint = "DD54 130B ABEC B65C 1F6B 2A38 8312 4F97 A318 EA18"; + }]; + }; + ydlr = { + name = "ydlr"; + email = "ydlr@ydlr.io"; + github = "ydlr"; + githubId = 58453832; + keys = [{ + longkeyid = "rsa4096/0x43AB44130A29AD9D"; + fingerprint = "FD0A C425 9EF5 4084 F99F 9B47 2ACC 9749 7C68 FAD4"; + }]; + }; + zane = { + name = "Zane van Iperen"; + email = "zane@zanevaniperen.com"; + github = "vs49688"; + githubId = 4423262; + keys = [{ + longkeyid = "rsa4096/0x68616B2D8AC4DCC5"; + fingerprint = "61AE D40F 368B 6F26 9DAE 3892 6861 6B2D 8AC4 DCC5"; + }]; + }; + zbioe = { + name = "Iury Fukuda"; + email = "zbioe@protonmail.com"; + github = "zbioe"; + githubId = 7332055; + }; + zenithal = { + name = "zenithal"; + email = "i@zenithal.me"; + github = "ZenithalHourlyRate"; + githubId = 19512674; + keys = [{ + longkeyid = "rsa4096/0x87E17EEF9B18B6C9"; + fingerprint = "1127 F188 280A E312 3619 3329 87E1 7EEF 9B18 B6C9"; + }]; + }; + zeri = { + name = "zeri"; + email = "68825133+zeri42@users.noreply.github.com"; + matrix = "@zeri:matrix.org"; + github = "zeri42"; + githubId = 68825133; + }; + zoedsoupe = { + github = "zoedsoupe"; + githubId = 44469426; + name = "Zoey de Souza Pessanha"; + email = "zoey.spessanha@outlook.com"; + keys = [{ + longkeyid = "rsa4096/0x1E1E889CDBD6A315"; + fingerprint = "EAA1 51DB 472B 0122 109A CB17 1E1E 889C DBD6 A315"; + }]; + }; + zombiezen = { + name = "Ross Light"; + email = "ross@zombiezen.com"; + github = "zombiezen"; + githubId = 181535; + }; + zseri = { + name = "zseri"; + email = "zseri.devel@ytrizja.de"; + github = "zseri"; + githubId = 1618343; + keys = [{ + longkeyid = "rsa4096/0x229E63AE5644A96D"; + fingerprint = "7AFB C595 0D3A 77BD B00F 947B 229E 63AE 5644 A96D"; + }]; + }; + zupo = { + name = "Nejc Zupan"; + email = "nejczupan+nix@gmail.com"; + github = "zupo"; + githubId = 311580; + }; + sei40kr = { + name = "Seong Yong-ju"; + email = "sei40kr@gmail.com"; + github = "sei40kr"; + githubId = 11665236; + }; + vdot0x23 = { + name = "Victor Büttner"; + email = "nix.victor@0x23.dk"; + github = "vdot0x23"; + githubId = 40716069; + }; + jpagex = { + name = "Jérémy Pagé"; + email = "contact@jeremypage.me"; + github = "jpagex"; + githubId = 635768; + }; + vbrandl = { + name = "Valentin Brandl"; + email = "mail+nixpkgs@vbrandl.net"; + github = "vbrandl"; + githubId = 20639051; + }; + portothree = { + name = "Gustavo Porto"; + email = "gustavoporto@ya.ru"; + github = "portothree"; + githubId = 3718120; + }; + pwoelfel = { + name = "Philipp Woelfel"; + email = "philipp.woelfel@gmail.com"; + github = "PhilippWoelfel"; + githubId = 19400064; + }; + qbit = { + name = "Aaron Bieber"; + email = "aaron@bolddaemon.com"; + github = "qbit"; + githubId = 68368; + matrix = "@qbit:tapenet.org"; + keys = [{ + longkeyid = "rsa4096/0x1F81112D62A9ADCE"; + fingerprint = "3586 3350 BFEA C101 DB1A 4AF0 1F81 112D 62A9 ADCE"; + }]; + }; + ameer = { + name = "Ameer Taweel"; + email = "ameertaweel2002@gmail.com"; + github = "AmeerTaweel"; + githubId = 20538273; + }; + nigelgbanks = { + name = "Nigel Banks"; + email = "nigel.g.banks@gmail.com"; + github = "nigelgbanks"; + githubId = 487373; + }; +} diff --git a/maintainers/scripts/all-tarballs.nix b/maintainers/scripts/all-tarballs.nix new file mode 100644 index 00000000000..6a4de8a4b95 --- /dev/null +++ b/maintainers/scripts/all-tarballs.nix @@ -0,0 +1,16 @@ +/* Helper expression for copy-tarballs. This returns (nearly) all + tarballs used the free packages in Nixpkgs. + + Typical usage: + + $ copy-tarballs.pl --expr 'import <nixpkgs/maintainers/scripts/all-tarballs.nix>' +*/ + +import ../../pkgs/top-level/release.nix + { # Don't apply ‘hydraJob’ to jobs, because then we can't get to the + # dependency graph. + scrubJobs = false; + # No need to evaluate on i686. + supportedSystems = [ "x86_64-linux" ]; + limitedSupportedSystems = []; + } diff --git a/maintainers/scripts/build.nix b/maintainers/scripts/build.nix new file mode 100644 index 00000000000..ca401700b4a --- /dev/null +++ b/maintainers/scripts/build.nix @@ -0,0 +1,55 @@ +{ maintainer +, localSystem ? { system = args.system or builtins.currentSystem; } +, system ? localSystem.system +, crossSystem ? localSystem +, ... +}@args: + +# based on update.nix +# nix-build build.nix --argstr maintainer <yourname> + +# to build for aarch64-linux using boot.binfmt.emulatedSystems: +# nix-build build.nix --argstr maintainer <yourname> --argstr system aarch64-linux + +let + pkgs = import ./../../default.nix (removeAttrs args [ "maintainer" ]); + maintainer_ = pkgs.lib.maintainers.${maintainer}; + packagesWith = cond: return: set: + (pkgs.lib.flatten + (pkgs.lib.mapAttrsToList + (name: pkg: + let + result = builtins.tryEval + ( + if pkgs.lib.isDerivation pkg && cond name pkg then + # Skip packages whose closure fails on evaluation. + # This happens for pkgs like `python27Packages.djangoql` + # that have disabled Python pkgs as dependencies. + builtins.seq pkg.outPath + [ (return name pkg) ] + else if pkg.recurseForDerivations or false || pkg.recurseForRelease or false + then packagesWith cond return pkg + else [ ] + ); + in + if result.success then result.value + else [ ] + ) + set + ) + ); +in +packagesWith + (name: pkg: + ( + if builtins.hasAttr "meta" pkg && builtins.hasAttr "maintainers" pkg.meta + then ( + if builtins.isList pkg.meta.maintainers + then builtins.elem maintainer_ pkg.meta.maintainers + else maintainer_ == pkg.meta.maintainers + ) + else false + ) + ) + (name: pkg: pkg) + pkgs diff --git a/maintainers/scripts/check-hydra-by-maintainer.nix b/maintainers/scripts/check-hydra-by-maintainer.nix new file mode 100644 index 00000000000..326aae47f8c --- /dev/null +++ b/maintainers/scripts/check-hydra-by-maintainer.nix @@ -0,0 +1,68 @@ +{ maintainer }: +let + pkgs = import ./../../default.nix { }; + maintainer_ = pkgs.lib.maintainers.${maintainer}; + packagesWith = cond: return: prefix: set: + (pkgs.lib.flatten + (pkgs.lib.mapAttrsToList + (name: pkg: + let + result = builtins.tryEval + ( + if pkgs.lib.isDerivation pkg && cond name pkg then + # Skip packages whose closure fails on evaluation. + # This happens for pkgs like `python27Packages.djangoql` + # that have disabled Python pkgs as dependencies. + builtins.seq pkg.outPath + [ (return "${prefix}${name}") ] + else if pkg.recurseForDerivations or false || pkg.recurseForRelease or false + # then packagesWith cond return pkg + then packagesWith cond return "${name}." pkg + else [ ] + ); + in + if result.success then result.value + else [ ] + ) + set + ) + ); + + packages = packagesWith + (name: pkg: + ( + if builtins.hasAttr "meta" pkg && builtins.hasAttr "maintainers" pkg.meta + then + ( + if builtins.isList pkg.meta.maintainers + then builtins.elem maintainer_ pkg.meta.maintainers + else maintainer_ == pkg.meta.maintainers + ) + else false + ) + ) + (name: name) + ("") + pkgs; + +in +pkgs.stdenv.mkDerivation { + name = "nixpkgs-update-script"; + buildInputs = [ pkgs.hydra-check ]; + buildCommand = '' + echo "" + echo "----------------------------------------------------------------" + echo "" + echo "nix-shell maintainers/scripts/check-hydra-by-maintainer.nix --argstr maintainer SuperSandro2000" + echo "" + echo "----------------------------------------------------------------" + exit 1 + ''; + shellHook = '' + unset shellHook # do not contaminate nested shells + echo "Please stand by" + echo nix-shell -p hydra-check --run "hydra-check ${builtins.concatStringsSep " " packages}" + nix-shell -p hydra-check --run "hydra-check ${builtins.concatStringsSep " " packages}" + exit $? + ''; +} diff --git a/maintainers/scripts/check-maintainer-github-handles.sh b/maintainers/scripts/check-maintainer-github-handles.sh new file mode 100755 index 00000000000..a5555ca9e90 --- /dev/null +++ b/maintainers/scripts/check-maintainer-github-handles.sh @@ -0,0 +1,66 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i bash -p jq parallel + +# Example how to work with the `lib.maintainers` attrset. +# Can be used to check whether all user handles are still valid. + +set -o errexit -o noclobber -o nounset -o pipefail +shopt -s failglob inherit_errexit + +function checkCommits { + local ret status tmp user + user="$1" + tmp=$(mktemp) + curl --silent -w "%{http_code}" \ + "https://github.com/NixOS/nixpkgs/commits?author=$user" \ + > "$tmp" + # the last line of tmp contains the http status + status=$(tail -n1 "$tmp") + ret= + case $status in + 200) if <"$tmp" grep -i "no commits found" > /dev/null; then + ret=1 + else + ret=0 + fi + ;; + # because of github’s hard request limits, this can take some time + 429) sleep 2 + printf "." + checkCommits "$user" + ret=$? + ;; + *) printf "BAD STATUS: $(tail -n1 "$tmp") for %s\n" "$user"; ret=1 + ret=1 + ;; + esac + rm "$tmp" + return $ret +} +export -f checkCommits + +function checkUser { + local user="$1" + local status= + status="$(curl --silent --head "https://github.com/${user}" | grep Status)" + # checks whether a user handle can be found on github + if [[ "$status" =~ 404 ]]; then + printf "%s\t\t\t\t%s\n" "$status" "$user" + # checks whether the user handle has any nixpkgs commits + elif checkCommits "$user"; then + printf "OK!\t\t\t\t%s\n" "$user" + else + printf "No Commits!\t\t\t%s\n" "$user" + fi +} +export -f checkUser + +# output the maintainers set as json +# and filter out the github username of each maintainer (if it exists) +# then check some at the same time +nix-instantiate -A lib.maintainers --eval --strict --json \ + | jq -r '.[]|.github|select(.)' \ + | parallel -j5 checkUser + +# To check some arbitrary users: +# parallel -j100 checkUser ::: "eelco" "profpatsch" "Profpatsch" "a" diff --git a/maintainers/scripts/copy-tarballs.pl b/maintainers/scripts/copy-tarballs.pl new file mode 100755 index 00000000000..6a08eb88bf8 --- /dev/null +++ b/maintainers/scripts/copy-tarballs.pl @@ -0,0 +1,240 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i perl -p perl perlPackages.NetAmazonS3 perlPackages.FileSlurp perlPackages.JSON perlPackages.LWPProtocolHttps nixUnstable nixUnstable.perl-bindings + +# This command uploads tarballs to tarballs.nixos.org, the +# content-addressed cache used by fetchurl as a fallback for when +# upstream tarballs disappear or change. Usage: +# +# 1) To upload one or more files: +# +# $ copy-tarballs.pl --file /path/to/tarball.tar.gz +# +# 2) To upload all files obtained via calls to fetchurl in a Nix derivation: +# +# $ copy-tarballs.pl --expr '(import <nixpkgs> {}).hello' + +use strict; +use warnings; +use File::Basename; +use File::Path; +use File::Slurp; +use JSON; +use Net::Amazon::S3; +use Nix::Store; + +isValidPath("/nix/store/aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa-foo"); # FIXME: forces Nix::Store initialisation + +sub usage { + die "Syntax: $0 [--dry-run] [--exclude REGEXP] [--expr EXPR | --file FILES...]\n"; +} + +my $dryRun = 0; +my $expr; +my @fileNames; +my $exclude; + +while (@ARGV) { + my $flag = shift @ARGV; + + if ($flag eq "--expr") { + $expr = shift @ARGV or die "--expr requires an argument"; + } elsif ($flag eq "--file") { + @fileNames = @ARGV; + last; + } elsif ($flag eq "--dry-run") { + $dryRun = 1; + } elsif ($flag eq "--exclude") { + $exclude = shift @ARGV or die "--exclude requires an argument"; + } else { + usage(); + } +} + + +# S3 setup. +my $aws_access_key_id = $ENV{'AWS_ACCESS_KEY_ID'} or die "AWS_ACCESS_KEY_ID not set\n"; +my $aws_secret_access_key = $ENV{'AWS_SECRET_ACCESS_KEY'} or die "AWS_SECRET_ACCESS_KEY not set\n"; + +my $s3 = Net::Amazon::S3->new( + { aws_access_key_id => $aws_access_key_id, + aws_secret_access_key => $aws_secret_access_key, + retry => 1, + host => "s3-eu-west-1.amazonaws.com", + }); + +my $bucket = $s3->bucket("nixpkgs-tarballs") or die; + +my $doWrite = 0; +my $cacheFile = ($ENV{"HOME"} or die "\$HOME is not set") . "/.cache/nix/copy-tarballs"; +my %cache; +$cache{$_} = 1 foreach read_file($cacheFile, err_mode => 'quiet', chomp => 1); +$doWrite = 1; + +END() { + File::Path::mkpath(dirname($cacheFile), 0, 0755); + write_file($cacheFile, map { "$_\n" } keys %cache) if $doWrite; +} + +sub alreadyMirrored { + my ($algo, $hash) = @_; + my $key = "$algo/$hash"; + return 1 if defined $cache{$key}; + my $res = defined $bucket->get_key($key); + $cache{$key} = 1 if $res; + return $res; +} + +sub uploadFile { + my ($fn, $name) = @_; + + my $md5_16 = hashFile("md5", 0, $fn) or die; + my $sha1_16 = hashFile("sha1", 0, $fn) or die; + my $sha256_32 = hashFile("sha256", 1, $fn) or die; + my $sha256_16 = hashFile("sha256", 0, $fn) or die; + my $sha512_32 = hashFile("sha512", 1, $fn) or die; + my $sha512_16 = hashFile("sha512", 0, $fn) or die; + + my $mainKey = "sha512/$sha512_16"; + + # Create redirects from the other hash types. + sub redirect { + my ($name, $dest) = @_; + #print STDERR "linking $name to $dest...\n"; + $bucket->add_key($name, "", { + 'x-amz-website-redirect-location' => "/" . $dest, + 'x-amz-acl' => "public-read" + }) + or die "failed to create redirect from $name to $dest\n"; + $cache{$name} = 1; + } + redirect "md5/$md5_16", $mainKey; + redirect "sha1/$sha1_16", $mainKey; + redirect "sha256/$sha256_32", $mainKey; + redirect "sha256/$sha256_16", $mainKey; + redirect "sha512/$sha512_32", $mainKey; + + # Upload the file as sha512/<hash-in-base-16>. + print STDERR "uploading $fn to $mainKey...\n"; + $bucket->add_key_filename($mainKey, $fn, { + 'x-amz-meta-original-name' => $name, + 'x-amz-acl' => "public-read" + }) + or die "failed to upload $fn to $mainKey\n"; + $cache{$mainKey} = 1; +} + +if (scalar @fileNames) { + my $res = 0; + foreach my $fn (@fileNames) { + eval { + if (alreadyMirrored("sha512", hashFile("sha512", 0, $fn))) { + print STDERR "$fn is already mirrored\n"; + } else { + uploadFile($fn, basename $fn); + } + }; + if ($@) { + warn "$@"; + $res = 1; + } + } + exit $res; +} + +elsif (defined $expr) { + + # Evaluate find-tarballs.nix. + my $pid = open(JSON, "-|", "nix-instantiate", "--eval", "--json", "--strict", + "<nixpkgs/maintainers/scripts/find-tarballs.nix>", + "--arg", "expr", $expr); + my $stdout = <JSON>; + waitpid($pid, 0); + die "$0: evaluation failed\n" if $?; + close JSON; + + my $fetches = decode_json($stdout); + + print STDERR "evaluation returned ", scalar(@{$fetches}), " tarballs\n"; + + # Check every fetchurl call discovered by find-tarballs.nix. + my $mirrored = 0; + my $have = 0; + foreach my $fetch (sort { $a->{url} cmp $b->{url} } @{$fetches}) { + my $url = $fetch->{url}; + my $algo = $fetch->{type}; + my $hash = $fetch->{hash}; + my $name = $fetch->{name}; + + if ($hash =~ /^([a-z0-9]+)-([A-Za-z0-9+\/=]+)$/) { + $algo = $1; + $hash = `nix hash to-base16 $hash` or die; + chomp $hash; + } + + next unless $algo =~ /^[a-z0-9]+$/; + + # Convert non-SRI base-64 to base-16. + if ($hash =~ /^[A-Za-z0-9+\/=]+$/) { + $hash = `nix hash to-base16 --type '$algo' $hash` or die; + chomp $hash; + } + + if (defined $ENV{DEBUG}) { + print "$url $algo $hash\n"; + next; + } + + if ($url !~ /^http:/ && $url !~ /^https:/ && $url !~ /^ftp:/ && $url !~ /^mirror:/) { + print STDERR "skipping $url (unsupported scheme)\n"; + next; + } + + next if defined $exclude && $url =~ /$exclude/; + + if (alreadyMirrored($algo, $hash)) { + $have++; + next; + } + + my $storePath = makeFixedOutputPath(0, $algo, $hash, $name); + + print STDERR "mirroring $url ($storePath, $algo, $hash)...\n"; + + if ($dryRun) { + $mirrored++; + next; + } + + # Substitute the output. + if (!isValidPath($storePath)) { + system("nix-store", "-r", $storePath); + } + + # Otherwise download the file using nix-prefetch-url. + if (!isValidPath($storePath)) { + $ENV{QUIET} = 1; + $ENV{PRINT_PATH} = 1; + my $fh; + my $pid = open($fh, "-|", "nix-prefetch-url", "--type", $algo, $url, $hash) or die; + waitpid($pid, 0) or die; + if ($? != 0) { + print STDERR "failed to fetch $url: $?\n"; + next; + } + <$fh>; my $storePath2 = <$fh>; chomp $storePath2; + if ($storePath ne $storePath2) { + warn "strange: $storePath != $storePath2\n"; + next; + } + } + + uploadFile($storePath, $url); + $mirrored++; + } + + print STDERR "mirrored $mirrored files, already have $have files\n"; +} + +else { + usage(); +} diff --git a/maintainers/scripts/db-to-md.sh b/maintainers/scripts/db-to-md.sh new file mode 100755 index 00000000000..01357d1e241 --- /dev/null +++ b/maintainers/scripts/db-to-md.sh @@ -0,0 +1,88 @@ +#! /usr/bin/env nix-shell +#! nix-shell -I nixpkgs=. -i bash -p pandoc + +# This script is temporarily needed while we transition the manual to +# CommonMark. It converts DocBook files into our CommonMark flavour. + +debug= +files=() + +while [ "$#" -gt 0 ]; do + i="$1"; shift 1 + case "$i" in + --debug) + debug=1 + ;; + *) + files+=("$i") + ;; + esac +done + +echo "WARNING: This is an experimental script and might not preserve all formatting." > /dev/stderr +echo "Please report any issues you discover." > /dev/stderr + +outExtension="md" +if [[ $debug ]]; then + outExtension="json" +fi + +DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" >/dev/null 2>&1 && pwd )" + +# NOTE: Keep in sync with Nixpkgs manual (/doc/Makefile). +# TODO: Remove raw-attribute when we can get rid of DocBook altogether. +pandoc_commonmark_enabled_extensions=+attributes+fenced_divs+footnotes+bracketed_spans+definition_lists+pipe_tables+raw_attribute +targetLang="commonmark${pandoc_commonmark_enabled_extensions}+smart" +if [[ $debug ]]; then + targetLang=json +fi +pandoc_flags=( + # Not needed: + # - diagram-generator.lua (we do not support that in NixOS manual to limit dependencies) + # - media extraction (was only required for diagram generator) + # - myst-reader/roles.lua (only relevant for MyST → DocBook) + # - link-unix-man-references.lua (links should only be added to display output) + # - docbook-writer/rst-roles.lua (only relevant for → DocBook) + # - docbook-writer/labelless-link-is-xref.lua (only relevant for → DocBook) + "--lua-filter=$DIR/../../doc/build-aux/pandoc-filters/docbook-reader/citerefentry-to-rst-role.lua" + "--lua-filter=$DIR/../../doc/build-aux/pandoc-filters/myst-writer/roles.lua" + "--lua-filter=$DIR/doc/unknown-code-language.lua" + -f docbook + -t "$targetLang" + --tab-stop=2 + --wrap=none +) + +for file in "${files[@]}"; do + if [[ ! -f "$file" ]]; then + echo "db-to-md.sh: $file does not exist" > /dev/stderr + exit 1 + else + rootElement=$(xmllint --xpath 'name(//*)' "$file") + + if [[ $rootElement = chapter ]]; then + extension=".chapter.$outExtension" + elif [[ $rootElement = section ]]; then + extension=".section.$outExtension" + else + echo "db-to-md.sh: $file contains an unsupported root element $rootElement" > /dev/stderr + exit 1 + fi + + outFile="${file%".section.xml"}" + outFile="${outFile%".chapter.xml"}" + outFile="${outFile%".xml"}$extension" + temp1=$(mktemp) + $DIR/doc/escape-code-markup.py "$file" "$temp1" + if [[ $debug ]]; then + echo "Converted $file to $temp1" > /dev/stderr + fi + temp2=$(mktemp) + $DIR/doc/replace-xrefs-by-empty-links.py "$temp1" "$temp2" + if [[ $debug ]]; then + echo "Converted $temp1 to $temp2" > /dev/stderr + fi + pandoc "$temp2" -o "$outFile" "${pandoc_flags[@]}" + echo "Converted $file to $outFile" > /dev/stderr + fi +done diff --git a/maintainers/scripts/debian-patches.sh b/maintainers/scripts/debian-patches.sh new file mode 100755 index 00000000000..de6be136ca7 --- /dev/null +++ b/maintainers/scripts/debian-patches.sh @@ -0,0 +1,34 @@ +#!/bin/sh + +# Download patches from debian project +# Usage $0 debian-patches.txt debian-patches.nix +# An example input and output files can be found in tools/graphics/plotutils + +DEB_URL=https://sources.debian.org/data/main +declare -a deb_patches +mapfile -t deb_patches < $1 + +# First letter +deb_prefix="${deb_patches[0]:0:1}" +prefix="${DEB_URL}/${deb_prefix}/${deb_patches[0]}/debian/patches" + +if [[ -n "$2" ]]; then + exec 1> $2 +fi + +cat <<EOF +# Generated by $(basename $0) from $(basename $1) +let + prefix = "${prefix}"; +in +[ +EOF +for ((i=1;i < ${#deb_patches[@]}; ++i)); do + url="${prefix}/${deb_patches[$i]}" + sha256=$(nix-prefetch-url $url) + echo " {" + echo " url = \"\${prefix}/${deb_patches[$i]}\";" + echo " sha256 = \"$sha256\";" + echo " }" +done +echo "]" diff --git a/maintainers/scripts/dep-licenses.sh b/maintainers/scripts/dep-licenses.sh new file mode 100755 index 00000000000..28ad22c334f --- /dev/null +++ b/maintainers/scripts/dep-licenses.sh @@ -0,0 +1,57 @@ +#!/bin/sh + +attr=$1 + +: ${NIXPKGS=/etc/nixos/nixpkgs} + +tmp=$(mktemp --tmpdir -d nixpkgs-dep-license.XXXXXX) + +exitHandler() { + exitCode=$? + rm -rf "$tmp" + exit $exitCode +} + +trap "exitHandler" EXIT + +# fetch the trace and the drvPath of the attribute. +nix-instantiate $NIXPKGS -A $attr --show-trace > "$tmp/drvPath" 2> "$tmp/trace" || { + cat 1>&2 - "$tmp/trace" <<EOF +An error occurred while evaluating $attr. +EOF + exit 1 +} + +# generate a sed script based on the trace output. +sed ' + \,@:.*:@, { + # \1 *.drv file + # \2 License terms + s,.*@:drv:\(.*\):\(.*\):@.*,s!\1!\1: \2!; t;, + s!Str(\\\"\([^,]*\)\\\",\[\])!\1!g + b + } + d +' "$tmp/trace" > "$tmp/filter.sed" + +if test $(wc -l "$tmp/filter.sed" | sed 's/ .*//') == 0; then + echo 1>&2 " +No derivation mentionned in the stack trace. Either your derivation does +not use stdenv.mkDerivation or you forgot to use the stdenv adapter named +traceDrvLicenses. + +- defaultStdenv = allStdenvs.stdenv; ++ defaultStdenv = traceDrvLicenses allStdenvs.stdenv; +" + exit 1 +fi + + +# remove all dependencies which are using stdenv.mkDerivation +echo ' +d +' >> "$tmp/filter.sed" + +nix-store -q --tree $(cat "$tmp/drvPath") | sed -f "$tmp/filter.sed" + +exit 0; diff --git a/maintainers/scripts/doc/escape-code-markup.py b/maintainers/scripts/doc/escape-code-markup.py new file mode 100755 index 00000000000..015435b698e --- /dev/null +++ b/maintainers/scripts/doc/escape-code-markup.py @@ -0,0 +1,97 @@ +#! /usr/bin/env nix-shell +#! nix-shell -I nixpkgs=channel:nixos-unstable -i python3 -p python3 -p python3.pkgs.lxml + +""" +Pandoc will strip any markup within code elements so +let’s escape them so that they can be handled manually. +""" + +import lxml.etree as ET +import re +import sys + +def replace_element_by_text(el: ET.Element, text: str) -> None: + """ + Author: bernulf + Source: https://stackoverflow.com/a/10520552/160386 + SPDX-License-Identifier: CC-BY-SA-3.0 + """ + text = text + (el.tail or "") + parent = el.getparent() + if parent is not None: + previous = el.getprevious() + if previous is not None: + previous.tail = (previous.tail or "") + text + else: + parent.text = (parent.text or "") + text + parent.remove(el) + +DOCBOOK_NS = "http://docbook.org/ns/docbook" + +# List of elements that pandoc’s DocBook reader strips markup from. +# https://github.com/jgm/pandoc/blob/master/src/Text/Pandoc/Readers/DocBook.hs +code_elements = [ + # CodeBlock + "literallayout", + "screen", + "programlisting", + # Code (inline) + "classname", + "code", + "filename", + "envar", + "literal", + "computeroutput", + "prompt", + "parameter", + "option", + "markup", + "wordasword", + "command", + "varname", + "function", + "type", + "symbol", + "constant", + "userinput", + "systemitem", +] + +XMLNS_REGEX = re.compile(r'\s+xmlns(?::[^=]+)?="[^"]*"') +ROOT_ELEMENT_REGEX = re.compile(r'^\s*<[^>]+>') + +def remove_xmlns(match: re.Match) -> str: + """ + Removes xmlns attributes. + + Expects a match containing an opening tag. + """ + return XMLNS_REGEX.sub('', match.group(0)) + +if __name__ == '__main__': + assert len(sys.argv) >= 3, "usage: escape-code-markup.py <input> <output>" + + tree = ET.parse(sys.argv[1]) + name_predicate = " or ".join([f"local-name()='{el}'" for el in code_elements]) + + for markup in tree.xpath(f"//*[({name_predicate}) and namespace-uri()='{DOCBOOK_NS}']/*"): + text = ET.tostring(markup, encoding=str) + + # tostring adds xmlns attributes to the element we want to stringify + # as if it was supposed to be usable standalone. + # We are just converting it to CDATA so we do not care. + # Let’s strip the namespace declarations to keep the code clean. + # + # Note that this removes even namespaces that were potentially + # in the original file. Though, that should be very rare – + # most of the time, we will stringify empty DocBook elements + # like <xref> or <co> or, at worst, <link> with xlink:href attribute. + # + # Also note that the regex expects the root element to be first + # thing in the string. But that should be fine, the tostring method + # does not produce XML declaration or doctype by default. + text = ROOT_ELEMENT_REGEX.sub(remove_xmlns, text) + + replace_element_by_text(markup, text) + + tree.write(sys.argv[2]) diff --git a/maintainers/scripts/doc/replace-xrefs-by-empty-links.py b/maintainers/scripts/doc/replace-xrefs-by-empty-links.py new file mode 100755 index 00000000000..2006ef897f7 --- /dev/null +++ b/maintainers/scripts/doc/replace-xrefs-by-empty-links.py @@ -0,0 +1,32 @@ +#! /usr/bin/env nix-shell +#! nix-shell -I nixpkgs=channel:nixos-unstable -i python3 -p python3 -p python3.pkgs.lxml + +""" +Pandoc will try to resolve xrefs and replace them with regular links. +let’s replace them with links with empty labels which MyST +and our pandoc filters recognize as cross-references. +""" + +import lxml.etree as ET +import sys + +XLINK_NS = "http://www.w3.org/1999/xlink" + +ns = { + "db": "http://docbook.org/ns/docbook", +} + + +if __name__ == '__main__': + assert len(sys.argv) >= 3, "usage: replace-xrefs-by-empty-links.py <input> <output>" + + tree = ET.parse(sys.argv[1]) + for xref in tree.findall(".//db:xref", ns): + text = ET.tostring(xref, encoding=str) + parent = xref.getparent() + link = parent.makeelement('link') + target_name = xref.get("linkend") + link.set(f"{{{XLINK_NS}}}href", f"#{target_name}") + parent.replace(xref, link) + + tree.write(sys.argv[2]) diff --git a/maintainers/scripts/doc/unknown-code-language.lua b/maintainers/scripts/doc/unknown-code-language.lua new file mode 100644 index 00000000000..85d8df4690b --- /dev/null +++ b/maintainers/scripts/doc/unknown-code-language.lua @@ -0,0 +1,12 @@ +--[[ +Adds “unknown” class to CodeBlock AST nodes without any classes. + +This will cause Pandoc to use fenced code block, which we prefer. +]] + +function CodeBlock(elem) + if #elem.classes == 0 then + elem.classes:insert('unknown') + return elem + end +end diff --git a/maintainers/scripts/eval-release.nix b/maintainers/scripts/eval-release.nix new file mode 100644 index 00000000000..bb9572cbc79 --- /dev/null +++ b/maintainers/scripts/eval-release.nix @@ -0,0 +1,24 @@ +# Evaluate `release.nix' like Hydra would. Too bad nix-instantiate +# can't to do this. + +with import ../../lib; + +let + trace = if builtins.getEnv "VERBOSE" == "1" then builtins.trace else (x: y: y); + + rel = removeAttrs (import ../../pkgs/top-level/release.nix { }) [ "tarball" "unstable" "xbursttools" ]; + + # Add the ‘recurseForDerivations’ attribute to ensure that + # nix-instantiate recurses into nested attribute sets. + recurse = path: attrs: + if (builtins.tryEval attrs).success then + if isDerivation attrs + then + if (builtins.tryEval attrs.drvPath).success + then { inherit (attrs) name drvPath; } + else { failed = true; } + else { recurseForDerivations = true; } // + mapAttrs (n: v: let path' = path ++ [n]; in trace path' (recurse path' v)) attrs + else { }; + +in recurse [] rel diff --git a/maintainers/scripts/eval-release.sh b/maintainers/scripts/eval-release.sh new file mode 100755 index 00000000000..e0dfaf1de74 --- /dev/null +++ b/maintainers/scripts/eval-release.sh @@ -0,0 +1,11 @@ +#! /bin/sh + +if [[ -z "$VERBOSE" ]]; then + echo "You may set VERBOSE=1 to see debug output or to any other non-empty string to make this script completely silent" +fi +unset HOME NIXPKGS_CONFIG # Force empty config + +# With the default heap size (380MB), nix-instantiate fails: +# Too many heap sections: Increase MAXHINCR or MAX_HEAP_SECTS +export GC_INITIAL_HEAP_SIZE=${GC_INITIAL_HEAP_SIZE:-2000000000} # 2GB +nix-instantiate --strict --eval-only --xml --show-trace "$(dirname "$0")"/eval-release.nix 2>&1 > /dev/null diff --git a/maintainers/scripts/fetch-kde-qt.sh b/maintainers/scripts/fetch-kde-qt.sh new file mode 100755 index 00000000000..22d78151978 --- /dev/null +++ b/maintainers/scripts/fetch-kde-qt.sh @@ -0,0 +1,61 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p coreutils findutils gnused nix wget + +set -efuo pipefail + +SRCS= +if [ -d "$1" ]; then + SRCS="$(pwd)/$1/srcs.nix" + . "$1/fetch.sh" +else + SRCS="$(pwd)/$(dirname $1)/srcs.nix" + . "$1" +fi + +tmp=$(mktemp -d) +pushd $tmp >/dev/null +wget -nH -r -c --no-parent "${WGET_ARGS[@]}" >/dev/null + +csv=$(mktemp) +find . -type f | while read src; do + # Sanitize file name + filename=$(basename "$src" | tr '@' '_') + nameVersion="${filename%.tar.*}" + name=$(echo "$nameVersion" | sed -e 's,-[[:digit:]].*,,' | sed -e 's,-opensource-src$,,' | sed -e 's,-everywhere-src$,,') + version=$(echo "$nameVersion" | sed -e 's,^\([[:alpha:]][[:alnum:]]*-\)\+,,') + echo "$name,$version,$src,$filename" >>$csv +done + +cat >"$SRCS" <<EOF +# DO NOT EDIT! This file is generated automatically. +# Command: $0 $@ +{ fetchurl, mirror }: + +{ +EOF + +gawk -F , "{ print \$1 }" $csv | sort | uniq | while read name; do + versions=$(gawk -F , "/^$name,/ { print \$2 }" $csv) + latestVersion=$(echo "$versions" | sort -rV | head -n 1) + src=$(gawk -F , "/^$name,$latestVersion,/ { print \$3 }" $csv) + filename=$(gawk -F , "/^$name,$latestVersion,/ { print \$4 }" $csv) + url="${src:2}" + sha256=$(nix-hash --type sha256 --base32 --flat "$src") + cat >>"$SRCS" <<EOF + $name = { + version = "$latestVersion"; + src = fetchurl { + url = "\${mirror}/$url"; + sha256 = "$sha256"; + name = "$filename"; + }; + }; +EOF +done + +echo "}" >>"$SRCS" + +popd >/dev/null +rm -fr $tmp >/dev/null + +rm -f $csv >/dev/null diff --git a/maintainers/scripts/find-tarballs.nix b/maintainers/scripts/find-tarballs.nix new file mode 100644 index 00000000000..990185bbb3b --- /dev/null +++ b/maintainers/scripts/find-tarballs.nix @@ -0,0 +1,50 @@ +# This expression returns a list of all fetchurl calls used by ‘expr’. + +with import ../.. { }; +with lib; + +{ expr }: + +let + + root = expr; + + uniqueUrls = map (x: x.file) (genericClosure { + startSet = map (file: { key = file.url; inherit file; }) urls; + operator = const [ ]; + }); + + urls = map (drv: { url = head (drv.urls or [ drv.url ]); hash = drv.outputHash; type = drv.outputHashAlgo; name = drv.name; }) fetchurlDependencies; + + fetchurlDependencies = + filter + (drv: drv.outputHash or "" != "" && drv.outputHashMode or "flat" == "flat" + && drv.postFetch or "" == "" && (drv ? url || drv ? urls)) + dependencies; + + dependencies = map (x: x.value) (genericClosure { + startSet = map keyDrv (derivationsIn' root); + operator = { key, value }: map keyDrv (immediateDependenciesOf value); + }); + + derivationsIn' = x: + if !canEval x then [] + else if isDerivation x then optional (canEval x.drvPath) x + else if isList x then concatLists (map derivationsIn' x) + else if isAttrs x then concatLists (mapAttrsToList (n: v: addErrorContext "while finding tarballs in '${n}':" (derivationsIn' v)) x) + else [ ]; + + keyDrv = drv: if canEval drv.drvPath then { key = drv.drvPath; value = drv; } else { }; + + immediateDependenciesOf = drv: + concatLists (mapAttrsToList (n: v: derivationsIn v) (removeAttrs drv (["meta" "passthru"] ++ optionals (drv?passthru) (attrNames drv.passthru)))); + + derivationsIn = x: + if !canEval x then [] + else if isDerivation x then optional (canEval x.drvPath) x + else if isList x then concatLists (map derivationsIn x) + else [ ]; + + canEval = val: (builtins.tryEval val).success; + +in uniqueUrls diff --git a/maintainers/scripts/haskell/dependencies.nix b/maintainers/scripts/haskell/dependencies.nix new file mode 100644 index 00000000000..f0620902c0e --- /dev/null +++ b/maintainers/scripts/haskell/dependencies.nix @@ -0,0 +1,10 @@ +# Nix script to calculate the Haskell dependencies of every haskellPackage. Used by ./hydra-report.hs. +let + pkgs = import ../../.. {}; + inherit (pkgs) lib; + getDeps = _: pkg: { + deps = builtins.filter (x: !isNull x) (map (x: x.pname or null) (pkg.propagatedBuildInputs or [])); + broken = (pkg.meta.hydraPlatforms or [null]) == []; + }; +in + lib.mapAttrs getDeps pkgs.haskellPackages diff --git a/maintainers/scripts/haskell/hydra-report.hs b/maintainers/scripts/haskell/hydra-report.hs new file mode 100755 index 00000000000..360b9f2058d --- /dev/null +++ b/maintainers/scripts/haskell/hydra-report.hs @@ -0,0 +1,490 @@ +#! /usr/bin/env nix-shell +#! nix-shell -p "haskellPackages.ghcWithPackages (p: [p.aeson p.req])" +#! nix-shell -p hydra-unstable +#! nix-shell -i runhaskell + +{- + +The purpose of this script is + +1) download the state of the nixpkgs/haskell-updates job from hydra (with get-report) +2) print a summary of the state suitable for pasting into a github comment (with ping-maintainers) +3) print a list of broken packages suitable for pasting into configuration-hackage2nix.yaml + +Because step 1) is quite expensive and takes roughly ~5 minutes the result is cached in a json file in XDG_CACHE. + +-} +{-# LANGUAGE BlockArguments #-} +{-# LANGUAGE DeriveAnyClass #-} +{-# LANGUAGE DeriveGeneric #-} +{-# LANGUAGE DerivingStrategies #-} +{-# LANGUAGE DuplicateRecordFields #-} +{-# LANGUAGE LambdaCase #-} +{-# LANGUAGE MultiWayIf #-} +{-# LANGUAGE NamedFieldPuns #-} +{-# LANGUAGE OverloadedStrings #-} +{-# LANGUAGE ScopedTypeVariables #-} +{-# LANGUAGE TupleSections #-} +{-# OPTIONS_GHC -Wall #-} +{-# LANGUAGE ViewPatterns #-} +{-# LANGUAGE TupleSections #-} + +import Control.Monad (forM_, (<=<)) +import Control.Monad.Trans (MonadIO (liftIO)) +import Data.Aeson ( + FromJSON, + ToJSON, + decodeFileStrict', + eitherDecodeStrict', + encodeFile, + ) +import Data.Foldable (Foldable (toList), foldl') +import Data.List.NonEmpty (NonEmpty, nonEmpty) +import qualified Data.List.NonEmpty as NonEmpty +import Data.Map.Strict (Map) +import qualified Data.Map.Strict as Map +import Data.Maybe (fromMaybe, mapMaybe, isNothing) +import Data.Monoid (Sum (Sum, getSum)) +import Data.Sequence (Seq) +import qualified Data.Sequence as Seq +import Data.Set (Set) +import qualified Data.Set as Set +import Data.Text (Text) +import qualified Data.Text as Text +import Data.Text.Encoding (encodeUtf8) +import Data.Time (defaultTimeLocale, formatTime, getCurrentTime) +import Data.Time.Clock (UTCTime) +import GHC.Generics (Generic) +import Network.HTTP.Req ( + GET (GET), + NoReqBody (NoReqBody), + defaultHttpConfig, + header, + https, + jsonResponse, + req, + responseBody, + responseTimeout, + runReq, + (/:), + ) +import System.Directory (XdgDirectory (XdgCache), getXdgDirectory) +import System.Environment (getArgs) +import System.Process (readProcess) +import Prelude hiding (id) +import Data.List (sortOn) +import Control.Concurrent.Async (concurrently) +import Control.Exception (evaluate) +import qualified Data.IntMap.Strict as IntMap +import qualified Data.IntSet as IntSet +import Data.Bifunctor (second) + +newtype JobsetEvals = JobsetEvals + { evals :: Seq Eval + } + deriving (Generic, ToJSON, FromJSON, Show) + +newtype Nixpkgs = Nixpkgs {revision :: Text} + deriving (Generic, ToJSON, FromJSON, Show) + +newtype JobsetEvalInputs = JobsetEvalInputs {nixpkgs :: Nixpkgs} + deriving (Generic, ToJSON, FromJSON, Show) + +data Eval = Eval + { id :: Int + , jobsetevalinputs :: JobsetEvalInputs + } + deriving (Generic, ToJSON, FromJSON, Show) + +data Build = Build + { job :: Text + , buildstatus :: Maybe Int + , finished :: Int + , id :: Int + , nixname :: Text + , system :: Text + , jobsetevals :: Seq Int + } + deriving (Generic, ToJSON, FromJSON, Show) + +main :: IO () +main = do + args <- getArgs + case args of + ["get-report"] -> getBuildReports + ["ping-maintainers"] -> printMaintainerPing + ["mark-broken-list"] -> printMarkBrokenList + _ -> putStrLn "Usage: get-report | ping-maintainers | mark-broken-list" + +reportFileName :: IO FilePath +reportFileName = getXdgDirectory XdgCache "haskell-updates-build-report.json" + +showT :: Show a => a -> Text +showT = Text.pack . show + +getBuildReports :: IO () +getBuildReports = runReq defaultHttpConfig do + evalMay <- Seq.lookup 0 . evals <$> myReq (https "hydra.nixos.org" /: "jobset" /: "nixpkgs" /: "haskell-updates" /: "evals") mempty + eval@Eval{id} <- maybe (liftIO $ fail "No Evalution found") pure evalMay + liftIO . putStrLn $ "Fetching evaluation " <> show id <> " from Hydra. This might take a few minutes..." + buildReports :: Seq Build <- myReq (https "hydra.nixos.org" /: "eval" /: showT id /: "builds") (responseTimeout 600000000) + liftIO do + fileName <- reportFileName + putStrLn $ "Finished fetching all builds from Hydra, saving report as " <> fileName + now <- getCurrentTime + encodeFile fileName (eval, now, buildReports) + where + myReq query option = responseBody <$> req GET query NoReqBody jsonResponse (header "User-Agent" "hydra-report.hs/v1 (nixpkgs;maintainers/scripts/haskell)" <> option) + +hydraEvalCommand :: FilePath +hydraEvalCommand = "hydra-eval-jobs" + +hydraEvalParams :: [String] +hydraEvalParams = ["-I", ".", "pkgs/top-level/release-haskell.nix"] + +nixExprCommand :: FilePath +nixExprCommand = "nix-instantiate" + +nixExprParams :: [String] +nixExprParams = ["--eval", "--strict", "--json"] + +-- | This newtype is used to parse a Hydra job output from @hydra-eval-jobs@. +-- The only field we are interested in is @maintainers@, which is why this +-- is just a newtype. +-- +-- Note that there are occasionally jobs that don't have a maintainers +-- field, which is why this has to be @Maybe Text@. +newtype Maintainers = Maintainers { maintainers :: Maybe Text } + deriving stock (Generic, Show) + deriving anyclass (FromJSON, ToJSON) + +-- | This is a 'Map' from Hydra job name to maintainer email addresses. +-- +-- It has values similar to the following: +-- +-- @@ +-- fromList +-- [ ("arion.aarch64-linux", Maintainers (Just "robert@example.com")) +-- , ("bench.x86_64-linux", Maintainers (Just "")) +-- , ("conduit.x86_64-linux", Maintainers (Just "snoy@man.com, web@ber.com")) +-- , ("lens.x86_64-darwin", Maintainers (Just "ek@category.com")) +-- ] +-- @@ +-- +-- Note that Hydra jobs without maintainers will have an empty string for the +-- maintainer list. +type HydraJobs = Map Text Maintainers + +-- | Map of email addresses to GitHub handles. +-- This is built from the file @../../maintainer-list.nix@. +-- +-- It has values similar to the following: +-- +-- @@ +-- fromList +-- [ ("robert@example.com", "rob22") +-- , ("ek@category.com", "edkm") +-- ] +-- @@ +type EmailToGitHubHandles = Map Text Text + +-- | Map of Hydra jobs to maintainer GitHub handles. +-- +-- It has values similar to the following: +-- +-- @@ +-- fromList +-- [ ("arion.aarch64-linux", ["rob22"]) +-- , ("conduit.x86_64-darwin", ["snoyb", "webber"]) +-- ] +-- @@ +type MaintainerMap = Map Text (NonEmpty Text) + +-- | Information about a package which lists its dependencies and whether the +-- package is marked broken. +data DepInfo = DepInfo { + deps :: Set Text, + broken :: Bool +} + deriving stock (Generic, Show) + deriving anyclass (FromJSON, ToJSON) + +-- | Map from package names to their DepInfo. This is the data we get out of a +-- nix call. +type DependencyMap = Map Text DepInfo + +-- | Map from package names to its broken state, number of reverse dependencies (fst) and +-- unbroken reverse dependencies (snd). +type ReverseDependencyMap = Map Text (Int, Int) + +-- | Calculate the (unbroken) reverse dependencies of a package by transitively +-- going through all packages if it’s a dependency of them. +calculateReverseDependencies :: DependencyMap -> ReverseDependencyMap +calculateReverseDependencies depMap = Map.fromDistinctAscList $ zip keys (zip (rdepMap False) (rdepMap True)) + where + -- This code tries to efficiently invert the dependency map and calculate + -- it’s transitive closure by internally identifying every pkg with it’s index + -- in the package list and then using memoization. + keys = Map.keys depMap + pkgToIndexMap = Map.fromDistinctAscList (zip keys [0..]) + intDeps = zip [0..] $ (\DepInfo{broken,deps} -> (broken,mapMaybe (`Map.lookup` pkgToIndexMap) $ Set.toList deps)) <$> Map.elems depMap + rdepMap onlyUnbroken = IntSet.size <$> resultList + where + resultList = go <$> [0..] + oneStepMap = IntMap.fromListWith IntSet.union $ (\(key,(_,deps)) -> (,IntSet.singleton key) <$> deps) <=< filter (\(_, (broken,_)) -> not (broken && onlyUnbroken)) $ intDeps + go pkg = IntSet.unions (oneStep:((resultList !!) <$> IntSet.toList oneStep)) + where oneStep = IntMap.findWithDefault mempty pkg oneStepMap + +-- | Generate a mapping of Hydra job names to maintainer GitHub handles. Calls +-- hydra-eval-jobs and the nix script ./maintainer-handles.nix. +getMaintainerMap :: IO MaintainerMap +getMaintainerMap = do + hydraJobs :: HydraJobs <- + readJSONProcess hydraEvalCommand hydraEvalParams "Failed to decode hydra-eval-jobs output: " + handlesMap :: EmailToGitHubHandles <- + readJSONProcess nixExprCommand ("maintainers/scripts/haskell/maintainer-handles.nix":nixExprParams) "Failed to decode nix output for lookup of github handles: " + pure $ Map.mapMaybe (splitMaintainersToGitHubHandles handlesMap) hydraJobs + where + -- Split a comma-spearated string of Maintainers into a NonEmpty list of + -- GitHub handles. + splitMaintainersToGitHubHandles + :: EmailToGitHubHandles -> Maintainers -> Maybe (NonEmpty Text) + splitMaintainersToGitHubHandles handlesMap (Maintainers maint) = + nonEmpty . mapMaybe (`Map.lookup` handlesMap) . Text.splitOn ", " $ fromMaybe "" maint + +-- | Get the a map of all dependencies of every package by calling the nix +-- script ./dependencies.nix. +getDependencyMap :: IO DependencyMap +getDependencyMap = + readJSONProcess nixExprCommand ("maintainers/scripts/haskell/dependencies.nix":nixExprParams) "Failed to decode nix output for lookup of dependencies: " + +-- | Run a process that produces JSON on stdout and and decode the JSON to a +-- data type. +-- +-- If the JSON-decoding fails, throw the JSON-decoding error. +readJSONProcess + :: FromJSON a + => FilePath -- ^ Filename of executable. + -> [String] -- ^ Arguments + -> String -- ^ String to prefix to JSON-decode error. + -> IO a +readJSONProcess exe args err = do + output <- readProcess exe args "" + let eitherDecodedOutput = eitherDecodeStrict' . encodeUtf8 . Text.pack $ output + case eitherDecodedOutput of + Left decodeErr -> error $ err <> decodeErr <> "\nRaw: '" <> take 1000 output <> "'" + Right decodedOutput -> pure decodedOutput + +-- BuildStates are sorted by subjective importance/concerningness +data BuildState + = Failed + | DependencyFailed + | OutputLimitExceeded + | Unknown (Maybe Int) + | TimedOut + | Canceled + | HydraFailure + | Unfinished + | Success + deriving stock (Show, Eq, Ord) + +icon :: BuildState -> Text +icon = \case + Failed -> ":x:" + DependencyFailed -> ":heavy_exclamation_mark:" + OutputLimitExceeded -> ":warning:" + Unknown x -> "unknown code " <> showT x + TimedOut -> ":hourglass::no_entry_sign:" + Canceled -> ":no_entry_sign:" + Unfinished -> ":hourglass_flowing_sand:" + HydraFailure -> ":construction:" + Success -> ":heavy_check_mark:" + +platformIcon :: Platform -> Text +platformIcon (Platform x) = case x of + "x86_64-linux" -> ":penguin:" + "aarch64-linux" -> ":iphone:" + "x86_64-darwin" -> ":apple:" + _ -> x + +data BuildResult = BuildResult {state :: BuildState, id :: Int} deriving (Show, Eq, Ord) +newtype Platform = Platform {platform :: Text} deriving (Show, Eq, Ord) +newtype Table row col a = Table (Map (row, col) a) +data SummaryEntry = SummaryEntry { + summaryBuilds :: Table Text Platform BuildResult, + summaryMaintainers :: Set Text, + summaryReverseDeps :: Int, + summaryUnbrokenReverseDeps :: Int +} +type StatusSummary = Map Text SummaryEntry + +instance (Ord row, Ord col, Semigroup a) => Semigroup (Table row col a) where + Table l <> Table r = Table (Map.unionWith (<>) l r) +instance (Ord row, Ord col, Semigroup a) => Monoid (Table row col a) where + mempty = Table Map.empty +instance Functor (Table row col) where + fmap f (Table a) = Table (fmap f a) +instance Foldable (Table row col) where + foldMap f (Table a) = foldMap f a + +buildSummary :: MaintainerMap -> ReverseDependencyMap -> Seq Build -> StatusSummary +buildSummary maintainerMap reverseDependencyMap = foldl (Map.unionWith unionSummary) Map.empty . fmap toSummary + where + unionSummary (SummaryEntry (Table lb) lm lr lu) (SummaryEntry (Table rb) rm rr ru) = SummaryEntry (Table $ Map.union lb rb) (lm <> rm) (max lr rr) (max lu ru) + toSummary Build{finished, buildstatus, job, id, system} = Map.singleton name (SummaryEntry (Table (Map.singleton (set, Platform system) (BuildResult state id))) maintainers reverseDeps unbrokenReverseDeps) + where + state :: BuildState + state = case (finished, buildstatus) of + (0, _) -> Unfinished + (_, Just 0) -> Success + (_, Just 1) -> Failed + (_, Just 2) -> DependencyFailed + (_, Just 3) -> HydraFailure + (_, Just 4) -> Canceled + (_, Just 7) -> TimedOut + (_, Just 11) -> OutputLimitExceeded + (_, i) -> Unknown i + packageName = fromMaybe job (Text.stripSuffix ("." <> system) job) + splitted = nonEmpty $ Text.splitOn "." packageName + name = maybe packageName NonEmpty.last splitted + set = maybe "" (Text.intercalate "." . NonEmpty.init) splitted + maintainers = maybe mempty (Set.fromList . toList) (Map.lookup job maintainerMap) + (reverseDeps, unbrokenReverseDeps) = Map.findWithDefault (0,0) name reverseDependencyMap + +readBuildReports :: IO (Eval, UTCTime, Seq Build) +readBuildReports = do + file <- reportFileName + fromMaybe (error $ "Could not decode " <> file) <$> decodeFileStrict' file + +sep :: Text +sep = " | " +joinTable :: [Text] -> Text +joinTable t = sep <> Text.intercalate sep t <> sep + +type NumSummary = Table Platform BuildState Int + +printTable :: (Ord rows, Ord cols) => Text -> (rows -> Text) -> (cols -> Text) -> (entries -> Text) -> Table rows cols entries -> [Text] +printTable name showR showC showE (Table mapping) = joinTable <$> (name : map showC cols) : replicate (length cols + sepsInName + 1) "---" : map printRow rows + where + sepsInName = Text.count "|" name + printRow row = showR row : map (\col -> maybe "" showE (Map.lookup (row, col) mapping)) cols + rows = toList $ Set.fromList (fst <$> Map.keys mapping) + cols = toList $ Set.fromList (snd <$> Map.keys mapping) + +printJob :: Int -> Text -> (Table Text Platform BuildResult, Text) -> [Text] +printJob evalId name (Table mapping, maintainers) = + if length sets <= 1 + then map printSingleRow sets + else ["- [ ] " <> makeJobSearchLink "" name <> " " <> maintainers] <> map printRow sets + where + printRow set = " - " <> printState set <> " " <> makeJobSearchLink set (if Text.null set then "toplevel" else set) + printSingleRow set = "- [ ] " <> printState set <> " " <> makeJobSearchLink set (makePkgName set) <> " " <> maintainers + makePkgName set = (if Text.null set then "" else set <> ".") <> name + printState set = Text.intercalate " " $ map (\pf -> maybe "" (label pf) $ Map.lookup (set, pf) mapping) platforms + makeJobSearchLink set linkLabel= makeSearchLink evalId linkLabel (makePkgName set) + sets = toList $ Set.fromList (fst <$> Map.keys mapping) + platforms = toList $ Set.fromList (snd <$> Map.keys mapping) + label pf (BuildResult s i) = "[[" <> platformIcon pf <> icon s <> "]](https://hydra.nixos.org/build/" <> showT i <> ")" + +makeSearchLink :: Int -> Text -> Text -> Text +makeSearchLink evalId linkLabel query = "[" <> linkLabel <> "](" <> "https://hydra.nixos.org/eval/" <> showT evalId <> "?filter=" <> query <> ")" + +statusToNumSummary :: StatusSummary -> NumSummary +statusToNumSummary = fmap getSum . foldMap (fmap Sum . jobTotals) + +jobTotals :: SummaryEntry -> Table Platform BuildState Int +jobTotals (summaryBuilds -> Table mapping) = getSum <$> Table (Map.foldMapWithKey (\(_, platform) (BuildResult buildstate _) -> Map.singleton (platform, buildstate) (Sum 1)) mapping) + +details :: Text -> [Text] -> [Text] +details summary content = ["<details><summary>" <> summary <> " </summary>", ""] <> content <> ["</details>", ""] + +printBuildSummary :: Eval -> UTCTime -> StatusSummary -> [(Text, Int)] -> Text +printBuildSummary + Eval{id, jobsetevalinputs = JobsetEvalInputs{nixpkgs = Nixpkgs{revision}}} + fetchTime + summary + topBrokenRdeps = + Text.unlines $ + headline <> [""] <> tldr <> ((" * "<>) <$> (errors <> warnings)) <> [""] + <> totals + <> optionalList "#### Maintained packages with build failure" (maintainedList fails) + <> optionalList "#### Maintained packages with failed dependency" (maintainedList failedDeps) + <> optionalList "#### Maintained packages with unknown error" (maintainedList unknownErr) + <> optionalHideableList "#### Unmaintained packages with build failure" (unmaintainedList fails) + <> optionalHideableList "#### Unmaintained packages with failed dependency" (unmaintainedList failedDeps) + <> optionalHideableList "#### Unmaintained packages with unknown error" (unmaintainedList unknownErr) + <> optionalHideableList "#### Top 50 broken packages, sorted by number of reverse dependencies" (brokenLine <$> topBrokenRdeps) + <> ["","*:arrow_heading_up:: The number of packages that depend (directly or indirectly) on this package (if any). If two numbers are shown the first (lower) number considers only packages which currently have enabled hydra jobs, i.e. are not marked broken. The second (higher) number considers all packages.*",""] + <> footer + where + footer = ["*Report generated with [maintainers/scripts/haskell/hydra-report.hs](https://github.com/NixOS/nixpkgs/blob/haskell-updates/maintainers/scripts/haskell/hydra-report.sh)*"] + totals = + [ "#### Build summary" + , "" + ] + <> printTable "Platform" (\x -> makeSearchLink id (platform x <> " " <> platformIcon x) ("." <> platform x)) (\x -> showT x <> " " <> icon x) showT numSummary + headline = + [ "### [haskell-updates build report from hydra](https://hydra.nixos.org/jobset/nixpkgs/haskell-updates)" + , "*evaluation [" + <> showT id + <> "](https://hydra.nixos.org/eval/" + <> showT id + <> ") of nixpkgs commit [" + <> Text.take 7 revision + <> "](https://github.com/NixOS/nixpkgs/commits/" + <> revision + <> ") as of " + <> Text.pack (formatTime defaultTimeLocale "%Y-%m-%d %H:%M UTC" fetchTime) + <> "*" + ] + brokenLine (name, rdeps) = "[" <> name <> "](https://packdeps.haskellers.com/reverse/" <> name <> ") :arrow_heading_up: " <> Text.pack (show rdeps) <> " " + numSummary = statusToNumSummary summary + jobsByState predicate = Map.filter (predicate . worstState) summary + worstState = foldl' min Success . fmap state . summaryBuilds + fails = jobsByState (== Failed) + failedDeps = jobsByState (== DependencyFailed) + unknownErr = jobsByState (\x -> x > DependencyFailed && x < TimedOut) + withMaintainer = Map.mapMaybe (\e -> (summaryBuilds e,) <$> nonEmpty (Set.toList (summaryMaintainers e))) + withoutMaintainer = Map.mapMaybe (\e -> if Set.null (summaryMaintainers e) then Just e else Nothing) + optionalList heading list = if null list then mempty else [heading] <> list + optionalHideableList heading list = if null list then mempty else [heading] <> details (showT (length list) <> " job(s)") list + maintainedList = showMaintainedBuild <=< Map.toList . withMaintainer + unmaintainedList = showBuild <=< sortOn (\(snd -> x) -> (negate (summaryUnbrokenReverseDeps x), negate (summaryReverseDeps x))) . Map.toList . withoutMaintainer + showBuild (name, entry) = printJob id name (summaryBuilds entry, Text.pack (if summaryReverseDeps entry > 0 then " :arrow_heading_up: " <> show (summaryUnbrokenReverseDeps entry) <>" | "<> show (summaryReverseDeps entry) else "")) + showMaintainedBuild (name, (table, maintainers)) = printJob id name (table, Text.intercalate " " (fmap ("@" <>) (toList maintainers))) + tldr = case (errors, warnings) of + ([],[]) -> [":green_circle: **Ready to merge**"] + ([],_) -> [":yellow_circle: **Potential issues**"] + _ -> [":red_circle: **Branch not mergeable**"] + warnings = + if' (Unfinished > maybe Success worstState maintainedJob) "`maintained` jobset failed." <> + if' (Unfinished == maybe Success worstState mergeableJob) "`mergeable` jobset is not finished." <> + if' (Unfinished == maybe Success worstState maintainedJob) "`maintained` jobset is not finished." + errors = + if' (isNothing mergeableJob) "No `mergeable` job found." <> + if' (isNothing maintainedJob) "No `maintained` job found." <> + if' (Unfinished > maybe Success worstState mergeableJob) "`mergeable` jobset failed." <> + if' (outstandingJobs (Platform "x86_64-linux") > 100) "Too many outstanding jobs on x86_64-linux." <> + if' (outstandingJobs (Platform "aarch64-linux") > 100) "Too many outstanding jobs on aarch64-linux." + if' p e = if p then [e] else mempty + outstandingJobs platform | Table m <- numSummary = Map.findWithDefault 0 (platform, Unfinished) m + maintainedJob = Map.lookup "maintained" summary + mergeableJob = Map.lookup "mergeable" summary + +printMaintainerPing :: IO () +printMaintainerPing = do + (maintainerMap, (reverseDependencyMap, topBrokenRdeps)) <- concurrently getMaintainerMap do + depMap <- getDependencyMap + rdepMap <- evaluate . calculateReverseDependencies $ depMap + let tops = take 50 . sortOn (negate . snd) . fmap (second fst) . filter (\x -> maybe False broken $ Map.lookup (fst x) depMap) . Map.toList $ rdepMap + pure (rdepMap, tops) + (eval, fetchTime, buildReport) <- readBuildReports + putStrLn (Text.unpack (printBuildSummary eval fetchTime (buildSummary maintainerMap reverseDependencyMap buildReport) topBrokenRdeps)) + +printMarkBrokenList :: IO () +printMarkBrokenList = do + (_, _, buildReport) <- readBuildReports + forM_ buildReport \Build{buildstatus, job} -> + case (buildstatus, Text.splitOn "." job) of + (Just 1, ["haskellPackages", name, "x86_64-linux"]) -> putStrLn $ " - " <> Text.unpack name + _ -> pure () diff --git a/maintainers/scripts/haskell/maintainer-handles.nix b/maintainers/scripts/haskell/maintainer-handles.nix new file mode 100644 index 00000000000..08c6bc4c96a --- /dev/null +++ b/maintainers/scripts/haskell/maintainer-handles.nix @@ -0,0 +1,7 @@ +# Nix script to lookup maintainer github handles from their email address. Used by ./hydra-report.hs. +let + pkgs = import ../../.. {}; + maintainers = import ../../maintainer-list.nix; + inherit (pkgs) lib; + mkMailGithubPair = _: maintainer: if maintainer ? github then { "${maintainer.email}" = maintainer.github; } else {}; +in lib.zipAttrsWith (_: builtins.head) (lib.mapAttrsToList mkMailGithubPair maintainers) diff --git a/maintainers/scripts/haskell/mark-broken.sh b/maintainers/scripts/haskell/mark-broken.sh new file mode 100755 index 00000000000..97dd5be8aaa --- /dev/null +++ b/maintainers/scripts/haskell/mark-broken.sh @@ -0,0 +1,47 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p coreutils git -I nixpkgs=. + +# This script uses the data pulled with +# maintainers/scripts/haskell/hydra-report.hs get-report to produce a list of +# failing builds that get written to the hackage2nix config. Then +# hackage-packages.nix gets regenerated and transitive-broken packages get +# marked as dont-distribute in the config as well. +# This should disable builds for most failing jobs in the haskell-updates jobset. + +set -euo pipefail + +broken_config="pkgs/development/haskell-modules/configuration-hackage2nix/broken.yaml" + +tmpfile=$(mktemp) +trap "rm ${tmpfile}" 0 + +echo "Remember that you need to manually run 'maintainers/scripts/haskell/hydra-report.hs get-report' sometime before running this script." +echo "Generating a list of broken builds and displaying for manual confirmation ..." +maintainers/scripts/haskell/hydra-report.hs mark-broken-list | sort -i > "$tmpfile" + +$EDITOR "$tmpfile" + +tail -n +3 "$broken_config" >> "$tmpfile" + +cat > "$broken_config" << EOF +broken-packages: + # These packages don't compile. +EOF + +# clear environment here to avoid things like allowing broken builds in +sort -iu "$tmpfile" >> "$broken_config" +clear="env -u HOME -u NIXPKGS_CONFIG" +$clear maintainers/scripts/haskell/regenerate-hackage-packages.sh +$clear maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh +$clear maintainers/scripts/haskell/regenerate-hackage-packages.sh + +if [[ "${1:-}" == "--do-commit" ]]; then +git add $broken_config +git add pkgs/development/haskell-modules/configuration-hackage2nix/transitive-broken.yaml +git add pkgs/development/haskell-modules/hackage-packages.nix +git commit -F - << EOF +haskellPackages: mark builds failing on hydra as broken + +This commit has been generated by maintainers/scripts/haskell/mark-broken.sh +EOF +fi diff --git a/maintainers/scripts/haskell/merge-and-open-pr.sh b/maintainers/scripts/haskell/merge-and-open-pr.sh new file mode 100755 index 00000000000..18db1da0f2a --- /dev/null +++ b/maintainers/scripts/haskell/merge-and-open-pr.sh @@ -0,0 +1,122 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p git gh -I nixpkgs=. +# +# Script to merge the currently open haskell-updates PR into master, bump the +# Stackage version and Hackage versions, and open the next haskell-updates PR. + +set -eu -o pipefail + +# exit after printing first argument to this function +function die { + # echo the first argument + echo "ERROR: $1" + echo "Aborting!" + + exit 1 +} + +function help { + echo "Usage: $0 HASKELL_UPDATES_PR_NUM" + echo "Merge the currently open haskell-updates PR into master, and open the next one." + echo + echo " -h, --help print this help" + echo " HASKELL_UPDATES_PR_NUM number of the currently open PR on NixOS/nixpkgs" + echo " for the haskell-updates branch" + echo + echo "Example:" + echo " \$ $0 137340" + + exit 1 +} + +# Read in the current haskell-updates PR number from the command line. +while [[ $# -gt 0 ]]; do + key="$1" + + case $key in + -h|--help) + help + ;; + *) + curr_haskell_updates_pr_num="$1" + shift + ;; + esac +done + +if [[ -z "${curr_haskell_updates_pr_num-}" ]] ; then + die "You must pass the current haskell-updates PR number as the first argument to this script." +fi + +# Make sure you have gh authentication setup. +if ! gh auth status 2>/dev/null ; then + die "You must setup the \`gh\` command. Run \`gh auth login\`." +fi + +# Fetch nixpkgs to get an up-to-date origin/haskell-updates branch. +echo "Fetching origin..." +git fetch origin >/dev/null + +# Make sure we are currently on a local haskell-updates branch. +curr_branch="$(git rev-parse --abbrev-ref HEAD)" +if [[ "$curr_branch" != "haskell-updates" ]]; then + die "Current branch is not called \"haskell-updates\"." +fi + +# Make sure our local haskell-updates branch is on the same commit as +# origin/haskell-updates. +curr_branch_commit="$(git rev-parse haskell-updates)" +origin_haskell_updates_commit="$(git rev-parse origin/haskell-updates)" +if [[ "$curr_branch_commit" != "$origin_haskell_updates_commit" ]]; then + die "Current branch is not at the same commit as origin/haskell-updates" +fi + +# Merge the current open haskell-updates PR. +echo "Merging https://github.com/NixOS/nixpkgs/pull/${curr_haskell_updates_pr_num}..." +gh pr merge --repo NixOS/nixpkgs --merge "$curr_haskell_updates_pr_num" + +# Update the list of Haskell package versions in NixOS on Hackage. +echo "Updating list of Haskell package versions in NixOS on Hackage..." +./maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh + +# Update stackage, Hackage hashes, and regenerate Haskell package set +echo "Updating Stackage..." +./maintainers/scripts/haskell/update-stackage.sh --do-commit +echo "Updating Hackage hashes..." +./maintainers/scripts/haskell/update-hackage.sh --do-commit +echo "Regenerating Hackage packages..." +./maintainers/scripts/haskell/regenerate-hackage-packages.sh --do-commit + +# Push these new commits to the haskell-updates branch +echo "Pushing commits just created to the remote haskell-updates branch..." +git push + +# Open new PR +new_pr_body=$(cat <<EOF +### This Merge + +This PR is the regular merge of the \`haskell-updates\` branch into \`master\`. + +This branch is being continually built and tested by hydra at https://hydra.nixos.org/jobset/nixpkgs/haskell-updates. You may be able to find an up-to-date Hydra build report at [cdepillabout/nix-haskell-updates-status](https://github.com/cdepillabout/nix-haskell-updates-status). + +We roughly aim to merge these \`haskell-updates\` PRs at least once every two weeks. See the @NixOS/haskell [team calendar](https://cloud.maralorn.de/apps/calendar/p/Mw5WLnzsP7fC4Zky) for who is currently in charge of this branch. + +### haskellPackages Workflow Summary + +Our workflow is currently described in [\`pkgs/development/haskell-modules/HACKING.md\`](https://github.com/NixOS/nixpkgs/blob/haskell-updates/pkgs/development/haskell-modules/HACKING.md). + +The short version is this: +* We regularly update the Stackage and Hackage pins on \`haskell-updates\` (normally at the beginning of a merge window). +* The community fixes builds of Haskell packages on that branch. +* We aim at at least one merge of \`haskell-updates\` into \`master\` every two weeks. +* We only do the merge if the [\`mergeable\`](https://hydra.nixos.org/job/nixpkgs/haskell-updates/mergeable) job is succeeding on hydra. +* If a [\`maintained\`](https://hydra.nixos.org/job/nixpkgs/haskell-updates/maintained) package is still broken at the time of merge, we will only merge if the maintainer has been pinged 7 days in advance. (If you care about a Haskell package, become a maintainer!) + +--- + +This is the follow-up to #${curr_haskell_updates_pr_num}. Come to [#haskell:nixos.org](https://matrix.to/#/#haskell:nixos.org) if you have any questions. +EOF +) + +echo "Opening a PR for the next haskell-updates merge cycle..." +gh pr create --repo NixOS/nixpkgs --base master --head haskell-updates --title "haskellPackages: update stackage and hackage" --body "$new_pr_body" diff --git a/maintainers/scripts/haskell/regenerate-hackage-packages.sh b/maintainers/scripts/haskell/regenerate-hackage-packages.sh new file mode 100755 index 00000000000..9d51eb4ca4a --- /dev/null +++ b/maintainers/scripts/haskell/regenerate-hackage-packages.sh @@ -0,0 +1,46 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p coreutils haskellPackages.cabal2nix-unstable git nix -I nixpkgs=. + +# This script is used to regenerate nixpkgs' Haskell package set, using the +# tool hackage2nix from the nixos/cabal2nix repo. hackage2nix looks at the +# config files in pkgs/development/haskell-modules/configuration-hackage2nix +# and generates a Nix expression for package version specified there, using the +# Cabal files from the Hackage database (available under all-cabal-hashes) and +# its companion tool cabal2nix. +# +# Related scripts are update-hackage.sh, for updating the snapshot of the +# Hackage database used by hackage2nix, and update-cabal2nix-unstable.sh, +# for updating the version of hackage2nix used to perform this task. + +set -euo pipefail + +HACKAGE2NIX="${HACKAGE2NIX:-hackage2nix}" + +# To prevent hackage2nix fails because of encoding. +# See: https://github.com/NixOS/nixpkgs/pull/122023 +export LC_ALL=C.UTF-8 + +extraction_derivation='with import ./. {}; runCommandLocal "unpacked-cabal-hashes" { } "tar xf ${all-cabal-hashes} --strip-components=1 --one-top-level=$out"' +unpacked_hackage="$(nix-build -E "$extraction_derivation" --no-out-link)" +config_dir=pkgs/development/haskell-modules/configuration-hackage2nix + +echo "Starting hackage2nix to regenerate pkgs/development/haskell-modules/hackage-packages.nix ..." +"$HACKAGE2NIX" \ + --hackage "$unpacked_hackage" \ + --preferred-versions <(for n in "$unpacked_hackage"/*/preferred-versions; do cat "$n"; echo; done) \ + --nixpkgs "$PWD" \ + --config "$config_dir/main.yaml" \ + --config "$config_dir/stackage.yaml" \ + --config "$config_dir/broken.yaml" \ + --config "$config_dir/transitive-broken.yaml" + +if [[ "${1:-}" == "--do-commit" ]]; then +git add pkgs/development/haskell-modules/hackage-packages.nix +git commit -F - << EOF +haskellPackages: regenerate package set based on current config + +This commit has been generated by maintainers/scripts/haskell/regenerate-hackage-packages.sh +EOF +fi + +echo "Regeneration of hackage-packages.nix finished." diff --git a/maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh b/maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh new file mode 100755 index 00000000000..94104e00edb --- /dev/null +++ b/maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh @@ -0,0 +1,15 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p coreutils nix gnused -I nixpkgs=. + +config_file=pkgs/development/haskell-modules/configuration-hackage2nix/transitive-broken.yaml + +cat > $config_file << EOF +# This file is automatically generated by +# maintainers/scripts/haskell/regenerate-transitive-broken-packages.sh +# It is supposed to list all haskellPackages that cannot evaluate because they +# depend on a dependency marked as broken. +dont-distribute-packages: +EOF + +echo "Regenerating list of transitive broken packages ..." +echo -e $(nix-instantiate --eval --strict maintainers/scripts/haskell/transitive-broken-packages.nix) | sed 's/\"//' | LC_ALL=C.UTF-8 sort -i >> $config_file diff --git a/maintainers/scripts/haskell/test-configurations.nix b/maintainers/scripts/haskell/test-configurations.nix new file mode 100644 index 00000000000..12287896b50 --- /dev/null +++ b/maintainers/scripts/haskell/test-configurations.nix @@ -0,0 +1,136 @@ +/* Nix expression to test for regressions in the Haskell configuration overlays. + + test-configurations.nix determines all attributes touched by given Haskell + configuration overlays (i. e. pkgs/development/haskell-modules/configuration-*.nix) + and builds all derivations (or at least a reasonable subset) affected by + these overrides. + + By default, it checks `configuration-{common,nix,ghc-8.10.x}.nix`. You can + invoke it like this: + + nix-build maintainers/scripts/haskell/test-configurations.nix --keep-going + + It is possible to specify other configurations: + + nix-build maintainers/scripts/haskell/test-configurations.nix \ + --arg files '[ "configuration-ghc-9.0.x.nix" "configuration-ghc-9.2.x.nix" ]' \ + --keep-going + + You can also just supply a single string: + + nix-build maintainers/scripts/haskell/test-configurations.nix \ + --argstr files "configuration-arm.nix" --keep-going + + You can even supply full paths which is handy, as it allows for tab-completing + the configurations: + + nix-build maintainers/scripts/haskell/test-configurations.nix \ + --argstr files pkgs/development/haskell-modules/configuration-arm.nix \ + --keep-going + + By default, derivation that fail to evaluate are skipped, unless they are + “just” marked as broken. You can check for other eval errors like this: + + nix-build maintainers/scripts/haskell/test-configurations.nix \ + --arg skipEvalErrors false --keep-going + + You can also disable checking broken packages by passing a nixpkgs config: + + nix-build maintainers/scripts/haskell/test-configurations.nix \ + --arg config '{ allowBroken = false; }' --keep-going + + By default the haskell.packages.ghc*Binary sets used for bootstrapping GHC + are _not_ tested. You can change this using: + + nix-build maintainers/scripts/haskell/test-configurations.nix \ + --arg skipBinaryGHCs false --keep-going + +*/ +{ files ? [ + "configuration-common.nix" + "configuration-nix.nix" + "configuration-ghc-8.10.x.nix" + ] +, nixpkgsPath ? ../../.. +, config ? { allowBroken = true; } +, skipEvalErrors ? true +, skipBinaryGHCs ? true +}: + +let + pkgs = import nixpkgsPath { inherit config; }; + inherit (pkgs) lib; + + # see usage explanation for the input format `files` allows + files' = builtins.map builtins.baseNameOf ( + if !builtins.isList files then [ files ] else files + ); + + setsForFile = fileName: + let + # extract the unique part of the config's file name + configName = builtins.head ( + builtins.match "configuration-(.+).nix" fileName + ); + # match the major and minor version of the GHC the config is intended for, if any + configVersion = lib.concatStrings ( + builtins.match "ghc-([0-9]+).([0-9]+).x" configName + ); + # return all package sets under haskell.packages matching the version components + setsForVersion = builtins.map (name: pkgs.haskell.packages.${name}) ( + builtins.filter (setName: + lib.hasPrefix "ghc${configVersion}" setName + && (skipBinaryGHCs -> !(lib.hasInfix "Binary" setName)) + ) ( + builtins.attrNames pkgs.haskell.packages + ) + ); + + defaultSets = [ pkgs.haskellPackages ]; + in { + # use plain haskellPackages for the version-agnostic files + # TODO(@sternenseemann): also consider currently selected versioned sets + "common" = defaultSets; + "nix" = defaultSets; + "arm" = defaultSets; + "darwin" = defaultSets; + }.${configName} or setsForVersion; + + # attribute set that has all the attributes of haskellPackages set to null + availableHaskellPackages = builtins.listToAttrs ( + builtins.map (attr: lib.nameValuePair attr null) ( + builtins.attrNames pkgs.haskellPackages + ) + ); + + # evaluate a configuration and only return the attributes changed by it, + # pass availableHaskellPackages as super in case intersectAttrs is used + overriddenAttrs = fileName: builtins.attrNames ( + lib.fix (self: + import (nixpkgsPath + "/pkgs/development/haskell-modules/${fileName}") { + haskellLib = pkgs.haskell.lib.compose; + inherit pkgs; + } self availableHaskellPackages + ) + ); + + # list of derivations that are affected by overrides in the given configuration + # overlays. For common, nix, darwin etc. only the derivation from the default + # package set will be emitted. + packages = builtins.filter (v: + lib.warnIf (v.meta.broken or false) "${v.pname} is marked as broken" ( + v != null + && (skipEvalErrors -> (builtins.tryEval (v.outPath or v)).success) + ) + ) ( + lib.concatMap (fileName: + let + sets = setsForFile fileName; + attrs = overriddenAttrs fileName; + in + lib.concatMap (set: builtins.map (attr: set.${attr}) attrs) sets + ) files' + ); +in + +packages diff --git a/maintainers/scripts/haskell/transitive-broken-packages.nix b/maintainers/scripts/haskell/transitive-broken-packages.nix new file mode 100644 index 00000000000..d4ddaa95765 --- /dev/null +++ b/maintainers/scripts/haskell/transitive-broken-packages.nix @@ -0,0 +1,16 @@ +let + nixpkgs = import ../../..; + inherit (nixpkgs {}) pkgs lib; + getEvaluating = x: + builtins.attrNames ( + lib.filterAttrs ( + _: v: (builtins.tryEval (v.outPath or null)).success && lib.isDerivation v && !v.meta.broken + ) x + ); + brokenDeps = lib.subtractLists + (getEvaluating pkgs.haskellPackages) + (getEvaluating (nixpkgs { config.allowBroken = true; }).haskellPackages); +in +'' + ${lib.concatMapStringsSep "\n" (x: " - ${x}") brokenDeps} +'' diff --git a/maintainers/scripts/haskell/update-cabal2nix-unstable.sh b/maintainers/scripts/haskell/update-cabal2nix-unstable.sh new file mode 100755 index 00000000000..41583704560 --- /dev/null +++ b/maintainers/scripts/haskell/update-cabal2nix-unstable.sh @@ -0,0 +1,17 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p coreutils curl jq gnused haskellPackages.cabal2nix-unstable -I nixpkgs=. + +# Updates cabal2nix-unstable to the latest master of the nixos/cabal2nix repository. +# See regenerate-hackage-packages.sh for details on the purpose of this script. + +set -euo pipefail + +# fetch current master HEAD from Github +head_info="$(curl -H "Accept: application/vnd.github.v3+json" https://api.github.com/repos/NixOS/cabal2nix/branches/master)" +# extract commit hash +commit="$(jq -r .commit.sha <<< "$head_info")" +# extract commit timestamp and convert to date +date="$(date "--date=$(jq -r .commit.commit.committer.date <<< "$head_info")" +%F)" +# generate nix expression from cabal file, replacing the version with the commit date +echo '# This file defines cabal2nix-unstable, used by maintainers/scripts/haskell/regenerate-hackage-packages.sh.' > pkgs/development/haskell-modules/cabal2nix-unstable.nix +cabal2nix "https://github.com/NixOS/cabal2nix/archive/$commit.tar.gz" | sed -e 's/version = ".*"/version = "'"unstable-$date"'"/' >> pkgs/development/haskell-modules/cabal2nix-unstable.nix diff --git a/maintainers/scripts/haskell/update-hackage.sh b/maintainers/scripts/haskell/update-hackage.sh new file mode 100755 index 00000000000..a7cfecbbb0f --- /dev/null +++ b/maintainers/scripts/haskell/update-hackage.sh @@ -0,0 +1,35 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p nix curl jq nix-prefetch-github git gnused -I nixpkgs=. + +# See regenerate-hackage-packages.sh for details on the purpose of this script. + +set -euo pipefail + +pin_file=pkgs/data/misc/hackage/pin.json +current_commit="$(jq -r .commit $pin_file)" +old_date="$(jq -r .msg $pin_file | sed 's/Update from Hackage at //')" +git_info="$(curl -H "Accept: application/vnd.github.v3+json" https://api.github.com/repos/commercialhaskell/all-cabal-hashes/branches/hackage)" +head_commit="$(echo "$git_info" | jq -r .commit.sha)" +commit_msg="$(echo "$git_info" | jq -r .commit.commit.message)" +new_date="$(echo "$commit_msg" | sed 's/Update from Hackage at //')" + +if [ "$current_commit" != "$head_commit" ]; then + url="https://github.com/commercialhaskell/all-cabal-hashes/archive/$head_commit.tar.gz" + hash="$(nix-prefetch-url "$url")" + jq -n \ + --arg commit "$head_commit" \ + --arg hash "$hash" \ + --arg url "$url" \ + --arg commit_msg "$commit_msg" \ + '{commit: $commit, url: $url, sha256: $hash, msg: $commit_msg}' \ + > $pin_file +fi + +if [[ "${1:-}" == "--do-commit" ]]; then +git add pkgs/data/misc/hackage/pin.json +git commit -F - << EOF +all-cabal-hashes: $old_date -> $new_date + +This commit has been generated by maintainers/scripts/haskell/update-hackage.sh +EOF +fi diff --git a/maintainers/scripts/haskell/update-stackage.sh b/maintainers/scripts/haskell/update-stackage.sh new file mode 100755 index 00000000000..ecf38dc4b90 --- /dev/null +++ b/maintainers/scripts/haskell/update-stackage.sh @@ -0,0 +1,57 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p nix curl jq nix-prefetch-github git gnused gnugrep -I nixpkgs=. + +set -eu -o pipefail + +tmpfile=$(mktemp "update-stackage.XXXXXXX") +# shellcheck disable=SC2064 + +stackage_config="pkgs/development/haskell-modules/configuration-hackage2nix/stackage.yaml" + +trap "rm ${tmpfile} ${tmpfile}.new" 0 +touch "$tmpfile" "$tmpfile.new" # Creating files here so that trap creates no errors. + +curl -L -s "https://stackage.org/lts/cabal.config" >"$tmpfile" +old_version=$(grep "# Stackage" $stackage_config | sed -E 's/.*([0-9]{2}\.[0-9]+)/\1/') +version=$(sed -rn "s/^--.*http:..(www.)?stackage.org.snapshot.lts-//p" "$tmpfile") + +if [[ "$old_version" == "$version" ]]; then + echo "No new stackage version" + exit 0 # Nothing to do +fi + +echo "Updating Stackage LTS from $old_version to $version." + +# Create a simple yaml version of the file. +sed -r \ + -e '/^--/d' \ + -e 's|^constraints:||' \ + -e 's|^ +| - |' \ + -e 's|,$||' \ + -e '/installed$/d' \ + -e '/^$/d' \ + < "${tmpfile}" | sort --ignore-case >"${tmpfile}.new" + +cat > $stackage_config << EOF +# Stackage LTS $version +# This file is auto-generated by +# maintainers/scripts/haskell/update-stackage.sh +default-package-overrides: +EOF + +# Drop restrictions on some tools where we always want the latest version. +sed -r \ + -e '/ cabal2nix /d' \ + -e '/ distribution-nixpkgs /d' \ + -e '/ jailbreak-cabal /d' \ + -e '/ language-nix /d' \ + < "${tmpfile}.new" >> $stackage_config + +if [[ "${1:-}" == "--do-commit" ]]; then +git add $stackage_config +git commit -F - << EOF +haskellPackages: stackage-lts $old_version -> $version + +This commit has been generated by maintainers/scripts/haskell/update-stackage.sh +EOF +fi diff --git a/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh b/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh new file mode 100755 index 00000000000..8c39d289f7a --- /dev/null +++ b/maintainers/scripts/haskell/upload-nixos-package-list-to-hackage.sh @@ -0,0 +1,22 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i bash -p nix curl gnused -I nixpkgs=. + +# On Hackage every package description shows a category "Distributions" which +# lists a "NixOS" version. +# This script uploads a csv to hackage which will update the displayed versions +# based on the current versions in nixpkgs. This happens with a simple http +# request. + +# For authorization you just need to have any valid hackage account. This +# script uses the `username` and `password-command` field from your +# ~/.cabal/config file. + +# e.g. username: maralorn +# password-command: pass hackage.haskell.org (this can be any command, but not an arbitrary shell expression. Like cabal we only read the first output line and ignore the rest.) +# Those fields are specified under `upload` on the `cabal` man page. + +package_list="$(nix-build -A haskell.package-list)/nixos-hackage-packages.csv" +username=$(grep "^username:" ~/.cabal/config | sed "s/^username: //") +password_command=$(grep "^password-command:" ~/.cabal/config | sed "s/^password-command: //") +curl -u "$username:$($password_command | head -n1)" --digest -H "Content-type: text/csv" -T "$package_list" http://hackage.haskell.org/distro/NixOS/packages.csv +echo diff --git a/maintainers/scripts/hydra-eval-failures.py b/maintainers/scripts/hydra-eval-failures.py new file mode 100755 index 00000000000..b7518b12857 --- /dev/null +++ b/maintainers/scripts/hydra-eval-failures.py @@ -0,0 +1,112 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i python3 -p "python3.withPackages(ps: with ps; [ requests pyquery click ])" + +# To use, just execute this script with --help to display help. + +import subprocess +import json +import sys + +import click +import requests +from pyquery import PyQuery as pq + +def map_dict (f, d): + for k,v in d.items(): + d[k] = f(v) + +maintainers_json = subprocess.check_output([ + 'nix-instantiate', '-A', 'lib.maintainers', '--eval', '--strict', '--json' +]) +maintainers = json.loads(maintainers_json) +MAINTAINERS = map_dict(lambda v: v.get('github', None), maintainers) + +def get_response_text(url): + return pq(requests.get(url).text) # IO + +EVAL_FILE = { + 'nixos': 'nixos/release.nix', + 'nixpkgs': 'pkgs/top-level/release.nix', +} + + +def get_maintainers(attr_name): + try: + nixname = attr_name.split('.') + meta_json = subprocess.check_output([ + 'nix-instantiate', + '--eval', + '--strict', + '-A', + '.'.join(nixname[1:]) + '.meta', + EVAL_FILE[nixname[0]], + '--arg', + 'nixpkgs', + './.', + '--json']) + meta = json.loads(meta_json) + return meta.get('maintainers', []) + except: + return [] + +def filter_github_users(maintainers): + github_only = [] + for i in maintainers: + if i.get('github'): + github_only.append(i) + return github_only + +def print_build(table_row): + a = pq(table_row)('a')[1] + print("- [ ] [{}]({})".format(a.text, a.get('href')), flush=True) + + job_maintainers = filter_github_users(get_maintainers(a.text)) + if job_maintainers: + print(" - maintainers: {}".format(" ".join(map(lambda u: '@' + u.get('github'), job_maintainers)))) + # TODO: print last three persons that touched this file + # TODO: pinpoint the diff that broke this build, or maybe it's transient or maybe it never worked? + + sys.stdout.flush() + +@click.command() +@click.option( + '--jobset', + default="nixos/release-19.09", + help='Hydra project like nixos/release-19.09') +def cli(jobset): + """ + Given a Hydra project, inspect latest evaluation + and print a summary of failed builds + """ + + url = "https://hydra.nixos.org/jobset/{}".format(jobset) + + # get the last evaluation + click.echo(click.style( + 'Getting latest evaluation for {}'.format(url), fg='green')) + d = get_response_text(url) + evaluations = d('#tabs-evaluations').find('a[class="row-link"]') + latest_eval_url = evaluations[0].get('href') + + # parse last evaluation page + click.echo(click.style( + 'Parsing evaluation {}'.format(latest_eval_url), fg='green')) + d = get_response_text(latest_eval_url + '?full=1') + + # TODO: aborted evaluations + # TODO: dependency failed without propagated builds + print('\nFailures:') + for tr in d('img[alt="Failed"]').parents('tr'): + print_build(tr) + + print('\nDependency failures:') + for tr in d('img[alt="Dependency failed"]').parents('tr'): + print_build(tr) + + + +if __name__ == "__main__": + try: + cli() + except Exception as e: + import pdb;pdb.post_mortem() diff --git a/maintainers/scripts/hydra_eval_check b/maintainers/scripts/hydra_eval_check new file mode 100755 index 00000000000..c8e03424f32 --- /dev/null +++ b/maintainers/scripts/hydra_eval_check @@ -0,0 +1,13 @@ +#! /bin/sh + +# give absolute path of release.nix as argument +hydra_eval_jobs \ + --argstr system x86_64-linux \ + --argstr system i686-linux \ + --argstr system x86_64-darwin \ + --argstr system i686-cygwin \ + --argstr system x86_64-cygwin \ + --argstr system i686-freebsd \ + --arg officialRelease false \ + --arg nixpkgs "{ outPath = builtins.storePath ./. ; rev = 1234; }" \ + $@ diff --git a/maintainers/scripts/luarocks-config.lua b/maintainers/scripts/luarocks-config.lua new file mode 100644 index 00000000000..89e74c00ea8 --- /dev/null +++ b/maintainers/scripts/luarocks-config.lua @@ -0,0 +1,4 @@ +rocks_servers = { + "https://luarocks.org" +} +version_check_on_fail = false diff --git a/maintainers/scripts/luarocks-packages.csv b/maintainers/scripts/luarocks-packages.csv new file mode 100644 index 00000000000..d69546cdf07 --- /dev/null +++ b/maintainers/scripts/luarocks-packages.csv @@ -0,0 +1,86 @@ +name,src,ref,server,version,luaversion,maintainers +alt-getopt,,,,,,arobyn +bit32,,,,5.3.0-1,lua5_1,lblasc +argparse,https://github.com/luarocks/argparse.git,,,,, +basexx,https://github.com/teto/basexx.git,,,,, +binaryheap,https://github.com/Tieske/binaryheap.lua,,,,,vcunat +busted,,,,,, +cassowary,,,,,,marsam alerque +compat53,,,,0.7-1,,vcunat +cosmo,,,,,,marsam +coxpcall,,,,1.17.0-1,, +cqueues,,,,,,vcunat +cyrussasl,https://github.com/JorjBauer/lua-cyrussasl.git,,,,, +digestif,https://github.com/astoff/digestif.git,,,0.2-1,lua5_3, +dkjson,,,,,, +fifo,,,,,, +gitsigns.nvim,https://github.com/lewis6991/gitsigns.nvim.git,,,,lua5_1, +http,,,,0.3-0,,vcunat +inspect,,,,,, +ldbus,,,http://luarocks.org/dev,,, +ldoc,https://github.com/stevedonovan/LDoc.git,,,,, +lgi,,,,,, +linenoise,https://github.com/hoelzro/lua-linenoise.git,,,,, +ljsyscall,,,,,lua5_1,lblasc +lpeg,,,,,,vyp +lpeg_patterns,,,,,, +lpeglabel,,,,,, +lpty,,,,,, +lrexlib-gnu,,,,,, +lrexlib-pcre,,,,,,vyp +lrexlib-posix,,,,,, +lua-cjson,,,,,, +lua-cmsgpack,,,,,, +lua-iconv,,,,,, +lua-lsp,,,,,, +lua-messagepack,,,,,, +lua-resty-http,,,,,, +lua-resty-jwt,,,,,, +lua-resty-openidc,,,,,, +lua-resty-openssl,,,,,, +lua-resty-session,,,,,, +lua-term,,,,,, +lua-toml,,,,,, +lua-zlib,,,,,,koral +lua_cliargs,https://github.com/amireh/lua_cliargs.git,,,,, +luabitop,https://github.com/teto/luabitop.git,,,,, +luacheck,,,,,, +luacov,,,,,, +luadbi,,,,,, +luadbi-mysql,,,,,, +luadbi-postgresql,,,,,, +luadbi-sqlite3,,,,,, +luaepnf,,,,,, +luaevent,,,,,, +luaexpat,,,,1.3.0-1,,arobyn flosse +luaffi,,,http://luarocks.org/dev,,, +luafilesystem,,,,1.7.0-2,,flosse +lualogging,,,,,, +luaossl,,,,,lua5_1, +luaposix,,,,34.1.1-1,,vyp lblasc +luarepl,,,,,, +luasec,,,,,,flosse +luasocket,,,,,, +luasql-sqlite3,,,,,,vyp +luassert,,,,,, +luasystem,,,,,, +luautf8,,,,,,pstn +luazip,,,,,, +lua-yajl,,,,,,pstn +luuid,,,,,, +luv,,,,1.43.0-0,, +lyaml,,,,,,lblasc +markdown,,,,,, +mediator_lua,,,,,, +mpack,,,,,, +moonscript,https://github.com/leafo/moonscript.git,dev-1,,,,arobyn +nvim-client,https://github.com/neovim/lua-client.git,,,,, +penlight,https://github.com/lunarmodules/Penlight.git,,,,,alerque +plenary.nvim,https://github.com/nvim-lua/plenary.nvim.git,,,,lua5_1, +rapidjson,https://github.com/xpol/lua-rapidjson.git,,,,, +readline,,,,,, +say,https://github.com/Olivine-Labs/say.git,,,,, +std._debug,https://github.com/lua-stdlib/_debug.git,,,,, +std.normalize,git://github.com/lua-stdlib/normalize.git,,,,, +stdlib,,,,41.2.2,,vyp +vstruct,https://github.com/ToxicFrog/vstruct.git,,,,, diff --git a/maintainers/scripts/nix-call-package b/maintainers/scripts/nix-call-package new file mode 100755 index 00000000000..be478fca2b7 --- /dev/null +++ b/maintainers/scripts/nix-call-package @@ -0,0 +1,5 @@ +#! /bin/sh + +echo "let pkgs = import <nixpkgs$2> {}; x = pkgs.callPackage $1 { $3 }; in ${4:-x}" | +nix-instantiate --show-trace - | +xargs nix-store -r -K diff --git a/maintainers/scripts/nix-diff.sh b/maintainers/scripts/nix-diff.sh new file mode 100755 index 00000000000..0c65e29cf43 --- /dev/null +++ b/maintainers/scripts/nix-diff.sh @@ -0,0 +1,277 @@ +#!/usr/bin/env nix-shell +#! nix-shell -i bash -p coreutils gnugrep gnused + +################################################################################ +# nix-diff.sh # +################################################################################ +# This script "diffs" Nix profile generations. # +# # +# Example: # +################################################################################ +# > nix-diff.sh 90 92 # +# + gnumake-4.2.1 # +# + gnumake-4.2.1-doc # +# - htmldoc-1.8.29 # +################################################################################ +# The example shows that as of generation 92 and since generation 90, # +# gnumake-4.2.1 and gnumake-4.2.1-doc have been installed, while # +# htmldoc-1.8.29 has been removed. # +# # +# The example above shows the default, minimal output mode of this script. # +# For more features, run `nix-diff.sh -h` for usage instructions. # +################################################################################ + +usage() { + cat <<EOF +usage: nix-diff.sh [-h | [-p profile | -s] [-q] [-l] [range]] +-h: print this message before exiting +-q: list the derivations installed in the parent generation +-l: diff every available intermediate generation between parent and + child +-p profile: specify the Nix profile to use + * defaults to ~/.nix-profile +-s: use the system profile + * equivalent to: -p /nix/var/nix/profiles/system +profile: * should be something like /nix/var/nix/profiles/default, not a + generation link like /nix/var/nix/profiles/default-2-link +range: the range of generations to diff + * the following patterns are allowed, where A, B, and N are positive + integers, and G is the currently active generation: + A..B => diffs from generation A to generation B + ~N => diffs from the Nth newest generation (older than G) to G + A => diffs from generation A to G + * defaults to ~1 +EOF +} + +usage_tip() { + echo 'run `nix-diff.sh -h` for usage instructions' >&2 + exit 1 +} + +while getopts :hqlp:s opt; do + case $opt in + h) + usage + exit + ;; + q) + opt_query=1 + ;; + l) + opt_log=1 + ;; + p) + opt_profile=$OPTARG + ;; + s) + opt_profile=/nix/var/nix/profiles/system + ;; + \?) + echo "error: invalid option -$OPTARG" >&2 + usage_tip + ;; + esac +done +shift $((OPTIND-1)) + +if [ -n "$opt_profile" ]; then + if ! [ -L "$opt_profile" ]; then + echo "error: expecting \`$opt_profile\` to be a symbolic link" >&2 + usage_tip + fi +else + opt_profile=$(readlink ~/.nix-profile) + if (( $? != 0 )); then + echo 'error: unable to dereference `~/.nix-profile`' >&2 + echo 'specify the profile manually with the `-p` flag' >&2 + usage_tip + fi +fi + +list_gens() { + nix-env -p "$opt_profile" --list-generations \ + | sed -r 's:^\s*::' \ + | cut -d' ' -f1 +} + +current_gen() { + nix-env -p "$opt_profile" --list-generations \ + | grep -E '\(current\)\s*$' \ + | sed -r 's:^\s*::' \ + | cut -d' ' -f1 +} + +neg_gen() { + local i=0 from=$1 n=$2 tmp + for gen in $(list_gens | sort -rn); do + if ((gen < from)); then + tmp=$gen + ((i++)) + ((i == n)) && break + fi + done + if ((i < n)); then + echo -n "error: there aren't $n generation(s) older than" >&2 + echo " generation $from" >&2 + return 1 + fi + echo $tmp +} + +match() { + argv=("$@") + for i in $(seq $(($#-1))); do + if grep -E "^${argv[$i]}\$" <(echo "$1") >/dev/null; then + echo $i + return + fi + done + echo 0 +} + +case $(match "$1" '' '[0-9]+' '[0-9]+\.\.[0-9]+' '~[0-9]+') in + 1) + diffTo=$(current_gen) + diffFrom=$(neg_gen $diffTo 1) + (($? == 1)) && usage_tip + ;; + 2) + diffFrom=$1 + diffTo=$(current_gen) + ;; + 3) + diffFrom=${1%%.*} + diffTo=${1##*.} + ;; + 4) + diffTo=$(current_gen) + diffFrom=$(neg_gen $diffTo ${1#*~}) + (($? == 1)) && usage_tip + ;; + 0) + echo 'error: invalid invocation' >&2 + usage_tip + ;; +esac + +dirA="${opt_profile}-${diffFrom}-link" +dirB="${opt_profile}-${diffTo}-link" + +declare -a temp_files +temp_length() { + echo -n ${#temp_files[@]} +} +temp_make() { + temp_files[$(temp_length)]=$(mktemp) +} +temp_clean() { + rm -f ${temp_files[@]} +} +temp_name() { + echo -n "${temp_files[$(($(temp_length)-1))]}" +} +trap 'temp_clean' EXIT + +temp_make +versA=$(temp_name) +refs=$(nix-store -q --references "$dirA") +(( $? != 0 )) && exit 1 +echo "$refs" \ + | grep -v env-manifest.nix \ + | sort \ + > "$versA" + +print_tag() { + local gen=$1 + nix-env -p "$opt_profile" --list-generations \ + | grep -E "^\s*${gen}" \ + | sed -r 's:^\s*::' \ + | sed -r 's:\s*$::' +} + +if [ -n "$opt_query" ]; then + print_tag $diffFrom + cat "$versA" \ + | sed -r 's:^[^-]+-(.*)$: \1:' + + print_line=1 +fi + +if [ -n "$opt_log" ]; then + gens=$(for gen in $(list_gens); do + ((diffFrom < gen && gen < diffTo)) && echo $gen + done) + # Force the $diffTo generation to be included in this list, instead of using + # `gen <= diffTo` in the preceding loop, so we encounter an error upon the + # event of its nonexistence. + gens=$(echo "$gens" + echo $diffTo) +else + gens=$diffTo +fi + +temp_make +add=$(temp_name) +temp_make +rem=$(temp_name) +temp_make +out=$(temp_name) + +for gen in $gens; do + + [ -n "$print_line" ] && echo + + temp_make + versB=$(temp_name) + + dirB="${opt_profile}-${gen}-link" + refs=$(nix-store -q --references "$dirB") + (( $? != 0 )) && exit 1 + echo "$refs" \ + | grep -v env-manifest.nix \ + | sort \ + > "$versB" + + in=$(comm -3 -1 "$versA" "$versB") + sed -r 's:^[^-]*-(.*)$:\1+:' <(echo "$in") \ + | sort -f \ + > "$add" + + un=$(comm -3 -2 "$versA" "$versB") + sed -r 's:^[^-]*-(.*)$:\1-:' <(echo "$un") \ + | sort -f \ + > "$rem" + + cat "$rem" "$add" \ + | sort -f \ + | sed -r 's:(.*)-$:- \1:' \ + | sed -r 's:(.*)\+$:\+ \1:' \ + | grep -v '^$' \ + > "$out" + + if [ -n "$opt_query" -o -n "$opt_log" ]; then + + lines=$(wc -l "$out" | cut -d' ' -f1) + tag=$(print_tag "$gen") + (( $? != 0 )) && exit 1 + if [ $lines -eq 0 ]; then + echo "$tag (no change)" + else + echo "$tag" + fi + cat "$out" \ + | sed 's:^: :' + + print_line=1 + + else + echo "diffing from generation $diffFrom to $diffTo" + cat "$out" + fi + + versA=$versB + +done + +exit 0 diff --git a/maintainers/scripts/nix-generate-from-cpan.nix b/maintainers/scripts/nix-generate-from-cpan.nix new file mode 100644 index 00000000000..fecca7f0c73 --- /dev/null +++ b/maintainers/scripts/nix-generate-from-cpan.nix @@ -0,0 +1,25 @@ +{ stdenv, lib, makeWrapper, perl, perlPackages }: + +stdenv.mkDerivation { + name = "nix-generate-from-cpan-3"; + + buildInputs = with perlPackages; [ + makeWrapper perl GetoptLongDescriptive CPANPLUS Readonly LogLog4perl + ]; + + phases = [ "installPhase" ]; + + installPhase = + '' + mkdir -p $out/bin + cp ${./nix-generate-from-cpan.pl} $out/bin/nix-generate-from-cpan + patchShebangs $out/bin/nix-generate-from-cpan + wrapProgram $out/bin/nix-generate-from-cpan --set PERL5LIB $PERL5LIB + ''; + + meta = { + maintainers = with lib.maintainers; [ eelco ]; + description = "Utility to generate a Nix expression for a Perl package from CPAN"; + platforms = lib.platforms.unix; + }; +} diff --git a/maintainers/scripts/nix-generate-from-cpan.pl b/maintainers/scripts/nix-generate-from-cpan.pl new file mode 100755 index 00000000000..6494acb50da --- /dev/null +++ b/maintainers/scripts/nix-generate-from-cpan.pl @@ -0,0 +1,466 @@ +#!/usr/bin/env perl + +use utf8; +use strict; +use warnings; + +use CPAN::Meta(); +use CPANPLUS::Backend(); +use Module::CoreList; +use Getopt::Long::Descriptive qw( describe_options ); +use JSON::PP qw( encode_json ); +use Log::Log4perl qw(:easy); +use Readonly(); + +# Readonly hash that maps CPAN style license strings to information +# necessary to generate a Nixpkgs style license attribute. +Readonly::Hash my %LICENSE_MAP => ( + + # The Perl 5 License (Artistic 1 & GPL 1 or later). + perl_5 => { + licenses => [qw( artistic1 gpl1Plus )] + }, + + # GNU Affero General Public License, Version 3. + agpl_3 => { + licenses => [qw( agpl3Plus )], + amb => 1 + }, + + # Apache Software License, Version 1.1. + apache_1_1 => { + licenses => ["Apache License 1.1"], + in_set => 0 + }, + + # Apache License, Version 2.0. + apache_2_0 => { + licenses => [qw( asl20 )] + }, + + # Artistic License, (Version 1). + artistic_1 => { + licenses => [qw( artistic1 )] + }, + + # Artistic License, Version 2.0. + artistic_2 => { + licenses => [qw( artistic2 )] + }, + + # BSD License (three-clause). + bsd => { + licenses => [qw( bsd3 )], + amb => 1 + }, + + # FreeBSD License (two-clause). + freebsd => { + licenses => [qw( bsd2 )] + }, + + # GNU Free Documentation License, Version 1.2. + gfdl_1_2 => { + licenses => [qw( fdl12 )] + }, + + # GNU Free Documentation License, Version 1.3. + gfdl_1_3 => { + licenses => [qw( fdl13 )] + }, + + # GNU General Public License, Version 1. + gpl_1 => { + licenses => [qw( gpl1Plus )], + amb => 1 + }, + + # GNU General Public License, Version 2. Note, we will interpret + # "gpl" alone as GPL v2+. + gpl_2 => { + licenses => [qw( gpl2Plus )], + amb => 1 + }, + + # GNU General Public License, Version 3. + gpl_3 => { + licenses => [qw( gpl3Plus )], + amb => 1 + }, + + # GNU Lesser General Public License, Version 2.1. Note, we will + # interpret "gpl" alone as LGPL v2.1+. + lgpl_2_1 => { + licenses => [qw( lgpl21Plus )], + amb => 1 + }, + + # GNU Lesser General Public License, Version 3.0. + lgpl_3_0 => { + licenses => [qw( lgpl3Plus )], + amb => 1 + }, + + # MIT (aka X11) License. + mit => { + licenses => [qw( mit )] + }, + + # Mozilla Public License, Version 1.0. + mozilla_1_0 => { + licenses => [qw( mpl10 )] + }, + + # Mozilla Public License, Version 1.1. + mozilla_1_1 => { + licenses => [qw( mpl11 )] + }, + + # OpenSSL License. + openssl => { + licenses => [qw( openssl )] + }, + + # Q Public License, Version 1.0. + qpl_1_0 => { + licenses => [qw( qpl )] + }, + + # Original SSLeay License. + ssleay => { + licenses => ["Original SSLeay License"], + in_set => 0 + }, + + # Sun Internet Standards Source License (SISSL). + sun => { + licenses => ["Sun Industry Standards Source License v1.1"], + in_set => 0 + }, + + # zlib License. + zlib => { + licenses => [qw( zlib )] + }, + + # Other Open Source Initiative (OSI) approved license. + open_source => { + licenses => [qw( free )], + amb => 1 + }, + + # Requires special permission from copyright holder. + restricted => { + licenses => [qw( unfree )], + amb => 1 + }, + + # Not an OSI approved license, but not restricted. Note, we + # currently map this to unfreeRedistributable, which is a + # conservative choice. + unrestricted => { + licenses => [qw( unfreeRedistributable )], + amb => 1 + }, + + # License not provided in metadata. + unknown => { + licenses => [], + amb => 1 + } +); + +sub handle_opts { + my ( $opt, $usage ) = describe_options( + 'usage: $0 %o MODULE', + [ 'maintainer|m=s', 'the package maintainer' ], + [ 'debug|d', 'enable debug output' ], + [ 'help', 'print usage message and exit' ] + ); + + if ( $opt->help ) { + print $usage->text; + exit; + } + + my $module_name = $ARGV[0]; + + if ( !defined $module_name ) { + print STDERR "Missing module name\n"; + print STDERR $usage->text; + exit 1; + } + + return ( $opt, $module_name ); +} + +# Takes a Perl package attribute name and returns 1 if the name cannot +# be referred to as a bareword. This typically happens if the package +# name is a reserved Nix keyword. +sub is_reserved { + my ($pkg) = @_; + + return $pkg =~ /^(?: assert | + else | + if | + import | + in | + inherit | + let | + rec | + then | + while | + with )$/x; +} + +sub pkg_to_attr { + my ($module) = @_; + my $attr_name = $module->package_name; + if ( $attr_name eq "libwww-perl" ) { + return "LWP"; + } + else { + $attr_name =~ s/-//g; + return $attr_name; + } +} + +sub get_pkg_name { + my ($module) = @_; + return ( $module->package_name, $module->package_version =~ s/^v(\d)/$1/r ); +} + +sub read_meta { + my ($pkg_path) = @_; + + my $yaml_path = "$pkg_path/META.yml"; + my $json_path = "$pkg_path/META.json"; + my $meta; + + if ( -r $json_path ) { + $meta = CPAN::Meta->load_file($json_path); + } + elsif ( -r $yaml_path ) { + $meta = CPAN::Meta->load_file($yaml_path); + } + else { + WARN("package has no META.yml or META.json"); + } + + return $meta; +} + +# Map a module to the attribute corresponding to its package +# (e.g. HTML::HeadParser will be mapped to HTMLParser, because that +# module is in the HTML-Parser package). +sub module_to_pkg { + my ( $cb, $module_name ) = @_; + my @modules = $cb->search( type => "name", allow => [$module_name] ); + if ( scalar @modules == 0 ) { + + # Fallback. + $module_name =~ s/:://g; + return $module_name; + } + my $module = $modules[0]; + my $attr_name = pkg_to_attr($module); + DEBUG("mapped dep $module_name to $attr_name"); + return $attr_name; +} + +sub get_deps { + my ( $cb, $meta, $type ) = @_; + + return if !defined $meta; + + my $prereqs = $meta->effective_prereqs; + my $deps = $prereqs->requirements_for( $type, "requires" ); + my @res; + foreach my $n ( $deps->required_modules ) { + next if $n eq "perl"; + + my @core = Module::CoreList->find_modules(qr/^$n$/); + next if (@core); + + my $pkg = module_to_pkg( $cb, $n ); + + # If the package name is reserved then we need to refer to it + # through the "self" variable. + $pkg = "self.\"$pkg\"" if is_reserved($pkg); + + push @res, $pkg; + } + return @res; +} + +sub uniq { + return keys %{ { map { $_ => 1 } @_ } }; +} + +sub render_license { + my ($cpan_license) = @_; + + return if !defined $cpan_license; + + my $licenses; + + # If the license is ambiguous then we'll print an extra warning. + # For example, "gpl_2" is ambiguous since it may refer to exactly + # "GPL v2" or to "GPL v2 or later". + my $amb = 0; + + # Whether the license is available inside `lib.licenses`. + my $in_set = 1; + + my $nix_license = $LICENSE_MAP{$cpan_license}; + if ( !$nix_license ) { + WARN("Unknown license: $cpan_license"); + $licenses = [$cpan_license]; + $in_set = 0; + } + else { + $licenses = $nix_license->{licenses}; + $amb = $nix_license->{amb}; + $in_set = !$nix_license->{in_set}; + } + + my $license_line; + + if ( @$licenses == 0 ) { + + # Avoid defining the license line. + } + elsif ($in_set) { + my $lic = 'lib.licenses'; + if ( @$licenses == 1 ) { + $license_line = "$lic.$licenses->[0]"; + } + else { + $license_line = "with $lic; [ " . join( ' ', @$licenses ) . " ]"; + } + } + else { + if ( @$licenses == 1 ) { + $license_line = $licenses->[0]; + } + else { + $license_line = '[ ' . join( ' ', @$licenses ) . ' ]'; + } + } + + INFO("license: $cpan_license"); + WARN("License '$cpan_license' is ambiguous, please verify") if $amb; + + return $license_line; +} + +my ( $opt, $module_name ) = handle_opts(); + +Log::Log4perl->easy_init( + { + level => $opt->debug ? $DEBUG : $INFO, + layout => '%m%n' + } +); + +my $cb = CPANPLUS::Backend->new; + +my @modules = $cb->search( type => "name", allow => [$module_name] ); +die "module $module_name not found\n" if scalar @modules == 0; +die "multiple packages that match module $module_name\n" if scalar @modules > 1; +my $module = $modules[0]; + +my ($pkg_name, $pkg_version) = get_pkg_name $module; +my $attr_name = pkg_to_attr $module; + +INFO( "attribute name: ", $attr_name ); +INFO( "module: ", $module->module ); +INFO( "version: ", $module->version ); +INFO( "package: ", $module->package, " (", "$pkg_name-$pkg_version", ", ", $attr_name, ")" ); +INFO( "path: ", $module->path ); + +my $tar_path = $module->fetch(); +INFO( "downloaded to: ", $tar_path ); +INFO( "sha-256: ", $module->status->checksum_value ); + +my $pkg_path = $module->extract(); +INFO( "unpacked to: ", $pkg_path ); + +my $meta = read_meta($pkg_path); + +DEBUG( "metadata: ", encode_json( $meta->as_struct ) ) if defined $meta; + +my @runtime_deps = sort( uniq( get_deps( $cb, $meta, "runtime" ) ) ); +INFO("runtime deps: @runtime_deps"); + +my @build_deps = sort( uniq( + get_deps( $cb, $meta, "configure" ), + get_deps( $cb, $meta, "build" ), + get_deps( $cb, $meta, "test" ) +) ); + +# Filter out runtime dependencies since those are already handled. +my %in_runtime_deps = map { $_ => 1 } @runtime_deps; +@build_deps = grep { not $in_runtime_deps{$_} } @build_deps; + +INFO("build deps: @build_deps"); + +my $homepage = $meta ? $meta->resources->{homepage} : undef; +INFO("homepage: $homepage") if defined $homepage; + +my $description = $meta ? $meta->abstract : undef; +if ( defined $description ) { + $description = uc( substr( $description, 0, 1 ) ) + . substr( $description, 1 ); # capitalise first letter + $description =~ s/\.$//; # remove period at the end + $description =~ s/\s*$//; + $description =~ s/^\s*//; + $description =~ s/\n+/ /; # Replace new lines by space. + INFO("description: $description"); +} + +#print(Data::Dumper::Dumper($meta->licenses) . "\n"); +my $license = $meta ? render_license( $meta->licenses ) : undef; + +INFO( "RSS feed: https://metacpan.org/feed/distribution/", + $module->package_name ); + +my $build_fun = -e "$pkg_path/Build.PL" + && !-e "$pkg_path/Makefile.PL" ? "buildPerlModule" : "buildPerlPackage"; + +print STDERR "===\n"; + +print <<EOF; + ${\(is_reserved($attr_name) ? "\"$attr_name\"" : $attr_name)} = $build_fun { + pname = "$pkg_name"; + version = "$pkg_version"; + src = fetchurl { + url = "mirror://cpan/${\$module->path}/${\$module->package}"; + sha256 = "${\$module->status->checksum_value}"; + }; +EOF +print <<EOF if scalar @build_deps > 0; + buildInputs = [ @build_deps ]; +EOF +print <<EOF if scalar @runtime_deps > 0; + propagatedBuildInputs = [ @runtime_deps ]; +EOF +print <<EOF; + meta = { +EOF +print <<EOF if defined $homepage; + homepage = "$homepage"; +EOF +print <<EOF if defined $description && $description ne "Unknown"; + description = "$description"; +EOF +print <<EOF if defined $license; + license = $license; +EOF +print <<EOF if $opt->maintainer; + maintainers = [ maintainers.${\$opt->maintainer} ]; +EOF +print <<EOF; + }; + }; +EOF diff --git a/maintainers/scripts/nixpkgs-lint.nix b/maintainers/scripts/nixpkgs-lint.nix new file mode 100644 index 00000000000..873905373af --- /dev/null +++ b/maintainers/scripts/nixpkgs-lint.nix @@ -0,0 +1,24 @@ +{ stdenv, lib, makeWrapper, perl, perlPackages }: + +stdenv.mkDerivation { + name = "nixpkgs-lint-1"; + + nativeBuildInputs = [ makeWrapper ]; + buildInputs = [ perl perlPackages.XMLSimple ]; + + dontUnpack = true; + buildPhase = "true"; + + installPhase = + '' + mkdir -p $out/bin + cp ${./nixpkgs-lint.pl} $out/bin/nixpkgs-lint + wrapProgram $out/bin/nixpkgs-lint --set PERL5LIB $PERL5LIB + ''; + + meta = with lib; { + maintainers = [ maintainers.eelco ]; + description = "A utility for Nixpkgs contributors to check Nixpkgs for common errors"; + platforms = platforms.unix; + }; +} diff --git a/maintainers/scripts/nixpkgs-lint.pl b/maintainers/scripts/nixpkgs-lint.pl new file mode 100755 index 00000000000..43fb3941361 --- /dev/null +++ b/maintainers/scripts/nixpkgs-lint.pl @@ -0,0 +1,173 @@ +#! /usr/bin/env nix-shell +#! nix-shell -i perl -p perl perlPackages.XMLSimple + +use strict; +use List::Util qw(min); +use XML::Simple qw(:strict); +use Getopt::Long qw(:config gnu_getopt); + +# Parse the command line. +my $path = "<nixpkgs>"; +my $filter = "*"; +my $maintainer; + +sub showHelp { + print <<EOF; +Usage: $0 [--package=NAME] [--maintainer=REGEXP] [--file=PATH] + +Check Nixpkgs for common errors/problems. + + -p, --package filter packages by name (default is ‘*’) + -m, --maintainer filter packages by maintainer (case-insensitive regexp) + -f, --file path to Nixpkgs (default is ‘<nixpkgs>’) + +Examples: + \$ nixpkgs-lint -f /my/nixpkgs -p firefox + \$ nixpkgs-lint -f /my/nixpkgs -m eelco +EOF + exit 0; +} + +GetOptions("package|p=s" => \$filter, + "maintainer|m=s" => \$maintainer, + "file|f=s" => \$path, + "help" => sub { showHelp() } + ) or exit 1; + +# Evaluate Nixpkgs into an XML representation. +my $xml = `nix-env -f '$path' --arg overlays '[]' -qa '$filter' --xml --meta --drv-path`; +die "$0: evaluation of ‘$path’ failed\n" if $? != 0; + +my $info = XMLin($xml, KeyAttr => { 'item' => '+attrPath', 'meta' => 'name' }, ForceArray => 1, SuppressEmpty => '' ) or die "cannot parse XML output"; + +# Check meta information. +print "=== Package meta information ===\n\n"; +my $nrBadNames = 0; +my $nrMissingMaintainers = 0; +my $nrMissingPlatforms = 0; +my $nrMissingDescriptions = 0; +my $nrBadDescriptions = 0; +my $nrMissingLicenses = 0; + +foreach my $attr (sort keys %{$info->{item}}) { + my $pkg = $info->{item}->{$attr}; + + my $pkgName = $pkg->{name}; + my $pkgVersion = ""; + if ($pkgName =~ /(.*)(-[0-9].*)$/) { + $pkgName = $1; + $pkgVersion = $2; + } + + # Check the maintainers. + my @maintainers; + my $x = $pkg->{meta}->{maintainers}; + if (defined $x && $x->{type} eq "strings") { + @maintainers = map { $_->{value} } @{$x->{string}}; + } elsif (defined $x->{value}) { + @maintainers = ($x->{value}); + } + + if (defined $maintainer && scalar(grep { $_ =~ /$maintainer/i } @maintainers) == 0) { + delete $info->{item}->{$attr}; + next; + } + + if (scalar @maintainers == 0) { + print "$attr: Lacks a maintainer\n"; + $nrMissingMaintainers++; + } + + # Check the platforms. + if (!defined $pkg->{meta}->{platforms}) { + print "$attr: Lacks a platform\n"; + $nrMissingPlatforms++; + } + + # Package names should not be capitalised. + if ($pkgName =~ /^[A-Z]/) { + print "$attr: package name ‘$pkgName’ should not be capitalised\n"; + $nrBadNames++; + } + + if ($pkgVersion eq "") { + print "$attr: package has no version\n"; + $nrBadNames++; + } + + # Check the license. + if (!defined $pkg->{meta}->{license}) { + print "$attr: Lacks a license\n"; + $nrMissingLicenses++; + } + + # Check the description. + my $description = $pkg->{meta}->{description}->{value}; + if (!$description) { + print "$attr: Lacks a description\n"; + $nrMissingDescriptions++; + } else { + my $bad = 0; + if ($description =~ /^\s/) { + print "$attr: Description starts with whitespace\n"; + $bad = 1; + } + if ($description =~ /\s$/) { + print "$attr: Description ends with whitespace\n"; + $bad = 1; + } + if ($description =~ /\.$/) { + print "$attr: Description ends with a period\n"; + $bad = 1; + } + if (index(lc($description), lc($attr)) != -1) { + print "$attr: Description contains package name\n"; + $bad = 1; + } + $nrBadDescriptions++ if $bad; + } +} + +print "\n"; + +# Find packages that have the same name. +print "=== Package name collisions ===\n\n"; + +my %pkgsByName; + +foreach my $attr (sort keys %{$info->{item}}) { + my $pkg = $info->{item}->{$attr}; + #print STDERR "attr = $attr, name = $pkg->{name}\n"; + $pkgsByName{$pkg->{name}} //= []; + push @{$pkgsByName{$pkg->{name}}}, $pkg; +} + +my $nrCollisions = 0; +foreach my $name (sort keys %pkgsByName) { + my @pkgs = @{$pkgsByName{$name}}; + + # Filter attributes that are aliases of each other (e.g. yield the + # same derivation path). + my %drvsSeen; + @pkgs = grep { my $x = $drvsSeen{$_->{drvPath}}; $drvsSeen{$_->{drvPath}} = 1; !defined $x } @pkgs; + + # Filter packages that have a lower priority. + my $highest = min (map { $_->{meta}->{priority}->{value} // 0 } @pkgs); + @pkgs = grep { ($_->{meta}->{priority}->{value} // 0) == $highest } @pkgs; + + next if scalar @pkgs == 1; + + $nrCollisions++; + print "The following attributes evaluate to a package named ‘$name’:\n"; + print " ", join(", ", map { $_->{attrPath} } @pkgs), "\n\n"; +} + +print "=== Bottom line ===\n"; +print "Number of packages: ", scalar(keys %{$info->{item}}), "\n"; +print "Number of bad names: $nrBadNames\n"; +print "Number of missing maintainers: $nrMissingMaintainers\n"; +print "Number of missing platforms: $nrMissingPlatforms\n"; +print "Number of missing licenses: $nrMissingLicenses\n"; +print "Number of missing descriptions: $nrMissingDescriptions\n"; +print "Number of bad descriptions: $nrBadDescriptions\n"; +print "Number of name collisions: $nrCollisions\n"; diff --git a/maintainers/scripts/patchelf-hints.sh b/maintainers/scripts/patchelf-hints.sh new file mode 100755 index 00000000000..5fdfc15dc23 --- /dev/null +++ b/maintainers/scripts/patchelf-hints.sh @@ -0,0 +1,84 @@ + +usage() { + echo " +$0 <path to unpacked binary distribution directory> + +This program return the list of libraries and where to find them based on +your currently installed programs. +"; + exit 1 +} + +if test $# -ne 1; then + usage +fi + +binaryDist=$1 + +hasBinaries=false +for bin in $(find $binaryDist -executable -type f) :; do + if test $bin = ":"; then + $hasBinaries || \ + echo "No patchable found in this directory." + break + fi + hasBinaries=true + + echo "" + echo "$bin:" + hasLibraries=false + unset interpreter + unset addRPath + for lib in $(strings $bin | grep '^\(/\|\)lib.*\.so' | sort | uniq) :; do + if test $lib = ":"; then + $hasLibraries || \ + echo " This program is a script or it is statically linked." + break + fi + hasLibraries=true + + echo " $lib:"; + + libPath=$lib + lib=$(basename $lib) + + #versionLessLib=$(echo $lib | sed 's,[.][.0-9]*$,,') + + libs="$( + find /nix/store/*/lib* \( -type f -or -type l \) -name $lib | + grep -v '\(bootstrap-tools\|system-path\|user-environment\|extra-utils\)' + )" + + echo "$libs" | + sed 's,^/nix/store/[a-z0-9]*-\([^/]*\)/.*/\([^/]*\)$, \1 -> \2,' | + sort | + uniq; + + names=$( + echo "$libs" | + sed 's,^/nix/store/[a-z0-9]*-\([^/]*\)-[.0-9]*/.*$,\1,' | + sort | + uniq; + ) + + if test "$names" = "glibc"; then names="stdenv.glibc"; fi + if echo $names | grep -c "gcc" &> /dev/null; then names="stdenv.cc.cc"; fi + + if test $lib != $libPath; then + interpreter="--interpreter \${$names}/lib/$lib" + elif echo $addRPath | grep -c "$names" &> /dev/null; then + : + else + addRPath=${addRPath+$addRPath:}"\${$names}/lib" + fi + done; + $hasLibraries && \ + echo " + Patchelf command: + + patchelf $interpreter \\ + ${addRPath+--set-rpath $addRPath \\ +} \$out/$bin + +" +done; diff --git a/maintainers/scripts/pluginupdate.py b/maintainers/scripts/pluginupdate.py new file mode 100644 index 00000000000..017e3ac758a --- /dev/null +++ b/maintainers/scripts/pluginupdate.py @@ -0,0 +1,674 @@ +# Used by pkgs/applications/editors/vim/plugins/update.py and pkgs/applications/editors/kakoune/plugins/update.py + +# format: +# $ nix run nixpkgs.python3Packages.black -c black update.py +# type-check: +# $ nix run nixpkgs.python3Packages.mypy -c mypy update.py +# linted: +# $ nix run nixpkgs.python3Packages.flake8 -c flake8 --ignore E501,E265 update.py + +import argparse +import functools +import http +import json +import os +import subprocess +import logging +import sys +import time +import traceback +import urllib.error +import urllib.parse +import urllib.request +import xml.etree.ElementTree as ET +from datetime import datetime +from functools import wraps +from multiprocessing.dummy import Pool +from pathlib import Path +from typing import Dict, List, Optional, Tuple, Union, Any, Callable +from urllib.parse import urljoin, urlparse +from tempfile import NamedTemporaryFile +from dataclasses import dataclass + +import git + +ATOM_ENTRY = "{http://www.w3.org/2005/Atom}entry" # " vim gets confused here +ATOM_LINK = "{http://www.w3.org/2005/Atom}link" # " +ATOM_UPDATED = "{http://www.w3.org/2005/Atom}updated" # " + +LOG_LEVELS = { + logging.getLevelName(level): level for level in [ + logging.DEBUG, logging.INFO, logging.WARN, logging.ERROR ] +} + +log = logging.getLogger() + +def retry(ExceptionToCheck: Any, tries: int = 4, delay: float = 3, backoff: float = 2): + """Retry calling the decorated function using an exponential backoff. + http://www.saltycrane.com/blog/2009/11/trying-out-retry-decorator-python/ + original from: http://wiki.python.org/moin/PythonDecoratorLibrary#Retry + (BSD licensed) + :param ExceptionToCheck: the exception on which to retry + :param tries: number of times to try (not retry) before giving up + :param delay: initial delay between retries in seconds + :param backoff: backoff multiplier e.g. value of 2 will double the delay + each retry + """ + + def deco_retry(f: Callable) -> Callable: + @wraps(f) + def f_retry(*args: Any, **kwargs: Any) -> Any: + mtries, mdelay = tries, delay + while mtries > 1: + try: + return f(*args, **kwargs) + except ExceptionToCheck as e: + print(f"{str(e)}, Retrying in {mdelay} seconds...") + time.sleep(mdelay) + mtries -= 1 + mdelay *= backoff + return f(*args, **kwargs) + + return f_retry # true decorator + + return deco_retry + +@dataclass +class FetchConfig: + proc: int + github_token: str + + +def make_request(url: str, token=None) -> urllib.request.Request: + headers = {} + if token is not None: + headers["Authorization"] = f"token {token}" + return urllib.request.Request(url, headers=headers) + +class Repo: + def __init__( + self, uri: str, branch: str, alias: Optional[str] + ) -> None: + self.uri = uri + '''Url to the repo''' + self.branch = branch + self.alias = alias + self.redirect: Dict[str, str] = {} + self.token = "dummy_token" + + @property + def name(self): + return self.uri.split('/')[-1] + + def __repr__(self) -> str: + return f"Repo({self.name}, {self.uri})" + + @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) + def has_submodules(self) -> bool: + return True + + @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) + def latest_commit(self) -> Tuple[str, datetime]: + loaded = self._prefetch(None) + updated = datetime.strptime(loaded['date'], "%Y-%m-%dT%H:%M:%S%z") + + return loaded['rev'], updated + + def _prefetch(self, ref: Optional[str]): + cmd = ["nix-prefetch-git", "--quiet", "--fetch-submodules", self.uri] + if ref is not None: + cmd.append(ref) + log.debug(cmd) + data = subprocess.check_output(cmd) + loaded = json.loads(data) + return loaded + + def prefetch(self, ref: Optional[str]) -> str: + loaded = self._prefetch(ref) + return loaded["sha256"] + + def as_nix(self, plugin: "Plugin") -> str: + return f'''fetchgit {{ + url = "{self.uri}"; + rev = "{plugin.commit}"; + sha256 = "{plugin.sha256}"; + }}''' + + +class RepoGitHub(Repo): + def __init__( + self, owner: str, repo: str, branch: str, alias: Optional[str] + ) -> None: + self.owner = owner + self.repo = repo + self.token = None + '''Url to the repo''' + super().__init__(self.url(""), branch, alias) + log.debug("Instantiating github repo %s/%s", self.owner, self.repo) + + @property + def name(self): + return self.repo + + def url(self, path: str) -> str: + return urljoin(f"https://github.com/{self.owner}/{self.name}/", path) + + @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) + def has_submodules(self) -> bool: + try: + req = make_request(self.url(f"blob/{self.branch}/.gitmodules"), self.token) + urllib.request.urlopen(req, timeout=10).close() + except urllib.error.HTTPError as e: + if e.code == 404: + return False + else: + raise + return True + + @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) + def latest_commit(self) -> Tuple[str, datetime]: + commit_url = self.url(f"commits/{self.branch}.atom") + commit_req = make_request(commit_url, self.token) + with urllib.request.urlopen(commit_req, timeout=10) as req: + self._check_for_redirect(commit_url, req) + xml = req.read() + root = ET.fromstring(xml) + latest_entry = root.find(ATOM_ENTRY) + assert latest_entry is not None, f"No commits found in repository {self}" + commit_link = latest_entry.find(ATOM_LINK) + assert commit_link is not None, f"No link tag found feed entry {xml}" + url = urlparse(commit_link.get("href")) + updated_tag = latest_entry.find(ATOM_UPDATED) + assert ( + updated_tag is not None and updated_tag.text is not None + ), f"No updated tag found feed entry {xml}" + updated = datetime.strptime(updated_tag.text, "%Y-%m-%dT%H:%M:%SZ") + return Path(str(url.path)).name, updated + + def _check_for_redirect(self, url: str, req: http.client.HTTPResponse): + response_url = req.geturl() + if url != response_url: + new_owner, new_name = ( + urllib.parse.urlsplit(response_url).path.strip("/").split("/")[:2] + ) + end_line = "\n" if self.alias is None else f" as {self.alias}\n" + plugin_line = "{owner}/{name}" + end_line + + old_plugin = plugin_line.format(owner=self.owner, name=self.name) + new_plugin = plugin_line.format(owner=new_owner, name=new_name) + self.redirect[old_plugin] = new_plugin + + + def prefetch(self, commit: str) -> str: + if self.has_submodules(): + sha256 = super().prefetch(commit) + else: + sha256 = self.prefetch_github(commit) + return sha256 + + def prefetch_github(self, ref: str) -> str: + data = subprocess.check_output( + ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")] + ) + return data.strip().decode("utf-8") + + def as_nix(self, plugin: "Plugin") -> str: + if plugin.has_submodules: + submodule_attr = "\n fetchSubmodules = true;" + else: + submodule_attr = "" + + return f'''fetchFromGitHub {{ + owner = "{self.owner}"; + repo = "{self.repo}"; + rev = "{plugin.commit}"; + sha256 = "{plugin.sha256}";{submodule_attr} + }}''' + + +@dataclass +class PluginDesc: + repo: Repo + branch: str + alias: Optional[str] + + @property + def name(self): + if self.alias is None: + return self.repo.name + else: + return self.alias + + +class Plugin: + def __init__( + self, + name: str, + commit: str, + has_submodules: bool, + sha256: str, + date: Optional[datetime] = None, + ) -> None: + self.name = name + self.commit = commit + self.has_submodules = has_submodules + self.sha256 = sha256 + self.date = date + + @property + def normalized_name(self) -> str: + return self.name.replace(".", "-") + + @property + def version(self) -> str: + assert self.date is not None + return self.date.strftime("%Y-%m-%d") + + def as_json(self) -> Dict[str, str]: + copy = self.__dict__.copy() + del copy["date"] + return copy + + + +class Editor: + """The configuration of the update script.""" + + def __init__( + self, + name: str, + root: Path, + get_plugins: str, + default_in: Optional[Path] = None, + default_out: Optional[Path] = None, + deprecated: Optional[Path] = None, + cache_file: Optional[str] = None, + ): + log.debug("get_plugins:", get_plugins) + self.name = name + self.root = root + self.get_plugins = get_plugins + self.default_in = default_in or root.joinpath(f"{name}-plugin-names") + self.default_out = default_out or root.joinpath("generated.nix") + self.deprecated = deprecated or root.joinpath("deprecated.json") + self.cache_file = cache_file or f"{name}-plugin-cache.json" + + def get_current_plugins(self): + """To fill the cache""" + return get_current_plugins(self) + + def load_plugin_spec(self, config: FetchConfig, plugin_file) -> List[PluginDesc]: + plugins = [] + with open(plugin_file) as f: + for line in f: + if line.startswith("#"): + continue + plugin = parse_plugin_line(config, line) + plugins.append(plugin) + return plugins + + def generate_nix(self, plugins, outfile: str): + '''Returns nothing for now, writes directly to outfile''' + raise NotImplementedError() + + def get_update(self, input_file: str, outfile: str, config: FetchConfig): + cache: Cache = Cache(self.get_current_plugins(), self.cache_file) + _prefetch = functools.partial(prefetch, cache=cache) + + def update() -> dict: + plugin_names = self.load_plugin_spec(config, input_file) + + try: + pool = Pool(processes=config.proc) + results = pool.map(_prefetch, plugin_names) + finally: + cache.store() + + plugins, redirects = check_results(results) + + self.generate_nix(plugins, outfile) + + return redirects + + return update + + + @property + def attr_path(self): + return self.name + "Plugins" + + def get_drv_name(self, name: str): + return self.attr_path + "." + name + + def rewrite_input(self, *args, **kwargs): + return rewrite_input(*args, **kwargs) + + def create_parser(self): + parser = argparse.ArgumentParser( + description=(f""" + Updates nix derivations for {self.name} plugins.\n + By default from {self.default_in} to {self.default_out}""" + ) + ) + parser.add_argument( + "--add", + dest="add_plugins", + default=[], + action="append", + help=f"Plugin to add to {self.attr_path} from Github in the form owner/repo", + ) + parser.add_argument( + "--input-names", + "-i", + dest="input_file", + default=self.default_in, + help="A list of plugins in the form owner/repo", + ) + parser.add_argument( + "--out", + "-o", + dest="outfile", + default=self.default_out, + help="Filename to save generated nix code", + ) + parser.add_argument( + "--proc", + "-p", + dest="proc", + type=int, + default=30, + help="Number of concurrent processes to spawn. Setting --github-token allows higher values.", + ) + parser.add_argument( + "--github-token", + "-t", + type=str, + default=os.getenv("GITHUB_API_TOKEN"), + help="""Allows to set --proc to higher values. + Uses GITHUB_API_TOKEN environment variables as the default value.""", + ) + parser.add_argument( + "--no-commit", "-n", action="store_true", default=False, + help="Whether to autocommit changes" + ) + parser.add_argument( + "--debug", "-d", choices=LOG_LEVELS.keys(), + default=logging.getLevelName(logging.WARN), + help="Adjust log level" + ) + return parser + + + +class CleanEnvironment(object): + def __enter__(self) -> None: + self.old_environ = os.environ.copy() + local_pkgs = str(Path(__file__).parent.parent.parent) + os.environ["NIX_PATH"] = f"localpkgs={local_pkgs}" + self.empty_config = NamedTemporaryFile() + self.empty_config.write(b"{}") + self.empty_config.flush() + os.environ["NIXPKGS_CONFIG"] = self.empty_config.name + + def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None: + os.environ.update(self.old_environ) + self.empty_config.close() + + +def get_current_plugins(editor: Editor) -> List[Plugin]: + with CleanEnvironment(): + cmd = ["nix", "eval", "--extra-experimental-features", "nix-command", "--impure", "--json", "--expr", editor.get_plugins] + log.debug("Running command %s", cmd) + out = subprocess.check_output(cmd) + data = json.loads(out) + plugins = [] + for name, attr in data.items(): + p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"]) + plugins.append(p) + return plugins + + +def prefetch_plugin( + p: PluginDesc, + cache: "Optional[Cache]" = None, +) -> Tuple[Plugin, Dict[str, str]]: + repo, branch, alias = p.repo, p.branch, p.alias + name = alias or p.repo.name + commit = None + log.info(f"Fetching last commit for plugin {name} from {repo.uri}@{branch}") + commit, date = repo.latest_commit() + cached_plugin = cache[commit] if cache else None + if cached_plugin is not None: + log.debug("Cache hit !") + cached_plugin.name = name + cached_plugin.date = date + return cached_plugin, repo.redirect + + has_submodules = repo.has_submodules() + print(f"prefetch {name}") + sha256 = repo.prefetch(commit) + + return ( + Plugin(name, commit, has_submodules, sha256, date=date), + repo.redirect, + ) + + +def fetch_plugin_from_pluginline(config: FetchConfig, plugin_line: str) -> Plugin: + plugin, _ = prefetch_plugin(parse_plugin_line(config, plugin_line)) + return plugin + + +def print_download_error(plugin: str, ex: Exception): + print(f"{plugin}: {ex}", file=sys.stderr) + ex_traceback = ex.__traceback__ + tb_lines = [ + line.rstrip("\n") + for line in traceback.format_exception(ex.__class__, ex, ex_traceback) + ] + print("\n".join(tb_lines)) + + +def check_results( + results: List[Tuple[PluginDesc, Union[Exception, Plugin], Dict[str, str]]] +) -> Tuple[List[Tuple[PluginDesc, Plugin]], Dict[str, str]]: + ''' ''' + failures: List[Tuple[str, Exception]] = [] + plugins = [] + redirects: Dict[str, str] = {} + for (pdesc, result, redirect) in results: + if isinstance(result, Exception): + failures.append((pdesc.name, result)) + else: + plugins.append((pdesc, result)) + redirects.update(redirect) + + print(f"{len(results) - len(failures)} plugins were checked", end="") + if len(failures) == 0: + print() + return plugins, redirects + else: + print(f", {len(failures)} plugin(s) could not be downloaded:\n") + + for (plugin, exception) in failures: + print_download_error(plugin, exception) + + sys.exit(1) + +def make_repo(uri, branch, alias) -> Repo: + '''Instantiate a Repo with the correct specialization depending on server (gitub spec)''' + # dumb check to see if it's of the form owner/repo (=> github) or https://... + res = uri.split('/') + if len(res) <= 2: + repo = RepoGitHub(res[0], res[1], branch, alias) + else: + repo = Repo(uri.strip(), branch, alias) + return repo + +def parse_plugin_line(config: FetchConfig, line: str) -> PluginDesc: + branch = "HEAD" + alias = None + uri = line + if " as " in uri: + uri, alias = uri.split(" as ") + alias = alias.strip() + if "@" in uri: + uri, branch = uri.split("@") + + repo = make_repo(uri.strip(), branch.strip(), alias) + repo.token = config.github_token + + return PluginDesc(repo, branch.strip(), alias) + + +def get_cache_path(cache_file_name: str) -> Optional[Path]: + xdg_cache = os.environ.get("XDG_CACHE_HOME", None) + if xdg_cache is None: + home = os.environ.get("HOME", None) + if home is None: + return None + xdg_cache = str(Path(home, ".cache")) + + return Path(xdg_cache, cache_file_name) + + +class Cache: + def __init__(self, initial_plugins: List[Plugin], cache_file_name: str) -> None: + self.cache_file = get_cache_path(cache_file_name) + + downloads = {} + for plugin in initial_plugins: + downloads[plugin.commit] = plugin + downloads.update(self.load()) + self.downloads = downloads + + def load(self) -> Dict[str, Plugin]: + if self.cache_file is None or not self.cache_file.exists(): + return {} + + downloads: Dict[str, Plugin] = {} + with open(self.cache_file) as f: + data = json.load(f) + for attr in data.values(): + p = Plugin( + attr["name"], attr["commit"], attr["has_submodules"], attr["sha256"] + ) + downloads[attr["commit"]] = p + return downloads + + def store(self) -> None: + if self.cache_file is None: + return + + os.makedirs(self.cache_file.parent, exist_ok=True) + with open(self.cache_file, "w+") as f: + data = {} + for name, attr in self.downloads.items(): + data[name] = attr.as_json() + json.dump(data, f, indent=4, sort_keys=True) + + def __getitem__(self, key: str) -> Optional[Plugin]: + return self.downloads.get(key, None) + + def __setitem__(self, key: str, value: Plugin) -> None: + self.downloads[key] = value + + +def prefetch( + pluginDesc: PluginDesc, cache: Cache +) -> Tuple[PluginDesc, Union[Exception, Plugin], dict]: + try: + plugin, redirect = prefetch_plugin(pluginDesc, cache) + cache[plugin.commit] = plugin + return (pluginDesc, plugin, redirect) + except Exception as e: + return (pluginDesc, e, {}) + + +def rewrite_input( + config: FetchConfig, + input_file: Path, + deprecated: Path, + redirects: Dict[str, str] = None, + append: Tuple = (), +): + with open(input_file, "r") as f: + lines = f.readlines() + + lines.extend(append) + + if redirects: + lines = [redirects.get(line, line) for line in lines] + + cur_date_iso = datetime.now().strftime("%Y-%m-%d") + with open(deprecated, "r") as f: + deprecations = json.load(f) + for old, new in redirects.items(): + old_plugin = fetch_plugin_from_pluginline(config, old) + new_plugin = fetch_plugin_from_pluginline(config, new) + if old_plugin.normalized_name != new_plugin.normalized_name: + deprecations[old_plugin.normalized_name] = { + "new": new_plugin.normalized_name, + "date": cur_date_iso, + } + with open(deprecated, "w") as f: + json.dump(deprecations, f, indent=4, sort_keys=True) + f.write("\n") + + lines = sorted(lines, key=str.casefold) + + with open(input_file, "w") as f: + f.writelines(lines) + + +def commit(repo: git.Repo, message: str, files: List[Path]) -> None: + repo.index.add([str(f.resolve()) for f in files]) + + if repo.index.diff("HEAD"): + print(f'committing to nixpkgs "{message}"') + repo.index.commit(message) + else: + print("no changes in working tree to commit") + + + +def update_plugins(editor: Editor, args): + """The main entry function of this module. All input arguments are grouped in the `Editor`.""" + + log.setLevel(LOG_LEVELS[args.debug]) + log.info("Start updating plugins") + fetch_config = FetchConfig(args.proc, args.github_token) + update = editor.get_update(args.input_file, args.outfile, fetch_config) + + redirects = update() + editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, redirects) + + autocommit = not args.no_commit + + nixpkgs_repo = None + if autocommit: + nixpkgs_repo = git.Repo(editor.root, search_parent_directories=True) + commit(nixpkgs_repo, f"{editor.attr_path}: update", [args.outfile]) + + if redirects: + update() + if autocommit: + commit( + nixpkgs_repo, + f"{editor.attr_path}: resolve github repository redirects", + [args.outfile, args.input_file, editor.deprecated], + ) + + for plugin_line in args.add_plugins: + editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=(plugin_line + "\n",)) + update() + plugin = fetch_plugin_from_pluginline(fetch_config, plugin_line) + if autocommit: + commit( + nixpkgs_repo, + "{drv_name}: init at {version}".format( + drv_name=editor.get_drv_name(plugin.normalized_name), + version=plugin.version + ), + [args.outfile, args.input_file], + ) diff --git a/maintainers/scripts/rebuild-amount.sh b/maintainers/scripts/rebuild-amount.sh new file mode 100755 index 00000000000..bedd352db5f --- /dev/null +++ b/maintainers/scripts/rebuild-amount.sh @@ -0,0 +1,133 @@ +#!/usr/bin/env bash +set -e + +# --print: avoid dependency on environment +optPrint= +if [ "$1" == "--print" ]; then + optPrint=true + shift +fi + +if [ "$#" != 1 ] && [ "$#" != 2 ]; then + cat <<EOF + Usage: $0 [--print] from-commit-spec [to-commit-spec] + You need to be in a git-controlled nixpkgs tree. + The current state of the tree will be used if the second commit is missing. + + Examples: + effect of latest commit: + $ $0 HEAD^ + $ $0 --print HEAD^ + effect of the whole patch series for 'staging' branch: + $ $0 origin/staging staging +EOF + exit 1 +fi + +# A slightly hacky way to get the config. +parallel="$(echo 'config.rebuild-amount.parallel or false' | nix-repl . 2>/dev/null \ + | grep -v '^\(nix-repl.*\)\?$' | tail -n 1 || true)" + +echo "Estimating rebuild amount by counting changed Hydra jobs (parallel=${parallel:-unset})." + +toRemove=() + +cleanup() { + rm -rf "${toRemove[@]}" +} +trap cleanup EXIT SIGINT SIGQUIT ERR + +MKTEMP='mktemp --tmpdir nix-rebuild-amount-XXXXXXXX' + +nixexpr() { + cat <<EONIX + let + lib = import $1/lib; + hydraJobs = import $1/pkgs/top-level/release.nix + # Compromise: accuracy vs. resources needed for evaluation. + { supportedSystems = cfg.systems or [ "x86_64-linux" "x86_64-darwin" ]; }; + cfg = (import $1 {}).config.rebuild-amount or {}; + + recurseIntoAttrs = attrs: attrs // { recurseForDerivations = true; }; + + # hydraJobs leaves recurseForDerivations as empty attrmaps; + # that would break nix-env and we also need to recurse everywhere. + tweak = lib.mapAttrs + (name: val: + if name == "recurseForDerivations" then true + else if lib.isAttrs val && val.type or null != "derivation" + then recurseIntoAttrs (tweak val) + else val + ); + + # Some of these contain explicit references to platform(s) we want to avoid; + # some even (transitively) depend on ~/.nixpkgs/config.nix (!) + blacklist = [ + "tarball" "metrics" "manual" + "darwin-tested" "unstable" "stdenvBootstrapTools" + "moduleSystem" "lib-tests" # these just confuse the output + ]; + + in + tweak (builtins.removeAttrs hydraJobs blacklist) +EONIX +} + +# Output packages in tree $2 that weren't in $1. +# Changing the output hash or name is taken as a change. +# Extra nix-env parameters can be in $3 +newPkgs() { + # We use files instead of pipes, as running multiple nix-env processes + # could eat too much memory for a standard 4GiB machine. + local -a list + for i in 1 2; do + local l="$($MKTEMP)" + list[$i]="$l" + toRemove+=("$l") + + local expr="$($MKTEMP)" + toRemove+=("$expr") + nixexpr "${!i}" > "$expr" + + nix-env -f "$expr" -qaP --no-name --out-path --show-trace $3 \ + | sort > "${list[$i]}" & + + if [ "$parallel" != "true" ]; then + wait + fi + done + + wait + comm -13 "${list[@]}" +} + +# Prepare nixpkgs trees. +declare -a tree +for i in 1 2; do + if [ -n "${!i}" ]; then # use the given commit + dir="$($MKTEMP -d)" + tree[$i]="$dir" + toRemove+=("$dir") + + git clone --shared --no-checkout --quiet . "${tree[$i]}" + (cd "${tree[$i]}" && git checkout --quiet "${!i}") + else #use the current tree + tree[$i]="$(pwd)" + fi +done + +newlist="$($MKTEMP)" +toRemove+=("$newlist") +# Notes: +# - the evaluation is done on x86_64-linux, like on Hydra. +# - using $newlist file so that newPkgs() isn't in a sub-shell (because of toRemove) +newPkgs "${tree[1]}" "${tree[2]}" '--argstr system "x86_64-linux"' > "$newlist" + +# Hacky: keep only the last word of each attribute path and sort. +sed -n 's/\([^. ]*\.\)*\([^. ]*\) .*$/\2/p' < "$newlist" \ + | sort | uniq -c + +if [ -n "$optPrint" ]; then + echo + cat "$newlist" +fi diff --git a/maintainers/scripts/remove-old-aliases.py b/maintainers/scripts/remove-old-aliases.py new file mode 100755 index 00000000000..5d9398feaa2 --- /dev/null +++ b/maintainers/scripts/remove-old-aliases.py @@ -0,0 +1,202 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i python3 -p "python3.withPackages(ps: with ps; [ ])" nix +""" +A program to remove old aliases or convert old aliases to throws +Example usage: +./maintainers/scripts/remove-old-aliases.py --year 2018 --file ./pkgs/top-level/aliases.nix + +Check this file with mypy after every change! +$ mypy --strict maintainers/scripts/remove-old-aliases.py +""" +import argparse +import shutil +import subprocess +from datetime import date as datetimedate +from datetime import datetime +from pathlib import Path + + +def process_args() -> argparse.Namespace: + """process args""" + arg_parser = argparse.ArgumentParser() + arg_parser.add_argument( + "--year", required=True, type=int, help="operate on aliases older than $year" + ) + arg_parser.add_argument( + "--month", + type=int, + default=1, + help="operate on aliases older than $year-$month", + ) + arg_parser.add_argument("--file", required=True, type=Path, help="alias file") + arg_parser.add_argument( + "--dry-run", action="store_true", help="don't modify files, only print results" + ) + return arg_parser.parse_args() + + +def get_date_lists( + txt: list[str], cutoffdate: datetimedate +) -> tuple[list[str], list[str], list[str]]: + """get a list of lines in which the date is older than $cutoffdate""" + date_older_list: list[str] = [] + date_older_throw_list: list[str] = [] + date_sep_line_list: list[str] = [] + + for lineno, line in enumerate(txt, start=1): + line = line.rstrip() + my_date = None + for string in line.split(): + string = string.strip(":") + try: + # strip ':' incase there is a string like 2019-11-01: + my_date = datetime.strptime(string, "%Y-%m-%d").date() + except ValueError: + try: + my_date = datetime.strptime(string, "%Y-%m").date() + except ValueError: + continue + + if my_date is None or my_date > cutoffdate: + continue + + if "=" not in line: + date_sep_line_list.append(f"{lineno} {line}") + # 'if' lines could be complicated + elif "if " in line and "if =" not in line: + print(f"RESOLVE MANUALLY {line}") + elif "throw" in line: + date_older_throw_list.append(line) + else: + date_older_list.append(line) + + return ( + date_older_list, + date_sep_line_list, + date_older_throw_list, + ) + + +def convert_to_throw(date_older_list: list[str]) -> list[tuple[str, str]]: + """convert a list of lines to throws""" + converted_list = [] + for line in date_older_list.copy(): + indent: str = " " * (len(line) - len(line.lstrip())) + before_equal = "" + after_equal = "" + try: + before_equal, after_equal = (x.strip() for x in line.split("=", maxsplit=2)) + except ValueError as err: + print(err, line, "\n") + date_older_list.remove(line) + continue + + alias = before_equal.strip() + after_equal_list = [x.strip(";:") for x in after_equal.split()] + + converted = ( + f"{indent}{alias} = throw \"'{alias}' has been renamed to/replaced by" + f" '{after_equal_list.pop(0)}'\";" + f' # Converted to throw {datetime.today().strftime("%Y-%m-%d")}' + ) + converted_list.append((line, converted)) + + return converted_list + + +def generate_text_to_write( + txt: list[str], + date_older_list: list[str], + converted_to_throw: list[tuple[str, str]], + date_older_throw_list: list[str], +) -> list[str]: + """generate a list of text to be written to the aliasfile""" + text_to_write: list[str] = [] + for line in txt: + text_to_append: str = "" + if converted_to_throw: + for tupl in converted_to_throw: + if line == tupl[0]: + text_to_append = f"{tupl[1]}\n" + if line not in date_older_list and line not in date_older_throw_list: + text_to_append = f"{line}\n" + if text_to_append: + text_to_write.append(text_to_append) + + return text_to_write + + +def write_file( + aliasfile: Path, + text_to_write: list[str], +) -> None: + """write file""" + temp_aliasfile = Path(f"{aliasfile}.raliases") + with open(temp_aliasfile, "w", encoding="utf-8") as far: + for line in text_to_write: + far.write(line) + print("\nChecking the syntax of the new aliasfile") + try: + subprocess.run( + ["nix-instantiate", "--eval", temp_aliasfile], + check=True, + stdout=subprocess.DEVNULL, + ) + except subprocess.CalledProcessError: + print( + "\nSyntax check failed,", + "there may have been a line which only has\n" + 'aliasname = "reason why";\n' + "when it should have been\n" + 'aliasname = throw "reason why";', + ) + temp_aliasfile.unlink() + return + shutil.move(f"{aliasfile}.raliases", aliasfile) + print(f"{aliasfile} modified! please verify with 'git diff'.") + + +def main() -> None: + """main""" + args = process_args() + + aliasfile = Path(args.file).absolute() + cutoffdate = (datetime.strptime(f"{args.year}-{args.month}-01", "%Y-%m-%d")).date() + + txt: list[str] = (aliasfile.read_text(encoding="utf-8")).splitlines() + + date_older_list: list[str] = [] + date_sep_line_list: list[str] = [] + date_older_throw_list: list[str] = [] + + date_older_list, date_sep_line_list, date_older_throw_list = get_date_lists( + txt, cutoffdate + ) + + converted_to_throw: list[tuple[str, str]] = [] + converted_to_throw = convert_to_throw(date_older_list) + + if date_older_list: + print(" Will be converted to throws. ".center(100, "-")) + for l_n in date_older_list: + print(l_n) + + if date_older_throw_list: + print(" Will be removed. ".center(100, "-")) + for l_n in date_older_throw_list: + print(l_n) + + if date_sep_line_list: + print(" On separate line, resolve manually. ".center(100, "-")) + for l_n in date_sep_line_list: + print(l_n) + + if not args.dry_run: + text_to_write = generate_text_to_write( + txt, date_older_list, converted_to_throw, date_older_throw_list + ) + write_file(aliasfile, text_to_write) + + +if __name__ == "__main__": + main() diff --git a/maintainers/scripts/update-channel-branches.sh b/maintainers/scripts/update-channel-branches.sh new file mode 100755 index 00000000000..d65cf3ec5f6 --- /dev/null +++ b/maintainers/scripts/update-channel-branches.sh @@ -0,0 +1,112 @@ +#!/bin/sh +set -e + +: ${NIXOS_CHANNELS:=https://nixos.org/channels/} +: ${CHANNELS_NAMESPACE:=refs/heads/channels/} + +# List all channels which are currently in the repository which we would +# have to remove if they are not found again. +deadChannels=$(git for-each-ref --format="%(refname)" "$CHANNELS_NAMESPACE") + +updateRef() { + local channelName=$1 + local newRev=$2 + + # if the inputs are not valid, then we do not update any branch. + test -z "$newRev" -o -z "$channelName" && return; + + # Update the local refs/heads/channels/* branches to be in-sync with the + # channel references. + local branch=$CHANNELS_NAMESPACE$channelName + oldRev=$(git rev-parse --short "$branch" 2>/dev/null || true) + if test "$oldRev" != "$newRev"; then + if git update-ref "$branch" "$newRev" 2>/dev/null; then + if test -z "$oldRev"; then + echo " * [new branch] $newRev -> ${branch#refs/heads/}" + else + echo " $oldRev..$newRev -> ${branch#refs/heads/}" + fi + else + if test -z "$oldRev"; then + echo " * [missing rev] $newRev -> ${branch#refs/heads/}" + else + echo " [missing rev] $oldRev..$newRev -> ${branch#refs/heads/}" + fi + fi + fi + + # Filter out the current channel from the list of dead channels. + deadChannels=$(grep -v "$CHANNELS_NAMESPACE$channelName" <<EOF +$deadChannels +EOF +) ||true +} + +# Find the name of all channels which are listed in the directory. +echo "Fetching channels from $NIXOS_CHANNELS:" +for channelName in : $(curl -s "$NIXOS_CHANNELS" | sed -n '/folder/ { s,.*href=",,; s,/".*,,; p }'); do + test "$channelName" = : && continue; + + # Do not follow redirections, such that we can extract the + # short-changeset from the name of the directory where we are + # redirected to. + sha1=$(curl -sI "$NIXOS_CHANNELS$channelName" | sed -n '/Location/ { s,.*\.\([a-f0-9]*\)[ \r]*$,\1,; p; }') + + updateRef "remotes/$channelName" "$sha1" +done + +echo "Fetching channels from nixos-version:" +if currentSystem=$(nixos-version 2>/dev/null); then + # If the system is entirely build from a custom nixpkgs version, + # then the version is not annotated in git version. This sed + # expression is basically matching that the expressions end with + # ".<sha1> (Name)" to extract the sha1. + sha1=$(echo "$currentSystem" | sed -n 's,^.*\.\([a-f0-9]*\) *(.*)$,\1,; T skip; p; :skip;') + + updateRef current-system "$sha1" +fi + +echo "Fetching channels from $HOME/.nix-defexpr:" +for revFile in : $(find -L "$HOME/.nix-defexpr/" -maxdepth 4 -name svn-revision); do + test "$revFile" = : && continue; + + # Deconstruct a path such as, into: + # + # /home/luke/.nix-defexpr/channels_root/nixos/nixpkgs/svn-revision + # channelName = root/nixos + # + # /home/luke/.nix-defexpr/channels/nixpkgs/svn-revision + # channelName = nixpkgs + # + user=${revFile#*.nix-defexpr/channels} + repo=${user#*/} + repo=${repo%%/*} + user=${user%%/*} + user=${user#_} + test -z "$user" && user=$USER + channelName="$user${user:+/}$repo" + + sha1=$(sed -n 's,^.*\.\([a-f0-9]*\)$,\1,; T skip; p; :skip;' "$revFile") + + updateRef "$channelName" "$sha1" +done + +# Suggest to remove channel branches which are no longer found by this +# script. This is to handle the cases where a local/remote channel +# disappear. We should not attempt to remove manually any branches, as they +# might be user branches. +if test -n "$deadChannels"; then + + echo " +Some old channel branches are still in your repository, if you +want to remove them, run the following command(s): +" + + while read branch; do + echo " git update-ref -d $branch" + done <<EOF +$deadChannels +EOF + + echo +fi diff --git a/maintainers/scripts/update-luarocks-packages b/maintainers/scripts/update-luarocks-packages new file mode 100755 index 00000000000..73a233c5f10 --- /dev/null +++ b/maintainers/scripts/update-luarocks-packages @@ -0,0 +1,218 @@ +#!/usr/bin/env nix-shell +#!nix-shell update-luarocks-shell.nix -i python3 + +# format: +# $ nix run nixpkgs.python3Packages.black -c black update.py +# type-check: +# $ nix run nixpkgs.python3Packages.mypy -c mypy update.py +# linted: +# $ nix run nixpkgs.python3Packages.flake8 -c flake8 --ignore E501,E265,E402 update.py + +import inspect +import os +import tempfile +import shutil +from dataclasses import dataclass +import subprocess +import csv +import logging +import textwrap +from multiprocessing.dummy import Pool + +from typing import List, Tuple, Optional +from pathlib import Path + +log = logging.getLogger() +log.addHandler(logging.StreamHandler()) + +ROOT = Path(os.path.dirname(os.path.abspath(inspect.getfile(inspect.currentframe())))).parent.parent # type: ignore +from pluginupdate import Editor, update_plugins, FetchConfig, CleanEnvironment + +PKG_LIST="maintainers/scripts/luarocks-packages.csv" +TMP_FILE="$(mktemp)" +GENERATED_NIXFILE="pkgs/development/lua-modules/generated-packages.nix" +LUAROCKS_CONFIG="$NIXPKGS_PATH/maintainers/scripts/luarocks-config.lua" + +HEADER = """/* {GENERATED_NIXFILE} is an auto-generated file -- DO NOT EDIT! +Regenerate it with: +nixpkgs$ ./maintainers/scripts/update-luarocks-packages + +You can customize the generated packages in pkgs/development/lua-modules/overrides.nix +*/ +""".format(GENERATED_NIXFILE=GENERATED_NIXFILE) + +FOOTER=""" +} +/* GENERATED - do not edit this file */ +""" + +@dataclass +class LuaPlugin: + name: str + '''Name of the plugin, as seen on luarocks.org''' + src: str + '''address to the git repository''' + ref: Optional[str] + '''git reference (branch name/tag)''' + version: Optional[str] + '''Set it to pin a package ''' + server: Optional[str] + '''luarocks.org registers packages under different manifests. + Its value can be 'http://luarocks.org/dev' + ''' + luaversion: Optional[str] + '''Attribue of the lua interpreter if a package is available only for a specific lua version''' + maintainers: Optional[str] + ''' Optional string listing maintainers separated by spaces''' + + @property + def normalized_name(self) -> str: + return self.name.replace(".", "-") + +# rename Editor to LangUpdate/ EcosystemUpdater +class LuaEditor(Editor): + def get_current_plugins(self): + return [] + + def load_plugin_spec(self, input_file) -> List[LuaPlugin]: + luaPackages = [] + csvfilename=input_file + log.info("Loading package descriptions from %s", csvfilename) + + with open(csvfilename, newline='') as csvfile: + reader = csv.DictReader(csvfile,) + for row in reader: + # name,server,version,luaversion,maintainers + plugin = LuaPlugin(**row) + luaPackages.append(plugin) + return luaPackages + + def generate_nix( + self, + results: List[Tuple[LuaPlugin, str]], + outfilename: str + ): + + with tempfile.NamedTemporaryFile("w+") as f: + f.write(HEADER) + header2 = textwrap.dedent( + # header2 = inspect.cleandoc( + """ + { self, stdenv, lib, fetchurl, fetchgit, callPackage, ... } @ args: + final: prev: + { + """) + f.write(header2) + for (plugin, nix_expr) in results: + f.write(f"{plugin.normalized_name} = {nix_expr}") + f.write(FOOTER) + f.flush() + + # if everything went fine, move the generated file to its destination + # using copy since move doesn't work across disks + shutil.copy(f.name, outfilename) + + print(f"updated {outfilename}") + + @property + def attr_path(self): + return "luaPackages" + + def get_update(self, input_file: str, outfile: str, config: FetchConfig): + _prefetch = generate_pkg_nix + + def update() -> dict: + plugin_specs = self.load_plugin_spec(input_file) + sorted_plugin_specs = sorted(plugin_specs, key=lambda v: v.name.lower()) + + try: + pool = Pool(processes=config.proc) + results = pool.map(_prefetch, sorted_plugin_specs) + finally: + pass + + self.generate_nix(results, outfile) + + redirects = {} + return redirects + + return update + + def rewrite_input(self, input_file: str, *args, **kwargs): + # vim plugin reads the file before update but that shouldn't be our case + # not implemented yet + # fieldnames = ['name', 'server', 'version', 'luaversion', 'maintainers'] + # input_file = "toto.csv" + # with open(input_file, newline='') as csvfile: + # writer = csv.DictWriter(csvfile, fieldnames=fieldnames) + # writer.writeheader() + # for row in reader: + # # name,server,version,luaversion,maintainers + # plugin = LuaPlugin(**row) + # luaPackages.append(plugin) + pass + +def generate_pkg_nix(plug: LuaPlugin): + ''' + Generate nix expression for a luarocks package + Our cache key associates "p.name-p.version" to its rockspec + ''' + log.debug("Generating nix expression for %s", plug.name) + cmd = [ "luarocks", "nix"] + + + if plug.maintainers: + cmd.append(f"--maintainers={plug.maintainers}") + + # updates plugin directly from its repository + print("server: [%s]" % plug.server) + # if plug.server == "src": + if plug.src != "": + if plug.src is None: + msg = "src must be set when 'version' is set to \"src\" for package %s" % plug.name + log.error(msg) + raise RuntimeError(msg) + log.debug("Updating from source %s", plug.src) + cmd.append(plug.src) + # update the plugin from luarocks + else: + cmd.append(plug.name) + if plug.version and plug.version != "src": + + cmd.append(plug.version) + + if plug.server != "src" and plug.server: + cmd.append(f"--only-server={plug.server}") + + if plug.luaversion: + with CleanEnvironment(): + local_pkgs = str(ROOT.resolve()) + cmd2 = ["nix-build", "--no-out-link", local_pkgs, "-A", f"{plug.luaversion}"] + + log.debug("running %s", ' '.join(cmd2)) + lua_drv_path=subprocess.check_output(cmd2, text=True).strip() + cmd.append(f"--lua-dir={lua_drv_path}/bin") + + log.debug("running %s", ' '.join(cmd)) + output = subprocess.check_output(cmd, text=True) + output = "callPackage(" + output.strip() + ") {};\n\n" + return (plug, output) + +def main(): + + editor = LuaEditor("lua", ROOT, '', + default_in = ROOT.joinpath(PKG_LIST), + default_out = ROOT.joinpath(GENERATED_NIXFILE) + ) + + parser = editor.create_parser() + args = parser.parse_args() + + update_plugins(editor, args) + + +if __name__ == "__main__": + + main() + +# vim: set ft=python noet fdm=manual fenc=utf-8 ff=unix sts=0 sw=4 ts=4 : diff --git a/maintainers/scripts/update-luarocks-shell.nix b/maintainers/scripts/update-luarocks-shell.nix new file mode 100644 index 00000000000..a58674fca8d --- /dev/null +++ b/maintainers/scripts/update-luarocks-shell.nix @@ -0,0 +1,13 @@ +{ nixpkgs ? import ../.. { } +}: +with nixpkgs; +let + pyEnv = python3.withPackages(ps: [ ps.GitPython ]); +in +mkShell { + packages = [ + pyEnv + luarocks-nix + nix-prefetch-scripts + ]; +} diff --git a/maintainers/scripts/update-python-libraries b/maintainers/scripts/update-python-libraries new file mode 100755 index 00000000000..4a6024c4038 --- /dev/null +++ b/maintainers/scripts/update-python-libraries @@ -0,0 +1,5 @@ +#!/bin/sh +build=`nix-build -E "with import (fetchTarball "channel:nixpkgs-unstable") {}; python3.withPackages(ps: with ps; [ packaging requests toolz ])"` +python=${build}/bin/python +exec ${python} pkgs/development/interpreters/python/update-python-libraries/update-python-libraries.py $@ + diff --git a/maintainers/scripts/update-redirected-urls.sh b/maintainers/scripts/update-redirected-urls.sh new file mode 100755 index 00000000000..5ffa9aca5f6 --- /dev/null +++ b/maintainers/scripts/update-redirected-urls.sh @@ -0,0 +1,12 @@ +#! /usr/bin/env nix-shell +#! nix-shell -p bash curl ripgrep jq -i bash + +set -euxo pipefail + +# Possibly also add non-https redirect, but there were non of those when I first +# made this script to test that. Feel free to add it when it is relevant. +curl https://repology.org/api/v1/repository/nix_unstable/problems \ + | jq -r '.[] | select(.type == "homepage_permanent_https_redirect") | .data | "s@\(.url)@\(.target)@"' \ + | sort | uniq | tee script.sed +find -name '*.nix' | xargs -P4 -- sed -f script.sed -i +rm script.sed diff --git a/maintainers/scripts/update-ruby-packages b/maintainers/scripts/update-ruby-packages new file mode 100755 index 00000000000..60da1a1b593 --- /dev/null +++ b/maintainers/scripts/update-ruby-packages @@ -0,0 +1,16 @@ +#!/usr/bin/env nix-shell +#!nix-shell -i bash -p bundler bundix + +set -euf -o pipefail + +( + cd pkgs/development/ruby-modules/with-packages + rm -f gemset.nix Gemfile.lock + # Since bundler 2+, the lock command generates a platform-dependent + # Gemfile.lock, hence causing to bundix to generate a gemset tied to the + # platform from where it was executed. + BUNDLE_FORCE_RUBY_PLATFORM=1 bundle lock + bundix + mv gemset.nix ../../../top-level/ruby-packages.nix + rm -f Gemfile.lock +) diff --git a/maintainers/scripts/update.nix b/maintainers/scripts/update.nix new file mode 100755 index 00000000000..1a2f06c73a2 --- /dev/null +++ b/maintainers/scripts/update.nix @@ -0,0 +1,212 @@ +{ package ? null +, maintainer ? null +, predicate ? null +, path ? null +, max-workers ? null +, include-overlays ? false +, keep-going ? null +, commit ? null +}: + +# TODO: add assert statements + +let + pkgs = import ./../../default.nix ( + if include-overlays == false then + { overlays = []; } + else if include-overlays == true then + { } # Let Nixpkgs include overlays impurely. + else { overlays = include-overlays; } + ); + + inherit (pkgs) lib; + + /* Remove duplicate elements from the list based on some extracted value. O(n^2) complexity. + */ + nubOn = f: list: + if list == [] then + [] + else + let + x = lib.head list; + xs = lib.filter (p: f x != f p) (lib.drop 1 list); + in + [x] ++ nubOn f xs; + + /* Recursively find all packages (derivations) in `pkgs` matching `cond` predicate. + + Type: packagesWithPath :: AttrPath → (AttrPath → derivation → bool) → AttrSet → List<AttrSet{attrPath :: str; package :: derivation; }> + AttrPath :: [str] + + The packages will be returned as a list of named pairs comprising of: + - attrPath: stringified attribute path (based on `rootPath`) + - package: corresponding derivation + */ + packagesWithPath = rootPath: cond: pkgs: + let + packagesWithPathInner = path: pathContent: + let + result = builtins.tryEval pathContent; + + dedupResults = lst: nubOn ({ package, attrPath }: package.updateScript) (lib.concatLists lst); + in + if result.success then + let + evaluatedPathContent = result.value; + in + if lib.isDerivation evaluatedPathContent then + lib.optional (cond path evaluatedPathContent) { attrPath = lib.concatStringsSep "." path; package = evaluatedPathContent; } + else if lib.isAttrs evaluatedPathContent then + # If user explicitly points to an attrSet or it is marked for recursion, we recur. + if path == rootPath || evaluatedPathContent.recurseForDerivations or false || evaluatedPathContent.recurseForRelease or false then + dedupResults (lib.mapAttrsToList (name: elem: packagesWithPathInner (path ++ [name]) elem) evaluatedPathContent) + else [] + else [] + else []; + in + packagesWithPathInner rootPath pkgs; + + /* Recursively find all packages (derivations) in `pkgs` matching `cond` predicate. + */ + packagesWith = packagesWithPath []; + + /* Recursively find all packages in `pkgs` with updateScript matching given predicate. + */ + packagesWithUpdateScriptMatchingPredicate = cond: + packagesWith (path: pkg: builtins.hasAttr "updateScript" pkg && cond path pkg); + + /* Recursively find all packages in `pkgs` with updateScript by given maintainer. + */ + packagesWithUpdateScriptAndMaintainer = maintainer': + let + maintainer = + if ! builtins.hasAttr maintainer' lib.maintainers then + builtins.throw "Maintainer with name `${maintainer'} does not exist in `maintainers/maintainer-list.nix`." + else + builtins.getAttr maintainer' lib.maintainers; + in + packagesWithUpdateScriptMatchingPredicate (path: pkg: + (if builtins.hasAttr "maintainers" pkg.meta + then (if builtins.isList pkg.meta.maintainers + then builtins.elem maintainer pkg.meta.maintainers + else maintainer == pkg.meta.maintainers + ) + else false + ) + ); + + /* Recursively find all packages under `path` in `pkgs` with updateScript. + */ + packagesWithUpdateScript = path: pkgs: + let + prefix = lib.splitString "." path; + pathContent = lib.attrByPath prefix null pkgs; + in + if pathContent == null then + builtins.throw "Attribute path `${path}` does not exist." + else + packagesWithPath prefix (path: pkg: builtins.hasAttr "updateScript" pkg) + pathContent; + + /* Find a package under `path` in `pkgs` and require that it has an updateScript. + */ + packageByName = path: pkgs: + let + package = lib.attrByPath (lib.splitString "." path) null pkgs; + in + if package == null then + builtins.throw "Package with an attribute name `${path}` does not exist." + else if ! builtins.hasAttr "updateScript" package then + builtins.throw "Package with an attribute name `${path}` does not have a `passthru.updateScript` attribute defined." + else + { attrPath = path; inherit package; }; + + /* List of packages matched based on the CLI arguments. + */ + packages = + if package != null then + [ (packageByName package pkgs) ] + else if predicate != null then + packagesWithUpdateScriptMatchingPredicate predicate pkgs + else if maintainer != null then + packagesWithUpdateScriptAndMaintainer maintainer pkgs + else if path != null then + packagesWithUpdateScript path pkgs + else + builtins.throw "No arguments provided.\n\n${helpText}"; + + helpText = '' + Please run: + + % nix-shell maintainers/scripts/update.nix --argstr maintainer garbas + + to run all update scripts for all packages that lists \`garbas\` as a maintainer + and have \`updateScript\` defined, or: + + % nix-shell maintainers/scripts/update.nix --argstr package gnome.nautilus + + to run update script for specific package, or + + % nix-shell maintainers/scripts/update.nix --arg predicate '(path: pkg: pkg.updateScript.name or null == "gnome-update-script")' + + to run update script for all packages matching given predicate, or + + % nix-shell maintainers/scripts/update.nix --argstr path gnome + + to run update script for all package under an attribute path. + + You can also add + + --argstr max-workers 8 + + to increase the number of jobs in parallel, or + + --argstr keep-going true + + to continue running when a single update fails. + + You can also make the updater automatically commit on your behalf from updateScripts + that support it by adding + + --argstr commit true + ''; + + /* Transform a matched package into an object for update.py. + */ + packageData = { package, attrPath }: { + name = package.name; + pname = lib.getName package; + oldVersion = lib.getVersion package; + updateScript = map builtins.toString (lib.toList (package.updateScript.command or package.updateScript)); + supportedFeatures = package.updateScript.supportedFeatures or []; + attrPath = package.updateScript.attrPath or attrPath; + }; + + /* JSON file with data for update.py. + */ + packagesJson = pkgs.writeText "packages.json" (builtins.toJSON (map packageData packages)); + + optionalArgs = + lib.optional (max-workers != null) "--max-workers=${max-workers}" + ++ lib.optional (keep-going == "true") "--keep-going" + ++ lib.optional (commit == "true") "--commit"; + + args = [ packagesJson ] ++ optionalArgs; + +in pkgs.stdenv.mkDerivation { + name = "nixpkgs-update-script"; + buildCommand = '' + echo "" + echo "----------------------------------------------------------------" + echo "" + echo "Not possible to update packages using \`nix-build\`" + echo "" + echo "${helpText}" + echo "----------------------------------------------------------------" + exit 1 + ''; + shellHook = '' + unset shellHook # do not contaminate nested shells + exec ${pkgs.python3.interpreter} ${./update.py} ${builtins.concatStringsSep " " args} + ''; +} diff --git a/maintainers/scripts/update.py b/maintainers/scripts/update.py new file mode 100644 index 00000000000..07e0b5c6830 --- /dev/null +++ b/maintainers/scripts/update.py @@ -0,0 +1,229 @@ +from __future__ import annotations +from typing import Dict, Generator, List, Optional, Tuple +import argparse +import asyncio +import contextlib +import json +import os +import re +import subprocess +import sys +import tempfile + +class CalledProcessError(Exception): + process: asyncio.subprocess.Process + +def eprint(*args, **kwargs): + print(*args, file=sys.stderr, **kwargs) + +async def check_subprocess(*args, **kwargs): + """ + Emulate check argument of subprocess.run function. + """ + process = await asyncio.create_subprocess_exec(*args, **kwargs) + returncode = await process.wait() + + if returncode != 0: + error = CalledProcessError() + error.process = process + + raise error + + return process + +async def run_update_script(nixpkgs_root: str, merge_lock: asyncio.Lock, temp_dir: Optional[Tuple[str, str]], package: Dict, keep_going: bool): + worktree: Optional[str] = None + + update_script_command = package['updateScript'] + + if temp_dir is not None: + worktree, _branch = temp_dir + + # Ensure the worktree is clean before update. + await check_subprocess('git', 'reset', '--hard', '--quiet', 'HEAD', cwd=worktree) + + # Update scripts can use $(dirname $0) to get their location but we want to run + # their clones in the git worktree, not in the main nixpkgs repo. + update_script_command = map(lambda arg: re.sub(r'^{0}'.format(re.escape(nixpkgs_root)), worktree, arg), update_script_command) + + eprint(f" - {package['name']}: UPDATING ...") + + try: + update_process = await check_subprocess('env', f"UPDATE_NIX_ATTR_PATH={package['attrPath']}", *update_script_command, stdout=asyncio.subprocess.PIPE, stderr=asyncio.subprocess.PIPE, cwd=worktree) + update_info = await update_process.stdout.read() + + await merge_changes(merge_lock, package, update_info, temp_dir) + except KeyboardInterrupt as e: + eprint('Cancelling…') + raise asyncio.exceptions.CancelledError() + except CalledProcessError as e: + eprint(f" - {package['name']}: ERROR") + eprint() + eprint(f"--- SHOWING ERROR LOG FOR {package['name']} ----------------------") + eprint() + stderr = await e.process.stderr.read() + eprint(stderr.decode('utf-8')) + with open(f"{package['pname']}.log", 'wb') as logfile: + logfile.write(stderr) + eprint() + eprint(f"--- SHOWING ERROR LOG FOR {package['name']} ----------------------") + + if not keep_going: + raise asyncio.exceptions.CancelledError() + +@contextlib.contextmanager +def make_worktree() -> Generator[Tuple[str, str], None, None]: + with tempfile.TemporaryDirectory() as wt: + branch_name = f'update-{os.path.basename(wt)}' + target_directory = f'{wt}/nixpkgs' + + subprocess.run(['git', 'worktree', 'add', '-b', branch_name, target_directory]) + yield (target_directory, branch_name) + subprocess.run(['git', 'worktree', 'remove', '--force', target_directory]) + subprocess.run(['git', 'branch', '-D', branch_name]) + +async def commit_changes(name: str, merge_lock: asyncio.Lock, worktree: str, branch: str, changes: List[Dict]) -> None: + for change in changes: + # Git can only handle a single index operation at a time + async with merge_lock: + await check_subprocess('git', 'add', *change['files'], cwd=worktree) + commit_message = '{attrPath}: {oldVersion} → {newVersion}'.format(**change) + if 'commitMessage' in change: + commit_message = change['commitMessage'] + elif 'commitBody' in change: + commit_message = commit_message + '\n\n' + change['commitBody'] + await check_subprocess('git', 'commit', '--quiet', '-m', commit_message, cwd=worktree) + await check_subprocess('git', 'cherry-pick', branch) + +async def check_changes(package: Dict, worktree: str, update_info: str): + if 'commit' in package['supportedFeatures']: + changes = json.loads(update_info) + else: + changes = [{}] + + # Try to fill in missing attributes when there is just a single change. + if len(changes) == 1: + # Dynamic data from updater take precedence over static data from passthru.updateScript. + if 'attrPath' not in changes[0]: + # update.nix is always passing attrPath + changes[0]['attrPath'] = package['attrPath'] + + if 'oldVersion' not in changes[0]: + # update.nix is always passing oldVersion + changes[0]['oldVersion'] = package['oldVersion'] + + if 'newVersion' not in changes[0]: + attr_path = changes[0]['attrPath'] + obtain_new_version_process = await check_subprocess('nix-instantiate', '--expr', f'with import ./. {{}}; lib.getVersion {attr_path}', '--eval', '--strict', '--json', stdout=asyncio.subprocess.PIPE, stderr=asyncio.subprocess.PIPE, cwd=worktree) + changes[0]['newVersion'] = json.loads((await obtain_new_version_process.stdout.read()).decode('utf-8')) + + if 'files' not in changes[0]: + changed_files_process = await check_subprocess('git', 'diff', '--name-only', 'HEAD', stdout=asyncio.subprocess.PIPE, cwd=worktree) + changed_files = (await changed_files_process.stdout.read()).splitlines() + changes[0]['files'] = changed_files + + if len(changed_files) == 0: + return [] + + return changes + +async def merge_changes(merge_lock: asyncio.Lock, package: Dict, update_info: str, temp_dir: Optional[Tuple[str, str]]) -> None: + if temp_dir is not None: + worktree, branch = temp_dir + changes = await check_changes(package, worktree, update_info) + + if len(changes) > 0: + await commit_changes(package['name'], merge_lock, worktree, branch, changes) + else: + eprint(f" - {package['name']}: DONE, no changes.") + else: + eprint(f" - {package['name']}: DONE.") + +async def updater(nixpkgs_root: str, temp_dir: Optional[Tuple[str, str]], merge_lock: asyncio.Lock, packages_to_update: asyncio.Queue[Optional[Dict]], keep_going: bool, commit: bool): + while True: + package = await packages_to_update.get() + if package is None: + # A sentinel received, we are done. + return + + if not ('commit' in package['supportedFeatures'] or 'attrPath' in package): + temp_dir = None + + await run_update_script(nixpkgs_root, merge_lock, temp_dir, package, keep_going) + +async def start_updates(max_workers: int, keep_going: bool, commit: bool, packages: List[Dict]): + merge_lock = asyncio.Lock() + packages_to_update: asyncio.Queue[Optional[Dict]] = asyncio.Queue() + + with contextlib.ExitStack() as stack: + temp_dirs: List[Optional[Tuple[str, str]]] = [] + + # Do not create more workers than there are packages. + num_workers = min(max_workers, len(packages)) + + nixpkgs_root_process = await check_subprocess('git', 'rev-parse', '--show-toplevel', stdout=asyncio.subprocess.PIPE) + nixpkgs_root = (await nixpkgs_root_process.stdout.read()).decode('utf-8').strip() + + # Set up temporary directories when using auto-commit. + for i in range(num_workers): + temp_dir = stack.enter_context(make_worktree()) if commit else None + temp_dirs.append(temp_dir) + + # Fill up an update queue, + for package in packages: + await packages_to_update.put(package) + + # Add sentinels, one for each worker. + # A workers will terminate when it gets sentinel from the queue. + for i in range(num_workers): + await packages_to_update.put(None) + + # Prepare updater workers for each temp_dir directory. + # At most `num_workers` instances of `run_update_script` will be running at one time. + updaters = asyncio.gather(*[updater(nixpkgs_root, temp_dir, merge_lock, packages_to_update, keep_going, commit) for temp_dir in temp_dirs]) + + try: + # Start updater workers. + await updaters + except asyncio.exceptions.CancelledError as e: + # When one worker is cancelled, cancel the others too. + updaters.cancel() + +def main(max_workers: int, keep_going: bool, commit: bool, packages_path: str) -> None: + with open(packages_path) as f: + packages = json.load(f) + + eprint() + eprint('Going to be running update for following packages:') + for package in packages: + eprint(f" - {package['name']}") + eprint() + + confirm = input('Press Enter key to continue...') + if confirm == '': + eprint() + eprint('Running update for:') + + asyncio.run(start_updates(max_workers, keep_going, commit, packages)) + + eprint() + eprint('Packages updated!') + sys.exit() + else: + eprint('Aborting!') + sys.exit(130) + +parser = argparse.ArgumentParser(description='Update packages') +parser.add_argument('--max-workers', '-j', dest='max_workers', type=int, help='Number of updates to run concurrently', nargs='?', default=4) +parser.add_argument('--keep-going', '-k', dest='keep_going', action='store_true', help='Do not stop after first failure') +parser.add_argument('--commit', '-c', dest='commit', action='store_true', help='Commit the changes') +parser.add_argument('packages', help='JSON file containing the list of package names and their update scripts') + +if __name__ == '__main__': + args = parser.parse_args() + + try: + main(args.max_workers, args.keep_going, args.commit, args.packages) + except KeyboardInterrupt as e: + # Let’s cancel outside of the main loop too. + sys.exit(130) diff --git a/maintainers/scripts/vanity-manual-equalities.txt b/maintainers/scripts/vanity-manual-equalities.txt new file mode 100644 index 00000000000..4a7bc3aea44 --- /dev/null +++ b/maintainers/scripts/vanity-manual-equalities.txt @@ -0,0 +1,7 @@ +viric viriketo@gmail.com +Pjotr Prins pjotr.public01@thebird.nl +Pjotr Prins pjotr.public05@thebird.nl +Wouter den Breejen wbreejen +MarcWeber marcweber +Ricardo Correia Ricardo M. Correia +ertesx@gmx.de ertes diff --git a/maintainers/scripts/vanity.sh b/maintainers/scripts/vanity.sh new file mode 100755 index 00000000000..b879488165d --- /dev/null +++ b/maintainers/scripts/vanity.sh @@ -0,0 +1,122 @@ +#! /bin/sh + +export LANG=C LC_ALL=C LC_COLLATE=C + +# Load git log +raw_git_log="$(git log)" +git_data="$(echo "$raw_git_log" | grep 'Author:' | + sed -e 's/^ *Author://; s/\\//g; s/^ *//; s/ *$//; + s/ @ .*//; s/ *[<]/\t/; s/[>]//')" + +# Name - nick - email correspondence from log and from maintainer list +# Also there are a few manual entries +maintainers="$(cat "$(dirname "$0")/../maintainer-list.nix" | + grep '=' | sed -re 's/\\"/''/g; + s/[ ]*([^ =]*)[ ]*=[ ]*" *(.*[^ ]) *[<](.*)[>] *".*/\1\t\2\t\3/')" +git_lines="$( ( echo "$git_data"; + cat "$(dirname "$0")/vanity-manual-equalities.txt") | sort |uniq)" + +emails="$( + ( echo "$maintainers" | cut -f 3; echo "$git_data" | cut -f 2 ) | + sort | uniq | grep -E ".+@.+[.].+" + )" + +fetchGithubName () { + commitid="$( + echo "$raw_git_log" | grep -B3 "Author: .*[<]$1[>]" | head -n 3 | + grep '^commit ' | tail -n 1 | sed -e 's/^commit //' + )" + userid="$( + curl https://github.com/NixOS/nixpkgs/commit/"$commitid" 2>/dev/null | + grep committed -B10 | grep 'href="/' | + sed -re 's@.* href="/@@; s@".*@@' | + grep -v "/commit/" + )"; + echo "$userid" +} + +[ -n "$NIXPKGS_GITHUB_NAME_CACHE" ] && { + echo "$emails" | while read email; do + line="$(grep "$email " "$NIXPKGS_GITHUB_NAME_CACHE")" + [ -z "$line" ] && { + echo "$email $(fetchGithubName "$email")" >> \ + "$NIXPKGS_GITHUB_NAME_CACHE" + } + done +} + +# For RDF +normalize_name () { + sed -e 's/%/%25/g; s/ /%20/g; s/'\''/%27/g; s/"/%22/g; s/`/%60/g; s/\^/%5e/g; ' +} + +denormalize_name () { + sed -e 's/%20/ /g; s/%27/'\''/g; s/%22/"/g; s/%60/`/g; s/%5e/^/g; s/%25/%/g;'; +} + +n3="$(mktemp --suffix .n3)" + +# «The same person» relation and a sorting hint +# Full name is something with a space +( +echo "$git_lines" | sed -re 's@(.*)\t(.*)@<my://name/\1> <my://can-be> <my://name/\2>.@' +echo "$git_lines" | sed -re 's@(.*)\t(.*)@<my://name/\2> <my://can-be> <my://name/\1>.@' +echo "$maintainers" | sed -re 's@(.*)\t(.*)\t(.*)@<my://name/\1> <my://can-be> <my://name/\2>.@' +echo "$maintainers" | sed -re 's@(.*)\t(.*)\t(.*)@<my://name/\2> <my://can-be> <my://name/\3>.@' +echo "$maintainers" | sed -re 's@(.*)\t(.*)\t(.*)@<my://name/\3> <my://can-be> <my://name/\1>.@' +echo "$git_lines" | grep ' ' | cut -f 1 | sed -e 's@.*@<my://name/&> <my://is-name> <my://0>.@' +echo "$git_lines" | grep -v ' ' | cut -f 1 | sed -e 's@.*@<my://name/&> <my://is-name> <my://1>.@' +echo "$maintainers" | cut -f 2 | sed -e 's@.*@<my://name/&> <my://is-name> <my://0>.@' +[ -n "$NIXPKGS_GITHUB_NAME_CACHE" ] && cat "$NIXPKGS_GITHUB_NAME_CACHE" | + grep -v " $" | + sed -re 's@(.*)\t(.*)@<my://name/\1> <my://at-github> <my://github/\2>.@' +) | normalize_name | grep -E '<my://[-a-z]+>' | sort | uniq > "$n3" + +# Get transitive closure +sparql="$(nix-build '<nixpkgs>' -Q -A apache-jena --no-out-link)/bin/sparql" +name_list="$( + "$sparql" --results=TSV --data="$n3" " + select ?x ?y ?g where { + ?x <my://can-be>+ ?y. + ?x <my://is-name> ?g. + } + " | tail -n +2 | + sed -re 's@<my://name/@@g; s@<my://@@g; s@>@@g;' | + sort -k 2,3 -t ' ' +)" +github_name_list="$( + "$sparql" --results=TSV --data="$n3" " + select ?x ?y where { + ?x (<my://can-be>+ / <my://at-github>) ?y. + } + " | tail -n +2 | + sed -re 's@<my://(name|github)/@@g; s@<my://@@g; s@>@@g;' +)" + +# Take first spelling option for every person +name_list_canonical="$(echo "$name_list" | cut -f 1,2 | uniq -f1)" + +cleaner_script="$(echo "$name_list_canonical" | denormalize_name | + sed -re 's/(.*)\t(.*)/s#^\2$#\1#g/g')" + +# Add github usernames +if [ -n "$NIXPKGS_GITHUB_NAME_CACHE" ]; then + github_adder_script="$(mktemp)" + echo "$github_name_list" | + grep -E "$(echo "$name_list_canonical" | cut -f 2 | + tr '\n' '|' )" | + sort | uniq | + sed -re 's/(.*)\t(.*)/s| \1$| \1\t\2|g;/' | + denormalize_name > "$github_adder_script" +else + github_adder_script='/dev/null' +fi + +echo "$name_list" | denormalize_name + +echo + +echo "$git_data" | cut -f 1 | + sed -e "$cleaner_script" | + sort | uniq -c | sort -k1n | sed -rf "$github_adder_script" | + sed -re 's/^ *([0-9]+) /\1\t/' diff --git a/maintainers/team-list.nix b/maintainers/team-list.nix new file mode 100644 index 00000000000..bf4fcc6a4a7 --- /dev/null +++ b/maintainers/team-list.nix @@ -0,0 +1,310 @@ +/* List of maintainer teams. + name = { + # Required + members = [ maintainer1 maintainer2 ]; + scope = "Maintain foo packages."; + }; + + where + + - `members` is the list of maintainers belonging to the group, + - `scope` describes the scope of the group. + + More fields may be added in the future. + + Please keep the list alphabetically sorted. + */ + +{ lib }: +with lib.maintainers; { + acme = { + members = [ + aanderse + andrew-d + arianvp + emily + flokli + m1cr0man + ]; + scope = "Maintain ACME-related packages and modules."; + }; + + bazel = { + members = [ + mboes + marsam + uri-canva + cbley + olebedev + groodt + aherrmann + ylecornec + ]; + scope = "Bazel build tool & related tools https://bazel.build/"; + }; + + beam = { + members = [ + ankhers + Br1ght0ne + DianaOlympos + gleber + happysalada + minijackson + yurrriq + ]; + scope = "Maintain BEAM-related packages and modules."; + }; + + cinnamon = { + members = [ + mkg20001 + ]; + scope = "Maintain Cinnamon desktop environment and applications made by the LinuxMint team."; + }; + + chia = { + members = [ + lourkeur + ]; + scope = "Maintain the Chia blockchain and its dependencies"; + }; + + deshaw = { + # Verify additions to this team with at least one already existing member of the team. + members = [ + limeytexan + ]; + scope = "Group registration for D. E. Shaw employees who collectively maintain packages."; + }; + + determinatesystems = { + # Verify additions to this team with at least one already existing member of the team. + members = [ + cole-h + grahamc + ]; + scope = "Group registration for packages maintained by Determinate Systems."; + }; + + freedesktop = { + members = [ jtojnar ]; + scope = "Maintain Freedesktop.org packages for graphical desktop."; + }; + + gcc = { + members = [ + synthetica + vcunat + ericson2314 + ]; + scope = "Maintain GCC (GNU Compiler Collection) compilers"; + }; + + golang = { + members = [ + c00w + cstrahan + Frostman + kalbasit + mic92 + orivej + rvolosatovs + zowoq + ]; + scope = "Maintain Golang compilers."; + }; + + gnome = { + members = [ + hedning + jtojnar + dasj19 + maxeaubrey + ]; + scope = "Maintain GNOME desktop environment and platform."; + }; + + haskell = { + members = [ + cdepillabout + expipiplus1 + maralorn + sternenseemann + ]; + scope = "Maintain Haskell packages and infrastructure."; + }; + + home-assistant = { + members = [ + fab + globin + hexa + mic92 + ]; + scope = "Maintain the Home Assistant ecosystem"; + }; + + iog = { + members = [ + cleverca22 + disassembler + jonringer + manveru + nrdxp + ]; + scope = "Input-Output Global employees, which maintain critical software"; + }; + + jitsi = { + members = [ + cleeyv + petabyteboy + ryantm + yuka + ]; + scope = "Maintain Jitsi."; + }; + + kubernetes = { + members = [ + johanot + offline + saschagrunert + srhb + zowoq + ]; + scope = "Maintain the Kubernetes package and module"; + }; + + kodi = { + members = [ + aanderse + cpages + edwtjo + minijackson + peterhoeg + sephalon + ]; + scope = "Maintain Kodi and related packages."; + }; + + linux-kernel = { + members = [ + TredwellGit + ma27 + nequissimus + qyliss + ]; + scope = "Maintain the Linux kernel."; + }; + + mate = { + members = [ + j03 + romildo + ]; + scope = "Maintain Mate desktop environment and related packages."; + }; + + matrix = { + members = [ + ma27 + fadenb + mguentner + ekleog + ralith + dandellion + sumnerevans + ]; + scope = "Maintain the ecosystem around Matrix, a decentralized messenger."; + }; + + openstack = { + members = [ + emilytrau + SuperSandro2000 + ]; + scope = "Maintain the ecosystem around OpenStack"; + }; + + pantheon = { + members = [ + davidak + bobby285271 + ]; + scope = "Maintain Pantheon desktop environment and platform."; + }; + + php = { + members = [ + aanderse + drupol + etu + globin + ma27 + talyz + ]; + scope = "Maintain PHP related packages and extensions."; + }; + + podman = { + members = [ + adisbladis + saschagrunert + vdemeester + zowoq + ]; + scope = "Maintain Podman and CRI-O related packages and modules."; + }; + + redcodelabs = { + members = [ + unrooted + wr0belj + wintrmvte + ]; + scope = "Maintain Red Code Labs related packages and modules."; + }; + + sage = { + members = [ + timokau + omasanori + raskin + collares + ]; + scope = "Maintain SageMath and the dependencies that are likely to break it."; + }; + + sphinx = { + members = [ + SuperSandro2000 + ]; + scope = "Maintain Sphinx related packages."; + }; + + serokell = { + # Verify additions by approval of an already existing member of the team. + members = [ + balsoft + mkaito + ]; + scope = "Group registration for Serokell employees who collectively maintain packages."; + }; + + tts = { + members = [ + hexa + mic92 + ]; + scope = "coqui-ai TTS (formerly Mozilla TTS) and leaf packages"; + }; + + xfce = { + members = [ + romildo + ]; + scope = "Maintain Xfce desktop environment and related packages."; + }; +} |